diff options
| author | Florian Dold <florian.dold@gmail.com> | 2016-11-03 01:33:53 +0100 |
|---|---|---|
| committer | Florian Dold <florian.dold@gmail.com> | 2016-11-03 01:33:53 +0100 |
| commit | d1291f67551c58168af43698a359cb5ddfd266b0 (patch) | |
| tree | 55a13ed29fe1915e3f42f1b1b7038dafa2e975a7 /node_modules/selenium-webdriver/lib/test/data | |
| parent | d0a0695fb5d34996850723f7d4b1b59c3df909c2 (diff) | |
node_modules
Diffstat (limited to 'node_modules/selenium-webdriver/lib/test/data')
252 files changed, 18291 insertions, 0 deletions
diff --git a/node_modules/selenium-webdriver/lib/test/data/ClickTest_testClicksASurroundingStrongTag.html b/node_modules/selenium-webdriver/lib/test/data/ClickTest_testClicksASurroundingStrongTag.html new file mode 100644 index 000000000..3d117df3b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/ClickTest_testClicksASurroundingStrongTag.html @@ -0,0 +1,11 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>ClickTest_testClicksASurroundingStrongTag</title> +</head> +<body> + <div> + <a href="xhtmlTest.html"><strong>Click</strong></a> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/Page.aspx b/node_modules/selenium-webdriver/lib/test/data/Page.aspx new file mode 100644 index 000000000..8e3a0d4dc --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Page.aspx @@ -0,0 +1,17 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeFile="Page.aspx.cs" Inherits="Page" %> + +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> + +<html xmlns="http://www.w3.org/1999/xhtml" > +<head runat="server"> + <title>Untitled Page</title> +</head> +<body> + <a href="../xhtmlTest.html" target="_top">top</a> + <form id="form1" runat="server"> + <div> + + </div> + </form> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/Page.aspx.cs b/node_modules/selenium-webdriver/lib/test/data/Page.aspx.cs new file mode 100644 index 000000000..1a8f7fe3e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Page.aspx.cs @@ -0,0 +1,22 @@ +using System; +using System.Threading; + +public partial class Page : System.Web.UI.Page +{ + protected void Page_Load(object sender, EventArgs e) + { + Response.ContentType = "text/html"; + + int lastIndex = Request.PathInfo.LastIndexOf("/"); + string pageNumber = (lastIndex == -1 ? "Unknown" : Request.PathInfo.Substring(lastIndex + 1)); + if (!string.IsNullOrEmpty(Request.QueryString["pageNumber"])) + { + pageNumber = Request.QueryString["pageNumber"]; + } + Response.Output.Write("<html><head><title>Page" + pageNumber + "</title></head>"); + Response.Output.Write("<body>Page number <span id=\"pageNumber\">"); + Response.Output.Write(pageNumber); + //Response.Output.Write("<script>var s=''; for (var i in window) {s += i + ' -> ' + window[i] + '<p>';} document.write(s);</script>")' + Response.Output.Write("</span></body></html>"); + } +} diff --git a/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx b/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx new file mode 100644 index 000000000..52d2e6786 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx @@ -0,0 +1,11 @@ +<%@ Page Language="C#" AutoEventWireup="true" CodeFile="Redirect.aspx.cs" Inherits="Redirect" %> + +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> + +<html xmlns="http://www.w3.org/1999/xhtml" > +<head runat="server"> + <title>Untitled Page</title> +</head> +<body> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx.cs b/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx.cs new file mode 100644 index 000000000..9e0650bfb --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Redirect.aspx.cs @@ -0,0 +1,9 @@ +using System; + +public partial class Redirect : Page +{ + protected new void Page_Load(object sender, EventArgs e) + { + Response.Redirect("resultPage.html"); + } +} diff --git a/node_modules/selenium-webdriver/lib/test/data/Settings.StyleCop b/node_modules/selenium-webdriver/lib/test/data/Settings.StyleCop new file mode 100644 index 000000000..fc955f815 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Settings.StyleCop @@ -0,0 +1,759 @@ +<StyleCopSettings Version="4.3"> + <Analyzers> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.DocumentationRules"> + <Rules> + <Rule Name="ElementsMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PartialElementsMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="EnumerationItemsMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationMustContainValidXml"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationMustHaveSummary"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PartialElementDocumentationMustHaveSummary"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationMustHaveSummaryText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PartialElementDocumentationMustHaveSummaryText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationMustNotHaveDefaultSummary"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementParametersMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementParameterDocumentationMustMatchElementParameters"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementParameterDocumentationMustDeclareParameterName"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementParameterDocumentationMustHaveText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementReturnValueMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementReturnValueDocumentationMustHaveText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="VoidReturnValueMustNotBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="GenericTypeParametersMustBeDocumented"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="GenericTypeParametersMustBeDocumentedPartialClass"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="GenericTypeParameterDocumentationMustMatchTypeParameters"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="GenericTypeParameterDocumentationMustDeclareParameterName"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="GenericTypeParameterDocumentationMustHaveText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PropertySummaryDocumentationMustMatchAccessors"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PropertySummaryDocumentationMustOmitSetAccessorWithRestrictedAccess"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationMustNotBeCopiedAndPasted"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SingleLineCommentsMustNotUseDocumentationStyleSlashes"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationTextMustNotBeEmpty"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationTextMustContainWhitespace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationMustMeetCharacterPercentage"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationTextMustMeetMinimumCharacterLength"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ConstructorSummaryDocumentationMustBeginWithStandardText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DestructorSummaryDocumentationMustBeginWithStandardText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationHeadersMustNotContainBlankLines"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="IncludedDocumentationXPathDoesNotExist"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="IncludeNodeDoesNotContainValidFileAndPath"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileMustHaveHeader"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileHeaderMustShowCopyright"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileHeaderMustHaveCopyrightText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileHeaderMustContainFileName"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileHeaderFileNameDocumentationMustMatchFileName"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileHeaderMustHaveValidCompanyText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.LayoutRules"> + <Rules> + <Rule Name="CurlyBracketsForMultiLineStatementsMustNotShareLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="StatementMustNotBeOnSingleLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementMustNotBeOnSingleLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CurlyBracketsMustNotBeOmitted"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="AllAccessorsMustBeMultiLineOrSingleLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningCurlyBracketsMustNotBeFollowedByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationHeadersMustNotBeFollowedByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeMustNotContainMultipleBlankLinesInARow"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingCurlyBracketsMustNotBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningCurlyBracketsMustNotBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ChainedStatementBlocksMustNotBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="WhileDoFooterMustNotBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SingleLineCommentsMustNotBeFollowedByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingCurlyBracketMustBeFollowedByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementDocumentationHeaderMustBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SingleLineCommentMustBePrecededByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementsMustBeSeparatedByBlankLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.MaintainabilityRules"> + <Rules> + <Rule Name="AccessModifierMustBeDeclared"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FieldsMustBePrivate"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeAnalysisSuppressionMustHaveJustification"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DebugAssertMustProvideMessageText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DebugFailMustProvideMessageText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileMayOnlyContainASingleClass"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FileMayOnlyContainASingleNamespace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="StatementMustNotUseUnnecessaryParenthesis"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ArithmeticExpressionsMustDeclarePrecedence"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ConditionalExpressionsMustDeclarePrecedence"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="RemoveDelegateParenthesisWhenPossible"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="RemoveUnnecessaryCode"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.NamingRules"> + <Rules> + <Rule Name="ElementMustBeginWithUpperCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementMustBeginWithLowerCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="InterfaceNamesMustBeginWithI"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ConstFieldNamesMustBeginWithUpperCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="NonPrivateReadonlyFieldsMustBeginWithUpperCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FieldNamesMustNotUseHungarianNotation"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FieldNamesMustBeginWithLowerCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="AccessibleFieldsMustBeginWithUpperCaseLetter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="VariableNamesMustNotBePrefixed"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FieldNamesMustNotBeginWithUnderscore"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="FieldNamesMustNotContainUnderscore"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.OrderingRules"> + <Rules> + <Rule Name="UsingDirectivesMustBePlacedWithinNamespace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementsMustAppearInTheCorrectOrder"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ElementsMustBeOrderedByAccess"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ConstantsMustAppearBeforeFields"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="StaticElementsMustAppearBeforeInstanceElements"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DeclarationKeywordsMustFollowOrder"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ProtectedMustComeBeforeInternal"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PropertyAccessorsMustFollowOrder"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="EventAccessorsMustFollowOrder"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SystemUsingDirectivesMustBePlacedBeforeOtherUsingDirectives"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="UsingAliasDirectivesMustBePlacedAfterOtherUsingDirectives"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="UsingDirectivesMustBeOrderedAlphabeticallyByNamespace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="UsingAliasDirectivesMustBeOrderedAlphabeticallyByAliasName"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.ReadabilityRules"> + <Rules> + <Rule Name="CommentsMustContainText"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DoNotPrefixCallsWithBaseUnlessLocalImplementationExists"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PrefixLocalCallsWithThis"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningParenthesisMustBeOnDeclarationLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingParenthesisMustBeOnLineOfLastParameter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingParenthesisMustBeOnLineOfOpeningParenthesis"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CommaMustBeOnSameLineAsPreviousParameter"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ParameterListMustFollowDeclaration"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ParameterMustFollowComma"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SplitParametersMustStartOnLineAfterDeclaration"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ParametersMustBeOnSameLineOrSeparateLines"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ParameterMustNotSpanMultipleLines"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="QueryClauseMustFollowPreviousClause"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="QueryClausesMustBeOnSeparateLinesOrAllOnOneLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="QueryClauseMustBeginOnNewLineWhenPreviousClauseSpansMultipleLines"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="QueryClausesSpanningMultipleLinesMustBeginOnOwnLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DoNotPlaceRegionsWithinElements"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeMustNotContainEmptyStatements"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeMustNotContainMultipleStatementsOnOneLine"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="BlockStatementsMustNotContainEmbeddedComments"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="BlockStatementsMustNotContainEmbeddedRegions"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="UseStringEmptyForEmptyStrings"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="UseBuiltInTypeAlias"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + <Analyzer AnalyzerId="Microsoft.StyleCop.CSharp.SpacingRules"> + <Rules> + <Rule Name="KeywordsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CommasMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SemicolonsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SymbolsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DocumentationLinesMustBeginWithSingleSpace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="SingleLineCommentsMustBeginWithSingleSpace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PreprocessorKeywordsMustNotBePrecededBySpace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OperatorKeywordMustBeFollowedBySpace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningParenthesisMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingParenthesisMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningSquareBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingSquareBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningCurlyBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingCurlyBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningGenericBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingGenericBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="OpeningAttributeBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ClosingAttributeBracketsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="NullableTypeSymbolsMustNotBePrecededBySpace"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="MemberAccessSymbolsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="IncrementDecrementSymbolsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="NegativeSignsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="PositiveSignsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="DereferenceAndAccessOfSymbolsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="ColonsMustBeSpacedCorrectly"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeMustNotContainMultipleWhitespaceInARow"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="CodeMustNotContainSpaceAfterNewKeywordInImplicitlyTypedArrayAllocation"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + <Rule Name="TabsMustNotBeUsed"> + <RuleSettings> + <BooleanProperty Name="Enabled">False</BooleanProperty> + </RuleSettings> + </Rule> + </Rules> + <AnalyzerSettings /> + </Analyzer> + </Analyzers> +</StyleCopSettings>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/Web.Config b/node_modules/selenium-webdriver/lib/test/data/Web.Config new file mode 100644 index 000000000..68b648f81 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/Web.Config @@ -0,0 +1,59 @@ +<?xml version="1.0"?> +<!-- + Note: As an alternative to hand editing this file you can use the + web admin tool to configure settings for your application. Use + the Website->Asp.Net Configuration option in Visual Studio. + A full list of settings and comments can be found in + machine.config.comments usually located in + \Windows\Microsoft.Net\Framework\v2.x\Config +--> +<configuration xmlns="http://schemas.microsoft.com/.NetConfiguration/v2.0"> + <configSections> + <section name="rewriter" requirePermission="false" type="Intelligencia.UrlRewriter.Configuration.RewriterConfigurationSectionHandler, Intelligencia.UrlRewriter"/> + </configSections> + <appSettings/> + <connectionStrings/> + <system.web> + <!-- + Set compilation debug="true" to insert debugging + symbols into the compiled page. Because this + affects performance, set this value to true only + during development. + --> + <compilation debug="true" defaultLanguage="c#" targetFramework="4.0"/> + <!-- + The <authentication> section enables configuration + of the security authentication mode used by + ASP.NET to identify an incoming user. + --> + <authentication mode="Windows"/> + <!-- + The <customErrors> section enables configuration + of what to do if/when an unhandled error occurs + during the execution of a request. Specifically, + it enables developers to configure html error pages + to be displayed in place of a error stack trace. + + <customErrors mode="RemoteOnly" defaultRedirect="GenericErrorPage.htm"> + <error statusCode="403" redirect="NoAccess.htm" /> + <error statusCode="404" redirect="FileNotFound.htm" /> + </customErrors> + --> + <httpModules> + <add name="UrlRewriter" type="Intelligencia.UrlRewriter.RewriterHttpModule, Intelligencia.UrlRewriter"/> + </httpModules> + <!--urlMappings enabled="true"> + <add url="~/redirect" mappedUrl="~/Redirect.aspx" /> + </urlMappings--> + <pages controlRenderingCompatibilityVersion="3.5" clientIDMode="AutoID"/></system.web> + <system.webServer> + <modules runAllManagedModulesForAllRequests="true"> + <add name="UrlRewriter" type="Intelligencia.UrlRewriter.RewriterHttpModule"/> + </modules> + </system.webServer> + <rewriter> + <rewrite url="~/redirect" to="~/Redirect.aspx"/> + <rewrite url="~/page/([0-9]+)$" to="~/Page.aspx?pageNumber=$1"/> + <rewrite url="~/page/([0-9]+)(\?)(.*)" to="~/Page.aspx?pageNumber=$1&$3"/> + </rewriter> +</configuration> diff --git a/node_modules/selenium-webdriver/lib/test/data/actualXhtmlPage.xhtml b/node_modules/selenium-webdriver/lib/test/data/actualXhtmlPage.xhtml new file mode 100644 index 000000000..a0f54703c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/actualXhtmlPage.xhtml @@ -0,0 +1,14 @@ +<?xml version="1.0" encoding="utf-8" ?> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> + <head> + <title> + Title + </title> + </head> + <body> + <p> + <a href="/foo">Foo</a> + </p> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/ajaxy_page.html b/node_modules/selenium-webdriver/lib/test/data/ajaxy_page.html new file mode 100644 index 000000000..4b34031d5 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/ajaxy_page.html @@ -0,0 +1,81 @@ +<!DOCTYPE html> +<html> +<body> +<form action="javascript:updateDom()"> + <label for="typer">New label text:</label> + <input name="typer" type="text"/> + <br/> + <label for="color">Select label color:</label> + <input name="color" id="red" value="red" type="radio"/>Red + <input name="color" id="green" value="green" type="radio"/>Green + <br/> + <input name="submit" type="submit" value="Add Label"/> +</form> +<div id="update_butter" style="display:none"></div> +<script> + var butter = document.getElementById('update_butter'); + + var textProperty = butter['innerText'] ? 'innerText' : 'textContent'; + + var listeners = []; + function registerListener(fn) { + listeners.push(fn); + } + + function updateDom() { + butter.style.display = 'block'; + butter[textProperty] = 'Updating'; + disableForm(); + tick(); + } + + function disableForm() { + var inputs = document.getElementsByTagName('input'); + for (var i = 0, input; input = inputs[i]; ++i) { + input.disabled = true; + } + } + + function enableForm() { + var inputs = document.getElementsByTagName('input'); + for (var i = 0, input; input = inputs[i]; ++i) { + input.disabled = false; + } + } + + function tick() { + var length = butter[textProperty].substring('Updating'.length).length; + if (length != 10) { + butter[textProperty] += '.'; + window.setTimeout(tick, 500); + } else { + enableForm(); + var div = document.createElement('div'); + var colors = document.forms[0].color; + for (var i = 0, color; color = colors[i]; ++i) { + if (color.checked) { + div.style.backgroundColor = color.value; + break; + } + } + div[textProperty] = document.forms[0].typer.value; + div.className = 'label'; + document.forms[0].typer.value = ''; + document.body.appendChild(div); + + butter[textProperty] = 'Done!'; + + window.setTimeout(function() { + while (listeners.length) { + try { + listeners.shift()(div[textProperty]); + } catch (e) { + butter[textProperty] = "Exception seen: " + e; + } + } + }, 500); + } + } +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/alerts.html b/node_modules/selenium-webdriver/lib/test/data/alerts.html new file mode 100644 index 000000000..1add0db99 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/alerts.html @@ -0,0 +1,85 @@ +<html> +<!-- Padding to account for small screens of mobile devices --> +<style> + p {margin-top:48px;} +</style> +<head> + <title>Testing Alerts</title> + + <script type="text/javascript"> + function setInnerText(id, value) { + document.getElementById(id).innerHTML = '<p>' + value + '</p>'; + } + + function displayPrompt() { + setInnerText('text', prompt('Enter something')); + } + + function displayPromptWithDefault() { + setInnerText('text', prompt('Enter something', 'This is a default value')); + } + + function displayTwoPrompts() { + setInnerText('text1', prompt('First')); + setInnerText('text2', prompt('Second')); + } + + function slowAlert() { + window.setTimeout(function() { + alert('Slow'); + }, 200); + } + </script> +</head> +<body> + +<h1>Testing Alerts and Stuff</h1> + +<p>This tests alerts: <a href="#" id="alert" onclick="alert('cheese');">click me</a></p> + +<p>This tests alerts: <a href="#" id="empty-alert" onclick="alert('');">click me</a></p> + +<p>Let's make the <a href="#" id="prompt" onclick="displayPrompt();">prompt happen</a></p> + +<p>Let's make the <a href="#" id="prompt-with-default" onclick="displayPromptWithDefault();">prompt with default happen</a></p> + +<p>Let's make TWO <a href="#" id="double-prompt" onclick="displayTwoPrompts();">prompts happen</a></p> + +<p>A <a href="#" id="slow-alert" onclick="slowAlert();">SLOW</a> alert</p> + +<p>This is a test of a confirm: + <a href="simpleTest.html" id="confirm" onclick="return confirm('Are you sure?');">test confirm</a></p> + +<p>This is a test of showModalDialog: <a href="#" id="dialog" onclick="showModalDialog('javascriptPage.html')">test dialog</a></p> + +<p>This is a test of an alert in an iframe: + <iframe src="iframeWithAlert.html" name="iframeWithAlert"></iframe> +</p> + +<p>This is a test of an alert in a nested iframe: + <iframe src="iframeWithIframe.html" name="iframeWithIframe"></iframe> +</p> + +<p>This is a test of an alert open from onload event handler: <a id="open-page-with-onload-alert" href="pageWithOnLoad.html">open new page</a></p> + +<p>This is a test of an alert open from onload event handler: <a id="open-window-with-onload-alert" href="pageWithOnLoad.html" target="onload">open new window</a></p> + +<p>This is a test of an alert open from onunload event handler: <a id="open-page-with-onunload-alert" href="pageWithOnUnload.html">open new page</a></p> + +<p>This is a test of an alert open from onclose event handler: <a id="open-window-with-onclose-alert" href="pageWithOnUnload.html" target="onclose">open new window</a></p> + +<p>This is a test of an alert open from onclose event handler: <a id="open-new-window" href="blank.html" target="newwindow">open new window</a></p> + +<div id="text"></div> +<div id="text1"></div> +<div id="text2"></div> + +<p><select id="select" onchange="alert('changed');"> + <option id="novalue" value="">Nothing selected</option> + <option id="value1" value="1">One</option> + <option id="value2" value="2">Two</option> + <option id="value3" value="3">Three</option> +</select></p> +<p><input id="input" onchange="alert('change fired');" value="onchange"/></p> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/banner.gif b/node_modules/selenium-webdriver/lib/test/data/banner.gif Binary files differnew file mode 100644 index 000000000..3f3435401 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/banner.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/beach.jpg b/node_modules/selenium-webdriver/lib/test/data/beach.jpg Binary files differnew file mode 100644 index 000000000..402237cbd --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/beach.jpg diff --git a/node_modules/selenium-webdriver/lib/test/data/blank.html b/node_modules/selenium-webdriver/lib/test/data/blank.html new file mode 100644 index 000000000..c3f376e76 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/blank.html @@ -0,0 +1 @@ +<html><head><title>blank</title></head><body></body></html> diff --git a/node_modules/selenium-webdriver/lib/test/data/bodyTypingTest.html b/node_modules/selenium-webdriver/lib/test/data/bodyTypingTest.html new file mode 100644 index 000000000..f2b1939f1 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/bodyTypingTest.html @@ -0,0 +1,41 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Testing Typing into body</title> + <script type="text/javascript"> + function appendMessage(message) { + document.getElementById('result').innerHTML += message + " "; + } + + function appendMessageFromBody(message) { + document.getElementById('body_result').innerHTML += message + " "; + } + </script> +</head> + +<body onkeypress="appendMessageFromBody('keypress')"> + <h1>Type Stuff</h1> + + <div id="result"> + + </div> + + <div id="body_result"> + + </div> + + + <!-- Textbox - to confuse some browsers. --> + + <form action="resultPage.html" id="on-form"> + <input id="intext" + onfocus="appendMessage('focus')" + onkeydown="appendMessage('keydown')" + onkeypress="appendMessage('keypress')" + onkeyup="appendMessage('keyup')" + onblur="appendMessage('blur')" + onchange="appendMessage('change')" + /> + </form> +</body> + diff --git a/node_modules/selenium-webdriver/lib/test/data/booleanAttributes.html b/node_modules/selenium-webdriver/lib/test/data/booleanAttributes.html new file mode 100644 index 000000000..16fbbe9f8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/booleanAttributes.html @@ -0,0 +1,19 @@ +<html> +<head> + <title>Elements with boolean attributes</title> +</head> +<body> +<form method="get" action="resultPage.html" name="required"> + <input type="text" id="working"/> + <input type="email" id="emailRequired" required/> + <input type="text" id="inputRequired" value="Example text" required=""/> + <textarea id="textAreaRequired" rows="5" cols="5" required="false">Example text</textarea> + <textarea id="emptyTextAreaRequired" rows="5" cols="5" required="required"></textarea> +</form> + +<!-- Empty div to test GetAttribute --> +<div id="wallace" class="gromit"></div> +<!-- Div to test boolean attributes --> +<div id="unwrappable" nowrap>Unwrappable text</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/child/childPage.html b/node_modules/selenium-webdriver/lib/test/data/child/childPage.html new file mode 100644 index 000000000..9192b54a4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/child/childPage.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>Depth one child page</title> +</head> +<body> + <p>I'm a page in a child directory</p> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/child/grandchild/grandchildPage.html b/node_modules/selenium-webdriver/lib/test/data/child/grandchild/grandchildPage.html new file mode 100644 index 000000000..f52685e06 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/child/grandchild/grandchildPage.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>Depth two child page</title> +</head> +<body> + <p>I'm a page in a grandchild directory! How cute!</p> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/clickEventPage.html b/node_modules/selenium-webdriver/lib/test/data/clickEventPage.html new file mode 100644 index 000000000..8e0355d94 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/clickEventPage.html @@ -0,0 +1,26 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Testing click events</title> + <script type="text/javascript"> + function displayEvent(event) { + var keys = ['x', 'y', 'clientX', 'clientY', 'pageX', 'pageY', 'screenX', 'screenY', 'shiftKey', 'ctrlKey']; + var message = "<ul>"; + for (var i = 0; i < keys.length; i++) { + message += "<li>" + keys[i] + ": <span id='" + keys[i] + "'>" + event[keys[i]] + "</span></li>"; + } + message += "</ul>"; + document.getElementById('result').innerHTML = message; + } + </script> +</head> +<body> + <div id="eventish" onclick="displayEvent(event);"> + Click me to view my coordinates + </div> + + <div id="result" style="width:300;height:60"> + <p> </p> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_frames.html b/node_modules/selenium-webdriver/lib/test/data/click_frames.html new file mode 100644 index 000000000..bd055c7c7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_frames.html @@ -0,0 +1,10 @@ +<html> +<head> + <title>click frames</title> +</head> +<frameset rows="*" border="1"> + <frame src="clicks.html" name="source" scrolling="NO" noresize> + <frame src="xhtmlTest.html" name="target"> +</frameset> +</frameset> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_jacker.html b/node_modules/selenium-webdriver/lib/test/data/click_jacker.html new file mode 100644 index 000000000..0ff3900ec --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_jacker.html @@ -0,0 +1,38 @@ +<!DOCTYPE html> +<html> +<head> + <title>click-jacking</title> + <script> + var clickJacker; + + function setOpacity(opacity) { + var matches = window.navigator.userAgent.match(/MSIE\s*(\d*)/); + if (matches && matches.length > 1 && parseInt(matches[1]) <= 8) { + clickJacker.style.filter = 'alpha(opacity=' + (opacity * 100) + ')'; + } else { + clickJacker.style.opacity = opacity; + } + } + + function init() { + clickJacker = document.getElementById('clickJacker'); + setOpacity(0); + } + </script> +</head> +<body onload="init()"> +<div> + <div id="clickJacker" + onclick="setOpacity(1);" + style="position:absolute;float:left; + width:200px;height:100px; padding:10px; + background-color:darkred; + border:1px solid darkred;">Click jacked!</div> + <div style="width:200px; height:100px; + border:1px solid black; padding:10px">Click Me</div> + <script> + clickJacker = document.getElementById('clickJacker'); + </script> +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds.html b/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds.html new file mode 100644 index 000000000..8a51659b2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds.html @@ -0,0 +1,23 @@ +<!DOCTYPE html> +<html> +<body> + +<table> + <tr> + + <td> + <div style="width:752px;"></div> + </td> + + <td> + <div style="width:350px; text-align: center;"> + <form onsubmit="return false;" method="get"> + <input id="button" value="Click me" type="submit"> + </form> + </div> + </td> + </tr> +</table> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds_overflow.html b/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds_overflow.html new file mode 100644 index 000000000..15ac17f92 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_out_of_bounds_overflow.html @@ -0,0 +1,85 @@ +<!DOCTYPE html> +<html><head> + <meta http-equiv="Content-Type" content="text/html; charset=UTF-8"> +<body> +<div style="height: 100px; overflow: auto;"> + <table> + <tbody> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td>data</td></tr> + <tr><td><a href="#clicked" id="link">click me</a></td></tr> + </tbody> +</table> +</div> +</body></html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_rtl.html b/node_modules/selenium-webdriver/lib/test/data/click_rtl.html new file mode 100644 index 000000000..e84fffa99 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_rtl.html @@ -0,0 +1,19 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.0//EN" "http://www.w3.org/TR/html4/strict.dtd"> +<html><head><meta http-equiv="Content-Type" content="text/html; charset=UTF-8"> +<title>RTL test</title> +<style type="text/css"> + .test { font-size: 150%; } + table td { border: 1px solid #CCC; } + img { margin: 10px; } +</style> +</head> +<body> +<div dir="rtl"> + +<div class="test">مفتاح<a href="clicks.html" id="ar_link"> معايير</a> الويب</div> + +<div class="test">פעילות<a id="hb_link" href="clicks.html"> הבינאום </a></div> + +</div> + +</body></html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_source.html b/node_modules/selenium-webdriver/lib/test/data/click_source.html new file mode 100644 index 000000000..22e9319a5 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_source.html @@ -0,0 +1,18 @@ +<html> +<head> + <title>Click Source</title> +</head> +<body> + <a href="simpleTest.html" target="target" id="otherframe">I go to a target</a> +</body> +</html> + +<html> +<head> + <title>Click Source</title> +</head> +<body> + <a href="simpleTest.html" target="target" id="otherframe">I go to a target</a> +</body> +</html> +
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/click_iframe.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/click_iframe.html new file mode 100644 index 000000000..7b749bc04 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/click_iframe.html @@ -0,0 +1,6 @@ +<html> +<head> + <title>click iframe</title> +</head> +<body><a id="link" href="submitted_page.html" target="_top">Click me</a></body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/click_in_iframe.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/click_in_iframe.html new file mode 100644 index 000000000..60b1ccab1 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/click_in_iframe.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>click in iframe</title> +</head> +<body> +<iframe id="ifr" src="click_iframe.html" style="margin: 200px; width: 100px; height: 50px;" /> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/disappearing_element.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/disappearing_element.html new file mode 100644 index 000000000..4386d5d4b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/disappearing_element.html @@ -0,0 +1,62 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>An element that disappears on click</title> + <style> +#under { + position: absolute; + top: 20; + left: 20; + width: 100px; + height: 100px; + background-color: white; +} + +#over { + position: absolute; + top: 20; + left: 20; + width: 100px; + height: 100px; + background-color: red; + opacity: 0.5; +} + +#log { + position: absolute; + top: 120px; +} + </style> +</head> +<body id="body"> + <div id="under"><p id="contents">Hello</p></div> + <div id="over"></div> + <div id="log"> + <p>Log:<p> + </div> +<script> +var byId = document.getElementById.bind(document); + +var log = byId("log"); + +function handler(ev) { + log.innerHTML += "<p></p>"; + log.lastElementChild.textContent = ev.type + " in " + ev.target.id + " (handled by " + ev.currentTarget.id + ")\n"; +} + +var under = byId("under"); +var over = byId("over"); +var body = document.body; + +var types = ["click", "mousedown", "mouseup"]; +for (var i = 0, type; (type = types[i]); ++i) { + under.addEventListener(type, handler); + over.addEventListener(type, handler); + body.addEventListener(type, handler); +} +over.addEventListener("mousedown", function () { + over.style.display = "none"; +}) +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.html new file mode 100644 index 000000000..eb2e556c9 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<html> +<head> + <title>Google Image Map</title> +</head> +<body> +<h1>Google Image Map</h1> +<img id="google_logo" src="google_map.png" usemap="#google_map" border="0" width="364" height="126"/> +<map id="google_map" name="google_map"> +<area id="rectG" shape="rect" coords="0,0,90,100" href="mapped_page1.html" alt="area 1"/> +<area id="circleO" shape="circle" coords="120,60,30" href="mapped_page2.html" alt="area 2"/> +<area id="polyLE" shape="poly" coords="280,0,310,0,360,30,360,90,280,90" href="mapped_page3.html" alt="area 3"/> +</map> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.png b/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.png Binary files differnew file mode 100644 index 000000000..763f56279 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/google_map.png diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/html5_submit_buttons.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/html5_submit_buttons.html new file mode 100644 index 000000000..a8fc6ca54 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/html5_submit_buttons.html @@ -0,0 +1,16 @@ +<!DOCTYPE html> +<html> +<head> +<title>HTML5 Submit Buttons</title> +</head> +<body> +<form id="form1" action="submitted_page.html"> +<label for="name">Enter your name: </label><input type="text" name="name" id="name"/> +<button id="internal_explicit_submit" type="submit">Explicit Submit</button> +<button id="internal_implicit_submit">Implicit Submit</button> +<button type="submit"><span id="internal_span_submit">Spanned Submit</span></button> +</form> +<button id="external_explicit_submit" type="submit" form="form1">Explicit Submit</button> +<button id="external_implicit_submit" form="form1">Implicit Submit</button> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237.html new file mode 100644 index 000000000..464fa1138 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Sample page for issue 5237</title> +</head> +<body> + <iframe id="search" src="issue5237_frame.html"></iframe> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_frame.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_frame.html new file mode 100644 index 000000000..d6f4caf12 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_frame.html @@ -0,0 +1 @@ +<a id="submit" href="#" onclick="window.top.location = 'issue5237_target.html'; return false;">Continue</a>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_target.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_target.html new file mode 100644 index 000000000..cbc16e851 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/issue5237_target.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Target page for issue 5237</title> +</head> +<body> +<h1>Test passed</h1> +</map> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/link_that_wraps.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/link_that_wraps.html new file mode 100644 index 000000000..04434364f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/link_that_wraps.html @@ -0,0 +1,11 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>Link that continues on next line</title> +</head> +<body> + <div style="width:300px"> + <div style="float:left;width:200px;background:red">placeholder</div><a id="link" href="submitted_page.html">Link that continues on next line</a> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page1.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page1.html new file mode 100644 index 000000000..245f0385b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page1.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Target Page 1</title> +</head> +<body> + <div>Target Page 1</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page2.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page2.html new file mode 100644 index 000000000..6f9636c5c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page2.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Target Page 2</title> +</head> +<body> + <div>Target Page 2</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page3.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page3.html new file mode 100644 index 000000000..87a35f388 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/mapped_page3.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Target Page 3</title> +</head> +<body> + <div>Target Page 3</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/overlapping_elements.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/overlapping_elements.html new file mode 100644 index 000000000..6cfa56ade --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/overlapping_elements.html @@ -0,0 +1,70 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>An element that disappears on click</title> + <style> +#under { + position: absolute; + top: 20px; + left: 20px; + width: 100px; + height: 100px; + background-color: white; +} + +#partially_under { + position: absolute; + top: 20px; + left: 10px; + width: 100px; + height: 100px; + background-color: blue; + opacity: 0.5; +} + +#over { + position: absolute; + top: 20px; + left: 20px; + width: 100px; + height: 100px; + background-color: red; + opacity: 0.5; +} + +#log { + position: absolute; + top: 120px; +} + </style> +</head> +<body id="body"> + <div id="under"><p id="contents">Hello</p></div> + <div id="partially_under"><p id="other_contents">Hello</p></div> + <div id="over"></div> + <div id="log"> + <p>Log:<p> + </div> +<script> +var byId = document.getElementById.bind(document); + +var log = byId("log"); + +function handler(ev) { + log.innerHTML += "<p></p>"; + log.lastElementChild.textContent = ev.type + " in " + ev.target.id + " (handled by " + ev.currentTarget.id + ")\n"; +} + +var under = byId("under"); +var over = byId("over"); +var body = document.body; + +var types = ["click", "mousedown", "mouseup"]; +for (var i = 0, type; (type = types[i]); ++i) { + under.addEventListener(type, handler); + over.addEventListener(type, handler); + body.addEventListener(type, handler); +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/partially_overlapping_elements.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/partially_overlapping_elements.html new file mode 100644 index 000000000..2af62526e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/partially_overlapping_elements.html @@ -0,0 +1,124 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>An element that disappears on click</title> + <style> +#under_under { + position: absolute; + top: 20px; + left: 20px; + width: 100px; + height: 100px; + background-color: white; +} + +#under { + position: absolute; + top: 20px; + left: 20px; + width: 100px; + height: 100px; + background-color: blue; + opacity: 0.1; +} + +#over1 { + position: absolute; + top: 10px; + left: 10px; + width: 50px; + height: 50px; + background-color: red; + opacity: 0.2; +} + +#over2 { + position: absolute; + top: 80px; + left: 10px; + width: 50px; + height: 50px; + background-color: red; + opacity: 0.2; +} + +#over3 { + position: absolute; + top: 10px; + left: 80px; + width: 50px; + height: 50px; + background-color: red; + opacity: 0.2; +} + +#over4 { + position: absolute; + top: 80px; + left: 80px; + width: 50px; + height: 50px; + background-color: red; + opacity: 0.2; +} + +#over5 { + position: absolute; + top: 45px; + left: 45px; + width: 50px; + height: 50px; + background-color: red; + opacity: 0.2; +} + +#log { + position: absolute; + top: 120px; +} + </style> +</head> +<body id="body"> + <div id="under_under"><p id="contents">Hello</p></div> + <div id="under"><p id="other_contents">Hello</p></div> + <div id="over1"></div> + <div id="over2"></div> + <div id="over3"></div> + <div id="over4"></div> + <div id="over5"></div> + <div id="log"> + <p>Log:<p> + </div> +<script> +var byId = document.getElementById.bind(document); + +var log = byId("log"); + +function handler(ev) { + log.innerHTML += "<p></p>"; + log.lastElementChild.textContent = ev.type + " in " + ev.target.id + " (handled by " + ev.currentTarget.id + ")\n"; +} + +var under_under = byId("under_under"); +var under = byId("under"); +var over1 = byId("over1"); +var over2 = byId("over2"); +var over3 = byId("over3"); +var over4 = byId("over4"); +var over5 = byId("over5"); +var body = document.body; + +var types = ["click", "mousedown", "mouseup"]; +for (var i = 0, type; (type = types[i]); ++i) { + under_under.addEventListener(type, handler); + under.addEventListener(type, handler); + over1.addEventListener(type, handler); + over2.addEventListener(type, handler); + over3.addEventListener(type, handler); + over4.addEventListener(type, handler); + over5.addEventListener(type, handler); + body.addEventListener(type, handler); +} +</script> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/span_that_wraps.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/span_that_wraps.html new file mode 100644 index 000000000..77a9d6d50 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/span_that_wraps.html @@ -0,0 +1,11 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>Link that continues on next line</title> +</head> +<body> + <div style="width:300px"> + <div style="float:left;width:200px;background:red">placeholder</div><span id="span" onclick="document.location='submitted_page.html'">Span that continues on next line</span> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/submitted_page.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/submitted_page.html new file mode 100644 index 000000000..0ed2cbacb --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/submitted_page.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> +<title>Submitted Successfully!</title> +</head> +<body> +<h1>Submitted Successfully!</h1> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/click_tests/wrapped_overlapping_elements.html b/node_modules/selenium-webdriver/lib/test/data/click_tests/wrapped_overlapping_elements.html new file mode 100644 index 000000000..1c0c3d03e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_tests/wrapped_overlapping_elements.html @@ -0,0 +1,13 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>A wrapped element with overlapped first part</title> +</head> +<body id="body"> +<div style="width:300px"> + <div style="float:left;width:200px;background:green;">placeholder</div> + <div style="float:left; position:absolute;width:100px;margin-left:200px;background:red;opacity:0.5;">Over</div> + <a id="link" href="submitted_page.html">Link that continues on next line</a> +</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_too_big.html b/node_modules/selenium-webdriver/lib/test/data/click_too_big.html new file mode 100644 index 000000000..568ee77eb --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_too_big.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<body> + <a id="click" href="clicks.html" target="_parent"> + <div style="width: 10001px; height: 10001px; background-color: green;"> + + </div> + </a> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/click_too_big_in_frame.html b/node_modules/selenium-webdriver/lib/test/data/click_too_big_in_frame.html new file mode 100644 index 000000000..cda990ed8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/click_too_big_in_frame.html @@ -0,0 +1,11 @@ +<html> +<head> + <title>This page has iframes</title> +</head> +<body> +<h1 id="iframe_page_heading">This is the heading</h1> + +<iframe src="click_too_big.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" + frameborder="0" height="10001" scrolling="no" width="10001" id="iframe1" name="iframe1-name" /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/clicks.html b/node_modules/selenium-webdriver/lib/test/data/clicks.html new file mode 100644 index 000000000..dc07fee6a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/clicks.html @@ -0,0 +1,35 @@ +<html> +<head> + <title>clicks</title> +</head> +<body> +<h1>Testing Clicks</h1> + +<iframe id="source" src="click_source.html"> + +</iframe> + +<iframe id="target" name="target"> + +</iframe> +<br> +<a href="xhtmlTest.html" id="normal">I'm a normal link</a> +<br/> +<a href="#" id="anchor">I go to an anchor</a> +<br> +<a href="javascript:window.open('xhtmlTest.html', '_blank')" id="new-window">I open a window with javascript</a> +<br/> +<a href="xhtmlTest.html" id="twoClientRects"><span></span><span>Click me</span></a> +<br/> +<a href="xhtmlTest.html" id="link-with-enclosed-image"><img id="enclosed-image" src="./icon.gif"/></a> +<br/> +<a href="xhtmlTest.html" id="link-with-enclosed-span"><span id="enclosed-span" style="color: rgb(0, 255, 0)">I'm a green link</span></a> +<p style="background: none repeat scroll 0% 0% rgb(0, 255, 0); width: 5em;"><a id="overflowLink" href="xhtmlTest.html">looooooooooong short looooooooooong</a> + </p> +<div id="bubblesTo" onclick="window.bubbledClick = true;"> + <a id="bubblesFrom">I bubble</a> +</div> +<a href="xhtmlTest.html">333333</a> +<p><a href="xhtmlTest.html" id="embeddedBlock"><span style="display: block;">I have a span</span><div>And a div</div><span>And another span</span></a></p> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/closeable_window.html b/node_modules/selenium-webdriver/lib/test/data/closeable_window.html new file mode 100644 index 000000000..e64c599c9 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/closeable_window.html @@ -0,0 +1,8 @@ +<html> +<head> +<title>closeable window</title> +</head> +<body> +This window can be closed by clicking on <a id="close" onclick="window.setTimeout(function() { window.close();}, 0);" href="#">this</a>. +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/cn-test.html b/node_modules/selenium-webdriver/lib/test/data/cn-test.html new file mode 100644 index 000000000..df846ad46 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/cn-test.html @@ -0,0 +1,156 @@ + +<head> +<meta http-equiv="Content-Type" content="text/html; charset=gb2312"> +<style type="text/css"> + + + + /* default css */ + + table { + font-size: 1em; + line-height: inherit; + } + + + div, address, ol, ul, li, option, select { + margin-top: 0px; + margin-bottom: 0px; + } + + p { + margin: 0px; + } + + body { + + + margin: 0px; + + + + padding-left: 50px; + padding-right: 50px; + padding-top: 40px; + + + } + + h6 { font-size: 10pt } + h5 { font-size: 11pt } + h4 { font-size: 12pt } + h3 { font-size: 13pt } + h2 { font-size: 14pt } + h1 { font-size: 16pt } + + blockquote {padding: 10px; border: 1px #DDD dashed } + + a img {border: 0} + + div.google_header, div.google_footer { + position: relative; + margin-top: 1em; + margin-bottom: 1em; + } + /* end default css */ + + + /* default print css */ + + @media print { + body { + padding: 0; + margin: 0; + } + + div.google_header, div.google_footer { + display: block; + min-height: 0; + border: none; + } + + div.google_header { + flow: static(header); + } + + /* used to insert page numbers */ + div.google_header::before, div.google_footer::before { + position: absolute; + top: 0; + } + + div.google_footer { + flow: static(footer); + } + + /* always consider this element at the start of the doc */ + div#google_footer { + flow: static(footer, start); + } + + span.google_pagenumber { + content: counter(page); + } + + span.google_pagecount { + content: counter(pages); + } + } + + @page { + @top { + content: flow(header); + } + @bottom { + content: flow(footer); + } + } + /* end default print css */ + + + /* custom css */ + + + /* end custom css */ + + /* ui edited css */ + + body { + font-family: Verdana; + + font-size: 10.0pt; + line-height: normal; + background-color: #ffffff; + } + /* end ui edited css */ + + + + +</style> + + +</head> + +<body revision="cczv65wb_54f62cc9f2:3"> + +<div id="result"> +</div> + + +<h1>չ2008ƣӿ </h1><br> +<br> + 882008˻ᵹʱһף찲Ź㳡СͼΪףеݳ » + + ӿġҪһԤ⣬ҪԽһʶ<br> +<br> +<a href=simpleTest.html id=b7v9 title=й֮>й֮</a><br> +<br> +<br> + +<form action="simpleTest.html"> + <input name="i18n" onchange="document.getElementById('result').innerHTML = '<p>' + this.value + '</p>';" /> +</form> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/colorPage.html b/node_modules/selenium-webdriver/lib/test/data/colorPage.html new file mode 100644 index 000000000..0d1bfc0af --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/colorPage.html @@ -0,0 +1,20 @@ +<!DOCTYPE html> +<html> +<head> + <title>Color Page</title> +</head> +<body> +<div id="namedColor" style="background-color: green;">namedColor</div> +<div id="rgb" style="background-color: rgb(0,128,0);">rgb</div> +<div id="rgbpct" style="background-color: rgb(0%,50%,0%);">rgbpct</div> +<div id="hex" style="background-color: #008000;">hex</div> +<div id="hexShort" style="background-color: #eee;">hex</div> +<div id="hsl" style="background-color: hsl(120,100%,25%);">hsl</div> +<div id="rgba" style="background-color: rgba(0,128,0, 0.5);">rgba</div> +<div id="rgbapct" style="background-color: rgba(0%,50%,0%, 0.5);">rgba</div> +<div id="hsla" style="background-color: hsla(120,100%,25%,0.5);">hsla</div> +</body> +</html> + + + diff --git a/node_modules/selenium-webdriver/lib/test/data/cookies.html b/node_modules/selenium-webdriver/lib/test/data/cookies.html new file mode 100644 index 000000000..7db5b4931 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/cookies.html @@ -0,0 +1,30 @@ +<html> +<head> + <title>Testing cookies</title> + + <script type="text/javascript"> + function setCookie(domain, name) { + document.cookie = name + "=ok;path=/;domain=" + domain; + } + + function showCookie() { + document.getElementById("result").innerHTML = "<p>" + document.cookie + "</p>"; + } + </script> +</head> +<body onload="showCookie();"> +<h2>Cookie Mashing</h2> + .com <a href="#" onclick="setCookie('.com', 'the.com_one'); showCookie(); return false;">Click</a></br /> + . <a href="#" onclick="setCookie('.', 'the.one'); showCookie(); return false;">Click</a></br /> + google.com <a href="#" onclick="setCookie('google.com', 'google'); showCookie(); return false;">Click</a></br /> + .google.com <a href="#" onclick="setCookie('.google.com', '.google'); showCookie(); return false;">Click</a></br /> + 127.0.0.1 <a href="#" onclick="setCookie('127.0.0.1', 'localhost'); showCookie(); return false;">Click</a></br /> + localhost:3001 <a href="#" onclick="setCookie('mency.ad.corp.google.com:62210', 'with_port'); showCookie(); return false;">Click</a></br /> + .google:3001 <a href="#" onclick="setCookie('.google.com:62210', 'with_domain_and_port'); showCookie(); return false;">Click</a></br /> + 172.16.12.225 <a href="#" onclick="setCookie('172.16.12.225', 'raw_IP'); showCookie(); return false;">Click</a></br /> + 172.16.12.225:port <a href="#" onclick="setCookie('172.16.12.225:62210', 'raw_IP_and_port'); showCookie(); return false;">Click</a></br /> + <a href="#" onclick="document.cookie = 'foo=bar;path=/common/galaxy';">Set on a different path</a> + +<div id="result"></div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_frame.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_frame.html new file mode 100644 index 000000000..7714a48ad --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_frame.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <iframe name="ifr" src="simple_page.html" width="400" height="300" style="border: 5px solid;"></iframe> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_nested_frame.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_nested_frame.html new file mode 100644 index 000000000..b3143b0d6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/element_in_nested_frame.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <iframe name="ifr" src="element_in_frame.html" width="500" height="400" style="border: 5px solid;"></iframe> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_element_out_of_view.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_element_out_of_view.html new file mode 100644 index 000000000..6f2bcd4f2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_element_out_of_view.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Element Out Of View</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div style="height: 5000px;">Placeholder</div> + <div id="box" style="width: 100px; height: 100px; background-color: red;">Red box</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_empty_element.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_empty_element.html new file mode 100644 index 000000000..b07972abd --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_empty_element.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Empty Element</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div id="box"></div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_fixed_element.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_fixed_element.html new file mode 100644 index 000000000..6cbb2738e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_fixed_element.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Fixed Element</title> +</head> +<body> + <div id="fixed" style="position:fixed; top:0px; left:100px; background-color:red">fixed red box</div> + <div id="placeholder" style="height: 5000px; background-color:green">Placeholder</div> + <div id="bottom">Element at the bottom</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_hidden_element.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_hidden_element.html new file mode 100644 index 000000000..286b04b17 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_hidden_element.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Hidden Element</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div id="box" style="width: 100px; height: 100px; background-color: red; visibility: hidden;">Hidden box</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_invisible_element.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_invisible_element.html new file mode 100644 index 000000000..dc33c7185 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_invisible_element.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Invisible Element</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div id="box" style="width: 100px; height: 100px; background-color: red; display: none;">Invisible box</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_transparent_element.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_transparent_element.html new file mode 100644 index 000000000..d0090d921 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/page_with_transparent_element.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page With Transparent Element</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div id="box" style="width: 100px; height: 100px; background-color: red; opacity: 0;">Hidden box</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/simple_page.html b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/simple_page.html new file mode 100644 index 000000000..7b857b9df --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/coordinates_tests/simple_page.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Simple Page</title> +</head> +<body style="margin: 10px; padding: 0px;"> + <div id="box" style="width: 100px; height: 100px; background-color: red;">Red box</div> + <div>Tex after box</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png Binary files differnew file mode 100644 index 000000000..954e22dbd --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_18_b81900_40x40.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png Binary files differnew file mode 100644 index 000000000..64ece5707 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_diagonals-thick_20_666666_40x40.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png Binary files differnew file mode 100644 index 000000000..abdc01082 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_flat_10_000000_40x100.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png Binary files differnew file mode 100644 index 000000000..9b383f4d2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_f6f6f6_1x400.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png Binary files differnew file mode 100644 index 000000000..a23baad25 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_100_fdf5ce_1x400.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png Binary files differnew file mode 100644 index 000000000..42ccba269 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_glass_65_ffffff_1x400.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png Binary files differnew file mode 100644 index 000000000..39d5824d6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_gloss-wave_35_f6a828_500x100.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png Binary files differnew file mode 100644 index 000000000..f1273672d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_100_eeeeee_1x100.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png Binary files differnew file mode 100644 index 000000000..359397acf --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-bg_highlight-soft_75_ffe45c_1x100.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_222222_256x240.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_222222_256x240.png Binary files differnew file mode 100644 index 000000000..b273ff111 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_222222_256x240.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_228ef1_256x240.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_228ef1_256x240.png Binary files differnew file mode 100644 index 000000000..a641a371a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_228ef1_256x240.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ef8c08_256x240.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ef8c08_256x240.png Binary files differnew file mode 100644 index 000000000..85e63e9f6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ef8c08_256x240.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffd27a_256x240.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffd27a_256x240.png Binary files differnew file mode 100644 index 000000000..e117effa3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffd27a_256x240.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffffff_256x240.png b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffffff_256x240.png Binary files differnew file mode 100644 index 000000000..42f8f992c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/images/ui-icons_ffffff_256x240.png diff --git a/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/jquery-ui-1.8.10.custom.css b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/jquery-ui-1.8.10.custom.css new file mode 100644 index 000000000..1706e2207 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/css/ui-lightness/jquery-ui-1.8.10.custom.css @@ -0,0 +1,573 @@ +/* + * jQuery UI CSS Framework 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + */ + +/* Layout helpers +----------------------------------*/ +.ui-helper-hidden { display: none; } +.ui-helper-hidden-accessible { position: absolute !important; clip: rect(1px 1px 1px 1px); clip: rect(1px,1px,1px,1px); } +.ui-helper-reset { margin: 0; padding: 0; border: 0; outline: 0; line-height: 1.3; text-decoration: none; font-size: 100%; list-style: none; } +.ui-helper-clearfix:after { content: "."; display: block; height: 0; clear: both; visibility: hidden; } +.ui-helper-clearfix { display: inline-block; } +/* required comment for clearfix to work in Opera \*/ +* html .ui-helper-clearfix { height:1%; } +.ui-helper-clearfix { display:block; } +/* end clearfix */ +.ui-helper-zfix { width: 100%; height: 100%; top: 0; left: 0; position: absolute; opacity: 0; filter:Alpha(Opacity=0); } + + +/* Interaction Cues +----------------------------------*/ +.ui-state-disabled { cursor: default !important; } + + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { display: block; text-indent: -99999px; overflow: hidden; background-repeat: no-repeat; } + + +/* Misc visuals +----------------------------------*/ + +/* Overlays */ +.ui-widget-overlay { position: absolute; top: 0; left: 0; width: 100%; height: 100%; } + + +/* + * jQuery UI CSS Framework 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Theming/API + * + * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Trebuchet%20MS,%20Tahoma,%20Verdana,%20Arial,%20sans-serif&fwDefault=bold&fsDefault=1.1em&cornerRadius=4px&bgColorHeader=f6a828&bgTextureHeader=12_gloss_wave.png&bgImgOpacityHeader=35&borderColorHeader=e78f08&fcHeader=ffffff&iconColorHeader=ffffff&bgColorContent=eeeeee&bgTextureContent=03_highlight_soft.png&bgImgOpacityContent=100&borderColorContent=dddddd&fcContent=333333&iconColorContent=222222&bgColorDefault=f6f6f6&bgTextureDefault=02_glass.png&bgImgOpacityDefault=100&borderColorDefault=cccccc&fcDefault=1c94c4&iconColorDefault=ef8c08&bgColorHover=fdf5ce&bgTextureHover=02_glass.png&bgImgOpacityHover=100&borderColorHover=fbcb09&fcHover=c77405&iconColorHover=ef8c08&bgColorActive=ffffff&bgTextureActive=02_glass.png&bgImgOpacityActive=65&borderColorActive=fbd850&fcActive=eb8f00&iconColorActive=ef8c08&bgColorHighlight=ffe45c&bgTextureHighlight=03_highlight_soft.png&bgImgOpacityHighlight=75&borderColorHighlight=fed22f&fcHighlight=363636&iconColorHighlight=228ef1&bgColorError=b81900&bgTextureError=08_diagonals_thick.png&bgImgOpacityError=18&borderColorError=cd0a0a&fcError=ffffff&iconColorError=ffd27a&bgColorOverlay=666666&bgTextureOverlay=08_diagonals_thick.png&bgImgOpacityOverlay=20&opacityOverlay=50&bgColorShadow=000000&bgTextureShadow=01_flat.png&bgImgOpacityShadow=10&opacityShadow=20&thicknessShadow=5px&offsetTopShadow=-5px&offsetLeftShadow=-5px&cornerRadiusShadow=5px + */ + + +/* Component containers +----------------------------------*/ +.ui-widget { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1.1em; } +.ui-widget .ui-widget { font-size: 1em; } +.ui-widget input, .ui-widget select, .ui-widget textarea, .ui-widget button { font-family: Trebuchet MS, Tahoma, Verdana, Arial, sans-serif; font-size: 1em; } +.ui-widget-content { border: 1px solid #dddddd; background: #eeeeee url(images/ui-bg_highlight-soft_100_eeeeee_1x100.png) 50% top repeat-x; color: #333333; } +.ui-widget-content a { color: #333333; } +.ui-widget-header { border: 1px solid #e78f08; background: #f6a828 url(images/ui-bg_gloss-wave_35_f6a828_500x100.png) 50% 50% repeat-x; color: #ffffff; font-weight: bold; } +.ui-widget-header a { color: #ffffff; } + +/* Interaction states +----------------------------------*/ +.ui-state-default, .ui-widget-content .ui-state-default, .ui-widget-header .ui-state-default { border: 1px solid #cccccc; background: #f6f6f6 url(images/ui-bg_glass_100_f6f6f6_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #1c94c4; } +.ui-state-default a, .ui-state-default a:link, .ui-state-default a:visited { color: #1c94c4; text-decoration: none; } +.ui-state-hover, .ui-widget-content .ui-state-hover, .ui-widget-header .ui-state-hover, .ui-state-focus, .ui-widget-content .ui-state-focus, .ui-widget-header .ui-state-focus { border: 1px solid #fbcb09; background: #fdf5ce url(images/ui-bg_glass_100_fdf5ce_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #c77405; } +.ui-state-hover a, .ui-state-hover a:hover { color: #c77405; text-decoration: none; } +.ui-state-active, .ui-widget-content .ui-state-active, .ui-widget-header .ui-state-active { border: 1px solid #fbd850; background: #ffffff url(images/ui-bg_glass_65_ffffff_1x400.png) 50% 50% repeat-x; font-weight: bold; color: #eb8f00; } +.ui-state-active a, .ui-state-active a:link, .ui-state-active a:visited { color: #eb8f00; text-decoration: none; } +.ui-widget :active { outline: none; } + +/* Interaction Cues +----------------------------------*/ +.ui-state-highlight, .ui-widget-content .ui-state-highlight, .ui-widget-header .ui-state-highlight {border: 1px solid #fed22f; background: #ffe45c url(images/ui-bg_highlight-soft_75_ffe45c_1x100.png) 50% top repeat-x; color: #363636; } +.ui-state-highlight a, .ui-widget-content .ui-state-highlight a,.ui-widget-header .ui-state-highlight a { color: #363636; } +.ui-state-error, .ui-widget-content .ui-state-error, .ui-widget-header .ui-state-error {border: 1px solid #cd0a0a; background: #b81900 url(images/ui-bg_diagonals-thick_18_b81900_40x40.png) 50% 50% repeat; color: #ffffff; } +.ui-state-error a, .ui-widget-content .ui-state-error a, .ui-widget-header .ui-state-error a { color: #ffffff; } +.ui-state-error-text, .ui-widget-content .ui-state-error-text, .ui-widget-header .ui-state-error-text { color: #ffffff; } +.ui-priority-primary, .ui-widget-content .ui-priority-primary, .ui-widget-header .ui-priority-primary { font-weight: bold; } +.ui-priority-secondary, .ui-widget-content .ui-priority-secondary, .ui-widget-header .ui-priority-secondary { opacity: .7; filter:Alpha(Opacity=70); font-weight: normal; } +.ui-state-disabled, .ui-widget-content .ui-state-disabled, .ui-widget-header .ui-state-disabled { opacity: .35; filter:Alpha(Opacity=35); background-image: none; } + +/* Icons +----------------------------------*/ + +/* states and images */ +.ui-icon { width: 16px; height: 16px; background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-content .ui-icon {background-image: url(images/ui-icons_222222_256x240.png); } +.ui-widget-header .ui-icon {background-image: url(images/ui-icons_ffffff_256x240.png); } +.ui-state-default .ui-icon { background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-hover .ui-icon, .ui-state-focus .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-active .ui-icon {background-image: url(images/ui-icons_ef8c08_256x240.png); } +.ui-state-highlight .ui-icon {background-image: url(images/ui-icons_228ef1_256x240.png); } +.ui-state-error .ui-icon, .ui-state-error-text .ui-icon {background-image: url(images/ui-icons_ffd27a_256x240.png); } + +/* positioning */ +.ui-icon-carat-1-n { background-position: 0 0; } +.ui-icon-carat-1-ne { background-position: -16px 0; } +.ui-icon-carat-1-e { background-position: -32px 0; } +.ui-icon-carat-1-se { background-position: -48px 0; } +.ui-icon-carat-1-s { background-position: -64px 0; } +.ui-icon-carat-1-sw { background-position: -80px 0; } +.ui-icon-carat-1-w { background-position: -96px 0; } +.ui-icon-carat-1-nw { background-position: -112px 0; } +.ui-icon-carat-2-n-s { background-position: -128px 0; } +.ui-icon-carat-2-e-w { background-position: -144px 0; } +.ui-icon-triangle-1-n { background-position: 0 -16px; } +.ui-icon-triangle-1-ne { background-position: -16px -16px; } +.ui-icon-triangle-1-e { background-position: -32px -16px; } +.ui-icon-triangle-1-se { background-position: -48px -16px; } +.ui-icon-triangle-1-s { background-position: -64px -16px; } +.ui-icon-triangle-1-sw { background-position: -80px -16px; } +.ui-icon-triangle-1-w { background-position: -96px -16px; } +.ui-icon-triangle-1-nw { background-position: -112px -16px; } +.ui-icon-triangle-2-n-s { background-position: -128px -16px; } +.ui-icon-triangle-2-e-w { background-position: -144px -16px; } +.ui-icon-arrow-1-n { background-position: 0 -32px; } +.ui-icon-arrow-1-ne { background-position: -16px -32px; } +.ui-icon-arrow-1-e { background-position: -32px -32px; } +.ui-icon-arrow-1-se { background-position: -48px -32px; } +.ui-icon-arrow-1-s { background-position: -64px -32px; } +.ui-icon-arrow-1-sw { background-position: -80px -32px; } +.ui-icon-arrow-1-w { background-position: -96px -32px; } +.ui-icon-arrow-1-nw { background-position: -112px -32px; } +.ui-icon-arrow-2-n-s { background-position: -128px -32px; } +.ui-icon-arrow-2-ne-sw { background-position: -144px -32px; } +.ui-icon-arrow-2-e-w { background-position: -160px -32px; } +.ui-icon-arrow-2-se-nw { background-position: -176px -32px; } +.ui-icon-arrowstop-1-n { background-position: -192px -32px; } +.ui-icon-arrowstop-1-e { background-position: -208px -32px; } +.ui-icon-arrowstop-1-s { background-position: -224px -32px; } +.ui-icon-arrowstop-1-w { background-position: -240px -32px; } +.ui-icon-arrowthick-1-n { background-position: 0 -48px; } +.ui-icon-arrowthick-1-ne { background-position: -16px -48px; } +.ui-icon-arrowthick-1-e { background-position: -32px -48px; } +.ui-icon-arrowthick-1-se { background-position: -48px -48px; } +.ui-icon-arrowthick-1-s { background-position: -64px -48px; } +.ui-icon-arrowthick-1-sw { background-position: -80px -48px; } +.ui-icon-arrowthick-1-w { background-position: -96px -48px; } +.ui-icon-arrowthick-1-nw { background-position: -112px -48px; } +.ui-icon-arrowthick-2-n-s { background-position: -128px -48px; } +.ui-icon-arrowthick-2-ne-sw { background-position: -144px -48px; } +.ui-icon-arrowthick-2-e-w { background-position: -160px -48px; } +.ui-icon-arrowthick-2-se-nw { background-position: -176px -48px; } +.ui-icon-arrowthickstop-1-n { background-position: -192px -48px; } +.ui-icon-arrowthickstop-1-e { background-position: -208px -48px; } +.ui-icon-arrowthickstop-1-s { background-position: -224px -48px; } +.ui-icon-arrowthickstop-1-w { background-position: -240px -48px; } +.ui-icon-arrowreturnthick-1-w { background-position: 0 -64px; } +.ui-icon-arrowreturnthick-1-n { background-position: -16px -64px; } +.ui-icon-arrowreturnthick-1-e { background-position: -32px -64px; } +.ui-icon-arrowreturnthick-1-s { background-position: -48px -64px; } +.ui-icon-arrowreturn-1-w { background-position: -64px -64px; } +.ui-icon-arrowreturn-1-n { background-position: -80px -64px; } +.ui-icon-arrowreturn-1-e { background-position: -96px -64px; } +.ui-icon-arrowreturn-1-s { background-position: -112px -64px; } +.ui-icon-arrowrefresh-1-w { background-position: -128px -64px; } +.ui-icon-arrowrefresh-1-n { background-position: -144px -64px; } +.ui-icon-arrowrefresh-1-e { background-position: -160px -64px; } +.ui-icon-arrowrefresh-1-s { background-position: -176px -64px; } +.ui-icon-arrow-4 { background-position: 0 -80px; } +.ui-icon-arrow-4-diag { background-position: -16px -80px; } +.ui-icon-extlink { background-position: -32px -80px; } +.ui-icon-newwin { background-position: -48px -80px; } +.ui-icon-refresh { background-position: -64px -80px; } +.ui-icon-shuffle { background-position: -80px -80px; } +.ui-icon-transfer-e-w { background-position: -96px -80px; } +.ui-icon-transferthick-e-w { background-position: -112px -80px; } +.ui-icon-folder-collapsed { background-position: 0 -96px; } +.ui-icon-folder-open { background-position: -16px -96px; } +.ui-icon-document { background-position: -32px -96px; } +.ui-icon-document-b { background-position: -48px -96px; } +.ui-icon-note { background-position: -64px -96px; } +.ui-icon-mail-closed { background-position: -80px -96px; } +.ui-icon-mail-open { background-position: -96px -96px; } +.ui-icon-suitcase { background-position: -112px -96px; } +.ui-icon-comment { background-position: -128px -96px; } +.ui-icon-person { background-position: -144px -96px; } +.ui-icon-print { background-position: -160px -96px; } +.ui-icon-trash { background-position: -176px -96px; } +.ui-icon-locked { background-position: -192px -96px; } +.ui-icon-unlocked { background-position: -208px -96px; } +.ui-icon-bookmark { background-position: -224px -96px; } +.ui-icon-tag { background-position: -240px -96px; } +.ui-icon-home { background-position: 0 -112px; } +.ui-icon-flag { background-position: -16px -112px; } +.ui-icon-calendar { background-position: -32px -112px; } +.ui-icon-cart { background-position: -48px -112px; } +.ui-icon-pencil { background-position: -64px -112px; } +.ui-icon-clock { background-position: -80px -112px; } +.ui-icon-disk { background-position: -96px -112px; } +.ui-icon-calculator { background-position: -112px -112px; } +.ui-icon-zoomin { background-position: -128px -112px; } +.ui-icon-zoomout { background-position: -144px -112px; } +.ui-icon-search { background-position: -160px -112px; } +.ui-icon-wrench { background-position: -176px -112px; } +.ui-icon-gear { background-position: -192px -112px; } +.ui-icon-heart { background-position: -208px -112px; } +.ui-icon-star { background-position: -224px -112px; } +.ui-icon-link { background-position: -240px -112px; } +.ui-icon-cancel { background-position: 0 -128px; } +.ui-icon-plus { background-position: -16px -128px; } +.ui-icon-plusthick { background-position: -32px -128px; } +.ui-icon-minus { background-position: -48px -128px; } +.ui-icon-minusthick { background-position: -64px -128px; } +.ui-icon-close { background-position: -80px -128px; } +.ui-icon-closethick { background-position: -96px -128px; } +.ui-icon-key { background-position: -112px -128px; } +.ui-icon-lightbulb { background-position: -128px -128px; } +.ui-icon-scissors { background-position: -144px -128px; } +.ui-icon-clipboard { background-position: -160px -128px; } +.ui-icon-copy { background-position: -176px -128px; } +.ui-icon-contact { background-position: -192px -128px; } +.ui-icon-image { background-position: -208px -128px; } +.ui-icon-video { background-position: -224px -128px; } +.ui-icon-script { background-position: -240px -128px; } +.ui-icon-alert { background-position: 0 -144px; } +.ui-icon-info { background-position: -16px -144px; } +.ui-icon-notice { background-position: -32px -144px; } +.ui-icon-help { background-position: -48px -144px; } +.ui-icon-check { background-position: -64px -144px; } +.ui-icon-bullet { background-position: -80px -144px; } +.ui-icon-radio-off { background-position: -96px -144px; } +.ui-icon-radio-on { background-position: -112px -144px; } +.ui-icon-pin-w { background-position: -128px -144px; } +.ui-icon-pin-s { background-position: -144px -144px; } +.ui-icon-play { background-position: 0 -160px; } +.ui-icon-pause { background-position: -16px -160px; } +.ui-icon-seek-next { background-position: -32px -160px; } +.ui-icon-seek-prev { background-position: -48px -160px; } +.ui-icon-seek-end { background-position: -64px -160px; } +.ui-icon-seek-start { background-position: -80px -160px; } +/* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ +.ui-icon-seek-first { background-position: -80px -160px; } +.ui-icon-stop { background-position: -96px -160px; } +.ui-icon-eject { background-position: -112px -160px; } +.ui-icon-volume-off { background-position: -128px -160px; } +.ui-icon-volume-on { background-position: -144px -160px; } +.ui-icon-power { background-position: 0 -176px; } +.ui-icon-signal-diag { background-position: -16px -176px; } +.ui-icon-signal { background-position: -32px -176px; } +.ui-icon-battery-0 { background-position: -48px -176px; } +.ui-icon-battery-1 { background-position: -64px -176px; } +.ui-icon-battery-2 { background-position: -80px -176px; } +.ui-icon-battery-3 { background-position: -96px -176px; } +.ui-icon-circle-plus { background-position: 0 -192px; } +.ui-icon-circle-minus { background-position: -16px -192px; } +.ui-icon-circle-close { background-position: -32px -192px; } +.ui-icon-circle-triangle-e { background-position: -48px -192px; } +.ui-icon-circle-triangle-s { background-position: -64px -192px; } +.ui-icon-circle-triangle-w { background-position: -80px -192px; } +.ui-icon-circle-triangle-n { background-position: -96px -192px; } +.ui-icon-circle-arrow-e { background-position: -112px -192px; } +.ui-icon-circle-arrow-s { background-position: -128px -192px; } +.ui-icon-circle-arrow-w { background-position: -144px -192px; } +.ui-icon-circle-arrow-n { background-position: -160px -192px; } +.ui-icon-circle-zoomin { background-position: -176px -192px; } +.ui-icon-circle-zoomout { background-position: -192px -192px; } +.ui-icon-circle-check { background-position: -208px -192px; } +.ui-icon-circlesmall-plus { background-position: 0 -208px; } +.ui-icon-circlesmall-minus { background-position: -16px -208px; } +.ui-icon-circlesmall-close { background-position: -32px -208px; } +.ui-icon-squaresmall-plus { background-position: -48px -208px; } +.ui-icon-squaresmall-minus { background-position: -64px -208px; } +.ui-icon-squaresmall-close { background-position: -80px -208px; } +.ui-icon-grip-dotted-vertical { background-position: 0 -224px; } +.ui-icon-grip-dotted-horizontal { background-position: -16px -224px; } +.ui-icon-grip-solid-vertical { background-position: -32px -224px; } +.ui-icon-grip-solid-horizontal { background-position: -48px -224px; } +.ui-icon-gripsmall-diagonal-se { background-position: -64px -224px; } +.ui-icon-grip-diagonal-se { background-position: -80px -224px; } + + +/* Misc visuals +----------------------------------*/ + +/* Corner radius */ +.ui-corner-tl { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; } +.ui-corner-tr { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bl { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-br { -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-top { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; } +.ui-corner-bottom { -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-right { -moz-border-radius-topright: 4px; -webkit-border-top-right-radius: 4px; border-top-right-radius: 4px; -moz-border-radius-bottomright: 4px; -webkit-border-bottom-right-radius: 4px; border-bottom-right-radius: 4px; } +.ui-corner-left { -moz-border-radius-topleft: 4px; -webkit-border-top-left-radius: 4px; border-top-left-radius: 4px; -moz-border-radius-bottomleft: 4px; -webkit-border-bottom-left-radius: 4px; border-bottom-left-radius: 4px; } +.ui-corner-all { -moz-border-radius: 4px; -webkit-border-radius: 4px; border-radius: 4px; } + +/* Overlays */ +.ui-widget-overlay { background: #666666 url(images/ui-bg_diagonals-thick_20_666666_40x40.png) 50% 50% repeat; opacity: .50;filter:Alpha(Opacity=50); } +.ui-widget-shadow { margin: -5px 0 0 -5px; padding: 5px; background: #000000 url(images/ui-bg_flat_10_000000_40x100.png) 50% 50% repeat-x; opacity: .20;filter:Alpha(Opacity=20); -moz-border-radius: 5px; -webkit-border-radius: 5px; border-radius: 5px; }/* + * jQuery UI Resizable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizable#theming + */ +.ui-resizable { position: relative;} +.ui-resizable-handle { position: absolute;font-size: 0.1px;z-index: 99999; display: block;} +.ui-resizable-disabled .ui-resizable-handle, .ui-resizable-autohide .ui-resizable-handle { display: none; } +.ui-resizable-n { cursor: n-resize; height: 7px; width: 100%; top: -5px; left: 0; } +.ui-resizable-s { cursor: s-resize; height: 7px; width: 100%; bottom: -5px; left: 0; } +.ui-resizable-e { cursor: e-resize; width: 7px; right: -5px; top: 0; height: 100%; } +.ui-resizable-w { cursor: w-resize; width: 7px; left: -5px; top: 0; height: 100%; } +.ui-resizable-se { cursor: se-resize; width: 12px; height: 12px; right: 1px; bottom: 1px; } +.ui-resizable-sw { cursor: sw-resize; width: 9px; height: 9px; left: -5px; bottom: -5px; } +.ui-resizable-nw { cursor: nw-resize; width: 9px; height: 9px; left: -5px; top: -5px; } +.ui-resizable-ne { cursor: ne-resize; width: 9px; height: 9px; right: -5px; top: -5px;}/* + * jQuery UI Selectable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectable#theming + */ +.ui-selectable-helper { position: absolute; z-index: 100; border:1px dotted black; } +/* + * jQuery UI Accordion 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion#theming + */ +/* IE/Win - Fix animation bug - #4615 */ +.ui-accordion { width: 100%; } +.ui-accordion .ui-accordion-header { cursor: pointer; position: relative; margin-top: 1px; zoom: 1; } +.ui-accordion .ui-accordion-li-fix { display: inline; } +.ui-accordion .ui-accordion-header-active { border-bottom: 0 !important; } +.ui-accordion .ui-accordion-header a { display: block; font-size: 1em; padding: .5em .5em .5em .7em; } +.ui-accordion-icons .ui-accordion-header a { padding-left: 2.2em; } +.ui-accordion .ui-accordion-header .ui-icon { position: absolute; left: .5em; top: 50%; margin-top: -8px; } +.ui-accordion .ui-accordion-content { padding: 1em 2.2em; border-top: 0; margin-top: -2px; position: relative; top: 1px; margin-bottom: 2px; overflow: auto; display: none; zoom: 1; } +.ui-accordion .ui-accordion-content-active { display: block; } +/* + * jQuery UI Autocomplete 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete#theming + */ +.ui-autocomplete { position: absolute; cursor: default; } + +/* workarounds */ +* html .ui-autocomplete { width:1px; } /* without this, the menu expands to 100% in IE6 */ + +/* + * jQuery UI Menu 1.8.10 + * + * Copyright 2010, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Menu#theming + */ +.ui-menu { + list-style:none; + padding: 2px; + margin: 0; + display:block; + float: left; +} +.ui-menu .ui-menu { + margin-top: -3px; +} +.ui-menu .ui-menu-item { + margin:0; + padding: 0; + zoom: 1; + float: left; + clear: left; + width: 100%; +} +.ui-menu .ui-menu-item a { + text-decoration:none; + display:block; + padding:.2em .4em; + line-height:1.5; + zoom:1; +} +.ui-menu .ui-menu-item a.ui-state-hover, +.ui-menu .ui-menu-item a.ui-state-active { + font-weight: normal; + margin: -1px; +} +/* + * jQuery UI Button 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button#theming + */ +.ui-button { display: inline-block; position: relative; padding: 0; margin-right: .1em; text-decoration: none !important; cursor: pointer; text-align: center; zoom: 1; overflow: visible; } /* the overflow property removes extra width in IE */ +.ui-button-icon-only { width: 2.2em; } /* to make room for the icon, a width needs to be set here */ +button.ui-button-icon-only { width: 2.4em; } /* button elements seem to need a little more width */ +.ui-button-icons-only { width: 3.4em; } +button.ui-button-icons-only { width: 3.7em; } + +/*button text element */ +.ui-button .ui-button-text { display: block; line-height: 1.4; } +.ui-button-text-only .ui-button-text { padding: .4em 1em; } +.ui-button-icon-only .ui-button-text, .ui-button-icons-only .ui-button-text { padding: .4em; text-indent: -9999999px; } +.ui-button-text-icon-primary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 1em .4em 2.1em; } +.ui-button-text-icon-secondary .ui-button-text, .ui-button-text-icons .ui-button-text { padding: .4em 2.1em .4em 1em; } +.ui-button-text-icons .ui-button-text { padding-left: 2.1em; padding-right: 2.1em; } +/* no icon support for input elements, provide padding by default */ +input.ui-button { padding: .4em 1em; } + +/*button icon element(s) */ +.ui-button-icon-only .ui-icon, .ui-button-text-icon-primary .ui-icon, .ui-button-text-icon-secondary .ui-icon, .ui-button-text-icons .ui-icon, .ui-button-icons-only .ui-icon { position: absolute; top: 50%; margin-top: -8px; } +.ui-button-icon-only .ui-icon { left: 50%; margin-left: -8px; } +.ui-button-text-icon-primary .ui-button-icon-primary, .ui-button-text-icons .ui-button-icon-primary, .ui-button-icons-only .ui-button-icon-primary { left: .5em; } +.ui-button-text-icon-secondary .ui-button-icon-secondary, .ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } +.ui-button-text-icons .ui-button-icon-secondary, .ui-button-icons-only .ui-button-icon-secondary { right: .5em; } + +/*button sets*/ +.ui-buttonset { margin-right: 7px; } +.ui-buttonset .ui-button { margin-left: 0; margin-right: -.3em; } + +/* workarounds */ +button.ui-button::-moz-focus-inner { border: 0; padding: 0; } /* reset extra padding in Firefox */ +/* + * jQuery UI Dialog 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog#theming + */ +.ui-dialog { position: absolute; padding: .2em; width: 300px; overflow: hidden; } +.ui-dialog .ui-dialog-titlebar { padding: .4em 1em; position: relative; } +.ui-dialog .ui-dialog-title { float: left; margin: .1em 16px .1em 0; } +.ui-dialog .ui-dialog-titlebar-close { position: absolute; right: .3em; top: 50%; width: 19px; margin: -10px 0 0 0; padding: 1px; height: 18px; } +.ui-dialog .ui-dialog-titlebar-close span { display: block; margin: 1px; } +.ui-dialog .ui-dialog-titlebar-close:hover, .ui-dialog .ui-dialog-titlebar-close:focus { padding: 0; } +.ui-dialog .ui-dialog-content { position: relative; border: 0; padding: .5em 1em; background: none; overflow: auto; zoom: 1; } +.ui-dialog .ui-dialog-buttonpane { text-align: left; border-width: 1px 0 0 0; background-image: none; margin: .5em 0 0 0; padding: .3em 1em .5em .4em; } +.ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { float: right; } +.ui-dialog .ui-dialog-buttonpane button { margin: .5em .4em .5em 0; cursor: pointer; } +.ui-dialog .ui-resizable-se { width: 14px; height: 14px; right: 3px; bottom: 3px; } +.ui-draggable .ui-dialog-titlebar { cursor: move; } +/* + * jQuery UI Slider 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider#theming + */ +.ui-slider { position: relative; text-align: left; } +.ui-slider .ui-slider-handle { position: absolute; z-index: 2; width: 1.2em; height: 1.2em; cursor: default; } +.ui-slider .ui-slider-range { position: absolute; z-index: 1; font-size: .7em; display: block; border: 0; background-position: 0 0; } + +.ui-slider-horizontal { height: .8em; } +.ui-slider-horizontal .ui-slider-handle { top: -.3em; margin-left: -.6em; } +.ui-slider-horizontal .ui-slider-range { top: 0; height: 100%; } +.ui-slider-horizontal .ui-slider-range-min { left: 0; } +.ui-slider-horizontal .ui-slider-range-max { right: 0; } + +.ui-slider-vertical { width: .8em; height: 100px; } +.ui-slider-vertical .ui-slider-handle { left: -.3em; margin-left: 0; margin-bottom: -.6em; } +.ui-slider-vertical .ui-slider-range { left: 0; width: 100%; } +.ui-slider-vertical .ui-slider-range-min { bottom: 0; } +.ui-slider-vertical .ui-slider-range-max { top: 0; }/* + * jQuery UI Tabs 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs#theming + */ +.ui-tabs { position: relative; padding: .2em; zoom: 1; } /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ +.ui-tabs .ui-tabs-nav { margin: 0; padding: .2em .2em 0; } +.ui-tabs .ui-tabs-nav li { list-style: none; float: left; position: relative; top: 1px; margin: 0 .2em 1px 0; border-bottom: 0 !important; padding: 0; white-space: nowrap; } +.ui-tabs .ui-tabs-nav li a { float: left; padding: .5em 1em; text-decoration: none; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected { margin-bottom: 0; padding-bottom: 1px; } +.ui-tabs .ui-tabs-nav li.ui-tabs-selected a, .ui-tabs .ui-tabs-nav li.ui-state-disabled a, .ui-tabs .ui-tabs-nav li.ui-state-processing a { cursor: text; } +.ui-tabs .ui-tabs-nav li a, .ui-tabs.ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-selected a { cursor: pointer; } /* first selector in group seems obsolete, but required to overcome bug in Opera applying cursor: text overall if defined elsewhere... */ +.ui-tabs .ui-tabs-panel { display: block; border-width: 0; padding: 1em 1.4em; background: none; } +.ui-tabs .ui-tabs-hide { display: none !important; } +/* + * jQuery UI Datepicker 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker#theming + */ +.ui-datepicker { width: 17em; padding: .2em .2em 0; display: none; } +.ui-datepicker .ui-datepicker-header { position:relative; padding:.2em 0; } +.ui-datepicker .ui-datepicker-prev, .ui-datepicker .ui-datepicker-next { position:absolute; top: 2px; width: 1.8em; height: 1.8em; } +.ui-datepicker .ui-datepicker-prev-hover, .ui-datepicker .ui-datepicker-next-hover { top: 1px; } +.ui-datepicker .ui-datepicker-prev { left:2px; } +.ui-datepicker .ui-datepicker-next { right:2px; } +.ui-datepicker .ui-datepicker-prev-hover { left:1px; } +.ui-datepicker .ui-datepicker-next-hover { right:1px; } +.ui-datepicker .ui-datepicker-prev span, .ui-datepicker .ui-datepicker-next span { display: block; position: absolute; left: 50%; margin-left: -8px; top: 50%; margin-top: -8px; } +.ui-datepicker .ui-datepicker-title { margin: 0 2.3em; line-height: 1.8em; text-align: center; } +.ui-datepicker .ui-datepicker-title select { font-size:1em; margin:1px 0; } +.ui-datepicker select.ui-datepicker-month-year {width: 100%;} +.ui-datepicker select.ui-datepicker-month, +.ui-datepicker select.ui-datepicker-year { width: 49%;} +.ui-datepicker table {width: 100%; font-size: .9em; border-collapse: collapse; margin:0 0 .4em; } +.ui-datepicker th { padding: .7em .3em; text-align: center; font-weight: bold; border: 0; } +.ui-datepicker td { border: 0; padding: 1px; } +.ui-datepicker td span, .ui-datepicker td a { display: block; padding: .2em; text-align: right; text-decoration: none; } +.ui-datepicker .ui-datepicker-buttonpane { background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0; } +.ui-datepicker .ui-datepicker-buttonpane button { float: right; margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; } +.ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { float:left; } + +/* with multiple calendars */ +.ui-datepicker.ui-datepicker-multi { width:auto; } +.ui-datepicker-multi .ui-datepicker-group { float:left; } +.ui-datepicker-multi .ui-datepicker-group table { width:95%; margin:0 auto .4em; } +.ui-datepicker-multi-2 .ui-datepicker-group { width:50%; } +.ui-datepicker-multi-3 .ui-datepicker-group { width:33.3%; } +.ui-datepicker-multi-4 .ui-datepicker-group { width:25%; } +.ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { border-left-width:0; } +.ui-datepicker-multi .ui-datepicker-buttonpane { clear:left; } +.ui-datepicker-row-break { clear:both; width:100%; } + +/* RTL support */ +.ui-datepicker-rtl { direction: rtl; } +.ui-datepicker-rtl .ui-datepicker-prev { right: 2px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next { left: 2px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-prev:hover { right: 1px; left: auto; } +.ui-datepicker-rtl .ui-datepicker-next:hover { left: 1px; right: auto; } +.ui-datepicker-rtl .ui-datepicker-buttonpane { clear:right; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button { float: left; } +.ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current { float:right; } +.ui-datepicker-rtl .ui-datepicker-group { float:right; } +.ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header { border-right-width:0; border-left-width:1px; } +.ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { border-right-width:0; border-left-width:1px; } + +/* IE6 IFRAME FIX (taken from datepicker 1.5.3 */ +.ui-datepicker-cover { + display: none; /*sorry for IE5*/ + display/**/: block; /*sorry for IE5*/ + position: absolute; /*must have*/ + z-index: -1; /*must have*/ + filter: mask(); /*must have*/ + top: -4px; /*must have*/ + left: -4px; /*must have*/ + width: 200px; /*must have*/ + height: 200px; /*must have*/ +}/* + * jQuery UI Progressbar 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar#theming + */ +.ui-progressbar { height:2em; text-align: left; } +.ui-progressbar .ui-progressbar-value {margin: -1px; height:100%; }
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/cssTransform.html b/node_modules/selenium-webdriver/lib/test/data/cssTransform.html new file mode 100644 index 000000000..c3b99648a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/cssTransform.html @@ -0,0 +1,61 @@ +<!DOCTYPE html> +<style> +#parentY { + transform: translateY(-10000px); + -webkit-transform: translateY(-10000px); + -o-transform: translateY(-10000px); + -ms-transform: translateY(-10000px); + -moz-transform: translateY(-10000px); +} +#parentX { + transform: translateX(-10000px); + -webkit-transform: translateX(-10000px); + -o-transform: translateX(-10000px); + -ms-transform: translateX(-10000px); + -moz-transform: translateX(-10000px); +} +#transformX { + transform: translateX(-10000px); + -webkit-transform: translateX(-10000px); + -o-transform: translateX(-10000px); + -ms-transform: translateX(-10000px); + -moz-transform: translateX(-10000px); +} +#transformY { + transform: translateY(-10000px); + -webkit-transform: translateY(-10000px); + -o-transform: translateY(-10000px); + -ms-transform: translateY(-10000px); + -moz-transform: translateY(-10000px); +} + +#zero-transform { + transform: translateY(0px); + -webkit-transform: translateY(0px); + -o-transform: translateY(0px); + -ms-transform: translateY(0px); + -moz-transform: translateY(0px); + transform: translateX(0px); + -webkit-transform: translateX(0px); + -o-transform: translateX(0px); + -ms-transform: translateX(0px); + -moz-transform: translateX(0px); +} +</style> +<div id='zero-tranform'> +You shouldn't see anything other than this sentence on the page +</div> +<div id='parentY'> + I have a hidden child + <div id='childY'> + I am a hidden child + </div> +</div> +<div id='parentX'> + I have a hidden child + <div id='childX'> + I am a hidden child + </div> +</div> +<div id='transformX'>I am a hidden element </div> +<div id='transformY'>I am a hidden element </div> diff --git a/node_modules/selenium-webdriver/lib/test/data/cssTransform2.html b/node_modules/selenium-webdriver/lib/test/data/cssTransform2.html new file mode 100644 index 000000000..602924bfb --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/cssTransform2.html @@ -0,0 +1,20 @@ +<!DOCTYPE html> +<style> +#negative-percentage-transformY{ + transform: translateY(-75px); + -webkit-transform: translateY(-75%); + -o-transform: translateY(-75%); + -ms-transform: translateY(-75%); + -moz-transform: translateY(-75%); +} +.block { + display = block; +} +</style> +<div class='block'> + <br/> +</div> + <br/> +<div class='block'> +</div> +<div id='negative-percentage-transformY'>I am not a hidden element </div> diff --git a/node_modules/selenium-webdriver/lib/test/data/document_write_in_onload.html b/node_modules/selenium-webdriver/lib/test/data/document_write_in_onload.html new file mode 100644 index 000000000..a15fc479e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/document_write_in_onload.html @@ -0,0 +1,13 @@ +<html> +<head> + <title>Document Write In Onload</title> + <script> + function init() { + document.writeln('goodbye, world!'); + } + </script> +</head> +<body onload="init();"> +<p>hello world</p> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/dragAndDropInsideScrolledDiv.html b/node_modules/selenium-webdriver/lib/test/data/dragAndDropInsideScrolledDiv.html new file mode 100644 index 000000000..0b2ee9a24 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/dragAndDropInsideScrolledDiv.html @@ -0,0 +1,67 @@ +<html> +<head> +<style> +<!-- +.dragme{position:relative;} +--> +</style> +<script language="JavaScript1.2"> +<!-- + +var ie=document.all; +var nn6=document.getElementById&&!document.all; + +var isdrag=false; +var x,y; +var dobj; + +function movemouse(e) +{ + + if (isdrag) + { + dobj.style.left = nn6 ? tx + e.clientX - x : tx + event.clientX - x; + dobj.style.top = nn6 ? ty + e.clientY - y : ty + event.clientY - y; + return false; + } +} + +function selectmouse(e) +{ + var fobj = nn6 ? e.target : event.srcElement; + var topelement = nn6 ? "HTML" : "BODY"; + + while (fobj.tagName != topelement && fobj.className != "dragme") + { + fobj = nn6 ? fobj.parentNode : fobj.parentElement; + } + + if (fobj.className=="dragme") + { + isdrag = true; + dobj = fobj; + tx = parseInt(dobj.style.left+0); + ty = parseInt(dobj.style.top+0); + x = nn6 ? e.clientX : event.clientX; + y = nn6 ? e.clientY : event.clientY; + document.onmousemove=movemouse; + return false; + } +} + +document.onmousedown=selectmouse; +document.onmouseup=new Function("isdrag=false"); + +//--> +</script> + +</head> +<body> + <div style="overflow: scroll; margin: 20px; height: 90%; width: 90%"> + <div style="height: 4000px; width: 4000px;"> + <div id="test1" class="dragme" style="width: 100px; height: 100px; + background-color: black;" /> + </div> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/dragAndDropTest.html b/node_modules/selenium-webdriver/lib/test/data/dragAndDropTest.html new file mode 100644 index 000000000..fdee16b0b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/dragAndDropTest.html @@ -0,0 +1,102 @@ +<html> +<body> + +<style> +<!-- +.dragme{position:relative;} +--> +</style> +<script language="JavaScript1.2"> +<!-- + +var ie=document.all; +var nn6=document.getElementById&&!document.all; + +var isdrag=false; +var x,y; +var dobj; + +function movemouse(e) +{ + if (isdrag) + { + if (e && e.clientX) + { + dobj.style.left = tx + e.clientX - x; + dobj.style.top = ty + e.clientY - y + } + else + { + dobj.style.left = tx + event.clientX - x; + dobj.style.top = ty + event.clientY - y; + } + return false; + } +} + +function selectmouse(e) +{ + var fobj; + var topelement; + if (e && e.target) + { + fobj = e.target; + topelement = "HTML"; + } + else + { + fobj = event.srcElement; + topelement = "BODY"; + } + + while (fobj.tagName != topelement && fobj.className != "dragme") + { + if (fobj.parentNode) + { + fobj = fobj.parentNode; + } + else + { + fobj = fobj.parentElement; + } + } + + if (fobj.className=="dragme") + { + isdrag = true; + dobj = fobj; + tx = parseInt(dobj.style.left+0); + ty = parseInt(dobj.style.top+0); + if (e && e.clientX) + { + x = e.clientX; + y = e.clientY; + } + else + { + x = event.clientX; + y = event.clientY; + } + + document.onmousemove=movemouse; + return false; + } +} + +document.onmousedown=selectmouse; +document.onmouseup=new Function("isdrag=false"); + +//--> +</script> + + + +<img src="icon.gif" class="dragme" id="test1"><br> +<img src="icon.gif" class="dragme" id="test2"><br> +<b>"Hi there</b> +<div style="position: absolute; left: 210px; top: 80px; height: 400px; width: 100px; padding: 10em;"> +<img src="icon.gif" class="dragme" id="test3"><br> +<img src="icon.gif" class="dragme" id="test4"><br> +</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/dragDropOverflow.html b/node_modules/selenium-webdriver/lib/test/data/dragDropOverflow.html new file mode 100644 index 000000000..ecb25625d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/dragDropOverflow.html @@ -0,0 +1,104 @@ +<html> +<head> + <meta content="text/html; charset=UTF-8" http-equiv="content-type"> + <style type="text/css"> + body { + color: #222; + font-size: 13px; + } + + .time-slot { + height: 47px; + vertical-align: top; + border-top: 1px solid #ddd; + padding-right: 2px; + z-index: 2; + } + + #time-marker { + border-top: 3px solid #4d90fe; + height: 6px; + position: absolute; + width: 100%; + z-index: 4; + cursor: row-resize; + } + </style> +</head> +<body> +<div style="position: absolute; overflow: hidden; width: 250px; height: 470px;"> + <div style="position: relative;"> + <div style="overflow: auto; position: relative; height: 85%; border: 1px solid #ebebeb"> + <div id="time-marker" style="top: 432;"></div> + <div class="time-slot">12am</div> + <div class="time-slot">1am</div> + <div class="time-slot">2am</div> + <div class="time-slot">3am</div> + <div class="time-slot">4am</div> + <div class="time-slot">5am</div> + <div class="time-slot">6am</div> + <div class="time-slot">7am</div> + <div class="time-slot">8am</div> + <div class="time-slot">9am</div> + <div class="time-slot">10am</div> + <div id="11am" class="time-slot">11am</div> + <div class="time-slot">12pm</div> + <div class="time-slot">1pm</div> + <div class="time-slot">2pm</div> + <div class="time-slot">3pm</div> + <div class="time-slot">4pm</div> + <div class="time-slot">5pm</div> + <div class="time-slot">6pm</div> + <div class="time-slot">7pm</div> + <div class="time-slot">8pm</div> + <div class="time-slot">9pm</div> + <div class="time-slot">10pm</div> + <div class="time-slot">11pm</div> + </div> + </div> +</div> +<script type="text/javascript"> + var startTime = document.getElementById('time-marker'); + + var ie = document.all; + var nn6 = document.getElementById && !document.all; + + var isDrag = false; + var x, y, tx, ty; + var dragEl; + + function movemouse(e) { + if (isDrag) { + var dy = (nn6 ? e.clientY - y : event.clientY - y); + if (dy % 12 == 0) { + dragEl.style.top = ty + dy; + } + return false; + } + } + + function selectmouse(e) { + var srcEl = nn6 ? e.target : event.srcElement; + var topElement = nn6 ? "HTML" : "BODY"; + + while (srcEl.tagName != topElement && srcEl != startTime) { + srcEl = nn6 ? srcEl.parentNode : srcEl.parentElement; + } + + if (srcEl === startTime) { + isDrag = true; + dragEl = srcEl; + tx = parseInt(dragEl.style.left + 0); + ty = parseInt(dragEl.style.top + 0); + x = nn6 ? e.clientX : event.clientX; + y = nn6 ? e.clientY : event.clientY; + document.onmousemove = movemouse; + return false; + } + } + + document.onmousedown = selectmouse; + document.onmouseup = function() { isDrag = false; }; +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/draggableLists.html b/node_modules/selenium-webdriver/lib/test/data/draggableLists.html new file mode 100644 index 000000000..f7e0dcace --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/draggableLists.html @@ -0,0 +1,67 @@ +<!DOCTYPE html> +<html lang="en"> + <head> + <meta charset="UTF-8" /> + <title>jQuery UI Sortable - Connect lists</title> + <!--link type="text/css" href="development-bundle/themes/base/jquery.ui.all.css" rel="stylesheet" /--> + <!--link type="text/css" href="development-bundle/demos/demos.css" rel="stylesheet" /--> + <link type="text/css" href="css/ui-lightness/jquery-ui-1.8.10.custom.css" rel="stylesheet" /> + <script type="text/javascript" src="js/jquery-1.4.4.min.js"></script> + <script type="text/javascript" src="js/jquery-ui-1.8.10.custom.min.js"></script> + <style type="text/css"> + #sortable1, #sortable2 { list-style-type: none; margin: 0; padding: 0; float: left; margin-right: 10px; } + #sortable1 li, #sortable2 li { margin: 0 5px 5px 5px; padding: 5px; font-size: 1.2em; width: 120px; } + </style> + <script type="text/javascript"> + $(function() { + $("#sortable1, #sortable2").sortable({ + connectWith: '.connectedSortable' + }).disableSelection(); + + var report_event = function(report_text) { + var reportElement = $("#dragging_reports"); + var origText = reportElement.text(); + reportElement.text(origText + " " + report_text); + } + + $("#sortable2").droppable({ + out: function(event, ui) { + report_event("DragOut"); + } + }); + + $("#sortable1").droppable({ + drop: function(event, ui) { + report_event("DropIn " + ui.draggable.text()); + } + }); + }); + </script> + </head> + <body> + <div class="demo"> + <ul id="sortable1" class="connectedSortable"> + <li id="leftitem-1" class="ui-state-default">LeftItem 1</li> + <li id="leftitem-2" class="ui-state-default">LeftItem 2</li> + <li id="leftitem-3" class="ui-state-default">LeftItem 3</li> + <li id="leftitem-4" class="ui-state-default">LeftItem 4</li> + <li id="leftitem-5" class="ui-state-default">LeftItem 5</li> + </ul> + + <ul id="sortable2" class="connectedSortable"> + <li id="rightitem-1" class="ui-state-highlight">RightItem 1</li> + <li id="rightitem-2" class="ui-state-highlight">RightItem 2</li> + <li id="rightitem-3" class="ui-state-highlight">RightItem 3</li> + <li id="rightitem-4" class="ui-state-highlight">RightItem 4</li> + <li id="rightitem-5" class="ui-state-highlight">RightItem 5</li> + </ul> + + </div> + + <br/> + <div class="test-data"> + <p id="dragging_reports">Nothing happened.</p> + </div> + + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/droppableItems.html b/node_modules/selenium-webdriver/lib/test/data/droppableItems.html new file mode 100644 index 000000000..fc850ac96 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/droppableItems.html @@ -0,0 +1,65 @@ +<!DOCTYPE html> +<html lang="en"> +<head> + <meta charset="UTF-8" /> + <title>jQuery UI Droppable - Default Demo</title> + <link type="text/css" href="css/ui-lightness/jquery-ui-1.8.10.custom.css" rel="stylesheet" /> + <script type="text/javascript" src="js/jquery-1.4.4.min.js"></script> + <script type="text/javascript" src="js/jquery-ui-1.8.10.custom.min.js"></script> + <style type="text/css"> + #draggable { width: 100px; height: 100px; padding: 0.5em; float: left; margin: 10px 10px 10px 0; } + #droppable { width: 150px; height: 150px; padding: 0.5em; float: left; margin: 10px; } + </style> + <script type="text/javascript"> + $(function() { + $("#draggable").draggable(); + $("#droppable").droppable({ + drop: function(event, ui) { + $(this).addClass('ui-state-highlight').find('p').html('Dropped!'); + } + }); + + var report_event = function(report_text) { + var reportElement = $("#drop_reports"); + var origText = reportElement.text(); + reportElement.text(origText + " " + report_text); + } + + $('body').mousedown(function() { + report_event('down'); + }); + + $('body').mousemove(function() { + report_event('move'); + }); + + $('body').mouseup(function() { + report_event('up'); + }); + }); + </script> +</head> +<body> +<div class="demo"> + +<div id="draggable" class="ui-widget-content"> + <p>Drag me to my target</p> +</div> + +<div id="droppable" class="ui-widget-header"> + <p>Drop here</p> +</div> + +<div class="test-data"> + <p id="drop_reports">start</p> +</div> + +</div><!-- End demo --> + +<div class="demo-description"> + +<p>Taken from the JQuery demo.</p> + +</div><!-- End demo-description --> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/dynamic.html b/node_modules/selenium-webdriver/lib/test/data/dynamic.html new file mode 100644 index 000000000..b9e60678d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/dynamic.html @@ -0,0 +1,39 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" + "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <title></title> + <script type="text/javascript"> + var next = 0; + + function addMore() { + var box = document.createElement('DIV'); + box.id = 'box' + next++; + box.className = 'redbox'; + box.style.width = '150px'; + box.style.height = '150px'; + box.style.backgroundColor = 'red'; + box.style.border = '1px solid black'; + box.style.margin = '5px'; + + window.setTimeout(function() { + document.body.appendChild(box); + }, 1000); + } + + function reveal() { + var elem = document.getElementById('revealed'); + window.setTimeout(function() { + elem.style.display = ''; + }, 1000); + } + </script> + </head> + <body> + <input id="adder" type="button" value="Add a box!" onclick="addMore()"/> + + <input id="reveal" type="button" value="Reveal a new input" onclick="reveal();" /> + + <input id="revealed" style="display:none;" /> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/dynamicallyModifiedPage.html b/node_modules/selenium-webdriver/lib/test/data/dynamicallyModifiedPage.html new file mode 100644 index 000000000..ed7c7ed2b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/dynamicallyModifiedPage.html @@ -0,0 +1,42 @@ +<?xml version="1.0"> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> + <head> + <title>Delayed remove of an element</title> + + <script type="text/javascript"> + + var parentNode; + var elementId; + + function timedRemove() + { + var t = setTimeout('removeElement()', 500); + t = setTimeout('insertElement()', 2000); + } + + function removeElement() + { + var element = document.getElementById('element-to-remove'); + elementId = element.id; + parentNode = element.parentNode; + parentNode.removeChild(element); + } + + function insertElement() + { + var newElement = document.createElement('p'); + newElement.setAttribute('id', elementId); + newElement.innerHTML = 'new element'; + parentNode.appendChild(newElement); + } + </script> + + </head> + <body> + <form> + <input id="buttonDelete" type="button" value="element will be removed in half a second" + onclick="timedRemove()"/> + </form> + <p id="element-to-remove">element</p> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/errors.html b/node_modules/selenium-webdriver/lib/test/data/errors.html new file mode 100644 index 000000000..78fb90207 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/errors.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<html> + <head> + <script type="text/javascript"> + window.ERRORS = []; + + window.onerror = function(e) { + window.ERRORS.push(e); + }; + </script> + </head> + <body> + <input type="button" value="Throw!" onclick="throw Error('boom!');"/> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/firefox/jetpack-sample.xpi b/node_modules/selenium-webdriver/lib/test/data/firefox/jetpack-sample.xpi Binary files differnew file mode 100644 index 000000000..84d6493dd --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/firefox/jetpack-sample.xpi diff --git a/node_modules/selenium-webdriver/lib/test/data/firefox/sample.xpi b/node_modules/selenium-webdriver/lib/test/data/firefox/sample.xpi Binary files differnew file mode 100644 index 000000000..062f9a172 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/firefox/sample.xpi diff --git a/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScroll.html b/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScroll.html new file mode 100644 index 000000000..ca65d1fee --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScroll.html @@ -0,0 +1,13 @@ +<!DOCTYPE html> +<html> +<head> + <title>Fixed footer with no scrollbar</title> +</head> +<body> + <div style="width: 100%; min-height: 100%;"> + <div style="position: absolute; bottom: 0px;"> + <a id="link" href="xhtmlTest.html">Click me</a> + </div> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScrollQuirksMode.html b/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScrollQuirksMode.html new file mode 100644 index 000000000..2593bf35c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/fixedFooterNoScrollQuirksMode.html @@ -0,0 +1,12 @@ +<html> +<head> + <title>Fixed footer with no scrollbar</title> +</head> +<body> + <div style="width: 100%; min-height: 100%;"> + <div style="position: absolute; bottom: 0px;"> + <a id="link" href="xhtmlTest.html">Click me</a> + </div> + </div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/formPage.html b/node_modules/selenium-webdriver/lib/test/data/formPage.html new file mode 100644 index 000000000..7bcfea00f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/formPage.html @@ -0,0 +1,174 @@ +<html> +<head> + <title>We Leave From Here</title> + + <script type="text/javascript"> + function changePage() { + var newLocation = '/common/page/3'; + window.location = newLocation; + } + </script> +</head> +<body> +There should be a form here: + +<form method="get" action="resultPage.html" name="login"> + <input type="email" id="email"/> + <input type="number" id="age"/> + <input type="submit" id="submitButton" value="Hello there"/> +</form> + +<form method="get" action="resultPage.html" name="image"> + <input type="image" id="imageButton" alt="click me!" src="images/button.gif"/> +</form> + +<form method="get" action="resultPage.html" name="optional" style="display: block"> + Here's a checkbox: + <input type="checkbox" id="checky" name="checky" value="furrfu"/> + <input type="checkbox" id="checkedchecky" name="checkedchecky" checked="checked" /> + <input type="checkbox" id="disabledchecky" disabled="disabled" name="disabledchecky" /> + <input type="checkbox" id="randomly_disabled_checky" disabled="somerandomstring" checked="checked" name="randomlydisabledchecky" /> + <br/> + <select name="selectomatic"> + <option selected="selected" id="non_multi_option" value="one">One</option> + <option value="two">Two</option> + <option value="four">Four</option> + <option value="still learning how to count, apparently">Still learning how to count, apparently</option> + </select> + + <select name="multi" id="multi" multiple="multiple"> + <option selected="selected" value="eggs">Eggs</option> + <option value="ham">Ham</option> + <option selected="selected" value="sausages">Sausages</option> + <option value="onion gravy">Onion gravy</option> + </select> + + <select name="no-select" disabled="disabled"> + <option value="foo">Foo</option> + </select> + + <select name="select_empty_multiple" multiple> + <option id="multi_1" value="select_1">select_1</option> + <option id="multi_2" value="select_2">select_2</option> + <option id="multi_3" value="select_3">select_3</option> + <option id="multi_4" value="select_4">select_4</option> + </select> + + <select name="multi_true" multiple="true"> + <option id="multi_true_1" value="select_1">select_1</option> + <option id="multi_true_2" value="select_2">select_2</option> + </select> + + <select name="multi_false" multiple="false"> + <option id="multi_false_1" value="select_1">select_1</option> + <option id="multi_false_2" value="select_2">select_2</option> + </select> + + <select id="invisi_select" style="opacity:0;"> + <option selected value="apples">Apples</option> + <option value="oranges">Oranges</option> + </select> + + <select name="select-default"> + <option>One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> + + <select name="select_with_spaces"> + <option>One</option> + <option> Two </option> + <option> + Four + </option> + <option> + Still learning how to count, + apparently + </option> + </select> + + <select> + <option id="blankOption"></option> + <option id="optionEmptyValueSet" value="">nothing</option> + </select> + + <br/> + + <input type="radio" id="cheese" name="snack" value="cheese"/>Cheese<br/> + <input type="radio" id="peas" name="snack" value="peas"/>Peas<br/> + <input type="radio" id="cheese_and_peas" name="snack" value="cheese and peas" checked/>Cheese and peas<br/> + <input type="radio" id="nothing" name="snack" value="nowt" disabled="disabled"/>Not a sausage<br/> + <input type="radio" id="randomly_disabled_nothing" name="snack" value="funny nowt" disabled="somedisablingstring"/>Not another sausage + + <input type="hidden" name="hidden" value="fromage" /> + + <p id="cheeseLiker">I like cheese</p> + <input type="submit" value="Click!"/> + + <input type="radio" id="lone_disabled_selected_radio" name="not_a_snack" value="cumberland" checked="checked" disabled="disabled" />Cumberland sausage +</form> + +<form method="get" action="resultPage.html" name="disable"> + <input type="text" id="working"/> + <input type="text" id="notWorking" disabled="true"/> + + <textarea id="notWorkingArea" disabled="disabled" cols="5" rows="5"></textarea> + + <input type="text" id="inputWithText" value="Example text"/> + <textarea id="withText" rows="5" cols="5">Example text</textarea> + <textarea id="emptyTextArea" rows="5" cols="5"></textarea> +</form> + +<form method="post" action="resultPage.html"> + <select id="redirect" name="redirect" onchange="javascript:changePage();"> + <option selected="selected" value="one">One</option> + <option id="changeme" value="two">Two</option> + </select> + + <input id="no-type" /> + <input type="file" id="upload" onchange="document.getElementById('fileResults').innerHTML = 'changed';" /> + <span id="fileResults"></span> + + <input type="submit" /> +</form> + +<form method="get" action="resultPage.html"> + <input type="text" value="name" name="id-name1"/> + <input type="text" value="id" id="id-name1"/> + + <!-- Reverse the ordering --> + <input type="text" value="id" id="id-name2"/> + <input type="text" value="name" name="id-name2"/> + <input name="readonly" readonly="readonly" /> +</form> + +<!-- form with nested children --> +<form method="get" action="resultPage.html" id="nested_form"> + <div> + <input type="text" value="name" name="x"/> + </div> + <input type="submit" /> +</form> + +<!-- Form with disabled form elements --> +<form method="get" action="xhtmlTest.html"> + <p> + <input type="text" id="disabledTextElement1" disabled="foo" /> + <input type="text" id="disabledTextElement2" disabled="" /> + <input type="submit" id="disabledSubmitElement" disabled="qwerty" value="Submit" /> + </p> +</form> +<!-- Empty div to test GetAttribute --> +<div id="wallace" class="gromit"></div> + +<input type='button' id='killIframe' onclick='top.remove();' value="Kill containing iframe" /> + +<form method="get" action="formPage.html"> + <p> + <label for="checkbox-with-label" id="label-for-checkbox-with-label">Label</label><input type="checkbox" id="checkbox-with-label" /> + </p> +</form> +<input id="vsearchGadget" name="SearchableText" type="text" size="18" value="" title="Hvad søger du?" accesskey="4" class="inputLabel" /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/formSelectionPage.html b/node_modules/selenium-webdriver/lib/test/data/formSelectionPage.html new file mode 100644 index 000000000..4890c08e8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/formSelectionPage.html @@ -0,0 +1,46 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Testing Typing into body</title> + <script type="text/javascript"> + function setMessage(message) { + document.getElementById('result').innerHTML = message; + } + + function showSelected() { + var selectElement = document.getElementById('multi'); + if (selectElement == null) { + appendMessage("null!"); + } + + var options_array = selectElement.getElementsByTagName('option'); + var selected_cheese = ""; + for (var i = 0; i < options_array.length; i++) { + if (options_array[i].selected) { + selected_cheese = selected_cheese + options_array[i].label + " "; + } + } + setMessage(selected_cheese); + } + </script> +</head> + +<body> + <h1>Type Stuff</h1> + + <div id="result"> + + </div> + + <form action="" id="on-form" name="multichoice"> + <select name="multi" id="multi" multiple="multiple"> + <option selected="selected" label="emmental">Emmental</option> + <option label="roquefort" >Roquefort</option> + <option label="parmigiano">Parmigiano</option> + <option label="cheddar">Cheddar</option> + </select> + </form> + + <input type="button" name="showselected" onclick="showSelected()" value="Show selected"/> +</body> + diff --git a/node_modules/selenium-webdriver/lib/test/data/form_handling_js_submit.html b/node_modules/selenium-webdriver/lib/test/data/form_handling_js_submit.html new file mode 100644 index 000000000..302314392 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/form_handling_js_submit.html @@ -0,0 +1,30 @@ +<!-- + ~ Copyright 2012 Selenium committers + ~ Copyright 2012 Software Freedom Conservancy + ~ + ~ Licensed under the Apache License, Version 2.0 (the "License"); + ~ you may not use this file except in compliance with the License. + ~ You may obtain a copy of the License at + ~ + ~ http://www.apache.org/licenses/LICENSE-2.0 + ~ + ~ Unless required by applicable law or agreed to in writing, software + ~ distributed under the License is distributed on an "AS IS" BASIS, + ~ WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied. + ~ See the License for the specific language governing permissions and + ~ limitations under the License. + --> + +<!DOCTYPE html> +<html> +<head> + <title>Form with JS action</title> +</head> +<body> + <form id="theForm" method="get" action="javascript:alert('Tasty cheese');"> + <input name="unused" type="submit"> + </form> + + <p id="result"></p> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/framePage3.html b/node_modules/selenium-webdriver/lib/test/data/framePage3.html new file mode 100644 index 000000000..3e62e455c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/framePage3.html @@ -0,0 +1,7 @@ +<html> + <head> + <title>inner</title> + </head> + <body> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/frameScrollChild.html b/node_modules/selenium-webdriver/lib/test/data/frameScrollChild.html new file mode 100644 index 000000000..3eb3bf47d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frameScrollChild.html @@ -0,0 +1,26 @@ +<!DOCTYPE html> +<html> +<head> + <title>Child frame</title> +</head> +<body> + <h1>This is a scrolling frame test</h1> + <div> + <table> + <tr height="50px"> + <td>First row</td> + </tr> + <tr height="50px"> + <td>Second row</td> + </tr> + <tr height="50px"> + <td>Third row</td> + </tr> + <tr height="50px"> + <td>Fourth row</td> + </tr> + </table> + </div> + <input type='checkbox' name='scroll_checkbox' /> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/frameScrollPage.html b/node_modules/selenium-webdriver/lib/test/data/frameScrollPage.html new file mode 100644 index 000000000..b7fb8f242 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frameScrollPage.html @@ -0,0 +1,14 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="scrolling_child_frame" src="frameScrollParent.html" width="800" height="200"></iframe> + </div> + <div> + <iframe name="scrolling_frame" src="frameScrollChild.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frameScrollParent.html b/node_modules/selenium-webdriver/lib/test/data/frameScrollParent.html new file mode 100644 index 000000000..8fccb6d36 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frameScrollParent.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="scrolling_frame" src="frameScrollChild.html" width="600" height="500"></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frameWithAnimals.html b/node_modules/selenium-webdriver/lib/test/data/frameWithAnimals.html new file mode 100644 index 000000000..1e0dc8704 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frameWithAnimals.html @@ -0,0 +1,11 @@ +<html> +<head> + <title>This page has iframes</title> +</head> +<body> +<h1 id="iframe_page_heading">This is the heading</h1> + +<iframe src="animals" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" + frameborder="0" height="600" scrolling="no" width="120" id="iframe1" name="iframe1-name" /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876.html b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876.html new file mode 100644 index 000000000..4ed597d37 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> +<title>Test issue 4876</title> +</head> +<body> +<iframe id="iframe" src="bug4876_iframe.html"></iframe> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876_iframe.html b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876_iframe.html new file mode 100644 index 000000000..57d47d845 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/bug4876_iframe.html @@ -0,0 +1,9 @@ +<html> + <head></head> + <body> + <form > + <input type="text" id="inputText" /> + <input type="submit" id="submitButton" value="submit" onclick="window.location=window.location;" /> + <form> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame.html b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame.html new file mode 100644 index 000000000..9c27e04c4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame.html @@ -0,0 +1,29 @@ +<html> +<head> + <title>Deleting frame: main page</title> +</head> + <script type="text/javascript"> + function remove() { + var iframe = document.getElementById("iframe1"); + var myDiv = document.getElementById("myDiv"); + myDiv.removeChild(iframe); + } + function addBack() { + var iframe = '<iframe src="deletingFrame_iframe2.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" frameborder="0" height="200" scrolling="no" width="400" id="iframe1"></iframe>'; + var myDiv2 = document.getElementById("myDiv2"); + myDiv2.innerHTML = iframe; + } + </script> +<body> + +<div id='myDiv'> +<iframe src="deletingFrame_iframe.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" + frameborder="1" height="200" scrolling="no" width="400" id="iframe1"></iframe> + + </div> +<div id='myDiv2'> + +</div> +<input type='button' id='addBackFrame' value='Add back frame' onclick='addBack();' /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe.html b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe.html new file mode 100644 index 000000000..e4b9723e9 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>Deleting frame: iframe</title> +</head> +<body> +<input type='button' id='killIframe' onclick='top.remove();' value="Kill containing iframe" /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe2.html b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe2.html new file mode 100644 index 000000000..47764eb3e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frame_switching_tests/deletingFrame_iframe2.html @@ -0,0 +1,7 @@ +<html> +<head> + <title>Deleting frame: iframe 2</title> +</head> +<body> +<div id="success">Added back</div></body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/frameset.html b/node_modules/selenium-webdriver/lib/test/data/frameset.html new file mode 100644 index 000000000..039c5f217 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/frameset.html @@ -0,0 +1,14 @@ +<html> + <head> + <title>Unique title</title> + </head> +<frameset cols="*, *, *, *, *, *, *"> + <frame name="first" src="page/1"/> + <frame name="second" src="page/2?title=Fish"/> + <frame name="third" src="formPage.html"/> + <frame name="fourth" src="framesetPage2.html"/> + <frame id="fifth" src="xhtmlTest.html"/> + <frame id="sixth" src="iframes.html"/> + <frame id="sixth.iframe1" src="page/3"/> +</frameset> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/framesetPage2.html b/node_modules/selenium-webdriver/lib/test/data/framesetPage2.html new file mode 100644 index 000000000..4ea35ff71 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/framesetPage2.html @@ -0,0 +1,7 @@ +<html> +<head></head> +<frameset cols="*, *"> + <frame name="child1" src="page/10"/> + <frame name="child2" src="page/11"/> +</frameset> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/framesetPage3.html b/node_modules/selenium-webdriver/lib/test/data/framesetPage3.html new file mode 100644 index 000000000..42a93007f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/framesetPage3.html @@ -0,0 +1,4 @@ +<frameset> + <frame src="framePage3.html" id="first"></frame> + <frame src="framePage3.html" id="second"></frame> +</frameset>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/globalscope.html b/node_modules/selenium-webdriver/lib/test/data/globalscope.html new file mode 100644 index 000000000..e4ca97ab7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/globalscope.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<html> + <head> + <title>Global scope</title> + <script type="text/javascript"> + window.w = "w"; + window.h = "h"; + window.__webdriver_w = "__webdriver_w"; + window.__webdriver_h = "__webdriver_h"; + </script> + </head> + <body> + <div style="position: absolute; left: 10px; top: 10px; height: 10px; width: 10px; background-color: blue;" id="toclick"></div> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/hidden.html b/node_modules/selenium-webdriver/lib/test/data/hidden.html new file mode 100644 index 000000000..0e8097e97 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/hidden.html @@ -0,0 +1,5 @@ +<!DOCTYPE html> +<div id='singleHidden' hidden>This will not be visible</div> +<div id='parent' hidden> + <div id='child'>My parent is hidden so you can't see me</div> +</div>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/hidden_partially.html b/node_modules/selenium-webdriver/lib/test/data/hidden_partially.html new file mode 100644 index 000000000..f0f9fe5b8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/hidden_partially.html @@ -0,0 +1,45 @@ +<!DOCTYPE html> +<html> + <head> + <title></title> + <script type="text/javascript"> + var next = 0; + + function addVisibleBox() { + var box = document.createElement('DIV'); + box.id = 'box' + next++; + box.className = 'redbox'; + box.style.width = '150px'; + box.style.height = '150px'; + box.style.backgroundColor = 'red'; + box.style.border = '1px solid black'; + box.style.margin = '5px'; + box.style.visibility = 'visible' + + window.setTimeout(function() { + document.body.appendChild(box); + }, 1000); + } + + function addHiddenBox() { + var box = document.createElement('DIV'); + box.id = 'box' + next++; + box.className = 'redbox'; + box.style.width = '150px'; + box.style.height = '150px'; + box.style.backgroundColor = 'red'; + box.style.border = '1px solid black'; + box.style.margin = '5px'; + box.style.visibility = 'hidden'; + + window.setTimeout(function() { + document.body.appendChild(box); + }, 1000); + } + </script> + </head> + <body> + <input id="addVisible" type="button" value="Add a visible box!" onclick="addVisibleBox()"/> + <input id="addHidden" type="button" value="Add a hidden box!" onclick="addHiddenBox();" /> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/blue.jpg b/node_modules/selenium-webdriver/lib/test/data/html5/blue.jpg Binary files differnew file mode 100644 index 000000000..8ea27c42f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/blue.jpg diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/database.js b/node_modules/selenium-webdriver/lib/test/data/html5/database.js new file mode 100644 index 000000000..c6333be8c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/database.js @@ -0,0 +1,84 @@ +var database={}; +database.db={}; + +database.onError = function(tx, e) { + var log = document.createElement('div'); + log.setAttribute('name','error'); + log.setAttribute('style','background-color:red'); + log.innerText = e.message; + document.getElementById('logs').appendChild(log); +} + +database.onSuccess = function(tx, r) { + if (r.rows.length) { + var ol; + for (var i = 0; i < r.rows.length; i++) { + ol = document.createElement('ol'); + ol.innerHTML = r.rows.item(i).ID + ": " + r.rows.item(i).docname + " (" + r.rows.item(i).created + ")"; + document.getElementById('logs').appendChild(ol); + } + + } +} + +database.open=function(){ + database.db=openDatabase('HTML5', '1.0', 'Offline document storage', 100*1024); +} + +database.create=function(){ + database.db.transaction(function(tx) { + tx.executeSql("CREATE TABLE IF NOT EXISTS docs(ID INTEGER PRIMARY KEY ASC, docname TEXT, created TIMESTAMP DEFAULT CURRENT_TIMESTAMP)", + [], + database.onSuccess, + database.onError); + });} + +database.add = function(message) { + database.db.transaction(function(tx){ + tx.executeSql("INSERT INTO docs(docname) VALUES (?)", + [message], database.onSuccess, database.onError); + }); +} + +database.selectAll = function() { + database.db.transaction(function(tx) { + tx.executeSql("SELECT * FROM docs", [], database.onSuccess, + database.onError); + }); +} + +database.onDeleteAllSuccess = function(tx, r) { + var doc = document.documentElement; + var db_completed = document.createElement("div"); + db_completed.setAttribute("id", "db_completed"); + db_completed.innerText = "db operation completed"; + doc.appendChild(db_completed); +} + +database.deleteAll = function() { + database.db.transaction(function(tx) { + tx.executeSql("delete from docs", [], database.onDeleteAllSuccess, + database.onError); + }); +} + +var log = document.createElement('div'); +log.setAttribute('name','notice'); +log.setAttribute('style','background-color:yellow'); +log.innerText = typeof window.openDatabase == "function" ? "Web Database is supported." : "Web Database is not supported."; +document.getElementById('logs').appendChild(log); + +try { + database.open(); + database.create(); + database.add('Doc 1'); + database.add('Doc 2'); + database.selectAll(); + database.deleteAll(); +} catch(error) { + var log = document.createElement('div'); + log.setAttribute('name','critical'); + log.setAttribute('style','background-color:pink'); + log.innerText = error; + document.getElementById('logs').appendChild(log); +} diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/geolocation.js b/node_modules/selenium-webdriver/lib/test/data/html5/geolocation.js new file mode 100644 index 000000000..f07af148e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/geolocation.js @@ -0,0 +1,18 @@ +function success(position) { + var message = document.getElementById("status"); + message.innerHTML ="<img src='http://maps.google.com/maps/api/staticmap?center=" + position.coords.latitude + "," + position.coords.longitude + "&size=300x200&maptype=roadmap&zoom=12&&markers=size:mid|color:red|" + position.coords.latitude + "," + position.coords.longitude + "&sensor=false' />"; + message.innerHTML += "<p>Longitude: " + position.coords.longitude + "</p>"; + message.innerHTML += "<p>Latitude: " + position.coords.latitude + "</p>"; + message.innerHTML += "<p>Altitude: " + position.coords.altitude + "</p>"; +} + +function error(msg) { + var message = document.getElementById("status"); + message.innerHTML = "Failed to get geolocation."; +} + +if (navigator.geolocation) { + navigator.geolocation.getCurrentPosition(success, error); +} else { + error('Geolocation is not supported.'); +}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/green.jpg b/node_modules/selenium-webdriver/lib/test/data/html5/green.jpg Binary files differnew file mode 100644 index 000000000..6a0d3bea4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/green.jpg diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/red.jpg b/node_modules/selenium-webdriver/lib/test/data/html5/red.jpg Binary files differnew file mode 100644 index 000000000..f296e2719 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/red.jpg diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/status.html b/node_modules/selenium-webdriver/lib/test/data/html5/status.html new file mode 100644 index 000000000..394116a52 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/status.html @@ -0,0 +1 @@ +<html><head><title>Online</title></head><body></body></html> diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/test.appcache b/node_modules/selenium-webdriver/lib/test/data/html5/test.appcache new file mode 100644 index 000000000..3bc4e0025 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/test.appcache @@ -0,0 +1,11 @@ +CACHE MANIFEST + +CACHE: +# Additional items to cache. +yellow.jpg +red.jpg +blue.jpg +green.jpg + +FALLBACK: +status.html offline.html diff --git a/node_modules/selenium-webdriver/lib/test/data/html5/yellow.jpg b/node_modules/selenium-webdriver/lib/test/data/html5/yellow.jpg Binary files differnew file mode 100644 index 000000000..7c609b371 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5/yellow.jpg diff --git a/node_modules/selenium-webdriver/lib/test/data/html5Page.html b/node_modules/selenium-webdriver/lib/test/data/html5Page.html new file mode 100644 index 000000000..355ddc3a1 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/html5Page.html @@ -0,0 +1,32 @@ +<html manifest="html5/test.appcache"> +<head> +<title>HTML5</title> +</head> +<body> + +<h3>Geolocation Test</h3> +<div id="status">Location unknown</div> +<script language="javascript" type="text/javascript" src="html5/geolocation.js"></script> + +<h3>Web SQL Database Test</h3> +<div id="logs"></div> +<script language="javascript" type="text/javascript" src="html5/database.js"></script> + +<h3>Application Cache Test</h3> +<div id="images"> + <p>Current network status: <span id="state"></span></p> + <script> + var state = document.getElementById('state') + setInterval(function () { + state.className = navigator.onLine ? 'online' : 'offline'; + state.innerHTML = navigator.onLine ? 'online' : 'offline'; + }, 250); + </script> + <img id="red" src="html5/red.jpg"> + <img id="blue" src="html5/blue.jpg"> + <img id="green" src="html5/green.jpg"> + <img id="yellow" src="html5/yellow.jpg"> +</div> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/icon.gif b/node_modules/selenium-webdriver/lib/test/data/icon.gif Binary files differnew file mode 100644 index 000000000..bb9946192 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/icon.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/idElements.html b/node_modules/selenium-webdriver/lib/test/data/idElements.html new file mode 100644 index 000000000..47f0834ca --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/idElements.html @@ -0,0 +1,2 @@ +<!DOCTYPE html> +<div id="with.dots">Element with a dot in the id</div> diff --git a/node_modules/selenium-webdriver/lib/test/data/iframeAtBottom.html b/node_modules/selenium-webdriver/lib/test/data/iframeAtBottom.html new file mode 100644 index 000000000..a686ba312 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/iframeAtBottom.html @@ -0,0 +1,15 @@ +<html> +<head> + <title>This page has iframes</title> +</head> +<body> +<h1 id="iframe_page_heading">This is the heading</h1> + +<div style="position: fixed; bottom: 0px; right: 0px; width: 150px; height: 150px;"> + <iframe src="dragAndDropTest.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" frameborder="1" height="100" scrolling="no" width="100" id="iframe1" name="iframe1-name" /> +</div> + +</body> +</html> + + diff --git a/node_modules/selenium-webdriver/lib/test/data/iframeWithAlert.html b/node_modules/selenium-webdriver/lib/test/data/iframeWithAlert.html new file mode 100644 index 000000000..bc54ddd58 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/iframeWithAlert.html @@ -0,0 +1 @@ +<a href="#" id="alertInFrame" onclick="alert('framed cheese');">click me</a> diff --git a/node_modules/selenium-webdriver/lib/test/data/iframeWithIframe.html b/node_modules/selenium-webdriver/lib/test/data/iframeWithIframe.html new file mode 100644 index 000000000..b29c54f3c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/iframeWithIframe.html @@ -0,0 +1 @@ +<iframe src="iframeWithAlert.html" name="iframeWithAlert"></iframe> diff --git a/node_modules/selenium-webdriver/lib/test/data/iframes.html b/node_modules/selenium-webdriver/lib/test/data/iframes.html new file mode 100644 index 000000000..e00b482aa --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/iframes.html @@ -0,0 +1,11 @@ +<html> +<head> + <title>This page has iframes</title> +</head> +<body> +<h1 id="iframe_page_heading">This is the heading</h1> + +<iframe src="formPage.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" + frameborder="0" height="600" scrolling="no" width="120" id="iframe1" name="iframe1-name" /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/injectableContent.html b/node_modules/selenium-webdriver/lib/test/data/injectableContent.html new file mode 100644 index 000000000..7248dccf8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/injectableContent.html @@ -0,0 +1,22 @@ +<html> + <head> + <title>random numbers</title> + <script> + function display() { + document.getElementById('numbers').textContent = numbers.join(' '); + } + </script> + </head> + <body onload="display()"> + <p>Some random numbers between 0 and 100:</p> + + <!-- Placeholder for the list of random numbers --> + <p id="numbers"></p> + <script> + numbers = []; + while (numbers.length < 100) { + numbers.push(Math.round(Math.random() * 100)); + } + </script> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/javascriptEnhancedForm.html b/node_modules/selenium-webdriver/lib/test/data/javascriptEnhancedForm.html new file mode 100644 index 000000000..cbcff4335 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/javascriptEnhancedForm.html @@ -0,0 +1,30 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> + +<html> + <head> + <title>Javascript Enhanced Page</title> + </head> + <body> + <form id="form1" action="javascriptEnhancedForm.html" method="post"> + <p> + <label id="labelforusername" for="username"> + Username: <input id="username" type="text" name="username" /> + <script type="text/javascript"> + document.getElementById('username').value = 'Michael'; + </script> + </label> + </p> + <p> + <label for="password"> + Password: <input id="password" type="password" name="password" /> + <script type="text/javascript"> + var z = document.getElementById('password'); setTimeout('try{z.focus();z.select();} catch(e) {}', 1); + </script> + </label> + </p> + <p> + <input type="submit" value="Submit" /> + </p> + </form> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/javascriptPage.html b/node_modules/selenium-webdriver/lib/test/data/javascriptPage.html new file mode 100644 index 000000000..fcac252e8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/javascriptPage.html @@ -0,0 +1,285 @@ +<?xml version="1.0"?> +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.1//EN" "http://www.w3.org/TR/xhtml11/DTD/xhtml11.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Testing Javascript</title> + <script type="text/javascript"> + var seen = {}; + + function updateContent(input) { + document.getElementById('resultParagraph').innerHTML = input.value; + } + + function displayMessage(message) { + document.getElementById('resultParagraph').innerHTML = message; + } + + function appendMessage(message) { + document.getElementById('resultParagraph').innerHTML += message + " "; + } + + function register(message) { + if (!seen[message]) { + appendMessage(message); + seen[message] = true; + } + } + + function delayedShowHide(delay, show) { + var blackBox = document.getElementById('clickToHide'); + window.setTimeout(function() { + blackBox.style.display = show ? '' : 'none'; + }, delay); + } + </script> + <script type="text/javascript"> + var startList = function() { + // Ugh. Let's hope no-one is faking their user agent when running the tests + if (navigator.userAgent.indexOf("MSIE") != -1) { + var navRoot = document.getElementById("nav"); + for (var i = 0; i < navRoot.childNodes.length; i++) { + var node = navRoot.childNodes[i]; + if (node.nodeName == "LI") { + node.onmouseover = function() { + this.className += " over"; + }; + node.onmouseout = function() { + this.className = this.className.replace(" over", ""); + }; + } + } + } + }; + window.onload=startList; + </script> + <style type="text/css"> + #nav { + padding: 0; margin: 0; list-style: none; + } + #nav li { + float: left; position: relative; width: 10em; + } + #nav li ul { + display: none; position: absolute; top: 1em; left: 0; + } + #nav li > ul { top: auto; left: auto; } + #nav li:hover ul, #nav li.over ul{ display: block; background: white; } + </style> +</head> +<body> +<h1>Type Stuff</h1> + +<div> + <ul id="nav"> + <li id="menu1">Menu 1 + <ul> + <li id="item1" onclick="displayMessage('item 1');">Item 1</li> + <li>Item 2</li> + </ul> + </li> + </ul> +</div> + +<div id="resultContainer" height="30"> + <div id="result" style="width:300;height:60"> + <p id="resultParagraph"> </p> + </div> + +</div> + +<div id="formageddon"> + <form action="#"> + Key Up: <input type="text" id="keyUp" onkeyup="javascript:updateContent(this)"/><br/> + Key Down: <input type="text" id="keyDown" onkeydown="javascript:updateContent(this)"/><br/> + Key Press: <input type="text" id="keyPress" onkeypress="javascript:updateContent(this)"/><br/> + Change: <input type="text" id="change" onkeypress="javascript:displayMessage('change')"/><br/> + <textarea id="keyDownArea" onkeydown="javascript:updateContent(this)" rows="2" cols="15"></textarea> + <textarea id="keyPressArea" onkeypress="javascript:updateContent(this)" rows="2" cols="15"></textarea> + <textarea id="keyUpArea" onkeyup="javascript:updateContent(this)" rows="2" cols="15"></textarea> + <select id="selector" onchange="javascript:updateContent(this)"> + <option value="foo">Foo</option> + <option value="bar">Bar</option> + </select> + <select id="selector2" onclick="javascript:updateContent(this)"> + <option value="foo">Foo</option> + <option value="bar">Bar</option> + </select> + <input type="checkbox" id="checkbox" value="checkbox thing" onchange="javascript:updateContent(this)"/> + <input id="clickField" type="text" onclick="document.getElementById('clickField').value='Clicked';" value="Hello"/> + <input id="doubleClickField" type="text" onclick="document.getElementById('doubleClickField').value='Clicked';" ondblclick="document.getElementById('doubleClickField').value='DoubleClicked';" oncontextmenu="document.getElementById('doubleClickField').value='ContextClicked'; return false;" value="DoubleHello"/> + <input id="clearMe" value="Something" onchange="displayMessage('Cleared')"/> + </form> +</div> + +<div> + <p><a href="#" onclick="javascript:document.title='Changed'">Change the page title!</a></p> + + <p><a onclick="javascript:document.title='Changed'" id="nohref">No href</a></p> + + <p><a id="updatediv" href="#" onclick="javascript:document.getElementById('dynamo').innerHTML = 'Fish and chips!';">Update a + div</a></p> +</div> + +<div id="dynamo">What's for dinner?</div> + +<div id="mousedown" onmousedown="javascript:displayMessage('mouse down');"> + <p>Click for the mouse down event</p> + <span><p id="child">Here's some text</p></span> +</div> + +<div id="mouseup" onmouseup="javascript:displayMessage('mouse up');"> + <p>Click for the mouse up event</p> +</div> + +<div id="mouseclick" onclick="javascript:displayMessage('mouse click');"> + <p>Click for the mouse click event</p> +</div> + +<div id="error" onclick="document.getElementById('doesnotexist').innerHTML = 'cheese';"> + Clicking this causes a JS exception in the click handler +</div> + +<div> + <form action="resultPage.html" id="on-form"> + <input id="theworks" + onfocus="appendMessage('focus')" + onkeydown="appendMessage('keydown')" + onkeypress="appendMessage('keypress')" + onkeyup="appendMessage('keyup')" + onblur="appendMessage('blur')" + onchange="appendMessage('change')" + /> + + <input id="changeable" name="changeable" onfocus="appendMessage('focus')" onchange="appendMessage('change')" onblur="appendMessage('blur')"/> + + <button type="button" id="plainButton" + onfocus="appendMessage('focus')" + onkeydown="appendMessage('keydown')" + onkeypress="appendMessage('keypress')" + onkeyup="appendMessage('keyup')" + onblur="appendMessage('blur')" + onclick="appendMessage('click')" + onmousedown="appendMessage('mousedown ')" + onmouseup="appendMessage('mouseup ')" + onmouseover="register('mouseover ')" + onmousemove="register('mousemove ')" + > + <b>Go somewhere</b> + </button> + <button type="submit" id="submittingButton"><emph>submit</emph></button> + <button type="button" id="jsSubmitButton" onclick="javascript:document.getElementById('on-form').submit();">Submitomatic</button> + + <button type="button" id="switchFocus" onclick="document.getElementById('theworks').focus();">Switch focus</button> + <button type="button" onclick="var element = document.getElementById('switchFocus'); var clickEvent = document.createEvent('MouseEvents'); clickEvent.initMouseEvent('click', true, true, null, 0, 0, 0, 0, 0,false, false, false, false, 0, element);element.dispatchEvent(clickEvent);">Do magic</button><br/> + <label id="labelForCheckbox" for="labeledCheckbox" onclick="appendMessage('labelclick')">Toggle checkbox</label><input type="checkbox" id="labeledCheckbox" onclick="appendMessage('chboxclick')"/> + </form> + + <form action="javascriptPage.html" id="submitListeningForm" onsubmit="appendMessage('form-onsubmit '); return false;"> + <p> + <input id="submitListeningForm-text" type="text" onsubmit="appendMessage('text-onsubmit ')" onclick="appendMessage('text-onclick ');" /> + <input id="submitListeningForm-submit" type="submit" onsubmit="appendMessage('submit-onsubmit ')" onclick="appendMessage('submit-onclick ');" /> + </p> + </form> +</div> + +<p id="suppressedParagraph" style="display: none">A paragraph suppressed using CSS display=none</p> + +<div> + <p id="displayed">Displayed</p> + + <form action="#"><input type="hidden" name="hidden" /> </form> + + <p id="none" style="display: none;">Display set to none</p> + + <p id="hidden" style="visibility: hidden;">Hidden</p> + + <div id="hiddenparent" style="height: 2em; display: none;"> + <div id="hiddenchild"> + <a href="#" id="hiddenlink">ok</a> + </div> + </div> + + <div style="visibility: hidden;"> + <span> + <input id="unclickable" /> + <input type="checkbox" id="untogglable" checked="checked" />Check box you can't see + </span> + </div> + + <p id="outer" style="visibility: hidden">A <b id="visibleSubElement" style="visibility: visible">sub-element that is explicitly visible</b> using CSS visibility=visible</p> +</div> + +<div> + <form> + <input type="text" id="keyReporter" size="80" + onkeyup="appendMessage('up: ' + event.keyCode)" + onkeypress="appendMessage('press: ' + event.keyCode)" + onkeydown="displayMessage(''); appendMessage('down: ' + event.keyCode)" /> + <input name="suppress" onkeydown="if (event.preventDefault) event.preventDefault(); event.returnValue = false; return false;" onkeypress="appendMessage('press');"/> + </form> +</div> + +<!-- Used for testing styles --> +<div style="background-color: green;" id="green-parent"> + <p id="style1">This should be greenish</p> + <ul> + <li id="green-item">So should this</li> + <li id="red-item" style="background-color: red;">But this is red</li> + </ul> +</div> + +<a href="#" id="close" onclick="window.close();">Close window</a> + +<div id="delete" onclick="var d = document.getElementById('deleted'); this.removeChild(d);"> + <p id="deleted">I should be deleted when you click my containing div</p> + <p>Whereas, I should not</p> +</div> + +<div> + <span id="hideMe" onclick="this.style.display = 'none';">Click to hide me.</span> +</div> + +<div id="hideOnBlur" tabindex="0" + style="width: 100px; height: 100px; border: 1px solid red" + onblur="appendMessage('blur'); this.style.display = 'none';"> + <div id="hideOnBlurChild" + style="width: 30px; height: 30px; border: 1px solid blue"> + x + </div> + Focusable. Will hide when focus is lost. +</div> + +<div style="margin-top: 10px;"> + Click actions delayed by 3000ms: + <div id="clickToShow" onclick="delayedShowHide(3000, true);" + style="float: left;width: 100px;height:100px;border: 1px solid black;"> + Click to show black box + </div> + <div id="clickToHide" onclick="delayedShowHide(3000, false);" + style="float: left;width: 100px;height:100px;border: 1px solid black; + background-color: black; color: white; display: none;"> + Click to hide black box + </div> + <div style="clear: both"></div> +</div> + +<a id="new_window" onmouseup="window.open('closeable_window.html', 'close_me')" href="#">Click me to open a new window</a> + +<a id="throwing-mouseover" onmouseover="throw new Error()" href="#throwing-mouseover">Mouse over me will throw a JS error</a> + +<div id="parent"> + <span id="movable" onmouseover="var p = document.getElementById('movable'); displayMessage('parent matches? ' + (p != event.relatedTarget));"> + Click on me to show the related target + </span> +</div> + +<div id="zero" style="width:0;height:0"> + <div> + <img src="map.png"> + </div> +</div> + +</body> +</html> + + diff --git a/node_modules/selenium-webdriver/lib/test/data/jquery-1.3.2.js b/node_modules/selenium-webdriver/lib/test/data/jquery-1.3.2.js new file mode 100644 index 000000000..462cde56c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/jquery-1.3.2.js @@ -0,0 +1,4376 @@ +/*! + * jQuery JavaScript Library v1.3.2 + * http://jquery.com/ + * + * Copyright (c) 2009 John Resig + * Dual licensed under the MIT and GPL licenses. + * http://docs.jquery.com/License + * + * Date: 2009-02-19 17:34:21 -0500 (Thu, 19 Feb 2009) + * Revision: 6246 + */ +(function(){ + +var + // Will speed up references to window, and allows munging its name. + window = this, + // Will speed up references to undefined, and allows munging its name. + undefined, + // Map over jQuery in case of overwrite + _jQuery = window.jQuery, + // Map over the $ in case of overwrite + _$ = window.$, + + jQuery = window.jQuery = window.$ = function( selector, context ) { + // The jQuery object is actually just the init constructor 'enhanced' + return new jQuery.fn.init( selector, context ); + }, + + // A simple way to check for HTML strings or ID strings + // (both of which we optimize for) + quickExpr = /^[^<]*(<(.|\s)+>)[^>]*$|^#([\w-]+)$/, + // Is it a simple selector + isSimple = /^.[^:#\[\.,]*$/; + +jQuery.fn = jQuery.prototype = { + init: function( selector, context ) { + // Make sure that a selection was provided + selector = selector || document; + + // Handle $(DOMElement) + if ( selector.nodeType ) { + this[0] = selector; + this.length = 1; + this.context = selector; + return this; + } + // Handle HTML strings + if ( typeof selector === "string" ) { + // Are we dealing with HTML string or an ID? + var match = quickExpr.exec( selector ); + + // Verify a match, and that no context was specified for #id + if ( match && (match[1] || !context) ) { + + // HANDLE: $(html) -> $(array) + if ( match[1] ) + selector = jQuery.clean( [ match[1] ], context ); + + // HANDLE: $("#id") + else { + var elem = document.getElementById( match[3] ); + + // Handle the case where IE and Opera return items + // by name instead of ID + if ( elem && elem.id != match[3] ) + return jQuery().find( selector ); + + // Otherwise, we inject the element directly into the jQuery object + var ret = jQuery( elem || [] ); + ret.context = document; + ret.selector = selector; + return ret; + } + + // HANDLE: $(expr, [context]) + // (which is just equivalent to: $(content).find(expr) + } else + return jQuery( context ).find( selector ); + + // HANDLE: $(function) + // Shortcut for document ready + } else if ( jQuery.isFunction( selector ) ) + return jQuery( document ).ready( selector ); + + // Make sure that old selector state is passed along + if ( selector.selector && selector.context ) { + this.selector = selector.selector; + this.context = selector.context; + } + + return this.setArray(jQuery.isArray( selector ) ? + selector : + jQuery.makeArray(selector)); + }, + + // Start with an empty selector + selector: "", + + // The current version of jQuery being used + jquery: "1.3.2", + + // The number of elements contained in the matched element set + size: function() { + return this.length; + }, + + // Get the Nth element in the matched element set OR + // Get the whole matched element set as a clean array + get: function( num ) { + return num === undefined ? + + // Return a 'clean' array + Array.prototype.slice.call( this ) : + + // Return just the object + this[ num ]; + }, + + // Take an array of elements and push it onto the stack + // (returning the new matched element set) + pushStack: function( elems, name, selector ) { + // Build a new jQuery matched element set + var ret = jQuery( elems ); + + // Add the old object onto the stack (as a reference) + ret.prevObject = this; + + ret.context = this.context; + + if ( name === "find" ) + ret.selector = this.selector + (this.selector ? " " : "") + selector; + else if ( name ) + ret.selector = this.selector + "." + name + "(" + selector + ")"; + + // Return the newly-formed element set + return ret; + }, + + // Force the current matched set of elements to become + // the specified array of elements (destroying the stack in the process) + // You should use pushStack() in order to do this, but maintain the stack + setArray: function( elems ) { + // Resetting the length to 0, then using the native Array push + // is a super-fast way to populate an object with array-like properties + this.length = 0; + Array.prototype.push.apply( this, elems ); + + return this; + }, + + // Execute a callback for every element in the matched set. + // (You can seed the arguments with an array of args, but this is + // only used internally.) + each: function( callback, args ) { + return jQuery.each( this, callback, args ); + }, + + // Determine the position of an element within + // the matched set of elements + index: function( elem ) { + // Locate the position of the desired element + return jQuery.inArray( + // If it receives a jQuery object, the first element is used + elem && elem.jquery ? elem[0] : elem + , this ); + }, + + attr: function( name, value, type ) { + var options = name; + + // Look for the case where we're accessing a style value + if ( typeof name === "string" ) + if ( value === undefined ) + return this[0] && jQuery[ type || "attr" ]( this[0], name ); + + else { + options = {}; + options[ name ] = value; + } + + // Check to see if we're setting style values + return this.each(function(i){ + // Set all the styles + for ( name in options ) + jQuery.attr( + type ? + this.style : + this, + name, jQuery.prop( this, options[ name ], type, i, name ) + ); + }); + }, + + css: function( key, value ) { + // ignore negative width and height values + if ( (key == 'width' || key == 'height') && parseFloat(value) < 0 ) + value = undefined; + return this.attr( key, value, "curCSS" ); + }, + + text: function( text ) { + if ( typeof text !== "object" && text != null ) + return this.empty().append( (this[0] && this[0].ownerDocument || document).createTextNode( text ) ); + + var ret = ""; + + jQuery.each( text || this, function(){ + jQuery.each( this.childNodes, function(){ + if ( this.nodeType != 8 ) + ret += this.nodeType != 1 ? + this.nodeValue : + jQuery.fn.text( [ this ] ); + }); + }); + + return ret; + }, + + wrapAll: function( html ) { + if ( this[0] ) { + // The elements to wrap the target around + var wrap = jQuery( html, this[0].ownerDocument ).clone(); + + if ( this[0].parentNode ) + wrap.insertBefore( this[0] ); + + wrap.map(function(){ + var elem = this; + + while ( elem.firstChild ) + elem = elem.firstChild; + + return elem; + }).append(this); + } + + return this; + }, + + wrapInner: function( html ) { + return this.each(function(){ + jQuery( this ).contents().wrapAll( html ); + }); + }, + + wrap: function( html ) { + return this.each(function(){ + jQuery( this ).wrapAll( html ); + }); + }, + + append: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.appendChild( elem ); + }); + }, + + prepend: function() { + return this.domManip(arguments, true, function(elem){ + if (this.nodeType == 1) + this.insertBefore( elem, this.firstChild ); + }); + }, + + before: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this ); + }); + }, + + after: function() { + return this.domManip(arguments, false, function(elem){ + this.parentNode.insertBefore( elem, this.nextSibling ); + }); + }, + + end: function() { + return this.prevObject || jQuery( [] ); + }, + + // For internal use only. + // Behaves like an Array's method, not like a jQuery method. + push: [].push, + sort: [].sort, + splice: [].splice, + + find: function( selector ) { + if ( this.length === 1 ) { + var ret = this.pushStack( [], "find", selector ); + ret.length = 0; + jQuery.find( selector, this[0], ret ); + return ret; + } else { + return this.pushStack( jQuery.unique(jQuery.map(this, function(elem){ + return jQuery.find( selector, elem ); + })), "find", selector ); + } + }, + + clone: function( events ) { + // Do the clone + var ret = this.map(function(){ + if ( !jQuery.support.noCloneEvent && !jQuery.isXMLDoc(this) ) { + // IE copies events bound via attachEvent when + // using cloneNode. Calling detachEvent on the + // clone will also remove the events from the orignal + // In order to get around this, we use innerHTML. + // Unfortunately, this means some modifications to + // attributes in IE that are actually only stored + // as properties will not be copied (such as the + // the name attribute on an input). + var html = this.outerHTML; + if ( !html ) { + var div = this.ownerDocument.createElement("div"); + div.appendChild( this.cloneNode(true) ); + html = div.innerHTML; + } + + return jQuery.clean([html.replace(/ jQuery\d+="(?:\d+|null)"/g, "").replace(/^\s*/, "")])[0]; + } else + return this.cloneNode(true); + }); + + // Copy the events from the original to the clone + if ( events === true ) { + var orig = this.find("*").andSelf(), i = 0; + + ret.find("*").andSelf().each(function(){ + if ( this.nodeName !== orig[i].nodeName ) + return; + + var events = jQuery.data( orig[i], "events" ); + + for ( var type in events ) { + for ( var handler in events[ type ] ) { + jQuery.event.add( this, type, events[ type ][ handler ], events[ type ][ handler ].data ); + } + } + + i++; + }); + } + + // Return the cloned set + return ret; + }, + + filter: function( selector ) { + return this.pushStack( + jQuery.isFunction( selector ) && + jQuery.grep(this, function(elem, i){ + return selector.call( elem, i ); + }) || + + jQuery.multiFilter( selector, jQuery.grep(this, function(elem){ + return elem.nodeType === 1; + }) ), "filter", selector ); + }, + + closest: function( selector ) { + var pos = jQuery.expr.match.POS.test( selector ) ? jQuery(selector) : null, + closer = 0; + + return this.map(function(){ + var cur = this; + while ( cur && cur.ownerDocument ) { + if ( pos ? pos.index(cur) > -1 : jQuery(cur).is(selector) ) { + jQuery.data(cur, "closest", closer); + return cur; + } + cur = cur.parentNode; + closer++; + } + }); + }, + + not: function( selector ) { + if ( typeof selector === "string" ) + // test special case where just one selector is passed in + if ( isSimple.test( selector ) ) + return this.pushStack( jQuery.multiFilter( selector, this, true ), "not", selector ); + else + selector = jQuery.multiFilter( selector, this ); + + var isArrayLike = selector.length && selector[selector.length - 1] !== undefined && !selector.nodeType; + return this.filter(function() { + return isArrayLike ? jQuery.inArray( this, selector ) < 0 : this != selector; + }); + }, + + add: function( selector ) { + return this.pushStack( jQuery.unique( jQuery.merge( + this.get(), + typeof selector === "string" ? + jQuery( selector ) : + jQuery.makeArray( selector ) + ))); + }, + + is: function( selector ) { + return !!selector && jQuery.multiFilter( selector, this ).length > 0; + }, + + hasClass: function( selector ) { + return !!selector && this.is( "." + selector ); + }, + + val: function( value ) { + if ( value === undefined ) { + var elem = this[0]; + + if ( elem ) { + if( jQuery.nodeName( elem, 'option' ) ) + return (elem.attributes.value || {}).specified ? elem.value : elem.text; + + // We need to handle select boxes special + if ( jQuery.nodeName( elem, "select" ) ) { + var index = elem.selectedIndex, + values = [], + options = elem.options, + one = elem.type == "select-one"; + + // Nothing was selected + if ( index < 0 ) + return null; + + // Loop through all the selected options + for ( var i = one ? index : 0, max = one ? index + 1 : options.length; i < max; i++ ) { + var option = options[ i ]; + + if ( option.selected ) { + // Get the specifc value for the option + value = jQuery(option).val(); + + // We don't need an array for one selects + if ( one ) + return value; + + // Multi-Selects return an array + values.push( value ); + } + } + + return values; + } + + // Everything else, we just grab the value + return (elem.value || "").replace(/\r/g, ""); + + } + + return undefined; + } + + if ( typeof value === "number" ) + value += ''; + + return this.each(function(){ + if ( this.nodeType != 1 ) + return; + + if ( jQuery.isArray(value) && /radio|checkbox/.test( this.type ) ) + this.checked = (jQuery.inArray(this.value, value) >= 0 || + jQuery.inArray(this.name, value) >= 0); + + else if ( jQuery.nodeName( this, "select" ) ) { + var values = jQuery.makeArray(value); + + jQuery( "option", this ).each(function(){ + this.selected = (jQuery.inArray( this.value, values ) >= 0 || + jQuery.inArray( this.text, values ) >= 0); + }); + + if ( !values.length ) + this.selectedIndex = -1; + + } else + this.value = value; + }); + }, + + html: function( value ) { + return value === undefined ? + (this[0] ? + this[0].innerHTML.replace(/ jQuery\d+="(?:\d+|null)"/g, "") : + null) : + this.empty().append( value ); + }, + + replaceWith: function( value ) { + return this.after( value ).remove(); + }, + + eq: function( i ) { + return this.slice( i, +i + 1 ); + }, + + slice: function() { + return this.pushStack( Array.prototype.slice.apply( this, arguments ), + "slice", Array.prototype.slice.call(arguments).join(",") ); + }, + + map: function( callback ) { + return this.pushStack( jQuery.map(this, function(elem, i){ + return callback.call( elem, i, elem ); + })); + }, + + andSelf: function() { + return this.add( this.prevObject ); + }, + + domManip: function( args, table, callback ) { + if ( this[0] ) { + var fragment = (this[0].ownerDocument || this[0]).createDocumentFragment(), + scripts = jQuery.clean( args, (this[0].ownerDocument || this[0]), fragment ), + first = fragment.firstChild; + + if ( first ) + for ( var i = 0, l = this.length; i < l; i++ ) + callback.call( root(this[i], first), this.length > 1 || i > 0 ? + fragment.cloneNode(true) : fragment ); + + if ( scripts ) + jQuery.each( scripts, evalScript ); + } + + return this; + + function root( elem, cur ) { + return table && jQuery.nodeName(elem, "table") && jQuery.nodeName(cur, "tr") ? + (elem.getElementsByTagName("tbody")[0] || + elem.appendChild(elem.ownerDocument.createElement("tbody"))) : + elem; + } + } +}; + +// Give the init function the jQuery prototype for later instantiation +jQuery.fn.init.prototype = jQuery.fn; + +function evalScript( i, elem ) { + if ( elem.src ) + jQuery.ajax({ + url: elem.src, + async: false, + dataType: "script" + }); + + else + jQuery.globalEval( elem.text || elem.textContent || elem.innerHTML || "" ); + + if ( elem.parentNode ) + elem.parentNode.removeChild( elem ); +} + +function now(){ + return +new Date; +} + +jQuery.extend = jQuery.fn.extend = function() { + // copy reference to target object + var target = arguments[0] || {}, i = 1, length = arguments.length, deep = false, options; + + // Handle a deep copy situation + if ( typeof target === "boolean" ) { + deep = target; + target = arguments[1] || {}; + // skip the boolean and the target + i = 2; + } + + // Handle case when target is a string or something (possible in deep copy) + if ( typeof target !== "object" && !jQuery.isFunction(target) ) + target = {}; + + // extend jQuery itself if only one argument is passed + if ( length == i ) { + target = this; + --i; + } + + for ( ; i < length; i++ ) + // Only deal with non-null/undefined values + if ( (options = arguments[ i ]) != null ) + // Extend the base object + for ( var name in options ) { + var src = target[ name ], copy = options[ name ]; + + // Prevent never-ending loop + if ( target === copy ) + continue; + + // Recurse if we're merging object values + if ( deep && copy && typeof copy === "object" && !copy.nodeType ) + target[ name ] = jQuery.extend( deep, + // Never move original objects, clone them + src || ( copy.length != null ? [ ] : { } ) + , copy ); + + // Don't bring in undefined values + else if ( copy !== undefined ) + target[ name ] = copy; + + } + + // Return the modified object + return target; +}; + +// exclude the following css properties to add px +var exclude = /z-?index|font-?weight|opacity|zoom|line-?height/i, + // cache defaultView + defaultView = document.defaultView || {}, + toString = Object.prototype.toString; + +jQuery.extend({ + noConflict: function( deep ) { + window.$ = _$; + + if ( deep ) + window.jQuery = _jQuery; + + return jQuery; + }, + + // See test/unit/core.js for details concerning isFunction. + // Since version 1.3, DOM methods and functions like alert + // aren't supported. They return false on IE (#2968). + isFunction: function( obj ) { + return toString.call(obj) === "[object Function]"; + }, + + isArray: function( obj ) { + return toString.call(obj) === "[object Array]"; + }, + + // check if an element is in a (or is an) XML document + isXMLDoc: function( elem ) { + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && jQuery.isXMLDoc( elem.ownerDocument ); + }, + + // Evalulates a script in a global context + globalEval: function( data ) { + if ( data && /\S/.test(data) ) { + // Inspired by code by Andrea Giammarchi + // http://webreflection.blogspot.com/2007/08/global-scope-evaluation-and-dom.html + var head = document.getElementsByTagName("head")[0] || document.documentElement, + script = document.createElement("script"); + + script.type = "text/javascript"; + if ( jQuery.support.scriptEval ) + script.appendChild( document.createTextNode( data ) ); + else + script.text = data; + + // Use insertBefore instead of appendChild to circumvent an IE6 bug. + // This arises when a base node is used (#2709). + head.insertBefore( script, head.firstChild ); + head.removeChild( script ); + } + }, + + nodeName: function( elem, name ) { + return elem.nodeName && elem.nodeName.toUpperCase() == name.toUpperCase(); + }, + + // args is for internal usage only + each: function( object, callback, args ) { + var name, i = 0, length = object.length; + + if ( args ) { + if ( length === undefined ) { + for ( name in object ) + if ( callback.apply( object[ name ], args ) === false ) + break; + } else + for ( ; i < length; ) + if ( callback.apply( object[ i++ ], args ) === false ) + break; + + // A special, fast, case for the most common use of each + } else { + if ( length === undefined ) { + for ( name in object ) + if ( callback.call( object[ name ], name, object[ name ] ) === false ) + break; + } else + for ( var value = object[0]; + i < length && callback.call( value, i, value ) !== false; value = object[++i] ){} + } + + return object; + }, + + prop: function( elem, value, type, i, name ) { + // Handle executable functions + if ( jQuery.isFunction( value ) ) + value = value.call( elem, i ); + + // Handle passing in a number to a CSS property + return typeof value === "number" && type == "curCSS" && !exclude.test( name ) ? + value + "px" : + value; + }, + + className: { + // internal only, use addClass("class") + add: function( elem, classNames ) { + jQuery.each((classNames || "").split(/\s+/), function(i, className){ + if ( elem.nodeType == 1 && !jQuery.className.has( elem.className, className ) ) + elem.className += (elem.className ? " " : "") + className; + }); + }, + + // internal only, use removeClass("class") + remove: function( elem, classNames ) { + if (elem.nodeType == 1) + elem.className = classNames !== undefined ? + jQuery.grep(elem.className.split(/\s+/), function(className){ + return !jQuery.className.has( classNames, className ); + }).join(" ") : + ""; + }, + + // internal only, use hasClass("class") + has: function( elem, className ) { + return elem && jQuery.inArray( className, (elem.className || elem).toString().split(/\s+/) ) > -1; + } + }, + + // A method for quickly swapping in/out CSS properties to get correct calculations + swap: function( elem, options, callback ) { + var old = {}; + // Remember the old values, and insert the new ones + for ( var name in options ) { + old[ name ] = elem.style[ name ]; + elem.style[ name ] = options[ name ]; + } + + callback.call( elem ); + + // Revert the old values + for ( var name in options ) + elem.style[ name ] = old[ name ]; + }, + + css: function( elem, name, force, extra ) { + if ( name == "width" || name == "height" ) { + var val, props = { position: "absolute", visibility: "hidden", display:"block" }, which = name == "width" ? [ "Left", "Right" ] : [ "Top", "Bottom" ]; + + function getWH() { + val = name == "width" ? elem.offsetWidth : elem.offsetHeight; + + if ( extra === "border" ) + return; + + jQuery.each( which, function() { + if ( !extra ) + val -= parseFloat(jQuery.curCSS( elem, "padding" + this, true)) || 0; + if ( extra === "margin" ) + val += parseFloat(jQuery.curCSS( elem, "margin" + this, true)) || 0; + else + val -= parseFloat(jQuery.curCSS( elem, "border" + this + "Width", true)) || 0; + }); + } + + if ( elem.offsetWidth !== 0 ) + getWH(); + else + jQuery.swap( elem, props, getWH ); + + return Math.max(0, Math.round(val)); + } + + return jQuery.curCSS( elem, name, force ); + }, + + curCSS: function( elem, name, force ) { + var ret, style = elem.style; + + // We need to handle opacity special in IE + if ( name == "opacity" && !jQuery.support.opacity ) { + ret = jQuery.attr( style, "opacity" ); + + return ret == "" ? + "1" : + ret; + } + + // Make sure we're using the right name for getting the float value + if ( name.match( /float/i ) ) + name = styleFloat; + + if ( !force && style && style[ name ] ) + ret = style[ name ]; + + else if ( defaultView.getComputedStyle ) { + + // Only "float" is needed here + if ( name.match( /float/i ) ) + name = "float"; + + name = name.replace( /([A-Z])/g, "-$1" ).toLowerCase(); + + var computedStyle = defaultView.getComputedStyle( elem, null ); + + if ( computedStyle ) + ret = computedStyle.getPropertyValue( name ); + + // We should always get a number back from opacity + if ( name == "opacity" && ret == "" ) + ret = "1"; + + } else if ( elem.currentStyle ) { + var camelCase = name.replace(/\-(\w)/g, function(all, letter){ + return letter.toUpperCase(); + }); + + ret = elem.currentStyle[ name ] || elem.currentStyle[ camelCase ]; + + // From the awesome hack by Dean Edwards + // http://erik.eae.net/archives/2007/07/27/18.54.15/#comment-102291 + + // If we're not dealing with a regular pixel number + // but a number that has a weird ending, we need to convert it to pixels + if ( !/^\d+(px)?$/i.test( ret ) && /^\d/.test( ret ) ) { + // Remember the original values + var left = style.left, rsLeft = elem.runtimeStyle.left; + + // Put in the new values to get a computed value out + elem.runtimeStyle.left = elem.currentStyle.left; + style.left = ret || 0; + ret = style.pixelLeft + "px"; + + // Revert the changed values + style.left = left; + elem.runtimeStyle.left = rsLeft; + } + } + + return ret; + }, + + clean: function( elems, context, fragment ) { + context = context || document; + + // !context.createElement fails in IE with an error but returns typeof 'object' + if ( typeof context.createElement === "undefined" ) + context = context.ownerDocument || context[0] && context[0].ownerDocument || document; + + // If a single string is passed in and it's a single tag + // just do a createElement and skip the rest + if ( !fragment && elems.length === 1 && typeof elems[0] === "string" ) { + var match = /^<(\w+)\s*\/?>$/.exec(elems[0]); + if ( match ) + return [ context.createElement( match[1] ) ]; + } + + var ret = [], scripts = [], div = context.createElement("div"); + + jQuery.each(elems, function(i, elem){ + if ( typeof elem === "number" ) + elem += ''; + + if ( !elem ) + return; + + // Convert html string into DOM nodes + if ( typeof elem === "string" ) { + // Fix "XHTML"-style tags in all browsers + elem = elem.replace(/(<(\w+)[^>]*?)\/>/g, function(all, front, tag){ + return tag.match(/^(abbr|br|col|img|input|link|meta|param|hr|area|embed)$/i) ? + all : + front + "></" + tag + ">"; + }); + + // Trim whitespace, otherwise indexOf won't work as expected + var tags = elem.replace(/^\s+/, "").substring(0, 10).toLowerCase(); + + var wrap = + // option or optgroup + !tags.indexOf("<opt") && + [ 1, "<select multiple='multiple'>", "</select>" ] || + + !tags.indexOf("<leg") && + [ 1, "<fieldset>", "</fieldset>" ] || + + tags.match(/^<(thead|tbody|tfoot|colg|cap)/) && + [ 1, "<table>", "</table>" ] || + + !tags.indexOf("<tr") && + [ 2, "<table><tbody>", "</tbody></table>" ] || + + // <thead> matched above + (!tags.indexOf("<td") || !tags.indexOf("<th")) && + [ 3, "<table><tbody><tr>", "</tr></tbody></table>" ] || + + !tags.indexOf("<col") && + [ 2, "<table><tbody></tbody><colgroup>", "</colgroup></table>" ] || + + // IE can't serialize <link> and <script> tags normally + !jQuery.support.htmlSerialize && + [ 1, "div<div>", "</div>" ] || + + [ 0, "", "" ]; + + // Go to html and back, then peel off extra wrappers + div.innerHTML = wrap[1] + elem + wrap[2]; + + // Move to the right depth + while ( wrap[0]-- ) + div = div.lastChild; + + // Remove IE's autoinserted <tbody> from table fragments + if ( !jQuery.support.tbody ) { + + // String was a <table>, *may* have spurious <tbody> + var hasBody = /<tbody/i.test(elem), + tbody = !tags.indexOf("<table") && !hasBody ? + div.firstChild && div.firstChild.childNodes : + + // String was a bare <thead> or <tfoot> + wrap[1] == "<table>" && !hasBody ? + div.childNodes : + []; + + for ( var j = tbody.length - 1; j >= 0 ; --j ) + if ( jQuery.nodeName( tbody[ j ], "tbody" ) && !tbody[ j ].childNodes.length ) + tbody[ j ].parentNode.removeChild( tbody[ j ] ); + + } + + // IE completely kills leading whitespace when innerHTML is used + if ( !jQuery.support.leadingWhitespace && /^\s/.test( elem ) ) + div.insertBefore( context.createTextNode( elem.match(/^\s*/)[0] ), div.firstChild ); + + elem = jQuery.makeArray( div.childNodes ); + } + + if ( elem.nodeType ) + ret.push( elem ); + else + ret = jQuery.merge( ret, elem ); + + }); + + if ( fragment ) { + for ( var i = 0; ret[i]; i++ ) { + if ( jQuery.nodeName( ret[i], "script" ) && (!ret[i].type || ret[i].type.toLowerCase() === "text/javascript") ) { + scripts.push( ret[i].parentNode ? ret[i].parentNode.removeChild( ret[i] ) : ret[i] ); + } else { + if ( ret[i].nodeType === 1 ) + ret.splice.apply( ret, [i + 1, 0].concat(jQuery.makeArray(ret[i].getElementsByTagName("script"))) ); + fragment.appendChild( ret[i] ); + } + } + + return scripts; + } + + return ret; + }, + + attr: function( elem, name, value ) { + // don't set attributes on text and comment nodes + if (!elem || elem.nodeType == 3 || elem.nodeType == 8) + return undefined; + + var notxml = !jQuery.isXMLDoc( elem ), + // Whether we are setting (or getting) + set = value !== undefined; + + // Try to normalize/fix the name + name = notxml && jQuery.props[ name ] || name; + + // Only do all the following if this is a node (faster for style) + // IE elem.getAttribute passes even for style + if ( elem.tagName ) { + + // These attributes require special treatment + var special = /href|src|style/.test( name ); + + // Safari mis-reports the default selected property of a hidden option + // Accessing the parent's selectedIndex property fixes it + if ( name == "selected" && elem.parentNode ) + elem.parentNode.selectedIndex; + + // If applicable, access the attribute via the DOM 0 way + if ( name in elem && notxml && !special ) { + if ( set ){ + // We can't allow the type property to be changed (since it causes problems in IE) + if ( name == "type" && jQuery.nodeName( elem, "input" ) && elem.parentNode ) + throw "type property can't be changed"; + + elem[ name ] = value; + } + + // browsers index elements by id/name on forms, give priority to attributes. + if( jQuery.nodeName( elem, "form" ) && elem.getAttributeNode(name) ) + return elem.getAttributeNode( name ).nodeValue; + + // elem.tabIndex doesn't always return the correct value when it hasn't been explicitly set + // http://fluidproject.org/blog/2008/01/09/getting-setting-and-removing-tabindex-values-with-javascript/ + if ( name == "tabIndex" ) { + var attributeNode = elem.getAttributeNode( "tabIndex" ); + return attributeNode && attributeNode.specified + ? attributeNode.value + : elem.nodeName.match(/(button|input|object|select|textarea)/i) + ? 0 + : elem.nodeName.match(/^(a|area)$/i) && elem.href + ? 0 + : undefined; + } + + return elem[ name ]; + } + + if ( !jQuery.support.style && notxml && name == "style" ) + return jQuery.attr( elem.style, "cssText", value ); + + if ( set ) + // convert the value to a string (all browsers do this but IE) see #1070 + elem.setAttribute( name, "" + value ); + + var attr = !jQuery.support.hrefNormalized && notxml && special + // Some attributes require a special call on IE + ? elem.getAttribute( name, 2 ) + : elem.getAttribute( name ); + + // Non-existent attributes return null, we normalize to undefined + return attr === null ? undefined : attr; + } + + // elem is actually elem.style ... set the style + + // IE uses filters for opacity + if ( !jQuery.support.opacity && name == "opacity" ) { + if ( set ) { + // IE has trouble with opacity if it does not have layout + // Force it by setting the zoom level + elem.zoom = 1; + + // Set the alpha filter to set the opacity + elem.filter = (elem.filter || "").replace( /alpha\([^)]*\)/, "" ) + + (parseInt( value ) + '' == "NaN" ? "" : "alpha(opacity=" + value * 100 + ")"); + } + + return elem.filter && elem.filter.indexOf("opacity=") >= 0 ? + (parseFloat( elem.filter.match(/opacity=([^)]*)/)[1] ) / 100) + '': + ""; + } + + name = name.replace(/-([a-z])/ig, function(all, letter){ + return letter.toUpperCase(); + }); + + if ( set ) + elem[ name ] = value; + + return elem[ name ]; + }, + + trim: function( text ) { + return (text || "").replace( /^\s+|\s+$/g, "" ); + }, + + makeArray: function( array ) { + var ret = []; + + if( array != null ){ + var i = array.length; + // The window, strings (and functions) also have 'length' + if( i == null || typeof array === "string" || jQuery.isFunction(array) || array.setInterval ) + ret[0] = array; + else + while( i ) + ret[--i] = array[i]; + } + + return ret; + }, + + inArray: function( elem, array ) { + for ( var i = 0, length = array.length; i < length; i++ ) + // Use === because on IE, window == document + if ( array[ i ] === elem ) + return i; + + return -1; + }, + + merge: function( first, second ) { + // We have to loop this way because IE & Opera overwrite the length + // expando of getElementsByTagName + var i = 0, elem, pos = first.length; + // Also, we need to make sure that the correct elements are being returned + // (IE returns comment nodes in a '*' query) + if ( !jQuery.support.getAll ) { + while ( (elem = second[ i++ ]) != null ) + if ( elem.nodeType != 8 ) + first[ pos++ ] = elem; + + } else + while ( (elem = second[ i++ ]) != null ) + first[ pos++ ] = elem; + + return first; + }, + + unique: function( array ) { + var ret = [], done = {}; + + try { + + for ( var i = 0, length = array.length; i < length; i++ ) { + var id = jQuery.data( array[ i ] ); + + if ( !done[ id ] ) { + done[ id ] = true; + ret.push( array[ i ] ); + } + } + + } catch( e ) { + ret = array; + } + + return ret; + }, + + grep: function( elems, callback, inv ) { + var ret = []; + + // Go through the array, only saving the items + // that pass the validator function + for ( var i = 0, length = elems.length; i < length; i++ ) + if ( !inv != !callback( elems[ i ], i ) ) + ret.push( elems[ i ] ); + + return ret; + }, + + map: function( elems, callback ) { + var ret = []; + + // Go through the array, translating each of the items to their + // new value (or values). + for ( var i = 0, length = elems.length; i < length; i++ ) { + var value = callback( elems[ i ], i ); + + if ( value != null ) + ret[ ret.length ] = value; + } + + return ret.concat.apply( [], ret ); + } +}); + +// Use of jQuery.browser is deprecated. +// It's included for backwards compatibility and plugins, +// although they should work to migrate away. + +var userAgent = navigator.userAgent.toLowerCase(); + +// Figure out what browser is being used +jQuery.browser = { + version: (userAgent.match( /.+(?:rv|it|ra|ie)[\/: ]([\d.]+)/ ) || [0,'0'])[1], + safari: /webkit/.test( userAgent ), + opera: /opera/.test( userAgent ), + msie: /msie/.test( userAgent ) && !/opera/.test( userAgent ), + mozilla: /mozilla/.test( userAgent ) && !/(compatible|webkit)/.test( userAgent ) +}; + +jQuery.each({ + parent: function(elem){return elem.parentNode;}, + parents: function(elem){return jQuery.dir(elem,"parentNode");}, + next: function(elem){return jQuery.nth(elem,2,"nextSibling");}, + prev: function(elem){return jQuery.nth(elem,2,"previousSibling");}, + nextAll: function(elem){return jQuery.dir(elem,"nextSibling");}, + prevAll: function(elem){return jQuery.dir(elem,"previousSibling");}, + siblings: function(elem){return jQuery.sibling(elem.parentNode.firstChild,elem);}, + children: function(elem){return jQuery.sibling(elem.firstChild);}, + contents: function(elem){return jQuery.nodeName(elem,"iframe")?elem.contentDocument||elem.contentWindow.document:jQuery.makeArray(elem.childNodes);} +}, function(name, fn){ + jQuery.fn[ name ] = function( selector ) { + var ret = jQuery.map( this, fn ); + + if ( selector && typeof selector == "string" ) + ret = jQuery.multiFilter( selector, ret ); + + return this.pushStack( jQuery.unique( ret ), name, selector ); + }; +}); + +jQuery.each({ + appendTo: "append", + prependTo: "prepend", + insertBefore: "before", + insertAfter: "after", + replaceAll: "replaceWith" +}, function(name, original){ + jQuery.fn[ name ] = function( selector ) { + var ret = [], insert = jQuery( selector ); + + for ( var i = 0, l = insert.length; i < l; i++ ) { + var elems = (i > 0 ? this.clone(true) : this).get(); + jQuery.fn[ original ].apply( jQuery(insert[i]), elems ); + ret = ret.concat( elems ); + } + + return this.pushStack( ret, name, selector ); + }; +}); + +jQuery.each({ + removeAttr: function( name ) { + jQuery.attr( this, name, "" ); + if (this.nodeType == 1) + this.removeAttribute( name ); + }, + + addClass: function( classNames ) { + jQuery.className.add( this, classNames ); + }, + + removeClass: function( classNames ) { + jQuery.className.remove( this, classNames ); + }, + + toggleClass: function( classNames, state ) { + if( typeof state !== "boolean" ) + state = !jQuery.className.has( this, classNames ); + jQuery.className[ state ? "add" : "remove" ]( this, classNames ); + }, + + remove: function( selector ) { + if ( !selector || jQuery.filter( selector, [ this ] ).length ) { + // Prevent memory leaks + jQuery( "*", this ).add([this]).each(function(){ + jQuery.event.remove(this); + jQuery.removeData(this); + }); + if (this.parentNode) + this.parentNode.removeChild( this ); + } + }, + + empty: function() { + // Remove element nodes and prevent memory leaks + jQuery(this).children().remove(); + + // Remove any remaining nodes + while ( this.firstChild ) + this.removeChild( this.firstChild ); + } +}, function(name, fn){ + jQuery.fn[ name ] = function(){ + return this.each( fn, arguments ); + }; +}); + +// Helper function used by the dimensions and offset modules +function num(elem, prop) { + return elem[0] && parseInt( jQuery.curCSS(elem[0], prop, true), 10 ) || 0; +} +var expando = "jQuery" + now(), uuid = 0, windowData = {}; + +jQuery.extend({ + cache: {}, + + data: function( elem, name, data ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // Compute a unique ID for the element + if ( !id ) + id = elem[ expando ] = ++uuid; + + // Only generate the data cache if we're + // trying to access or manipulate it + if ( name && !jQuery.cache[ id ] ) + jQuery.cache[ id ] = {}; + + // Prevent overriding the named cache with undefined values + if ( data !== undefined ) + jQuery.cache[ id ][ name ] = data; + + // Return the named cache data, or the ID for the element + return name ? + jQuery.cache[ id ][ name ] : + id; + }, + + removeData: function( elem, name ) { + elem = elem == window ? + windowData : + elem; + + var id = elem[ expando ]; + + // If we want to remove a specific section of the element's data + if ( name ) { + if ( jQuery.cache[ id ] ) { + // Remove the section of cache data + delete jQuery.cache[ id ][ name ]; + + // If we've removed all the data, remove the element's cache + name = ""; + + for ( name in jQuery.cache[ id ] ) + break; + + if ( !name ) + jQuery.removeData( elem ); + } + + // Otherwise, we want to remove all of the element's data + } else { + // Clean up the element expando + try { + delete elem[ expando ]; + } catch(e){ + // IE has trouble directly removing the expando + // but it's ok with using removeAttribute + if ( elem.removeAttribute ) + elem.removeAttribute( expando ); + } + + // Completely remove the data cache + delete jQuery.cache[ id ]; + } + }, + queue: function( elem, type, data ) { + if ( elem ){ + + type = (type || "fx") + "queue"; + + var q = jQuery.data( elem, type ); + + if ( !q || jQuery.isArray(data) ) + q = jQuery.data( elem, type, jQuery.makeArray(data) ); + else if( data ) + q.push( data ); + + } + return q; + }, + + dequeue: function( elem, type ){ + var queue = jQuery.queue( elem, type ), + fn = queue.shift(); + + if( !type || type === "fx" ) + fn = queue[0]; + + if( fn !== undefined ) + fn.call(elem); + } +}); + +jQuery.fn.extend({ + data: function( key, value ){ + var parts = key.split("."); + parts[1] = parts[1] ? "." + parts[1] : ""; + + if ( value === undefined ) { + var data = this.triggerHandler("getData" + parts[1] + "!", [parts[0]]); + + if ( data === undefined && this.length ) + data = jQuery.data( this[0], key ); + + return data === undefined && parts[1] ? + this.data( parts[0] ) : + data; + } else + return this.trigger("setData" + parts[1] + "!", [parts[0], value]).each(function(){ + jQuery.data( this, key, value ); + }); + }, + + removeData: function( key ){ + return this.each(function(){ + jQuery.removeData( this, key ); + }); + }, + queue: function(type, data){ + if ( typeof type !== "string" ) { + data = type; + type = "fx"; + } + + if ( data === undefined ) + return jQuery.queue( this[0], type ); + + return this.each(function(){ + var queue = jQuery.queue( this, type, data ); + + if( type == "fx" && queue.length == 1 ) + queue[0].call(this); + }); + }, + dequeue: function(type){ + return this.each(function(){ + jQuery.dequeue( this, type ); + }); + } +});/*! + * Sizzle CSS Selector Engine - v0.9.3 + * Copyright 2009, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * More information: http://sizzlejs.com/ + */ +(function(){ + +var chunker = /((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^[\]]*\]|['"][^'"]*['"]|[^[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?/g, + done = 0, + toString = Object.prototype.toString; + +var Sizzle = function(selector, context, results, seed) { + results = results || []; + context = context || document; + + if ( context.nodeType !== 1 && context.nodeType !== 9 ) + return []; + + if ( !selector || typeof selector !== "string" ) { + return results; + } + + var parts = [], m, set, checkSet, check, mode, extra, prune = true; + + // Reset the position of the chunker regexp (start from head) + chunker.lastIndex = 0; + + while ( (m = chunker.exec(selector)) !== null ) { + parts.push( m[1] ); + + if ( m[2] ) { + extra = RegExp.rightContext; + break; + } + } + + if ( parts.length > 1 && origPOS.exec( selector ) ) { + if ( parts.length === 2 && Expr.relative[ parts[0] ] ) { + set = posProcess( parts[0] + parts[1], context ); + } else { + set = Expr.relative[ parts[0] ] ? + [ context ] : + Sizzle( parts.shift(), context ); + + while ( parts.length ) { + selector = parts.shift(); + + if ( Expr.relative[ selector ] ) + selector += parts.shift(); + + set = posProcess( selector, set ); + } + } + } else { + var ret = seed ? + { expr: parts.pop(), set: makeArray(seed) } : + Sizzle.find( parts.pop(), parts.length === 1 && context.parentNode ? context.parentNode : context, isXML(context) ); + set = Sizzle.filter( ret.expr, ret.set ); + + if ( parts.length > 0 ) { + checkSet = makeArray(set); + } else { + prune = false; + } + + while ( parts.length ) { + var cur = parts.pop(), pop = cur; + + if ( !Expr.relative[ cur ] ) { + cur = ""; + } else { + pop = parts.pop(); + } + + if ( pop == null ) { + pop = context; + } + + Expr.relative[ cur ]( checkSet, pop, isXML(context) ); + } + } + + if ( !checkSet ) { + checkSet = set; + } + + if ( !checkSet ) { + throw "Syntax error, unrecognized expression: " + (cur || selector); + } + + if ( toString.call(checkSet) === "[object Array]" ) { + if ( !prune ) { + results.push.apply( results, checkSet ); + } else if ( context.nodeType === 1 ) { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && (checkSet[i] === true || checkSet[i].nodeType === 1 && contains(context, checkSet[i])) ) { + results.push( set[i] ); + } + } + } else { + for ( var i = 0; checkSet[i] != null; i++ ) { + if ( checkSet[i] && checkSet[i].nodeType === 1 ) { + results.push( set[i] ); + } + } + } + } else { + makeArray( checkSet, results ); + } + + if ( extra ) { + Sizzle( extra, context, results, seed ); + + if ( sortOrder ) { + hasDuplicate = false; + results.sort(sortOrder); + + if ( hasDuplicate ) { + for ( var i = 1; i < results.length; i++ ) { + if ( results[i] === results[i-1] ) { + results.splice(i--, 1); + } + } + } + } + } + + return results; +}; + +Sizzle.matches = function(expr, set){ + return Sizzle(expr, null, null, set); +}; + +Sizzle.find = function(expr, context, isXML){ + var set, match; + + if ( !expr ) { + return []; + } + + for ( var i = 0, l = Expr.order.length; i < l; i++ ) { + var type = Expr.order[i], match; + + if ( (match = Expr.match[ type ].exec( expr )) ) { + var left = RegExp.leftContext; + + if ( left.substr( left.length - 1 ) !== "\\" ) { + match[1] = (match[1] || "").replace(/\\/g, ""); + set = Expr.find[ type ]( match, context, isXML ); + if ( set != null ) { + expr = expr.replace( Expr.match[ type ], "" ); + break; + } + } + } + } + + if ( !set ) { + set = context.getElementsByTagName("*"); + } + + return {set: set, expr: expr}; +}; + +Sizzle.filter = function(expr, set, inplace, not){ + var old = expr, result = [], curLoop = set, match, anyFound, + isXMLFilter = set && set[0] && isXML(set[0]); + + while ( expr && set.length ) { + for ( var type in Expr.filter ) { + if ( (match = Expr.match[ type ].exec( expr )) != null ) { + var filter = Expr.filter[ type ], found, item; + anyFound = false; + + if ( curLoop == result ) { + result = []; + } + + if ( Expr.preFilter[ type ] ) { + match = Expr.preFilter[ type ]( match, curLoop, inplace, result, not, isXMLFilter ); + + if ( !match ) { + anyFound = found = true; + } else if ( match === true ) { + continue; + } + } + + if ( match ) { + for ( var i = 0; (item = curLoop[i]) != null; i++ ) { + if ( item ) { + found = filter( item, match, i, curLoop ); + var pass = not ^ !!found; + + if ( inplace && found != null ) { + if ( pass ) { + anyFound = true; + } else { + curLoop[i] = false; + } + } else if ( pass ) { + result.push( item ); + anyFound = true; + } + } + } + } + + if ( found !== undefined ) { + if ( !inplace ) { + curLoop = result; + } + + expr = expr.replace( Expr.match[ type ], "" ); + + if ( !anyFound ) { + return []; + } + + break; + } + } + } + + // Improper expression + if ( expr == old ) { + if ( anyFound == null ) { + throw "Syntax error, unrecognized expression: " + expr; + } else { + break; + } + } + + old = expr; + } + + return curLoop; +}; + +var Expr = Sizzle.selectors = { + order: [ "ID", "NAME", "TAG" ], + match: { + ID: /#((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + CLASS: /\.((?:[\w\u00c0-\uFFFF_-]|\\.)+)/, + NAME: /\[name=['"]*((?:[\w\u00c0-\uFFFF_-]|\\.)+)['"]*\]/, + ATTR: /\[\s*((?:[\w\u00c0-\uFFFF_-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/, + TAG: /^((?:[\w\u00c0-\uFFFF\*_-]|\\.)+)/, + CHILD: /:(only|nth|last|first)-child(?:\((even|odd|[\dn+-]*)\))?/, + POS: /:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^-]|$)/, + PSEUDO: /:((?:[\w\u00c0-\uFFFF_-]|\\.)+)(?:\((['"]*)((?:\([^\)]+\)|[^\2\(\)]*)+)\2\))?/ + }, + attrMap: { + "class": "className", + "for": "htmlFor" + }, + attrHandle: { + href: function(elem){ + return elem.getAttribute("href"); + } + }, + relative: { + "+": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string", + isTag = isPartStr && !/\W/.test(part), + isPartStrNotTag = isPartStr && !isTag; + + if ( isTag && !isXML ) { + part = part.toUpperCase(); + } + + for ( var i = 0, l = checkSet.length, elem; i < l; i++ ) { + if ( (elem = checkSet[i]) ) { + while ( (elem = elem.previousSibling) && elem.nodeType !== 1 ) {} + + checkSet[i] = isPartStrNotTag || elem && elem.nodeName === part ? + elem || false : + elem === part; + } + } + + if ( isPartStrNotTag ) { + Sizzle.filter( part, checkSet, true ); + } + }, + ">": function(checkSet, part, isXML){ + var isPartStr = typeof part === "string"; + + if ( isPartStr && !/\W/.test(part) ) { + part = isXML ? part : part.toUpperCase(); + + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + var parent = elem.parentNode; + checkSet[i] = parent.nodeName === part ? parent : false; + } + } + } else { + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + checkSet[i] = isPartStr ? + elem.parentNode : + elem.parentNode === part; + } + } + + if ( isPartStr ) { + Sizzle.filter( part, checkSet, true ); + } + } + }, + "": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("parentNode", part, doneName, checkSet, nodeCheck, isXML); + }, + "~": function(checkSet, part, isXML){ + var doneName = done++, checkFn = dirCheck; + + if ( typeof part === "string" && !part.match(/\W/) ) { + var nodeCheck = part = isXML ? part : part.toUpperCase(); + checkFn = dirNodeCheck; + } + + checkFn("previousSibling", part, doneName, checkSet, nodeCheck, isXML); + } + }, + find: { + ID: function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? [m] : []; + } + }, + NAME: function(match, context, isXML){ + if ( typeof context.getElementsByName !== "undefined" ) { + var ret = [], results = context.getElementsByName(match[1]); + + for ( var i = 0, l = results.length; i < l; i++ ) { + if ( results[i].getAttribute("name") === match[1] ) { + ret.push( results[i] ); + } + } + + return ret.length === 0 ? null : ret; + } + }, + TAG: function(match, context){ + return context.getElementsByTagName(match[1]); + } + }, + preFilter: { + CLASS: function(match, curLoop, inplace, result, not, isXML){ + match = " " + match[1].replace(/\\/g, "") + " "; + + if ( isXML ) { + return match; + } + + for ( var i = 0, elem; (elem = curLoop[i]) != null; i++ ) { + if ( elem ) { + if ( not ^ (elem.className && (" " + elem.className + " ").indexOf(match) >= 0) ) { + if ( !inplace ) + result.push( elem ); + } else if ( inplace ) { + curLoop[i] = false; + } + } + } + + return false; + }, + ID: function(match){ + return match[1].replace(/\\/g, ""); + }, + TAG: function(match, curLoop){ + for ( var i = 0; curLoop[i] === false; i++ ){} + return curLoop[i] && isXML(curLoop[i]) ? match[1] : match[1].toUpperCase(); + }, + CHILD: function(match){ + if ( match[1] == "nth" ) { + // parse equations like 'even', 'odd', '5', '2n', '3n+2', '4n-1', '-n+6' + var test = /(-?)(\d*)n((?:\+|-)?\d*)/.exec( + match[2] == "even" && "2n" || match[2] == "odd" && "2n+1" || + !/\D/.test( match[2] ) && "0n+" + match[2] || match[2]); + + // calculate the numbers (first)n+(last) including if they are negative + match[2] = (test[1] + (test[2] || 1)) - 0; + match[3] = test[3] - 0; + } + + // TODO: Move to normal caching system + match[0] = done++; + + return match; + }, + ATTR: function(match, curLoop, inplace, result, not, isXML){ + var name = match[1].replace(/\\/g, ""); + + if ( !isXML && Expr.attrMap[name] ) { + match[1] = Expr.attrMap[name]; + } + + if ( match[2] === "~=" ) { + match[4] = " " + match[4] + " "; + } + + return match; + }, + PSEUDO: function(match, curLoop, inplace, result, not){ + if ( match[1] === "not" ) { + // If we're dealing with a complex expression, or a simple one + if ( match[3].match(chunker).length > 1 || /^\w/.test(match[3]) ) { + match[3] = Sizzle(match[3], null, null, curLoop); + } else { + var ret = Sizzle.filter(match[3], curLoop, inplace, true ^ not); + if ( !inplace ) { + result.push.apply( result, ret ); + } + return false; + } + } else if ( Expr.match.POS.test( match[0] ) || Expr.match.CHILD.test( match[0] ) ) { + return true; + } + + return match; + }, + POS: function(match){ + match.unshift( true ); + return match; + } + }, + filters: { + enabled: function(elem){ + return elem.disabled === false && elem.type !== "hidden"; + }, + disabled: function(elem){ + return elem.disabled === true; + }, + checked: function(elem){ + return elem.checked === true; + }, + selected: function(elem){ + // Accessing this property makes selected-by-default + // options in Safari work properly + elem.parentNode.selectedIndex; + return elem.selected === true; + }, + parent: function(elem){ + return !!elem.firstChild; + }, + empty: function(elem){ + return !elem.firstChild; + }, + has: function(elem, i, match){ + return !!Sizzle( match[3], elem ).length; + }, + header: function(elem){ + return /h\d/i.test( elem.nodeName ); + }, + text: function(elem){ + return "text" === elem.type; + }, + radio: function(elem){ + return "radio" === elem.type; + }, + checkbox: function(elem){ + return "checkbox" === elem.type; + }, + file: function(elem){ + return "file" === elem.type; + }, + password: function(elem){ + return "password" === elem.type; + }, + submit: function(elem){ + return "submit" === elem.type; + }, + image: function(elem){ + return "image" === elem.type; + }, + reset: function(elem){ + return "reset" === elem.type; + }, + button: function(elem){ + return "button" === elem.type || elem.nodeName.toUpperCase() === "BUTTON"; + }, + input: function(elem){ + return /input|select|textarea|button/i.test(elem.nodeName); + } + }, + setFilters: { + first: function(elem, i){ + return i === 0; + }, + last: function(elem, i, match, array){ + return i === array.length - 1; + }, + even: function(elem, i){ + return i % 2 === 0; + }, + odd: function(elem, i){ + return i % 2 === 1; + }, + lt: function(elem, i, match){ + return i < match[3] - 0; + }, + gt: function(elem, i, match){ + return i > match[3] - 0; + }, + nth: function(elem, i, match){ + return match[3] - 0 == i; + }, + eq: function(elem, i, match){ + return match[3] - 0 == i; + } + }, + filter: { + PSEUDO: function(elem, match, i, array){ + var name = match[1], filter = Expr.filters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } else if ( name === "contains" ) { + return (elem.textContent || elem.innerText || "").indexOf(match[3]) >= 0; + } else if ( name === "not" ) { + var not = match[3]; + + for ( var i = 0, l = not.length; i < l; i++ ) { + if ( not[i] === elem ) { + return false; + } + } + + return true; + } + }, + CHILD: function(elem, match){ + var type = match[1], node = elem; + switch (type) { + case 'only': + case 'first': + while (node = node.previousSibling) { + if ( node.nodeType === 1 ) return false; + } + if ( type == 'first') return true; + node = elem; + case 'last': + while (node = node.nextSibling) { + if ( node.nodeType === 1 ) return false; + } + return true; + case 'nth': + var first = match[2], last = match[3]; + + if ( first == 1 && last == 0 ) { + return true; + } + + var doneName = match[0], + parent = elem.parentNode; + + if ( parent && (parent.sizcache !== doneName || !elem.nodeIndex) ) { + var count = 0; + for ( node = parent.firstChild; node; node = node.nextSibling ) { + if ( node.nodeType === 1 ) { + node.nodeIndex = ++count; + } + } + parent.sizcache = doneName; + } + + var diff = elem.nodeIndex - last; + if ( first == 0 ) { + return diff == 0; + } else { + return ( diff % first == 0 && diff / first >= 0 ); + } + } + }, + ID: function(elem, match){ + return elem.nodeType === 1 && elem.getAttribute("id") === match; + }, + TAG: function(elem, match){ + return (match === "*" && elem.nodeType === 1) || elem.nodeName === match; + }, + CLASS: function(elem, match){ + return (" " + (elem.className || elem.getAttribute("class")) + " ") + .indexOf( match ) > -1; + }, + ATTR: function(elem, match){ + var name = match[1], + result = Expr.attrHandle[ name ] ? + Expr.attrHandle[ name ]( elem ) : + elem[ name ] != null ? + elem[ name ] : + elem.getAttribute( name ), + value = result + "", + type = match[2], + check = match[4]; + + return result == null ? + type === "!=" : + type === "=" ? + value === check : + type === "*=" ? + value.indexOf(check) >= 0 : + type === "~=" ? + (" " + value + " ").indexOf(check) >= 0 : + !check ? + value && result !== false : + type === "!=" ? + value != check : + type === "^=" ? + value.indexOf(check) === 0 : + type === "$=" ? + value.substr(value.length - check.length) === check : + type === "|=" ? + value === check || value.substr(0, check.length + 1) === check + "-" : + false; + }, + POS: function(elem, match, i, array){ + var name = match[2], filter = Expr.setFilters[ name ]; + + if ( filter ) { + return filter( elem, i, match, array ); + } + } + } +}; + +var origPOS = Expr.match.POS; + +for ( var type in Expr.match ) { + Expr.match[ type ] = RegExp( Expr.match[ type ].source + /(?![^\[]*\])(?![^\(]*\))/.source ); +} + +var makeArray = function(array, results) { + array = Array.prototype.slice.call( array ); + + if ( results ) { + results.push.apply( results, array ); + return results; + } + + return array; +}; + +// Perform a simple check to determine if the browser is capable of +// converting a NodeList to an array using builtin methods. +try { + Array.prototype.slice.call( document.documentElement.childNodes ); + +// Provide a fallback method if it does not work +} catch(e){ + makeArray = function(array, results) { + var ret = results || []; + + if ( toString.call(array) === "[object Array]" ) { + Array.prototype.push.apply( ret, array ); + } else { + if ( typeof array.length === "number" ) { + for ( var i = 0, l = array.length; i < l; i++ ) { + ret.push( array[i] ); + } + } else { + for ( var i = 0; array[i]; i++ ) { + ret.push( array[i] ); + } + } + } + + return ret; + }; +} + +var sortOrder; + +if ( document.documentElement.compareDocumentPosition ) { + sortOrder = function( a, b ) { + var ret = a.compareDocumentPosition(b) & 4 ? -1 : a === b ? 0 : 1; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( "sourceIndex" in document.documentElement ) { + sortOrder = function( a, b ) { + var ret = a.sourceIndex - b.sourceIndex; + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} else if ( document.createRange ) { + sortOrder = function( a, b ) { + var aRange = a.ownerDocument.createRange(), bRange = b.ownerDocument.createRange(); + aRange.selectNode(a); + aRange.collapse(true); + bRange.selectNode(b); + bRange.collapse(true); + var ret = aRange.compareBoundaryPoints(Range.START_TO_END, bRange); + if ( ret === 0 ) { + hasDuplicate = true; + } + return ret; + }; +} + +// Check to see if the browser returns elements by name when +// querying by getElementById (and provide a workaround) +(function(){ + // We're going to inject a fake input element with a specified name + var form = document.createElement("form"), + id = "script" + (new Date).getTime(); + form.innerHTML = "<input name='" + id + "'/>"; + + // Inject it into the root element, check its status, and remove it quickly + var root = document.documentElement; + root.insertBefore( form, root.firstChild ); + + // The workaround has to do additional checks after a getElementById + // Which slows things down for other browsers (hence the branching) + if ( !!document.getElementById( id ) ) { + Expr.find.ID = function(match, context, isXML){ + if ( typeof context.getElementById !== "undefined" && !isXML ) { + var m = context.getElementById(match[1]); + return m ? m.id === match[1] || typeof m.getAttributeNode !== "undefined" && m.getAttributeNode("id").nodeValue === match[1] ? [m] : undefined : []; + } + }; + + Expr.filter.ID = function(elem, match){ + var node = typeof elem.getAttributeNode !== "undefined" && elem.getAttributeNode("id"); + return elem.nodeType === 1 && node && node.nodeValue === match; + }; + } + + root.removeChild( form ); +})(); + +(function(){ + // Check to see if the browser returns only elements + // when doing getElementsByTagName("*") + + // Create a fake element + var div = document.createElement("div"); + div.appendChild( document.createComment("") ); + + // Make sure no comments are found + if ( div.getElementsByTagName("*").length > 0 ) { + Expr.find.TAG = function(match, context){ + var results = context.getElementsByTagName(match[1]); + + // Filter out possible comments + if ( match[1] === "*" ) { + var tmp = []; + + for ( var i = 0; results[i]; i++ ) { + if ( results[i].nodeType === 1 ) { + tmp.push( results[i] ); + } + } + + results = tmp; + } + + return results; + }; + } + + // Check to see if an attribute returns normalized href attributes + div.innerHTML = "<a href='#'></a>"; + if ( div.firstChild && typeof div.firstChild.getAttribute !== "undefined" && + div.firstChild.getAttribute("href") !== "#" ) { + Expr.attrHandle.href = function(elem){ + return elem.getAttribute("href", 2); + }; + } +})(); + +if ( document.querySelectorAll ) (function(){ + var oldSizzle = Sizzle, div = document.createElement("div"); + div.innerHTML = "<p class='TEST'></p>"; + + // Safari can't handle uppercase or unicode characters when + // in quirks mode. + if ( div.querySelectorAll && div.querySelectorAll(".TEST").length === 0 ) { + return; + } + + Sizzle = function(query, context, extra, seed){ + context = context || document; + + // Only use querySelectorAll on non-XML documents + // (ID selectors don't work in non-HTML documents) + if ( !seed && context.nodeType === 9 && !isXML(context) ) { + try { + return makeArray( context.querySelectorAll(query), extra ); + } catch(e){} + } + + return oldSizzle(query, context, extra, seed); + }; + + Sizzle.find = oldSizzle.find; + Sizzle.filter = oldSizzle.filter; + Sizzle.selectors = oldSizzle.selectors; + Sizzle.matches = oldSizzle.matches; +})(); + +if ( document.getElementsByClassName && document.documentElement.getElementsByClassName ) (function(){ + var div = document.createElement("div"); + div.innerHTML = "<div class='test e'></div><div class='test'></div>"; + + // Opera can't find a second classname (in 9.6) + if ( div.getElementsByClassName("e").length === 0 ) + return; + + // Safari caches class attributes, doesn't catch changes (in 3.2) + div.lastChild.className = "e"; + + if ( div.getElementsByClassName("e").length === 1 ) + return; + + Expr.order.splice(1, 0, "CLASS"); + Expr.find.CLASS = function(match, context, isXML) { + if ( typeof context.getElementsByClassName !== "undefined" && !isXML ) { + return context.getElementsByClassName(match[1]); + } + }; +})(); + +function dirNodeCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ){ + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 && !isXML ){ + elem.sizcache = doneName; + elem.sizset = i; + } + + if ( elem.nodeName === cur ) { + match = elem; + break; + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +function dirCheck( dir, cur, doneName, checkSet, nodeCheck, isXML ) { + var sibDir = dir == "previousSibling" && !isXML; + for ( var i = 0, l = checkSet.length; i < l; i++ ) { + var elem = checkSet[i]; + if ( elem ) { + if ( sibDir && elem.nodeType === 1 ) { + elem.sizcache = doneName; + elem.sizset = i; + } + elem = elem[dir]; + var match = false; + + while ( elem ) { + if ( elem.sizcache === doneName ) { + match = checkSet[elem.sizset]; + break; + } + + if ( elem.nodeType === 1 ) { + if ( !isXML ) { + elem.sizcache = doneName; + elem.sizset = i; + } + if ( typeof cur !== "string" ) { + if ( elem === cur ) { + match = true; + break; + } + + } else if ( Sizzle.filter( cur, [elem] ).length > 0 ) { + match = elem; + break; + } + } + + elem = elem[dir]; + } + + checkSet[i] = match; + } + } +} + +var contains = document.compareDocumentPosition ? function(a, b){ + return a.compareDocumentPosition(b) & 16; +} : function(a, b){ + return a !== b && (a.contains ? a.contains(b) : true); +}; + +var isXML = function(elem){ + return elem.nodeType === 9 && elem.documentElement.nodeName !== "HTML" || + !!elem.ownerDocument && isXML( elem.ownerDocument ); +}; + +var posProcess = function(selector, context){ + var tmpSet = [], later = "", match, + root = context.nodeType ? [context] : context; + + // Position selectors must be done after the filter + // And so must :not(positional) so we move all PSEUDOs to the end + while ( (match = Expr.match.PSEUDO.exec( selector )) ) { + later += match[0]; + selector = selector.replace( Expr.match.PSEUDO, "" ); + } + + selector = Expr.relative[selector] ? selector + "*" : selector; + + for ( var i = 0, l = root.length; i < l; i++ ) { + Sizzle( selector, root[i], tmpSet ); + } + + return Sizzle.filter( later, tmpSet ); +}; + +// EXPOSE +jQuery.find = Sizzle; +jQuery.filter = Sizzle.filter; +jQuery.expr = Sizzle.selectors; +jQuery.expr[":"] = jQuery.expr.filters; + +Sizzle.selectors.filters.hidden = function(elem){ + return elem.offsetWidth === 0 || elem.offsetHeight === 0; +}; + +Sizzle.selectors.filters.visible = function(elem){ + return elem.offsetWidth > 0 || elem.offsetHeight > 0; +}; + +Sizzle.selectors.filters.animated = function(elem){ + return jQuery.grep(jQuery.timers, function(fn){ + return elem === fn.elem; + }).length; +}; + +jQuery.multiFilter = function( expr, elems, not ) { + if ( not ) { + expr = ":not(" + expr + ")"; + } + + return Sizzle.matches(expr, elems); +}; + +jQuery.dir = function( elem, dir ){ + var matched = [], cur = elem[dir]; + while ( cur && cur != document ) { + if ( cur.nodeType == 1 ) + matched.push( cur ); + cur = cur[dir]; + } + return matched; +}; + +jQuery.nth = function(cur, result, dir, elem){ + result = result || 1; + var num = 0; + + for ( ; cur; cur = cur[dir] ) + if ( cur.nodeType == 1 && ++num == result ) + break; + + return cur; +}; + +jQuery.sibling = function(n, elem){ + var r = []; + + for ( ; n; n = n.nextSibling ) { + if ( n.nodeType == 1 && n != elem ) + r.push( n ); + } + + return r; +}; + +return; + +window.Sizzle = Sizzle; + +})(); +/* + * A number of helper functions used for managing events. + * Many of the ideas behind this code originated from + * Dean Edwards' addEvent library. + */ +jQuery.event = { + + // Bind an event to an element + // Original by Dean Edwards + add: function(elem, types, handler, data) { + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + // For whatever reason, IE has trouble passing the window object + // around, causing it to be cloned in the process + if ( elem.setInterval && elem != window ) + elem = window; + + // Make sure that the function being executed has a unique ID + if ( !handler.guid ) + handler.guid = this.guid++; + + // if data is passed, bind to handler + if ( data !== undefined ) { + // Create temporary function pointer to original handler + var fn = handler; + + // Create unique handler function, wrapped around original handler + handler = this.proxy( fn ); + + // Store data in unique handler + handler.data = data; + } + + // Init the element's event structure + var events = jQuery.data(elem, "events") || jQuery.data(elem, "events", {}), + handle = jQuery.data(elem, "handle") || jQuery.data(elem, "handle", function(){ + // Handle the second event of a trigger and when + // an event is called after a page has unloaded + return typeof jQuery !== "undefined" && !jQuery.event.triggered ? + jQuery.event.handle.apply(arguments.callee.elem, arguments) : + undefined; + }); + // Add elem as a property of the handle function + // This is to prevent a memory leak with non-native + // event in IE. + handle.elem = elem; + + // Handle multiple events separated by a space + // jQuery(...).bind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type) { + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + handler.type = namespaces.slice().sort().join("."); + + // Get the current list of functions bound to this event + var handlers = events[type]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].setup.call(elem, data, namespaces); + + // Init the event handler queue + if (!handlers) { + handlers = events[type] = {}; + + // Check for a special event handler + // Only use addEventListener/attachEvent if the special + // events handler returns false + if ( !jQuery.event.special[type] || jQuery.event.special[type].setup.call(elem, data, namespaces) === false ) { + // Bind the global event handler to the element + if (elem.addEventListener) + elem.addEventListener(type, handle, false); + else if (elem.attachEvent) + elem.attachEvent("on" + type, handle); + } + } + + // Add the function to the element's handler list + handlers[handler.guid] = handler; + + // Keep track of which events have been used, for global triggering + jQuery.event.global[type] = true; + }); + + // Nullify elem to prevent memory leaks in IE + elem = null; + }, + + guid: 1, + global: {}, + + // Detach an event or set of events from an element + remove: function(elem, types, handler) { + // don't do events on text and comment nodes + if ( elem.nodeType == 3 || elem.nodeType == 8 ) + return; + + var events = jQuery.data(elem, "events"), ret, index; + + if ( events ) { + // Unbind all events for the element + if ( types === undefined || (typeof types === "string" && types.charAt(0) == ".") ) + for ( var type in events ) + this.remove( elem, type + (types || "") ); + else { + // types is actually an event object here + if ( types.type ) { + handler = types.handler; + types = types.type; + } + + // Handle multiple events seperated by a space + // jQuery(...).unbind("mouseover mouseout", fn); + jQuery.each(types.split(/\s+/), function(index, type){ + // Namespaced event handlers + var namespaces = type.split("."); + type = namespaces.shift(); + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + if ( events[type] ) { + // remove the given handler for the given type + if ( handler ) + delete events[type][handler.guid]; + + // remove all handlers for the given type + else + for ( var handle in events[type] ) + // Handle the removal of namespaced events + if ( namespace.test(events[type][handle].type) ) + delete events[type][handle]; + + if ( jQuery.event.specialAll[type] ) + jQuery.event.specialAll[type].teardown.call(elem, namespaces); + + // remove generic event handler if no more handlers exist + for ( ret in events[type] ) break; + if ( !ret ) { + if ( !jQuery.event.special[type] || jQuery.event.special[type].teardown.call(elem, namespaces) === false ) { + if (elem.removeEventListener) + elem.removeEventListener(type, jQuery.data(elem, "handle"), false); + else if (elem.detachEvent) + elem.detachEvent("on" + type, jQuery.data(elem, "handle")); + } + ret = null; + delete events[type]; + } + } + }); + } + + // Remove the expando if it's no longer used + for ( ret in events ) break; + if ( !ret ) { + var handle = jQuery.data( elem, "handle" ); + if ( handle ) handle.elem = null; + jQuery.removeData( elem, "events" ); + jQuery.removeData( elem, "handle" ); + } + } + }, + + // bubbling is internal + trigger: function( event, data, elem, bubbling ) { + // Event object or event type + var type = event.type || event; + + if( !bubbling ){ + event = typeof event === "object" ? + // jQuery.Event object + event[expando] ? event : + // Object literal + jQuery.extend( jQuery.Event(type), event ) : + // Just the event type (string) + jQuery.Event(type); + + if ( type.indexOf("!") >= 0 ) { + event.type = type = type.slice(0, -1); + event.exclusive = true; + } + + // Handle a global trigger + if ( !elem ) { + // Don't bubble custom events when global (to avoid too much overhead) + event.stopPropagation(); + // Only trigger if we've ever bound an event for it + if ( this.global[type] ) + jQuery.each( jQuery.cache, function(){ + if ( this.events && this.events[type] ) + jQuery.event.trigger( event, data, this.handle.elem ); + }); + } + + // Handle triggering a single element + + // don't do events on text and comment nodes + if ( !elem || elem.nodeType == 3 || elem.nodeType == 8 ) + return undefined; + + // Clean up in case it is reused + event.result = undefined; + event.target = elem; + + // Clone the incoming data, if any + data = jQuery.makeArray(data); + data.unshift( event ); + } + + event.currentTarget = elem; + + // Trigger the event, it is assumed that "handle" is a function + var handle = jQuery.data(elem, "handle"); + if ( handle ) + handle.apply( elem, data ); + + // Handle triggering native .onfoo handlers (and on links since we don't call .click() for links) + if ( (!elem[type] || (jQuery.nodeName(elem, 'a') && type == "click")) && elem["on"+type] && elem["on"+type].apply( elem, data ) === false ) + event.result = false; + + // Trigger the native events (except for clicks on links) + if ( !bubbling && elem[type] && !event.isDefaultPrevented() && !(jQuery.nodeName(elem, 'a') && type == "click") ) { + this.triggered = true; + try { + elem[ type ](); + // prevent IE from throwing an error for some hidden elements + } catch (e) {} + } + + this.triggered = false; + + if ( !event.isPropagationStopped() ) { + var parent = elem.parentNode || elem.ownerDocument; + if ( parent ) + jQuery.event.trigger(event, data, parent, true); + } + }, + + handle: function(event) { + // returned undefined or false + var all, handlers; + + event = arguments[0] = jQuery.event.fix( event || window.event ); + event.currentTarget = this; + + // Namespaced event handlers + var namespaces = event.type.split("."); + event.type = namespaces.shift(); + + // Cache this now, all = true means, any handler + all = !namespaces.length && !event.exclusive; + + var namespace = RegExp("(^|\\.)" + namespaces.slice().sort().join(".*\\.") + "(\\.|$)"); + + handlers = ( jQuery.data(this, "events") || {} )[event.type]; + + for ( var j in handlers ) { + var handler = handlers[j]; + + // Filter the functions by class + if ( all || namespace.test(handler.type) ) { + // Pass in a reference to the handler function itself + // So that we can later remove it + event.handler = handler; + event.data = handler.data; + + var ret = handler.apply(this, arguments); + + if( ret !== undefined ){ + event.result = ret; + if ( ret === false ) { + event.preventDefault(); + event.stopPropagation(); + } + } + + if( event.isImmediatePropagationStopped() ) + break; + + } + } + }, + + props: "altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode metaKey newValue originalTarget pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), + + fix: function(event) { + if ( event[expando] ) + return event; + + // store a copy of the original event object + // and "clone" to set read-only properties + var originalEvent = event; + event = jQuery.Event( originalEvent ); + + for ( var i = this.props.length, prop; i; ){ + prop = this.props[ --i ]; + event[ prop ] = originalEvent[ prop ]; + } + + // Fix target property, if necessary + if ( !event.target ) + event.target = event.srcElement || document; // Fixes #1925 where srcElement might not be defined either + + // check if target is a textnode (safari) + if ( event.target.nodeType == 3 ) + event.target = event.target.parentNode; + + // Add relatedTarget, if necessary + if ( !event.relatedTarget && event.fromElement ) + event.relatedTarget = event.fromElement == event.target ? event.toElement : event.fromElement; + + // Calculate pageX/Y if missing and clientX/Y available + if ( event.pageX == null && event.clientX != null ) { + var doc = document.documentElement, body = document.body; + event.pageX = event.clientX + (doc && doc.scrollLeft || body && body.scrollLeft || 0) - (doc.clientLeft || 0); + event.pageY = event.clientY + (doc && doc.scrollTop || body && body.scrollTop || 0) - (doc.clientTop || 0); + } + + // Add which for key events + if ( !event.which && ((event.charCode || event.charCode === 0) ? event.charCode : event.keyCode) ) + event.which = event.charCode || event.keyCode; + + // Add metaKey to non-Mac browsers (use ctrl for PC's and Meta for Macs) + if ( !event.metaKey && event.ctrlKey ) + event.metaKey = event.ctrlKey; + + // Add which for click: 1 == left; 2 == middle; 3 == right + // Note: button is not normalized, so don't use it + if ( !event.which && event.button ) + event.which = (event.button & 1 ? 1 : ( event.button & 2 ? 3 : ( event.button & 4 ? 2 : 0 ) )); + + return event; + }, + + proxy: function( fn, proxy ){ + proxy = proxy || function(){ return fn.apply(this, arguments); }; + // Set the guid of unique handler to the same of original handler, so it can be removed + proxy.guid = fn.guid = fn.guid || proxy.guid || this.guid++; + // So proxy can be declared as an argument + return proxy; + }, + + special: { + ready: { + // Make sure the ready event is setup + setup: bindReady, + teardown: function() {} + } + }, + + specialAll: { + live: { + setup: function( selector, namespaces ){ + jQuery.event.add( this, namespaces[0], liveHandler ); + }, + teardown: function( namespaces ){ + if ( namespaces.length ) { + var remove = 0, name = RegExp("(^|\\.)" + namespaces[0] + "(\\.|$)"); + + jQuery.each( (jQuery.data(this, "events").live || {}), function(){ + if ( name.test(this.type) ) + remove++; + }); + + if ( remove < 1 ) + jQuery.event.remove( this, namespaces[0], liveHandler ); + } + } + } + } +}; + +jQuery.Event = function( src ){ + // Allow instantiation without the 'new' keyword + if( !this.preventDefault ) + return new jQuery.Event(src); + + // Event object + if( src && src.type ){ + this.originalEvent = src; + this.type = src.type; + // Event type + }else + this.type = src; + + // timeStamp is buggy for some events on Firefox(#3843) + // So we won't rely on the native value + this.timeStamp = now(); + + // Mark it as fixed + this[expando] = true; +}; + +function returnFalse(){ + return false; +} +function returnTrue(){ + return true; +} + +// jQuery.Event is based on DOM3 Events as specified by the ECMAScript Language Binding +// http://www.w3.org/TR/2003/WD-DOM-Level-3-Events-20030331/ecma-script-binding.html +jQuery.Event.prototype = { + preventDefault: function() { + this.isDefaultPrevented = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if preventDefault exists run it on the original event + if (e.preventDefault) + e.preventDefault(); + // otherwise set the returnValue property of the original event to false (IE) + e.returnValue = false; + }, + stopPropagation: function() { + this.isPropagationStopped = returnTrue; + + var e = this.originalEvent; + if( !e ) + return; + // if stopPropagation exists run it on the original event + if (e.stopPropagation) + e.stopPropagation(); + // otherwise set the cancelBubble property of the original event to true (IE) + e.cancelBubble = true; + }, + stopImmediatePropagation:function(){ + this.isImmediatePropagationStopped = returnTrue; + this.stopPropagation(); + }, + isDefaultPrevented: returnFalse, + isPropagationStopped: returnFalse, + isImmediatePropagationStopped: returnFalse +}; +// Checks if an event happened on an element within another element +// Used in jQuery.event.special.mouseenter and mouseleave handlers +var withinElement = function(event) { + // Check if mouse(over|out) are still within the same parent element + var parent = event.relatedTarget; + // Traverse up the tree + while ( parent && parent != this ) + try { parent = parent.parentNode; } + catch(e) { parent = this; } + + if( parent != this ){ + // set the correct event type + event.type = event.data; + // handle event if we actually just moused on to a non sub-element + jQuery.event.handle.apply( this, arguments ); + } +}; + +jQuery.each({ + mouseover: 'mouseenter', + mouseout: 'mouseleave' +}, function( orig, fix ){ + jQuery.event.special[ fix ] = { + setup: function(){ + jQuery.event.add( this, orig, withinElement, fix ); + }, + teardown: function(){ + jQuery.event.remove( this, orig, withinElement ); + } + }; +}); + +jQuery.fn.extend({ + bind: function( type, data, fn ) { + return type == "unload" ? this.one(type, data, fn) : this.each(function(){ + jQuery.event.add( this, type, fn || data, fn && data ); + }); + }, + + one: function( type, data, fn ) { + var one = jQuery.event.proxy( fn || data, function(event) { + jQuery(this).unbind(event, one); + return (fn || data).apply( this, arguments ); + }); + return this.each(function(){ + jQuery.event.add( this, type, one, fn && data); + }); + }, + + unbind: function( type, fn ) { + return this.each(function(){ + jQuery.event.remove( this, type, fn ); + }); + }, + + trigger: function( type, data ) { + return this.each(function(){ + jQuery.event.trigger( type, data, this ); + }); + }, + + triggerHandler: function( type, data ) { + if( this[0] ){ + var event = jQuery.Event(type); + event.preventDefault(); + event.stopPropagation(); + jQuery.event.trigger( event, data, this[0] ); + return event.result; + } + }, + + toggle: function( fn ) { + // Save reference to arguments for access in closure + var args = arguments, i = 1; + + // link all the functions, so any of them can unbind this click handler + while( i < args.length ) + jQuery.event.proxy( fn, args[i++] ); + + return this.click( jQuery.event.proxy( fn, function(event) { + // Figure out which function to execute + this.lastToggle = ( this.lastToggle || 0 ) % i; + + // Make sure that clicks stop + event.preventDefault(); + + // and execute the function + return args[ this.lastToggle++ ].apply( this, arguments ) || false; + })); + }, + + hover: function(fnOver, fnOut) { + return this.mouseenter(fnOver).mouseleave(fnOut); + }, + + ready: function(fn) { + // Attach the listeners + bindReady(); + + // If the DOM is already ready + if ( jQuery.isReady ) + // Execute the function immediately + fn.call( document, jQuery ); + + // Otherwise, remember the function for later + else + // Add the function to the wait list + jQuery.readyList.push( fn ); + + return this; + }, + + live: function( type, fn ){ + var proxy = jQuery.event.proxy( fn ); + proxy.guid += this.selector + type; + + jQuery(document).bind( liveConvert(type, this.selector), this.selector, proxy ); + + return this; + }, + + die: function( type, fn ){ + jQuery(document).unbind( liveConvert(type, this.selector), fn ? { guid: fn.guid + this.selector + type } : null ); + return this; + } +}); + +function liveHandler( event ){ + var check = RegExp("(^|\\.)" + event.type + "(\\.|$)"), + stop = true, + elems = []; + + jQuery.each(jQuery.data(this, "events").live || [], function(i, fn){ + if ( check.test(fn.type) ) { + var elem = jQuery(event.target).closest(fn.data)[0]; + if ( elem ) + elems.push({ elem: elem, fn: fn }); + } + }); + + elems.sort(function(a,b) { + return jQuery.data(a.elem, "closest") - jQuery.data(b.elem, "closest"); + }); + + jQuery.each(elems, function(){ + if ( this.fn.call(this.elem, event, this.fn.data) === false ) + return (stop = false); + }); + + return stop; +} + +function liveConvert(type, selector){ + return ["live", type, selector.replace(/\./g, "`").replace(/ /g, "|")].join("."); +} + +jQuery.extend({ + isReady: false, + readyList: [], + // Handle when the DOM is ready + ready: function() { + // Make sure that the DOM is not already loaded + if ( !jQuery.isReady ) { + // Remember that the DOM is ready + jQuery.isReady = true; + + // If there are functions bound, to execute + if ( jQuery.readyList ) { + // Execute all of them + jQuery.each( jQuery.readyList, function(){ + this.call( document, jQuery ); + }); + + // Reset the list of functions + jQuery.readyList = null; + } + + // Trigger any bound ready events + jQuery(document).triggerHandler("ready"); + } + } +}); + +var readyBound = false; + +function bindReady(){ + if ( readyBound ) return; + readyBound = true; + + // Mozilla, Opera and webkit nightlies currently support this event + if ( document.addEventListener ) { + // Use the handy event callback + document.addEventListener( "DOMContentLoaded", function(){ + document.removeEventListener( "DOMContentLoaded", arguments.callee, false ); + jQuery.ready(); + }, false ); + + // If IE event model is used + } else if ( document.attachEvent ) { + // ensure firing before onload, + // maybe late but safe also for iframes + document.attachEvent("onreadystatechange", function(){ + if ( document.readyState === "complete" ) { + document.detachEvent( "onreadystatechange", arguments.callee ); + jQuery.ready(); + } + }); + + // If IE and not an iframe + // continually check to see if the document is ready + if ( document.documentElement.doScroll && window == window.top ) (function(){ + if ( jQuery.isReady ) return; + + try { + // If IE is used, use the trick by Diego Perini + // http://javascript.nwbox.com/IEContentLoaded/ + document.documentElement.doScroll("left"); + } catch( error ) { + setTimeout( arguments.callee, 0 ); + return; + } + + // and execute any waiting functions + jQuery.ready(); + })(); + } + + // A fallback to window.onload, that will always work + jQuery.event.add( window, "load", jQuery.ready ); +} + +jQuery.each( ("blur,focus,load,resize,scroll,unload,click,dblclick," + + "mousedown,mouseup,mousemove,mouseover,mouseout,mouseenter,mouseleave," + + "change,select,submit,keydown,keypress,keyup,error").split(","), function(i, name){ + + // Handle event binding + jQuery.fn[name] = function(fn){ + return fn ? this.bind(name, fn) : this.trigger(name); + }; +}); + +// Prevent memory leaks in IE +// And prevent errors on refresh with events like mouseover in other browsers +// Window isn't included so as not to unbind existing unload events +jQuery( window ).bind( 'unload', function(){ + for ( var id in jQuery.cache ) + // Skip the window + if ( id != 1 && jQuery.cache[ id ].handle ) + jQuery.event.remove( jQuery.cache[ id ].handle.elem ); +}); +(function(){ + + jQuery.support = {}; + + var root = document.documentElement, + script = document.createElement("script"), + div = document.createElement("div"), + id = "script" + (new Date).getTime(); + + div.style.display = "none"; + div.innerHTML = ' <link/><table></table><a href="/a" style="color:red;float:left;opacity:.5;">a</a><select><option>text</option></select><object><param/></object>'; + + var all = div.getElementsByTagName("*"), + a = div.getElementsByTagName("a")[0]; + + // Can't get basic test support + if ( !all || !all.length || !a ) { + return; + } + + jQuery.support = { + // IE strips leading whitespace when .innerHTML is used + leadingWhitespace: div.firstChild.nodeType == 3, + + // Make sure that tbody elements aren't automatically inserted + // IE will insert them into empty tables + tbody: !div.getElementsByTagName("tbody").length, + + // Make sure that you can get all elements in an <object> element + // IE 7 always returns no results + objectAll: !!div.getElementsByTagName("object")[0] + .getElementsByTagName("*").length, + + // Make sure that link elements get serialized correctly by innerHTML + // This requires a wrapper element in IE + htmlSerialize: !!div.getElementsByTagName("link").length, + + // Get the style information from getAttribute + // (IE uses .cssText insted) + style: /red/.test( a.getAttribute("style") ), + + // Make sure that URLs aren't manipulated + // (IE normalizes it by default) + hrefNormalized: a.getAttribute("href") === "/a", + + // Make sure that element opacity exists + // (IE uses filter instead) + opacity: a.style.opacity === "0.5", + + // Verify style float existence + // (IE uses styleFloat instead of cssFloat) + cssFloat: !!a.style.cssFloat, + + // Will be defined later + scriptEval: false, + noCloneEvent: true, + boxModel: null + }; + + script.type = "text/javascript"; + try { + script.appendChild( document.createTextNode( "window." + id + "=1;" ) ); + } catch(e){} + + root.insertBefore( script, root.firstChild ); + + // Make sure that the execution of code works by injecting a script + // tag with appendChild/createTextNode + // (IE doesn't support this, fails, and uses .text instead) + if ( window[ id ] ) { + jQuery.support.scriptEval = true; + delete window[ id ]; + } + + root.removeChild( script ); + + if ( div.attachEvent && div.fireEvent ) { + div.attachEvent("onclick", function(){ + // Cloning a node shouldn't copy over any + // bound event handlers (IE does this) + jQuery.support.noCloneEvent = false; + div.detachEvent("onclick", arguments.callee); + }); + div.cloneNode(true).fireEvent("onclick"); + } + + // Figure out if the W3C box model works as expected + // document.body must exist before we can do this + jQuery(function(){ + var div = document.createElement("div"); + div.style.width = div.style.paddingLeft = "1px"; + + document.body.appendChild( div ); + jQuery.boxModel = jQuery.support.boxModel = div.offsetWidth === 2; + document.body.removeChild( div ).style.display = 'none'; + }); +})(); + +var styleFloat = jQuery.support.cssFloat ? "cssFloat" : "styleFloat"; + +jQuery.props = { + "for": "htmlFor", + "class": "className", + "float": styleFloat, + cssFloat: styleFloat, + styleFloat: styleFloat, + readonly: "readOnly", + maxlength: "maxLength", + cellspacing: "cellSpacing", + rowspan: "rowSpan", + tabindex: "tabIndex" +}; +jQuery.fn.extend({ + // Keep a copy of the old load + _load: jQuery.fn.load, + + load: function( url, params, callback ) { + if ( typeof url !== "string" ) + return this._load( url ); + + var off = url.indexOf(" "); + if ( off >= 0 ) { + var selector = url.slice(off, url.length); + url = url.slice(0, off); + } + + // Default to a GET request + var type = "GET"; + + // If the second parameter was provided + if ( params ) + // If it's a function + if ( jQuery.isFunction( params ) ) { + // We assume that it's the callback + callback = params; + params = null; + + // Otherwise, build a param string + } else if( typeof params === "object" ) { + params = jQuery.param( params ); + type = "POST"; + } + + var self = this; + + // Request the remote document + jQuery.ajax({ + url: url, + type: type, + dataType: "html", + data: params, + complete: function(res, status){ + // If successful, inject the HTML into all the matched elements + if ( status == "success" || status == "notmodified" ) + // See if a selector was specified + self.html( selector ? + // Create a dummy div to hold the results + jQuery("<div/>") + // inject the contents of the document in, removing the scripts + // to avoid any 'Permission Denied' errors in IE + .append(res.responseText.replace(/<script(.|\s)*?\/script>/g, "")) + + // Locate the specified elements + .find(selector) : + + // If not, just inject the full result + res.responseText ); + + if( callback ) + self.each( callback, [res.responseText, status, res] ); + } + }); + return this; + }, + + serialize: function() { + return jQuery.param(this.serializeArray()); + }, + serializeArray: function() { + return this.map(function(){ + return this.elements ? jQuery.makeArray(this.elements) : this; + }) + .filter(function(){ + return this.name && !this.disabled && + (this.checked || /select|textarea/i.test(this.nodeName) || + /text|hidden|password|search/i.test(this.type)); + }) + .map(function(i, elem){ + var val = jQuery(this).val(); + return val == null ? null : + jQuery.isArray(val) ? + jQuery.map( val, function(val, i){ + return {name: elem.name, value: val}; + }) : + {name: elem.name, value: val}; + }).get(); + } +}); + +// Attach a bunch of functions for handling common AJAX events +jQuery.each( "ajaxStart,ajaxStop,ajaxComplete,ajaxError,ajaxSuccess,ajaxSend".split(","), function(i,o){ + jQuery.fn[o] = function(f){ + return this.bind(o, f); + }; +}); + +var jsc = now(); + +jQuery.extend({ + + get: function( url, data, callback, type ) { + // shift arguments if data argument was ommited + if ( jQuery.isFunction( data ) ) { + callback = data; + data = null; + } + + return jQuery.ajax({ + type: "GET", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + getScript: function( url, callback ) { + return jQuery.get(url, null, callback, "script"); + }, + + getJSON: function( url, data, callback ) { + return jQuery.get(url, data, callback, "json"); + }, + + post: function( url, data, callback, type ) { + if ( jQuery.isFunction( data ) ) { + callback = data; + data = {}; + } + + return jQuery.ajax({ + type: "POST", + url: url, + data: data, + success: callback, + dataType: type + }); + }, + + ajaxSetup: function( settings ) { + jQuery.extend( jQuery.ajaxSettings, settings ); + }, + + ajaxSettings: { + url: location.href, + global: true, + type: "GET", + contentType: "application/x-www-form-urlencoded", + processData: true, + async: true, + /* + timeout: 0, + data: null, + username: null, + password: null, + */ + // Create the request object; Microsoft failed to properly + // implement the XMLHttpRequest in IE7, so we use the ActiveXObject when it is available + // This function can be overriden by calling jQuery.ajaxSetup + xhr:function(){ + return window.ActiveXObject ? new ActiveXObject("Microsoft.XMLHTTP") : new XMLHttpRequest(); + }, + accepts: { + xml: "application/xml, text/xml", + html: "text/html", + script: "text/javascript, application/javascript", + json: "application/json, text/javascript", + text: "text/plain", + _default: "*/*" + } + }, + + // Last-Modified header cache for next request + lastModified: {}, + + ajax: function( s ) { + // Extend the settings, but re-extend 's' so that it can be + // checked again later (in the test suite, specifically) + s = jQuery.extend(true, s, jQuery.extend(true, {}, jQuery.ajaxSettings, s)); + + var jsonp, jsre = /=\?(&|$)/g, status, data, + type = s.type.toUpperCase(); + + // convert data if not already a string + if ( s.data && s.processData && typeof s.data !== "string" ) + s.data = jQuery.param(s.data); + + // Handle JSONP Parameter Callbacks + if ( s.dataType == "jsonp" ) { + if ( type == "GET" ) { + if ( !s.url.match(jsre) ) + s.url += (s.url.match(/\?/) ? "&" : "?") + (s.jsonp || "callback") + "=?"; + } else if ( !s.data || !s.data.match(jsre) ) + s.data = (s.data ? s.data + "&" : "") + (s.jsonp || "callback") + "=?"; + s.dataType = "json"; + } + + // Build temporary JSONP function + if ( s.dataType == "json" && (s.data && s.data.match(jsre) || s.url.match(jsre)) ) { + jsonp = "jsonp" + jsc++; + + // Replace the =? sequence both in the query string and the data + if ( s.data ) + s.data = (s.data + "").replace(jsre, "=" + jsonp + "$1"); + s.url = s.url.replace(jsre, "=" + jsonp + "$1"); + + // We need to make sure + // that a JSONP style response is executed properly + s.dataType = "script"; + + // Handle JSONP-style loading + window[ jsonp ] = function(tmp){ + data = tmp; + success(); + complete(); + // Garbage collect + window[ jsonp ] = undefined; + try{ delete window[ jsonp ]; } catch(e){} + if ( head ) + head.removeChild( script ); + }; + } + + if ( s.dataType == "script" && s.cache == null ) + s.cache = false; + + if ( s.cache === false && type == "GET" ) { + var ts = now(); + // try replacing _= if it is there + var ret = s.url.replace(/(\?|&)_=.*?(&|$)/, "$1_=" + ts + "$2"); + // if nothing was replaced, add timestamp to the end + s.url = ret + ((ret == s.url) ? (s.url.match(/\?/) ? "&" : "?") + "_=" + ts : ""); + } + + // If data is available, append data to url for get requests + if ( s.data && type == "GET" ) { + s.url += (s.url.match(/\?/) ? "&" : "?") + s.data; + + // IE likes to send both get and post data, prevent this + s.data = null; + } + + // Watch for a new set of requests + if ( s.global && ! jQuery.active++ ) + jQuery.event.trigger( "ajaxStart" ); + + // Matches an absolute URL, and saves the domain + var parts = /^(\w+:)?\/\/([^\/?#]+)/.exec( s.url ); + + // If we're requesting a remote document + // and trying to load JSON or Script with a GET + if ( s.dataType == "script" && type == "GET" && parts + && ( parts[1] && parts[1] != location.protocol || parts[2] != location.host )){ + + var head = document.getElementsByTagName("head")[0]; + var script = document.createElement("script"); + script.src = s.url; + if (s.scriptCharset) + script.charset = s.scriptCharset; + + // Handle Script loading + if ( !jsonp ) { + var done = false; + + // Attach handlers for all browsers + script.onload = script.onreadystatechange = function(){ + if ( !done && (!this.readyState || + this.readyState == "loaded" || this.readyState == "complete") ) { + done = true; + success(); + complete(); + + // Handle memory leak in IE + script.onload = script.onreadystatechange = null; + head.removeChild( script ); + } + }; + } + + head.appendChild(script); + + // We handle everything using the script element injection + return undefined; + } + + var requestDone = false; + + // Create the request object + var xhr = s.xhr(); + + // Open the socket + // Passing null username, generates a login popup on Opera (#2865) + if( s.username ) + xhr.open(type, s.url, s.async, s.username, s.password); + else + xhr.open(type, s.url, s.async); + + // Need an extra try/catch for cross domain requests in Firefox 3 + try { + // Set the correct header, if data is being sent + if ( s.data ) + xhr.setRequestHeader("Content-Type", s.contentType); + + // Set the If-Modified-Since header, if ifModified mode. + if ( s.ifModified ) + xhr.setRequestHeader("If-Modified-Since", + jQuery.lastModified[s.url] || "Thu, 01 Jan 1970 00:00:00 GMT" ); + + // Set header so the called script knows that it's an XMLHttpRequest + xhr.setRequestHeader("X-Requested-With", "XMLHttpRequest"); + + // Set the Accepts header for the server, depending on the dataType + xhr.setRequestHeader("Accept", s.dataType && s.accepts[ s.dataType ] ? + s.accepts[ s.dataType ] + ", */*" : + s.accepts._default ); + } catch(e){} + + // Allow custom headers/mimetypes and early abort + if ( s.beforeSend && s.beforeSend(xhr, s) === false ) { + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + // close opended socket + xhr.abort(); + return false; + } + + if ( s.global ) + jQuery.event.trigger("ajaxSend", [xhr, s]); + + // Wait for a response to come back + var onreadystatechange = function(isTimeout){ + // The request was aborted, clear the interval and decrement jQuery.active + if (xhr.readyState == 0) { + if (ival) { + // clear poll interval + clearInterval(ival); + ival = null; + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + // The transfer is complete and the data is available, or the request timed out + } else if ( !requestDone && xhr && (xhr.readyState == 4 || isTimeout == "timeout") ) { + requestDone = true; + + // clear poll interval + if (ival) { + clearInterval(ival); + ival = null; + } + + status = isTimeout == "timeout" ? "timeout" : + !jQuery.httpSuccess( xhr ) ? "error" : + s.ifModified && jQuery.httpNotModified( xhr, s.url ) ? "notmodified" : + "success"; + + if ( status == "success" ) { + // Watch for, and catch, XML document parse errors + try { + // process the data (runs the xml through httpData regardless of callback) + data = jQuery.httpData( xhr, s.dataType, s ); + } catch(e) { + status = "parsererror"; + } + } + + // Make sure that the request was successful or notmodified + if ( status == "success" ) { + // Cache Last-Modified header, if ifModified mode. + var modRes; + try { + modRes = xhr.getResponseHeader("Last-Modified"); + } catch(e) {} // swallow exception thrown by FF if header is not available + + if ( s.ifModified && modRes ) + jQuery.lastModified[s.url] = modRes; + + // JSONP handles its own success callback + if ( !jsonp ) + success(); + } else + jQuery.handleError(s, xhr, status); + + // Fire the complete handlers + complete(); + + if ( isTimeout ) + xhr.abort(); + + // Stop memory leaks + if ( s.async ) + xhr = null; + } + }; + + if ( s.async ) { + // don't attach the handler to the request, just poll it instead + var ival = setInterval(onreadystatechange, 13); + + // Timeout checker + if ( s.timeout > 0 ) + setTimeout(function(){ + // Check to see if the request is still happening + if ( xhr && !requestDone ) + onreadystatechange( "timeout" ); + }, s.timeout); + } + + // Send the data + try { + xhr.send(s.data); + } catch(e) { + jQuery.handleError(s, xhr, null, e); + } + + // firefox 1.5 doesn't fire statechange for sync requests + if ( !s.async ) + onreadystatechange(); + + function success(){ + // If a local callback was specified, fire it and pass it the data + if ( s.success ) + s.success( data, status ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxSuccess", [xhr, s] ); + } + + function complete(){ + // Process result + if ( s.complete ) + s.complete(xhr, status); + + // The request was completed + if ( s.global ) + jQuery.event.trigger( "ajaxComplete", [xhr, s] ); + + // Handle the global AJAX counter + if ( s.global && ! --jQuery.active ) + jQuery.event.trigger( "ajaxStop" ); + } + + // return XMLHttpRequest to allow aborting the request etc. + return xhr; + }, + + handleError: function( s, xhr, status, e ) { + // If a local callback was specified, fire it + if ( s.error ) s.error( xhr, status, e ); + + // Fire the global callback + if ( s.global ) + jQuery.event.trigger( "ajaxError", [xhr, s, e] ); + }, + + // Counter for holding the number of active queries + active: 0, + + // Determines if an XMLHttpRequest was successful or not + httpSuccess: function( xhr ) { + try { + // IE error sometimes returns 1223 when it should be 204 so treat it as success, see #1450 + return !xhr.status && location.protocol == "file:" || + ( xhr.status >= 200 && xhr.status < 300 ) || xhr.status == 304 || xhr.status == 1223; + } catch(e){} + return false; + }, + + // Determines if an XMLHttpRequest returns NotModified + httpNotModified: function( xhr, url ) { + try { + var xhrRes = xhr.getResponseHeader("Last-Modified"); + + // Firefox always returns 200. check Last-Modified date + return xhr.status == 304 || xhrRes == jQuery.lastModified[url]; + } catch(e){} + return false; + }, + + httpData: function( xhr, type, s ) { + var ct = xhr.getResponseHeader("content-type"), + xml = type == "xml" || !type && ct && ct.indexOf("xml") >= 0, + data = xml ? xhr.responseXML : xhr.responseText; + + if ( xml && data.documentElement.tagName == "parsererror" ) + throw "parsererror"; + + // Allow a pre-filtering function to sanitize the response + // s != null is checked to keep backwards compatibility + if( s && s.dataFilter ) + data = s.dataFilter( data, type ); + + // The filter can actually parse the response + if( typeof data === "string" ){ + + // If the type is "script", eval it in global context + if ( type == "script" ) + jQuery.globalEval( data ); + + // Get the JavaScript object, if JSON is used. + if ( type == "json" ) + data = window["eval"]("(" + data + ")"); + } + + return data; + }, + + // Serialize an array of form elements or a set of + // key/values into a query string + param: function( a ) { + var s = [ ]; + + function add( key, value ){ + s[ s.length ] = encodeURIComponent(key) + '=' + encodeURIComponent(value); + }; + + // If an array was passed in, assume that it is an array + // of form elements + if ( jQuery.isArray(a) || a.jquery ) + // Serialize the form elements + jQuery.each( a, function(){ + add( this.name, this.value ); + }); + + // Otherwise, assume that it's an object of key/value pairs + else + // Serialize the key/values + for ( var j in a ) + // If the value is an array then the key names need to be repeated + if ( jQuery.isArray(a[j]) ) + jQuery.each( a[j], function(){ + add( j, this ); + }); + else + add( j, jQuery.isFunction(a[j]) ? a[j]() : a[j] ); + + // Return the resulting serialization + return s.join("&").replace(/%20/g, "+"); + } + +}); +var elemdisplay = {}, + timerId, + fxAttrs = [ + // height animations + [ "height", "marginTop", "marginBottom", "paddingTop", "paddingBottom" ], + // width animations + [ "width", "marginLeft", "marginRight", "paddingLeft", "paddingRight" ], + // opacity animations + [ "opacity" ] + ]; + +function genFx( type, num ){ + var obj = {}; + jQuery.each( fxAttrs.concat.apply([], fxAttrs.slice(0,num)), function(){ + obj[ this ] = type; + }); + return obj; +} + +jQuery.fn.extend({ + show: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("show", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + + this[i].style.display = old || ""; + + if ( jQuery.css(this[i], "display") === "none" ) { + var tagName = this[i].tagName, display; + + if ( elemdisplay[ tagName ] ) { + display = elemdisplay[ tagName ]; + } else { + var elem = jQuery("<" + tagName + " />").appendTo("body"); + + display = elem.css("display"); + if ( display === "none" ) + display = "block"; + + elem.remove(); + + elemdisplay[ tagName ] = display; + } + + jQuery.data(this[i], "olddisplay", display); + } + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( var i = 0, l = this.length; i < l; i++ ){ + this[i].style.display = jQuery.data(this[i], "olddisplay") || ""; + } + + return this; + } + }, + + hide: function(speed,callback){ + if ( speed ) { + return this.animate( genFx("hide", 3), speed, callback); + } else { + for ( var i = 0, l = this.length; i < l; i++ ){ + var old = jQuery.data(this[i], "olddisplay"); + if ( !old && old !== "none" ) + jQuery.data(this[i], "olddisplay", jQuery.css(this[i], "display")); + } + + // Set the display of the elements in a second loop + // to avoid the constant reflow + for ( var i = 0, l = this.length; i < l; i++ ){ + this[i].style.display = "none"; + } + + return this; + } + }, + + // Save the old toggle function + _toggle: jQuery.fn.toggle, + + toggle: function( fn, fn2 ){ + var bool = typeof fn === "boolean"; + + return jQuery.isFunction(fn) && jQuery.isFunction(fn2) ? + this._toggle.apply( this, arguments ) : + fn == null || bool ? + this.each(function(){ + var state = bool ? fn : jQuery(this).is(":hidden"); + jQuery(this)[ state ? "show" : "hide" ](); + }) : + this.animate(genFx("toggle", 3), fn, fn2); + }, + + fadeTo: function(speed,to,callback){ + return this.animate({opacity: to}, speed, callback); + }, + + animate: function( prop, speed, easing, callback ) { + var optall = jQuery.speed(speed, easing, callback); + + return this[ optall.queue === false ? "each" : "queue" ](function(){ + + var opt = jQuery.extend({}, optall), p, + hidden = this.nodeType == 1 && jQuery(this).is(":hidden"), + self = this; + + for ( p in prop ) { + if ( prop[p] == "hide" && hidden || prop[p] == "show" && !hidden ) + return opt.complete.call(this); + + if ( ( p == "height" || p == "width" ) && this.style ) { + // Store display property + opt.display = jQuery.css(this, "display"); + + // Make sure that nothing sneaks out + opt.overflow = this.style.overflow; + } + } + + if ( opt.overflow != null ) + this.style.overflow = "hidden"; + + opt.curAnim = jQuery.extend({}, prop); + + jQuery.each( prop, function(name, val){ + var e = new jQuery.fx( self, opt, name ); + + if ( /toggle|show|hide/.test(val) ) + e[ val == "toggle" ? hidden ? "show" : "hide" : val ]( prop ); + else { + var parts = val.toString().match(/^([+-]=)?([\d+-.]+)(.*)$/), + start = e.cur(true) || 0; + + if ( parts ) { + var end = parseFloat(parts[2]), + unit = parts[3] || "px"; + + // We need to compute starting value + if ( unit != "px" ) { + self.style[ name ] = (end || 1) + unit; + start = ((end || 1) / e.cur(true)) * start; + self.style[ name ] = start + unit; + } + + // If a +=/-= token was provided, we're doing a relative animation + if ( parts[1] ) + end = ((parts[1] == "-=" ? -1 : 1) * end) + start; + + e.custom( start, end, unit ); + } else + e.custom( start, val, "" ); + } + }); + + // For JS strict compliance + return true; + }); + }, + + stop: function(clearQueue, gotoEnd){ + var timers = jQuery.timers; + + if (clearQueue) + this.queue([]); + + this.each(function(){ + // go in reverse order so anything added to the queue during the loop is ignored + for ( var i = timers.length - 1; i >= 0; i-- ) + if ( timers[i].elem == this ) { + if (gotoEnd) + // force the next step to be the last + timers[i](true); + timers.splice(i, 1); + } + }); + + // start the next in the queue if the last step wasn't forced + if (!gotoEnd) + this.dequeue(); + + return this; + } + +}); + +// Generate shortcuts for custom animations +jQuery.each({ + slideDown: genFx("show", 1), + slideUp: genFx("hide", 1), + slideToggle: genFx("toggle", 1), + fadeIn: { opacity: "show" }, + fadeOut: { opacity: "hide" } +}, function( name, props ){ + jQuery.fn[ name ] = function( speed, callback ){ + return this.animate( props, speed, callback ); + }; +}); + +jQuery.extend({ + + speed: function(speed, easing, fn) { + var opt = typeof speed === "object" ? speed : { + complete: fn || !fn && easing || + jQuery.isFunction( speed ) && speed, + duration: speed, + easing: fn && easing || easing && !jQuery.isFunction(easing) && easing + }; + + opt.duration = jQuery.fx.off ? 0 : typeof opt.duration === "number" ? opt.duration : + jQuery.fx.speeds[opt.duration] || jQuery.fx.speeds._default; + + // Queueing + opt.old = opt.complete; + opt.complete = function(){ + if ( opt.queue !== false ) + jQuery(this).dequeue(); + if ( jQuery.isFunction( opt.old ) ) + opt.old.call( this ); + }; + + return opt; + }, + + easing: { + linear: function( p, n, firstNum, diff ) { + return firstNum + diff * p; + }, + swing: function( p, n, firstNum, diff ) { + return ((-Math.cos(p*Math.PI)/2) + 0.5) * diff + firstNum; + } + }, + + timers: [], + + fx: function( elem, options, prop ){ + this.options = options; + this.elem = elem; + this.prop = prop; + + if ( !options.orig ) + options.orig = {}; + } + +}); + +jQuery.fx.prototype = { + + // Simple function for setting a style value + update: function(){ + if ( this.options.step ) + this.options.step.call( this.elem, this.now, this ); + + (jQuery.fx.step[this.prop] || jQuery.fx.step._default)( this ); + + // Set display property to block for height/width animations + if ( ( this.prop == "height" || this.prop == "width" ) && this.elem.style ) + this.elem.style.display = "block"; + }, + + // Get the current size + cur: function(force){ + if ( this.elem[this.prop] != null && (!this.elem.style || this.elem.style[this.prop] == null) ) + return this.elem[ this.prop ]; + + var r = parseFloat(jQuery.css(this.elem, this.prop, force)); + return r && r > -10000 ? r : parseFloat(jQuery.curCSS(this.elem, this.prop)) || 0; + }, + + // Start an animation from one number to another + custom: function(from, to, unit){ + this.startTime = now(); + this.start = from; + this.end = to; + this.unit = unit || this.unit || "px"; + this.now = this.start; + this.pos = this.state = 0; + + var self = this; + function t(gotoEnd){ + return self.step(gotoEnd); + } + + t.elem = this.elem; + + if ( t() && jQuery.timers.push(t) && !timerId ) { + timerId = setInterval(function(){ + var timers = jQuery.timers; + + for ( var i = 0; i < timers.length; i++ ) + if ( !timers[i]() ) + timers.splice(i--, 1); + + if ( !timers.length ) { + clearInterval( timerId ); + timerId = undefined; + } + }, 13); + } + }, + + // Simple 'show' function + show: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.show = true; + + // Begin the animation + // Make sure that we start at a small width/height to avoid any + // flash of content + this.custom(this.prop == "width" || this.prop == "height" ? 1 : 0, this.cur()); + + // Start by showing the element + jQuery(this.elem).show(); + }, + + // Simple 'hide' function + hide: function(){ + // Remember where we started, so that we can go back to it later + this.options.orig[this.prop] = jQuery.attr( this.elem.style, this.prop ); + this.options.hide = true; + + // Begin the animation + this.custom(this.cur(), 0); + }, + + // Each step of an animation + step: function(gotoEnd){ + var t = now(); + + if ( gotoEnd || t >= this.options.duration + this.startTime ) { + this.now = this.end; + this.pos = this.state = 1; + this.update(); + + this.options.curAnim[ this.prop ] = true; + + var done = true; + for ( var i in this.options.curAnim ) + if ( this.options.curAnim[i] !== true ) + done = false; + + if ( done ) { + if ( this.options.display != null ) { + // Reset the overflow + this.elem.style.overflow = this.options.overflow; + + // Reset the display + this.elem.style.display = this.options.display; + if ( jQuery.css(this.elem, "display") == "none" ) + this.elem.style.display = "block"; + } + + // Hide the element if the "hide" operation was done + if ( this.options.hide ) + jQuery(this.elem).hide(); + + // Reset the properties, if the item has been hidden or shown + if ( this.options.hide || this.options.show ) + for ( var p in this.options.curAnim ) + jQuery.attr(this.elem.style, p, this.options.orig[p]); + + // Execute the complete function + this.options.complete.call( this.elem ); + } + + return false; + } else { + var n = t - this.startTime; + this.state = n / this.options.duration; + + // Perform the easing function, defaults to swing + this.pos = jQuery.easing[this.options.easing || (jQuery.easing.swing ? "swing" : "linear")](this.state, n, 0, 1, this.options.duration); + this.now = this.start + ((this.end - this.start) * this.pos); + + // Perform the next step of the animation + this.update(); + } + + return true; + } + +}; + +jQuery.extend( jQuery.fx, { + speeds:{ + slow: 600, + fast: 200, + // Default speed + _default: 400 + }, + step: { + + opacity: function(fx){ + jQuery.attr(fx.elem.style, "opacity", fx.now); + }, + + _default: function(fx){ + if ( fx.elem.style && fx.elem.style[ fx.prop ] != null ) + fx.elem.style[ fx.prop ] = fx.now + fx.unit; + else + fx.elem[ fx.prop ] = fx.now; + } + } +}); +if ( document.documentElement["getBoundingClientRect"] ) + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + var box = this[0].getBoundingClientRect(), doc = this[0].ownerDocument, body = doc.body, docElem = doc.documentElement, + clientTop = docElem.clientTop || body.clientTop || 0, clientLeft = docElem.clientLeft || body.clientLeft || 0, + top = box.top + (self.pageYOffset || jQuery.boxModel && docElem.scrollTop || body.scrollTop ) - clientTop, + left = box.left + (self.pageXOffset || jQuery.boxModel && docElem.scrollLeft || body.scrollLeft) - clientLeft; + return { top: top, left: left }; + }; +else + jQuery.fn.offset = function() { + if ( !this[0] ) return { top: 0, left: 0 }; + if ( this[0] === this[0].ownerDocument.body ) return jQuery.offset.bodyOffset( this[0] ); + jQuery.offset.initialized || jQuery.offset.initialize(); + + var elem = this[0], offsetParent = elem.offsetParent, prevOffsetParent = elem, + doc = elem.ownerDocument, computedStyle, docElem = doc.documentElement, + body = doc.body, defaultView = doc.defaultView, + prevComputedStyle = defaultView.getComputedStyle(elem, null), + top = elem.offsetTop, left = elem.offsetLeft; + + while ( (elem = elem.parentNode) && elem !== body && elem !== docElem ) { + computedStyle = defaultView.getComputedStyle(elem, null); + top -= elem.scrollTop, left -= elem.scrollLeft; + if ( elem === offsetParent ) { + top += elem.offsetTop, left += elem.offsetLeft; + if ( jQuery.offset.doesNotAddBorder && !(jQuery.offset.doesAddBorderForTableAndCells && /^t(able|d|h)$/i.test(elem.tagName)) ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevOffsetParent = offsetParent, offsetParent = elem.offsetParent; + } + if ( jQuery.offset.subtractsBorderForOverflowNotVisible && computedStyle.overflow !== "visible" ) + top += parseInt( computedStyle.borderTopWidth, 10) || 0, + left += parseInt( computedStyle.borderLeftWidth, 10) || 0; + prevComputedStyle = computedStyle; + } + + if ( prevComputedStyle.position === "relative" || prevComputedStyle.position === "static" ) + top += body.offsetTop, + left += body.offsetLeft; + + if ( prevComputedStyle.position === "fixed" ) + top += Math.max(docElem.scrollTop, body.scrollTop), + left += Math.max(docElem.scrollLeft, body.scrollLeft); + + return { top: top, left: left }; + }; + +jQuery.offset = { + initialize: function() { + if ( this.initialized ) return; + var body = document.body, container = document.createElement('div'), innerDiv, checkDiv, table, td, rules, prop, bodyMarginTop = body.style.marginTop, + html = '<div style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;"><div></div></div><table style="position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;" cellpadding="0" cellspacing="0"><tr><td></td></tr></table>'; + + rules = { position: 'absolute', top: 0, left: 0, margin: 0, border: 0, width: '1px', height: '1px', visibility: 'hidden' }; + for ( prop in rules ) container.style[prop] = rules[prop]; + + container.innerHTML = html; + body.insertBefore(container, body.firstChild); + innerDiv = container.firstChild, checkDiv = innerDiv.firstChild, td = innerDiv.nextSibling.firstChild.firstChild; + + this.doesNotAddBorder = (checkDiv.offsetTop !== 5); + this.doesAddBorderForTableAndCells = (td.offsetTop === 5); + + innerDiv.style.overflow = 'hidden', innerDiv.style.position = 'relative'; + this.subtractsBorderForOverflowNotVisible = (checkDiv.offsetTop === -5); + + body.style.marginTop = '1px'; + this.doesNotIncludeMarginInBodyOffset = (body.offsetTop === 0); + body.style.marginTop = bodyMarginTop; + + body.removeChild(container); + this.initialized = true; + }, + + bodyOffset: function(body) { + jQuery.offset.initialized || jQuery.offset.initialize(); + var top = body.offsetTop, left = body.offsetLeft; + if ( jQuery.offset.doesNotIncludeMarginInBodyOffset ) + top += parseInt( jQuery.curCSS(body, 'marginTop', true), 10 ) || 0, + left += parseInt( jQuery.curCSS(body, 'marginLeft', true), 10 ) || 0; + return { top: top, left: left }; + } +}; + + +jQuery.fn.extend({ + position: function() { + var left = 0, top = 0, results; + + if ( this[0] ) { + // Get *real* offsetParent + var offsetParent = this.offsetParent(), + + // Get correct offsets + offset = this.offset(), + parentOffset = /^body|html$/i.test(offsetParent[0].tagName) ? { top: 0, left: 0 } : offsetParent.offset(); + + // Subtract element margins + // note: when an element has margin: auto the offsetLeft and marginLeft + // are the same in Safari causing offset.left to incorrectly be 0 + offset.top -= num( this, 'marginTop' ); + offset.left -= num( this, 'marginLeft' ); + + // Add offsetParent borders + parentOffset.top += num( offsetParent, 'borderTopWidth' ); + parentOffset.left += num( offsetParent, 'borderLeftWidth' ); + + // Subtract the two offsets + results = { + top: offset.top - parentOffset.top, + left: offset.left - parentOffset.left + }; + } + + return results; + }, + + offsetParent: function() { + var offsetParent = this[0].offsetParent || document.body; + while ( offsetParent && (!/^body|html$/i.test(offsetParent.tagName) && jQuery.css(offsetParent, 'position') == 'static') ) + offsetParent = offsetParent.offsetParent; + return jQuery(offsetParent); + } +}); + + +// Create scrollLeft and scrollTop methods +jQuery.each( ['Left', 'Top'], function(i, name) { + var method = 'scroll' + name; + + jQuery.fn[ method ] = function(val) { + if (!this[0]) return null; + + return val !== undefined ? + + // Set the scroll offset + this.each(function() { + this == window || this == document ? + window.scrollTo( + !i ? val : jQuery(window).scrollLeft(), + i ? val : jQuery(window).scrollTop() + ) : + this[ method ] = val; + }) : + + // Return the scroll offset + this[0] == window || this[0] == document ? + self[ i ? 'pageYOffset' : 'pageXOffset' ] || + jQuery.boxModel && document.documentElement[ method ] || + document.body[ method ] : + this[0][ method ]; + }; +}); +// Create innerHeight, innerWidth, outerHeight and outerWidth methods +jQuery.each([ "Height", "Width" ], function(i, name){ + + var tl = i ? "Left" : "Top", // top or left + br = i ? "Right" : "Bottom", // bottom or right + lower = name.toLowerCase(); + + // innerHeight and innerWidth + jQuery.fn["inner" + name] = function(){ + return this[0] ? + jQuery.css( this[0], lower, false, "padding" ) : + null; + }; + + // outerHeight and outerWidth + jQuery.fn["outer" + name] = function(margin) { + return this[0] ? + jQuery.css( this[0], lower, false, margin ? "margin" : "border" ) : + null; + }; + + var type = name.toLowerCase(); + + jQuery.fn[ type ] = function( size ) { + // Get window width or height + return this[0] == window ? + // Everyone else use document.documentElement or document.body depending on Quirks vs Standards mode + document.compatMode == "CSS1Compat" && document.documentElement[ "client" + name ] || + document.body[ "client" + name ] : + + // Get document width or height + this[0] == document ? + // Either scroll[Width/Height] or offset[Width/Height], whichever is greater + Math.max( + document.documentElement["client" + name], + document.body["scroll" + name], document.documentElement["scroll" + name], + document.body["offset" + name], document.documentElement["offset" + name] + ) : + + // Get or set width or height on the element + size === undefined ? + // Get width or height on the element + (this.length ? jQuery.css( this[0], type ) : null) : + + // Set the width or height on the element (default to pixels if value is unitless) + this.css( type, typeof size === "string" ? size : size + "px" ); + }; + +}); +})(); diff --git a/node_modules/selenium-webdriver/lib/test/data/js/jquery-1.4.4.min.js b/node_modules/selenium-webdriver/lib/test/data/js/jquery-1.4.4.min.js new file mode 100644 index 000000000..8f3ca2e2d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/jquery-1.4.4.min.js @@ -0,0 +1,167 @@ +/*! + * jQuery JavaScript Library v1.4.4 + * http://jquery.com/ + * + * Copyright 2010, John Resig + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * Includes Sizzle.js + * http://sizzlejs.com/ + * Copyright 2010, The Dojo Foundation + * Released under the MIT, BSD, and GPL Licenses. + * + * Date: Thu Nov 11 19:04:53 2010 -0500 + */ +(function(E,B){function ka(a,b,d){if(d===B&&a.nodeType===1){d=a.getAttribute("data-"+b);if(typeof d==="string"){try{d=d==="true"?true:d==="false"?false:d==="null"?null:!c.isNaN(d)?parseFloat(d):Ja.test(d)?c.parseJSON(d):d}catch(e){}c.data(a,b,d)}else d=B}return d}function U(){return false}function ca(){return true}function la(a,b,d){d[0].type=a;return c.event.handle.apply(b,d)}function Ka(a){var b,d,e,f,h,l,k,o,x,r,A,C=[];f=[];h=c.data(this,this.nodeType?"events":"__events__");if(typeof h==="function")h= +h.events;if(!(a.liveFired===this||!h||!h.live||a.button&&a.type==="click")){if(a.namespace)A=RegExp("(^|\\.)"+a.namespace.split(".").join("\\.(?:.*\\.)?")+"(\\.|$)");a.liveFired=this;var J=h.live.slice(0);for(k=0;k<J.length;k++){h=J[k];h.origType.replace(X,"")===a.type?f.push(h.selector):J.splice(k--,1)}f=c(a.target).closest(f,a.currentTarget);o=0;for(x=f.length;o<x;o++){r=f[o];for(k=0;k<J.length;k++){h=J[k];if(r.selector===h.selector&&(!A||A.test(h.namespace))){l=r.elem;e=null;if(h.preType==="mouseenter"|| +h.preType==="mouseleave"){a.type=h.preType;e=c(a.relatedTarget).closest(h.selector)[0]}if(!e||e!==l)C.push({elem:l,handleObj:h,level:r.level})}}}o=0;for(x=C.length;o<x;o++){f=C[o];if(d&&f.level>d)break;a.currentTarget=f.elem;a.data=f.handleObj.data;a.handleObj=f.handleObj;A=f.handleObj.origHandler.apply(f.elem,arguments);if(A===false||a.isPropagationStopped()){d=f.level;if(A===false)b=false;if(a.isImmediatePropagationStopped())break}}return b}}function Y(a,b){return(a&&a!=="*"?a+".":"")+b.replace(La, +"`").replace(Ma,"&")}function ma(a,b,d){if(c.isFunction(b))return c.grep(a,function(f,h){return!!b.call(f,h,f)===d});else if(b.nodeType)return c.grep(a,function(f){return f===b===d});else if(typeof b==="string"){var e=c.grep(a,function(f){return f.nodeType===1});if(Na.test(b))return c.filter(b,e,!d);else b=c.filter(b,e)}return c.grep(a,function(f){return c.inArray(f,b)>=0===d})}function na(a,b){var d=0;b.each(function(){if(this.nodeName===(a[d]&&a[d].nodeName)){var e=c.data(a[d++]),f=c.data(this, +e);if(e=e&&e.events){delete f.handle;f.events={};for(var h in e)for(var l in e[h])c.event.add(this,h,e[h][l],e[h][l].data)}}})}function Oa(a,b){b.src?c.ajax({url:b.src,async:false,dataType:"script"}):c.globalEval(b.text||b.textContent||b.innerHTML||"");b.parentNode&&b.parentNode.removeChild(b)}function oa(a,b,d){var e=b==="width"?a.offsetWidth:a.offsetHeight;if(d==="border")return e;c.each(b==="width"?Pa:Qa,function(){d||(e-=parseFloat(c.css(a,"padding"+this))||0);if(d==="margin")e+=parseFloat(c.css(a, +"margin"+this))||0;else e-=parseFloat(c.css(a,"border"+this+"Width"))||0});return e}function da(a,b,d,e){if(c.isArray(b)&&b.length)c.each(b,function(f,h){d||Ra.test(a)?e(a,h):da(a+"["+(typeof h==="object"||c.isArray(h)?f:"")+"]",h,d,e)});else if(!d&&b!=null&&typeof b==="object")c.isEmptyObject(b)?e(a,""):c.each(b,function(f,h){da(a+"["+f+"]",h,d,e)});else e(a,b)}function S(a,b){var d={};c.each(pa.concat.apply([],pa.slice(0,b)),function(){d[this]=a});return d}function qa(a){if(!ea[a]){var b=c("<"+ +a+">").appendTo("body"),d=b.css("display");b.remove();if(d==="none"||d==="")d="block";ea[a]=d}return ea[a]}function fa(a){return c.isWindow(a)?a:a.nodeType===9?a.defaultView||a.parentWindow:false}var t=E.document,c=function(){function a(){if(!b.isReady){try{t.documentElement.doScroll("left")}catch(j){setTimeout(a,1);return}b.ready()}}var b=function(j,s){return new b.fn.init(j,s)},d=E.jQuery,e=E.$,f,h=/^(?:[^<]*(<[\w\W]+>)[^>]*$|#([\w\-]+)$)/,l=/\S/,k=/^\s+/,o=/\s+$/,x=/\W/,r=/\d/,A=/^<(\w+)\s*\/?>(?:<\/\1>)?$/, +C=/^[\],:{}\s]*$/,J=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,w=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,I=/(?:^|:|,)(?:\s*\[)+/g,L=/(webkit)[ \/]([\w.]+)/,g=/(opera)(?:.*version)?[ \/]([\w.]+)/,i=/(msie) ([\w.]+)/,n=/(mozilla)(?:.*? rv:([\w.]+))?/,m=navigator.userAgent,p=false,q=[],u,y=Object.prototype.toString,F=Object.prototype.hasOwnProperty,M=Array.prototype.push,N=Array.prototype.slice,O=String.prototype.trim,D=Array.prototype.indexOf,R={};b.fn=b.prototype={init:function(j, +s){var v,z,H;if(!j)return this;if(j.nodeType){this.context=this[0]=j;this.length=1;return this}if(j==="body"&&!s&&t.body){this.context=t;this[0]=t.body;this.selector="body";this.length=1;return this}if(typeof j==="string")if((v=h.exec(j))&&(v[1]||!s))if(v[1]){H=s?s.ownerDocument||s:t;if(z=A.exec(j))if(b.isPlainObject(s)){j=[t.createElement(z[1])];b.fn.attr.call(j,s,true)}else j=[H.createElement(z[1])];else{z=b.buildFragment([v[1]],[H]);j=(z.cacheable?z.fragment.cloneNode(true):z.fragment).childNodes}return b.merge(this, +j)}else{if((z=t.getElementById(v[2]))&&z.parentNode){if(z.id!==v[2])return f.find(j);this.length=1;this[0]=z}this.context=t;this.selector=j;return this}else if(!s&&!x.test(j)){this.selector=j;this.context=t;j=t.getElementsByTagName(j);return b.merge(this,j)}else return!s||s.jquery?(s||f).find(j):b(s).find(j);else if(b.isFunction(j))return f.ready(j);if(j.selector!==B){this.selector=j.selector;this.context=j.context}return b.makeArray(j,this)},selector:"",jquery:"1.4.4",length:0,size:function(){return this.length}, +toArray:function(){return N.call(this,0)},get:function(j){return j==null?this.toArray():j<0?this.slice(j)[0]:this[j]},pushStack:function(j,s,v){var z=b();b.isArray(j)?M.apply(z,j):b.merge(z,j);z.prevObject=this;z.context=this.context;if(s==="find")z.selector=this.selector+(this.selector?" ":"")+v;else if(s)z.selector=this.selector+"."+s+"("+v+")";return z},each:function(j,s){return b.each(this,j,s)},ready:function(j){b.bindReady();if(b.isReady)j.call(t,b);else q&&q.push(j);return this},eq:function(j){return j=== +-1?this.slice(j):this.slice(j,+j+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(N.apply(this,arguments),"slice",N.call(arguments).join(","))},map:function(j){return this.pushStack(b.map(this,function(s,v){return j.call(s,v,s)}))},end:function(){return this.prevObject||b(null)},push:M,sort:[].sort,splice:[].splice};b.fn.init.prototype=b.fn;b.extend=b.fn.extend=function(){var j,s,v,z,H,G=arguments[0]||{},K=1,Q=arguments.length,ga=false; +if(typeof G==="boolean"){ga=G;G=arguments[1]||{};K=2}if(typeof G!=="object"&&!b.isFunction(G))G={};if(Q===K){G=this;--K}for(;K<Q;K++)if((j=arguments[K])!=null)for(s in j){v=G[s];z=j[s];if(G!==z)if(ga&&z&&(b.isPlainObject(z)||(H=b.isArray(z)))){if(H){H=false;v=v&&b.isArray(v)?v:[]}else v=v&&b.isPlainObject(v)?v:{};G[s]=b.extend(ga,v,z)}else if(z!==B)G[s]=z}return G};b.extend({noConflict:function(j){E.$=e;if(j)E.jQuery=d;return b},isReady:false,readyWait:1,ready:function(j){j===true&&b.readyWait--; +if(!b.readyWait||j!==true&&!b.isReady){if(!t.body)return setTimeout(b.ready,1);b.isReady=true;if(!(j!==true&&--b.readyWait>0))if(q){var s=0,v=q;for(q=null;j=v[s++];)j.call(t,b);b.fn.trigger&&b(t).trigger("ready").unbind("ready")}}},bindReady:function(){if(!p){p=true;if(t.readyState==="complete")return setTimeout(b.ready,1);if(t.addEventListener){t.addEventListener("DOMContentLoaded",u,false);E.addEventListener("load",b.ready,false)}else if(t.attachEvent){t.attachEvent("onreadystatechange",u);E.attachEvent("onload", +b.ready);var j=false;try{j=E.frameElement==null}catch(s){}t.documentElement.doScroll&&j&&a()}}},isFunction:function(j){return b.type(j)==="function"},isArray:Array.isArray||function(j){return b.type(j)==="array"},isWindow:function(j){return j&&typeof j==="object"&&"setInterval"in j},isNaN:function(j){return j==null||!r.test(j)||isNaN(j)},type:function(j){return j==null?String(j):R[y.call(j)]||"object"},isPlainObject:function(j){if(!j||b.type(j)!=="object"||j.nodeType||b.isWindow(j))return false;if(j.constructor&& +!F.call(j,"constructor")&&!F.call(j.constructor.prototype,"isPrototypeOf"))return false;for(var s in j);return s===B||F.call(j,s)},isEmptyObject:function(j){for(var s in j)return false;return true},error:function(j){throw j;},parseJSON:function(j){if(typeof j!=="string"||!j)return null;j=b.trim(j);if(C.test(j.replace(J,"@").replace(w,"]").replace(I,"")))return E.JSON&&E.JSON.parse?E.JSON.parse(j):(new Function("return "+j))();else b.error("Invalid JSON: "+j)},noop:function(){},globalEval:function(j){if(j&& +l.test(j)){var s=t.getElementsByTagName("head")[0]||t.documentElement,v=t.createElement("script");v.type="text/javascript";if(b.support.scriptEval)v.appendChild(t.createTextNode(j));else v.text=j;s.insertBefore(v,s.firstChild);s.removeChild(v)}},nodeName:function(j,s){return j.nodeName&&j.nodeName.toUpperCase()===s.toUpperCase()},each:function(j,s,v){var z,H=0,G=j.length,K=G===B||b.isFunction(j);if(v)if(K)for(z in j){if(s.apply(j[z],v)===false)break}else for(;H<G;){if(s.apply(j[H++],v)===false)break}else if(K)for(z in j){if(s.call(j[z], +z,j[z])===false)break}else for(v=j[0];H<G&&s.call(v,H,v)!==false;v=j[++H]);return j},trim:O?function(j){return j==null?"":O.call(j)}:function(j){return j==null?"":j.toString().replace(k,"").replace(o,"")},makeArray:function(j,s){var v=s||[];if(j!=null){var z=b.type(j);j.length==null||z==="string"||z==="function"||z==="regexp"||b.isWindow(j)?M.call(v,j):b.merge(v,j)}return v},inArray:function(j,s){if(s.indexOf)return s.indexOf(j);for(var v=0,z=s.length;v<z;v++)if(s[v]===j)return v;return-1},merge:function(j, +s){var v=j.length,z=0;if(typeof s.length==="number")for(var H=s.length;z<H;z++)j[v++]=s[z];else for(;s[z]!==B;)j[v++]=s[z++];j.length=v;return j},grep:function(j,s,v){var z=[],H;v=!!v;for(var G=0,K=j.length;G<K;G++){H=!!s(j[G],G);v!==H&&z.push(j[G])}return z},map:function(j,s,v){for(var z=[],H,G=0,K=j.length;G<K;G++){H=s(j[G],G,v);if(H!=null)z[z.length]=H}return z.concat.apply([],z)},guid:1,proxy:function(j,s,v){if(arguments.length===2)if(typeof s==="string"){v=j;j=v[s];s=B}else if(s&&!b.isFunction(s)){v= +s;s=B}if(!s&&j)s=function(){return j.apply(v||this,arguments)};if(j)s.guid=j.guid=j.guid||s.guid||b.guid++;return s},access:function(j,s,v,z,H,G){var K=j.length;if(typeof s==="object"){for(var Q in s)b.access(j,Q,s[Q],z,H,v);return j}if(v!==B){z=!G&&z&&b.isFunction(v);for(Q=0;Q<K;Q++)H(j[Q],s,z?v.call(j[Q],Q,H(j[Q],s)):v,G);return j}return K?H(j[0],s):B},now:function(){return(new Date).getTime()},uaMatch:function(j){j=j.toLowerCase();j=L.exec(j)||g.exec(j)||i.exec(j)||j.indexOf("compatible")<0&&n.exec(j)|| +[];return{browser:j[1]||"",version:j[2]||"0"}},browser:{}});b.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(j,s){R["[object "+s+"]"]=s.toLowerCase()});m=b.uaMatch(m);if(m.browser){b.browser[m.browser]=true;b.browser.version=m.version}if(b.browser.webkit)b.browser.safari=true;if(D)b.inArray=function(j,s){return D.call(s,j)};if(!/\s/.test("\u00a0")){k=/^[\s\xA0]+/;o=/[\s\xA0]+$/}f=b(t);if(t.addEventListener)u=function(){t.removeEventListener("DOMContentLoaded",u, +false);b.ready()};else if(t.attachEvent)u=function(){if(t.readyState==="complete"){t.detachEvent("onreadystatechange",u);b.ready()}};return E.jQuery=E.$=b}();(function(){c.support={};var a=t.documentElement,b=t.createElement("script"),d=t.createElement("div"),e="script"+c.now();d.style.display="none";d.innerHTML=" <link/><table></table><a href='/a' style='color:red;float:left;opacity:.55;'>a</a><input type='checkbox'/>";var f=d.getElementsByTagName("*"),h=d.getElementsByTagName("a")[0],l=t.createElement("select"), +k=l.appendChild(t.createElement("option"));if(!(!f||!f.length||!h)){c.support={leadingWhitespace:d.firstChild.nodeType===3,tbody:!d.getElementsByTagName("tbody").length,htmlSerialize:!!d.getElementsByTagName("link").length,style:/red/.test(h.getAttribute("style")),hrefNormalized:h.getAttribute("href")==="/a",opacity:/^0.55$/.test(h.style.opacity),cssFloat:!!h.style.cssFloat,checkOn:d.getElementsByTagName("input")[0].value==="on",optSelected:k.selected,deleteExpando:true,optDisabled:false,checkClone:false, +scriptEval:false,noCloneEvent:true,boxModel:null,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableHiddenOffsets:true};l.disabled=true;c.support.optDisabled=!k.disabled;b.type="text/javascript";try{b.appendChild(t.createTextNode("window."+e+"=1;"))}catch(o){}a.insertBefore(b,a.firstChild);if(E[e]){c.support.scriptEval=true;delete E[e]}try{delete b.test}catch(x){c.support.deleteExpando=false}a.removeChild(b);if(d.attachEvent&&d.fireEvent){d.attachEvent("onclick",function r(){c.support.noCloneEvent= +false;d.detachEvent("onclick",r)});d.cloneNode(true).fireEvent("onclick")}d=t.createElement("div");d.innerHTML="<input type='radio' name='radiotest' checked='checked'/>";a=t.createDocumentFragment();a.appendChild(d.firstChild);c.support.checkClone=a.cloneNode(true).cloneNode(true).lastChild.checked;c(function(){var r=t.createElement("div");r.style.width=r.style.paddingLeft="1px";t.body.appendChild(r);c.boxModel=c.support.boxModel=r.offsetWidth===2;if("zoom"in r.style){r.style.display="inline";r.style.zoom= +1;c.support.inlineBlockNeedsLayout=r.offsetWidth===2;r.style.display="";r.innerHTML="<div style='width:4px;'></div>";c.support.shrinkWrapBlocks=r.offsetWidth!==2}r.innerHTML="<table><tr><td style='padding:0;display:none'></td><td>t</td></tr></table>";var A=r.getElementsByTagName("td");c.support.reliableHiddenOffsets=A[0].offsetHeight===0;A[0].style.display="";A[1].style.display="none";c.support.reliableHiddenOffsets=c.support.reliableHiddenOffsets&&A[0].offsetHeight===0;r.innerHTML="";t.body.removeChild(r).style.display= +"none"});a=function(r){var A=t.createElement("div");r="on"+r;var C=r in A;if(!C){A.setAttribute(r,"return;");C=typeof A[r]==="function"}return C};c.support.submitBubbles=a("submit");c.support.changeBubbles=a("change");a=b=d=f=h=null}})();var ra={},Ja=/^(?:\{.*\}|\[.*\])$/;c.extend({cache:{},uuid:0,expando:"jQuery"+c.now(),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},data:function(a,b,d){if(c.acceptData(a)){a=a==E?ra:a;var e=a.nodeType,f=e?a[c.expando]:null,h= +c.cache;if(!(e&&!f&&typeof b==="string"&&d===B)){if(e)f||(a[c.expando]=f=++c.uuid);else h=a;if(typeof b==="object")if(e)h[f]=c.extend(h[f],b);else c.extend(h,b);else if(e&&!h[f])h[f]={};a=e?h[f]:h;if(d!==B)a[b]=d;return typeof b==="string"?a[b]:a}}},removeData:function(a,b){if(c.acceptData(a)){a=a==E?ra:a;var d=a.nodeType,e=d?a[c.expando]:a,f=c.cache,h=d?f[e]:e;if(b){if(h){delete h[b];d&&c.isEmptyObject(h)&&c.removeData(a)}}else if(d&&c.support.deleteExpando)delete a[c.expando];else if(a.removeAttribute)a.removeAttribute(c.expando); +else if(d)delete f[e];else for(var l in a)delete a[l]}},acceptData:function(a){if(a.nodeName){var b=c.noData[a.nodeName.toLowerCase()];if(b)return!(b===true||a.getAttribute("classid")!==b)}return true}});c.fn.extend({data:function(a,b){var d=null;if(typeof a==="undefined"){if(this.length){var e=this[0].attributes,f;d=c.data(this[0]);for(var h=0,l=e.length;h<l;h++){f=e[h].name;if(f.indexOf("data-")===0){f=f.substr(5);ka(this[0],f,d[f])}}}return d}else if(typeof a==="object")return this.each(function(){c.data(this, +a)});var k=a.split(".");k[1]=k[1]?"."+k[1]:"";if(b===B){d=this.triggerHandler("getData"+k[1]+"!",[k[0]]);if(d===B&&this.length){d=c.data(this[0],a);d=ka(this[0],a,d)}return d===B&&k[1]?this.data(k[0]):d}else return this.each(function(){var o=c(this),x=[k[0],b];o.triggerHandler("setData"+k[1]+"!",x);c.data(this,a,b);o.triggerHandler("changeData"+k[1]+"!",x)})},removeData:function(a){return this.each(function(){c.removeData(this,a)})}});c.extend({queue:function(a,b,d){if(a){b=(b||"fx")+"queue";var e= +c.data(a,b);if(!d)return e||[];if(!e||c.isArray(d))e=c.data(a,b,c.makeArray(d));else e.push(d);return e}},dequeue:function(a,b){b=b||"fx";var d=c.queue(a,b),e=d.shift();if(e==="inprogress")e=d.shift();if(e){b==="fx"&&d.unshift("inprogress");e.call(a,function(){c.dequeue(a,b)})}}});c.fn.extend({queue:function(a,b){if(typeof a!=="string"){b=a;a="fx"}if(b===B)return c.queue(this[0],a);return this.each(function(){var d=c.queue(this,a,b);a==="fx"&&d[0]!=="inprogress"&&c.dequeue(this,a)})},dequeue:function(a){return this.each(function(){c.dequeue(this, +a)})},delay:function(a,b){a=c.fx?c.fx.speeds[a]||a:a;b=b||"fx";return this.queue(b,function(){var d=this;setTimeout(function(){c.dequeue(d,b)},a)})},clearQueue:function(a){return this.queue(a||"fx",[])}});var sa=/[\n\t]/g,ha=/\s+/,Sa=/\r/g,Ta=/^(?:href|src|style)$/,Ua=/^(?:button|input)$/i,Va=/^(?:button|input|object|select|textarea)$/i,Wa=/^a(?:rea)?$/i,ta=/^(?:radio|checkbox)$/i;c.props={"for":"htmlFor","class":"className",readonly:"readOnly",maxlength:"maxLength",cellspacing:"cellSpacing",rowspan:"rowSpan", +colspan:"colSpan",tabindex:"tabIndex",usemap:"useMap",frameborder:"frameBorder"};c.fn.extend({attr:function(a,b){return c.access(this,a,b,true,c.attr)},removeAttr:function(a){return this.each(function(){c.attr(this,a,"");this.nodeType===1&&this.removeAttribute(a)})},addClass:function(a){if(c.isFunction(a))return this.each(function(x){var r=c(this);r.addClass(a.call(this,x,r.attr("class")))});if(a&&typeof a==="string")for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType=== +1)if(f.className){for(var h=" "+f.className+" ",l=f.className,k=0,o=b.length;k<o;k++)if(h.indexOf(" "+b[k]+" ")<0)l+=" "+b[k];f.className=c.trim(l)}else f.className=a}return this},removeClass:function(a){if(c.isFunction(a))return this.each(function(o){var x=c(this);x.removeClass(a.call(this,o,x.attr("class")))});if(a&&typeof a==="string"||a===B)for(var b=(a||"").split(ha),d=0,e=this.length;d<e;d++){var f=this[d];if(f.nodeType===1&&f.className)if(a){for(var h=(" "+f.className+" ").replace(sa," "), +l=0,k=b.length;l<k;l++)h=h.replace(" "+b[l]+" "," ");f.className=c.trim(h)}else f.className=""}return this},toggleClass:function(a,b){var d=typeof a,e=typeof b==="boolean";if(c.isFunction(a))return this.each(function(f){var h=c(this);h.toggleClass(a.call(this,f,h.attr("class"),b),b)});return this.each(function(){if(d==="string")for(var f,h=0,l=c(this),k=b,o=a.split(ha);f=o[h++];){k=e?k:!l.hasClass(f);l[k?"addClass":"removeClass"](f)}else if(d==="undefined"||d==="boolean"){this.className&&c.data(this, +"__className__",this.className);this.className=this.className||a===false?"":c.data(this,"__className__")||""}})},hasClass:function(a){a=" "+a+" ";for(var b=0,d=this.length;b<d;b++)if((" "+this[b].className+" ").replace(sa," ").indexOf(a)>-1)return true;return false},val:function(a){if(!arguments.length){var b=this[0];if(b){if(c.nodeName(b,"option")){var d=b.attributes.value;return!d||d.specified?b.value:b.text}if(c.nodeName(b,"select")){var e=b.selectedIndex;d=[];var f=b.options;b=b.type==="select-one"; +if(e<0)return null;var h=b?e:0;for(e=b?e+1:f.length;h<e;h++){var l=f[h];if(l.selected&&(c.support.optDisabled?!l.disabled:l.getAttribute("disabled")===null)&&(!l.parentNode.disabled||!c.nodeName(l.parentNode,"optgroup"))){a=c(l).val();if(b)return a;d.push(a)}}return d}if(ta.test(b.type)&&!c.support.checkOn)return b.getAttribute("value")===null?"on":b.value;return(b.value||"").replace(Sa,"")}return B}var k=c.isFunction(a);return this.each(function(o){var x=c(this),r=a;if(this.nodeType===1){if(k)r= +a.call(this,o,x.val());if(r==null)r="";else if(typeof r==="number")r+="";else if(c.isArray(r))r=c.map(r,function(C){return C==null?"":C+""});if(c.isArray(r)&&ta.test(this.type))this.checked=c.inArray(x.val(),r)>=0;else if(c.nodeName(this,"select")){var A=c.makeArray(r);c("option",this).each(function(){this.selected=c.inArray(c(this).val(),A)>=0});if(!A.length)this.selectedIndex=-1}else this.value=r}})}});c.extend({attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true}, +attr:function(a,b,d,e){if(!a||a.nodeType===3||a.nodeType===8)return B;if(e&&b in c.attrFn)return c(a)[b](d);e=a.nodeType!==1||!c.isXMLDoc(a);var f=d!==B;b=e&&c.props[b]||b;var h=Ta.test(b);if((b in a||a[b]!==B)&&e&&!h){if(f){b==="type"&&Ua.test(a.nodeName)&&a.parentNode&&c.error("type property can't be changed");if(d===null)a.nodeType===1&&a.removeAttribute(b);else a[b]=d}if(c.nodeName(a,"form")&&a.getAttributeNode(b))return a.getAttributeNode(b).nodeValue;if(b==="tabIndex")return(b=a.getAttributeNode("tabIndex"))&& +b.specified?b.value:Va.test(a.nodeName)||Wa.test(a.nodeName)&&a.href?0:B;return a[b]}if(!c.support.style&&e&&b==="style"){if(f)a.style.cssText=""+d;return a.style.cssText}f&&a.setAttribute(b,""+d);if(!a.attributes[b]&&a.hasAttribute&&!a.hasAttribute(b))return B;a=!c.support.hrefNormalized&&e&&h?a.getAttribute(b,2):a.getAttribute(b);return a===null?B:a}});var X=/\.(.*)$/,ia=/^(?:textarea|input|select)$/i,La=/\./g,Ma=/ /g,Xa=/[^\w\s.|`]/g,Ya=function(a){return a.replace(Xa,"\\$&")},ua={focusin:0,focusout:0}; +c.event={add:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(c.isWindow(a)&&a!==E&&!a.frameElement)a=E;if(d===false)d=U;else if(!d)return;var f,h;if(d.handler){f=d;d=f.handler}if(!d.guid)d.guid=c.guid++;if(h=c.data(a)){var l=a.nodeType?"events":"__events__",k=h[l],o=h.handle;if(typeof k==="function"){o=k.handle;k=k.events}else if(!k){a.nodeType||(h[l]=h=function(){});h.events=k={}}if(!o)h.handle=o=function(){return typeof c!=="undefined"&&!c.event.triggered?c.event.handle.apply(o.elem, +arguments):B};o.elem=a;b=b.split(" ");for(var x=0,r;l=b[x++];){h=f?c.extend({},f):{handler:d,data:e};if(l.indexOf(".")>-1){r=l.split(".");l=r.shift();h.namespace=r.slice(0).sort().join(".")}else{r=[];h.namespace=""}h.type=l;if(!h.guid)h.guid=d.guid;var A=k[l],C=c.event.special[l]||{};if(!A){A=k[l]=[];if(!C.setup||C.setup.call(a,e,r,o)===false)if(a.addEventListener)a.addEventListener(l,o,false);else a.attachEvent&&a.attachEvent("on"+l,o)}if(C.add){C.add.call(a,h);if(!h.handler.guid)h.handler.guid= +d.guid}A.push(h);c.event.global[l]=true}a=null}}},global:{},remove:function(a,b,d,e){if(!(a.nodeType===3||a.nodeType===8)){if(d===false)d=U;var f,h,l=0,k,o,x,r,A,C,J=a.nodeType?"events":"__events__",w=c.data(a),I=w&&w[J];if(w&&I){if(typeof I==="function"){w=I;I=I.events}if(b&&b.type){d=b.handler;b=b.type}if(!b||typeof b==="string"&&b.charAt(0)==="."){b=b||"";for(f in I)c.event.remove(a,f+b)}else{for(b=b.split(" ");f=b[l++];){r=f;k=f.indexOf(".")<0;o=[];if(!k){o=f.split(".");f=o.shift();x=RegExp("(^|\\.)"+ +c.map(o.slice(0).sort(),Ya).join("\\.(?:.*\\.)?")+"(\\.|$)")}if(A=I[f])if(d){r=c.event.special[f]||{};for(h=e||0;h<A.length;h++){C=A[h];if(d.guid===C.guid){if(k||x.test(C.namespace)){e==null&&A.splice(h--,1);r.remove&&r.remove.call(a,C)}if(e!=null)break}}if(A.length===0||e!=null&&A.length===1){if(!r.teardown||r.teardown.call(a,o)===false)c.removeEvent(a,f,w.handle);delete I[f]}}else for(h=0;h<A.length;h++){C=A[h];if(k||x.test(C.namespace)){c.event.remove(a,r,C.handler,h);A.splice(h--,1)}}}if(c.isEmptyObject(I)){if(b= +w.handle)b.elem=null;delete w.events;delete w.handle;if(typeof w==="function")c.removeData(a,J);else c.isEmptyObject(w)&&c.removeData(a)}}}}},trigger:function(a,b,d,e){var f=a.type||a;if(!e){a=typeof a==="object"?a[c.expando]?a:c.extend(c.Event(f),a):c.Event(f);if(f.indexOf("!")>=0){a.type=f=f.slice(0,-1);a.exclusive=true}if(!d){a.stopPropagation();c.event.global[f]&&c.each(c.cache,function(){this.events&&this.events[f]&&c.event.trigger(a,b,this.handle.elem)})}if(!d||d.nodeType===3||d.nodeType=== +8)return B;a.result=B;a.target=d;b=c.makeArray(b);b.unshift(a)}a.currentTarget=d;(e=d.nodeType?c.data(d,"handle"):(c.data(d,"__events__")||{}).handle)&&e.apply(d,b);e=d.parentNode||d.ownerDocument;try{if(!(d&&d.nodeName&&c.noData[d.nodeName.toLowerCase()]))if(d["on"+f]&&d["on"+f].apply(d,b)===false){a.result=false;a.preventDefault()}}catch(h){}if(!a.isPropagationStopped()&&e)c.event.trigger(a,b,e,true);else if(!a.isDefaultPrevented()){var l;e=a.target;var k=f.replace(X,""),o=c.nodeName(e,"a")&&k=== +"click",x=c.event.special[k]||{};if((!x._default||x._default.call(d,a)===false)&&!o&&!(e&&e.nodeName&&c.noData[e.nodeName.toLowerCase()])){try{if(e[k]){if(l=e["on"+k])e["on"+k]=null;c.event.triggered=true;e[k]()}}catch(r){}if(l)e["on"+k]=l;c.event.triggered=false}}},handle:function(a){var b,d,e,f;d=[];var h=c.makeArray(arguments);a=h[0]=c.event.fix(a||E.event);a.currentTarget=this;b=a.type.indexOf(".")<0&&!a.exclusive;if(!b){e=a.type.split(".");a.type=e.shift();d=e.slice(0).sort();e=RegExp("(^|\\.)"+ +d.join("\\.(?:.*\\.)?")+"(\\.|$)")}a.namespace=a.namespace||d.join(".");f=c.data(this,this.nodeType?"events":"__events__");if(typeof f==="function")f=f.events;d=(f||{})[a.type];if(f&&d){d=d.slice(0);f=0;for(var l=d.length;f<l;f++){var k=d[f];if(b||e.test(k.namespace)){a.handler=k.handler;a.data=k.data;a.handleObj=k;k=k.handler.apply(this,h);if(k!==B){a.result=k;if(k===false){a.preventDefault();a.stopPropagation()}}if(a.isImmediatePropagationStopped())break}}}return a.result},props:"altKey attrChange attrName bubbles button cancelable charCode clientX clientY ctrlKey currentTarget data detail eventPhase fromElement handler keyCode layerX layerY metaKey newValue offsetX offsetY pageX pageY prevValue relatedNode relatedTarget screenX screenY shiftKey srcElement target toElement view wheelDelta which".split(" "), +fix:function(a){if(a[c.expando])return a;var b=a;a=c.Event(b);for(var d=this.props.length,e;d;){e=this.props[--d];a[e]=b[e]}if(!a.target)a.target=a.srcElement||t;if(a.target.nodeType===3)a.target=a.target.parentNode;if(!a.relatedTarget&&a.fromElement)a.relatedTarget=a.fromElement===a.target?a.toElement:a.fromElement;if(a.pageX==null&&a.clientX!=null){b=t.documentElement;d=t.body;a.pageX=a.clientX+(b&&b.scrollLeft||d&&d.scrollLeft||0)-(b&&b.clientLeft||d&&d.clientLeft||0);a.pageY=a.clientY+(b&&b.scrollTop|| +d&&d.scrollTop||0)-(b&&b.clientTop||d&&d.clientTop||0)}if(a.which==null&&(a.charCode!=null||a.keyCode!=null))a.which=a.charCode!=null?a.charCode:a.keyCode;if(!a.metaKey&&a.ctrlKey)a.metaKey=a.ctrlKey;if(!a.which&&a.button!==B)a.which=a.button&1?1:a.button&2?3:a.button&4?2:0;return a},guid:1E8,proxy:c.proxy,special:{ready:{setup:c.bindReady,teardown:c.noop},live:{add:function(a){c.event.add(this,Y(a.origType,a.selector),c.extend({},a,{handler:Ka,guid:a.handler.guid}))},remove:function(a){c.event.remove(this, +Y(a.origType,a.selector),a)}},beforeunload:{setup:function(a,b,d){if(c.isWindow(this))this.onbeforeunload=d},teardown:function(a,b){if(this.onbeforeunload===b)this.onbeforeunload=null}}}};c.removeEvent=t.removeEventListener?function(a,b,d){a.removeEventListener&&a.removeEventListener(b,d,false)}:function(a,b,d){a.detachEvent&&a.detachEvent("on"+b,d)};c.Event=function(a){if(!this.preventDefault)return new c.Event(a);if(a&&a.type){this.originalEvent=a;this.type=a.type}else this.type=a;this.timeStamp= +c.now();this[c.expando]=true};c.Event.prototype={preventDefault:function(){this.isDefaultPrevented=ca;var a=this.originalEvent;if(a)if(a.preventDefault)a.preventDefault();else a.returnValue=false},stopPropagation:function(){this.isPropagationStopped=ca;var a=this.originalEvent;if(a){a.stopPropagation&&a.stopPropagation();a.cancelBubble=true}},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=ca;this.stopPropagation()},isDefaultPrevented:U,isPropagationStopped:U,isImmediatePropagationStopped:U}; +var va=function(a){var b=a.relatedTarget;try{for(;b&&b!==this;)b=b.parentNode;if(b!==this){a.type=a.data;c.event.handle.apply(this,arguments)}}catch(d){}},wa=function(a){a.type=a.data;c.event.handle.apply(this,arguments)};c.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(a,b){c.event.special[a]={setup:function(d){c.event.add(this,b,d&&d.selector?wa:va,a)},teardown:function(d){c.event.remove(this,b,d&&d.selector?wa:va)}}});if(!c.support.submitBubbles)c.event.special.submit={setup:function(){if(this.nodeName.toLowerCase()!== +"form"){c.event.add(this,"click.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="submit"||d==="image")&&c(b).closest("form").length){a.liveFired=B;return la("submit",this,arguments)}});c.event.add(this,"keypress.specialSubmit",function(a){var b=a.target,d=b.type;if((d==="text"||d==="password")&&c(b).closest("form").length&&a.keyCode===13){a.liveFired=B;return la("submit",this,arguments)}})}else return false},teardown:function(){c.event.remove(this,".specialSubmit")}};if(!c.support.changeBubbles){var V, +xa=function(a){var b=a.type,d=a.value;if(b==="radio"||b==="checkbox")d=a.checked;else if(b==="select-multiple")d=a.selectedIndex>-1?c.map(a.options,function(e){return e.selected}).join("-"):"";else if(a.nodeName.toLowerCase()==="select")d=a.selectedIndex;return d},Z=function(a,b){var d=a.target,e,f;if(!(!ia.test(d.nodeName)||d.readOnly)){e=c.data(d,"_change_data");f=xa(d);if(a.type!=="focusout"||d.type!=="radio")c.data(d,"_change_data",f);if(!(e===B||f===e))if(e!=null||f){a.type="change";a.liveFired= +B;return c.event.trigger(a,b,d)}}};c.event.special.change={filters:{focusout:Z,beforedeactivate:Z,click:function(a){var b=a.target,d=b.type;if(d==="radio"||d==="checkbox"||b.nodeName.toLowerCase()==="select")return Z.call(this,a)},keydown:function(a){var b=a.target,d=b.type;if(a.keyCode===13&&b.nodeName.toLowerCase()!=="textarea"||a.keyCode===32&&(d==="checkbox"||d==="radio")||d==="select-multiple")return Z.call(this,a)},beforeactivate:function(a){a=a.target;c.data(a,"_change_data",xa(a))}},setup:function(){if(this.type=== +"file")return false;for(var a in V)c.event.add(this,a+".specialChange",V[a]);return ia.test(this.nodeName)},teardown:function(){c.event.remove(this,".specialChange");return ia.test(this.nodeName)}};V=c.event.special.change.filters;V.focus=V.beforeactivate}t.addEventListener&&c.each({focus:"focusin",blur:"focusout"},function(a,b){function d(e){e=c.event.fix(e);e.type=b;return c.event.trigger(e,null,e.target)}c.event.special[b]={setup:function(){ua[b]++===0&&t.addEventListener(a,d,true)},teardown:function(){--ua[b]=== +0&&t.removeEventListener(a,d,true)}}});c.each(["bind","one"],function(a,b){c.fn[b]=function(d,e,f){if(typeof d==="object"){for(var h in d)this[b](h,e,d[h],f);return this}if(c.isFunction(e)||e===false){f=e;e=B}var l=b==="one"?c.proxy(f,function(o){c(this).unbind(o,l);return f.apply(this,arguments)}):f;if(d==="unload"&&b!=="one")this.one(d,e,f);else{h=0;for(var k=this.length;h<k;h++)c.event.add(this[h],d,l,e)}return this}});c.fn.extend({unbind:function(a,b){if(typeof a==="object"&&!a.preventDefault)for(var d in a)this.unbind(d, +a[d]);else{d=0;for(var e=this.length;d<e;d++)c.event.remove(this[d],a,b)}return this},delegate:function(a,b,d,e){return this.live(b,d,e,a)},undelegate:function(a,b,d){return arguments.length===0?this.unbind("live"):this.die(b,null,d,a)},trigger:function(a,b){return this.each(function(){c.event.trigger(a,b,this)})},triggerHandler:function(a,b){if(this[0]){var d=c.Event(a);d.preventDefault();d.stopPropagation();c.event.trigger(d,b,this[0]);return d.result}},toggle:function(a){for(var b=arguments,d= +1;d<b.length;)c.proxy(a,b[d++]);return this.click(c.proxy(a,function(e){var f=(c.data(this,"lastToggle"+a.guid)||0)%d;c.data(this,"lastToggle"+a.guid,f+1);e.preventDefault();return b[f].apply(this,arguments)||false}))},hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}});var ya={focus:"focusin",blur:"focusout",mouseenter:"mouseover",mouseleave:"mouseout"};c.each(["live","die"],function(a,b){c.fn[b]=function(d,e,f,h){var l,k=0,o,x,r=h||this.selector;h=h?this:c(this.context);if(typeof d=== +"object"&&!d.preventDefault){for(l in d)h[b](l,e,d[l],r);return this}if(c.isFunction(e)){f=e;e=B}for(d=(d||"").split(" ");(l=d[k++])!=null;){o=X.exec(l);x="";if(o){x=o[0];l=l.replace(X,"")}if(l==="hover")d.push("mouseenter"+x,"mouseleave"+x);else{o=l;if(l==="focus"||l==="blur"){d.push(ya[l]+x);l+=x}else l=(ya[l]||l)+x;if(b==="live"){x=0;for(var A=h.length;x<A;x++)c.event.add(h[x],"live."+Y(l,r),{data:e,selector:r,handler:f,origType:l,origHandler:f,preType:o})}else h.unbind("live."+Y(l,r),f)}}return this}}); +c.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error".split(" "),function(a,b){c.fn[b]=function(d,e){if(e==null){e=d;d=null}return arguments.length>0?this.bind(b,d,e):this.trigger(b)};if(c.attrFn)c.attrFn[b]=true});E.attachEvent&&!E.addEventListener&&c(E).bind("unload",function(){for(var a in c.cache)if(c.cache[a].handle)try{c.event.remove(c.cache[a].handle.elem)}catch(b){}}); +(function(){function a(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1&&!q){y.sizcache=n;y.sizset=p}if(y.nodeName.toLowerCase()===i){F=y;break}y=y[g]}m[p]=F}}}function b(g,i,n,m,p,q){p=0;for(var u=m.length;p<u;p++){var y=m[p];if(y){var F=false;for(y=y[g];y;){if(y.sizcache===n){F=m[y.sizset];break}if(y.nodeType===1){if(!q){y.sizcache=n;y.sizset=p}if(typeof i!=="string"){if(y===i){F=true;break}}else if(k.filter(i, +[y]).length>0){F=y;break}}y=y[g]}m[p]=F}}}var d=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,e=0,f=Object.prototype.toString,h=false,l=true;[0,0].sort(function(){l=false;return 0});var k=function(g,i,n,m){n=n||[];var p=i=i||t;if(i.nodeType!==1&&i.nodeType!==9)return[];if(!g||typeof g!=="string")return n;var q,u,y,F,M,N=true,O=k.isXML(i),D=[],R=g;do{d.exec("");if(q=d.exec(R)){R=q[3];D.push(q[1]);if(q[2]){F=q[3]; +break}}}while(q);if(D.length>1&&x.exec(g))if(D.length===2&&o.relative[D[0]])u=L(D[0]+D[1],i);else for(u=o.relative[D[0]]?[i]:k(D.shift(),i);D.length;){g=D.shift();if(o.relative[g])g+=D.shift();u=L(g,u)}else{if(!m&&D.length>1&&i.nodeType===9&&!O&&o.match.ID.test(D[0])&&!o.match.ID.test(D[D.length-1])){q=k.find(D.shift(),i,O);i=q.expr?k.filter(q.expr,q.set)[0]:q.set[0]}if(i){q=m?{expr:D.pop(),set:C(m)}:k.find(D.pop(),D.length===1&&(D[0]==="~"||D[0]==="+")&&i.parentNode?i.parentNode:i,O);u=q.expr?k.filter(q.expr, +q.set):q.set;if(D.length>0)y=C(u);else N=false;for(;D.length;){q=M=D.pop();if(o.relative[M])q=D.pop();else M="";if(q==null)q=i;o.relative[M](y,q,O)}}else y=[]}y||(y=u);y||k.error(M||g);if(f.call(y)==="[object Array]")if(N)if(i&&i.nodeType===1)for(g=0;y[g]!=null;g++){if(y[g]&&(y[g]===true||y[g].nodeType===1&&k.contains(i,y[g])))n.push(u[g])}else for(g=0;y[g]!=null;g++)y[g]&&y[g].nodeType===1&&n.push(u[g]);else n.push.apply(n,y);else C(y,n);if(F){k(F,p,n,m);k.uniqueSort(n)}return n};k.uniqueSort=function(g){if(w){h= +l;g.sort(w);if(h)for(var i=1;i<g.length;i++)g[i]===g[i-1]&&g.splice(i--,1)}return g};k.matches=function(g,i){return k(g,null,null,i)};k.matchesSelector=function(g,i){return k(i,null,null,[g]).length>0};k.find=function(g,i,n){var m;if(!g)return[];for(var p=0,q=o.order.length;p<q;p++){var u,y=o.order[p];if(u=o.leftMatch[y].exec(g)){var F=u[1];u.splice(1,1);if(F.substr(F.length-1)!=="\\"){u[1]=(u[1]||"").replace(/\\/g,"");m=o.find[y](u,i,n);if(m!=null){g=g.replace(o.match[y],"");break}}}}m||(m=i.getElementsByTagName("*")); +return{set:m,expr:g}};k.filter=function(g,i,n,m){for(var p,q,u=g,y=[],F=i,M=i&&i[0]&&k.isXML(i[0]);g&&i.length;){for(var N in o.filter)if((p=o.leftMatch[N].exec(g))!=null&&p[2]){var O,D,R=o.filter[N];D=p[1];q=false;p.splice(1,1);if(D.substr(D.length-1)!=="\\"){if(F===y)y=[];if(o.preFilter[N])if(p=o.preFilter[N](p,F,n,y,m,M)){if(p===true)continue}else q=O=true;if(p)for(var j=0;(D=F[j])!=null;j++)if(D){O=R(D,p,j,F);var s=m^!!O;if(n&&O!=null)if(s)q=true;else F[j]=false;else if(s){y.push(D);q=true}}if(O!== +B){n||(F=y);g=g.replace(o.match[N],"");if(!q)return[];break}}}if(g===u)if(q==null)k.error(g);else break;u=g}return F};k.error=function(g){throw"Syntax error, unrecognized expression: "+g;};var o=k.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(['"]*)(.*?)\3|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\((even|odd|[\dn+\-]*)\))?/, +POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(g){return g.getAttribute("href")}},relative:{"+":function(g,i){var n=typeof i==="string",m=n&&!/\W/.test(i);n=n&&!m;if(m)i=i.toLowerCase();m=0;for(var p=g.length,q;m<p;m++)if(q=g[m]){for(;(q=q.previousSibling)&&q.nodeType!==1;);g[m]=n||q&&q.nodeName.toLowerCase()=== +i?q||false:q===i}n&&k.filter(i,g,true)},">":function(g,i){var n,m=typeof i==="string",p=0,q=g.length;if(m&&!/\W/.test(i))for(i=i.toLowerCase();p<q;p++){if(n=g[p]){n=n.parentNode;g[p]=n.nodeName.toLowerCase()===i?n:false}}else{for(;p<q;p++)if(n=g[p])g[p]=m?n.parentNode:n.parentNode===i;m&&k.filter(i,g,true)}},"":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m=i=i.toLowerCase();q=a}q("parentNode",i,p,g,m,n)},"~":function(g,i,n){var m,p=e++,q=b;if(typeof i==="string"&&!/\W/.test(i)){m= +i=i.toLowerCase();q=a}q("previousSibling",i,p,g,m,n)}},find:{ID:function(g,i,n){if(typeof i.getElementById!=="undefined"&&!n)return(g=i.getElementById(g[1]))&&g.parentNode?[g]:[]},NAME:function(g,i){if(typeof i.getElementsByName!=="undefined"){for(var n=[],m=i.getElementsByName(g[1]),p=0,q=m.length;p<q;p++)m[p].getAttribute("name")===g[1]&&n.push(m[p]);return n.length===0?null:n}},TAG:function(g,i){return i.getElementsByTagName(g[1])}},preFilter:{CLASS:function(g,i,n,m,p,q){g=" "+g[1].replace(/\\/g, +"")+" ";if(q)return g;q=0;for(var u;(u=i[q])!=null;q++)if(u)if(p^(u.className&&(" "+u.className+" ").replace(/[\t\n]/g," ").indexOf(g)>=0))n||m.push(u);else if(n)i[q]=false;return false},ID:function(g){return g[1].replace(/\\/g,"")},TAG:function(g){return g[1].toLowerCase()},CHILD:function(g){if(g[1]==="nth"){var i=/(-?)(\d*)n((?:\+|-)?\d*)/.exec(g[2]==="even"&&"2n"||g[2]==="odd"&&"2n+1"||!/\D/.test(g[2])&&"0n+"+g[2]||g[2]);g[2]=i[1]+(i[2]||1)-0;g[3]=i[3]-0}g[0]=e++;return g},ATTR:function(g,i,n, +m,p,q){i=g[1].replace(/\\/g,"");if(!q&&o.attrMap[i])g[1]=o.attrMap[i];if(g[2]==="~=")g[4]=" "+g[4]+" ";return g},PSEUDO:function(g,i,n,m,p){if(g[1]==="not")if((d.exec(g[3])||"").length>1||/^\w/.test(g[3]))g[3]=k(g[3],null,null,i);else{g=k.filter(g[3],i,n,true^p);n||m.push.apply(m,g);return false}else if(o.match.POS.test(g[0])||o.match.CHILD.test(g[0]))return true;return g},POS:function(g){g.unshift(true);return g}},filters:{enabled:function(g){return g.disabled===false&&g.type!=="hidden"},disabled:function(g){return g.disabled=== +true},checked:function(g){return g.checked===true},selected:function(g){return g.selected===true},parent:function(g){return!!g.firstChild},empty:function(g){return!g.firstChild},has:function(g,i,n){return!!k(n[3],g).length},header:function(g){return/h\d/i.test(g.nodeName)},text:function(g){return"text"===g.type},radio:function(g){return"radio"===g.type},checkbox:function(g){return"checkbox"===g.type},file:function(g){return"file"===g.type},password:function(g){return"password"===g.type},submit:function(g){return"submit"=== +g.type},image:function(g){return"image"===g.type},reset:function(g){return"reset"===g.type},button:function(g){return"button"===g.type||g.nodeName.toLowerCase()==="button"},input:function(g){return/input|select|textarea|button/i.test(g.nodeName)}},setFilters:{first:function(g,i){return i===0},last:function(g,i,n,m){return i===m.length-1},even:function(g,i){return i%2===0},odd:function(g,i){return i%2===1},lt:function(g,i,n){return i<n[3]-0},gt:function(g,i,n){return i>n[3]-0},nth:function(g,i,n){return n[3]- +0===i},eq:function(g,i,n){return n[3]-0===i}},filter:{PSEUDO:function(g,i,n,m){var p=i[1],q=o.filters[p];if(q)return q(g,n,i,m);else if(p==="contains")return(g.textContent||g.innerText||k.getText([g])||"").indexOf(i[3])>=0;else if(p==="not"){i=i[3];n=0;for(m=i.length;n<m;n++)if(i[n]===g)return false;return true}else k.error("Syntax error, unrecognized expression: "+p)},CHILD:function(g,i){var n=i[1],m=g;switch(n){case "only":case "first":for(;m=m.previousSibling;)if(m.nodeType===1)return false;if(n=== +"first")return true;m=g;case "last":for(;m=m.nextSibling;)if(m.nodeType===1)return false;return true;case "nth":n=i[2];var p=i[3];if(n===1&&p===0)return true;var q=i[0],u=g.parentNode;if(u&&(u.sizcache!==q||!g.nodeIndex)){var y=0;for(m=u.firstChild;m;m=m.nextSibling)if(m.nodeType===1)m.nodeIndex=++y;u.sizcache=q}m=g.nodeIndex-p;return n===0?m===0:m%n===0&&m/n>=0}},ID:function(g,i){return g.nodeType===1&&g.getAttribute("id")===i},TAG:function(g,i){return i==="*"&&g.nodeType===1||g.nodeName.toLowerCase()=== +i},CLASS:function(g,i){return(" "+(g.className||g.getAttribute("class"))+" ").indexOf(i)>-1},ATTR:function(g,i){var n=i[1];n=o.attrHandle[n]?o.attrHandle[n](g):g[n]!=null?g[n]:g.getAttribute(n);var m=n+"",p=i[2],q=i[4];return n==null?p==="!=":p==="="?m===q:p==="*="?m.indexOf(q)>=0:p==="~="?(" "+m+" ").indexOf(q)>=0:!q?m&&n!==false:p==="!="?m!==q:p==="^="?m.indexOf(q)===0:p==="$="?m.substr(m.length-q.length)===q:p==="|="?m===q||m.substr(0,q.length+1)===q+"-":false},POS:function(g,i,n,m){var p=o.setFilters[i[2]]; +if(p)return p(g,n,i,m)}}},x=o.match.POS,r=function(g,i){return"\\"+(i-0+1)},A;for(A in o.match){o.match[A]=RegExp(o.match[A].source+/(?![^\[]*\])(?![^\(]*\))/.source);o.leftMatch[A]=RegExp(/(^(?:.|\r|\n)*?)/.source+o.match[A].source.replace(/\\(\d+)/g,r))}var C=function(g,i){g=Array.prototype.slice.call(g,0);if(i){i.push.apply(i,g);return i}return g};try{Array.prototype.slice.call(t.documentElement.childNodes,0)}catch(J){C=function(g,i){var n=0,m=i||[];if(f.call(g)==="[object Array]")Array.prototype.push.apply(m, +g);else if(typeof g.length==="number")for(var p=g.length;n<p;n++)m.push(g[n]);else for(;g[n];n++)m.push(g[n]);return m}}var w,I;if(t.documentElement.compareDocumentPosition)w=function(g,i){if(g===i){h=true;return 0}if(!g.compareDocumentPosition||!i.compareDocumentPosition)return g.compareDocumentPosition?-1:1;return g.compareDocumentPosition(i)&4?-1:1};else{w=function(g,i){var n,m,p=[],q=[];n=g.parentNode;m=i.parentNode;var u=n;if(g===i){h=true;return 0}else if(n===m)return I(g,i);else if(n){if(!m)return 1}else return-1; +for(;u;){p.unshift(u);u=u.parentNode}for(u=m;u;){q.unshift(u);u=u.parentNode}n=p.length;m=q.length;for(u=0;u<n&&u<m;u++)if(p[u]!==q[u])return I(p[u],q[u]);return u===n?I(g,q[u],-1):I(p[u],i,1)};I=function(g,i,n){if(g===i)return n;for(g=g.nextSibling;g;){if(g===i)return-1;g=g.nextSibling}return 1}}k.getText=function(g){for(var i="",n,m=0;g[m];m++){n=g[m];if(n.nodeType===3||n.nodeType===4)i+=n.nodeValue;else if(n.nodeType!==8)i+=k.getText(n.childNodes)}return i};(function(){var g=t.createElement("div"), +i="script"+(new Date).getTime(),n=t.documentElement;g.innerHTML="<a name='"+i+"'/>";n.insertBefore(g,n.firstChild);if(t.getElementById(i)){o.find.ID=function(m,p,q){if(typeof p.getElementById!=="undefined"&&!q)return(p=p.getElementById(m[1]))?p.id===m[1]||typeof p.getAttributeNode!=="undefined"&&p.getAttributeNode("id").nodeValue===m[1]?[p]:B:[]};o.filter.ID=function(m,p){var q=typeof m.getAttributeNode!=="undefined"&&m.getAttributeNode("id");return m.nodeType===1&&q&&q.nodeValue===p}}n.removeChild(g); +n=g=null})();(function(){var g=t.createElement("div");g.appendChild(t.createComment(""));if(g.getElementsByTagName("*").length>0)o.find.TAG=function(i,n){var m=n.getElementsByTagName(i[1]);if(i[1]==="*"){for(var p=[],q=0;m[q];q++)m[q].nodeType===1&&p.push(m[q]);m=p}return m};g.innerHTML="<a href='#'></a>";if(g.firstChild&&typeof g.firstChild.getAttribute!=="undefined"&&g.firstChild.getAttribute("href")!=="#")o.attrHandle.href=function(i){return i.getAttribute("href",2)};g=null})();t.querySelectorAll&& +function(){var g=k,i=t.createElement("div");i.innerHTML="<p class='TEST'></p>";if(!(i.querySelectorAll&&i.querySelectorAll(".TEST").length===0)){k=function(m,p,q,u){p=p||t;m=m.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!u&&!k.isXML(p))if(p.nodeType===9)try{return C(p.querySelectorAll(m),q)}catch(y){}else if(p.nodeType===1&&p.nodeName.toLowerCase()!=="object"){var F=p.getAttribute("id"),M=F||"__sizzle__";F||p.setAttribute("id",M);try{return C(p.querySelectorAll("#"+M+" "+m),q)}catch(N){}finally{F|| +p.removeAttribute("id")}}return g(m,p,q,u)};for(var n in g)k[n]=g[n];i=null}}();(function(){var g=t.documentElement,i=g.matchesSelector||g.mozMatchesSelector||g.webkitMatchesSelector||g.msMatchesSelector,n=false;try{i.call(t.documentElement,"[test!='']:sizzle")}catch(m){n=true}if(i)k.matchesSelector=function(p,q){q=q.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!k.isXML(p))try{if(n||!o.match.PSEUDO.test(q)&&!/!=/.test(q))return i.call(p,q)}catch(u){}return k(q,null,null,[p]).length>0}})();(function(){var g= +t.createElement("div");g.innerHTML="<div class='test e'></div><div class='test'></div>";if(!(!g.getElementsByClassName||g.getElementsByClassName("e").length===0)){g.lastChild.className="e";if(g.getElementsByClassName("e").length!==1){o.order.splice(1,0,"CLASS");o.find.CLASS=function(i,n,m){if(typeof n.getElementsByClassName!=="undefined"&&!m)return n.getElementsByClassName(i[1])};g=null}}})();k.contains=t.documentElement.contains?function(g,i){return g!==i&&(g.contains?g.contains(i):true)}:t.documentElement.compareDocumentPosition? +function(g,i){return!!(g.compareDocumentPosition(i)&16)}:function(){return false};k.isXML=function(g){return(g=(g?g.ownerDocument||g:0).documentElement)?g.nodeName!=="HTML":false};var L=function(g,i){for(var n,m=[],p="",q=i.nodeType?[i]:i;n=o.match.PSEUDO.exec(g);){p+=n[0];g=g.replace(o.match.PSEUDO,"")}g=o.relative[g]?g+"*":g;n=0;for(var u=q.length;n<u;n++)k(g,q[n],m);return k.filter(p,m)};c.find=k;c.expr=k.selectors;c.expr[":"]=c.expr.filters;c.unique=k.uniqueSort;c.text=k.getText;c.isXMLDoc=k.isXML; +c.contains=k.contains})();var Za=/Until$/,$a=/^(?:parents|prevUntil|prevAll)/,ab=/,/,Na=/^.[^:#\[\.,]*$/,bb=Array.prototype.slice,cb=c.expr.match.POS;c.fn.extend({find:function(a){for(var b=this.pushStack("","find",a),d=0,e=0,f=this.length;e<f;e++){d=b.length;c.find(a,this[e],b);if(e>0)for(var h=d;h<b.length;h++)for(var l=0;l<d;l++)if(b[l]===b[h]){b.splice(h--,1);break}}return b},has:function(a){var b=c(a);return this.filter(function(){for(var d=0,e=b.length;d<e;d++)if(c.contains(this,b[d]))return true})}, +not:function(a){return this.pushStack(ma(this,a,false),"not",a)},filter:function(a){return this.pushStack(ma(this,a,true),"filter",a)},is:function(a){return!!a&&c.filter(a,this).length>0},closest:function(a,b){var d=[],e,f,h=this[0];if(c.isArray(a)){var l,k={},o=1;if(h&&a.length){e=0;for(f=a.length;e<f;e++){l=a[e];k[l]||(k[l]=c.expr.match.POS.test(l)?c(l,b||this.context):l)}for(;h&&h.ownerDocument&&h!==b;){for(l in k){e=k[l];if(e.jquery?e.index(h)>-1:c(h).is(e))d.push({selector:l,elem:h,level:o})}h= +h.parentNode;o++}}return d}l=cb.test(a)?c(a,b||this.context):null;e=0;for(f=this.length;e<f;e++)for(h=this[e];h;)if(l?l.index(h)>-1:c.find.matchesSelector(h,a)){d.push(h);break}else{h=h.parentNode;if(!h||!h.ownerDocument||h===b)break}d=d.length>1?c.unique(d):d;return this.pushStack(d,"closest",a)},index:function(a){if(!a||typeof a==="string")return c.inArray(this[0],a?c(a):this.parent().children());return c.inArray(a.jquery?a[0]:a,this)},add:function(a,b){var d=typeof a==="string"?c(a,b||this.context): +c.makeArray(a),e=c.merge(this.get(),d);return this.pushStack(!d[0]||!d[0].parentNode||d[0].parentNode.nodeType===11||!e[0]||!e[0].parentNode||e[0].parentNode.nodeType===11?e:c.unique(e))},andSelf:function(){return this.add(this.prevObject)}});c.each({parent:function(a){return(a=a.parentNode)&&a.nodeType!==11?a:null},parents:function(a){return c.dir(a,"parentNode")},parentsUntil:function(a,b,d){return c.dir(a,"parentNode",d)},next:function(a){return c.nth(a,2,"nextSibling")},prev:function(a){return c.nth(a, +2,"previousSibling")},nextAll:function(a){return c.dir(a,"nextSibling")},prevAll:function(a){return c.dir(a,"previousSibling")},nextUntil:function(a,b,d){return c.dir(a,"nextSibling",d)},prevUntil:function(a,b,d){return c.dir(a,"previousSibling",d)},siblings:function(a){return c.sibling(a.parentNode.firstChild,a)},children:function(a){return c.sibling(a.firstChild)},contents:function(a){return c.nodeName(a,"iframe")?a.contentDocument||a.contentWindow.document:c.makeArray(a.childNodes)}},function(a, +b){c.fn[a]=function(d,e){var f=c.map(this,b,d);Za.test(a)||(e=d);if(e&&typeof e==="string")f=c.filter(e,f);f=this.length>1?c.unique(f):f;if((this.length>1||ab.test(e))&&$a.test(a))f=f.reverse();return this.pushStack(f,a,bb.call(arguments).join(","))}});c.extend({filter:function(a,b,d){if(d)a=":not("+a+")";return b.length===1?c.find.matchesSelector(b[0],a)?[b[0]]:[]:c.find.matches(a,b)},dir:function(a,b,d){var e=[];for(a=a[b];a&&a.nodeType!==9&&(d===B||a.nodeType!==1||!c(a).is(d));){a.nodeType===1&& +e.push(a);a=a[b]}return e},nth:function(a,b,d){b=b||1;for(var e=0;a;a=a[d])if(a.nodeType===1&&++e===b)break;return a},sibling:function(a,b){for(var d=[];a;a=a.nextSibling)a.nodeType===1&&a!==b&&d.push(a);return d}});var za=/ jQuery\d+="(?:\d+|null)"/g,$=/^\s+/,Aa=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,Ba=/<([\w:]+)/,db=/<tbody/i,eb=/<|&#?\w+;/,Ca=/<(?:script|object|embed|option|style)/i,Da=/checked\s*(?:[^=]|=\s*.checked.)/i,fb=/\=([^="'>\s]+\/)>/g,P={option:[1, +"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]};P.optgroup=P.option;P.tbody=P.tfoot=P.colgroup=P.caption=P.thead;P.th=P.td;if(!c.support.htmlSerialize)P._default=[1,"div<div>","</div>"];c.fn.extend({text:function(a){if(c.isFunction(a))return this.each(function(b){var d= +c(this);d.text(a.call(this,b,d.text()))});if(typeof a!=="object"&&a!==B)return this.empty().append((this[0]&&this[0].ownerDocument||t).createTextNode(a));return c.text(this)},wrapAll:function(a){if(c.isFunction(a))return this.each(function(d){c(this).wrapAll(a.call(this,d))});if(this[0]){var b=c(a,this[0].ownerDocument).eq(0).clone(true);this[0].parentNode&&b.insertBefore(this[0]);b.map(function(){for(var d=this;d.firstChild&&d.firstChild.nodeType===1;)d=d.firstChild;return d}).append(this)}return this}, +wrapInner:function(a){if(c.isFunction(a))return this.each(function(b){c(this).wrapInner(a.call(this,b))});return this.each(function(){var b=c(this),d=b.contents();d.length?d.wrapAll(a):b.append(a)})},wrap:function(a){return this.each(function(){c(this).wrapAll(a)})},unwrap:function(){return this.parent().each(function(){c.nodeName(this,"body")||c(this).replaceWith(this.childNodes)}).end()},append:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.appendChild(a)})}, +prepend:function(){return this.domManip(arguments,true,function(a){this.nodeType===1&&this.insertBefore(a,this.firstChild)})},before:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b,this)});else if(arguments.length){var a=c(arguments[0]);a.push.apply(a,this.toArray());return this.pushStack(a,"before",arguments)}},after:function(){if(this[0]&&this[0].parentNode)return this.domManip(arguments,false,function(b){this.parentNode.insertBefore(b, +this.nextSibling)});else if(arguments.length){var a=this.pushStack(this,"after",arguments);a.push.apply(a,c(arguments[0]).toArray());return a}},remove:function(a,b){for(var d=0,e;(e=this[d])!=null;d++)if(!a||c.filter(a,[e]).length){if(!b&&e.nodeType===1){c.cleanData(e.getElementsByTagName("*"));c.cleanData([e])}e.parentNode&&e.parentNode.removeChild(e)}return this},empty:function(){for(var a=0,b;(b=this[a])!=null;a++)for(b.nodeType===1&&c.cleanData(b.getElementsByTagName("*"));b.firstChild;)b.removeChild(b.firstChild); +return this},clone:function(a){var b=this.map(function(){if(!c.support.noCloneEvent&&!c.isXMLDoc(this)){var d=this.outerHTML,e=this.ownerDocument;if(!d){d=e.createElement("div");d.appendChild(this.cloneNode(true));d=d.innerHTML}return c.clean([d.replace(za,"").replace(fb,'="$1">').replace($,"")],e)[0]}else return this.cloneNode(true)});if(a===true){na(this,b);na(this.find("*"),b.find("*"))}return b},html:function(a){if(a===B)return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(za,""):null; +else if(typeof a==="string"&&!Ca.test(a)&&(c.support.leadingWhitespace||!$.test(a))&&!P[(Ba.exec(a)||["",""])[1].toLowerCase()]){a=a.replace(Aa,"<$1></$2>");try{for(var b=0,d=this.length;b<d;b++)if(this[b].nodeType===1){c.cleanData(this[b].getElementsByTagName("*"));this[b].innerHTML=a}}catch(e){this.empty().append(a)}}else c.isFunction(a)?this.each(function(f){var h=c(this);h.html(a.call(this,f,h.html()))}):this.empty().append(a);return this},replaceWith:function(a){if(this[0]&&this[0].parentNode){if(c.isFunction(a))return this.each(function(b){var d= +c(this),e=d.html();d.replaceWith(a.call(this,b,e))});if(typeof a!=="string")a=c(a).detach();return this.each(function(){var b=this.nextSibling,d=this.parentNode;c(this).remove();b?c(b).before(a):c(d).append(a)})}else return this.pushStack(c(c.isFunction(a)?a():a),"replaceWith",a)},detach:function(a){return this.remove(a,true)},domManip:function(a,b,d){var e,f,h,l=a[0],k=[];if(!c.support.checkClone&&arguments.length===3&&typeof l==="string"&&Da.test(l))return this.each(function(){c(this).domManip(a, +b,d,true)});if(c.isFunction(l))return this.each(function(x){var r=c(this);a[0]=l.call(this,x,b?r.html():B);r.domManip(a,b,d)});if(this[0]){e=l&&l.parentNode;e=c.support.parentNode&&e&&e.nodeType===11&&e.childNodes.length===this.length?{fragment:e}:c.buildFragment(a,this,k);h=e.fragment;if(f=h.childNodes.length===1?h=h.firstChild:h.firstChild){b=b&&c.nodeName(f,"tr");f=0;for(var o=this.length;f<o;f++)d.call(b?c.nodeName(this[f],"table")?this[f].getElementsByTagName("tbody")[0]||this[f].appendChild(this[f].ownerDocument.createElement("tbody")): +this[f]:this[f],f>0||e.cacheable||this.length>1?h.cloneNode(true):h)}k.length&&c.each(k,Oa)}return this}});c.buildFragment=function(a,b,d){var e,f,h;b=b&&b[0]?b[0].ownerDocument||b[0]:t;if(a.length===1&&typeof a[0]==="string"&&a[0].length<512&&b===t&&!Ca.test(a[0])&&(c.support.checkClone||!Da.test(a[0]))){f=true;if(h=c.fragments[a[0]])if(h!==1)e=h}if(!e){e=b.createDocumentFragment();c.clean(a,b,e,d)}if(f)c.fragments[a[0]]=h?e:1;return{fragment:e,cacheable:f}};c.fragments={};c.each({appendTo:"append", +prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){c.fn[a]=function(d){var e=[];d=c(d);var f=this.length===1&&this[0].parentNode;if(f&&f.nodeType===11&&f.childNodes.length===1&&d.length===1){d[b](this[0]);return this}else{f=0;for(var h=d.length;f<h;f++){var l=(f>0?this.clone(true):this).get();c(d[f])[b](l);e=e.concat(l)}return this.pushStack(e,a,d.selector)}}});c.extend({clean:function(a,b,d,e){b=b||t;if(typeof b.createElement==="undefined")b=b.ownerDocument|| +b[0]&&b[0].ownerDocument||t;for(var f=[],h=0,l;(l=a[h])!=null;h++){if(typeof l==="number")l+="";if(l){if(typeof l==="string"&&!eb.test(l))l=b.createTextNode(l);else if(typeof l==="string"){l=l.replace(Aa,"<$1></$2>");var k=(Ba.exec(l)||["",""])[1].toLowerCase(),o=P[k]||P._default,x=o[0],r=b.createElement("div");for(r.innerHTML=o[1]+l+o[2];x--;)r=r.lastChild;if(!c.support.tbody){x=db.test(l);k=k==="table"&&!x?r.firstChild&&r.firstChild.childNodes:o[1]==="<table>"&&!x?r.childNodes:[];for(o=k.length- +1;o>=0;--o)c.nodeName(k[o],"tbody")&&!k[o].childNodes.length&&k[o].parentNode.removeChild(k[o])}!c.support.leadingWhitespace&&$.test(l)&&r.insertBefore(b.createTextNode($.exec(l)[0]),r.firstChild);l=r.childNodes}if(l.nodeType)f.push(l);else f=c.merge(f,l)}}if(d)for(h=0;f[h];h++)if(e&&c.nodeName(f[h],"script")&&(!f[h].type||f[h].type.toLowerCase()==="text/javascript"))e.push(f[h].parentNode?f[h].parentNode.removeChild(f[h]):f[h]);else{f[h].nodeType===1&&f.splice.apply(f,[h+1,0].concat(c.makeArray(f[h].getElementsByTagName("script")))); +d.appendChild(f[h])}return f},cleanData:function(a){for(var b,d,e=c.cache,f=c.event.special,h=c.support.deleteExpando,l=0,k;(k=a[l])!=null;l++)if(!(k.nodeName&&c.noData[k.nodeName.toLowerCase()]))if(d=k[c.expando]){if((b=e[d])&&b.events)for(var o in b.events)f[o]?c.event.remove(k,o):c.removeEvent(k,o,b.handle);if(h)delete k[c.expando];else k.removeAttribute&&k.removeAttribute(c.expando);delete e[d]}}});var Ea=/alpha\([^)]*\)/i,gb=/opacity=([^)]*)/,hb=/-([a-z])/ig,ib=/([A-Z])/g,Fa=/^-?\d+(?:px)?$/i, +jb=/^-?\d/,kb={position:"absolute",visibility:"hidden",display:"block"},Pa=["Left","Right"],Qa=["Top","Bottom"],W,Ga,aa,lb=function(a,b){return b.toUpperCase()};c.fn.css=function(a,b){if(arguments.length===2&&b===B)return this;return c.access(this,a,b,true,function(d,e,f){return f!==B?c.style(d,e,f):c.css(d,e)})};c.extend({cssHooks:{opacity:{get:function(a,b){if(b){var d=W(a,"opacity","opacity");return d===""?"1":d}else return a.style.opacity}}},cssNumber:{zIndex:true,fontWeight:true,opacity:true, +zoom:true,lineHeight:true},cssProps:{"float":c.support.cssFloat?"cssFloat":"styleFloat"},style:function(a,b,d,e){if(!(!a||a.nodeType===3||a.nodeType===8||!a.style)){var f,h=c.camelCase(b),l=a.style,k=c.cssHooks[h];b=c.cssProps[h]||h;if(d!==B){if(!(typeof d==="number"&&isNaN(d)||d==null)){if(typeof d==="number"&&!c.cssNumber[h])d+="px";if(!k||!("set"in k)||(d=k.set(a,d))!==B)try{l[b]=d}catch(o){}}}else{if(k&&"get"in k&&(f=k.get(a,false,e))!==B)return f;return l[b]}}},css:function(a,b,d){var e,f=c.camelCase(b), +h=c.cssHooks[f];b=c.cssProps[f]||f;if(h&&"get"in h&&(e=h.get(a,true,d))!==B)return e;else if(W)return W(a,b,f)},swap:function(a,b,d){var e={},f;for(f in b){e[f]=a.style[f];a.style[f]=b[f]}d.call(a);for(f in b)a.style[f]=e[f]},camelCase:function(a){return a.replace(hb,lb)}});c.curCSS=c.css;c.each(["height","width"],function(a,b){c.cssHooks[b]={get:function(d,e,f){var h;if(e){if(d.offsetWidth!==0)h=oa(d,b,f);else c.swap(d,kb,function(){h=oa(d,b,f)});if(h<=0){h=W(d,b,b);if(h==="0px"&&aa)h=aa(d,b,b); +if(h!=null)return h===""||h==="auto"?"0px":h}if(h<0||h==null){h=d.style[b];return h===""||h==="auto"?"0px":h}return typeof h==="string"?h:h+"px"}},set:function(d,e){if(Fa.test(e)){e=parseFloat(e);if(e>=0)return e+"px"}else return e}}});if(!c.support.opacity)c.cssHooks.opacity={get:function(a,b){return gb.test((b&&a.currentStyle?a.currentStyle.filter:a.style.filter)||"")?parseFloat(RegExp.$1)/100+"":b?"1":""},set:function(a,b){var d=a.style;d.zoom=1;var e=c.isNaN(b)?"":"alpha(opacity="+b*100+")",f= +d.filter||"";d.filter=Ea.test(f)?f.replace(Ea,e):d.filter+" "+e}};if(t.defaultView&&t.defaultView.getComputedStyle)Ga=function(a,b,d){var e;d=d.replace(ib,"-$1").toLowerCase();if(!(b=a.ownerDocument.defaultView))return B;if(b=b.getComputedStyle(a,null)){e=b.getPropertyValue(d);if(e===""&&!c.contains(a.ownerDocument.documentElement,a))e=c.style(a,d)}return e};if(t.documentElement.currentStyle)aa=function(a,b){var d,e,f=a.currentStyle&&a.currentStyle[b],h=a.style;if(!Fa.test(f)&&jb.test(f)){d=h.left; +e=a.runtimeStyle.left;a.runtimeStyle.left=a.currentStyle.left;h.left=b==="fontSize"?"1em":f||0;f=h.pixelLeft+"px";h.left=d;a.runtimeStyle.left=e}return f===""?"auto":f};W=Ga||aa;if(c.expr&&c.expr.filters){c.expr.filters.hidden=function(a){var b=a.offsetHeight;return a.offsetWidth===0&&b===0||!c.support.reliableHiddenOffsets&&(a.style.display||c.css(a,"display"))==="none"};c.expr.filters.visible=function(a){return!c.expr.filters.hidden(a)}}var mb=c.now(),nb=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi, +ob=/^(?:select|textarea)/i,pb=/^(?:color|date|datetime|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,qb=/^(?:GET|HEAD)$/,Ra=/\[\]$/,T=/\=\?(&|$)/,ja=/\?/,rb=/([?&])_=[^&]*/,sb=/^(\w+:)?\/\/([^\/?#]+)/,tb=/%20/g,ub=/#.*$/,Ha=c.fn.load;c.fn.extend({load:function(a,b,d){if(typeof a!=="string"&&Ha)return Ha.apply(this,arguments);else if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var f=a.slice(e,a.length);a=a.slice(0,e)}e="GET";if(b)if(c.isFunction(b)){d=b;b=null}else if(typeof b=== +"object"){b=c.param(b,c.ajaxSettings.traditional);e="POST"}var h=this;c.ajax({url:a,type:e,dataType:"html",data:b,complete:function(l,k){if(k==="success"||k==="notmodified")h.html(f?c("<div>").append(l.responseText.replace(nb,"")).find(f):l.responseText);d&&h.each(d,[l.responseText,k,l])}});return this},serialize:function(){return c.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?c.makeArray(this.elements):this}).filter(function(){return this.name&& +!this.disabled&&(this.checked||ob.test(this.nodeName)||pb.test(this.type))}).map(function(a,b){var d=c(this).val();return d==null?null:c.isArray(d)?c.map(d,function(e){return{name:b.name,value:e}}):{name:b.name,value:d}}).get()}});c.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){c.fn[b]=function(d){return this.bind(b,d)}});c.extend({get:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b=null}return c.ajax({type:"GET",url:a,data:b,success:d,dataType:e})}, +getScript:function(a,b){return c.get(a,null,b,"script")},getJSON:function(a,b,d){return c.get(a,b,d,"json")},post:function(a,b,d,e){if(c.isFunction(b)){e=e||d;d=b;b={}}return c.ajax({type:"POST",url:a,data:b,success:d,dataType:e})},ajaxSetup:function(a){c.extend(c.ajaxSettings,a)},ajaxSettings:{url:location.href,global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,xhr:function(){return new E.XMLHttpRequest},accepts:{xml:"application/xml, text/xml",html:"text/html", +script:"text/javascript, application/javascript",json:"application/json, text/javascript",text:"text/plain",_default:"*/*"}},ajax:function(a){var b=c.extend(true,{},c.ajaxSettings,a),d,e,f,h=b.type.toUpperCase(),l=qb.test(h);b.url=b.url.replace(ub,"");b.context=a&&a.context!=null?a.context:b;if(b.data&&b.processData&&typeof b.data!=="string")b.data=c.param(b.data,b.traditional);if(b.dataType==="jsonp"){if(h==="GET")T.test(b.url)||(b.url+=(ja.test(b.url)?"&":"?")+(b.jsonp||"callback")+"=?");else if(!b.data|| +!T.test(b.data))b.data=(b.data?b.data+"&":"")+(b.jsonp||"callback")+"=?";b.dataType="json"}if(b.dataType==="json"&&(b.data&&T.test(b.data)||T.test(b.url))){d=b.jsonpCallback||"jsonp"+mb++;if(b.data)b.data=(b.data+"").replace(T,"="+d+"$1");b.url=b.url.replace(T,"="+d+"$1");b.dataType="script";var k=E[d];E[d]=function(m){if(c.isFunction(k))k(m);else{E[d]=B;try{delete E[d]}catch(p){}}f=m;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);r&&r.removeChild(A)}}if(b.dataType==="script"&&b.cache===null)b.cache= +false;if(b.cache===false&&l){var o=c.now(),x=b.url.replace(rb,"$1_="+o);b.url=x+(x===b.url?(ja.test(b.url)?"&":"?")+"_="+o:"")}if(b.data&&l)b.url+=(ja.test(b.url)?"&":"?")+b.data;b.global&&c.active++===0&&c.event.trigger("ajaxStart");o=(o=sb.exec(b.url))&&(o[1]&&o[1].toLowerCase()!==location.protocol||o[2].toLowerCase()!==location.host);if(b.dataType==="script"&&h==="GET"&&o){var r=t.getElementsByTagName("head")[0]||t.documentElement,A=t.createElement("script");if(b.scriptCharset)A.charset=b.scriptCharset; +A.src=b.url;if(!d){var C=false;A.onload=A.onreadystatechange=function(){if(!C&&(!this.readyState||this.readyState==="loaded"||this.readyState==="complete")){C=true;c.handleSuccess(b,w,e,f);c.handleComplete(b,w,e,f);A.onload=A.onreadystatechange=null;r&&A.parentNode&&r.removeChild(A)}}}r.insertBefore(A,r.firstChild);return B}var J=false,w=b.xhr();if(w){b.username?w.open(h,b.url,b.async,b.username,b.password):w.open(h,b.url,b.async);try{if(b.data!=null&&!l||a&&a.contentType)w.setRequestHeader("Content-Type", +b.contentType);if(b.ifModified){c.lastModified[b.url]&&w.setRequestHeader("If-Modified-Since",c.lastModified[b.url]);c.etag[b.url]&&w.setRequestHeader("If-None-Match",c.etag[b.url])}o||w.setRequestHeader("X-Requested-With","XMLHttpRequest");w.setRequestHeader("Accept",b.dataType&&b.accepts[b.dataType]?b.accepts[b.dataType]+", */*; q=0.01":b.accepts._default)}catch(I){}if(b.beforeSend&&b.beforeSend.call(b.context,w,b)===false){b.global&&c.active--===1&&c.event.trigger("ajaxStop");w.abort();return false}b.global&& +c.triggerGlobal(b,"ajaxSend",[w,b]);var L=w.onreadystatechange=function(m){if(!w||w.readyState===0||m==="abort"){J||c.handleComplete(b,w,e,f);J=true;if(w)w.onreadystatechange=c.noop}else if(!J&&w&&(w.readyState===4||m==="timeout")){J=true;w.onreadystatechange=c.noop;e=m==="timeout"?"timeout":!c.httpSuccess(w)?"error":b.ifModified&&c.httpNotModified(w,b.url)?"notmodified":"success";var p;if(e==="success")try{f=c.httpData(w,b.dataType,b)}catch(q){e="parsererror";p=q}if(e==="success"||e==="notmodified")d|| +c.handleSuccess(b,w,e,f);else c.handleError(b,w,e,p);d||c.handleComplete(b,w,e,f);m==="timeout"&&w.abort();if(b.async)w=null}};try{var g=w.abort;w.abort=function(){w&&Function.prototype.call.call(g,w);L("abort")}}catch(i){}b.async&&b.timeout>0&&setTimeout(function(){w&&!J&&L("timeout")},b.timeout);try{w.send(l||b.data==null?null:b.data)}catch(n){c.handleError(b,w,null,n);c.handleComplete(b,w,e,f)}b.async||L();return w}},param:function(a,b){var d=[],e=function(h,l){l=c.isFunction(l)?l():l;d[d.length]= +encodeURIComponent(h)+"="+encodeURIComponent(l)};if(b===B)b=c.ajaxSettings.traditional;if(c.isArray(a)||a.jquery)c.each(a,function(){e(this.name,this.value)});else for(var f in a)da(f,a[f],b,e);return d.join("&").replace(tb,"+")}});c.extend({active:0,lastModified:{},etag:{},handleError:function(a,b,d,e){a.error&&a.error.call(a.context,b,d,e);a.global&&c.triggerGlobal(a,"ajaxError",[b,a,e])},handleSuccess:function(a,b,d,e){a.success&&a.success.call(a.context,e,d,b);a.global&&c.triggerGlobal(a,"ajaxSuccess", +[b,a])},handleComplete:function(a,b,d){a.complete&&a.complete.call(a.context,b,d);a.global&&c.triggerGlobal(a,"ajaxComplete",[b,a]);a.global&&c.active--===1&&c.event.trigger("ajaxStop")},triggerGlobal:function(a,b,d){(a.context&&a.context.url==null?c(a.context):c.event).trigger(b,d)},httpSuccess:function(a){try{return!a.status&&location.protocol==="file:"||a.status>=200&&a.status<300||a.status===304||a.status===1223}catch(b){}return false},httpNotModified:function(a,b){var d=a.getResponseHeader("Last-Modified"), +e=a.getResponseHeader("Etag");if(d)c.lastModified[b]=d;if(e)c.etag[b]=e;return a.status===304},httpData:function(a,b,d){var e=a.getResponseHeader("content-type")||"",f=b==="xml"||!b&&e.indexOf("xml")>=0;a=f?a.responseXML:a.responseText;f&&a.documentElement.nodeName==="parsererror"&&c.error("parsererror");if(d&&d.dataFilter)a=d.dataFilter(a,b);if(typeof a==="string")if(b==="json"||!b&&e.indexOf("json")>=0)a=c.parseJSON(a);else if(b==="script"||!b&&e.indexOf("javascript")>=0)c.globalEval(a);return a}}); +if(E.ActiveXObject)c.ajaxSettings.xhr=function(){if(E.location.protocol!=="file:")try{return new E.XMLHttpRequest}catch(a){}try{return new E.ActiveXObject("Microsoft.XMLHTTP")}catch(b){}};c.support.ajax=!!c.ajaxSettings.xhr();var ea={},vb=/^(?:toggle|show|hide)$/,wb=/^([+\-]=)?([\d+.\-]+)(.*)$/,ba,pa=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]];c.fn.extend({show:function(a,b,d){if(a||a===0)return this.animate(S("show", +3),a,b,d);else{d=0;for(var e=this.length;d<e;d++){a=this[d];b=a.style.display;if(!c.data(a,"olddisplay")&&b==="none")b=a.style.display="";b===""&&c.css(a,"display")==="none"&&c.data(a,"olddisplay",qa(a.nodeName))}for(d=0;d<e;d++){a=this[d];b=a.style.display;if(b===""||b==="none")a.style.display=c.data(a,"olddisplay")||""}return this}},hide:function(a,b,d){if(a||a===0)return this.animate(S("hide",3),a,b,d);else{a=0;for(b=this.length;a<b;a++){d=c.css(this[a],"display");d!=="none"&&c.data(this[a],"olddisplay", +d)}for(a=0;a<b;a++)this[a].style.display="none";return this}},_toggle:c.fn.toggle,toggle:function(a,b,d){var e=typeof a==="boolean";if(c.isFunction(a)&&c.isFunction(b))this._toggle.apply(this,arguments);else a==null||e?this.each(function(){var f=e?a:c(this).is(":hidden");c(this)[f?"show":"hide"]()}):this.animate(S("toggle",3),a,b,d);return this},fadeTo:function(a,b,d,e){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:b},a,d,e)},animate:function(a,b,d,e){var f=c.speed(b, +d,e);if(c.isEmptyObject(a))return this.each(f.complete);return this[f.queue===false?"each":"queue"](function(){var h=c.extend({},f),l,k=this.nodeType===1,o=k&&c(this).is(":hidden"),x=this;for(l in a){var r=c.camelCase(l);if(l!==r){a[r]=a[l];delete a[l];l=r}if(a[l]==="hide"&&o||a[l]==="show"&&!o)return h.complete.call(this);if(k&&(l==="height"||l==="width")){h.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(c.css(this,"display")==="inline"&&c.css(this,"float")==="none")if(c.support.inlineBlockNeedsLayout)if(qa(this.nodeName)=== +"inline")this.style.display="inline-block";else{this.style.display="inline";this.style.zoom=1}else this.style.display="inline-block"}if(c.isArray(a[l])){(h.specialEasing=h.specialEasing||{})[l]=a[l][1];a[l]=a[l][0]}}if(h.overflow!=null)this.style.overflow="hidden";h.curAnim=c.extend({},a);c.each(a,function(A,C){var J=new c.fx(x,h,A);if(vb.test(C))J[C==="toggle"?o?"show":"hide":C](a);else{var w=wb.exec(C),I=J.cur()||0;if(w){var L=parseFloat(w[2]),g=w[3]||"px";if(g!=="px"){c.style(x,A,(L||1)+g);I=(L|| +1)/J.cur()*I;c.style(x,A,I+g)}if(w[1])L=(w[1]==="-="?-1:1)*L+I;J.custom(I,L,g)}else J.custom(I,C,"")}});return true})},stop:function(a,b){var d=c.timers;a&&this.queue([]);this.each(function(){for(var e=d.length-1;e>=0;e--)if(d[e].elem===this){b&&d[e](true);d.splice(e,1)}});b||this.dequeue();return this}});c.each({slideDown:S("show",1),slideUp:S("hide",1),slideToggle:S("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){c.fn[a]=function(d,e,f){return this.animate(b, +d,e,f)}});c.extend({speed:function(a,b,d){var e=a&&typeof a==="object"?c.extend({},a):{complete:d||!d&&b||c.isFunction(a)&&a,duration:a,easing:d&&b||b&&!c.isFunction(b)&&b};e.duration=c.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in c.fx.speeds?c.fx.speeds[e.duration]:c.fx.speeds._default;e.old=e.complete;e.complete=function(){e.queue!==false&&c(this).dequeue();c.isFunction(e.old)&&e.old.call(this)};return e},easing:{linear:function(a,b,d,e){return d+e*a},swing:function(a,b,d,e){return(-Math.cos(a* +Math.PI)/2+0.5)*e+d}},timers:[],fx:function(a,b,d){this.options=b;this.elem=a;this.prop=d;if(!b.orig)b.orig={}}});c.fx.prototype={update:function(){this.options.step&&this.options.step.call(this.elem,this.now,this);(c.fx.step[this.prop]||c.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null))return this.elem[this.prop];var a=parseFloat(c.css(this.elem,this.prop));return a&&a>-1E4?a:0},custom:function(a,b,d){function e(l){return f.step(l)} +var f=this,h=c.fx;this.startTime=c.now();this.start=a;this.end=b;this.unit=d||this.unit||"px";this.now=this.start;this.pos=this.state=0;e.elem=this.elem;if(e()&&c.timers.push(e)&&!ba)ba=setInterval(h.tick,h.interval)},show:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.show=true;this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur());c(this.elem).show()},hide:function(){this.options.orig[this.prop]=c.style(this.elem,this.prop);this.options.hide=true; +this.custom(this.cur(),0)},step:function(a){var b=c.now(),d=true;if(a||b>=this.options.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();this.options.curAnim[this.prop]=true;for(var e in this.options.curAnim)if(this.options.curAnim[e]!==true)d=false;if(d){if(this.options.overflow!=null&&!c.support.shrinkWrapBlocks){var f=this.elem,h=this.options;c.each(["","X","Y"],function(k,o){f.style["overflow"+o]=h.overflow[k]})}this.options.hide&&c(this.elem).hide();if(this.options.hide|| +this.options.show)for(var l in this.options.curAnim)c.style(this.elem,l,this.options.orig[l]);this.options.complete.call(this.elem)}return false}else{a=b-this.startTime;this.state=a/this.options.duration;b=this.options.easing||(c.easing.swing?"swing":"linear");this.pos=c.easing[this.options.specialEasing&&this.options.specialEasing[this.prop]||b](this.state,a,0,1,this.options.duration);this.now=this.start+(this.end-this.start)*this.pos;this.update()}return true}};c.extend(c.fx,{tick:function(){for(var a= +c.timers,b=0;b<a.length;b++)a[b]()||a.splice(b--,1);a.length||c.fx.stop()},interval:13,stop:function(){clearInterval(ba);ba=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(a){c.style(a.elem,"opacity",a.now)},_default:function(a){if(a.elem.style&&a.elem.style[a.prop]!=null)a.elem.style[a.prop]=(a.prop==="width"||a.prop==="height"?Math.max(0,a.now):a.now)+a.unit;else a.elem[a.prop]=a.now}}});if(c.expr&&c.expr.filters)c.expr.filters.animated=function(a){return c.grep(c.timers,function(b){return a=== +b.elem}).length};var xb=/^t(?:able|d|h)$/i,Ia=/^(?:body|html)$/i;c.fn.offset="getBoundingClientRect"in t.documentElement?function(a){var b=this[0],d;if(a)return this.each(function(l){c.offset.setOffset(this,a,l)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);try{d=b.getBoundingClientRect()}catch(e){}var f=b.ownerDocument,h=f.documentElement;if(!d||!c.contains(h,b))return d||{top:0,left:0};b=f.body;f=fa(f);return{top:d.top+(f.pageYOffset||c.support.boxModel&& +h.scrollTop||b.scrollTop)-(h.clientTop||b.clientTop||0),left:d.left+(f.pageXOffset||c.support.boxModel&&h.scrollLeft||b.scrollLeft)-(h.clientLeft||b.clientLeft||0)}}:function(a){var b=this[0];if(a)return this.each(function(x){c.offset.setOffset(this,a,x)});if(!b||!b.ownerDocument)return null;if(b===b.ownerDocument.body)return c.offset.bodyOffset(b);c.offset.initialize();var d,e=b.offsetParent,f=b.ownerDocument,h=f.documentElement,l=f.body;d=(f=f.defaultView)?f.getComputedStyle(b,null):b.currentStyle; +for(var k=b.offsetTop,o=b.offsetLeft;(b=b.parentNode)&&b!==l&&b!==h;){if(c.offset.supportsFixedPosition&&d.position==="fixed")break;d=f?f.getComputedStyle(b,null):b.currentStyle;k-=b.scrollTop;o-=b.scrollLeft;if(b===e){k+=b.offsetTop;o+=b.offsetLeft;if(c.offset.doesNotAddBorder&&!(c.offset.doesAddBorderForTableAndCells&&xb.test(b.nodeName))){k+=parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}e=b.offsetParent}if(c.offset.subtractsBorderForOverflowNotVisible&&d.overflow!=="visible"){k+= +parseFloat(d.borderTopWidth)||0;o+=parseFloat(d.borderLeftWidth)||0}d=d}if(d.position==="relative"||d.position==="static"){k+=l.offsetTop;o+=l.offsetLeft}if(c.offset.supportsFixedPosition&&d.position==="fixed"){k+=Math.max(h.scrollTop,l.scrollTop);o+=Math.max(h.scrollLeft,l.scrollLeft)}return{top:k,left:o}};c.offset={initialize:function(){var a=t.body,b=t.createElement("div"),d,e,f,h=parseFloat(c.css(a,"marginTop"))||0;c.extend(b.style,{position:"absolute",top:0,left:0,margin:0,border:0,width:"1px", +height:"1px",visibility:"hidden"});b.innerHTML="<div style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;'><div></div></div><table style='position:absolute;top:0;left:0;margin:0;border:5px solid #000;padding:0;width:1px;height:1px;' cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";a.insertBefore(b,a.firstChild);d=b.firstChild;e=d.firstChild;f=d.nextSibling.firstChild.firstChild;this.doesNotAddBorder=e.offsetTop!==5;this.doesAddBorderForTableAndCells= +f.offsetTop===5;e.style.position="fixed";e.style.top="20px";this.supportsFixedPosition=e.offsetTop===20||e.offsetTop===15;e.style.position=e.style.top="";d.style.overflow="hidden";d.style.position="relative";this.subtractsBorderForOverflowNotVisible=e.offsetTop===-5;this.doesNotIncludeMarginInBodyOffset=a.offsetTop!==h;a.removeChild(b);c.offset.initialize=c.noop},bodyOffset:function(a){var b=a.offsetTop,d=a.offsetLeft;c.offset.initialize();if(c.offset.doesNotIncludeMarginInBodyOffset){b+=parseFloat(c.css(a, +"marginTop"))||0;d+=parseFloat(c.css(a,"marginLeft"))||0}return{top:b,left:d}},setOffset:function(a,b,d){var e=c.css(a,"position");if(e==="static")a.style.position="relative";var f=c(a),h=f.offset(),l=c.css(a,"top"),k=c.css(a,"left"),o=e==="absolute"&&c.inArray("auto",[l,k])>-1;e={};var x={};if(o)x=f.position();l=o?x.top:parseInt(l,10)||0;k=o?x.left:parseInt(k,10)||0;if(c.isFunction(b))b=b.call(a,d,h);if(b.top!=null)e.top=b.top-h.top+l;if(b.left!=null)e.left=b.left-h.left+k;"using"in b?b.using.call(a, +e):f.css(e)}};c.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),d=this.offset(),e=Ia.test(b[0].nodeName)?{top:0,left:0}:b.offset();d.top-=parseFloat(c.css(a,"marginTop"))||0;d.left-=parseFloat(c.css(a,"marginLeft"))||0;e.top+=parseFloat(c.css(b[0],"borderTopWidth"))||0;e.left+=parseFloat(c.css(b[0],"borderLeftWidth"))||0;return{top:d.top-e.top,left:d.left-e.left}},offsetParent:function(){return this.map(function(){for(var a=this.offsetParent||t.body;a&&!Ia.test(a.nodeName)&& +c.css(a,"position")==="static";)a=a.offsetParent;return a})}});c.each(["Left","Top"],function(a,b){var d="scroll"+b;c.fn[d]=function(e){var f=this[0],h;if(!f)return null;if(e!==B)return this.each(function(){if(h=fa(this))h.scrollTo(!a?e:c(h).scrollLeft(),a?e:c(h).scrollTop());else this[d]=e});else return(h=fa(f))?"pageXOffset"in h?h[a?"pageYOffset":"pageXOffset"]:c.support.boxModel&&h.document.documentElement[d]||h.document.body[d]:f[d]}});c.each(["Height","Width"],function(a,b){var d=b.toLowerCase(); +c.fn["inner"+b]=function(){return this[0]?parseFloat(c.css(this[0],d,"padding")):null};c.fn["outer"+b]=function(e){return this[0]?parseFloat(c.css(this[0],d,e?"margin":"border")):null};c.fn[d]=function(e){var f=this[0];if(!f)return e==null?null:this;if(c.isFunction(e))return this.each(function(l){var k=c(this);k[d](e.call(this,l,k[d]()))});if(c.isWindow(f))return f.document.compatMode==="CSS1Compat"&&f.document.documentElement["client"+b]||f.document.body["client"+b];else if(f.nodeType===9)return Math.max(f.documentElement["client"+ +b],f.body["scroll"+b],f.documentElement["scroll"+b],f.body["offset"+b],f.documentElement["offset"+b]);else if(e===B){f=c.css(f,d);var h=parseFloat(f);return c.isNaN(h)?f:h}else return this.css(d,typeof e==="string"?e:e+"px")}})})(window); diff --git a/node_modules/selenium-webdriver/lib/test/data/js/jquery-ui-1.8.10.custom.min.js b/node_modules/selenium-webdriver/lib/test/data/js/jquery-ui-1.8.10.custom.min.js new file mode 100644 index 000000000..7d4ff1cec --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/jquery-ui-1.8.10.custom.min.js @@ -0,0 +1,782 @@ +/*! + * jQuery UI 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI + */ +(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.10",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106, +NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this, +"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position"); +if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f, +"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h, +d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}}); +c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e<b.length;e++)a.options[b[e][0]]&& +b[e][1].apply(a.element,d)}},contains:function(a,b){return document.compareDocumentPosition?a.compareDocumentPosition(b)&16:a!==b&&a.contains(b)},hasScroll:function(a,b){if(c(a).css("overflow")==="hidden")return false;b=b&&b==="left"?"scrollLeft":"scrollTop";var d=false;if(a[b]>0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a<b+d},isOver:function(a,b,d,e,h,i){return c.ui.isOverAxis(a,d,h)&&c.ui.isOverAxis(b,e,i)}})}})(jQuery); +;/*! + * jQuery UI Widget 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Widget + */ +(function(b,j){if(b.cleanData){var k=b.cleanData;b.cleanData=function(a){for(var c=0,d;(d=a[c])!=null;c++)b(d).triggerHandler("remove");k(a)}}else{var l=b.fn.remove;b.fn.remove=function(a,c){return this.each(function(){if(!c)if(!a||b.filter(a,[this]).length)b("*",this).add([this]).each(function(){b(this).triggerHandler("remove")});return l.call(b(this),a,c)})}}b.widget=function(a,c,d){var e=a.split(".")[0],f;a=a.split(".")[1];f=e+"-"+a;if(!d){d=c;c=b.Widget}b.expr[":"][f]=function(h){return!!b.data(h, +a)};b[e]=b[e]||{};b[e][a]=function(h,g){arguments.length&&this._createWidget(h,g)};c=new c;c.options=b.extend(true,{},c.options);b[e][a].prototype=b.extend(true,c,{namespace:e,widgetName:a,widgetEventPrefix:b[e][a].prototype.widgetEventPrefix||a,widgetBaseClass:f},d);b.widget.bridge(a,b[e][a])};b.widget.bridge=function(a,c){b.fn[a]=function(d){var e=typeof d==="string",f=Array.prototype.slice.call(arguments,1),h=this;d=!e&&f.length?b.extend.apply(null,[true,d].concat(f)):d;if(e&&d.charAt(0)==="_")return h; +e?this.each(function(){var g=b.data(this,a),i=g&&b.isFunction(g[d])?g[d].apply(g,f):g;if(i!==g&&i!==j){h=i;return false}}):this.each(function(){var g=b.data(this,a);g?g.option(d||{})._init():b.data(this,a,new c(d,this))});return h}};b.Widget=function(a,c){arguments.length&&this._createWidget(a,c)};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(a,c){b.data(c,this.widgetName,this);this.element=b(c);this.options=b.extend(true,{},this.options, +this._getCreateOptions(),a);var d=this;this.element.bind("remove."+this.widgetName,function(){d.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")}, +widget:function(){return this.element},option:function(a,c){var d=a;if(arguments.length===0)return b.extend({},this.options);if(typeof a==="string"){if(c===j)return this.options[a];d={};d[a]=c}this._setOptions(d);return this},_setOptions:function(a){var c=this;b.each(a,function(d,e){c._setOption(d,e)});return this},_setOption:function(a,c){this.options[a]=c;if(a==="disabled")this.widget()[c?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",c);return this}, +enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(a,c,d){var e=this.options[a];c=b.Event(c);c.type=(a===this.widgetEventPrefix?a:this.widgetEventPrefix+a).toLowerCase();d=d||{};if(c.originalEvent){a=b.event.props.length;for(var f;a;){f=b.event.props[--a];c[f]=c.originalEvent[f]}}this.element.trigger(c,d);return!(b.isFunction(e)&&e.call(this.element[0],c,d)===false||c.isDefaultPrevented())}}})(jQuery); +;/*! + * jQuery UI Mouse 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Mouse + * + * Depends: + * jquery.ui.widget.js + */ +(function(c){c.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var a=this;this.element.bind("mousedown."+this.widgetName,function(b){return a._mouseDown(b)}).bind("click."+this.widgetName,function(b){if(true===c.data(b.target,a.widgetName+".preventClickEvent")){c.removeData(b.target,a.widgetName+".preventClickEvent");b.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(a){a.originalEvent= +a.originalEvent||{};if(!a.originalEvent.mouseHandled){this._mouseStarted&&this._mouseUp(a);this._mouseDownEvent=a;var b=this,e=a.which==1,f=typeof this.options.cancel=="string"?c(a.target).parents().add(a.target).filter(this.options.cancel).length:false;if(!e||f||!this._mouseCapture(a))return true;this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet)this._mouseDelayTimer=setTimeout(function(){b.mouseDelayMet=true},this.options.delay);if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a)){this._mouseStarted= +this._mouseStart(a)!==false;if(!this._mouseStarted){a.preventDefault();return true}}this._mouseMoveDelegate=function(d){return b._mouseMove(d)};this._mouseUpDelegate=function(d){return b._mouseUp(d)};c(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);a.preventDefault();return a.originalEvent.mouseHandled=true}},_mouseMove:function(a){if(c.browser.msie&&!(document.documentMode>=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a); +return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent", +true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery); +;/* + * jQuery UI Position 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Position + */ +(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY, +left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+= +k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-= +m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left= +d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+= +a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b), +g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery); +;/* + * jQuery UI Draggable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Draggables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper== +"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b= +this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top- +this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions(); +d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis|| +this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&& +this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this== +a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]|| +0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0], +this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top- +(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment== +"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"? +0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"), +10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor== +Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop(): +f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY; +if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.left<this.containment[0])e=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/ +b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top<this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;e=this.originalPageX+Math.round((e-this.originalPageX)/b.grid[0])*b.grid[0];e=this.containment?!(e-this.offset.click.left<this.containment[0]||e-this.offset.click.left>this.containment[2])?e:!(e-this.offset.click.left<this.containment[0])?e-b.grid[0]:e+b.grid[0]:e}}return{top:g-this.offset.click.top- +this.offset.relative.top-this.offset.parent.top+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():f?0:c.scrollTop()),left:e-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())}},_clear:function(){this.helper.removeClass("ui-draggable-dragging");this.helper[0]!= +this.element[0]&&!this.cancelHelperRemoval&&this.helper.remove();this.helper=null;this.cancelHelperRemoval=false},_trigger:function(a,b,c){c=c||this._uiHash();d.ui.plugin.call(this,a,[b,c]);if(a=="drag")this.positionAbs=this._convertPositionTo("absolute");return d.Widget.prototype._trigger.call(this,a,b,c)},plugins:{},_uiHash:function(){return{helper:this.helper,position:this.position,originalPosition:this.originalPosition,offset:this.positionAbs}}});d.extend(d.ui.draggable,{version:"1.8.10"}); +d.ui.plugin.add("draggable","connectToSortable",{start:function(a,b){var c=d(this).data("draggable"),f=c.options,e=d.extend({},b,{item:c.element});c.sortables=[];d(f.connectToSortable).each(function(){var g=d.data(this,"sortable");if(g&&!g.options.disabled){c.sortables.push({instance:g,shouldRevert:g.options.revert});g._refreshItems();g._trigger("activate",a,e)}})},stop:function(a,b){var c=d(this).data("draggable"),f=d.extend({},b,{item:c.element});d.each(c.sortables,function(){if(this.instance.isOver){this.instance.isOver= +0;c.cancelHelperRemoval=true;this.instance.cancelHelperRemoval=false;if(this.shouldRevert)this.instance.options.revert=true;this.instance._mouseStop(a);this.instance.options.helper=this.instance.options._helper;c.options.helper=="original"&&this.instance.currentItem.css({top:"auto",left:"auto"})}else{this.instance.cancelHelperRemoval=false;this.instance._trigger("deactivate",a,f)}})},drag:function(a,b){var c=d(this).data("draggable"),f=this;d.each(c.sortables,function(){this.instance.positionAbs= +c.positionAbs;this.instance.helperProportions=c.helperProportions;this.instance.offset.click=c.offset.click;if(this.instance._intersectsWith(this.instance.containerCache)){if(!this.instance.isOver){this.instance.isOver=1;this.instance.currentItem=d(f).clone().appendTo(this.instance.element).data("sortable-item",true);this.instance.options._helper=this.instance.options.helper;this.instance.options.helper=function(){return b.helper[0]};a.target=this.instance.currentItem[0];this.instance._mouseCapture(a, +true);this.instance._mouseStart(a,true,true);this.instance.offset.click.top=c.offset.click.top;this.instance.offset.click.left=c.offset.click.left;this.instance.offset.parent.left-=c.offset.parent.left-this.instance.offset.parent.left;this.instance.offset.parent.top-=c.offset.parent.top-this.instance.offset.parent.top;c._trigger("toSortable",a);c.dropped=this.instance.element;c.currentItem=c.element;this.instance.fromOutside=c}this.instance.currentItem&&this.instance._mouseDrag(a)}else if(this.instance.isOver){this.instance.isOver= +0;this.instance.cancelHelperRemoval=true;this.instance.options.revert=false;this.instance._trigger("out",a,this.instance._uiHash(this.instance));this.instance._mouseStop(a,true);this.instance.options.helper=this.instance.options._helper;this.instance.currentItem.remove();this.instance.placeholder&&this.instance.placeholder.remove();c._trigger("fromSortable",a);c.dropped=false}})}});d.ui.plugin.add("draggable","cursor",{start:function(){var a=d("body"),b=d(this).data("draggable").options;if(a.css("cursor"))b._cursor= +a.css("cursor");a.css("cursor",b.cursor)},stop:function(){var a=d(this).data("draggable").options;a._cursor&&d("body").css("cursor",a._cursor)}});d.ui.plugin.add("draggable","iframeFix",{start:function(){var a=d(this).data("draggable").options;d(a.iframeFix===true?"iframe":a.iframeFix).each(function(){d('<div class="ui-draggable-iframeFix" style="background: #fff;"></div>').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})}, +stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!= +document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop+c.scrollSpeed;else if(a.pageY-b.overflowOffset.top<c.scrollSensitivity)b.scrollParent[0].scrollTop=f=b.scrollParent[0].scrollTop- +c.scrollSpeed;if(!c.axis||c.axis!="y")if(b.overflowOffset.left+b.scrollParent[0].offsetWidth-a.pageX<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft+c.scrollSpeed;else if(a.pageX-b.overflowOffset.left<c.scrollSensitivity)b.scrollParent[0].scrollLeft=f=b.scrollParent[0].scrollLeft-c.scrollSpeed}else{if(!c.axis||c.axis!="x")if(a.pageY-d(document).scrollTop()<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()-c.scrollSpeed);else if(d(window).height()- +(a.pageY-d(document).scrollTop())<c.scrollSensitivity)f=d(document).scrollTop(d(document).scrollTop()+c.scrollSpeed);if(!c.axis||c.axis!="y")if(a.pageX-d(document).scrollLeft()<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()-c.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<c.scrollSensitivity)f=d(document).scrollLeft(d(document).scrollLeft()+c.scrollSpeed)}f!==false&&d.ui.ddmanager&&!c.dropBehaviour&&d.ui.ddmanager.prepareOffsets(b,a)}});d.ui.plugin.add("draggable", +"snap",{start:function(){var a=d(this).data("draggable"),b=a.options;a.snapElements=[];d(b.snap.constructor!=String?b.snap.items||":data(draggable)":b.snap).each(function(){var c=d(this),f=c.offset();this!=a.element[0]&&a.snapElements.push({item:this,width:c.outerWidth(),height:c.outerHeight(),top:f.top,left:f.left})})},drag:function(a,b){for(var c=d(this).data("draggable"),f=c.options,e=f.snapTolerance,g=b.offset.left,n=g+c.helperProportions.width,m=b.offset.top,o=m+c.helperProportions.height,h= +c.snapElements.length-1;h>=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e<g&&g<k+e&&j-e<m&&m<l+e||i-e<g&&g<k+e&&j-e<o&&o<l+e||i-e<n&&n<k+e&&j-e<m&&m<l+e||i-e<n&&n<k+e&&j-e<o&&o<l+e){if(f.snapMode!="inner"){var p=Math.abs(j-o)<=e,q=Math.abs(l-m)<=e,r=Math.abs(i-n)<=e,s=Math.abs(k-g)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j-c.helperProportions.height,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative", +{top:l,left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i-c.helperProportions.width}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k}).left-c.margins.left}var t=p||q||r||s;if(f.snapMode!="outer"){p=Math.abs(j-m)<=e;q=Math.abs(l-o)<=e;r=Math.abs(i-g)<=e;s=Math.abs(k-n)<=e;if(p)b.position.top=c._convertPositionTo("relative",{top:j,left:0}).top-c.margins.top;if(q)b.position.top=c._convertPositionTo("relative",{top:l-c.helperProportions.height, +left:0}).top-c.margins.top;if(r)b.position.left=c._convertPositionTo("relative",{top:0,left:i}).left-c.margins.left;if(s)b.position.left=c._convertPositionTo("relative",{top:0,left:k-c.helperProportions.width}).left-c.margins.left}if(!c.snapElements[h].snapping&&(p||q||r||s||t))c.options.snap.snap&&c.options.snap.snap.call(c.element,a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=p||q||r||s||t}else{c.snapElements[h].snapping&&c.options.snap.release&&c.options.snap.release.call(c.element, +a,d.extend(c._uiHash(),{snapItem:c.snapElements[h].item}));c.snapElements[h].snapping=false}}}});d.ui.plugin.add("draggable","stack",{start:function(){var a=d(this).data("draggable").options;a=d.makeArray(d(a.stack)).sort(function(c,f){return(parseInt(d(c).css("zIndex"),10)||0)-(parseInt(d(f).css("zIndex"),10)||0)});if(a.length){var b=parseInt(a[0].style.zIndex)||0;d(a).each(function(c){this.style.zIndex=b+c});this[0].style.zIndex=b+a.length}}});d.ui.plugin.add("draggable","zIndex",{start:function(a, +b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("zIndex"))b._zIndex=a.css("zIndex");a.css("zIndex",b.zIndex)},stop:function(a,b){a=d(this).data("draggable").options;a._zIndex&&d(b.helper).css("zIndex",a._zIndex)}})})(jQuery); +;/* + * jQuery UI Droppable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Droppables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.mouse.js + * jquery.ui.draggable.js + */ +(function(d){d.widget("ui.droppable",{widgetEventPrefix:"drop",options:{accept:"*",activeClass:false,addClasses:true,greedy:false,hoverClass:false,scope:"default",tolerance:"intersect"},_create:function(){var a=this.options,b=a.accept;this.isover=0;this.isout=1;this.accept=d.isFunction(b)?b:function(c){return c.is(b)};this.proportions={width:this.element[0].offsetWidth,height:this.element[0].offsetHeight};d.ui.ddmanager.droppables[a.scope]=d.ui.ddmanager.droppables[a.scope]||[];d.ui.ddmanager.droppables[a.scope].push(this); +a.addClasses&&this.element.addClass("ui-droppable")},destroy:function(){for(var a=d.ui.ddmanager.droppables[this.options.scope],b=0;b<a.length;b++)a[b]==this&&a.splice(b,1);this.element.removeClass("ui-droppable ui-droppable-disabled").removeData("droppable").unbind(".droppable");return this},_setOption:function(a,b){if(a=="accept")this.accept=d.isFunction(b)?b:function(c){return c.is(b)};d.Widget.prototype._setOption.apply(this,arguments)},_activate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&& +this.element.addClass(this.options.activeClass);b&&this._trigger("activate",a,this.ui(b))},_deactivate:function(a){var b=d.ui.ddmanager.current;this.options.activeClass&&this.element.removeClass(this.options.activeClass);b&&this._trigger("deactivate",a,this.ui(b))},_over:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.addClass(this.options.hoverClass); +this._trigger("over",a,this.ui(b))}},_out:function(a){var b=d.ui.ddmanager.current;if(!(!b||(b.currentItem||b.element)[0]==this.element[0]))if(this.accept.call(this.element[0],b.currentItem||b.element)){this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("out",a,this.ui(b))}},_drop:function(a,b){var c=b||d.ui.ddmanager.current;if(!c||(c.currentItem||c.element)[0]==this.element[0])return false;var e=false;this.element.find(":data(droppable)").not(".ui-draggable-dragging").each(function(){var g= +d.data(this,"droppable");if(g.options.greedy&&!g.options.disabled&&g.options.scope==c.options.scope&&g.accept.call(g.element[0],c.currentItem||c.element)&&d.ui.intersect(c,d.extend(g,{offset:g.element.offset()}),g.options.tolerance)){e=true;return false}});if(e)return false;if(this.accept.call(this.element[0],c.currentItem||c.element)){this.options.activeClass&&this.element.removeClass(this.options.activeClass);this.options.hoverClass&&this.element.removeClass(this.options.hoverClass);this._trigger("drop", +a,this.ui(c));return this.element}return false},ui:function(a){return{draggable:a.currentItem||a.element,helper:a.helper,position:a.position,offset:a.positionAbs}}});d.extend(d.ui.droppable,{version:"1.8.10"});d.ui.intersect=function(a,b,c){if(!b.offset)return false;var e=(a.positionAbs||a.position.absolute).left,g=e+a.helperProportions.width,f=(a.positionAbs||a.position.absolute).top,h=f+a.helperProportions.height,i=b.offset.left,k=i+b.proportions.width,j=b.offset.top,l=j+b.proportions.height; +switch(c){case "fit":return i<=e&&g<=k&&j<=f&&h<=l;case "intersect":return i<e+a.helperProportions.width/2&&g-a.helperProportions.width/2<k&&j<f+a.helperProportions.height/2&&h-a.helperProportions.height/2<l;case "pointer":return d.ui.isOver((a.positionAbs||a.position.absolute).top+(a.clickOffset||a.offset.click).top,(a.positionAbs||a.position.absolute).left+(a.clickOffset||a.offset.click).left,j,i,b.proportions.height,b.proportions.width);case "touch":return(f>=j&&f<=l||h>=j&&h<=l||f<j&&h>l)&&(e>= +i&&e<=k||g>=i&&g<=k||e<i&&g>k);default:return false}};d.ui.ddmanager={current:null,droppables:{"default":[]},prepareOffsets:function(a,b){var c=d.ui.ddmanager.droppables[a.options.scope]||[],e=b?b.type:null,g=(a.currentItem||a.element).find(":data(droppable)").andSelf(),f=0;a:for(;f<c.length;f++)if(!(c[f].options.disabled||a&&!c[f].accept.call(c[f].element[0],a.currentItem||a.element))){for(var h=0;h<g.length;h++)if(g[h]==c[f].element[0]){c[f].proportions.height=0;continue a}c[f].visible=c[f].element.css("display")!= +"none";if(c[f].visible){c[f].offset=c[f].element.offset();c[f].proportions={width:c[f].element[0].offsetWidth,height:c[f].element[0].offsetHeight};e=="mousedown"&&c[f]._activate.call(c[f],b)}}},drop:function(a,b){var c=false;d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(this.options){if(!this.options.disabled&&this.visible&&d.ui.intersect(a,this,this.options.tolerance))c=c||this._drop.call(this,b);if(!this.options.disabled&&this.visible&&this.accept.call(this.element[0],a.currentItem|| +a.element)){this.isout=1;this.isover=0;this._deactivate.call(this,b)}}});return c},drag:function(a,b){a.options.refreshPositions&&d.ui.ddmanager.prepareOffsets(a,b);d.each(d.ui.ddmanager.droppables[a.options.scope]||[],function(){if(!(this.options.disabled||this.greedyChild||!this.visible)){var c=d.ui.intersect(a,this,this.options.tolerance);if(c=!c&&this.isover==1?"isout":c&&this.isover==0?"isover":null){var e;if(this.options.greedy){var g=this.element.parents(":data(droppable):eq(0)");if(g.length){e= +d.data(g[0],"droppable");e.greedyChild=c=="isover"?1:0}}if(e&&c=="isover"){e.isover=0;e.isout=1;e._out.call(e,b)}this[c]=1;this[c=="isout"?"isover":"isout"]=0;this[c=="isover"?"_over":"_out"].call(this,b);if(e&&c=="isout"){e.isout=0;e.isover=1;e._over.call(e,b)}}}})}}})(jQuery); +;/* + * jQuery UI Resizable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Resizables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.resizable",e.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1E3},_create:function(){var b=this,a=this.options;this.element.addClass("ui-resizable");e.extend(this,{_aspectRatio:!!a.aspectRatio,aspectRatio:a.aspectRatio,originalElement:this.element, +_proportionallyResizeElements:[],_helper:a.helper||a.ghost||a.animate?a.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){/relative/.test(this.element.css("position"))&&e.browser.opera&&this.element.css({position:"relative",top:"auto",left:"auto"});this.element.wrap(e('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(), +top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle= +this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne", +nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d<c.length;d++){var f=e.trim(c[d]),g=e('<div class="ui-resizable-handle '+("ui-resizable-"+f)+'"></div>');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor== +String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection(); +this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()}; +if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(), +d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset= +this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio: +this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize", +b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height; +f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing"); +this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top= +null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidth<b.width,f=l(b.height)&&a.maxHeight&&a.maxHeight<b.height,g=l(b.width)&&a.minWidth&&a.minWidth>b.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+ +this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a<this._proportionallyResizeElements.length;a++){var c=this._proportionallyResizeElements[a];if(!this.borderDif){var d= +[c.css("borderTopWidth"),c.css("borderRightWidth"),c.css("borderBottomWidth"),c.css("borderLeftWidth")],f=[c.css("paddingTop"),c.css("paddingRight"),c.css("paddingBottom"),c.css("paddingLeft")];this.borderDif=e.map(d,function(g,h){g=parseInt(g,10)||0;h=parseInt(f[h],10)||0;return g+h})}e.browser.msie&&(e(b).is(":hidden")||e(b).parents(":hidden").length)||c.css({height:b.height()-this.borderDif[0]-this.borderDif[2]||0,width:b.width()-this.borderDif[1]-this.borderDif[3]||0})}},_renderProxy:function(){var b= +this.options;this.elementOffset=this.element.offset();if(this._helper){this.helper=this.helper||e('<div style="overflow:hidden;"></div>');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b, +a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a, +c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize, +originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.10"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize= +b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width", +"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})}; +if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height- +g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width, +height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d= +e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options, +d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper? +d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height= +a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&& +/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable"); +b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/ +(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery); +;/* + * jQuery UI Selectable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Selectables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(e){e.widget("ui.selectable",e.ui.mouse,{options:{appendTo:"body",autoRefresh:true,distance:0,filter:"*",tolerance:"touch"},_create:function(){var c=this;this.element.addClass("ui-selectable");this.dragged=false;var f;this.refresh=function(){f=e(c.options.filter,c.element[0]);f.each(function(){var d=e(this),b=d.offset();e.data(this,"selectable-item",{element:this,$element:d,left:b.left,top:b.top,right:b.left+d.outerWidth(),bottom:b.top+d.outerHeight(),startselected:false,selected:d.hasClass("ui-selected"), +selecting:d.hasClass("ui-selecting"),unselecting:d.hasClass("ui-unselecting")})})};this.refresh();this.selectees=f.addClass("ui-selectee");this._mouseInit();this.helper=e("<div class='ui-selectable-helper'></div>")},destroy:function(){this.selectees.removeClass("ui-selectee").removeData("selectable-item");this.element.removeClass("ui-selectable ui-selectable-disabled").removeData("selectable").unbind(".selectable");this._mouseDestroy();return this},_mouseStart:function(c){var f=this;this.opos=[c.pageX, +c.pageY];if(!this.options.disabled){var d=this.options;this.selectees=e(d.filter,this.element[0]);this._trigger("start",c);e(d.appendTo).append(this.helper);this.helper.css({left:c.clientX,top:c.clientY,width:0,height:0});d.autoRefresh&&this.refresh();this.selectees.filter(".ui-selected").each(function(){var b=e.data(this,"selectable-item");b.startselected=true;if(!c.metaKey){b.$element.removeClass("ui-selected");b.selected=false;b.$element.addClass("ui-unselecting");b.unselecting=true;f._trigger("unselecting", +c,{unselecting:b.element})}});e(c.target).parents().andSelf().each(function(){var b=e.data(this,"selectable-item");if(b){var g=!c.metaKey||!b.$element.hasClass("ui-selected");b.$element.removeClass(g?"ui-unselecting":"ui-selected").addClass(g?"ui-selecting":"ui-unselecting");b.unselecting=!g;b.selecting=g;(b.selected=g)?f._trigger("selecting",c,{selecting:b.element}):f._trigger("unselecting",c,{unselecting:b.element});return false}})}},_mouseDrag:function(c){var f=this;this.dragged=true;if(!this.options.disabled){var d= +this.options,b=this.opos[0],g=this.opos[1],h=c.pageX,i=c.pageY;if(b>h){var j=h;h=b;b=j}if(g>i){j=i;i=g;g=j}this.helper.css({left:b,top:g,width:h-b,height:i-g});this.selectees.each(function(){var a=e.data(this,"selectable-item");if(!(!a||a.element==f.element[0])){var k=false;if(d.tolerance=="touch")k=!(a.left>h||a.right<b||a.top>i||a.bottom<g);else if(d.tolerance=="fit")k=a.left>b&&a.right<h&&a.top>g&&a.bottom<i;if(k){if(a.selected){a.$element.removeClass("ui-selected");a.selected=false}if(a.unselecting){a.$element.removeClass("ui-unselecting"); +a.unselecting=false}if(!a.selecting){a.$element.addClass("ui-selecting");a.selecting=true;f._trigger("selecting",c,{selecting:a.element})}}else{if(a.selecting)if(c.metaKey&&a.startselected){a.$element.removeClass("ui-selecting");a.selecting=false;a.$element.addClass("ui-selected");a.selected=true}else{a.$element.removeClass("ui-selecting");a.selecting=false;if(a.startselected){a.$element.addClass("ui-unselecting");a.unselecting=true}f._trigger("unselecting",c,{unselecting:a.element})}if(a.selected)if(!c.metaKey&& +!a.startselected){a.$element.removeClass("ui-selected");a.selected=false;a.$element.addClass("ui-unselecting");a.unselecting=true;f._trigger("unselecting",c,{unselecting:a.element})}}}});return false}},_mouseStop:function(c){var f=this;this.dragged=false;e(".ui-unselecting",this.element[0]).each(function(){var d=e.data(this,"selectable-item");d.$element.removeClass("ui-unselecting");d.unselecting=false;d.startselected=false;f._trigger("unselected",c,{unselected:d.element})});e(".ui-selecting",this.element[0]).each(function(){var d= +e.data(this,"selectable-item");d.$element.removeClass("ui-selecting").addClass("ui-selected");d.selecting=false;d.selected=true;d.startselected=true;f._trigger("selected",c,{selected:d.element})});this._trigger("stop",c);this.helper.remove();return false}});e.extend(e.ui.selectable,{version:"1.8.10"})})(jQuery); +;/* + * jQuery UI Sortable 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Sortables + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.sortable",d.ui.mouse,{widgetEventPrefix:"sort",options:{appendTo:"parent",axis:false,connectWith:false,containment:false,cursor:"auto",cursorAt:false,dropOnEmpty:true,forcePlaceholderSize:false,forceHelperSize:false,grid:false,handle:false,helper:"original",items:"> *",opacity:false,placeholder:false,revert:false,scroll:true,scrollSensitivity:20,scrollSpeed:20,scope:"default",tolerance:"intersect",zIndex:1E3},_create:function(){this.containerCache={};this.element.addClass("ui-sortable"); +this.refresh();this.floating=this.items.length?/left|right/.test(this.items[0].item.css("float")):false;this.offset=this.element.offset();this._mouseInit()},destroy:function(){this.element.removeClass("ui-sortable ui-sortable-disabled").removeData("sortable").unbind(".sortable");this._mouseDestroy();for(var a=this.items.length-1;a>=0;a--)this.items[a].item.removeData("sortable-item");return this},_setOption:function(a,b){if(a==="disabled"){this.options[a]=b;this.widget()[b?"addClass":"removeClass"]("ui-sortable-disabled")}else d.Widget.prototype._setOption.apply(this, +arguments)},_mouseCapture:function(a,b){if(this.reverting)return false;if(this.options.disabled||this.options.type=="static")return false;this._refreshItems(a);var c=null,e=this;d(a.target).parents().each(function(){if(d.data(this,"sortable-item")==e){c=d(this);return false}});if(d.data(a.target,"sortable-item")==e)c=d(a.target);if(!c)return false;if(this.options.handle&&!b){var f=false;d(this.options.handle,c).find("*").andSelf().each(function(){if(this==a.target)f=true});if(!f)return false}this.currentItem= +c;this._removeCurrentsFromItems();return true},_mouseStart:function(a,b,c){b=this.options;var e=this;this.currentContainer=this;this.refreshPositions();this.helper=this._createHelper(a);this._cacheHelperProportions();this._cacheMargins();this.scrollParent=this.helper.scrollParent();this.offset=this.currentItem.offset();this.offset={top:this.offset.top-this.margins.top,left:this.offset.left-this.margins.left};this.helper.css("position","absolute");this.cssPosition=this.helper.css("position");d.extend(this.offset, +{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);this.domPosition={prev:this.currentItem.prev()[0],parent:this.currentItem.parent()[0]};this.helper[0]!=this.currentItem[0]&&this.currentItem.hide();this._createPlaceholder();b.containment&&this._setContainment(); +if(b.cursor){if(d("body").css("cursor"))this._storedCursor=d("body").css("cursor");d("body").css("cursor",b.cursor)}if(b.opacity){if(this.helper.css("opacity"))this._storedOpacity=this.helper.css("opacity");this.helper.css("opacity",b.opacity)}if(b.zIndex){if(this.helper.css("zIndex"))this._storedZIndex=this.helper.css("zIndex");this.helper.css("zIndex",b.zIndex)}if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML")this.overflowOffset=this.scrollParent.offset();this._trigger("start", +a,this._uiHash());this._preserveHelperProportions||this._cacheHelperProportions();if(!c)for(c=this.containers.length-1;c>=0;c--)this.containers[c]._trigger("activate",a,e._uiHash(this));if(d.ui.ddmanager)d.ui.ddmanager.current=this;d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.dragging=true;this.helper.addClass("ui-sortable-helper");this._mouseDrag(a);return true},_mouseDrag:function(a){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute"); +if(!this.lastPositionAbs)this.lastPositionAbs=this.positionAbs;if(this.options.scroll){var b=this.options,c=false;if(this.scrollParent[0]!=document&&this.scrollParent[0].tagName!="HTML"){if(this.overflowOffset.top+this.scrollParent[0].offsetHeight-a.pageY<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop+b.scrollSpeed;else if(a.pageY-this.overflowOffset.top<b.scrollSensitivity)this.scrollParent[0].scrollTop=c=this.scrollParent[0].scrollTop-b.scrollSpeed;if(this.overflowOffset.left+ +this.scrollParent[0].offsetWidth-a.pageX<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft+b.scrollSpeed;else if(a.pageX-this.overflowOffset.left<b.scrollSensitivity)this.scrollParent[0].scrollLeft=c=this.scrollParent[0].scrollLeft-b.scrollSpeed}else{if(a.pageY-d(document).scrollTop()<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()-b.scrollSpeed);else if(d(window).height()-(a.pageY-d(document).scrollTop())<b.scrollSensitivity)c=d(document).scrollTop(d(document).scrollTop()+ +b.scrollSpeed);if(a.pageX-d(document).scrollLeft()<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()-b.scrollSpeed);else if(d(window).width()-(a.pageX-d(document).scrollLeft())<b.scrollSensitivity)c=d(document).scrollLeft(d(document).scrollLeft()+b.scrollSpeed)}c!==false&&d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a)}this.positionAbs=this._convertPositionTo("absolute");if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+ +"px";if(!this.options.axis||this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";for(b=this.items.length-1;b>=0;b--){c=this.items[b];var e=c.item[0],f=this._intersectsWithPointer(c);if(f)if(e!=this.currentItem[0]&&this.placeholder[f==1?"next":"prev"]()[0]!=e&&!d.ui.contains(this.placeholder[0],e)&&(this.options.type=="semi-dynamic"?!d.ui.contains(this.element[0],e):true)){this.direction=f==1?"down":"up";if(this.options.tolerance=="pointer"||this._intersectsWithSides(c))this._rearrange(a, +c);else break;this._trigger("change",a,this._uiHash());break}}this._contactContainers(a);d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);this._trigger("sort",a,this._uiHash());this.lastPositionAbs=this.positionAbs;return false},_mouseStop:function(a,b){if(a){d.ui.ddmanager&&!this.options.dropBehaviour&&d.ui.ddmanager.drop(this,a);if(this.options.revert){var c=this;b=c.placeholder.offset();c.reverting=true;d(this.helper).animate({left:b.left-this.offset.parent.left-c.margins.left+(this.offsetParent[0]== +document.body?0:this.offsetParent[0].scrollLeft),top:b.top-this.offset.parent.top-c.margins.top+(this.offsetParent[0]==document.body?0:this.offsetParent[0].scrollTop)},parseInt(this.options.revert,10)||500,function(){c._clear(a)})}else this._clear(a,b);return false}},cancel:function(){var a=this;if(this.dragging){this._mouseUp({target:null});this.options.helper=="original"?this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper"):this.currentItem.show();for(var b=this.containers.length- +1;b>=0;b--){this.containers[b]._trigger("deactivate",null,a._uiHash(this));if(this.containers[b].containerCache.over){this.containers[b]._trigger("out",null,a._uiHash(this));this.containers[b].containerCache.over=0}}}if(this.placeholder){this.placeholder[0].parentNode&&this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.options.helper!="original"&&this.helper&&this.helper[0].parentNode&&this.helper.remove();d.extend(this,{helper:null,dragging:false,reverting:false,_noFinalSort:null}); +this.domPosition.prev?d(this.domPosition.prev).after(this.currentItem):d(this.domPosition.parent).prepend(this.currentItem)}return this},serialize:function(a){var b=this._getItemsAsjQuery(a&&a.connected),c=[];a=a||{};d(b).each(function(){var e=(d(a.item||this).attr(a.attribute||"id")||"").match(a.expression||/(.+)[-=_](.+)/);if(e)c.push((a.key||e[1]+"[]")+"="+(a.key&&a.expression?e[1]:e[2]))});!c.length&&a.key&&c.push(a.key+"=");return c.join("&")},toArray:function(a){var b=this._getItemsAsjQuery(a&& +a.connected),c=[];a=a||{};b.each(function(){c.push(d(a.item||this).attr(a.attribute||"id")||"")});return c},_intersectsWith:function(a){var b=this.positionAbs.left,c=b+this.helperProportions.width,e=this.positionAbs.top,f=e+this.helperProportions.height,g=a.left,h=g+a.width,i=a.top,k=i+a.height,j=this.offset.click.top,l=this.offset.click.left;j=e+j>i&&e+j<k&&b+l>g&&b+l<h;return this.options.tolerance=="pointer"||this.options.forcePointerForContainers||this.options.tolerance!="pointer"&&this.helperProportions[this.floating? +"width":"height"]>a[this.floating?"width":"height"]?j:g<b+this.helperProportions.width/2&&c-this.helperProportions.width/2<h&&i<e+this.helperProportions.height/2&&f-this.helperProportions.height/2<k},_intersectsWithPointer:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left,a.width);b=b&&a;a=this._getDragVerticalDirection();var c=this._getDragHorizontalDirection();if(!b)return false;return this.floating? +c&&c=="right"||a=="down"?2:1:a&&(a=="down"?2:1)},_intersectsWithSides:function(a){var b=d.ui.isOverAxis(this.positionAbs.top+this.offset.click.top,a.top+a.height/2,a.height);a=d.ui.isOverAxis(this.positionAbs.left+this.offset.click.left,a.left+a.width/2,a.width);var c=this._getDragVerticalDirection(),e=this._getDragHorizontalDirection();return this.floating&&e?e=="right"&&a||e=="left"&&!a:c&&(c=="down"&&b||c=="up"&&!b)},_getDragVerticalDirection:function(){var a=this.positionAbs.top-this.lastPositionAbs.top; +return a!=0&&(a>0?"down":"up")},_getDragHorizontalDirection:function(){var a=this.positionAbs.left-this.lastPositionAbs.left;return a!=0&&(a>0?"right":"left")},refresh:function(a){this._refreshItems(a);this.refreshPositions();return this},_connectWith:function(){var a=this.options;return a.connectWith.constructor==String?[a.connectWith]:a.connectWith},_getItemsAsjQuery:function(a){var b=[],c=[],e=this._connectWith();if(e&&a)for(a=e.length-1;a>=0;a--)for(var f=d(e[a]),g=f.length-1;g>=0;g--){var h= +d.data(f[g],"sortable");if(h&&h!=this&&!h.options.disabled)c.push([d.isFunction(h.options.items)?h.options.items.call(h.element):d(h.options.items,h.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),h])}c.push([d.isFunction(this.options.items)?this.options.items.call(this.element,null,{options:this.options,item:this.currentItem}):d(this.options.items,this.element).not(".ui-sortable-helper").not(".ui-sortable-placeholder"),this]);for(a=c.length-1;a>=0;a--)c[a][0].each(function(){b.push(this)}); +return d(b)},_removeCurrentsFromItems:function(){for(var a=this.currentItem.find(":data(sortable-item)"),b=0;b<this.items.length;b++)for(var c=0;c<a.length;c++)a[c]==this.items[b].item[0]&&this.items.splice(b,1)},_refreshItems:function(a){this.items=[];this.containers=[this];var b=this.items,c=[[d.isFunction(this.options.items)?this.options.items.call(this.element[0],a,{item:this.currentItem}):d(this.options.items,this.element),this]],e=this._connectWith();if(e)for(var f=e.length-1;f>=0;f--)for(var g= +d(e[f]),h=g.length-1;h>=0;h--){var i=d.data(g[h],"sortable");if(i&&i!=this&&!i.options.disabled){c.push([d.isFunction(i.options.items)?i.options.items.call(i.element[0],a,{item:this.currentItem}):d(i.options.items,i.element),i]);this.containers.push(i)}}for(f=c.length-1;f>=0;f--){a=c[f][1];e=c[f][0];h=0;for(g=e.length;h<g;h++){i=d(e[h]);i.data("sortable-item",a);b.push({item:i,instance:a,width:0,height:0,left:0,top:0})}}},refreshPositions:function(a){if(this.offsetParent&&this.helper)this.offset.parent= +this._getParentOffset();for(var b=this.items.length-1;b>=0;b--){var c=this.items[b],e=this.options.toleranceElement?d(this.options.toleranceElement,c.item):c.item;if(!a){c.width=e.outerWidth();c.height=e.outerHeight()}e=e.offset();c.left=e.left;c.top=e.top}if(this.options.custom&&this.options.custom.refreshContainers)this.options.custom.refreshContainers.call(this);else for(b=this.containers.length-1;b>=0;b--){e=this.containers[b].element.offset();this.containers[b].containerCache.left=e.left;this.containers[b].containerCache.top= +e.top;this.containers[b].containerCache.width=this.containers[b].element.outerWidth();this.containers[b].containerCache.height=this.containers[b].element.outerHeight()}return this},_createPlaceholder:function(a){var b=a||this,c=b.options;if(!c.placeholder||c.placeholder.constructor==String){var e=c.placeholder;c.placeholder={element:function(){var f=d(document.createElement(b.currentItem[0].nodeName)).addClass(e||b.currentItem[0].className+" ui-sortable-placeholder").removeClass("ui-sortable-helper")[0]; +if(!e)f.style.visibility="hidden";return f},update:function(f,g){if(!(e&&!c.forcePlaceholderSize)){g.height()||g.height(b.currentItem.innerHeight()-parseInt(b.currentItem.css("paddingTop")||0,10)-parseInt(b.currentItem.css("paddingBottom")||0,10));g.width()||g.width(b.currentItem.innerWidth()-parseInt(b.currentItem.css("paddingLeft")||0,10)-parseInt(b.currentItem.css("paddingRight")||0,10))}}}}b.placeholder=d(c.placeholder.element.call(b.element,b.currentItem));b.currentItem.after(b.placeholder); +c.placeholder.update(b,b.placeholder)},_contactContainers:function(a){for(var b=null,c=null,e=this.containers.length-1;e>=0;e--)if(!d.ui.contains(this.currentItem[0],this.containers[e].element[0]))if(this._intersectsWith(this.containers[e].containerCache)){if(!(b&&d.ui.contains(this.containers[e].element[0],b.element[0]))){b=this.containers[e];c=e}}else if(this.containers[e].containerCache.over){this.containers[e]._trigger("out",a,this._uiHash(this));this.containers[e].containerCache.over=0}if(b)if(this.containers.length=== +1){this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}else if(this.currentContainer!=this.containers[c]){b=1E4;e=null;for(var f=this.positionAbs[this.containers[c].floating?"left":"top"],g=this.items.length-1;g>=0;g--)if(d.ui.contains(this.containers[c].element[0],this.items[g].item[0])){var h=this.items[g][this.containers[c].floating?"left":"top"];if(Math.abs(h-f)<b){b=Math.abs(h-f);e=this.items[g]}}if(e||this.options.dropOnEmpty){this.currentContainer= +this.containers[c];e?this._rearrange(a,e,null,true):this._rearrange(a,null,this.containers[c].element,true);this._trigger("change",a,this._uiHash());this.containers[c]._trigger("change",a,this._uiHash(this));this.options.placeholder.update(this.currentContainer,this.placeholder);this.containers[c]._trigger("over",a,this._uiHash(this));this.containers[c].containerCache.over=1}}},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a,this.currentItem])): +b.helper=="clone"?this.currentItem.clone():this.currentItem;a.parents("body").length||d(b.appendTo!="parent"?b.appendTo:this.currentItem[0].parentNode)[0].appendChild(a[0]);if(a[0]==this.currentItem[0])this._storedCSS={width:this.currentItem[0].style.width,height:this.currentItem[0].style.height,position:this.currentItem.css("position"),top:this.currentItem.css("top"),left:this.currentItem.css("left")};if(a[0].style.width==""||b.forceHelperSize)a.width(this.currentItem.width());if(a[0].style.height== +""||b.forceHelperSize)a.height(this.currentItem.height());return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent= +this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"), +10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.currentItem.position();return{top:a.top-(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.currentItem.css("marginLeft"),10)||0,top:parseInt(this.currentItem.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions= +{width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment=="parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[0-this.offset.relative.left-this.offset.parent.left,0-this.offset.relative.top-this.offset.parent.top,d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(d(a.containment=="document"?document:window).height()|| +document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)){var b=d(a.containment)[0];a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth, +b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!= +document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft(): +e?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,e=/(html|body)/i.test(c[0].tagName);if(this.cssPosition=="relative"&&!(this.scrollParent[0]!=document&&this.scrollParent[0]!=this.offsetParent[0]))this.offset.relative=this._getRelativeOffset();var f=a.pageX,g=a.pageY;if(this.originalPosition){if(this.containment){if(a.pageX- +this.offset.click.left<this.containment[0])f=this.containment[0]+this.offset.click.left;if(a.pageY-this.offset.click.top<this.containment[1])g=this.containment[1]+this.offset.click.top;if(a.pageX-this.offset.click.left>this.containment[2])f=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.top< +this.containment[1]||g-this.offset.click.top>this.containment[3])?g:!(g-this.offset.click.top<this.containment[1])?g-b.grid[1]:g+b.grid[1]:g;f=this.originalPageX+Math.round((f-this.originalPageX)/b.grid[0])*b.grid[0];f=this.containment?!(f-this.offset.click.left<this.containment[0]||f-this.offset.click.left>this.containment[2])?f:!(f-this.offset.click.left<this.containment[0])?f-b.grid[0]:f+b.grid[0]:f}}return{top:g-this.offset.click.top-this.offset.relative.top-this.offset.parent.top+(d.browser.safari&& +this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollTop():e?0:c.scrollTop()),left:f-this.offset.click.left-this.offset.relative.left-this.offset.parent.left+(d.browser.safari&&this.cssPosition=="fixed"?0:this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():e?0:c.scrollLeft())}},_rearrange:function(a,b,c,e){c?c[0].appendChild(this.placeholder[0]):b.item[0].parentNode.insertBefore(this.placeholder[0],this.direction=="down"?b.item[0]:b.item[0].nextSibling);this.counter= +this.counter?++this.counter:1;var f=this,g=this.counter;window.setTimeout(function(){g==f.counter&&f.refreshPositions(!e)},0)},_clear:function(a,b){this.reverting=false;var c=[];!this._noFinalSort&&this.currentItem[0].parentNode&&this.placeholder.before(this.currentItem);this._noFinalSort=null;if(this.helper[0]==this.currentItem[0]){for(var e in this._storedCSS)if(this._storedCSS[e]=="auto"||this._storedCSS[e]=="static")this._storedCSS[e]="";this.currentItem.css(this._storedCSS).removeClass("ui-sortable-helper")}else this.currentItem.show(); +this.fromOutside&&!b&&c.push(function(f){this._trigger("receive",f,this._uiHash(this.fromOutside))});if((this.fromOutside||this.domPosition.prev!=this.currentItem.prev().not(".ui-sortable-helper")[0]||this.domPosition.parent!=this.currentItem.parent()[0])&&!b)c.push(function(f){this._trigger("update",f,this._uiHash())});if(!d.ui.contains(this.element[0],this.currentItem[0])){b||c.push(function(f){this._trigger("remove",f,this._uiHash())});for(e=this.containers.length-1;e>=0;e--)if(d.ui.contains(this.containers[e].element[0], +this.currentItem[0])&&!b){c.push(function(f){return function(g){f._trigger("receive",g,this._uiHash(this))}}.call(this,this.containers[e]));c.push(function(f){return function(g){f._trigger("update",g,this._uiHash(this))}}.call(this,this.containers[e]))}}for(e=this.containers.length-1;e>=0;e--){b||c.push(function(f){return function(g){f._trigger("deactivate",g,this._uiHash(this))}}.call(this,this.containers[e]));if(this.containers[e].containerCache.over){c.push(function(f){return function(g){f._trigger("out", +g,this._uiHash(this))}}.call(this,this.containers[e]));this.containers[e].containerCache.over=0}}this._storedCursor&&d("body").css("cursor",this._storedCursor);this._storedOpacity&&this.helper.css("opacity",this._storedOpacity);if(this._storedZIndex)this.helper.css("zIndex",this._storedZIndex=="auto"?"":this._storedZIndex);this.dragging=false;if(this.cancelHelperRemoval){if(!b){this._trigger("beforeStop",a,this._uiHash());for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}return false}b|| +this._trigger("beforeStop",a,this._uiHash());this.placeholder[0].parentNode.removeChild(this.placeholder[0]);this.helper[0]!=this.currentItem[0]&&this.helper.remove();this.helper=null;if(!b){for(e=0;e<c.length;e++)c[e].call(this,a);this._trigger("stop",a,this._uiHash())}this.fromOutside=false;return true},_trigger:function(){d.Widget.prototype._trigger.apply(this,arguments)===false&&this.cancel()},_uiHash:function(a){var b=a||this;return{helper:b.helper,placeholder:b.placeholder||d([]),position:b.position, +originalPosition:b.originalPosition,offset:b.positionAbs,item:b.currentItem,sender:a?a.element:null}}});d.extend(d.ui.sortable,{version:"1.8.10"})})(jQuery); +;/* + * jQuery UI Accordion 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Accordion + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(c){c.widget("ui.accordion",{options:{active:0,animated:"slide",autoHeight:true,clearStyle:false,collapsible:false,event:"click",fillSpace:false,header:"> li > :first-child,> :not(li):even",icons:{header:"ui-icon-triangle-1-e",headerSelected:"ui-icon-triangle-1-s"},navigation:false,navigationFilter:function(){return this.href.toLowerCase()===location.href.toLowerCase()}},_create:function(){var a=this,b=a.options;a.running=0;a.element.addClass("ui-accordion ui-widget ui-helper-reset").children("li").addClass("ui-accordion-li-fix"); +a.headers=a.element.find(b.header).addClass("ui-accordion-header ui-helper-reset ui-state-default ui-corner-all").bind("mouseenter.accordion",function(){b.disabled||c(this).addClass("ui-state-hover")}).bind("mouseleave.accordion",function(){b.disabled||c(this).removeClass("ui-state-hover")}).bind("focus.accordion",function(){b.disabled||c(this).addClass("ui-state-focus")}).bind("blur.accordion",function(){b.disabled||c(this).removeClass("ui-state-focus")});a.headers.next().addClass("ui-accordion-content ui-helper-reset ui-widget-content ui-corner-bottom"); +if(b.navigation){var d=a.element.find("a").filter(b.navigationFilter).eq(0);if(d.length){var h=d.closest(".ui-accordion-header");a.active=h.length?h:d.closest(".ui-accordion-content").prev()}}a.active=a._findActive(a.active||b.active).addClass("ui-state-default ui-state-active").toggleClass("ui-corner-all").toggleClass("ui-corner-top");a.active.next().addClass("ui-accordion-content-active");a._createIcons();a.resize();a.element.attr("role","tablist");a.headers.attr("role","tab").bind("keydown.accordion", +function(f){return a._keydown(f)}).next().attr("role","tabpanel");a.headers.not(a.active||"").attr({"aria-expanded":"false",tabIndex:-1}).next().hide();a.active.length?a.active.attr({"aria-expanded":"true",tabIndex:0}):a.headers.eq(0).attr("tabIndex",0);c.browser.safari||a.headers.find("a").attr("tabIndex",-1);b.event&&a.headers.bind(b.event.split(" ").join(".accordion ")+".accordion",function(f){a._clickHandler.call(a,f,this);f.preventDefault()})},_createIcons:function(){var a=this.options;if(a.icons){c("<span></span>").addClass("ui-icon "+ +a.icons.header).prependTo(this.headers);this.active.children(".ui-icon").toggleClass(a.icons.header).toggleClass(a.icons.headerSelected);this.element.addClass("ui-accordion-icons")}},_destroyIcons:function(){this.headers.children(".ui-icon").remove();this.element.removeClass("ui-accordion-icons")},destroy:function(){var a=this.options;this.element.removeClass("ui-accordion ui-widget ui-helper-reset").removeAttr("role");this.headers.unbind(".accordion").removeClass("ui-accordion-header ui-accordion-disabled ui-helper-reset ui-state-default ui-corner-all ui-state-active ui-state-disabled ui-corner-top").removeAttr("role").removeAttr("aria-expanded").removeAttr("tabIndex"); +this.headers.find("a").removeAttr("tabIndex");this._destroyIcons();var b=this.headers.next().css("display","").removeAttr("role").removeClass("ui-helper-reset ui-widget-content ui-corner-bottom ui-accordion-content ui-accordion-content-active ui-accordion-disabled ui-state-disabled");if(a.autoHeight||a.fillHeight)b.css("height","");return c.Widget.prototype.destroy.call(this)},_setOption:function(a,b){c.Widget.prototype._setOption.apply(this,arguments);a=="active"&&this.activate(b);if(a=="icons"){this._destroyIcons(); +b&&this._createIcons()}if(a=="disabled")this.headers.add(this.headers.next())[b?"addClass":"removeClass"]("ui-accordion-disabled ui-state-disabled")},_keydown:function(a){if(!(this.options.disabled||a.altKey||a.ctrlKey)){var b=c.ui.keyCode,d=this.headers.length,h=this.headers.index(a.target),f=false;switch(a.keyCode){case b.RIGHT:case b.DOWN:f=this.headers[(h+1)%d];break;case b.LEFT:case b.UP:f=this.headers[(h-1+d)%d];break;case b.SPACE:case b.ENTER:this._clickHandler({target:a.target},a.target); +a.preventDefault()}if(f){c(a.target).attr("tabIndex",-1);c(f).attr("tabIndex",0);f.focus();return false}return true}},resize:function(){var a=this.options,b;if(a.fillSpace){if(c.browser.msie){var d=this.element.parent().css("overflow");this.element.parent().css("overflow","hidden")}b=this.element.parent().height();c.browser.msie&&this.element.parent().css("overflow",d);this.headers.each(function(){b-=c(this).outerHeight(true)});this.headers.next().each(function(){c(this).height(Math.max(0,b-c(this).innerHeight()+ +c(this).height()))}).css("overflow","auto")}else if(a.autoHeight){b=0;this.headers.next().each(function(){b=Math.max(b,c(this).height("").height())}).height(b)}return this},activate:function(a){this.options.active=a;a=this._findActive(a)[0];this._clickHandler({target:a},a);return this},_findActive:function(a){return a?typeof a==="number"?this.headers.filter(":eq("+a+")"):this.headers.not(this.headers.not(a)):a===false?c([]):this.headers.filter(":eq(0)")},_clickHandler:function(a,b){var d=this.options; +if(!d.disabled)if(a.target){a=c(a.currentTarget||b);b=a[0]===this.active[0];d.active=d.collapsible&&b?false:this.headers.index(a);if(!(this.running||!d.collapsible&&b)){var h=this.active;j=a.next();g=this.active.next();e={options:d,newHeader:b&&d.collapsible?c([]):a,oldHeader:this.active,newContent:b&&d.collapsible?c([]):j,oldContent:g};var f=this.headers.index(this.active[0])>this.headers.index(a[0]);this.active=b?c([]):a;this._toggle(j,g,e,b,f);h.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header); +if(!b){a.removeClass("ui-state-default ui-corner-all").addClass("ui-state-active ui-corner-top").children(".ui-icon").removeClass(d.icons.header).addClass(d.icons.headerSelected);a.next().addClass("ui-accordion-content-active")}}}else if(d.collapsible){this.active.removeClass("ui-state-active ui-corner-top").addClass("ui-state-default ui-corner-all").children(".ui-icon").removeClass(d.icons.headerSelected).addClass(d.icons.header);this.active.next().addClass("ui-accordion-content-active");var g=this.active.next(), +e={options:d,newHeader:c([]),oldHeader:d.active,newContent:c([]),oldContent:g},j=this.active=c([]);this._toggle(j,g,e)}},_toggle:function(a,b,d,h,f){var g=this,e=g.options;g.toShow=a;g.toHide=b;g.data=d;var j=function(){if(g)return g._completed.apply(g,arguments)};g._trigger("changestart",null,g.data);g.running=b.size()===0?a.size():b.size();if(e.animated){d={};d=e.collapsible&&h?{toShow:c([]),toHide:b,complete:j,down:f,autoHeight:e.autoHeight||e.fillSpace}:{toShow:a,toHide:b,complete:j,down:f,autoHeight:e.autoHeight|| +e.fillSpace};if(!e.proxied)e.proxied=e.animated;if(!e.proxiedDuration)e.proxiedDuration=e.duration;e.animated=c.isFunction(e.proxied)?e.proxied(d):e.proxied;e.duration=c.isFunction(e.proxiedDuration)?e.proxiedDuration(d):e.proxiedDuration;h=c.ui.accordion.animations;var i=e.duration,k=e.animated;if(k&&!h[k]&&!c.easing[k])k="slide";h[k]||(h[k]=function(l){this.slide(l,{easing:k,duration:i||700})});h[k](d)}else{if(e.collapsible&&h)a.toggle();else{b.hide();a.show()}j(true)}b.prev().attr({"aria-expanded":"false", +tabIndex:-1}).blur();a.prev().attr({"aria-expanded":"true",tabIndex:0}).focus()},_completed:function(a){this.running=a?0:--this.running;if(!this.running){this.options.clearStyle&&this.toShow.add(this.toHide).css({height:"",overflow:""});this.toHide.removeClass("ui-accordion-content-active");if(this.toHide.length)this.toHide.parent()[0].className=this.toHide.parent()[0].className;this._trigger("change",null,this.data)}}});c.extend(c.ui.accordion,{version:"1.8.10",animations:{slide:function(a,b){a= +c.extend({easing:"swing",duration:300},a,b);if(a.toHide.size())if(a.toShow.size()){var d=a.toShow.css("overflow"),h=0,f={},g={},e;b=a.toShow;e=b[0].style.width;b.width(parseInt(b.parent().width(),10)-parseInt(b.css("paddingLeft"),10)-parseInt(b.css("paddingRight"),10)-(parseInt(b.css("borderLeftWidth"),10)||0)-(parseInt(b.css("borderRightWidth"),10)||0));c.each(["height","paddingTop","paddingBottom"],function(j,i){g[i]="hide";j=(""+c.css(a.toShow[0],i)).match(/^([\d+-.]+)(.*)$/);f[i]={value:j[1], +unit:j[2]||"px"}});a.toShow.css({height:0,overflow:"hidden"}).show();a.toHide.filter(":hidden").each(a.complete).end().filter(":visible").animate(g,{step:function(j,i){if(i.prop=="height")h=i.end-i.start===0?0:(i.now-i.start)/(i.end-i.start);a.toShow[0].style[i.prop]=h*f[i.prop].value+f[i.prop].unit},duration:a.duration,easing:a.easing,complete:function(){a.autoHeight||a.toShow.css("height","");a.toShow.css({width:e,overflow:d});a.complete()}})}else a.toHide.animate({height:"hide",paddingTop:"hide", +paddingBottom:"hide"},a);else a.toShow.animate({height:"show",paddingTop:"show",paddingBottom:"show"},a)},bounceslide:function(a){this.slide(a,{easing:a.down?"easeOutBounce":"swing",duration:a.down?1E3:200})}}})})(jQuery); +;/* + * jQuery UI Autocomplete 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Autocomplete + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.position.js + */ +(function(d){var e=0;d.widget("ui.autocomplete",{options:{appendTo:"body",delay:300,minLength:1,position:{my:"left top",at:"left bottom",collision:"none"},source:null},pending:0,_create:function(){var a=this,b=this.element[0].ownerDocument,g;this.element.addClass("ui-autocomplete-input").attr("autocomplete","off").attr({role:"textbox","aria-autocomplete":"list","aria-haspopup":"true"}).bind("keydown.autocomplete",function(c){if(!(a.options.disabled||a.element.attr("readonly"))){g=false;var f=d.ui.keyCode; +switch(c.keyCode){case f.PAGE_UP:a._move("previousPage",c);break;case f.PAGE_DOWN:a._move("nextPage",c);break;case f.UP:a._move("previous",c);c.preventDefault();break;case f.DOWN:a._move("next",c);c.preventDefault();break;case f.ENTER:case f.NUMPAD_ENTER:if(a.menu.active){g=true;c.preventDefault()}case f.TAB:if(!a.menu.active)return;a.menu.select(c);break;case f.ESCAPE:a.element.val(a.term);a.close(c);break;default:clearTimeout(a.searching);a.searching=setTimeout(function(){if(a.term!=a.element.val()){a.selectedItem= +null;a.search(null,c)}},a.options.delay);break}}}).bind("keypress.autocomplete",function(c){if(g){g=false;c.preventDefault()}}).bind("focus.autocomplete",function(){if(!a.options.disabled){a.selectedItem=null;a.previous=a.element.val()}}).bind("blur.autocomplete",function(c){if(!a.options.disabled){clearTimeout(a.searching);a.closing=setTimeout(function(){a.close(c);a._change(c)},150)}});this._initSource();this.response=function(){return a._response.apply(a,arguments)};this.menu=d("<ul></ul>").addClass("ui-autocomplete").appendTo(d(this.options.appendTo|| +"body",b)[0]).mousedown(function(c){var f=a.menu.element[0];d(c.target).closest(".ui-menu-item").length||setTimeout(function(){d(document).one("mousedown",function(h){h.target!==a.element[0]&&h.target!==f&&!d.ui.contains(f,h.target)&&a.close()})},1);setTimeout(function(){clearTimeout(a.closing)},13)}).menu({focus:function(c,f){f=f.item.data("item.autocomplete");false!==a._trigger("focus",c,{item:f})&&/^key/.test(c.originalEvent.type)&&a.element.val(f.value)},selected:function(c,f){var h=f.item.data("item.autocomplete"), +i=a.previous;if(a.element[0]!==b.activeElement){a.element.focus();a.previous=i;setTimeout(function(){a.previous=i;a.selectedItem=h},1)}false!==a._trigger("select",c,{item:h})&&a.element.val(h.value);a.term=a.element.val();a.close(c);a.selectedItem=h},blur:function(){a.menu.element.is(":visible")&&a.element.val()!==a.term&&a.element.val(a.term)}}).zIndex(this.element.zIndex()+1).css({top:0,left:0}).hide().data("menu");d.fn.bgiframe&&this.menu.element.bgiframe()},destroy:function(){this.element.removeClass("ui-autocomplete-input").removeAttr("autocomplete").removeAttr("role").removeAttr("aria-autocomplete").removeAttr("aria-haspopup"); +this.menu.element.remove();d.Widget.prototype.destroy.call(this)},_setOption:function(a,b){d.Widget.prototype._setOption.apply(this,arguments);a==="source"&&this._initSource();if(a==="appendTo")this.menu.element.appendTo(d(b||"body",this.element[0].ownerDocument)[0]);a==="disabled"&&b&&this.xhr&&this.xhr.abort()},_initSource:function(){var a=this,b,g;if(d.isArray(this.options.source)){b=this.options.source;this.source=function(c,f){f(d.ui.autocomplete.filter(b,c.term))}}else if(typeof this.options.source=== +"string"){g=this.options.source;this.source=function(c,f){a.xhr&&a.xhr.abort();a.xhr=d.ajax({url:g,data:c,dataType:"json",autocompleteRequest:++e,success:function(h){this.autocompleteRequest===e&&f(h)},error:function(){this.autocompleteRequest===e&&f([])}})}}else this.source=this.options.source},search:function(a,b){a=a!=null?a:this.element.val();this.term=this.element.val();if(a.length<this.options.minLength)return this.close(b);clearTimeout(this.closing);if(this._trigger("search",b)!==false)return this._search(a)}, +_search:function(a){this.pending++;this.element.addClass("ui-autocomplete-loading");this.source({term:a},this.response)},_response:function(a){if(!this.options.disabled&&a&&a.length){a=this._normalize(a);this._suggest(a);this._trigger("open")}else this.close();this.pending--;this.pending||this.element.removeClass("ui-autocomplete-loading")},close:function(a){clearTimeout(this.closing);if(this.menu.element.is(":visible")){this.menu.element.hide();this.menu.deactivate();this._trigger("close",a)}},_change:function(a){this.previous!== +this.element.val()&&this._trigger("change",a,{item:this.selectedItem})},_normalize:function(a){if(a.length&&a[0].label&&a[0].value)return a;return d.map(a,function(b){if(typeof b==="string")return{label:b,value:b};return d.extend({label:b.label||b.value,value:b.value||b.label},b)})},_suggest:function(a){var b=this.menu.element.empty().zIndex(this.element.zIndex()+1);this._renderMenu(b,a);this.menu.deactivate();this.menu.refresh();b.show();this._resizeMenu();b.position(d.extend({of:this.element},this.options.position))}, +_resizeMenu:function(){var a=this.menu.element;a.outerWidth(Math.max(a.width("").outerWidth(),this.element.outerWidth()))},_renderMenu:function(a,b){var g=this;d.each(b,function(c,f){g._renderItem(a,f)})},_renderItem:function(a,b){return d("<li></li>").data("item.autocomplete",b).append(d("<a></a>").text(b.label)).appendTo(a)},_move:function(a,b){if(this.menu.element.is(":visible"))if(this.menu.first()&&/^previous/.test(a)||this.menu.last()&&/^next/.test(a)){this.element.val(this.term);this.menu.deactivate()}else this.menu[a](b); +else this.search(null,b)},widget:function(){return this.menu.element}});d.extend(d.ui.autocomplete,{escapeRegex:function(a){return a.replace(/[-[\]{}()*+?.,\\^$|#\s]/g,"\\$&")},filter:function(a,b){var g=new RegExp(d.ui.autocomplete.escapeRegex(b),"i");return d.grep(a,function(c){return g.test(c.label||c.value||c)})}})})(jQuery); +(function(d){d.widget("ui.menu",{_create:function(){var e=this;this.element.addClass("ui-menu ui-widget ui-widget-content ui-corner-all").attr({role:"listbox","aria-activedescendant":"ui-active-menuitem"}).click(function(a){if(d(a.target).closest(".ui-menu-item a").length){a.preventDefault();e.select(a)}});this.refresh()},refresh:function(){var e=this;this.element.children("li:not(.ui-menu-item):has(a)").addClass("ui-menu-item").attr("role","menuitem").children("a").addClass("ui-corner-all").attr("tabindex", +-1).mouseenter(function(a){e.activate(a,d(this).parent())}).mouseleave(function(){e.deactivate()})},activate:function(e,a){this.deactivate();if(this.hasScroll()){var b=a.offset().top-this.element.offset().top,g=this.element.attr("scrollTop"),c=this.element.height();if(b<0)this.element.attr("scrollTop",g+b);else b>=c&&this.element.attr("scrollTop",g+b-c+a.height())}this.active=a.eq(0).children("a").addClass("ui-state-hover").attr("id","ui-active-menuitem").end();this._trigger("focus",e,{item:a})}, +deactivate:function(){if(this.active){this.active.children("a").removeClass("ui-state-hover").removeAttr("id");this._trigger("blur");this.active=null}},next:function(e){this.move("next",".ui-menu-item:first",e)},previous:function(e){this.move("prev",".ui-menu-item:last",e)},first:function(){return this.active&&!this.active.prevAll(".ui-menu-item").length},last:function(){return this.active&&!this.active.nextAll(".ui-menu-item").length},move:function(e,a,b){if(this.active){e=this.active[e+"All"](".ui-menu-item").eq(0); +e.length?this.activate(b,e):this.activate(b,this.element.children(a))}else this.activate(b,this.element.children(a))},nextPage:function(e){if(this.hasScroll())if(!this.active||this.last())this.activate(e,this.element.children(".ui-menu-item:first"));else{var a=this.active.offset().top,b=this.element.height(),g=this.element.children(".ui-menu-item").filter(function(){var c=d(this).offset().top-a-b+d(this).height();return c<10&&c>-10});g.length||(g=this.element.children(".ui-menu-item:last"));this.activate(e, +g)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.last()?":first":":last"))},previousPage:function(e){if(this.hasScroll())if(!this.active||this.first())this.activate(e,this.element.children(".ui-menu-item:last"));else{var a=this.active.offset().top,b=this.element.height();result=this.element.children(".ui-menu-item").filter(function(){var g=d(this).offset().top-a+b-d(this).height();return g<10&&g>-10});result.length||(result=this.element.children(".ui-menu-item:first")); +this.activate(e,result)}else this.activate(e,this.element.children(".ui-menu-item").filter(!this.active||this.first()?":last":":first"))},hasScroll:function(){return this.element.height()<this.element.attr("scrollHeight")},select:function(e){this._trigger("selected",e,{item:this.active})}})})(jQuery); +;/* + * jQuery UI Button 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Button + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(a){var g,i=function(b){a(":ui-button",b.target.form).each(function(){var c=a(this).data("button");setTimeout(function(){c.refresh()},1)})},h=function(b){var c=b.name,d=b.form,f=a([]);if(c)f=d?a(d).find("[name='"+c+"']"):a("[name='"+c+"']",b.ownerDocument).filter(function(){return!this.form});return f};a.widget("ui.button",{options:{disabled:null,text:true,label:null,icons:{primary:null,secondary:null}},_create:function(){this.element.closest("form").unbind("reset.button").bind("reset.button", +i);if(typeof this.options.disabled!=="boolean")this.options.disabled=this.element.attr("disabled");this._determineButtonType();this.hasTitle=!!this.buttonElement.attr("title");var b=this,c=this.options,d=this.type==="checkbox"||this.type==="radio",f="ui-state-hover"+(!d?" ui-state-active":"");if(c.label===null)c.label=this.buttonElement.html();if(this.element.is(":disabled"))c.disabled=true;this.buttonElement.addClass("ui-button ui-widget ui-state-default ui-corner-all").attr("role","button").bind("mouseenter.button", +function(){if(!c.disabled){a(this).addClass("ui-state-hover");this===g&&a(this).addClass("ui-state-active")}}).bind("mouseleave.button",function(){c.disabled||a(this).removeClass(f)}).bind("focus.button",function(){a(this).addClass("ui-state-focus")}).bind("blur.button",function(){a(this).removeClass("ui-state-focus")});d&&this.element.bind("change.button",function(){b.refresh()});if(this.type==="checkbox")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).toggleClass("ui-state-active"); +b.buttonElement.attr("aria-pressed",b.element[0].checked)});else if(this.type==="radio")this.buttonElement.bind("click.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active");b.buttonElement.attr("aria-pressed",true);var e=b.element[0];h(e).not(e).map(function(){return a(this).button("widget")[0]}).removeClass("ui-state-active").attr("aria-pressed",false)});else{this.buttonElement.bind("mousedown.button",function(){if(c.disabled)return false;a(this).addClass("ui-state-active"); +g=this;a(document).one("mouseup",function(){g=null})}).bind("mouseup.button",function(){if(c.disabled)return false;a(this).removeClass("ui-state-active")}).bind("keydown.button",function(e){if(c.disabled)return false;if(e.keyCode==a.ui.keyCode.SPACE||e.keyCode==a.ui.keyCode.ENTER)a(this).addClass("ui-state-active")}).bind("keyup.button",function(){a(this).removeClass("ui-state-active")});this.buttonElement.is("a")&&this.buttonElement.keyup(function(e){e.keyCode===a.ui.keyCode.SPACE&&a(this).click()})}this._setOption("disabled", +c.disabled)},_determineButtonType:function(){this.type=this.element.is(":checkbox")?"checkbox":this.element.is(":radio")?"radio":this.element.is("input")?"input":"button";if(this.type==="checkbox"||this.type==="radio"){this.buttonElement=this.element.parents().last().find("label[for="+this.element.attr("id")+"]");this.element.addClass("ui-helper-hidden-accessible");var b=this.element.is(":checked");b&&this.buttonElement.addClass("ui-state-active");this.buttonElement.attr("aria-pressed",b)}else this.buttonElement= +this.element},widget:function(){return this.buttonElement},destroy:function(){this.element.removeClass("ui-helper-hidden-accessible");this.buttonElement.removeClass("ui-button ui-widget ui-state-default ui-corner-all ui-state-hover ui-state-active ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only").removeAttr("role").removeAttr("aria-pressed").html(this.buttonElement.find(".ui-button-text").html());this.hasTitle|| +this.buttonElement.removeAttr("title");a.Widget.prototype.destroy.call(this)},_setOption:function(b,c){a.Widget.prototype._setOption.apply(this,arguments);if(b==="disabled")c?this.element.attr("disabled",true):this.element.removeAttr("disabled");this._resetButton()},refresh:function(){var b=this.element.is(":disabled");b!==this.options.disabled&&this._setOption("disabled",b);if(this.type==="radio")h(this.element[0]).each(function(){a(this).is(":checked")?a(this).button("widget").addClass("ui-state-active").attr("aria-pressed", +true):a(this).button("widget").removeClass("ui-state-active").attr("aria-pressed",false)});else if(this.type==="checkbox")this.element.is(":checked")?this.buttonElement.addClass("ui-state-active").attr("aria-pressed",true):this.buttonElement.removeClass("ui-state-active").attr("aria-pressed",false)},_resetButton:function(){if(this.type==="input")this.options.label&&this.element.val(this.options.label);else{var b=this.buttonElement.removeClass("ui-button-icons-only ui-button-icon-only ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary ui-button-text-only"), +c=a("<span></span>").addClass("ui-button-text").html(this.options.label).appendTo(b.empty()).text(),d=this.options.icons,f=d.primary&&d.secondary,e=[];if(d.primary||d.secondary){e.push("ui-button-text-icon"+(f?"s":d.primary?"-primary":"-secondary"));d.primary&&b.prepend("<span class='ui-button-icon-primary ui-icon "+d.primary+"'></span>");d.secondary&&b.append("<span class='ui-button-icon-secondary ui-icon "+d.secondary+"'></span>");if(!this.options.text){e.push(f?"ui-button-icons-only":"ui-button-icon-only"); +b.removeClass("ui-button-text-icons ui-button-text-icon-primary ui-button-text-icon-secondary");this.hasTitle||b.attr("title",c)}}else e.push("ui-button-text-only");b.addClass(e.join(" "))}}});a.widget("ui.buttonset",{options:{items:":button, :submit, :reset, :checkbox, :radio, a, :data(button)"},_create:function(){this.element.addClass("ui-buttonset")},_init:function(){this.refresh()},_setOption:function(b,c){b==="disabled"&&this.buttons.button("option",b,c);a.Widget.prototype._setOption.apply(this, +arguments)},refresh:function(){this.buttons=this.element.find(this.options.items).filter(":ui-button").button("refresh").end().not(":ui-button").button().end().map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-all ui-corner-left ui-corner-right").filter(":first").addClass("ui-corner-left").end().filter(":last").addClass("ui-corner-right").end().end()},destroy:function(){this.element.removeClass("ui-buttonset");this.buttons.map(function(){return a(this).button("widget")[0]}).removeClass("ui-corner-left ui-corner-right").end().button("destroy"); +a.Widget.prototype.destroy.call(this)}})})(jQuery); +;/* + * jQuery UI Dialog 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Dialog + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + * jquery.ui.button.js + * jquery.ui.draggable.js + * jquery.ui.mouse.js + * jquery.ui.position.js + * jquery.ui.resizable.js + */ +(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&& +c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("<div></div>")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex", +-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("<div></div>")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('<a href="#"></a>').addClass("ui-dialog-titlebar-close ui-corner-all").attr("role", +"button").hover(function(){h.addClass("ui-state-hover")},function(){h.removeClass("ui-state-hover")}).focus(function(){h.addClass("ui-state-focus")}).blur(function(){h.removeClass("ui-state-focus")}).click(function(i){a.close(i);return false}).appendTo(f);(a.uiDialogTitlebarCloseText=c("<span></span>")).addClass("ui-icon ui-icon-closethick").text(b.closeText).appendTo(h);c("<span></span>").addClass("ui-dialog-title").attr("id",e).html(d).prependTo(f);if(c.isFunction(b.beforeclose)&&!c.isFunction(b.beforeClose))b.beforeClose= +b.beforeclose;f.find("*").add(f).disableSelection();b.draggable&&c.fn.draggable&&a._makeDraggable();b.resizable&&c.fn.resizable&&a._makeResizable();a._createButtons(b.buttons);a._isOpen=false;c.fn.bgiframe&&g.bgiframe()},_init:function(){this.options.autoOpen&&this.open()},destroy:function(){var a=this;a.overlay&&a.overlay.destroy();a.uiDialog.hide();a.element.unbind(".dialog").removeData("dialog").removeClass("ui-dialog-content ui-widget-content").hide().appendTo("body");a.uiDialog.remove();a.originalTitle&& +a.element.attr("title",a.originalTitle);return a},widget:function(){return this.uiDialog},close:function(a){var b=this,d,e;if(false!==b._trigger("beforeClose",a)){b.overlay&&b.overlay.destroy();b.uiDialog.unbind("keypress.ui-dialog");b._isOpen=false;if(b.options.hide)b.uiDialog.hide(b.options.hide,function(){b._trigger("close",a)});else{b.uiDialog.hide();b._trigger("close",a)}c.ui.dialog.overlay.resize();if(b.options.modal){d=0;c(".ui-dialog").each(function(){if(this!==b.uiDialog[0]){e=c(this).css("z-index"); +isNaN(e)||(d=Math.max(d,e))}});c.ui.dialog.maxZ=d}return b}},isOpen:function(){return this._isOpen},moveToTop:function(a,b){var d=this,e=d.options;if(e.modal&&!a||!e.stack&&!e.modal)return d._trigger("focus",b);if(e.zIndex>c.ui.dialog.maxZ)c.ui.dialog.maxZ=e.zIndex;if(d.overlay){c.ui.dialog.maxZ+=1;d.overlay.$el.css("z-index",c.ui.dialog.overlay.maxZ=c.ui.dialog.maxZ)}a={scrollTop:d.element.attr("scrollTop"),scrollLeft:d.element.attr("scrollLeft")};c.ui.dialog.maxZ+=1;d.uiDialog.css("z-index",c.ui.dialog.maxZ); +d.element.attr(a);d._trigger("focus",b);return d},open:function(){if(!this._isOpen){var a=this,b=a.options,d=a.uiDialog;a.overlay=b.modal?new c.ui.dialog.overlay(a):null;a._size();a._position(b.position);d.show(b.show);a.moveToTop(true);b.modal&&d.bind("keypress.ui-dialog",function(e){if(e.keyCode===c.ui.keyCode.TAB){var g=c(":tabbable",this),f=g.filter(":first");g=g.filter(":last");if(e.target===g[0]&&!e.shiftKey){f.focus(1);return false}else if(e.target===f[0]&&e.shiftKey){g.focus(1);return false}}}); +c(a.element.find(":tabbable").get().concat(d.find(".ui-dialog-buttonpane :tabbable").get().concat(d.get()))).eq(0).focus();a._isOpen=true;a._trigger("open");return a}},_createButtons:function(a){var b=this,d=false,e=c("<div></div>").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("<div></div>").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f, +h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('<button type="button"></button>').attr(h,true).unbind("click").click(function(){h.click.apply(b.element[0],arguments)}).appendTo(g);c.fn.button&&f.button()});e.appendTo(b.uiDialog)}},_makeDraggable:function(){function a(f){return{position:f.position,offset:f.offset}}var b=this,d=b.options,e=c(document),g;b.uiDialog.draggable({cancel:".ui-dialog-content, .ui-dialog-titlebar-close",handle:".ui-dialog-titlebar",containment:"document",start:function(f,h){g= +d.height==="auto"?"auto":c(this).height();c(this).height(c(this).height()).addClass("ui-dialog-dragging");b._trigger("dragStart",f,a(h))},drag:function(f,h){b._trigger("drag",f,a(h))},stop:function(f,h){d.position=[h.position.left-e.scrollLeft(),h.position.top-e.scrollTop()];c(this).removeClass("ui-dialog-dragging").height(g);b._trigger("dragStop",f,a(h));c.ui.dialog.overlay.resize()}})},_makeResizable:function(a){function b(f){return{originalPosition:f.originalPosition,originalSize:f.originalSize, +position:f.position,size:f.size}}a=a===j?this.options.resizable:a;var d=this,e=d.options,g=d.uiDialog.css("position");a=typeof a==="string"?a:"n,e,s,w,se,sw,ne,nw";d.uiDialog.resizable({cancel:".ui-dialog-content",containment:"document",alsoResize:d.element,maxWidth:e.maxWidth,maxHeight:e.maxHeight,minWidth:e.minWidth,minHeight:d._minHeight(),handles:a,start:function(f,h){c(this).addClass("ui-dialog-resizing");d._trigger("resizeStart",f,b(h))},resize:function(f,h){d._trigger("resize",f,b(h))},stop:function(f, +h){c(this).removeClass("ui-dialog-resizing");e.height=c(this).height();e.width=c(this).width();d._trigger("resizeStop",f,b(h));c.ui.dialog.overlay.resize()}}).css("position",g).find(".ui-resizable-se").addClass("ui-icon ui-icon-grip-diagonal-se")},_minHeight:function(){var a=this.options;return a.height==="auto"?a.minHeight:Math.min(a.minHeight,a.height)},_position:function(a){var b=[],d=[0,0],e;if(a){if(typeof a==="string"||typeof a==="object"&&"0"in a){b=a.split?a.split(" "):[a[0],a[1]];if(b.length=== +1)b[1]=b[0];c.each(["left","top"],function(g,f){if(+b[g]===b[g]){d[g]=b[g];b[g]=f}});a={my:b.join(" "),at:b.join(" "),offset:d.join(" ")}}a=c.extend({},c.ui.dialog.prototype.options.position,a)}else a=c.ui.dialog.prototype.options.position;(e=this.uiDialog.is(":visible"))||this.uiDialog.show();this.uiDialog.css({top:0,left:0}).position(c.extend({of:window},a));e||this.uiDialog.hide()},_setOptions:function(a){var b=this,d={},e=false;c.each(a,function(g,f){b._setOption(g,f);if(g in k)e=true;if(g in +l)d[g]=f});e&&this._size();this.uiDialog.is(":data(resizable)")&&this.uiDialog.resizable("option",d)},_setOption:function(a,b){var d=this,e=d.uiDialog;switch(a){case "beforeclose":a="beforeClose";break;case "buttons":d._createButtons(b);break;case "closeText":d.uiDialogTitlebarCloseText.text(""+b);break;case "dialogClass":e.removeClass(d.options.dialogClass).addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b);break;case "disabled":b?e.addClass("ui-dialog-disabled"):e.removeClass("ui-dialog-disabled"); +break;case "draggable":var g=e.is(":data(draggable)");g&&!b&&e.draggable("destroy");!g&&b&&d._makeDraggable();break;case "position":d._position(b);break;case "resizable":(g=e.is(":data(resizable)"))&&!b&&e.resizable("destroy");g&&typeof b==="string"&&e.resizable("option","handles",b);!g&&b!==false&&d._makeResizable(b);break;case "title":c(".ui-dialog-title",d.uiDialogTitlebar).html(""+(b||" "));break}c.Widget.prototype._setOption.apply(d,arguments)},_size:function(){var a=this.options,b,d,e= +this.uiDialog.is(":visible");this.element.show().css({width:"auto",minHeight:0,height:0});if(a.minWidth>a.width)a.width=a.minWidth;b=this.uiDialog.css({height:"auto",width:a.width}).height();d=Math.max(0,a.minHeight-b);if(a.height==="auto")if(c.support.minHeight)this.element.css({minHeight:d,height:"auto"});else{this.uiDialog.show();a=this.element.css("height","auto").height();e||this.uiDialog.hide();this.element.height(Math.max(a,d))}else this.element.height(Math.max(a.height-b,0));this.uiDialog.is(":data(resizable)")&& +this.uiDialog.resizable("option","minHeight",this._minHeight())}});c.extend(c.ui.dialog,{version:"1.8.10",uuid:0,maxZ:0,getTitleId:function(a){a=a.attr("id");if(!a){this.uuid+=1;a=this.uuid}return"ui-dialog-title-"+a},overlay:function(a){this.$el=c.ui.dialog.overlay.create(a)}});c.extend(c.ui.dialog.overlay,{instances:[],oldInstances:[],maxZ:0,events:c.map("focus,mousedown,mouseup,keydown,keypress,click".split(","),function(a){return a+".dialog-overlay"}).join(" "),create:function(a){if(this.instances.length=== +0){setTimeout(function(){c.ui.dialog.overlay.instances.length&&c(document).bind(c.ui.dialog.overlay.events,function(d){if(c(d.target).zIndex()<c.ui.dialog.overlay.maxZ)return false})},1);c(document).bind("keydown.dialog-overlay",function(d){if(a.options.closeOnEscape&&d.keyCode&&d.keyCode===c.ui.keyCode.ESCAPE){a.close(d);d.preventDefault()}});c(window).bind("resize.dialog-overlay",c.ui.dialog.overlay.resize)}var b=(this.oldInstances.pop()||c("<div></div>").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(), +height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight); +b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a<b?c(window).height()+"px":a+"px"}else return c(document).height()+"px"},width:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollWidth,document.body.scrollWidth);b=Math.max(document.documentElement.offsetWidth,document.body.offsetWidth);return a<b?c(window).width()+"px":a+"px"}else return c(document).width()+"px"},resize:function(){var a=c([]);c.each(c.ui.dialog.overlay.instances, +function(){a=a.add(this)});a.css({width:0,height:0}).css({width:c.ui.dialog.overlay.width(),height:c.ui.dialog.overlay.height()})}});c.extend(c.ui.dialog.overlay.prototype,{destroy:function(){c.ui.dialog.overlay.destroy(this.$el)}})})(jQuery); +;/* + * jQuery UI Slider 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Slider + * + * Depends: + * jquery.ui.core.js + * jquery.ui.mouse.js + * jquery.ui.widget.js + */ +(function(d){d.widget("ui.slider",d.ui.mouse,{widgetEventPrefix:"slide",options:{animate:false,distance:0,max:100,min:0,orientation:"horizontal",range:false,step:1,value:0,values:null},_create:function(){var b=this,a=this.options;this._mouseSliding=this._keySliding=false;this._animateOff=true;this._handleIndex=null;this._detectOrientation();this._mouseInit();this.element.addClass("ui-slider ui-slider-"+this.orientation+" ui-widget ui-widget-content ui-corner-all");a.disabled&&this.element.addClass("ui-slider-disabled ui-disabled"); +this.range=d([]);if(a.range){if(a.range===true){this.range=d("<div></div>");if(!a.values)a.values=[this._valueMin(),this._valueMin()];if(a.values.length&&a.values.length!==2)a.values=[a.values[0],a.values[0]]}else this.range=d("<div></div>");this.range.appendTo(this.element).addClass("ui-slider-range");if(a.range==="min"||a.range==="max")this.range.addClass("ui-slider-range-"+a.range);this.range.addClass("ui-widget-header")}d(".ui-slider-handle",this.element).length===0&&d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle"); +if(a.values&&a.values.length)for(;d(".ui-slider-handle",this.element).length<a.values.length;)d("<a href='#'></a>").appendTo(this.element).addClass("ui-slider-handle");this.handles=d(".ui-slider-handle",this.element).addClass("ui-state-default ui-corner-all");this.handle=this.handles.eq(0);this.handles.add(this.range).filter("a").click(function(c){c.preventDefault()}).hover(function(){a.disabled||d(this).addClass("ui-state-hover")},function(){d(this).removeClass("ui-state-hover")}).focus(function(){if(a.disabled)d(this).blur(); +else{d(".ui-slider .ui-state-focus").removeClass("ui-state-focus");d(this).addClass("ui-state-focus")}}).blur(function(){d(this).removeClass("ui-state-focus")});this.handles.each(function(c){d(this).data("index.ui-slider-handle",c)});this.handles.keydown(function(c){var e=true,f=d(this).data("index.ui-slider-handle"),h,g,i;if(!b.options.disabled){switch(c.keyCode){case d.ui.keyCode.HOME:case d.ui.keyCode.END:case d.ui.keyCode.PAGE_UP:case d.ui.keyCode.PAGE_DOWN:case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:e= +false;if(!b._keySliding){b._keySliding=true;d(this).addClass("ui-state-active");h=b._start(c,f);if(h===false)return}break}i=b.options.step;h=b.options.values&&b.options.values.length?(g=b.values(f)):(g=b.value());switch(c.keyCode){case d.ui.keyCode.HOME:g=b._valueMin();break;case d.ui.keyCode.END:g=b._valueMax();break;case d.ui.keyCode.PAGE_UP:g=b._trimAlignValue(h+(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.PAGE_DOWN:g=b._trimAlignValue(h-(b._valueMax()-b._valueMin())/5);break;case d.ui.keyCode.UP:case d.ui.keyCode.RIGHT:if(h=== +b._valueMax())return;g=b._trimAlignValue(h+i);break;case d.ui.keyCode.DOWN:case d.ui.keyCode.LEFT:if(h===b._valueMin())return;g=b._trimAlignValue(h-i);break}b._slide(c,f,g);return e}}).keyup(function(c){var e=d(this).data("index.ui-slider-handle");if(b._keySliding){b._keySliding=false;b._stop(c,e);b._change(c,e);d(this).removeClass("ui-state-active")}});this._refreshValue();this._animateOff=false},destroy:function(){this.handles.remove();this.range.remove();this.element.removeClass("ui-slider ui-slider-horizontal ui-slider-vertical ui-slider-disabled ui-widget ui-widget-content ui-corner-all").removeData("slider").unbind(".slider"); +this._mouseDestroy();return this},_mouseCapture:function(b){var a=this.options,c,e,f,h,g;if(a.disabled)return false;this.elementSize={width:this.element.outerWidth(),height:this.element.outerHeight()};this.elementOffset=this.element.offset();c=this._normValueFromMouse({x:b.pageX,y:b.pageY});e=this._valueMax()-this._valueMin()+1;h=this;this.handles.each(function(i){var j=Math.abs(c-h.values(i));if(e>j){e=j;f=d(this);g=i}});if(a.range===true&&this.values(1)===a.min){g+=1;f=d(this.handles[g])}if(this._start(b, +g)===false)return false;this._mouseSliding=true;h._handleIndex=g;f.addClass("ui-state-active").focus();a=f.offset();this._clickOffset=!d(b.target).parents().andSelf().is(".ui-slider-handle")?{left:0,top:0}:{left:b.pageX-a.left-f.width()/2,top:b.pageY-a.top-f.height()/2-(parseInt(f.css("borderTopWidth"),10)||0)-(parseInt(f.css("borderBottomWidth"),10)||0)+(parseInt(f.css("marginTop"),10)||0)};this.handles.hasClass("ui-state-hover")||this._slide(b,g,c);return this._animateOff=true},_mouseStart:function(){return true}, +_mouseDrag:function(b){var a=this._normValueFromMouse({x:b.pageX,y:b.pageY});this._slide(b,this._handleIndex,a);return false},_mouseStop:function(b){this.handles.removeClass("ui-state-active");this._mouseSliding=false;this._stop(b,this._handleIndex);this._change(b,this._handleIndex);this._clickOffset=this._handleIndex=null;return this._animateOff=false},_detectOrientation:function(){this.orientation=this.options.orientation==="vertical"?"vertical":"horizontal"},_normValueFromMouse:function(b){var a; +if(this.orientation==="horizontal"){a=this.elementSize.width;b=b.x-this.elementOffset.left-(this._clickOffset?this._clickOffset.left:0)}else{a=this.elementSize.height;b=b.y-this.elementOffset.top-(this._clickOffset?this._clickOffset.top:0)}a=b/a;if(a>1)a=1;if(a<0)a=0;if(this.orientation==="vertical")a=1-a;b=this._valueMax()-this._valueMin();return this._trimAlignValue(this._valueMin()+a*b)},_start:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value= +this.values(a);c.values=this.values()}return this._trigger("start",b,c)},_slide:function(b,a,c){var e;if(this.options.values&&this.options.values.length){e=this.values(a?0:1);if(this.options.values.length===2&&this.options.range===true&&(a===0&&c>e||a===1&&c<e))c=e;if(c!==this.values(a)){e=this.values();e[a]=c;b=this._trigger("slide",b,{handle:this.handles[a],value:c,values:e});this.values(a?0:1);b!==false&&this.values(a,c,true)}}else if(c!==this.value()){b=this._trigger("slide",b,{handle:this.handles[a], +value:c});b!==false&&this.value(c)}},_stop:function(b,a){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("stop",b,c)},_change:function(b,a){if(!this._keySliding&&!this._mouseSliding){var c={handle:this.handles[a],value:this.value()};if(this.options.values&&this.options.values.length){c.value=this.values(a);c.values=this.values()}this._trigger("change",b,c)}},value:function(b){if(arguments.length){this.options.value= +this._trimAlignValue(b);this._refreshValue();this._change(null,0)}return this._value()},values:function(b,a){var c,e,f;if(arguments.length>1){this.options.values[b]=this._trimAlignValue(a);this._refreshValue();this._change(null,b)}if(arguments.length)if(d.isArray(arguments[0])){c=this.options.values;e=arguments[0];for(f=0;f<c.length;f+=1){c[f]=this._trimAlignValue(e[f]);this._change(null,f)}this._refreshValue()}else return this.options.values&&this.options.values.length?this._values(b):this.value(); +else return this._values()},_setOption:function(b,a){var c,e=0;if(d.isArray(this.options.values))e=this.options.values.length;d.Widget.prototype._setOption.apply(this,arguments);switch(b){case "disabled":if(a){this.handles.filter(".ui-state-focus").blur();this.handles.removeClass("ui-state-hover");this.handles.attr("disabled","disabled");this.element.addClass("ui-disabled")}else{this.handles.removeAttr("disabled");this.element.removeClass("ui-disabled")}break;case "orientation":this._detectOrientation(); +this.element.removeClass("ui-slider-horizontal ui-slider-vertical").addClass("ui-slider-"+this.orientation);this._refreshValue();break;case "value":this._animateOff=true;this._refreshValue();this._change(null,0);this._animateOff=false;break;case "values":this._animateOff=true;this._refreshValue();for(c=0;c<e;c+=1)this._change(null,c);this._animateOff=false;break}},_value:function(){var b=this.options.value;return b=this._trimAlignValue(b)},_values:function(b){var a,c;if(arguments.length){a=this.options.values[b]; +return a=this._trimAlignValue(a)}else{a=this.options.values.slice();for(c=0;c<a.length;c+=1)a[c]=this._trimAlignValue(a[c]);return a}},_trimAlignValue:function(b){if(b<=this._valueMin())return this._valueMin();if(b>=this._valueMax())return this._valueMax();var a=this.options.step>0?this.options.step:1,c=(b-this._valueMin())%a;alignValue=b-c;if(Math.abs(c)*2>=a)alignValue+=c>0?a:-a;return parseFloat(alignValue.toFixed(5))},_valueMin:function(){return this.options.min},_valueMax:function(){return this.options.max}, +_refreshValue:function(){var b=this.options.range,a=this.options,c=this,e=!this._animateOff?a.animate:false,f,h={},g,i,j,l;if(this.options.values&&this.options.values.length)this.handles.each(function(k){f=(c.values(k)-c._valueMin())/(c._valueMax()-c._valueMin())*100;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";d(this).stop(1,1)[e?"animate":"css"](h,a.animate);if(c.options.range===true)if(c.orientation==="horizontal"){if(k===0)c.range.stop(1,1)[e?"animate":"css"]({left:f+"%"},a.animate); +if(k===1)c.range[e?"animate":"css"]({width:f-g+"%"},{queue:false,duration:a.animate})}else{if(k===0)c.range.stop(1,1)[e?"animate":"css"]({bottom:f+"%"},a.animate);if(k===1)c.range[e?"animate":"css"]({height:f-g+"%"},{queue:false,duration:a.animate})}g=f});else{i=this.value();j=this._valueMin();l=this._valueMax();f=l!==j?(i-j)/(l-j)*100:0;h[c.orientation==="horizontal"?"left":"bottom"]=f+"%";this.handle.stop(1,1)[e?"animate":"css"](h,a.animate);if(b==="min"&&this.orientation==="horizontal")this.range.stop(1, +1)[e?"animate":"css"]({width:f+"%"},a.animate);if(b==="max"&&this.orientation==="horizontal")this.range[e?"animate":"css"]({width:100-f+"%"},{queue:false,duration:a.animate});if(b==="min"&&this.orientation==="vertical")this.range.stop(1,1)[e?"animate":"css"]({height:f+"%"},a.animate);if(b==="max"&&this.orientation==="vertical")this.range[e?"animate":"css"]({height:100-f+"%"},{queue:false,duration:a.animate})}}});d.extend(d.ui.slider,{version:"1.8.10"})})(jQuery); +;/* + * jQuery UI Tabs 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Tabs + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(d,p){function u(){return++v}function w(){return++x}var v=0,x=0;d.widget("ui.tabs",{options:{add:null,ajaxOptions:null,cache:false,cookie:null,collapsible:false,disable:null,disabled:[],enable:null,event:"click",fx:null,idPrefix:"ui-tabs-",load:null,panelTemplate:"<div></div>",remove:null,select:null,show:null,spinner:"<em>Loading…</em>",tabTemplate:"<li><a href='#{href}'><span>#{label}</span></a></li>"},_create:function(){this._tabify(true)},_setOption:function(b,e){if(b=="selected")this.options.collapsible&& +e==this.options.selected||this.select(e);else{this.options[b]=e;this._tabify()}},_tabId:function(b){return b.title&&b.title.replace(/\s/g,"_").replace(/[^\w\u00c0-\uFFFF-]/g,"")||this.options.idPrefix+u()},_sanitizeSelector:function(b){return b.replace(/:/g,"\\:")},_cookie:function(){var b=this.cookie||(this.cookie=this.options.cookie.name||"ui-tabs-"+w());return d.cookie.apply(null,[b].concat(d.makeArray(arguments)))},_ui:function(b,e){return{tab:b,panel:e,index:this.anchors.index(b)}},_cleanup:function(){this.lis.filter(".ui-state-processing").removeClass("ui-state-processing").find("span:data(label.tabs)").each(function(){var b= +d(this);b.html(b.data("label.tabs")).removeData("label.tabs")})},_tabify:function(b){function e(g,f){g.css("display","");!d.support.opacity&&f.opacity&&g[0].style.removeAttribute("filter")}var a=this,c=this.options,h=/^#.+/;this.list=this.element.find("ol,ul").eq(0);this.lis=d(" > li:has(a[href])",this.list);this.anchors=this.lis.map(function(){return d("a",this)[0]});this.panels=d([]);this.anchors.each(function(g,f){var i=d(f).attr("href"),l=i.split("#")[0],q;if(l&&(l===location.toString().split("#")[0]|| +(q=d("base")[0])&&l===q.href)){i=f.hash;f.href=i}if(h.test(i))a.panels=a.panels.add(a.element.find(a._sanitizeSelector(i)));else if(i&&i!=="#"){d.data(f,"href.tabs",i);d.data(f,"load.tabs",i.replace(/#.*$/,""));i=a._tabId(f);f.href="#"+i;f=a.element.find("#"+i);if(!f.length){f=d(c.panelTemplate).attr("id",i).addClass("ui-tabs-panel ui-widget-content ui-corner-bottom").insertAfter(a.panels[g-1]||a.list);f.data("destroy.tabs",true)}a.panels=a.panels.add(f)}else c.disabled.push(g)});if(b){this.element.addClass("ui-tabs ui-widget ui-widget-content ui-corner-all"); +this.list.addClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.lis.addClass("ui-state-default ui-corner-top");this.panels.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom");if(c.selected===p){location.hash&&this.anchors.each(function(g,f){if(f.hash==location.hash){c.selected=g;return false}});if(typeof c.selected!=="number"&&c.cookie)c.selected=parseInt(a._cookie(),10);if(typeof c.selected!=="number"&&this.lis.filter(".ui-tabs-selected").length)c.selected= +this.lis.index(this.lis.filter(".ui-tabs-selected"));c.selected=c.selected||(this.lis.length?0:-1)}else if(c.selected===null)c.selected=-1;c.selected=c.selected>=0&&this.anchors[c.selected]||c.selected<0?c.selected:0;c.disabled=d.unique(c.disabled.concat(d.map(this.lis.filter(".ui-state-disabled"),function(g){return a.lis.index(g)}))).sort();d.inArray(c.selected,c.disabled)!=-1&&c.disabled.splice(d.inArray(c.selected,c.disabled),1);this.panels.addClass("ui-tabs-hide");this.lis.removeClass("ui-tabs-selected ui-state-active"); +if(c.selected>=0&&this.anchors.length){a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash)).removeClass("ui-tabs-hide");this.lis.eq(c.selected).addClass("ui-tabs-selected ui-state-active");a.element.queue("tabs",function(){a._trigger("show",null,a._ui(a.anchors[c.selected],a.element.find(a._sanitizeSelector(a.anchors[c.selected].hash))[0]))});this.load(c.selected)}d(window).bind("unload",function(){a.lis.add(a.anchors).unbind(".tabs");a.lis=a.anchors=a.panels=null})}else c.selected=this.lis.index(this.lis.filter(".ui-tabs-selected")); +this.element[c.collapsible?"addClass":"removeClass"]("ui-tabs-collapsible");c.cookie&&this._cookie(c.selected,c.cookie);b=0;for(var j;j=this.lis[b];b++)d(j)[d.inArray(b,c.disabled)!=-1&&!d(j).hasClass("ui-tabs-selected")?"addClass":"removeClass"]("ui-state-disabled");c.cache===false&&this.anchors.removeData("cache.tabs");this.lis.add(this.anchors).unbind(".tabs");if(c.event!=="mouseover"){var k=function(g,f){f.is(":not(.ui-state-disabled)")&&f.addClass("ui-state-"+g)},n=function(g,f){f.removeClass("ui-state-"+ +g)};this.lis.bind("mouseover.tabs",function(){k("hover",d(this))});this.lis.bind("mouseout.tabs",function(){n("hover",d(this))});this.anchors.bind("focus.tabs",function(){k("focus",d(this).closest("li"))});this.anchors.bind("blur.tabs",function(){n("focus",d(this).closest("li"))})}var m,o;if(c.fx)if(d.isArray(c.fx)){m=c.fx[0];o=c.fx[1]}else m=o=c.fx;var r=o?function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.hide().removeClass("ui-tabs-hide").animate(o,o.duration||"normal", +function(){e(f,o);a._trigger("show",null,a._ui(g,f[0]))})}:function(g,f){d(g).closest("li").addClass("ui-tabs-selected ui-state-active");f.removeClass("ui-tabs-hide");a._trigger("show",null,a._ui(g,f[0]))},s=m?function(g,f){f.animate(m,m.duration||"normal",function(){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");e(f,m);a.element.dequeue("tabs")})}:function(g,f){a.lis.removeClass("ui-tabs-selected ui-state-active");f.addClass("ui-tabs-hide");a.element.dequeue("tabs")}; +this.anchors.bind(c.event+".tabs",function(){var g=this,f=d(g).closest("li"),i=a.panels.filter(":not(.ui-tabs-hide)"),l=a.element.find(a._sanitizeSelector(g.hash));if(f.hasClass("ui-tabs-selected")&&!c.collapsible||f.hasClass("ui-state-disabled")||f.hasClass("ui-state-processing")||a.panels.filter(":animated").length||a._trigger("select",null,a._ui(this,l[0]))===false){this.blur();return false}c.selected=a.anchors.index(this);a.abort();if(c.collapsible)if(f.hasClass("ui-tabs-selected")){c.selected= +-1;c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){s(g,i)}).dequeue("tabs");this.blur();return false}else if(!i.length){c.cookie&&a._cookie(c.selected,c.cookie);a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this));this.blur();return false}c.cookie&&a._cookie(c.selected,c.cookie);if(l.length){i.length&&a.element.queue("tabs",function(){s(g,i)});a.element.queue("tabs",function(){r(g,l)});a.load(a.anchors.index(this))}else throw"jQuery UI Tabs: Mismatching fragment identifier."; +d.browser.msie&&this.blur()});this.anchors.bind("click.tabs",function(){return false})},_getIndex:function(b){if(typeof b=="string")b=this.anchors.index(this.anchors.filter("[href$="+b+"]"));return b},destroy:function(){var b=this.options;this.abort();this.element.unbind(".tabs").removeClass("ui-tabs ui-widget ui-widget-content ui-corner-all ui-tabs-collapsible").removeData("tabs");this.list.removeClass("ui-tabs-nav ui-helper-reset ui-helper-clearfix ui-widget-header ui-corner-all");this.anchors.each(function(){var e= +d.data(this,"href.tabs");if(e)this.href=e;var a=d(this).unbind(".tabs");d.each(["href","load","cache"],function(c,h){a.removeData(h+".tabs")})});this.lis.unbind(".tabs").add(this.panels).each(function(){d.data(this,"destroy.tabs")?d(this).remove():d(this).removeClass("ui-state-default ui-corner-top ui-tabs-selected ui-state-active ui-state-hover ui-state-focus ui-state-disabled ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide")});b.cookie&&this._cookie(null,b.cookie);return this},add:function(b, +e,a){if(a===p)a=this.anchors.length;var c=this,h=this.options;e=d(h.tabTemplate.replace(/#\{href\}/g,b).replace(/#\{label\}/g,e));b=!b.indexOf("#")?b.replace("#",""):this._tabId(d("a",e)[0]);e.addClass("ui-state-default ui-corner-top").data("destroy.tabs",true);var j=c.element.find("#"+b);j.length||(j=d(h.panelTemplate).attr("id",b).data("destroy.tabs",true));j.addClass("ui-tabs-panel ui-widget-content ui-corner-bottom ui-tabs-hide");if(a>=this.lis.length){e.appendTo(this.list);j.appendTo(this.list[0].parentNode)}else{e.insertBefore(this.lis[a]); +j.insertBefore(this.panels[a])}h.disabled=d.map(h.disabled,function(k){return k>=a?++k:k});this._tabify();if(this.anchors.length==1){h.selected=0;e.addClass("ui-tabs-selected ui-state-active");j.removeClass("ui-tabs-hide");this.element.queue("tabs",function(){c._trigger("show",null,c._ui(c.anchors[0],c.panels[0]))});this.load(0)}this._trigger("add",null,this._ui(this.anchors[a],this.panels[a]));return this},remove:function(b){b=this._getIndex(b);var e=this.options,a=this.lis.eq(b).remove(),c=this.panels.eq(b).remove(); +if(a.hasClass("ui-tabs-selected")&&this.anchors.length>1)this.select(b+(b+1<this.anchors.length?1:-1));e.disabled=d.map(d.grep(e.disabled,function(h){return h!=b}),function(h){return h>=b?--h:h});this._tabify();this._trigger("remove",null,this._ui(a.find("a")[0],c[0]));return this},enable:function(b){b=this._getIndex(b);var e=this.options;if(d.inArray(b,e.disabled)!=-1){this.lis.eq(b).removeClass("ui-state-disabled");e.disabled=d.grep(e.disabled,function(a){return a!=b});this._trigger("enable",null, +this._ui(this.anchors[b],this.panels[b]));return this}},disable:function(b){b=this._getIndex(b);var e=this.options;if(b!=e.selected){this.lis.eq(b).addClass("ui-state-disabled");e.disabled.push(b);e.disabled.sort();this._trigger("disable",null,this._ui(this.anchors[b],this.panels[b]))}return this},select:function(b){b=this._getIndex(b);if(b==-1)if(this.options.collapsible&&this.options.selected!=-1)b=this.options.selected;else return this;this.anchors.eq(b).trigger(this.options.event+".tabs");return this}, +load:function(b){b=this._getIndex(b);var e=this,a=this.options,c=this.anchors.eq(b)[0],h=d.data(c,"load.tabs");this.abort();if(!h||this.element.queue("tabs").length!==0&&d.data(c,"cache.tabs"))this.element.dequeue("tabs");else{this.lis.eq(b).addClass("ui-state-processing");if(a.spinner){var j=d("span",c);j.data("label.tabs",j.html()).html(a.spinner)}this.xhr=d.ajax(d.extend({},a.ajaxOptions,{url:h,success:function(k,n){e.element.find(e._sanitizeSelector(c.hash)).html(k);e._cleanup();a.cache&&d.data(c, +"cache.tabs",true);e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.success(k,n)}catch(m){}},error:function(k,n){e._cleanup();e._trigger("load",null,e._ui(e.anchors[b],e.panels[b]));try{a.ajaxOptions.error(k,n,b,c)}catch(m){}}}));e.element.dequeue("tabs");return this}},abort:function(){this.element.queue([]);this.panels.stop(false,true);this.element.queue("tabs",this.element.queue("tabs").splice(-2,2));if(this.xhr){this.xhr.abort();delete this.xhr}this._cleanup();return this}, +url:function(b,e){this.anchors.eq(b).removeData("cache.tabs").data("load.tabs",e);return this},length:function(){return this.anchors.length}});d.extend(d.ui.tabs,{version:"1.8.10"});d.extend(d.ui.tabs.prototype,{rotation:null,rotate:function(b,e){var a=this,c=this.options,h=a._rotate||(a._rotate=function(j){clearTimeout(a.rotation);a.rotation=setTimeout(function(){var k=c.selected;a.select(++k<a.anchors.length?k:0)},b);j&&j.stopPropagation()});e=a._unrotate||(a._unrotate=!e?function(j){j.clientX&& +a.rotate(null)}:function(){t=c.selected;h()});if(b){this.element.bind("tabsshow",h);this.anchors.bind(c.event+".tabs",e);h()}else{clearTimeout(a.rotation);this.element.unbind("tabsshow",h);this.anchors.unbind(c.event+".tabs",e);delete this._rotate;delete this._unrotate}return this}})})(jQuery); +;/* + * jQuery UI Datepicker 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Datepicker + * + * Depends: + * jquery.ui.core.js + */ +(function(d,G){function K(){this.debug=false;this._curInst=null;this._keyEvent=false;this._disabledInputs=[];this._inDialog=this._datepickerShowing=false;this._mainDivId="ui-datepicker-div";this._inlineClass="ui-datepicker-inline";this._appendClass="ui-datepicker-append";this._triggerClass="ui-datepicker-trigger";this._dialogClass="ui-datepicker-dialog";this._disableClass="ui-datepicker-disabled";this._unselectableClass="ui-datepicker-unselectable";this._currentClass="ui-datepicker-current-day";this._dayOverClass= +"ui-datepicker-days-cell-over";this.regional=[];this.regional[""]={closeText:"Done",prevText:"Prev",nextText:"Next",currentText:"Today",monthNames:["January","February","March","April","May","June","July","August","September","October","November","December"],monthNamesShort:["Jan","Feb","Mar","Apr","May","Jun","Jul","Aug","Sep","Oct","Nov","Dec"],dayNames:["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"],dayNamesShort:["Sun","Mon","Tue","Wed","Thu","Fri","Sat"],dayNamesMin:["Su", +"Mo","Tu","We","Th","Fr","Sa"],weekHeader:"Wk",dateFormat:"mm/dd/yy",firstDay:0,isRTL:false,showMonthAfterYear:false,yearSuffix:""};this._defaults={showOn:"focus",showAnim:"fadeIn",showOptions:{},defaultDate:null,appendText:"",buttonText:"...",buttonImage:"",buttonImageOnly:false,hideIfNoPrevNext:false,navigationAsDateFormat:false,gotoCurrent:false,changeMonth:false,changeYear:false,yearRange:"c-10:c+10",showOtherMonths:false,selectOtherMonths:false,showWeek:false,calculateWeek:this.iso8601Week,shortYearCutoff:"+10", +minDate:null,maxDate:null,duration:"fast",beforeShowDay:null,beforeShow:null,onSelect:null,onChangeMonthYear:null,onClose:null,numberOfMonths:1,showCurrentAtPos:0,stepMonths:1,stepBigMonths:12,altField:"",altFormat:"",constrainInput:true,showButtonPanel:false,autoSize:false};d.extend(this._defaults,this.regional[""]);this.dpDiv=d('<div id="'+this._mainDivId+'" class="ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}function E(a,b){d.extend(a,b);for(var c in b)if(b[c]== +null||b[c]==G)a[c]=b[c];return a}d.extend(d.ui,{datepicker:{version:"1.8.10"}});var y=(new Date).getTime();d.extend(K.prototype,{markerClassName:"hasDatepicker",log:function(){this.debug&&console.log.apply("",arguments)},_widgetDatepicker:function(){return this.dpDiv},setDefaults:function(a){E(this._defaults,a||{});return this},_attachDatepicker:function(a,b){var c=null;for(var e in this._defaults){var f=a.getAttribute("date:"+e);if(f){c=c||{};try{c[e]=eval(f)}catch(h){c[e]=f}}}e=a.nodeName.toLowerCase(); +f=e=="div"||e=="span";if(!a.id){this.uuid+=1;a.id="dp"+this.uuid}var i=this._newInst(d(a),f);i.settings=d.extend({},b||{},c||{});if(e=="input")this._connectDatepicker(a,i);else f&&this._inlineDatepicker(a,i)},_newInst:function(a,b){return{id:a[0].id.replace(/([^A-Za-z0-9_-])/g,"\\\\$1"),input:a,selectedDay:0,selectedMonth:0,selectedYear:0,drawMonth:0,drawYear:0,inline:b,dpDiv:!b?this.dpDiv:d('<div class="'+this._inlineClass+' ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all"></div>')}}, +_connectDatepicker:function(a,b){var c=d(a);b.append=d([]);b.trigger=d([]);if(!c.hasClass(this.markerClassName)){this._attachments(c,b);c.addClass(this.markerClassName).keydown(this._doKeyDown).keypress(this._doKeyPress).keyup(this._doKeyUp).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});this._autoSize(b);d.data(a,"datepicker",b)}},_attachments:function(a,b){var c=this._get(b,"appendText"),e=this._get(b,"isRTL");b.append&& +b.append.remove();if(c){b.append=d('<span class="'+this._appendClass+'">'+c+"</span>");a[e?"before":"after"](b.append)}a.unbind("focus",this._showDatepicker);b.trigger&&b.trigger.remove();c=this._get(b,"showOn");if(c=="focus"||c=="both")a.focus(this._showDatepicker);if(c=="button"||c=="both"){c=this._get(b,"buttonText");var f=this._get(b,"buttonImage");b.trigger=d(this._get(b,"buttonImageOnly")?d("<img/>").addClass(this._triggerClass).attr({src:f,alt:c,title:c}):d('<button type="button"></button>').addClass(this._triggerClass).html(f== +""?c:d("<img/>").attr({src:f,alt:c,title:c})));a[e?"before":"after"](b.trigger);b.trigger.click(function(){d.datepicker._datepickerShowing&&d.datepicker._lastInput==a[0]?d.datepicker._hideDatepicker():d.datepicker._showDatepicker(a[0]);return false})}},_autoSize:function(a){if(this._get(a,"autoSize")&&!a.inline){var b=new Date(2009,11,20),c=this._get(a,"dateFormat");if(c.match(/[DM]/)){var e=function(f){for(var h=0,i=0,g=0;g<f.length;g++)if(f[g].length>h){h=f[g].length;i=g}return i};b.setMonth(e(this._get(a, +c.match(/MM/)?"monthNames":"monthNamesShort")));b.setDate(e(this._get(a,c.match(/DD/)?"dayNames":"dayNamesShort"))+20-b.getDay())}a.input.attr("size",this._formatDate(a,b).length)}},_inlineDatepicker:function(a,b){var c=d(a);if(!c.hasClass(this.markerClassName)){c.addClass(this.markerClassName).append(b.dpDiv).bind("setData.datepicker",function(e,f,h){b.settings[f]=h}).bind("getData.datepicker",function(e,f){return this._get(b,f)});d.data(a,"datepicker",b);this._setDate(b,this._getDefaultDate(b), +true);this._updateDatepicker(b);this._updateAlternate(b);b.dpDiv.show()}},_dialogDatepicker:function(a,b,c,e,f){a=this._dialogInst;if(!a){this.uuid+=1;this._dialogInput=d('<input type="text" id="'+("dp"+this.uuid)+'" style="position: absolute; top: -100px; width: 0px; z-index: -10;"/>');this._dialogInput.keydown(this._doKeyDown);d("body").append(this._dialogInput);a=this._dialogInst=this._newInst(this._dialogInput,false);a.settings={};d.data(this._dialogInput[0],"datepicker",a)}E(a.settings,e||{}); +b=b&&b.constructor==Date?this._formatDate(a,b):b;this._dialogInput.val(b);this._pos=f?f.length?f:[f.pageX,f.pageY]:null;if(!this._pos)this._pos=[document.documentElement.clientWidth/2-100+(document.documentElement.scrollLeft||document.body.scrollLeft),document.documentElement.clientHeight/2-150+(document.documentElement.scrollTop||document.body.scrollTop)];this._dialogInput.css("left",this._pos[0]+20+"px").css("top",this._pos[1]+"px");a.settings.onSelect=c;this._inDialog=true;this.dpDiv.addClass(this._dialogClass); +this._showDatepicker(this._dialogInput[0]);d.blockUI&&d.blockUI(this.dpDiv);d.data(this._dialogInput[0],"datepicker",a);return this},_destroyDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();d.removeData(a,"datepicker");if(e=="input"){c.append.remove();c.trigger.remove();b.removeClass(this.markerClassName).unbind("focus",this._showDatepicker).unbind("keydown",this._doKeyDown).unbind("keypress",this._doKeyPress).unbind("keyup", +this._doKeyUp)}else if(e=="div"||e=="span")b.removeClass(this.markerClassName).empty()}},_enableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=false;c.trigger.filter("button").each(function(){this.disabled=false}).end().filter("img").css({opacity:"1.0",cursor:""})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().removeClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs, +function(f){return f==a?null:f})}},_disableDatepicker:function(a){var b=d(a),c=d.data(a,"datepicker");if(b.hasClass(this.markerClassName)){var e=a.nodeName.toLowerCase();if(e=="input"){a.disabled=true;c.trigger.filter("button").each(function(){this.disabled=true}).end().filter("img").css({opacity:"0.5",cursor:"default"})}else if(e=="div"||e=="span")b.children("."+this._inlineClass).children().addClass("ui-state-disabled");this._disabledInputs=d.map(this._disabledInputs,function(f){return f==a?null: +f});this._disabledInputs[this._disabledInputs.length]=a}},_isDisabledDatepicker:function(a){if(!a)return false;for(var b=0;b<this._disabledInputs.length;b++)if(this._disabledInputs[b]==a)return true;return false},_getInst:function(a){try{return d.data(a,"datepicker")}catch(b){throw"Missing instance data for this datepicker";}},_optionDatepicker:function(a,b,c){var e=this._getInst(a);if(arguments.length==2&&typeof b=="string")return b=="defaults"?d.extend({},d.datepicker._defaults):e?b=="all"?d.extend({}, +e.settings):this._get(e,b):null;var f=b||{};if(typeof b=="string"){f={};f[b]=c}if(e){this._curInst==e&&this._hideDatepicker();var h=this._getDateDatepicker(a,true);E(e.settings,f);this._attachments(d(a),e);this._autoSize(e);this._setDateDatepicker(a,h);this._updateDatepicker(e)}},_changeDatepicker:function(a,b,c){this._optionDatepicker(a,b,c)},_refreshDatepicker:function(a){(a=this._getInst(a))&&this._updateDatepicker(a)},_setDateDatepicker:function(a,b){if(a=this._getInst(a)){this._setDate(a,b); +this._updateDatepicker(a);this._updateAlternate(a)}},_getDateDatepicker:function(a,b){(a=this._getInst(a))&&!a.inline&&this._setDateFromField(a,b);return a?this._getDate(a):null},_doKeyDown:function(a){var b=d.datepicker._getInst(a.target),c=true,e=b.dpDiv.is(".ui-datepicker-rtl");b._keyEvent=true;if(d.datepicker._datepickerShowing)switch(a.keyCode){case 9:d.datepicker._hideDatepicker();c=false;break;case 13:c=d("td."+d.datepicker._dayOverClass+":not(."+d.datepicker._currentClass+")",b.dpDiv);c[0]? +d.datepicker._selectDay(a.target,b.selectedMonth,b.selectedYear,c[0]):d.datepicker._hideDatepicker();return false;case 27:d.datepicker._hideDatepicker();break;case 33:d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 34:d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 35:if(a.ctrlKey||a.metaKey)d.datepicker._clearDate(a.target);c=a.ctrlKey|| +a.metaKey;break;case 36:if(a.ctrlKey||a.metaKey)d.datepicker._gotoToday(a.target);c=a.ctrlKey||a.metaKey;break;case 37:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,e?+1:-1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?-d.datepicker._get(b,"stepBigMonths"):-d.datepicker._get(b,"stepMonths"),"M");break;case 38:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,-7,"D");c=a.ctrlKey||a.metaKey;break;case 39:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target, +e?-1:+1,"D");c=a.ctrlKey||a.metaKey;if(a.originalEvent.altKey)d.datepicker._adjustDate(a.target,a.ctrlKey?+d.datepicker._get(b,"stepBigMonths"):+d.datepicker._get(b,"stepMonths"),"M");break;case 40:if(a.ctrlKey||a.metaKey)d.datepicker._adjustDate(a.target,+7,"D");c=a.ctrlKey||a.metaKey;break;default:c=false}else if(a.keyCode==36&&a.ctrlKey)d.datepicker._showDatepicker(this);else c=false;if(c){a.preventDefault();a.stopPropagation()}},_doKeyPress:function(a){var b=d.datepicker._getInst(a.target);if(d.datepicker._get(b, +"constrainInput")){b=d.datepicker._possibleChars(d.datepicker._get(b,"dateFormat"));var c=String.fromCharCode(a.charCode==G?a.keyCode:a.charCode);return a.ctrlKey||a.metaKey||c<" "||!b||b.indexOf(c)>-1}},_doKeyUp:function(a){a=d.datepicker._getInst(a.target);if(a.input.val()!=a.lastVal)try{if(d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),a.input?a.input.val():null,d.datepicker._getFormatConfig(a))){d.datepicker._setDateFromField(a);d.datepicker._updateAlternate(a);d.datepicker._updateDatepicker(a)}}catch(b){d.datepicker.log(b)}return true}, +_showDatepicker:function(a){a=a.target||a;if(a.nodeName.toLowerCase()!="input")a=d("input",a.parentNode)[0];if(!(d.datepicker._isDisabledDatepicker(a)||d.datepicker._lastInput==a)){var b=d.datepicker._getInst(a);d.datepicker._curInst&&d.datepicker._curInst!=b&&d.datepicker._curInst.dpDiv.stop(true,true);var c=d.datepicker._get(b,"beforeShow");E(b.settings,c?c.apply(a,[a,b]):{});b.lastVal=null;d.datepicker._lastInput=a;d.datepicker._setDateFromField(b);if(d.datepicker._inDialog)a.value="";if(!d.datepicker._pos){d.datepicker._pos= +d.datepicker._findPos(a);d.datepicker._pos[1]+=a.offsetHeight}var e=false;d(a).parents().each(function(){e|=d(this).css("position")=="fixed";return!e});if(e&&d.browser.opera){d.datepicker._pos[0]-=document.documentElement.scrollLeft;d.datepicker._pos[1]-=document.documentElement.scrollTop}c={left:d.datepicker._pos[0],top:d.datepicker._pos[1]};d.datepicker._pos=null;b.dpDiv.empty();b.dpDiv.css({position:"absolute",display:"block",top:"-1000px"});d.datepicker._updateDatepicker(b);c=d.datepicker._checkOffset(b, +c,e);b.dpDiv.css({position:d.datepicker._inDialog&&d.blockUI?"static":e?"fixed":"absolute",display:"none",left:c.left+"px",top:c.top+"px"});if(!b.inline){c=d.datepicker._get(b,"showAnim");var f=d.datepicker._get(b,"duration"),h=function(){d.datepicker._datepickerShowing=true;var i=b.dpDiv.find("iframe.ui-datepicker-cover");if(i.length){var g=d.datepicker._getBorders(b.dpDiv);i.css({left:-g[0],top:-g[1],width:b.dpDiv.outerWidth(),height:b.dpDiv.outerHeight()})}};b.dpDiv.zIndex(d(a).zIndex()+1);d.effects&& +d.effects[c]?b.dpDiv.show(c,d.datepicker._get(b,"showOptions"),f,h):b.dpDiv[c||"show"](c?f:null,h);if(!c||!f)h();b.input.is(":visible")&&!b.input.is(":disabled")&&b.input.focus();d.datepicker._curInst=b}}},_updateDatepicker:function(a){var b=this,c=d.datepicker._getBorders(a.dpDiv);a.dpDiv.empty().append(this._generateHTML(a));var e=a.dpDiv.find("iframe.ui-datepicker-cover");e.length&&e.css({left:-c[0],top:-c[1],width:a.dpDiv.outerWidth(),height:a.dpDiv.outerHeight()});a.dpDiv.find("button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a").bind("mouseout", +function(){d(this).removeClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!=-1&&d(this).removeClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).removeClass("ui-datepicker-next-hover")}).bind("mouseover",function(){if(!b._isDisabledDatepicker(a.inline?a.dpDiv.parent()[0]:a.input[0])){d(this).parents(".ui-datepicker-calendar").find("a").removeClass("ui-state-hover");d(this).addClass("ui-state-hover");this.className.indexOf("ui-datepicker-prev")!= +-1&&d(this).addClass("ui-datepicker-prev-hover");this.className.indexOf("ui-datepicker-next")!=-1&&d(this).addClass("ui-datepicker-next-hover")}}).end().find("."+this._dayOverClass+" a").trigger("mouseover").end();c=this._getNumberOfMonths(a);e=c[1];e>1?a.dpDiv.addClass("ui-datepicker-multi-"+e).css("width",17*e+"em"):a.dpDiv.removeClass("ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4").width("");a.dpDiv[(c[0]!=1||c[1]!=1?"add":"remove")+"Class"]("ui-datepicker-multi");a.dpDiv[(this._get(a, +"isRTL")?"add":"remove")+"Class"]("ui-datepicker-rtl");a==d.datepicker._curInst&&d.datepicker._datepickerShowing&&a.input&&a.input.is(":visible")&&!a.input.is(":disabled")&&a.input[0]!=document.activeElement&&a.input.focus();if(a.yearshtml){var f=a.yearshtml;setTimeout(function(){f===a.yearshtml&&a.dpDiv.find("select.ui-datepicker-year:first").replaceWith(a.yearshtml);f=a.yearshtml=null},0)}},_getBorders:function(a){var b=function(c){return{thin:1,medium:2,thick:3}[c]||c};return[parseFloat(b(a.css("border-left-width"))), +parseFloat(b(a.css("border-top-width")))]},_checkOffset:function(a,b,c){var e=a.dpDiv.outerWidth(),f=a.dpDiv.outerHeight(),h=a.input?a.input.outerWidth():0,i=a.input?a.input.outerHeight():0,g=document.documentElement.clientWidth+d(document).scrollLeft(),j=document.documentElement.clientHeight+d(document).scrollTop();b.left-=this._get(a,"isRTL")?e-h:0;b.left-=c&&b.left==a.input.offset().left?d(document).scrollLeft():0;b.top-=c&&b.top==a.input.offset().top+i?d(document).scrollTop():0;b.left-=Math.min(b.left, +b.left+e>g&&g>e?Math.abs(b.left+e-g):0);b.top-=Math.min(b.top,b.top+f>j&&j>f?Math.abs(f+i):0);return b},_findPos:function(a){for(var b=this._get(this._getInst(a),"isRTL");a&&(a.type=="hidden"||a.nodeType!=1||d.expr.filters.hidden(a));)a=a[b?"previousSibling":"nextSibling"];a=d(a).offset();return[a.left,a.top]},_hideDatepicker:function(a){var b=this._curInst;if(!(!b||a&&b!=d.data(a,"datepicker")))if(this._datepickerShowing){a=this._get(b,"showAnim");var c=this._get(b,"duration"),e=function(){d.datepicker._tidyDialog(b); +this._curInst=null};d.effects&&d.effects[a]?b.dpDiv.hide(a,d.datepicker._get(b,"showOptions"),c,e):b.dpDiv[a=="slideDown"?"slideUp":a=="fadeIn"?"fadeOut":"hide"](a?c:null,e);a||e();if(a=this._get(b,"onClose"))a.apply(b.input?b.input[0]:null,[b.input?b.input.val():"",b]);this._datepickerShowing=false;this._lastInput=null;if(this._inDialog){this._dialogInput.css({position:"absolute",left:"0",top:"-100px"});if(d.blockUI){d.unblockUI();d("body").append(this.dpDiv)}}this._inDialog=false}},_tidyDialog:function(a){a.dpDiv.removeClass(this._dialogClass).unbind(".ui-datepicker-calendar")}, +_checkExternalClick:function(a){if(d.datepicker._curInst){a=d(a.target);a[0].id!=d.datepicker._mainDivId&&a.parents("#"+d.datepicker._mainDivId).length==0&&!a.hasClass(d.datepicker.markerClassName)&&!a.hasClass(d.datepicker._triggerClass)&&d.datepicker._datepickerShowing&&!(d.datepicker._inDialog&&d.blockUI)&&d.datepicker._hideDatepicker()}},_adjustDate:function(a,b,c){a=d(a);var e=this._getInst(a[0]);if(!this._isDisabledDatepicker(a[0])){this._adjustInstDate(e,b+(c=="M"?this._get(e,"showCurrentAtPos"): +0),c);this._updateDatepicker(e)}},_gotoToday:function(a){a=d(a);var b=this._getInst(a[0]);if(this._get(b,"gotoCurrent")&&b.currentDay){b.selectedDay=b.currentDay;b.drawMonth=b.selectedMonth=b.currentMonth;b.drawYear=b.selectedYear=b.currentYear}else{var c=new Date;b.selectedDay=c.getDate();b.drawMonth=b.selectedMonth=c.getMonth();b.drawYear=b.selectedYear=c.getFullYear()}this._notifyChange(b);this._adjustDate(a)},_selectMonthYear:function(a,b,c){a=d(a);var e=this._getInst(a[0]);e._selectingMonthYear= +false;e["selected"+(c=="M"?"Month":"Year")]=e["draw"+(c=="M"?"Month":"Year")]=parseInt(b.options[b.selectedIndex].value,10);this._notifyChange(e);this._adjustDate(a)},_clickMonthYear:function(a){var b=this._getInst(d(a)[0]);b.input&&b._selectingMonthYear&&setTimeout(function(){b.input.focus()},0);b._selectingMonthYear=!b._selectingMonthYear},_selectDay:function(a,b,c,e){var f=d(a);if(!(d(e).hasClass(this._unselectableClass)||this._isDisabledDatepicker(f[0]))){f=this._getInst(f[0]);f.selectedDay=f.currentDay= +d("a",e).html();f.selectedMonth=f.currentMonth=b;f.selectedYear=f.currentYear=c;this._selectDate(a,this._formatDate(f,f.currentDay,f.currentMonth,f.currentYear))}},_clearDate:function(a){a=d(a);this._getInst(a[0]);this._selectDate(a,"")},_selectDate:function(a,b){a=this._getInst(d(a)[0]);b=b!=null?b:this._formatDate(a);a.input&&a.input.val(b);this._updateAlternate(a);var c=this._get(a,"onSelect");if(c)c.apply(a.input?a.input[0]:null,[b,a]);else a.input&&a.input.trigger("change");if(a.inline)this._updateDatepicker(a); +else{this._hideDatepicker();this._lastInput=a.input[0];typeof a.input[0]!="object"&&a.input.focus();this._lastInput=null}},_updateAlternate:function(a){var b=this._get(a,"altField");if(b){var c=this._get(a,"altFormat")||this._get(a,"dateFormat"),e=this._getDate(a),f=this.formatDate(c,e,this._getFormatConfig(a));d(b).each(function(){d(this).val(f)})}},noWeekends:function(a){a=a.getDay();return[a>0&&a<6,""]},iso8601Week:function(a){a=new Date(a.getTime());a.setDate(a.getDate()+4-(a.getDay()||7));var b= +a.getTime();a.setMonth(0);a.setDate(1);return Math.floor(Math.round((b-a)/864E5)/7)+1},parseDate:function(a,b,c){if(a==null||b==null)throw"Invalid arguments";b=typeof b=="object"?b.toString():b+"";if(b=="")return null;var e=(c?c.shortYearCutoff:null)||this._defaults.shortYearCutoff;e=typeof e!="string"?e:(new Date).getFullYear()%100+parseInt(e,10);for(var f=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,h=(c?c.dayNames:null)||this._defaults.dayNames,i=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort, +g=(c?c.monthNames:null)||this._defaults.monthNames,j=c=-1,l=-1,u=-1,k=false,o=function(p){(p=z+1<a.length&&a.charAt(z+1)==p)&&z++;return p},m=function(p){var v=o(p);p=new RegExp("^\\d{1,"+(p=="@"?14:p=="!"?20:p=="y"&&v?4:p=="o"?3:2)+"}");p=b.substring(s).match(p);if(!p)throw"Missing number at position "+s;s+=p[0].length;return parseInt(p[0],10)},n=function(p,v,H){p=o(p)?H:v;for(v=0;v<p.length;v++)if(b.substr(s,p[v].length).toLowerCase()==p[v].toLowerCase()){s+=p[v].length;return v+1}throw"Unknown name at position "+ +s;},r=function(){if(b.charAt(s)!=a.charAt(z))throw"Unexpected literal at position "+s;s++},s=0,z=0;z<a.length;z++)if(k)if(a.charAt(z)=="'"&&!o("'"))k=false;else r();else switch(a.charAt(z)){case "d":l=m("d");break;case "D":n("D",f,h);break;case "o":u=m("o");break;case "m":j=m("m");break;case "M":j=n("M",i,g);break;case "y":c=m("y");break;case "@":var w=new Date(m("@"));c=w.getFullYear();j=w.getMonth()+1;l=w.getDate();break;case "!":w=new Date((m("!")-this._ticksTo1970)/1E4);c=w.getFullYear();j=w.getMonth()+ +1;l=w.getDate();break;case "'":if(o("'"))r();else k=true;break;default:r()}if(c==-1)c=(new Date).getFullYear();else if(c<100)c+=(new Date).getFullYear()-(new Date).getFullYear()%100+(c<=e?0:-100);if(u>-1){j=1;l=u;do{e=this._getDaysInMonth(c,j-1);if(l<=e)break;j++;l-=e}while(1)}w=this._daylightSavingAdjust(new Date(c,j-1,l));if(w.getFullYear()!=c||w.getMonth()+1!=j||w.getDate()!=l)throw"Invalid date";return w},ATOM:"yy-mm-dd",COOKIE:"D, dd M yy",ISO_8601:"yy-mm-dd",RFC_822:"D, d M y",RFC_850:"DD, dd-M-y", +RFC_1036:"D, d M y",RFC_1123:"D, d M yy",RFC_2822:"D, d M yy",RSS:"D, d M y",TICKS:"!",TIMESTAMP:"@",W3C:"yy-mm-dd",_ticksTo1970:(718685+Math.floor(492.5)-Math.floor(19.7)+Math.floor(4.925))*24*60*60*1E7,formatDate:function(a,b,c){if(!b)return"";var e=(c?c.dayNamesShort:null)||this._defaults.dayNamesShort,f=(c?c.dayNames:null)||this._defaults.dayNames,h=(c?c.monthNamesShort:null)||this._defaults.monthNamesShort;c=(c?c.monthNames:null)||this._defaults.monthNames;var i=function(o){(o=k+1<a.length&& +a.charAt(k+1)==o)&&k++;return o},g=function(o,m,n){m=""+m;if(i(o))for(;m.length<n;)m="0"+m;return m},j=function(o,m,n,r){return i(o)?r[m]:n[m]},l="",u=false;if(b)for(var k=0;k<a.length;k++)if(u)if(a.charAt(k)=="'"&&!i("'"))u=false;else l+=a.charAt(k);else switch(a.charAt(k)){case "d":l+=g("d",b.getDate(),2);break;case "D":l+=j("D",b.getDay(),e,f);break;case "o":l+=g("o",(b.getTime()-(new Date(b.getFullYear(),0,0)).getTime())/864E5,3);break;case "m":l+=g("m",b.getMonth()+1,2);break;case "M":l+=j("M", +b.getMonth(),h,c);break;case "y":l+=i("y")?b.getFullYear():(b.getYear()%100<10?"0":"")+b.getYear()%100;break;case "@":l+=b.getTime();break;case "!":l+=b.getTime()*1E4+this._ticksTo1970;break;case "'":if(i("'"))l+="'";else u=true;break;default:l+=a.charAt(k)}return l},_possibleChars:function(a){for(var b="",c=false,e=function(h){(h=f+1<a.length&&a.charAt(f+1)==h)&&f++;return h},f=0;f<a.length;f++)if(c)if(a.charAt(f)=="'"&&!e("'"))c=false;else b+=a.charAt(f);else switch(a.charAt(f)){case "d":case "m":case "y":case "@":b+= +"0123456789";break;case "D":case "M":return null;case "'":if(e("'"))b+="'";else c=true;break;default:b+=a.charAt(f)}return b},_get:function(a,b){return a.settings[b]!==G?a.settings[b]:this._defaults[b]},_setDateFromField:function(a,b){if(a.input.val()!=a.lastVal){var c=this._get(a,"dateFormat"),e=a.lastVal=a.input?a.input.val():null,f,h;f=h=this._getDefaultDate(a);var i=this._getFormatConfig(a);try{f=this.parseDate(c,e,i)||h}catch(g){this.log(g);e=b?"":e}a.selectedDay=f.getDate();a.drawMonth=a.selectedMonth= +f.getMonth();a.drawYear=a.selectedYear=f.getFullYear();a.currentDay=e?f.getDate():0;a.currentMonth=e?f.getMonth():0;a.currentYear=e?f.getFullYear():0;this._adjustInstDate(a)}},_getDefaultDate:function(a){return this._restrictMinMax(a,this._determineDate(a,this._get(a,"defaultDate"),new Date))},_determineDate:function(a,b,c){var e=function(h){var i=new Date;i.setDate(i.getDate()+h);return i},f=function(h){try{return d.datepicker.parseDate(d.datepicker._get(a,"dateFormat"),h,d.datepicker._getFormatConfig(a))}catch(i){}var g= +(h.toLowerCase().match(/^c/)?d.datepicker._getDate(a):null)||new Date,j=g.getFullYear(),l=g.getMonth();g=g.getDate();for(var u=/([+-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,k=u.exec(h);k;){switch(k[2]||"d"){case "d":case "D":g+=parseInt(k[1],10);break;case "w":case "W":g+=parseInt(k[1],10)*7;break;case "m":case "M":l+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break;case "y":case "Y":j+=parseInt(k[1],10);g=Math.min(g,d.datepicker._getDaysInMonth(j,l));break}k=u.exec(h)}return new Date(j, +l,g)};if(b=(b=b==null||b===""?c:typeof b=="string"?f(b):typeof b=="number"?isNaN(b)?c:e(b):new Date(b.getTime()))&&b.toString()=="Invalid Date"?c:b){b.setHours(0);b.setMinutes(0);b.setSeconds(0);b.setMilliseconds(0)}return this._daylightSavingAdjust(b)},_daylightSavingAdjust:function(a){if(!a)return null;a.setHours(a.getHours()>12?a.getHours()+2:0);return a},_setDate:function(a,b,c){var e=!b,f=a.selectedMonth,h=a.selectedYear;b=this._restrictMinMax(a,this._determineDate(a,b,new Date));a.selectedDay= +a.currentDay=b.getDate();a.drawMonth=a.selectedMonth=a.currentMonth=b.getMonth();a.drawYear=a.selectedYear=a.currentYear=b.getFullYear();if((f!=a.selectedMonth||h!=a.selectedYear)&&!c)this._notifyChange(a);this._adjustInstDate(a);if(a.input)a.input.val(e?"":this._formatDate(a))},_getDate:function(a){return!a.currentYear||a.input&&a.input.val()==""?null:this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay))},_generateHTML:function(a){var b=new Date;b=this._daylightSavingAdjust(new Date(b.getFullYear(), +b.getMonth(),b.getDate()));var c=this._get(a,"isRTL"),e=this._get(a,"showButtonPanel"),f=this._get(a,"hideIfNoPrevNext"),h=this._get(a,"navigationAsDateFormat"),i=this._getNumberOfMonths(a),g=this._get(a,"showCurrentAtPos"),j=this._get(a,"stepMonths"),l=i[0]!=1||i[1]!=1,u=this._daylightSavingAdjust(!a.currentDay?new Date(9999,9,9):new Date(a.currentYear,a.currentMonth,a.currentDay)),k=this._getMinMaxDate(a,"min"),o=this._getMinMaxDate(a,"max");g=a.drawMonth-g;var m=a.drawYear;if(g<0){g+=12;m--}if(o){var n= +this._daylightSavingAdjust(new Date(o.getFullYear(),o.getMonth()-i[0]*i[1]+1,o.getDate()));for(n=k&&n<k?k:n;this._daylightSavingAdjust(new Date(m,g,1))>n;){g--;if(g<0){g=11;m--}}}a.drawMonth=g;a.drawYear=m;n=this._get(a,"prevText");n=!h?n:this.formatDate(n,this._daylightSavingAdjust(new Date(m,g-j,1)),this._getFormatConfig(a));n=this._canAdjustMonth(a,-1,m,g)?'<a class="ui-datepicker-prev ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', -"+j+", 'M');\" title=\""+n+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"e":"w")+'">'+n+"</span></a>":f?"":'<a class="ui-datepicker-prev ui-corner-all ui-state-disabled" title="'+n+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"e":"w")+'">'+n+"</span></a>";var r=this._get(a,"nextText");r=!h?r:this.formatDate(r,this._daylightSavingAdjust(new Date(m,g+j,1)),this._getFormatConfig(a));f=this._canAdjustMonth(a,+1,m,g)?'<a class="ui-datepicker-next ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._adjustDate('#"+a.id+"', +"+j+", 'M');\" title=\""+r+'"><span class="ui-icon ui-icon-circle-triangle-'+ +(c?"w":"e")+'">'+r+"</span></a>":f?"":'<a class="ui-datepicker-next ui-corner-all ui-state-disabled" title="'+r+'"><span class="ui-icon ui-icon-circle-triangle-'+(c?"w":"e")+'">'+r+"</span></a>";j=this._get(a,"currentText");r=this._get(a,"gotoCurrent")&&a.currentDay?u:b;j=!h?j:this.formatDate(j,r,this._getFormatConfig(a));h=!a.inline?'<button type="button" class="ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all" onclick="DP_jQuery_'+y+'.datepicker._hideDatepicker();">'+this._get(a, +"closeText")+"</button>":"";e=e?'<div class="ui-datepicker-buttonpane ui-widget-content">'+(c?h:"")+(this._isInRange(a,r)?'<button type="button" class="ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all" onclick="DP_jQuery_'+y+".datepicker._gotoToday('#"+a.id+"');\">"+j+"</button>":"")+(c?"":h)+"</div>":"";h=parseInt(this._get(a,"firstDay"),10);h=isNaN(h)?0:h;j=this._get(a,"showWeek");r=this._get(a,"dayNames");this._get(a,"dayNamesShort");var s=this._get(a,"dayNamesMin"),z= +this._get(a,"monthNames"),w=this._get(a,"monthNamesShort"),p=this._get(a,"beforeShowDay"),v=this._get(a,"showOtherMonths"),H=this._get(a,"selectOtherMonths");this._get(a,"calculateWeek");for(var L=this._getDefaultDate(a),I="",C=0;C<i[0];C++){for(var M="",D=0;D<i[1];D++){var N=this._daylightSavingAdjust(new Date(m,g,a.selectedDay)),t=" ui-corner-all",x="";if(l){x+='<div class="ui-datepicker-group';if(i[1]>1)switch(D){case 0:x+=" ui-datepicker-group-first";t=" ui-corner-"+(c?"right":"left");break;case i[1]- +1:x+=" ui-datepicker-group-last";t=" ui-corner-"+(c?"left":"right");break;default:x+=" ui-datepicker-group-middle";t="";break}x+='">'}x+='<div class="ui-datepicker-header ui-widget-header ui-helper-clearfix'+t+'">'+(/all|left/.test(t)&&C==0?c?f:n:"")+(/all|right/.test(t)&&C==0?c?n:f:"")+this._generateMonthYearHeader(a,g,m,k,o,C>0||D>0,z,w)+'</div><table class="ui-datepicker-calendar"><thead><tr>';var A=j?'<th class="ui-datepicker-week-col">'+this._get(a,"weekHeader")+"</th>":"";for(t=0;t<7;t++){var q= +(t+h)%7;A+="<th"+((t+h+6)%7>=5?' class="ui-datepicker-week-end"':"")+'><span title="'+r[q]+'">'+s[q]+"</span></th>"}x+=A+"</tr></thead><tbody>";A=this._getDaysInMonth(m,g);if(m==a.selectedYear&&g==a.selectedMonth)a.selectedDay=Math.min(a.selectedDay,A);t=(this._getFirstDayOfMonth(m,g)-h+7)%7;A=l?6:Math.ceil((t+A)/7);q=this._daylightSavingAdjust(new Date(m,g,1-t));for(var O=0;O<A;O++){x+="<tr>";var P=!j?"":'<td class="ui-datepicker-week-col">'+this._get(a,"calculateWeek")(q)+"</td>";for(t=0;t<7;t++){var F= +p?p.apply(a.input?a.input[0]:null,[q]):[true,""],B=q.getMonth()!=g,J=B&&!H||!F[0]||k&&q<k||o&&q>o;P+='<td class="'+((t+h+6)%7>=5?" ui-datepicker-week-end":"")+(B?" ui-datepicker-other-month":"")+(q.getTime()==N.getTime()&&g==a.selectedMonth&&a._keyEvent||L.getTime()==q.getTime()&&L.getTime()==N.getTime()?" "+this._dayOverClass:"")+(J?" "+this._unselectableClass+" ui-state-disabled":"")+(B&&!v?"":" "+F[1]+(q.getTime()==u.getTime()?" "+this._currentClass:"")+(q.getTime()==b.getTime()?" ui-datepicker-today": +""))+'"'+((!B||v)&&F[2]?' title="'+F[2]+'"':"")+(J?"":' onclick="DP_jQuery_'+y+".datepicker._selectDay('#"+a.id+"',"+q.getMonth()+","+q.getFullYear()+', this);return false;"')+">"+(B&&!v?" ":J?'<span class="ui-state-default">'+q.getDate()+"</span>":'<a class="ui-state-default'+(q.getTime()==b.getTime()?" ui-state-highlight":"")+(q.getTime()==u.getTime()?" ui-state-active":"")+(B?" ui-priority-secondary":"")+'" href="#">'+q.getDate()+"</a>")+"</td>";q.setDate(q.getDate()+1);q=this._daylightSavingAdjust(q)}x+= +P+"</tr>"}g++;if(g>11){g=0;m++}x+="</tbody></table>"+(l?"</div>"+(i[0]>0&&D==i[1]-1?'<div class="ui-datepicker-row-break"></div>':""):"");M+=x}I+=M}I+=e+(d.browser.msie&&parseInt(d.browser.version,10)<7&&!a.inline?'<iframe src="javascript:false;" class="ui-datepicker-cover" frameborder="0"></iframe>':"");a._keyEvent=false;return I},_generateMonthYearHeader:function(a,b,c,e,f,h,i,g){var j=this._get(a,"changeMonth"),l=this._get(a,"changeYear"),u=this._get(a,"showMonthAfterYear"),k='<div class="ui-datepicker-title">', +o="";if(h||!j)o+='<span class="ui-datepicker-month">'+i[b]+"</span>";else{i=e&&e.getFullYear()==c;var m=f&&f.getFullYear()==c;o+='<select class="ui-datepicker-month" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+a.id+"', this, 'M');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";for(var n=0;n<12;n++)if((!i||n>=e.getMonth())&&(!m||n<=f.getMonth()))o+='<option value="'+n+'"'+(n==b?' selected="selected"':"")+">"+g[n]+"</option>";o+="</select>"}u||(k+=o+(h||!(j&& +l)?" ":""));a.yearshtml="";if(h||!l)k+='<span class="ui-datepicker-year">'+c+"</span>";else{g=this._get(a,"yearRange").split(":");var r=(new Date).getFullYear();i=function(s){s=s.match(/c[+-].*/)?c+parseInt(s.substring(1),10):s.match(/[+-].*/)?r+parseInt(s,10):parseInt(s,10);return isNaN(s)?r:s};b=i(g[0]);g=Math.max(b,i(g[1]||""));b=e?Math.max(b,e.getFullYear()):b;g=f?Math.min(g,f.getFullYear()):g;for(a.yearshtml+='<select class="ui-datepicker-year" onchange="DP_jQuery_'+y+".datepicker._selectMonthYear('#"+ +a.id+"', this, 'Y');\" onclick=\"DP_jQuery_"+y+".datepicker._clickMonthYear('#"+a.id+"');\">";b<=g;b++)a.yearshtml+='<option value="'+b+'"'+(b==c?' selected="selected"':"")+">"+b+"</option>";a.yearshtml+="</select>";if(d.browser.mozilla)k+='<select class="ui-datepicker-year"><option value="'+c+'" selected="selected">'+c+"</option></select>";else{k+=a.yearshtml;a.yearshtml=null}}k+=this._get(a,"yearSuffix");if(u)k+=(h||!(j&&l)?" ":"")+o;k+="</div>";return k},_adjustInstDate:function(a,b,c){var e= +a.drawYear+(c=="Y"?b:0),f=a.drawMonth+(c=="M"?b:0);b=Math.min(a.selectedDay,this._getDaysInMonth(e,f))+(c=="D"?b:0);e=this._restrictMinMax(a,this._daylightSavingAdjust(new Date(e,f,b)));a.selectedDay=e.getDate();a.drawMonth=a.selectedMonth=e.getMonth();a.drawYear=a.selectedYear=e.getFullYear();if(c=="M"||c=="Y")this._notifyChange(a)},_restrictMinMax:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");b=c&&b<c?c:b;return b=a&&b>a?a:b},_notifyChange:function(a){var b=this._get(a, +"onChangeMonthYear");if(b)b.apply(a.input?a.input[0]:null,[a.selectedYear,a.selectedMonth+1,a])},_getNumberOfMonths:function(a){a=this._get(a,"numberOfMonths");return a==null?[1,1]:typeof a=="number"?[1,a]:a},_getMinMaxDate:function(a,b){return this._determineDate(a,this._get(a,b+"Date"),null)},_getDaysInMonth:function(a,b){return 32-this._daylightSavingAdjust(new Date(a,b,32)).getDate()},_getFirstDayOfMonth:function(a,b){return(new Date(a,b,1)).getDay()},_canAdjustMonth:function(a,b,c,e){var f=this._getNumberOfMonths(a); +c=this._daylightSavingAdjust(new Date(c,e+(b<0?b:f[0]*f[1]),1));b<0&&c.setDate(this._getDaysInMonth(c.getFullYear(),c.getMonth()));return this._isInRange(a,c)},_isInRange:function(a,b){var c=this._getMinMaxDate(a,"min");a=this._getMinMaxDate(a,"max");return(!c||b.getTime()>=c.getTime())&&(!a||b.getTime()<=a.getTime())},_getFormatConfig:function(a){var b=this._get(a,"shortYearCutoff");b=typeof b!="string"?b:(new Date).getFullYear()%100+parseInt(b,10);return{shortYearCutoff:b,dayNamesShort:this._get(a, +"dayNamesShort"),dayNames:this._get(a,"dayNames"),monthNamesShort:this._get(a,"monthNamesShort"),monthNames:this._get(a,"monthNames")}},_formatDate:function(a,b,c,e){if(!b){a.currentDay=a.selectedDay;a.currentMonth=a.selectedMonth;a.currentYear=a.selectedYear}b=b?typeof b=="object"?b:this._daylightSavingAdjust(new Date(e,c,b)):this._daylightSavingAdjust(new Date(a.currentYear,a.currentMonth,a.currentDay));return this.formatDate(this._get(a,"dateFormat"),b,this._getFormatConfig(a))}});d.fn.datepicker= +function(a){if(!this.length)return this;if(!d.datepicker.initialized){d(document).mousedown(d.datepicker._checkExternalClick).find("body").append(d.datepicker.dpDiv);d.datepicker.initialized=true}var b=Array.prototype.slice.call(arguments,1);if(typeof a=="string"&&(a=="isDisabled"||a=="getDate"||a=="widget"))return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this[0]].concat(b));if(a=="option"&&arguments.length==2&&typeof arguments[1]=="string")return d.datepicker["_"+a+"Datepicker"].apply(d.datepicker, +[this[0]].concat(b));return this.each(function(){typeof a=="string"?d.datepicker["_"+a+"Datepicker"].apply(d.datepicker,[this].concat(b)):d.datepicker._attachDatepicker(this,a)})};d.datepicker=new K;d.datepicker.initialized=false;d.datepicker.uuid=(new Date).getTime();d.datepicker.version="1.8.10";window["DP_jQuery_"+y]=d})(jQuery); +;/* + * jQuery UI Progressbar 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Progressbar + * + * Depends: + * jquery.ui.core.js + * jquery.ui.widget.js + */ +(function(b,d){b.widget("ui.progressbar",{options:{value:0,max:100},min:0,_create:function(){this.element.addClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").attr({role:"progressbar","aria-valuemin":this.min,"aria-valuemax":this.options.max,"aria-valuenow":this._value()});this.valueDiv=b("<div class='ui-progressbar-value ui-widget-header ui-corner-left'></div>").appendTo(this.element);this.oldValue=this._value();this._refreshValue()},destroy:function(){this.element.removeClass("ui-progressbar ui-widget ui-widget-content ui-corner-all").removeAttr("role").removeAttr("aria-valuemin").removeAttr("aria-valuemax").removeAttr("aria-valuenow"); +this.valueDiv.remove();b.Widget.prototype.destroy.apply(this,arguments)},value:function(a){if(a===d)return this._value();this._setOption("value",a);return this},_setOption:function(a,c){if(a==="value"){this.options.value=c;this._refreshValue();this._value()===this.options.max&&this._trigger("complete")}b.Widget.prototype._setOption.apply(this,arguments)},_value:function(){var a=this.options.value;if(typeof a!=="number")a=0;return Math.min(this.options.max,Math.max(this.min,a))},_percentage:function(){return 100* +this._value()/this.options.max},_refreshValue:function(){var a=this.value(),c=this._percentage();if(this.oldValue!==a){this.oldValue=a;this._trigger("change")}this.valueDiv.toggleClass("ui-corner-right",a===this.options.max).width(c.toFixed(0)+"%");this.element.attr("aria-valuenow",a)}});b.extend(b.ui.progressbar,{version:"1.8.10"})})(jQuery); +;/* + * jQuery UI Effects 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/ + */ +jQuery.effects||function(f,j){function n(c){var a;if(c&&c.constructor==Array&&c.length==3)return c;if(a=/rgb\(\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*,\s*([0-9]{1,3})\s*\)/.exec(c))return[parseInt(a[1],10),parseInt(a[2],10),parseInt(a[3],10)];if(a=/rgb\(\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*,\s*([0-9]+(?:\.[0-9]+)?)\%\s*\)/.exec(c))return[parseFloat(a[1])*2.55,parseFloat(a[2])*2.55,parseFloat(a[3])*2.55];if(a=/#([a-fA-F0-9]{2})([a-fA-F0-9]{2})([a-fA-F0-9]{2})/.exec(c))return[parseInt(a[1], +16),parseInt(a[2],16),parseInt(a[3],16)];if(a=/#([a-fA-F0-9])([a-fA-F0-9])([a-fA-F0-9])/.exec(c))return[parseInt(a[1]+a[1],16),parseInt(a[2]+a[2],16),parseInt(a[3]+a[3],16)];if(/rgba\(0, 0, 0, 0\)/.exec(c))return o.transparent;return o[f.trim(c).toLowerCase()]}function s(c,a){var b;do{b=f.curCSS(c,a);if(b!=""&&b!="transparent"||f.nodeName(c,"body"))break;a="backgroundColor"}while(c=c.parentNode);return n(b)}function p(){var c=document.defaultView?document.defaultView.getComputedStyle(this,null):this.currentStyle, +a={},b,d;if(c&&c.length&&c[0]&&c[c[0]])for(var e=c.length;e--;){b=c[e];if(typeof c[b]=="string"){d=b.replace(/\-(\w)/g,function(g,h){return h.toUpperCase()});a[d]=c[b]}}else for(b in c)if(typeof c[b]==="string")a[b]=c[b];return a}function q(c){var a,b;for(a in c){b=c[a];if(b==null||f.isFunction(b)||a in t||/scrollbar/.test(a)||!/color/i.test(a)&&isNaN(parseFloat(b)))delete c[a]}return c}function u(c,a){var b={_:0},d;for(d in a)if(c[d]!=a[d])b[d]=a[d];return b}function k(c,a,b,d){if(typeof c=="object"){d= +a;b=null;a=c;c=a.effect}if(f.isFunction(a)){d=a;b=null;a={}}if(typeof a=="number"||f.fx.speeds[a]){d=b;b=a;a={}}if(f.isFunction(b)){d=b;b=null}a=a||{};b=b||a.duration;b=f.fx.off?0:typeof b=="number"?b:b in f.fx.speeds?f.fx.speeds[b]:f.fx.speeds._default;d=d||a.complete;return[c,a,b,d]}function m(c){if(!c||typeof c==="number"||f.fx.speeds[c])return true;if(typeof c==="string"&&!f.effects[c])return true;return false}f.effects={};f.each(["backgroundColor","borderBottomColor","borderLeftColor","borderRightColor", +"borderTopColor","borderColor","color","outlineColor"],function(c,a){f.fx.step[a]=function(b){if(!b.colorInit){b.start=s(b.elem,a);b.end=n(b.end);b.colorInit=true}b.elem.style[a]="rgb("+Math.max(Math.min(parseInt(b.pos*(b.end[0]-b.start[0])+b.start[0],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[1]-b.start[1])+b.start[1],10),255),0)+","+Math.max(Math.min(parseInt(b.pos*(b.end[2]-b.start[2])+b.start[2],10),255),0)+")"}});var o={aqua:[0,255,255],azure:[240,255,255],beige:[245,245,220],black:[0, +0,0],blue:[0,0,255],brown:[165,42,42],cyan:[0,255,255],darkblue:[0,0,139],darkcyan:[0,139,139],darkgrey:[169,169,169],darkgreen:[0,100,0],darkkhaki:[189,183,107],darkmagenta:[139,0,139],darkolivegreen:[85,107,47],darkorange:[255,140,0],darkorchid:[153,50,204],darkred:[139,0,0],darksalmon:[233,150,122],darkviolet:[148,0,211],fuchsia:[255,0,255],gold:[255,215,0],green:[0,128,0],indigo:[75,0,130],khaki:[240,230,140],lightblue:[173,216,230],lightcyan:[224,255,255],lightgreen:[144,238,144],lightgrey:[211, +211,211],lightpink:[255,182,193],lightyellow:[255,255,224],lime:[0,255,0],magenta:[255,0,255],maroon:[128,0,0],navy:[0,0,128],olive:[128,128,0],orange:[255,165,0],pink:[255,192,203],purple:[128,0,128],violet:[128,0,128],red:[255,0,0],silver:[192,192,192],white:[255,255,255],yellow:[255,255,0],transparent:[255,255,255]},r=["add","remove","toggle"],t={border:1,borderBottom:1,borderColor:1,borderLeft:1,borderRight:1,borderTop:1,borderWidth:1,margin:1,padding:1};f.effects.animateClass=function(c,a,b, +d){if(f.isFunction(b)){d=b;b=null}return this.queue("fx",function(){var e=f(this),g=e.attr("style")||" ",h=q(p.call(this)),l,v=e.attr("className");f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});l=q(p.call(this));e.attr("className",v);e.animate(u(h,l),a,b,function(){f.each(r,function(w,i){c[i]&&e[i+"Class"](c[i])});if(typeof e.attr("style")=="object"){e.attr("style").cssText="";e.attr("style").cssText=g}else e.attr("style",g);d&&d.apply(this,arguments)});h=f.queue(this);l=h.splice(h.length-1,1)[0]; +h.splice(1,0,l);f.dequeue(this)})};f.fn.extend({_addClass:f.fn.addClass,addClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{add:c},a,b,d]):this._addClass(c)},_removeClass:f.fn.removeClass,removeClass:function(c,a,b,d){return a?f.effects.animateClass.apply(this,[{remove:c},a,b,d]):this._removeClass(c)},_toggleClass:f.fn.toggleClass,toggleClass:function(c,a,b,d,e){return typeof a=="boolean"||a===j?b?f.effects.animateClass.apply(this,[a?{add:c}:{remove:c},b,d,e]):this._toggleClass(c, +a):f.effects.animateClass.apply(this,[{toggle:c},a,b,d])},switchClass:function(c,a,b,d,e){return f.effects.animateClass.apply(this,[{add:a,remove:c},b,d,e])}});f.extend(f.effects,{version:"1.8.10",save:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.data("ec.storage."+a[b],c[0].style[a[b]])},restore:function(c,a){for(var b=0;b<a.length;b++)a[b]!==null&&c.css(a[b],c.data("ec.storage."+a[b]))},setMode:function(c,a){if(a=="toggle")a=c.is(":hidden")?"show":"hide";return a},getBaseline:function(c, +a){var b;switch(c[0]){case "top":b=0;break;case "middle":b=0.5;break;case "bottom":b=1;break;default:b=c[0]/a.height}switch(c[1]){case "left":c=0;break;case "center":c=0.5;break;case "right":c=1;break;default:c=c[1]/a.width}return{x:c,y:b}},createWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent();var a={width:c.outerWidth(true),height:c.outerHeight(true),"float":c.css("float")},b=f("<div></div>").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent", +border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c); +return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments); +else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c), +b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c, +a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c, +a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a== +e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c= +g/(2*Math.PI)*Math.asin(d/h);return-(h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g))+b},easeOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/h);return h*Math.pow(2,-10*a)*Math.sin((a*e-c)*2*Math.PI/g)+d+b},easeInOutElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e/2)==2)return b+d;g||(g=e*0.3*1.5);if(h<Math.abs(d)){h=d;c=g/4}else c=g/(2*Math.PI)*Math.asin(d/ +h);if(a<1)return-0.5*h*Math.pow(2,10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)+b;return h*Math.pow(2,-10*(a-=1))*Math.sin((a*e-c)*2*Math.PI/g)*0.5+d+b},easeInBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*(a/=e)*a*((g+1)*a-g)+b},easeOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;return d*((a=a/e-1)*a*((g+1)*a+g)+1)+b},easeInOutBack:function(c,a,b,d,e,g){if(g==j)g=1.70158;if((a/=e/2)<1)return d/2*a*a*(((g*=1.525)+1)*a-g)+b;return d/2*((a-=2)*a*(((g*=1.525)+1)*a+g)+2)+b},easeInBounce:function(c, +a,b,d,e){return d-f.easing.easeOutBounce(c,e-a,0,d,e)+b},easeOutBounce:function(c,a,b,d,e){return(a/=e)<1/2.75?d*7.5625*a*a+b:a<2/2.75?d*(7.5625*(a-=1.5/2.75)*a+0.75)+b:a<2.5/2.75?d*(7.5625*(a-=2.25/2.75)*a+0.9375)+b:d*(7.5625*(a-=2.625/2.75)*a+0.984375)+b},easeInOutBounce:function(c,a,b,d,e){if(a<e/2)return f.easing.easeInBounce(c,a*2,0,d,e)*0.5+b;return f.easing.easeOutBounce(c,a*2-e,0,d,e)*0.5+d*0.5+b}})}(jQuery); +;/* + * jQuery UI Effects Blind 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Blind + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.blind=function(c){return this.queue(function(){var a=b(this),g=["position","top","bottom","left","right"],f=b.effects.setMode(a,c.options.mode||"hide"),d=c.options.direction||"vertical";b.effects.save(a,g);a.show();var e=b.effects.createWrapper(a).css({overflow:"hidden"}),h=d=="vertical"?"height":"width";d=d=="vertical"?e.height():e.width();f=="show"&&e.css(h,0);var i={};i[h]=f=="show"?d:0;e.animate(i,c.duration,c.options.easing,function(){f=="hide"&&a.hide();b.effects.restore(a, +g);b.effects.removeWrapper(a);c.callback&&c.callback.apply(a[0],arguments);a.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Bounce 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Bounce + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.bounce=function(b){return this.queue(function(){var a=e(this),l=["position","top","bottom","left","right"],h=e.effects.setMode(a,b.options.mode||"effect"),d=b.options.direction||"up",c=b.options.distance||20,m=b.options.times||5,i=b.duration||250;/show|hide/.test(h)&&l.push("opacity");e.effects.save(a,l);a.show();e.effects.createWrapper(a);var f=d=="up"||d=="down"?"top":"left";d=d=="up"||d=="left"?"pos":"neg";c=b.options.distance||(f=="top"?a.outerHeight({margin:true})/3:a.outerWidth({margin:true})/ +3);if(h=="show")a.css("opacity",0).css(f,d=="pos"?-c:c);if(h=="hide")c/=m*2;h!="hide"&&m--;if(h=="show"){var g={opacity:1};g[f]=(d=="pos"?"+=":"-=")+c;a.animate(g,i/2,b.options.easing);c/=2;m--}for(g=0;g<m;g++){var j={},k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing);c=h=="hide"?c*2:c/2}if(h=="hide"){g={opacity:0};g[f]=(d=="pos"?"-=":"+=")+c;a.animate(g,i/2,b.options.easing,function(){a.hide();e.effects.restore(a,l);e.effects.removeWrapper(a); +b.callback&&b.callback.apply(this,arguments)})}else{j={};k={};j[f]=(d=="pos"?"-=":"+=")+c;k[f]=(d=="pos"?"+=":"-=")+c;a.animate(j,i/2,b.options.easing).animate(k,i/2,b.options.easing,function(){e.effects.restore(a,l);e.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments)})}a.queue("fx",function(){a.dequeue()});a.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Clip 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Clip + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.clip=function(e){return this.queue(function(){var a=b(this),i=["position","top","bottom","left","right","height","width"],f=b.effects.setMode(a,e.options.mode||"hide"),c=e.options.direction||"vertical";b.effects.save(a,i);a.show();var d=b.effects.createWrapper(a).css({overflow:"hidden"});d=a[0].tagName=="IMG"?d:a;var g={size:c=="vertical"?"height":"width",position:c=="vertical"?"top":"left"};c=c=="vertical"?d.height():d.width();if(f=="show"){d.css(g.size,0);d.css(g.position, +c/2)}var h={};h[g.size]=f=="show"?c:0;h[g.position]=f=="show"?0:c/2;d.animate(h,{queue:false,duration:e.duration,easing:e.options.easing,complete:function(){f=="hide"&&a.hide();b.effects.restore(a,i);b.effects.removeWrapper(a);e.callback&&e.callback.apply(a[0],arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Drop 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Drop + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.drop=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right","opacity"],e=c.effects.setMode(a,d.options.mode||"hide"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a);var f=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var g=d.options.distance||(f=="top"?a.outerHeight({margin:true})/2:a.outerWidth({margin:true})/2);if(e=="show")a.css("opacity",0).css(f,b=="pos"?-g:g);var i={opacity:e== +"show"?1:0};i[f]=(e=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+g;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){e=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Explode 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Explode + * + * Depends: + * jquery.effects.core.js + */ +(function(j){j.effects.explode=function(a){return this.queue(function(){var c=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3,d=a.options.pieces?Math.round(Math.sqrt(a.options.pieces)):3;a.options.mode=a.options.mode=="toggle"?j(this).is(":visible")?"hide":"show":a.options.mode;var b=j(this).show().css("visibility","hidden"),g=b.offset();g.top-=parseInt(b.css("marginTop"),10)||0;g.left-=parseInt(b.css("marginLeft"),10)||0;for(var h=b.outerWidth(true),i=b.outerHeight(true),e=0;e<c;e++)for(var f= +0;f<d;f++)b.clone().appendTo("body").wrap("<div></div>").css({position:"absolute",visibility:"visible",left:-f*(h/d),top:-e*(i/c)}).parent().addClass("ui-effects-explode").css({position:"absolute",overflow:"hidden",width:h/d,height:i/c,left:g.left+f*(h/d)+(a.options.mode=="show"?(f-Math.floor(d/2))*(h/d):0),top:g.top+e*(i/c)+(a.options.mode=="show"?(e-Math.floor(c/2))*(i/c):0),opacity:a.options.mode=="show"?0:1}).animate({left:g.left+f*(h/d)+(a.options.mode=="show"?0:(f-Math.floor(d/2))*(h/d)),top:g.top+ +e*(i/c)+(a.options.mode=="show"?0:(e-Math.floor(c/2))*(i/c)),opacity:a.options.mode=="show"?1:0},a.duration||500);setTimeout(function(){a.options.mode=="show"?b.css({visibility:"visible"}):b.css({visibility:"visible"}).hide();a.callback&&a.callback.apply(b[0]);b.dequeue();j("div.ui-effects-explode").remove()},a.duration||500)})}})(jQuery); +;/* + * jQuery UI Effects Fade 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fade + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.fade=function(a){return this.queue(function(){var c=b(this),d=b.effects.setMode(c,a.options.mode||"hide");c.animate({opacity:d},{queue:false,duration:a.duration,easing:a.options.easing,complete:function(){a.callback&&a.callback.apply(this,arguments);c.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Fold 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Fold + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.fold=function(a){return this.queue(function(){var b=c(this),j=["position","top","bottom","left","right"],d=c.effects.setMode(b,a.options.mode||"hide"),g=a.options.size||15,h=!!a.options.horizFirst,k=a.duration?a.duration/2:c.fx.speeds._default/2;c.effects.save(b,j);b.show();var e=c.effects.createWrapper(b).css({overflow:"hidden"}),f=d=="show"!=h,l=f?["width","height"]:["height","width"];f=f?[e.width(),e.height()]:[e.height(),e.width()];var i=/([0-9]+)%/.exec(g);if(i)g=parseInt(i[1], +10)/100*f[d=="hide"?0:1];if(d=="show")e.css(h?{height:0,width:g}:{height:g,width:0});h={};i={};h[l[0]]=d=="show"?f[0]:g;i[l[1]]=d=="show"?f[1]:0;e.animate(h,k,a.options.easing).animate(i,k,a.options.easing,function(){d=="hide"&&b.hide();c.effects.restore(b,j);c.effects.removeWrapper(b);a.callback&&a.callback.apply(b[0],arguments);b.dequeue()})})}})(jQuery); +;/* + * jQuery UI Effects Highlight 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Highlight + * + * Depends: + * jquery.effects.core.js + */ +(function(b){b.effects.highlight=function(c){return this.queue(function(){var a=b(this),e=["backgroundImage","backgroundColor","opacity"],d=b.effects.setMode(a,c.options.mode||"show"),f={backgroundColor:a.css("backgroundColor")};if(d=="hide")f.opacity=0;b.effects.save(a,e);a.show().css({backgroundImage:"none",backgroundColor:c.options.color||"#ffff99"}).animate(f,{queue:false,duration:c.duration,easing:c.options.easing,complete:function(){d=="hide"&&a.hide();b.effects.restore(a,e);d=="show"&&!b.support.opacity&& +this.style.removeAttribute("filter");c.callback&&c.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Pulsate 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Pulsate + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.pulsate=function(a){return this.queue(function(){var b=d(this),c=d.effects.setMode(b,a.options.mode||"show");times=(a.options.times||5)*2-1;duration=a.duration?a.duration/2:d.fx.speeds._default/2;isVisible=b.is(":visible");animateTo=0;if(!isVisible){b.css("opacity",0).show();animateTo=1}if(c=="hide"&&isVisible||c=="show"&&!isVisible)times--;for(c=0;c<times;c++){b.animate({opacity:animateTo},duration,a.options.easing);animateTo=(animateTo+1)%2}b.animate({opacity:animateTo},duration, +a.options.easing,function(){animateTo==0&&b.hide();a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()}).dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Scale 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Scale + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.puff=function(b){return this.queue(function(){var a=c(this),e=c.effects.setMode(a,b.options.mode||"hide"),g=parseInt(b.options.percent,10)||150,h=g/100,i={height:a.height(),width:a.width()};c.extend(b.options,{fade:true,mode:e,percent:e=="hide"?g:100,from:e=="hide"?i:{height:i.height*h,width:i.width*h}});a.effect("scale",b.options,b.duration,b.callback);a.dequeue()})};c.effects.scale=function(b){return this.queue(function(){var a=c(this),e=c.extend(true,{},b.options),g=c.effects.setMode(a, +b.options.mode||"effect"),h=parseInt(b.options.percent,10)||(parseInt(b.options.percent,10)==0?0:g=="hide"?0:100),i=b.options.direction||"both",f=b.options.origin;if(g!="effect"){e.origin=f||["middle","center"];e.restore=true}f={height:a.height(),width:a.width()};a.from=b.options.from||(g=="show"?{height:0,width:0}:f);h={y:i!="horizontal"?h/100:1,x:i!="vertical"?h/100:1};a.to={height:f.height*h.y,width:f.width*h.x};if(b.options.fade){if(g=="show"){a.from.opacity=0;a.to.opacity=1}if(g=="hide"){a.from.opacity= +1;a.to.opacity=0}}e.from=a.from;e.to=a.to;e.mode=g;a.effect("size",e,b.duration,b.callback);a.dequeue()})};c.effects.size=function(b){return this.queue(function(){var a=c(this),e=["position","top","bottom","left","right","width","height","overflow","opacity"],g=["position","top","bottom","left","right","overflow","opacity"],h=["width","height","overflow"],i=["fontSize"],f=["borderTopWidth","borderBottomWidth","paddingTop","paddingBottom"],k=["borderLeftWidth","borderRightWidth","paddingLeft","paddingRight"], +p=c.effects.setMode(a,b.options.mode||"effect"),n=b.options.restore||false,m=b.options.scale||"both",l=b.options.origin,j={height:a.height(),width:a.width()};a.from=b.options.from||j;a.to=b.options.to||j;if(l){l=c.effects.getBaseline(l,j);a.from.top=(j.height-a.from.height)*l.y;a.from.left=(j.width-a.from.width)*l.x;a.to.top=(j.height-a.to.height)*l.y;a.to.left=(j.width-a.to.width)*l.x}var d={from:{y:a.from.height/j.height,x:a.from.width/j.width},to:{y:a.to.height/j.height,x:a.to.width/j.width}}; +if(m=="box"||m=="both"){if(d.from.y!=d.to.y){e=e.concat(f);a.from=c.effects.setTransition(a,f,d.from.y,a.from);a.to=c.effects.setTransition(a,f,d.to.y,a.to)}if(d.from.x!=d.to.x){e=e.concat(k);a.from=c.effects.setTransition(a,k,d.from.x,a.from);a.to=c.effects.setTransition(a,k,d.to.x,a.to)}}if(m=="content"||m=="both")if(d.from.y!=d.to.y){e=e.concat(i);a.from=c.effects.setTransition(a,i,d.from.y,a.from);a.to=c.effects.setTransition(a,i,d.to.y,a.to)}c.effects.save(a,n?e:g);a.show();c.effects.createWrapper(a); +a.css("overflow","hidden").css(a.from);if(m=="content"||m=="both"){f=f.concat(["marginTop","marginBottom"]).concat(i);k=k.concat(["marginLeft","marginRight"]);h=e.concat(f).concat(k);a.find("*[width]").each(function(){child=c(this);n&&c.effects.save(child,h);var o={height:child.height(),width:child.width()};child.from={height:o.height*d.from.y,width:o.width*d.from.x};child.to={height:o.height*d.to.y,width:o.width*d.to.x};if(d.from.y!=d.to.y){child.from=c.effects.setTransition(child,f,d.from.y,child.from); +child.to=c.effects.setTransition(child,f,d.to.y,child.to)}if(d.from.x!=d.to.x){child.from=c.effects.setTransition(child,k,d.from.x,child.from);child.to=c.effects.setTransition(child,k,d.to.x,child.to)}child.css(child.from);child.animate(child.to,b.duration,b.options.easing,function(){n&&c.effects.restore(child,h)})})}a.animate(a.to,{queue:false,duration:b.duration,easing:b.options.easing,complete:function(){a.to.opacity===0&&a.css("opacity",a.from.opacity);p=="hide"&&a.hide();c.effects.restore(a, +n?e:g);c.effects.removeWrapper(a);b.callback&&b.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Shake 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Shake + * + * Depends: + * jquery.effects.core.js + */ +(function(d){d.effects.shake=function(a){return this.queue(function(){var b=d(this),j=["position","top","bottom","left","right"];d.effects.setMode(b,a.options.mode||"effect");var c=a.options.direction||"left",e=a.options.distance||20,l=a.options.times||3,f=a.duration||a.options.duration||140;d.effects.save(b,j);b.show();d.effects.createWrapper(b);var g=c=="up"||c=="down"?"top":"left",h=c=="up"||c=="left"?"pos":"neg";c={};var i={},k={};c[g]=(h=="pos"?"-=":"+=")+e;i[g]=(h=="pos"?"+=":"-=")+e*2;k[g]= +(h=="pos"?"-=":"+=")+e*2;b.animate(c,f,a.options.easing);for(e=1;e<l;e++)b.animate(i,f,a.options.easing).animate(k,f,a.options.easing);b.animate(i,f,a.options.easing).animate(c,f/2,a.options.easing,function(){d.effects.restore(b,j);d.effects.removeWrapper(b);a.callback&&a.callback.apply(this,arguments)});b.queue("fx",function(){b.dequeue()});b.dequeue()})}})(jQuery); +;/* + * jQuery UI Effects Slide 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Slide + * + * Depends: + * jquery.effects.core.js + */ +(function(c){c.effects.slide=function(d){return this.queue(function(){var a=c(this),h=["position","top","bottom","left","right"],f=c.effects.setMode(a,d.options.mode||"show"),b=d.options.direction||"left";c.effects.save(a,h);a.show();c.effects.createWrapper(a).css({overflow:"hidden"});var g=b=="up"||b=="down"?"top":"left";b=b=="up"||b=="left"?"pos":"neg";var e=d.options.distance||(g=="top"?a.outerHeight({margin:true}):a.outerWidth({margin:true}));if(f=="show")a.css(g,b=="pos"?isNaN(e)?"-"+e:-e:e); +var i={};i[g]=(f=="show"?b=="pos"?"+=":"-=":b=="pos"?"-=":"+=")+e;a.animate(i,{queue:false,duration:d.duration,easing:d.options.easing,complete:function(){f=="hide"&&a.hide();c.effects.restore(a,h);c.effects.removeWrapper(a);d.callback&&d.callback.apply(this,arguments);a.dequeue()}})})}})(jQuery); +;/* + * jQuery UI Effects Transfer 1.8.10 + * + * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about) + * Dual licensed under the MIT or GPL Version 2 licenses. + * http://jquery.org/license + * + * http://docs.jquery.com/UI/Effects/Transfer + * + * Depends: + * jquery.effects.core.js + */ +(function(e){e.effects.transfer=function(a){return this.queue(function(){var b=e(this),c=e(a.options.to),d=c.offset();c={top:d.top,left:d.left,height:c.innerHeight(),width:c.innerWidth()};d=b.offset();var f=e('<div class="ui-effects-transfer"></div>').appendTo(document.body).addClass(a.options.className).css({top:d.top,left:d.left,height:b.innerHeight(),width:b.innerWidth(),position:"absolute"}).animate(c,a.duration,a.options.easing,function(){f.remove();a.callback&&a.callback.apply(b[0],arguments); +b.dequeue()})})}})(jQuery); +;
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.inline.min.css b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.inline.min.css new file mode 100644 index 000000000..9f194f6a6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.inline.min.css @@ -0,0 +1 @@ +.mce-object{border:1px dotted #3A3A3A;background:#d5d5d5 url(img/object.gif) no-repeat center}.mce-pagebreak{cursor:default;display:block;border:0;width:100%;height:5px;border:1px dashed #666;margin-top:15px;page-break-before:always}@media print{.mce-pagebreak{border:0px}}.mce-item-anchor{cursor:default;display:inline-block;-webkit-user-select:all;-webkit-user-modify:read-only;-moz-user-select:all;-moz-user-modify:read-only;user-select:all;user-modify:read-only;width:9px !important;height:9px !important;border:1px dotted #3A3A3A;background:#d5d5d5 url(img/anchor.gif) no-repeat center}.mce-nbsp{background:#AAA}hr{cursor:default}.mce-match-marker{background:#AAA;color:#fff}.mce-match-marker-selected{background:#3399ff;color:#fff}.mce-spellchecker-word{border-bottom:2px solid #F00;cursor:default}.mce-spellchecker-grammar{border-bottom:2px solid #008000;cursor:default}.mce-item-table,.mce-item-table td,.mce-item-table th,.mce-item-table caption{border:1px dashed #BBB}td.mce-item-selected,th.mce-item-selected{background-color:#3399ff !important}.mce-edit-focus{outline:1px dotted #333}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.min.css b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.min.css new file mode 100644 index 000000000..ea08c6896 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/content.min.css @@ -0,0 +1 @@ +body{background-color:#FFFFFF;color:#000000;font-family:Verdana,Arial,Helvetica,sans-serif;font-size:11px;scrollbar-3dlight-color:#F0F0EE;scrollbar-arrow-color:#676662;scrollbar-base-color:#F0F0EE;scrollbar-darkshadow-color:#DDDDDD;scrollbar-face-color:#E0E0DD;scrollbar-highlight-color:#F0F0EE;scrollbar-shadow-color:#F0F0EE;scrollbar-track-color:#F5F5F5}td,th{font-family:Verdana,Arial,Helvetica,sans-serif;font-size:11px}.mce-object{border:1px dotted #3A3A3A;background:#d5d5d5 url(img/object.gif) no-repeat center}.mce-pagebreak{cursor:default;display:block;border:0;width:100%;height:5px;border:1px dashed #666;margin-top:15px;page-break-before:always}@media print{.mce-pagebreak{border:0px}}.mce-item-anchor{cursor:default;display:inline-block;-webkit-user-select:all;-webkit-user-modify:read-only;-moz-user-select:all;-moz-user-modify:read-only;user-select:all;user-modify:read-only;width:9px !important;height:9px !important;border:1px dotted #3A3A3A;background:#d5d5d5 url(img/anchor.gif) no-repeat center}.mce-nbsp{background:#AAA}hr{cursor:default}.mce-match-marker{background:#AAA;color:#fff}.mce-match-marker-selected{background:#3399ff;color:#fff}.mce-spellchecker-word{border-bottom:2px solid #F00;cursor:default}.mce-spellchecker-grammar{border-bottom:2px solid #008000;cursor:default}.mce-item-table,.mce-item-table td,.mce-item-table th,.mce-item-table caption{border:1px dashed #BBB}td.mce-item-selected,th.mce-item-selected{background-color:#3399ff !important}.mce-edit-focus{outline:1px dotted #333}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/readme.md b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/readme.md new file mode 100644 index 000000000..fa5d63946 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/readme.md @@ -0,0 +1 @@ +Icons are generated and provided by the http://icomoon.io service. diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.dev.svg b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.dev.svg new file mode 100644 index 000000000..578b86954 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.dev.svg @@ -0,0 +1,175 @@ +<?xml version="1.0" standalone="no"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > +<svg xmlns="http://www.w3.org/2000/svg"> +<metadata> +This is a custom SVG font generated by IcoMoon. +<iconset grid="16"></iconset> +</metadata> +<defs> +<font id="tinymce-small" horiz-adv-x="512" > +<font-face units-per-em="512" ascent="480" descent="-32" /> +<missing-glyph horiz-adv-x="512" /> +<glyph class="hidden" unicode="" d="M0,480L 512 -32L0 -32 z" horiz-adv-x="0" /> +<glyph unicode="" d="M 352,64l0,18.502 c 75.674,30.814, 128,96.91, 128,173.498c0,106.039-100.288,192-224,192S 32,362.039, 32,256 + c0-76.588, 52.327-142.684, 128-173.498L 160,64 L 64,64 l-32,48l0-112 l 160,0 L 192,111.406 c-50.45,25.681-85.333,80.77-85.333,144.594 + c0,88.366, 66.859,160, 149.333,160c 82.474,0, 149.333-71.634, 149.333-160c0-63.824-34.883-118.913-85.333-144.594L 320,0 l 160,0 L 480,112 l-32-48 + L 352,64 z" /> +<glyph unicode="" d="M 128,448l0-448 l 128,128l 128-128L 384,448 L 128,448 z M 352,85.255l-96,96l-96-96L 160,416 l 192,0 L 352,85.255 z" /> +<glyph unicode="" d="M 463.637,364.892l-66.745,66.744C 386.34,442.188, 372.276,448, 357.293,448s-29.047-5.812-39.598-16.363l-82.746-82.745 + c-21.834-21.834-21.834-57.362,0-79.196l 1.373-1.373l 33.941,33.941l-1.373,1.373c-3.066,3.066-3.066,8.247,0,11.313l 82.746,82.746 + C 353.641,399.7, 356.040,400, 357.292,400s 3.651-0.299, 5.656-2.305l 66.745-66.744c 3.066-3.067, 3.066-8.249, 0.001-11.314l-82.747-82.747 + c-2.004-2.004-4.403-2.304-5.655-2.304s-3.651,0.3-5.656,2.306l-1.373,1.373l-33.94-33.942l 1.371-1.371 + c 10.553-10.554, 24.615-16.364, 39.6-16.364s 29.047,5.812, 39.598,16.363l 82.747,82.746C 485.47,307.53, 485.47,343.057, 463.637,364.892 + zM 275.678,179.678l-33.941-33.941l 1.373-1.373c 2.004-2.004, 2.305-4.403, 2.305-5.655c0-1.253-0.299-3.651-2.303-5.657 + l-82.747-82.745c-2.005-2.005-4.405-2.305-5.657-2.305s-3.652,0.3-5.657,2.305L 82.305,117.050C 80.3,119.055, 80,121.455, 80,122.707 + s 0.299,3.65, 2.305,5.656l 82.745,82.744c 2.005,2.006, 4.405,2.306, 5.657,2.306s 3.652-0.3, 5.657-2.306l 1.373-1.371l 33.941,33.94 + l-1.373,1.373c-10.552,10.552-24.615,16.363-39.598,16.363s-29.046-5.812-39.598-16.363l-82.744-82.743 + C 37.812,151.754, 32,137.689, 32,122.707s 5.812-29.047, 16.363-39.599l 66.745-66.745C 125.661,5.812, 139.724,0, 154.707,0 + s 29.046,5.812, 39.598,16.363l 82.747,82.746c 10.552,10.552, 16.361,24.615, 16.361,39.598s-5.812,29.047-16.363,39.598 + L 275.678,179.678zM 400,61c-4.862,0-9.725,1.854-13.435,5.565l-64,63.999c-7.422,7.42-7.422,19.449,0,26.869 + c 7.42,7.422, 19.448,7.422, 26.868,0l 64-64c 7.422-7.42, 7.422-19.448,0-26.868C 409.725,62.854, 404.862,61, 400,61zM 304,0c-8.837,0-16,7.163-16,16l0,64 c0,8.837, 7.163,16, 16,16s 16-7.163, 16-16l0-64 C 320,7.163, 312.837,0, 304,0zM 464,160l-64,0 c-8.837,0-16,7.163-16,16s 7.163,16, 16,16l 64,0 c 8.837,0, 16-7.163, 16-16S 472.837,160, 464,160zM 112,387c 4.862,0, 9.725-1.854, 13.435-5.565l 64-64c 7.421-7.42, 7.421-19.449,0-26.869c-7.42-7.422-19.449-7.422-26.869,0 + l-64,64c-7.421,7.42-7.421,19.449,0,26.869C 102.275,385.146, 107.138,387, 112,387zM 208,448c 8.837,0, 16-7.163, 16-16l0-64 c0-8.837-7.163-16-16-16s-16,7.163-16,16L 192,432 C 192,440.837, 199.163,448, 208,448zM 48,288l 64,0 c 8.837,0, 16-7.163, 16-16s-7.163-16-16-16L 48,256 c-8.837,0-16,7.163-16,16S 39.163,288, 48,288z" /> +<glyph unicode="" d="M 463.637,364.892l-66.745,66.744C 386.34,442.188, 372.276,448, 357.293,448s-29.047-5.812-39.598-16.363l-82.746-82.745 + c-21.834-21.834-21.834-57.362,0-79.196l 1.373-1.373l 33.941,33.941l-1.373,1.373c-3.066,3.066-3.066,8.247,0,11.313l 82.746,82.746 + C 353.641,399.7, 356.040,400, 357.292,400s 3.651-0.299, 5.656-2.305l 66.745-66.744c 3.066-3.067, 3.066-8.249, 0.001-11.314l-82.747-82.747 + c-2.004-2.004-4.403-2.304-5.655-2.304s-3.651,0.3-5.656,2.306l-1.373,1.373l-33.94-33.942l 1.371-1.371 + c 10.553-10.554, 24.615-16.364, 39.6-16.364s 29.047,5.812, 39.598,16.363l 82.747,82.746C 485.47,307.53, 485.47,343.057, 463.637,364.892 + zM 275.678,179.678l-33.941-33.941l 1.373-1.373c 2.004-2.004, 2.305-4.403, 2.305-5.655c0-1.253-0.299-3.651-2.303-5.657 + l-82.747-82.745c-2.005-2.005-4.405-2.305-5.657-2.305s-3.652,0.3-5.657,2.305L 82.305,117.050C 80.3,119.055, 80,121.455, 80,122.707 + s 0.299,3.65, 2.305,5.656l 82.745,82.744c 2.005,2.006, 4.405,2.306, 5.657,2.306s 3.652-0.3, 5.657-2.306l 1.373-1.371l 33.941,33.94 + l-1.373,1.373c-10.552,10.552-24.615,16.363-39.598,16.363s-29.046-5.812-39.598-16.363l-82.744-82.743 + C 37.812,151.754, 32,137.689, 32,122.707s 5.812-29.047, 16.363-39.599l 66.745-66.745C 125.661,5.812, 139.724,0, 154.707,0 + s 29.046,5.812, 39.598,16.363l 82.747,82.746c 10.552,10.552, 16.361,24.615, 16.361,39.598s-5.812,29.047-16.363,39.598 + L 275.678,179.678zM 176,125c-4.862,0-9.725,1.855-13.435,5.564c-7.42,7.42-7.42,19.449,0,26.869l 160,160c 7.42,7.42, 19.448,7.42, 26.868,0 + c 7.422-7.42, 7.422-19.45,0-26.87l-160-160C 185.725,126.855, 180.862,125, 176,125z" /> +<glyph unicode="" d="M 288,339.337L 288,448 l 168.001-168L 288,112L 288,223.048 C 92.547,227.633, 130.5,99.5, 160,0C 16,160, 53.954,345.437, 288,339.337z" /> +<glyph unicode="" d="M 352,0c 29.5,99.5, 67.453,227.633-128,223.048L 224,112 L 55.999,280L 224,448l0-108.663 C 458.046,345.437, 496,160, 352,0z" /> +<glyph unicode="" d="M 128.214,267.637c 52.9,0, 95.786-45.585, 95.786-101.819C 224,109.586, 181.114,64, 128.214,64 + c-52.901,0-95.786,45.585-95.786,101.818L 32,180.364C 32,292.829, 117.77,384, 223.572,384l0-58.182 c-36.55,0-70.913-15.13-96.758-42.602 + c-4.977-5.289-9.517-10.917-13.612-16.828C 118.094,267.208, 123.105,267.637, 128.214,267.637zM 384.214,267.637c 52.9,0, 95.786-45.585, 95.786-101.819C 480,109.586, 437.114,64, 384.214,64 + c-52.901,0-95.786,45.585-95.786,101.818L 288,180.364C 288,292.829, 373.77,384, 479.572,384l0-58.182 c-36.55,0-70.913-15.13-96.758-42.602 + c-4.978-5.289-9.518-10.917-13.612-16.828C 374.094,267.208, 379.105,267.637, 384.214,267.637z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 192,192L 480,192L 480,128L 192,128zM 192,288L 480,288L 480,224L 192,224zM 32,96L 480,96L 480,32L 32,32zM 32,288L 144,208L 32,128 z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 32,192L 320,192L 320,128L 32,128zM 32,288L 320,288L 320,224L 32,224zM 32,96L 480,96L 480,32L 32,32zM 480,288L 368,208L 480,128 z" /> +<glyph unicode="" d="M 192,416L 480,416L 480,352L 192,352zM 192,256L 480,256L 480,192L 192,192zM 192,96L 480,96L 480,32L 192,32zM 160,215L 160,288L 128,288L 128,448L 64,448L 64,416L 96,416L 96,288L 64,288L 64,256L 128,256L 128,231L 64,201L 64,128L 128,128L 128,96L 64,96L 64,64L 128,64L 128,32L 64,32L 64,0L 160,0L 160,160L 96,160L 96,185 z" /> +<glyph unicode="" d="M 192,416L 480,416L 480,352L 192,352zM 192,256L 480,256L 480,192L 192,192zM 192,96L 480,96L 480,32L 192,32zM 64,384A32,32 2700 1 1 128,384A32,32 2700 1 1 64,384zM 64,224A32,32 2700 1 1 128,224A32,32 2700 1 1 64,224zM 64,64A32,32 2700 1 1 128,64A32,32 2700 1 1 64,64z" /> +<glyph unicode="" d="M 444,288l-28,0 L 416,416 l 32,0 L 448,448 L 288,448 l0-32 l 32,0 l0-128 L 192,288 L 192,416 l 32,0 L 224,448 L 64,448 l0-32 l 32,0 l0-128 L 68,288 c-19.8,0-36-16.2-36-36l0-216 c0-19.8, 16.2-36, 36-36l 120,0 + c 19.8,0, 36,16.2, 36,36L 224,192 l 64,0 l0-156 c0-19.8, 16.2-36, 36-36l 120,0 c 19.8,0, 36,16.2, 36,36L 480,252 C 480,271.8, 463.8,288, 444,288z M 174,32L 82,32 + c-9.9,0-18,7.2-18,16s 8.1,16, 18,16l 92,0 c 9.9,0, 18-7.2, 18-16S 183.9,32, 174,32z M 272,224l-32,0 c-8.8,0-16,7.2-16,16s 7.2,16, 16,16l 32,0 + c 8.8,0, 16-7.2, 16-16S 280.8,224, 272,224z M 430,32l-92,0 c-9.9,0-18,7.2-18,16s 8.1,16, 18,16l 92,0 c 9.9,0, 18-7.2, 18-16S 439.9,32, 430,32z" /> +<glyph unicode="" d="M 352,288l0,80 c0,8.8-7.2,16-16,16l-80,0 L 256,416 c0,17.6-14.4,32-32,32l-64,0 c-17.602,0-32-14.4-32-32l0-32 L 48,384 c-8.801,0-16-7.2-16-16l0-256 + c0-8.8, 7.199-16, 16-16l 112,0 l0-96 l 192,0 l 96,96L 448,288 L 352,288 z M 160,415.943c 0.017,0.019, 0.036,0.039, 0.057,0.057l 63.884,0 + c 0.021-0.018, 0.041-0.038, 0.059-0.057L 224,384 l-64,0 L 160,415.943 L 160,415.943z M 96,320l0,32 l 192,0 l0-32 L 96,320 z M 352,45.255L 352,96 l 50.745,0 L 352,45.255z + M 416,128l-96,0 l0-96 L 192,32 L 192,256 l 224,0 L 416,128 z" /> +<glyph unicode="" d="M 416,320l-96,0 l0,32 l-96,96L 32,448 l0-352 l 192,0 l0-96 l 288,0 L 512,224 L 416,320z M 416,274.745L 466.745,224L 416,224 L 416,274.745 z M 224,402.745L 274.745,352 + L 224,352 L 224,402.745 z M 64,416l 128,0 l0-96 l 96,0 l0-192 L 64,128 L 64,416 z M 480,32L 256,32 l0,64 l 64,0 L 320,288 l 64,0 l0-96 l 96,0 L 480,32 z" /> +<glyph unicode="" d="M 432.204,144.934c-23.235,23.235-53.469,34.002-80.541,31.403L 320,208l 96,96c0,0, 64,64,0,128L 256,272L 96,432 + c-64-64,0-128,0-128l 96-96l-31.663-31.663c-27.072,2.599-57.305-8.169-80.54-31.403c-37.49-37.49-42.556-93.209-11.313-124.45 + c 31.241-31.241, 86.96-26.177, 124.45,11.313c 23.235,23.234, 34.001,53.469, 31.403,80.54L 256,144l 31.664-31.664 + c-2.598-27.072, 8.168-57.305, 31.403-80.539c 37.489-37.49, 93.209-42.556, 124.449-11.313 + C 474.76,51.725, 469.694,107.443, 432.204,144.934z M 176.562,100.711c-1.106-12.166-7.51-24.913-17.57-34.973 + C 147.886,54.631, 133.452,48, 120.383,48c-5.262,0-12.649,1.114-17.958,6.424c-10.703,10.702-8.688,36.566, 11.313,56.568 + c 11.106,11.107, 25.54,17.738, 38.609,17.738c 5.262,0, 12.649-1.114, 17.958-6.424C 176.861,115.751, 177.040,105.962, 176.562,100.711z + M 256,176c-17.673,0-32,14.327-32,32s 14.327,32, 32,32s 32-14.327, 32-32S 273.673,176, 256,176z M 409.576,54.424 + c-5.31-5.31-12.696-6.424-17.958-6.424c-13.069,0-27.503,6.631-38.609,17.738c-10.061,10.060-16.464,22.807-17.569,34.973 + c-0.479,5.251-0.3,15.040, 6.257,21.596c 5.309,5.311, 12.695,6.424, 17.958,6.424c 13.068,0, 27.503-6.631, 38.608-17.737 + C 418.265,90.99, 420.279,65.126, 409.576,54.424z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 32,192L 480,192L 480,128L 32,128zM 32,288L 480,288L 480,224L 32,224zM 32,96L 480,96L 480,32L 32,32z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 32,192L 480,192L 480,128L 32,128zM 128,288L 384,288L 384,224L 128,224zM 128,96L 384,96L 384,32L 128,32z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 32,192L 480,192L 480,128L 32,128zM 192,288L 480,288L 480,224L 192,224zM 192,96L 480,96L 480,32L 192,32z" /> +<glyph unicode="" d="M 32,384L 480,384L 480,320L 32,320zM 32,192L 480,192L 480,128L 32,128zM 32,288L 320,288L 320,224L 32,224zM 32,96L 320,96L 320,32L 32,32z" /> +<glyph unicode="" d="M 480,224l-4.571,0 L 347.062,224 c-25.039,17.71-57.215,27.43-91.062,27.43c-44.603,0-82.286,25.121-82.286,54.856 + c0,29.735, 37.683,54.857, 82.286,54.857c 37.529,0, 70.154-17.788, 79.56-41.143l 56.508,0 c-3.965,25.322-18.79,48.984-42.029,66.413 + C 324.599,405.493, 291.201,416, 256,416c-35.202,0-68.598-10.507-94.037-29.587c-27.394-20.545-43.106-49.751-43.106-80.127 + s 15.712-59.582, 43.106-80.127c 0.978-0.733, 1.971-1.449, 2.973-2.158L 36.571,224.001 L 32,224.001 l0-32 l 256.266,0 c 29.104-8.553, 50.021-28.135, 50.021-50.286 + c0-29.734-37.684-54.855-82.286-54.855c-37.53,0-70.154,17.787-79.559,41.143l-56.508,0 c 3.965-25.32, 18.791-48.984, 42.030-66.413 + C 187.402,42.508, 220.798,32, 256,32c 35.201,0, 68.599,10.508, 94.037,29.587c 27.395,20.545, 43.104,49.751, 43.104,80.127 + c0,17.649-5.327,34.896-15.147,50.286L 480,192 L 480,224 z" /> +<glyph unicode="" d="M 96,64l 288,0 l0-32 L 96,32 L 96,64 zM 320,416l0-192 c0-15.656-7.35-30.812-20.695-42.676C 283.834,167.573, 262.771,160, 240,160c-22.772,0-43.834,7.573-59.304,21.324 + C 167.35,193.188, 160,208.344, 160,224L 160,416 L 96,416 l0-192 c0-70.691, 64.471-128, 144-128c 79.529,0, 144,57.309, 144,128L 384,416 L 320,416 z" /> +<glyph unicode="" d="M 416,416l0-32 l-72,0 L 216,64l 72,0 l0-32 L 64,32 l0,32 l 72,0 L 264,384l-72,0 L 192,416 L 416,416 z" /> +<glyph unicode="" d="M 312.721,232.909C 336.758,251.984, 352,280.337, 352,312c0,57.438-50.145,104-112,104L 128,416 l0-384 l 144,0 + c 61.856,0, 112,46.562, 112,104C 384,180.098, 354.441,217.781, 312.721,232.909z M 192,328c0,13.255, 10.745,24, 24,24l 33.602,0 + C 270.809,352, 288,330.51, 288,304s-17.191-48-38.398-48L 192,256 L 192,328 z M 273.6,96L 216,96 c-13.255,0-24,10.745-24,24l0,72 l 81.6,0 + c 21.209,0, 38.4-21.49, 38.4-48S 294.809,96, 273.6,96z" /> +<glyph unicode="" d="M 425.373,358.627l-66.746,66.745C 346.183,437.818, 321.6,448, 304,448L 96,448 c-17.6,0-32-14.4-32-32l0-384 c0-17.6, 14.4-32, 32-32l 320,0 + c 17.6,0, 32,14.4, 32,32L 448,304 C 448,321.6, 437.817,346.182, 425.373,358.627z M 402.745,336.001c 3.396-3.398, 6.896-9.581, 9.447-16.001L 320,320 + L 320,412.193 c 6.42-2.55, 12.602-6.050, 16-9.448L 402.745,336.001z M 415.942,32L 96.057,32 c-0.020,0.017-0.041,0.038-0.057,0.058L 96,415.943 + c 0.017,0.020, 0.038,0.041, 0.057,0.057L 288,416 l0-128 l 128,0 l0-255.942 C 415.983,32.038, 415.962,32.017, 415.942,32z" /> +<glyph unicode="" d="M 480,40L 480,335.969 L 368.031,448L 72,448 c-22.091,0-40-17.908-40-40l0-368 c0-22.092, 17.909-40, 40-40l 368,0 + C 462.092,0, 480,17.908, 480,40z M 288,384l 32,0 l0-96 l-32,0 L 288,384 z M 352,64L 160,64 L 160,191.941 c 0.017,0.021, 0.038,0.041, 0.058,0.059l 191.885,0 + c 0.020-0.018, 0.041-0.038, 0.058-0.059L 352,64L 352,64z M 416,64l-32,0 L 384,192 c0,17.6-14.4,32-32,32L 160,224 c-17.6,0-32-14.4-32-32l0-128 L 96,64 L 96,384 + l 32,0 l0-96 c0-17.6, 14.4-32, 32-32l 160,0 c 17.6,0, 32,14.4, 32,32l0,85.505 l 64-64.036L 416,64 z" /> +<glyph unicode="" d="M 32,384l0-352 l 448,0 L 480,384 L 32,384 z M 192,160l0,64 l 128,0 l0-64 L 192,160 z M 320,128l0-64 L 192,64 l0,64 L 320,128 z M 320,320l0-64 L 192,256 l0,64 L 320,320 z M 160,320l0-64 L 64,256 l0,64 L 160,320 + z M 64,224l 96,0 l0-64 L 64,160 L 64,224 z M 352,224l 96,0 l0-64 l-96,0 L 352,224 z M 352,256l0,64 l 96,0 l0-64 L 352,256 z M 64,128l 96,0 l0-64 L 64,64 L 64,128 z M 352,64l0,64 l 96,0 l0-64 L 352,64 z" /> +<glyph unicode="" d="M 256,410c 49.683,0, 96.391-19.347, 131.521-54.478S 442,273.683, 442,224s-19.348-96.391-54.479-131.521S 305.683,38, 256,38 + s-96.391,19.348-131.522,54.479S 70,174.317, 70,224s 19.347,96.391, 54.478,131.522S 206.317,410, 256,410 M 256,448 + C 132.288,448, 32,347.712, 32,224s 100.288-224, 224-224s 224,100.288, 224,224S 379.712,448, 256,448L 256,448zM 160,288A32,32 2700 1 1 224,288A32,32 2700 1 1 160,288zM 288,288A32,32 2700 1 1 352,288A32,32 2700 1 1 288,288zM 256,152c-50.92,0-96.28,18.437-125.583,47.164C 141.98,140.36, 193.806,96, 256,96c 62.194,0, 114.020,44.36, 125.584,103.164 + C 352.28,170.437, 306.92,152, 256,152z" /> +<glyph unicode="" d="M 240,288L 144,384L 208,448L 32,448L 32,272L 96,336L 192,240 zM 320,240L 416,336L 480,272L 480,448L 304,448L 368,384L 272,288 zM 272,160L 368,64L 304,0L 480,0L 480,176L 416,112L 320,208 zM 192,208L 96,112L 32,176L 32,0L 208,0L 144,64L 240,160 z" /> +<glyph unicode="" d="M 32,256L 480,256L 480,192L 32,192z" /> +<glyph unicode="" d="M 32,96l 256,0 l0-64 L 32,32 L 32,96 z M 384,384L 273.721,384 l-91.883-256l-66.144,0 l 91.881,256L 96,384 L 96,448 l 288,0 L 384,384 z M 464.887,32L 400,96.887 + L 335.113,32L 304,63.113L 368.887,128L 304,192.887L 335.113,224L 400,159.113L 464.887,224L 496,192.887L 431.113,128L 496,63.113 + L 464.887,32z" /> +<glyph unicode="" d="M 128,416l 256,0 l0-64 L 128,352 L 128,416 z M 448,320L 64,320 c-17.6,0-32-14.4-32-32l0-128 c0-17.6, 14.398-32, 32-32l 64,0 l0-96 l 256,0 l0,96 l 64,0 + c 17.6,0, 32,14.4, 32,32L 480,288 C 480,305.6, 465.6,320, 448,320z M 352,64L 160,64 L 160,192 l 192,0 L 352,64 z M 455.2,272c0-12.813-10.387-23.2-23.199-23.2 + S 408.8,259.187, 408.8,272s 10.389,23.2, 23.201,23.2C 444.814,295.2, 455.2,284.813, 455.2,272z" /> +<glyph unicode="" d="M 192,416c-61.856,0-112-50.144-112-112s 50.144-112, 112-112l0-160 l 64,0 L 256,352 l 32,0 l0-320 l 64,0 L 352,352 l 64,0 L 416,416 L 192,416 z" /> +<glyph unicode="" d="M 224,416c-61.856,0-112-50.144-112-112s 50.144-112, 112-112l0-160 l 64,0 L 288,352 l 32,0 l0-320 l 64,0 L 384,352 l 64,0 L 448,416 L 224,416 zM 32,32L 144,128L 32,224 z" /> +<glyph unicode="" d="M 160,416C 98.144,416, 48,365.856, 48,304s 50.144-112, 112-112l0-160 l 64,0 L 224,352 l 32,0 l0-320 l 64,0 L 320,352 l 64,0 L 384,416 L 160,416 zM 480,224L 368,128L 480,32 z" /> +<glyph unicode="" d="M 256,288L 320,288L 320,256L 256,256zM 256,96L 320,96L 320,64L 256,64zM 288,192L 352,192L 352,160L 288,160zM 384,192L 384,96L 352,96L 352,64L 416,64L 416,192 zM 192,192L 256,192L 256,160L 192,160zM 160,96L 224,96L 224,64L 160,64zM 160,288L 224,288L 224,256L 160,256zM 96,384L 96,256L 128,256L 128,352L 160,352L 160,384 zM 352,256L 416,256L 416,384L 384,384L 384,288L 352,288 zM 32,448l0-448 l 448,0 L 480,448 L 32,448 z M 448,32L 64,32 L 64,416 l 384,0 L 448,32 zM 96,192L 96,64L 128,64L 128,160L 160,160L 160,192 zM 288,384L 352,384L 352,352L 288,352zM 192,384L 256,384L 256,352L 192,352z" /> +<glyph unicode="" d="M 408,448l 8-192L 96,256 l 8,192l 16,0 l 8-160l 256,0 l 8,160L 408,448 z M 104,0l-8,160l 320,0 l-8-160l-16,0 l-8,128L 128,128 l-8-128L 104,0 zM 32,224L 96,224L 96,192L 32,192zM 128,224L 192,224L 192,192L 128,192zM 224,224L 288,224L 288,192L 224,192zM 320,224L 384,224L 384,192L 320,192zM 416,224L 480,224L 480,192L 416,192z" /> +<glyph unicode="" d="M 480,416L 480,448 l-96,0 c-17.601,0-32-14.4-32-32l0-160 c0-7.928, 2.929-15.201, 7.748-20.807L 208,105l-71,74l-41-35l 112-144l 208,224l 64,0 + l0,32 l-96,0 L 384,416 L 480,416 zM 128,224l 32,0 L 160,416 c0,17.6-14.4,32-32,32L 64,448 c-17.6,0-32-14.4-32-32l0-192 l 32,0 l0,96 l 64,0 L 128,224 z M 64,352L 64,416 l 64,0 l0-64 L 64,352 zM 320,256l0,48 c0,17.6-4.4,32-22,32c 17.6,0, 22,14.4, 22,32L 320,416 c0,17.6-14.4,32-32,32l-96,0 l0-224 l 96,0 C 305.6,224, 320,238.4, 320,256z + M 224,416l 64,0 l0-64 l-64,0 L 224,416 z M 224,320l 64,0 l0-64 l-64,0 L 224,320 z" /> +<glyph unicode="" d="M 224,224l-64,0 l0,64 l 64,0 l0,64 l 64,0 l0-64 l 64,0 l0-64 l-64,0 l0-64 l-64,0 L 224,224 z M 480,192l0-160 L 32,32 L 32,192 l 64,0 l0-96 l 320,0 l0,96 L 480,192 z" /> +<glyph unicode="" d="M 208,128L 112,224L 208,320L 176,352L 48,224L 176,96 zM 336,352L 304,320L 400,224L 304,128L 336,96L 464,224 z" /> +<glyph unicode="" d="M 224,128l 64,0 l0-64 l-64,0 L 224,128 z M 352,352c 17.673,0, 32-14.327, 32-32l0-83 l-114-77l-46,0 l0,32 l 96,64l0,32 L 160,288 l0,64 L 352,352 z M 256,448 + c-59.833,0-116.083-23.3-158.392-65.608C 55.301,340.083, 32,283.833, 32,224c0-59.832, 23.301-116.084, 65.608-158.392 + C 139.917,23.3, 196.167,0, 256,0c 59.832,0, 116.084,23.3, 158.392,65.608C 456.7,107.916, 480,164.168, 480,224 + c0,59.833-23.3,116.083-65.608,158.392C 372.084,424.7, 315.832,448, 256,448z" /> +<glyph unicode="" d="M 448,416L 64,416 c-17.6,0-32-14.4-32-32l0-320 c0-17.6, 14.4-32, 32-32l 384,0 c 17.6,0, 32,14.4, 32,32L 480,384 C 480,401.6, 465.6,416, 448,416z + M 448,64.058c-0.006-0.007-0.015-0.014-0.021-0.021L 352,224l-80-64L 160,304L 64.016,64.042c-0.005,0.005-0.011,0.011-0.016,0.016 + L 64,383.943 c 0.017,0.020, 0.038,0.041, 0.057,0.057l 383.885,0 c 0.020-0.017, 0.041-0.038, 0.058-0.058L 448,64.058 zM 320,304A48,48 2700 1 1 416,304A48,48 2700 1 1 320,304z" /> +<glyph unicode="" d="M 448,416L 64,416 c-17.6,0-32-14.4-32-32l0-320 c0-17.6, 14.4-32, 32-32l 384,0 c 17.6,0, 32,14.4, 32,32L 480,384 C 480,401.6, 465.6,416, 448,416z + M 128,64L 64,64 l0,64 l 64,0 L 128,64 z M 128,192L 64,192 l0,64 l 64,0 L 128,192 z M 128,320L 64,320 L 64,384 l 64,0 L 128,320 z M 352,64L 160,64 L 160,384 l 192,0 L 352,64 z M 448,64l-64,0 l0,64 l 64,0 L 448,64 z + M 448,192l-64,0 l0,64 l 64,0 L 448,192 z M 448,320l-64,0 L 384,384 l 64,0 L 448,320 zM 192,320L 192,128L 336,224 z" /> +<glyph unicode="" d="M 38.899,327.688l 40.707-25.441C 105.007,342.804, 144,373.974, 190.21,389.37l-15.183,45.547 + C 118.153,415.968, 70.163,377.604, 38.899,327.688zM 336.973,434.917L 321.79,389.37c 46.211-15.396, 85.202-46.566, 110.604-87.124l 40.706,25.441 + C 441.837,377.604, 393.847,415.968, 336.973,434.917zM 303.987,127.996c-2.404,0-4.846,0.545-7.143,1.693L 224,166.111L 224,272 c0,8.836, 7.164,16, 16,16s 16-7.164, 16-16l0-86.111 + l 55.155-27.578c 7.903-3.951, 11.107-13.562, 7.155-21.466C 315.508,131.238, 309.856,127.997, 303.987,127.996zM 256,384C 149.961,384, 64,298.039, 64,192c0-106.039, 85.961-192, 192-192c 106.039,0, 192,85.961, 192,192 + C 448,298.039, 362.039,384, 256,384z M 256,48c-79.529,0-144,64.471-144,144c0,79.529, 64.471,144, 144,144c 79.529,0, 144-64.471, 144-144 + C 400,112.471, 335.529,48, 256,48z" /> +<glyph unicode="" d="M 32,252.127c 22.659,24.96, 48.581,46.18, 76.636,62.562C 153.802,341.061, 204.759,355, 256,355 + c 51.24,0, 102.198-13.939, 147.363-40.312c 28.056-16.382, 53.978-37.602, 76.637-62.562l0,58.716 + c-16.505,14.059-34.062,26.57-52.434,37.297C 375.063,378.796, 315.737,395, 256,395s-119.064-16.204-171.567-46.86 + C 66.062,337.413, 48.505,324.901, 32,310.842L 32,252.127 zM 256,320c-91.598,0-172.919-50.278-224-128c 51.081-77.724, 132.402-128, 224-128c 91.598,0, 172.919,50.276, 224,128 + C 428.919,269.722, 347.598,320, 256,320z M 256,224c0-17.673-14.327-32-32-32s-32,14.327-32,32c0,17.674, 14.327,32, 32,32 + S 256,241.674, 256,224z M 364.033,131.669C 330.316,111.982, 293.969,102, 256,102s-74.316,9.982-108.033,29.669 + C 122.19,146.721, 98.659,167.324, 78.91,192c 19.749,24.675, 43.28,45.279, 69.058,60.33c 6.638,3.876, 13.379,7.37, 20.213,10.491 + C 162.925,250.95, 160,237.817, 160,224c0-53.020, 42.981-96, 96-96c 53.020,0, 96,42.98, 96,96c0,13.817-2.925,26.95-8.18,38.821 + c 6.834-3.122, 13.575-6.615, 20.213-10.491c 25.777-15.051, 49.308-35.655, 69.058-60.33 + C 413.342,167.324, 389.811,146.721, 364.033,131.669z" /> +<glyph unicode="" d="M 325.584,338.083C 313.278,379.064, 311.146,384, 272,384l-32,0 c-39.809,0-41.332-5.076-54.209-48c0-0.001,0-0.001-0.001-0.002 + L 113.791,96l 56.818,0 l 28.8,96l 113.183,0 l 28.8-96l 56.815,0 L 325.584,338.083z M 218.609,256l 19.2,68c 5.043,16.809, 18.19,15, 18.19,15 + s 13.147,1.809, 18.19-15l 0.002,0 l 19.2-68L 218.609,256 z" /> +<glyph unicode="" d="M 288,448 C 411.712,448 512,347.712 512,224 C 512,100.288 411.712,0 288,0 L 288,48 C 335.012,48 379.209,66.307 412.451,99.549 C 445.693,132.791 464,176.988 464,224 C 464,271.011 445.693,315.209 412.451,348.451 C 379.209,381.693 335.012,400 288,400 C 240.989,400 196.791,381.693 163.549,348.451 C 137.979,322.882 121.258,290.828 114.896,256 L 208,256 L 96,128 L -16,256 L 66.285,256 C 81.815,364.551 175.154,448 288,448 ZM 384,256 L 384,192 L 256,192 L 256,352 L 320,352 L 320,256 Z" /> +<glyph unicode="" d="M 512,183.771l0,80.458 l-79.572,7.957c-4.093,15.021-10.044,29.274-17.605,42.49l 52.298,63.919L 410.595,435.12l-63.918-52.298 + c-13.217,7.562-27.471,13.513-42.491,17.604L 296.229,480l-80.458,0 l-7.957-79.573c-15.021-4.093-29.274-10.043-42.49-17.604 + L 101.405,435.12L 44.88,378.595l 52.298-63.918c-7.562-13.216-13.513-27.47-17.605-42.49L0,264.229l0-80.458 l 79.573-7.957 + c 4.093-15.021, 10.043-29.274, 17.605-42.491L 44.88,69.405l 56.524-56.524l 63.919,52.298c 13.216-7.562, 27.47-13.514, 42.49-17.605 + L 215.771-32l 80.458,0 l 7.957,79.572c 15.021,4.093, 29.274,10.044, 42.491,17.605l 63.918-52.298l 56.524,56.524l-52.298,63.918 + c 7.562,13.217, 13.514,27.471, 17.605,42.49L 512,183.771z M 352,192l-64-64l-64,0 l-64,64l0,64 l 64,64l 64,0 l 64-64L 352,192 z" /> +<glyph unicode="" d="M 384,377 L 384,352 L 448,352 L 448,320 L 352,320 L 352,393 L 416,423 L 416,448 L 352,448 L 352,480 L 448,480 L 448,407 ZM 338,352L 270,352L 176,258L 82,352L 14,352L 142,224L 14,96L 82,96L 176,190L 270,96L 338,96L 210,224 z" /> +<glyph unicode="" d="M 384,25 L 384,0 L 448,0 L 448-32 L 352-32 L 352,41 L 416,71 L 416,96 L 352,96 L 352,128 L 448,128 L 448,55 ZM 338,352L 270,352L 176,258L 82,352L 14,352L 142,224L 14,96L 82,96L 176,190L 270,96L 338,96L 210,224 z" /> +<glyph unicode="" d="M 352,288l0,80 c0,8.8-7.2,16-16,16l-80,0 L 256,416 c0,17.6-14.4,32-32,32l-64,0 c-17.602,0-32-14.4-32-32l0-32 L 48,384 c-8.801,0-16-7.2-16-16 + l0-256 c0-8.8, 7.199-16, 16-16l 112,0 l0-96 l 288,0 L 448,288 L 352,288 z M 160,415.943c 0.017,0.019, 0.036,0.039, 0.057,0.057l 63.884,0 + c 0.021-0.018, 0.041-0.038, 0.059-0.057L 224,384 l-64,0 L 160,415.943 z M 96,320l0,32 l 192,0 l0-32 L 96,320 z M 416,32L 192,32 L 192,256 l 224,0 L 416,32 zM 224,224L 224,160L 240,160L 256,192L 288,192L 288,96L 264,96L 264,64L 344,64L 344,96L 320,96L 320,192L 352,192L 368,160L 384,160L 384,224 z" data-tags="pastetext" /> +<glyph unicode="" d="M 384,352L 416,352L 416,320L 384,320zM 320,288L 352,288L 352,256L 320,256zM 320,224L 352,224L 352,192L 320,192zM 320,160L 352,160L 352,128L 320,128zM 256,224L 288,224L 288,192L 256,192zM 256,160L 288,160L 288,128L 256,128zM 192,160L 224,160L 224,128L 192,128zM 384,288L 416,288L 416,256L 384,256zM 384,224L 416,224L 416,192L 384,192zM 384,160L 416,160L 416,128L 384,128zM 384,96L 416,96L 416,64L 384,64zM 320,96L 352,96L 352,64L 320,64zM 256,96L 288,96L 288,64L 256,64zM 192,96L 224,96L 224,64L 192,64zM 128,96L 160,96L 160,64L 128,64z" data-tags="resize, dots" /> +<glyph unicode="" d="M 464,416L 256,416L 240,448L 64,448L 32,384L 480,384 zM 420.17,128L 464,128 l 16,224L 32,352 l 32-320l 178.040,0 C 189.599,50.888, 152,101.133, 152,160c0,74.991, 61.009,136, 136,136 + c 74.99,0, 136-61.009, 136-136C 424,149.161, 422.689,138.425, 420.17,128zM 437.498,55.125l-67.248,55.346C 378.977,124.932, 384,141.878, 384,160c0,53.020-42.98,96-96,96s-96-42.98-96-96 + s 42.98-96, 96-96c 18.122,0, 35.069,5.023, 49.529,13.75l 55.346-67.248c 11.481-13.339, 31.059-14.070, 43.503-1.626l 2.746,2.746 + C 451.568,24.066, 450.837,43.644, 437.498,55.125z M 288,98c-34.242,0-62,27.758-62,62s 27.758,62, 62,62s 62-27.758, 62-62 + S 322.242,98, 288,98z" data-tags="browse" /> +<glyph unicode=" " horiz-adv-x="256" /> +</font></defs></svg>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.eot b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.eot Binary files differnew file mode 100644 index 000000000..60e2d2e5c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.eot diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.svg b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.svg new file mode 100644 index 000000000..930c48dce --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.svg @@ -0,0 +1,62 @@ +<?xml version="1.0" standalone="no"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > +<svg xmlns="http://www.w3.org/2000/svg"> +<metadata>Generated by IcoMoon</metadata> +<defs> +<font id="tinymce-small" horiz-adv-x="512"> +<font-face units-per-em="512" ascent="480" descent="-32" /> +<missing-glyph horiz-adv-x="512" /> +<glyph unicode=" " d="" horiz-adv-x="256" /> +<glyph unicode="" d="M480 40v295.969l-111.969 112.031h-296.031c-22.091 0-40-17.908-40-40v-368c0-22.092 17.909-40 40-40h368c22.092 0 40 17.908 40 40zM288 384h32v-96h-32v96zM352 64h-192v127.941c0.017 0.021 0.038 0.041 0.058 0.059h191.885c0.020-0.018 0.041-0.038 0.058-0.059l-0.001-127.941zM416 64h-32v128c0 17.6-14.4 32-32 32h-192c-17.6 0-32-14.4-32-32v-128h-32v320h32v-96c0-17.6 14.4-32 32-32h160c17.6 0 32 14.4 32 32v85.505l64-64.036v-245.469z" /> +<glyph unicode="" d="M425.373 358.627l-66.746 66.745c-12.444 12.446-37.027 22.628-54.627 22.628h-208c-17.6 0-32-14.4-32-32v-384c0-17.6 14.4-32 32-32h320c17.6 0 32 14.4 32 32v272c0 17.6-10.183 42.182-22.627 54.627zM402.745 336.001c3.396-3.398 6.896-9.581 9.447-16.001h-92.192v92.193c6.42-2.55 12.602-6.050 16-9.448l66.745-66.744zM415.942 32h-319.885c-0.020 0.017-0.041 0.038-0.057 0.058v383.885c0.017 0.020 0.038 0.041 0.057 0.057h191.943v-128h128v-255.942c-0.017-0.020-0.038-0.041-0.058-0.058z" /> +<glyph unicode="" d="M512 183.771v80.458l-79.572 7.957c-4.093 15.021-10.044 29.274-17.605 42.49l52.298 63.919-56.526 56.525-63.918-52.298c-13.217 7.562-27.471 13.513-42.491 17.604l-7.957 79.574h-80.458l-7.957-79.573c-15.021-4.093-29.274-10.043-42.49-17.604l-63.919 52.297-56.525-56.525 52.298-63.918c-7.562-13.216-13.513-27.47-17.605-42.49l-79.573-7.958v-80.458l79.573-7.957c4.093-15.021 10.043-29.274 17.605-42.491l-52.298-63.918 56.524-56.524 63.919 52.298c13.216-7.562 27.47-13.514 42.49-17.605l7.958-79.574h80.458l7.957 79.572c15.021 4.093 29.274 10.044 42.491 17.605l63.918-52.298 56.524 56.524-52.298 63.918c7.562 13.217 13.514 27.471 17.605 42.49l79.574 7.96zM352 192l-64-64h-64l-64 64v64l64 64h64l64-64v-64z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM32 192h448v-64h-448zM32 288h288v-64h-288zM32 96h288v-64h-288z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM32 192h448v-64h-448zM128 288h256v-64h-256zM128 96h256v-64h-256z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM32 192h448v-64h-448zM192 288h288v-64h-288zM192 96h288v-64h-288z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM32 192h448v-64h-448zM32 288h448v-64h-448zM32 96h448v-64h-448z" /> +<glyph unicode="" d="M432.204 144.934c-23.235 23.235-53.469 34.002-80.541 31.403l-31.663 31.663 96 96c0 0 64 64 0 128l-160-160-160 160c-64-64 0-128 0-128l96-96-31.663-31.663c-27.072 2.599-57.305-8.169-80.54-31.403-37.49-37.49-42.556-93.209-11.313-124.45 31.241-31.241 86.96-26.177 124.45 11.313 23.235 23.234 34.001 53.469 31.403 80.54l31.663 31.663 31.664-31.664c-2.598-27.072 8.168-57.305 31.403-80.539 37.489-37.49 93.209-42.556 124.449-11.313 31.244 31.241 26.178 86.959-11.312 124.45zM176.562 100.711c-1.106-12.166-7.51-24.913-17.57-34.973-11.106-11.107-25.54-17.738-38.609-17.738-5.262 0-12.649 1.114-17.958 6.424-10.703 10.702-8.688 36.566 11.313 56.568 11.106 11.107 25.54 17.738 38.609 17.738 5.262 0 12.649-1.114 17.958-6.424 6.556-6.555 6.735-16.344 6.257-21.595zM256 176c-17.673 0-32 14.327-32 32s14.327 32 32 32 32-14.327 32-32-14.327-32-32-32zM409.576 54.424c-5.31-5.31-12.696-6.424-17.958-6.424-13.069 0-27.503 6.631-38.609 17.738-10.061 10.060-16.464 22.807-17.569 34.973-0.479 5.251-0.3 15.040 6.257 21.596 5.309 5.311 12.695 6.424 17.958 6.424 13.068 0 27.503-6.631 38.608-17.737 20.002-20.004 22.016-45.868 11.313-56.57z" /> +<glyph unicode="" d="M352 288v80c0 8.8-7.2 16-16 16h-80v32c0 17.6-14.4 32-32 32h-64c-17.602 0-32-14.4-32-32v-32h-80c-8.801 0-16-7.2-16-16v-256c0-8.8 7.199-16 16-16h112v-96h192l96 96v192h-96zM160 415.943c0.017 0.019 0.036 0.039 0.057 0.057h63.884c0.021-0.018 0.041-0.038 0.059-0.057v-31.943h-64v31.943zM96 320v32h192v-32h-192zM352 45.255v50.745h50.745l-50.745-50.745zM416 128h-96v-96h-128v224h224v-128z" /> +<glyph unicode="" d="M444 288h-28v128h32v32h-160v-32h32v-128h-128v128h32v32h-160v-32h32v-128h-28c-19.8 0-36-16.2-36-36v-216c0-19.8 16.2-36 36-36h120c19.8 0 36 16.2 36 36v156h64v-156c0-19.8 16.2-36 36-36h120c19.8 0 36 16.2 36 36v216c0 19.8-16.2 36-36 36zM174 32h-92c-9.9 0-18 7.2-18 16s8.1 16 18 16h92c9.9 0 18-7.2 18-16s-8.1-16-18-16zM272 224h-32c-8.8 0-16 7.2-16 16s7.2 16 16 16h32c8.8 0 16-7.2 16-16s-7.2-16-16-16zM430 32h-92c-9.9 0-18 7.2-18 16s8.1 16 18 16h92c9.9 0 18-7.2 18-16s-8.1-16-18-16z" /> +<glyph unicode="" d="M192 416h288v-64h-288zM192 256h288v-64h-288zM192 96h288v-64h-288zM64 384c0-17.673 14.327-32 32-32s32 14.327 32 32c0 17.673-14.327 32-32 32-17.673 0-32-14.327-32-32zM64 224c0-17.673 14.327-32 32-32s32 14.327 32 32c0 17.673-14.327 32-32 32-17.673 0-32-14.327-32-32zM64 64c0-17.673 14.327-32 32-32s32 14.327 32 32c0 17.673-14.327 32-32 32-17.673 0-32-14.327-32-32z" /> +<glyph unicode="" d="M192 416h288v-64h-288zM192 256h288v-64h-288zM192 96h288v-64h-288zM160 215v73h-32v160h-64v-32h32v-128h-32v-32h64v-25l-64-30v-73h64v-32h-64v-32h64v-32h-64v-32h96v160h-64v25z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM192 192h288v-64h-288zM192 288h288v-64h-288zM32 96h448v-64h-448zM32 288l112-80-112-80z" /> +<glyph unicode="" d="M32 384h448v-64h-448zM32 192h288v-64h-288zM32 288h288v-64h-288zM32 96h448v-64h-448zM480 288l-112-80 112-80z" /> +<glyph unicode="" d="M128.214 267.637c52.9 0 95.786-45.585 95.786-101.819 0-56.232-42.886-101.818-95.786-101.818-52.901 0-95.786 45.585-95.786 101.818l-0.428 14.546c0 112.465 85.77 203.636 191.572 203.636v-58.182c-36.55 0-70.913-15.13-96.758-42.602-4.977-5.289-9.517-10.917-13.612-16.828 4.892 0.82 9.903 1.249 15.012 1.249zM384.214 267.637c52.9 0 95.786-45.585 95.786-101.819 0-56.232-42.886-101.818-95.786-101.818-52.901 0-95.786 45.585-95.786 101.818l-0.428 14.546c0 112.465 85.77 203.636 191.572 203.636v-58.182c-36.55 0-70.913-15.13-96.758-42.602-4.978-5.289-9.518-10.917-13.612-16.828 4.892 0.82 9.903 1.249 15.012 1.249z" /> +<glyph unicode="" d="M352 0c29.5 99.5 67.453 227.633-128 223.048v-111.048l-168.001 168 168.001 168v-108.663c234.046 6.1 272-179.337 128-339.337z" /> +<glyph unicode="" d="M288 339.337v108.663l168.001-168-168.001-168v111.048c-195.453 4.585-157.5-123.548-128-223.048-144 160-106.046 345.437 128 339.337z" /> +<glyph unicode="" d="M463.637 364.892l-66.745 66.744c-10.552 10.552-24.616 16.364-39.599 16.364s-29.047-5.812-39.598-16.363l-82.746-82.745c-21.834-21.834-21.834-57.362 0-79.196l1.373-1.373 33.941 33.941-1.373 1.373c-3.066 3.066-3.066 8.247 0 11.313l82.746 82.746c2.005 2.004 4.404 2.304 5.656 2.304s3.651-0.299 5.656-2.305l66.745-66.744c3.066-3.067 3.066-8.249 0.001-11.314l-82.747-82.747c-2.004-2.004-4.403-2.304-5.655-2.304s-3.651 0.3-5.656 2.306l-1.373 1.373-33.94-33.942 1.371-1.371c10.553-10.554 24.615-16.364 39.6-16.364s29.047 5.812 39.598 16.363l82.747 82.746c21.831 21.833 21.831 57.36-0.002 79.195zM275.678 179.678l-33.941-33.941 1.373-1.373c2.004-2.004 2.305-4.403 2.305-5.655 0-1.253-0.299-3.651-2.303-5.657l-82.747-82.745c-2.005-2.005-4.405-2.305-5.657-2.305s-3.652 0.3-5.657 2.305l-66.746 66.743c-2.005 2.005-2.305 4.405-2.305 5.657s0.299 3.65 2.305 5.656l82.745 82.744c2.005 2.006 4.405 2.306 5.657 2.306s3.652-0.3 5.657-2.306l1.373-1.371 33.941 33.94-1.373 1.373c-10.552 10.552-24.615 16.363-39.598 16.363s-29.046-5.812-39.598-16.363l-82.744-82.743c-10.553-10.552-16.365-24.617-16.365-39.599s5.812-29.047 16.363-39.599l66.745-66.745c10.553-10.551 24.616-16.363 39.599-16.363s29.046 5.812 39.598 16.363l82.747 82.746c10.552 10.552 16.361 24.615 16.361 39.598s-5.812 29.047-16.363 39.598l-1.372 1.373zM176 125c-4.862 0-9.725 1.855-13.435 5.564-7.42 7.42-7.42 19.449 0 26.869l160 160c7.42 7.42 19.448 7.42 26.868 0 7.422-7.42 7.422-19.45 0-26.87l-160-160c-3.708-3.708-8.571-5.563-13.433-5.563z" /> +<glyph unicode="" d="M463.637 364.892l-66.745 66.744c-10.552 10.552-24.616 16.364-39.599 16.364s-29.047-5.812-39.598-16.363l-82.746-82.745c-21.834-21.834-21.834-57.362 0-79.196l1.373-1.373 33.941 33.941-1.373 1.373c-3.066 3.066-3.066 8.247 0 11.313l82.746 82.746c2.005 2.004 4.404 2.304 5.656 2.304s3.651-0.299 5.656-2.305l66.745-66.744c3.066-3.067 3.066-8.249 0.001-11.314l-82.747-82.747c-2.004-2.004-4.403-2.304-5.655-2.304s-3.651 0.3-5.656 2.306l-1.373 1.373-33.94-33.942 1.371-1.371c10.553-10.554 24.615-16.364 39.6-16.364s29.047 5.812 39.598 16.363l82.747 82.746c21.831 21.833 21.831 57.36-0.002 79.195zM275.678 179.678l-33.941-33.941 1.373-1.373c2.004-2.004 2.305-4.403 2.305-5.655 0-1.253-0.299-3.651-2.303-5.657l-82.747-82.745c-2.005-2.005-4.405-2.305-5.657-2.305s-3.652 0.3-5.657 2.305l-66.746 66.743c-2.005 2.005-2.305 4.405-2.305 5.657s0.299 3.65 2.305 5.656l82.745 82.744c2.005 2.006 4.405 2.306 5.657 2.306s3.652-0.3 5.657-2.306l1.373-1.371 33.941 33.94-1.373 1.373c-10.552 10.552-24.615 16.363-39.598 16.363s-29.046-5.812-39.598-16.363l-82.744-82.743c-10.553-10.552-16.365-24.617-16.365-39.599s5.812-29.047 16.363-39.599l66.745-66.745c10.553-10.551 24.616-16.363 39.599-16.363s29.046 5.812 39.598 16.363l82.747 82.746c10.552 10.552 16.361 24.615 16.361 39.598s-5.812 29.047-16.363 39.598l-1.372 1.373zM400 61c-4.862 0-9.725 1.854-13.435 5.565l-64 63.999c-7.422 7.42-7.422 19.449 0 26.869 7.42 7.422 19.448 7.422 26.868 0l64-64c7.422-7.42 7.422-19.448 0-26.868-3.708-3.711-8.571-5.565-13.433-5.565zM304 0c-8.837 0-16 7.163-16 16v64c0 8.837 7.163 16 16 16s16-7.163 16-16v-64c0-8.837-7.163-16-16-16zM464 160h-64c-8.837 0-16 7.163-16 16s7.163 16 16 16h64c8.837 0 16-7.163 16-16s-7.163-16-16-16zM112 387c4.862 0 9.725-1.854 13.435-5.565l64-64c7.421-7.42 7.421-19.449 0-26.869-7.42-7.422-19.449-7.422-26.869 0l-64 64c-7.421 7.42-7.421 19.449 0 26.869 3.709 3.711 8.572 5.565 13.434 5.565zM208 448c8.837 0 16-7.163 16-16v-64c0-8.837-7.163-16-16-16s-16 7.163-16 16v64c0 8.837 7.163 16 16 16zM48 288h64c8.837 0 16-7.163 16-16s-7.163-16-16-16h-64c-8.837 0-16 7.163-16 16s7.163 16 16 16z" /> +<glyph unicode="" d="M128 448v-448l128 128 128-128v448h-256zM352 85.255l-96 96-96-96v330.745h192v-330.745z" /> +<glyph unicode="" d="M448 416h-384c-17.6 0-32-14.4-32-32v-320c0-17.6 14.4-32 32-32h384c17.6 0 32 14.4 32 32v320c0 17.6-14.4 32-32 32zM448 64.058c-0.006-0.007-0.015-0.014-0.021-0.021l-95.979 159.963-80-64-112 144-95.984-239.958c-0.005 0.005-0.011 0.011-0.016 0.016v319.885c0.017 0.020 0.038 0.041 0.057 0.057h383.885c0.020-0.017 0.041-0.038 0.058-0.058v-319.884zM320 304c0-26.51 21.49-48 48-48s48 21.49 48 48c0 26.51-21.49 48-48 48-26.51 0-48-21.49-48-48z" /> +<glyph unicode="" d="M448 416h-384c-17.6 0-32-14.4-32-32v-320c0-17.6 14.4-32 32-32h384c17.6 0 32 14.4 32 32v320c0 17.6-14.4 32-32 32zM128 64h-64v64h64v-64zM128 192h-64v64h64v-64zM128 320h-64v64h64v-64zM352 64h-192v320h192v-320zM448 64h-64v64h64v-64zM448 192h-64v64h64v-64zM448 320h-64v64h64v-64zM192 320v-192l144 96z" /> +<glyph unicode="" d="M224 128h64v-64h-64v64zM352 352c17.673 0 32-14.327 32-32v-83l-114-77h-46v32l96 64v32h-160v64h192zM256 448c-59.833 0-116.083-23.3-158.392-65.608-42.307-42.309-65.608-98.559-65.608-158.392 0-59.832 23.301-116.084 65.608-158.392 42.309-42.308 98.559-65.608 158.392-65.608 59.832 0 116.084 23.3 158.392 65.608 42.308 42.308 65.608 98.56 65.608 158.392 0 59.833-23.3 116.083-65.608 158.392-42.308 42.308-98.56 65.608-158.392 65.608z" /> +<glyph unicode="" d="M208 128l-96 96 96 96-32 32-128-128 128-128zM336 352l-32-32 96-96-96-96 32-32 128 128z" /> +<glyph unicode="" d="M38.899 327.688l40.707-25.441c25.401 40.557 64.394 71.727 110.604 87.123l-15.183 45.547c-56.874-18.949-104.864-57.313-136.128-107.229zM336.973 434.917l-15.183-45.547c46.211-15.396 85.202-46.566 110.604-87.124l40.706 25.441c-31.263 49.917-79.253 88.281-136.127 107.23zM303.987 127.996c-2.404 0-4.846 0.545-7.143 1.693l-72.844 36.422v105.889c0 8.836 7.164 16 16 16s16-7.164 16-16v-86.111l55.155-27.578c7.903-3.951 11.107-13.562 7.155-21.466-2.802-5.607-8.454-8.848-14.323-8.849zM256 384c-106.039 0-192-85.961-192-192s85.961-192 192-192c106.039 0 192 85.961 192 192 0 106.039-85.961 192-192 192zM256 48c-79.529 0-144 64.471-144 144s64.471 144 144 144c79.529 0 144-64.471 144-144 0-79.529-64.471-144-144-144z" /> +<glyph unicode="" d="M32 252.127c22.659 24.96 48.581 46.18 76.636 62.562 45.166 26.372 96.123 40.311 147.364 40.311 51.24 0 102.198-13.939 147.363-40.312 28.056-16.382 53.978-37.602 76.637-62.562v58.716c-16.505 14.059-34.062 26.57-52.434 37.297-52.503 30.657-111.829 46.861-171.566 46.861s-119.064-16.204-171.567-46.86c-18.371-10.727-35.928-23.239-52.433-37.298v-58.715zM256 320c-91.598 0-172.919-50.278-224-128 51.081-77.724 132.402-128 224-128 91.598 0 172.919 50.276 224 128-51.081 77.722-132.402 128-224 128zM256 224c0-17.673-14.327-32-32-32s-32 14.327-32 32c0 17.674 14.327 32 32 32s32-14.326 32-32zM364.033 131.669c-33.717-19.687-70.064-29.669-108.033-29.669s-74.316 9.982-108.033 29.669c-25.777 15.052-49.308 35.655-69.057 60.331 19.749 24.675 43.28 45.279 69.058 60.33 6.638 3.876 13.379 7.37 20.213 10.491-5.256-11.871-8.181-25.004-8.181-38.821 0-53.020 42.981-96 96-96 53.020 0 96 42.98 96 96 0 13.817-2.925 26.95-8.18 38.821 6.834-3.122 13.575-6.615 20.213-10.491 25.777-15.051 49.308-35.655 69.058-60.33-19.749-24.676-43.28-45.279-69.058-60.331z" /> +<glyph unicode="" d="M325.584 338.083c-12.306 40.981-14.438 45.917-53.584 45.917h-32c-39.809 0-41.332-5.076-54.209-48 0-0.001 0-0.001-0.001-0.002l-71.999-239.998h56.818l28.8 96h113.183l28.8-96h56.815l-72.623 242.083zM218.609 256l19.2 68c5.043 16.809 18.19 15 18.19 15s13.147 1.809 18.19-15h0.002l19.2-68h-74.782z" /> +<glyph unicode="" d="M32 384v-352h448v352h-448zM192 160v64h128v-64h-128zM320 128v-64h-128v64h128zM320 320v-64h-128v64h128zM160 320v-64h-96v64h96zM64 224h96v-64h-96v64zM352 224h96v-64h-96v64zM352 256v64h96v-64h-96zM64 128h96v-64h-96v64zM352 64v64h96v-64h-96z" /> +<glyph unicode="" d="M32 256h448v-64h-448z" /> +<glyph unicode="" d="M32 96h256v-64h-256v64zM384 384h-110.279l-91.883-256h-66.144l91.881 256h-111.575v64h288v-64zM464.887 32l-64.887 64.887-64.887-64.887-31.113 31.113 64.887 64.887-64.887 64.887 31.113 31.113 64.887-64.887 64.887 64.887 31.113-31.113-64.887-64.887 64.887-64.887-31.113-31.113z" /> +<glyph unicode="" d="M384 25v-25h64v-32h-96v73l64 30v25h-64v32h96v-73zM338 352h-68l-94-94-94 94h-68l128-128-128-128h68l94 94 94-94h68l-128 128z" /> +<glyph unicode="" d="M384 377v-25h64v-32h-96v73l64 30v25h-64v32h96v-73zM338 352h-68l-94-94-94 94h-68l128-128-128-128h68l94 94 94-94h68l-128 128z" /> +<glyph unicode="" d="M352 64v18.502c75.674 30.814 128 96.91 128 173.498 0 106.039-100.288 192-224 192s-224-85.961-224-192c0-76.588 52.327-142.684 128-173.498v-18.502h-96l-32 48v-112h160v111.406c-50.45 25.681-85.333 80.77-85.333 144.594 0 88.366 66.859 160 149.333 160 82.474 0 149.333-71.634 149.333-160 0-63.824-34.883-118.913-85.333-144.594v-111.406h160v112l-32-48h-96z" /> +<glyph unicode="" d="M256 410c49.683 0 96.391-19.347 131.521-54.478s54.479-81.839 54.479-131.522-19.348-96.391-54.479-131.521-81.838-54.479-131.521-54.479-96.391 19.348-131.522 54.479-54.478 81.838-54.478 131.521 19.347 96.391 54.478 131.522 81.839 54.478 131.522 54.478zM256 448c-123.712 0-224-100.288-224-224s100.288-224 224-224 224 100.288 224 224-100.288 224-224 224v0zM160 288c0-17.673 14.327-32 32-32s32 14.327 32 32c0 17.673-14.327 32-32 32-17.673 0-32-14.327-32-32zM288 288c0-17.673 14.327-32 32-32s32 14.327 32 32c0 17.673-14.327 32-32 32-17.673 0-32-14.327-32-32zM256 152c-50.92 0-96.28 18.437-125.583 47.164 11.563-58.804 63.389-103.164 125.583-103.164 62.194 0 114.020 44.36 125.584 103.164-29.304-28.727-74.664-47.164-125.584-47.164z" /> +<glyph unicode="" d="M128 416h256v-64h-256v64zM448 320h-384c-17.6 0-32-14.4-32-32v-128c0-17.6 14.398-32 32-32h64v-96h256v96h64c17.6 0 32 14.4 32 32v128c0 17.6-14.4 32-32 32zM352 64h-192v128h192v-128zM455.2 272c0-12.813-10.387-23.2-23.199-23.2s-23.201 10.387-23.201 23.2 10.389 23.2 23.201 23.2c12.813 0 23.199-10.387 23.199-23.2z" /> +<glyph unicode="" d="M240 288l-96 96 64 64h-176v-176l64 64 96-96zM320 240l96 96 64-64v176h-176l64-64-96-96zM272 160l96-96-64-64h176v176l-64-64-96 96zM192 208l-96-96-64 64v-176h176l-64 64 96 96z" /> +<glyph unicode="" d="M480 416v32h-96c-17.601 0-32-14.4-32-32v-160c0-7.928 2.929-15.201 7.748-20.807l-151.748-130.193-71 74-41-35 112-144 208 224h64v32h-96v160h96zM128 224h32v192c0 17.6-14.4 32-32 32h-64c-17.6 0-32-14.4-32-32v-192h32v96h64v-96zM64 352v64h64v-64h-64zM320 256v48c0 17.6-4.4 32-22 32 17.6 0 22 14.4 22 32v48c0 17.6-14.4 32-32 32h-96v-224h96c17.6 0 32 14.4 32 32zM224 416h64v-64h-64v64zM224 320h64v-64h-64v64z" /> +<glyph unicode="" d="M224 224h-64v64h64v64h64v-64h64v-64h-64v-64h-64v64zM480 192v-160h-448v160h64v-96h320v96h64z" /> +<glyph unicode="" d="M256 288h64v-32h-64zM256 96h64v-32h-64zM288 192h64v-32h-64zM384 192v-96h-32v-32h64v128zM192 192h64v-32h-64zM160 96h64v-32h-64zM160 288h64v-32h-64zM96 384v-128h32v96h32v32zM352 256h64v128h-32v-96h-32zM32 448v-448h448v448h-448zM448 32h-384v384h384v-384zM96 192v-128h32v96h32v32zM288 384h64v-32h-64zM192 384h64v-32h-64z" /> +<glyph unicode="" d="M408 448l8-192h-320l8 192h16l8-160h256l8 160h16zM104 0l-8 160h320l-8-160h-16l-8 128h-256l-8-128h-16zM32 224h64v-32h-64zM128 224h64v-32h-64zM224 224h64v-32h-64zM320 224h64v-32h-64zM416 224h64v-32h-64z" /> +<glyph unicode="" d="M288 448c123.712 0 224-100.288 224-224s-100.288-224-224-224v48c47.012 0 91.209 18.307 124.451 51.549 33.242 33.242 51.549 77.439 51.549 124.451 0 47.011-18.307 91.209-51.549 124.451-33.242 33.242-77.439 51.549-124.451 51.549-47.011 0-91.209-18.307-124.451-51.549-25.57-25.569-42.291-57.623-48.653-92.451h93.104l-112-128-112 128h82.285c15.53 108.551 108.869 192 221.715 192zM384 256v-64h-128v160h64v-96z" /> +<glyph unicode="" d="M312.721 232.909c24.037 19.075 39.279 47.428 39.279 79.091 0 57.438-50.145 104-112 104h-112v-384h144c61.856 0 112 46.562 112 104 0 44.098-29.559 81.781-71.279 96.909zM192 328c0 13.255 10.745 24 24 24h33.602c21.207 0 38.398-21.49 38.398-48s-17.191-48-38.398-48h-57.602v72zM273.6 96h-57.6c-13.255 0-24 10.745-24 24v72h81.6c21.209 0 38.4-21.49 38.4-48s-17.191-48-38.4-48z" /> +<glyph unicode="" d="M416 416v-32h-72l-128-320h72v-32h-224v32h72l128 320h-72v32h224z" /> +<glyph unicode="" d="M96 64h288v-32h-288v32zM320 416v-192c0-15.656-7.35-30.812-20.695-42.676-15.471-13.751-36.534-21.324-59.305-21.324-22.772 0-43.834 7.573-59.304 21.324-13.346 11.864-20.696 27.020-20.696 42.676v192h-64v-192c0-70.691 64.471-128 144-128s144 57.309 144 128v192h-64z" /> +<glyph unicode="" d="M480 224h-132.938c-25.039 17.71-57.215 27.43-91.062 27.43-44.603 0-82.286 25.121-82.286 54.856 0 29.735 37.683 54.857 82.286 54.857 37.529 0 70.154-17.788 79.56-41.143h56.508c-3.965 25.322-18.79 48.984-42.029 66.413-25.44 19.080-58.838 29.587-94.039 29.587-35.202 0-68.598-10.507-94.037-29.587-27.394-20.545-43.106-49.751-43.106-80.127s15.712-59.582 43.106-80.127c0.978-0.733 1.971-1.449 2.973-2.158h-132.936v-32h256.266c29.104-8.553 50.021-28.135 50.021-50.286 0-29.734-37.684-54.855-82.286-54.855-37.53 0-70.154 17.787-79.559 41.143h-56.508c3.965-25.32 18.791-48.984 42.030-66.413 25.438-19.082 58.834-29.59 94.036-29.59 35.201 0 68.599 10.508 94.037 29.587 27.395 20.545 43.104 49.751 43.104 80.127 0 17.649-5.327 34.896-15.147 50.286h102.006v32z" /> +<glyph unicode="" d="M192 416c-61.856 0-112-50.144-112-112s50.144-112 112-112v-160h64v320h32v-320h64v320h64v64h-224z" /> +<glyph unicode="" d="M224 416c-61.856 0-112-50.144-112-112s50.144-112 112-112v-160h64v320h32v-320h64v320h64v64h-224zM32 32l112 96-112 96z" /> +<glyph unicode="" d="M160 416c-61.856 0-112-50.144-112-112s50.144-112 112-112v-160h64v320h32v-320h64v320h64v64h-224zM480 224l-112-96 112-96z" /> +<glyph unicode="" d="M416 320h-96v32l-96 96h-192v-352h192v-96h288v224l-96 96zM416 274.745l50.745-50.745h-50.745v50.745zM224 402.745l50.745-50.745h-50.745v50.745zM64 416h128v-96h96v-192h-224v288zM480 32h-224v64h64v192h64v-96h96v-160z" /> +<glyph unicode="" d="M384 352h32v-32h-32zM320 288h32v-32h-32zM320 224h32v-32h-32zM320 160h32v-32h-32zM256 224h32v-32h-32zM256 160h32v-32h-32zM192 160h32v-32h-32zM384 288h32v-32h-32zM384 224h32v-32h-32zM384 160h32v-32h-32zM384 96h32v-32h-32zM320 96h32v-32h-32zM256 96h32v-32h-32zM192 96h32v-32h-32zM128 96h32v-32h-32z" /> +<glyph unicode="" d="M464 416h-208l-16 32h-176l-32-64h448zM420.17 128h43.83l16 224h-448l32-320h178.040c-52.441 18.888-90.040 69.133-90.040 128 0 74.991 61.009 136 136 136 74.99 0 136-61.009 136-136 0-10.839-1.311-21.575-3.83-32zM437.498 55.125l-67.248 55.346c8.727 14.461 13.75 31.407 13.75 49.529 0 53.020-42.98 96-96 96s-96-42.98-96-96 42.98-96 96-96c18.122 0 35.069 5.023 49.529 13.75l55.346-67.248c11.481-13.339 31.059-14.070 43.503-1.626l2.746 2.746c12.444 12.444 11.713 32.022-1.626 43.503zM288 98c-34.242 0-62 27.758-62 62s27.758 62 62 62 62-27.758 62-62-27.758-62-62-62z" /> +<glyph unicode="" d="M352 288v80c0 8.8-7.2 16-16 16h-80v32c0 17.6-14.4 32-32 32h-64c-17.602 0-32-14.4-32-32v-32h-80c-8.801 0-16-7.2-16-16v-256c0-8.8 7.199-16 16-16h112v-96h288v288h-96zM160 415.943c0.017 0.019 0.036 0.039 0.057 0.057h63.884c0.021-0.018 0.041-0.038 0.059-0.057v-31.943h-64v31.943zM96 320v32h192v-32h-192zM416 32h-224v224h224v-224zM224 224v-64h16l16 32h32v-96h-24v-32h80v32h-24v96h32l16-32h16v64z" /> +</font></defs></svg>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.ttf b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.ttf Binary files differnew file mode 100644 index 000000000..afc6ec458 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.ttf diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.woff b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.woff Binary files differnew file mode 100644 index 000000000..fa72c74b4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce-small.woff diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.dev.svg b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.dev.svg new file mode 100644 index 000000000..c87b8cd1a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.dev.svg @@ -0,0 +1,153 @@ +<?xml version="1.0" standalone="no"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > +<svg xmlns="http://www.w3.org/2000/svg"> +<metadata> +This is a custom SVG font generated by IcoMoon. +<iconset grid="16"></iconset> +</metadata> +<defs> +<font id="tinymce" horiz-adv-x="512" > +<font-face units-per-em="512" ascent="480" descent="-32" /> +<missing-glyph horiz-adv-x="512" /> +<glyph class="hidden" unicode="" d="M0,480L 512 -32L0 -32 z" horiz-adv-x="0" /> +<glyph unicode="" d="M 464,416L 256,416L 240,448L 64,448L 32,384L 480,384 zM 452.17,128l 37.43,0 L 512,352L0,352 l 32-320l 242.040,0 C 221.599,50.888, 184,101.133, 184,160c0,74.991, 61.009,136, 136,136 + c 74.99,0, 136-61.009, 136-136C 456,149.161, 454.689,138.425, 452.17,128zM 501.498,23.125l-99.248,87.346C 410.977,124.931, 416,141.878, 416,160c0,53.020-42.98,96-96,96s-96-42.98-96-96 + s 42.98-96, 96-96c 18.122,0, 35.069,5.023, 49.529,13.75l 87.346-99.248c 11.481-13.339, 31.059-14.070, 43.503-1.626l 2.746,2.746 + C 515.568-7.934, 514.837,11.644, 501.498,23.125z M 320,98c-34.242,0-62,27.758-62,62s 27.758,62, 62,62s 62-27.758, 62-62 + S 354.242,98, 320,98z" /> +<glyph unicode="" d="M 384,352L 416,352L 416,320L 384,320zM 320,288L 352,288L 352,256L 320,256zM 320,224L 352,224L 352,192L 320,192zM 320,160L 352,160L 352,128L 320,128zM 256,224L 288,224L 288,192L 256,192zM 256,160L 288,160L 288,128L 256,128zM 192,160L 224,160L 224,128L 192,128zM 384,288L 416,288L 416,256L 384,256zM 384,224L 416,224L 416,192L 384,192zM 384,160L 416,160L 416,128L 384,128zM 384,96L 416,96L 416,64L 384,64zM 320,96L 352,96L 352,64L 320,64zM 256,96L 288,96L 288,64L 256,64zM 192,96L 224,96L 224,64L 192,64zM 128,96L 160,96L 160,64L 128,64z" data-tags="resize, dots" /> +<glyph unicode="" d="M 416,352l-96,0 L 320,384 L 224,480L0,480 l0-384 l 192,0 l0-128 l 320,0 L 512,256 L 416,352z M 416,306.745L 466.745,256L 416,256 L 416,306.745 z M 224,434.745L 274.745,384L 224,384 + L 224,434.745 z M 32,448l 160,0 l0-96 l 96,0 l0-224 L 32,128 L 32,448 z M 480,0L 224,0 l0,96 l 96,0 L 320,320 l 64,0 l0-96 l 96,0 L 480,0 z" data-tags="copy" /> +<glyph unicode="" d="M 128,448 L 384,448 L 384,384 L 320,384 L 320,0 L 256,0 L 256,384 L 192,384 L 192,0 L 128,0 L 128,224 C 66.144,224 16,274.144 16,336 C 16,397.856 66.144,448 128,448 ZM 480,32L 352,144L 480,256 z" data-tags="rtl" /> +<glyph unicode="" d="M 224,448 L 480,448 L 480,384 L 416,384 L 416,0 L 352,0 L 352,384 L 288,384 L 288,0 L 224,0 L 224,224 C 162.144,224 112,274.144 112,336 C 112,397.856 162.144,448 224,448 ZM 32,256L 160,144L 32,32 z" data-tags="ltr" /> +<glyph unicode="" d="M 192,448 L 448,448 L 448,384 L 384,384 L 384,0 L 320,0 L 320,384 L 256,384 L 256,0 L 192,0 L 192,224 C 130.144,224 80,274.144 80,336 C 80,397.856 130.144,448 192,448 Z" data-tags="visualchars" /> +<glyph unicode="" d="M 365.71,221.482 C 397.67,197.513 416,163.439 416,128 C 416,92.561 397.67,58.487 365.71,34.518 C 336.031,12.259 297.068,0 256,0 C 214.931,0 175.969,12.259 146.29,34.518 C 114.33,58.487 96,92.561 96,128 L 160,128 C 160,93.309 203.963,64 256,64 C 308.037,64 352,93.309 352,128 C 352,162.691 308.037,192 256,192 C 214.931,192 175.969,204.259 146.29,226.518 C 114.33,250.488 96,284.561 96,320 C 96,355.439 114.33,389.512 146.29,413.482 C 175.969,435.741 214.931,448 256,448 C 297.068,448 336.031,435.741 365.71,413.482 C 397.67,389.512 416,355.439 416,320 L 352,320 C 352,354.691 308.037,384 256,384 C 203.963,384 160,354.691 160,320 C 160,285.309 203.963,256 256,256 C 297.068,256 336.031,243.741 365.71,221.482 ZM0,224L 512,224L 512,192L0,192z" data-tags="strikethrough" /> +<glyph unicode="" d="M 352,448 L 416,448 L 416,240 C 416,160.471 344.366,96 256,96 C 167.635,96 96,160.471 96,240 L 96,448 L 160,448 L 160,240 C 160,219.917 169.119,200.648 185.677,185.747 C 204.125,169.145 229.1,160 256,160 C 282.9,160 307.875,169.145 326.323,185.747 C 342.881,200.648 352,219.917 352,240 L 352,448 ZM 96,64L 416,64L 416,0L 96,0z" data-tags="underline" /> +<glyph unicode="" d="M 448,448 L 448,416 L 384,416 L 224,32 L 288,32 L 288,0 L 64,0 L 64,32 L 128,32 L 288,416 L 224,416 L 224,448 Z" data-tags="italic" /> +<glyph unicode="" d="M 353.94,237.674C 372.689,259.945, 384,288.678, 384,320c0,70.58-57.421,128-128,128l-64,0 l-64,0 L 96,448 l0-448 l 32,0 l 64,0 l 96,0 + c 70.579,0, 128,57.421, 128,128C 416,174.478, 391.101,215.248, 353.94,237.674z M 192,384l 50.75,0 c 27.984,0, 50.75-28.71, 50.75-64 + s-22.766-64-50.75-64L 192,256 L 192,384 z M 271.5,64L 192,64 L 192,192 l 79.5,0 c 29.225,0, 53-28.71, 53-64S 300.725,64, 271.5,64z" data-tags="bold0" /> +<glyph unicode="" d="M 192,64L 288,64L 288-32L 192-32zM 400,448 C 426.51,448 448,426.51 448,400 L 448,256 L 288,160 L 288,96 L 192,96 L 192,192 L 352,288 L 352,352 L 96,352 L 96,448 L 400,448 Z" /> +<glyph unicode="" d="M 288,448 C 411.712,448 512,347.712 512,224 C 512,100.288 411.712,0 288,0 L 288,48 C 335.012,48 379.209,66.307 412.451,99.549 C 445.693,132.791 464,176.988 464,224 C 464,271.011 445.693,315.209 412.451,348.451 C 379.209,381.693 335.012,400 288,400 C 240.989,400 196.791,381.693 163.549,348.451 C 137.979,322.882 121.258,290.828 114.896,256 L 208,256 L 96,128 L -16,256 L 66.285,256 C 81.815,364.551 175.154,448 288,448 ZM 384,256 L 384,192 L 256,192 L 256,352 L 320,352 L 320,256 Z" data-tags="restoredraft" /> +<glyph unicode="" d="M0,224L 64,224L 64,192L0,192zM 96,224L 192,224L 192,192L 96,192zM 224,224L 288,224L 288,192L 224,192zM 320,224L 416,224L 416,192L 320,192zM 448,224L 512,224L 512,192L 448,192zM 440,480 L 448,256 L 64,256 L 72,480 L 88,480 L 96,288 L 416,288 L 424,480 ZM 72-32 L 64,160 L 448,160 L 440-32 L 424-32 L 416,128 L 96,128 L 88-32 Z" data-tags="pagebreak" /> +<glyph unicode="" d="M 192,384L 256,384L 256,352L 192,352zM 288,384L 352,384L 352,352L 288,352zM 448,384 L 448,256 L 352,256 L 352,288 L 416,288 L 416,352 L 384,352 L 384,384 ZM 160,288L 224,288L 224,256L 160,256zM 256,288L 320,288L 320,256L 256,256zM 96,352 L 96,288 L 128,288 L 128,256 L 64,256 L 64,384 L 160,384 L 160,352 ZM 192,192L 256,192L 256,160L 192,160zM 288,192L 352,192L 352,160L 288,160zM 448,192 L 448,64 L 352,64 L 352,96 L 416,96 L 416,160 L 384,160 L 384,192 ZM 160,96L 224,96L 224,64L 160,64zM 256,96L 320,96L 320,64L 256,64zM 96,160 L 96,96 L 128,96 L 128,64 L 64,64 L 64,192 L 160,192 L 160,160 ZM 480,448 L 32,448 L 32,0 L 480,0 L 480,448 Z M 512,480 L 512,480 L 512-32 L 0-32 L 0,480 L 512,480 Z" data-tags="template" /> +<glyph unicode="" d="M 224,192 L 128,192 L 128,256 L 224,256 L 224,352 L 288,352 L 288,256 L 384,256 L 384,192 L 288,192 L 288,96 L 224,96 ZM 512,160 L 512-32 L 0-32 L 0,160 L 64,160 L 64,32 L 448,32 L 448,160 Z" data-tags="nonbreaking" /> +<glyph unicode="" d="M 64,352l 64,0 l0-96 l 32,0 L 160,448 c0,17.6-14.4,32-32,32L 64,480 C 46.4,480, 32,465.6, 32,448l0-192 l 32,0 L 64,352 z M 64,448l 64,0 l0-64 L 64,384 L 64,448 z M 480,448L 480,480 l-96,0 + c-17.601,0-32-14.4-32-32l0-160 c0-17.6, 14.399-32, 32-32l 96,0 l0,32 l-96,0 L 384,448 L 480,448 z M 320,400L 320,448 c0,17.6-14.4,32-32,32l-96,0 l0-224 l 96,0 + c 17.6,0, 32,14.4, 32,32l0,48 c0,17.6-4.4,32-22,32C 315.6,368, 320,382.4, 320,400z M 288,288l-64,0 l0,64 l 64,0 L 288,288 z M 288,384l-64,0 L 224,448 l 64,0 L 288,384 zM 416,192 L 208-32 L 96,112 L 137,147 L 208,73 L 384,224 Z" data-tags="spellchecker" /> +<glyph unicode="" d="M 512,480 L 512,288 L 442.87,357.13 L 336.87,251.13 L 283.13,304.87 L 389.13,410.87 L 320,480 ZM 122.87,410.87 L 228.87,304.87 L 175.13,251.13 L 69.13,357.13 L 0,288 L 0,480 L 192,480 ZM 442.87,90.87 L 512,160 L 512-32 L 320-32 L 389.13,37.13 L 283.13,143.13 L 336.87,196.87 ZM 228.87,143.13 L 122.87,37.13 L 192-32 L 0-32 L 0,160 L 69.13,90.87 L 175.13,196.87 Z" data-tags="fullscreen" /> +<glyph unicode="" d="M 128,448L 384,448L 384,384L 128,384zM 480,352L 32,352 C 14.4,352,0,337.6,0,320l0-160 c0-17.6, 14.398-32, 32-32l 96,0 l0-128 l 256,0 L 384,128 l 96,0 c 17.6,0, 32,14.4, 32,32L 512,320 + C 512,337.6, 497.6,352, 480,352z M 352,32L 160,32 L 160,192 l 192,0 L 352,32 z M 487.2,304c0-12.813-10.387-23.2-23.199-23.2 + c-12.813,0-23.201,10.387-23.201,23.2s 10.388,23.2, 23.201,23.2C 476.814,327.2, 487.2,316.813, 487.2,304z" data-tags="print" /> +<glyph unicode="" d="M 256,480C 114.615,480,0,365.386,0,224c0-141.385, 114.614-256, 256-256c 141.385,0, 256,114.615, 256,256 + C 512,365.386, 397.385,480, 256,480z M 256,8c-119.293,0-216,96.706-216,216c0,119.293, 96.707,216, 216,216c 119.295,0, 216-96.707, 216-216 + C 472,104.706, 375.295,8, 256,8z M 192,320c0-17.673-14.327-32-32-32s-32,14.327-32,32s 14.327,32, 32,32S 192,337.673, 192,320z + M 384,320c0-17.673-14.326-32-32-32s-32,14.327-32,32s 14.326,32, 32,32S 384,337.673, 384,320zM 256,154 C 326.537,154 387.344,182.766 415.231,215.596 C 404.795,129.986 337.087,64 256,64 C 174.941,64 107.251,130.013 96.778,215.584 C 124.671,182.761 185.471,154 256,154 Z" data-tags="emoticons" /> +<glyph unicode="" d="M 352,32 L 480,32 L 512,96 L 512-32 L 320-32 L 320,75.107 C 385.556,103.349 432,173.688 432,256 C 432,363.216 353.201,447.133 256,447.133 C 158.797,447.133 80,363.217 80,256 C 80,173.688 126.443,103.349 192,75.107 L 192-32 L 0-32 L 0,96 L 32,32 L 160,32 L 160,48.295 C 66.185,81.525 0,161.996 0,256 C 0,379.712 114.615,480 256,480 C 397.385,480 512,379.712 512,256 C 512,161.996 445.815,81.525 352,48.295 L 352,32 Z" data-tags="charmap" /> +<glyph unicode="" d="M 384,377 L 384,352 L 448,352 L 448,320 L 352,320 L 352,393 L 416,423 L 416,448 L 352,448 L 352,480 L 448,480 L 448,407 ZM 338,352L 270,352L 176,258L 82,352L 14,352L 142,224L 14,96L 82,96L 176,190L 270,96L 338,96L 210,224 z" data-tags="sup" /> +<glyph unicode="" d="M 384,25 L 384,0 L 448,0 L 448-32 L 352-32 L 352,41 L 416,71 L 416,96 L 352,96 L 352,128 L 448,128 L 448,55 ZM 338,352L 270,352L 176,258L 82,352L 14,352L 142,224L 14,96L 82,96L 176,190L 270,96L 338,96L 210,224 z" data-tags="sub" /> +<glyph unicode="" d="M0,32L 288,32L 288-32L0-32zM 96,480L 448,480L 448,416L 96,416zM 138.694,64 L 241.038,456.082 L 302.963,439.918 L 204.838,64 ZM 464.887-32 L 400,32.887 L 335.113-32 L 304-0.887 L 368.887,64 L 304,128.887 L 335.113,160 L 400,95.113 L 464.887,160 L 496,128.887 L 431.113,64 L 496-0.887 Z" data-tags="removeformat" /> +<glyph unicode="" d="M0,256L 512,256L 512,192L0,192z" data-tags="hr" /> +<glyph unicode="" d="M0,448l0-448 l 512,0 L 512,448 L0,448 z M 192,160l0,96 l 128,0 l0-96 L 192,160 z M 320,128l0-96 L 192,32 l0,96 L 320,128 z M 320,384l0-96 L 192,288 L 192,384 L 320,384 z M 160,384l0-96 L 32,288 L 32,384 L 160,384 z + M 32,256l 128,0 l0-96 L 32,160 L 32,256 z M 352,256l 128,0 l0-96 L 352,160 L 352,256 z M 352,288L 352,384 l 128,0 l0-96 L 352,288 z M 32,128l 128,0 l0-96 L 32,32 L 32,128 z M 352,32l0,96 l 128,0 l0-96 L 352,32 z" data-tags="table" /> +<glyph unicode="" d="M 161.009,64l 28.8,96l 132.382,0 l 28.8-96l 56.816,0 L 311.809,384L 200.191,384 l-96-320L 161.009,64 z M 237.809,320l 36.382,0 l 28.8-96l-93.982,0 + L 237.809,320z" data-tags="forecolor" /> +<glyph unicode="" d="M 256,320C 151.316,320, 58.378,269.722,0,192c 58.378-77.723, 151.316-128, 256-128c 104.684,0, 197.622,50.277, 256,128 + C 453.622,269.722, 360.684,320, 256,320z M 224,256c 17.673,0, 32-14.327, 32-32s-14.327-32-32-32s-32,14.327-32,32S 206.327,256, 224,256z + M 386.808,127.352c-19.824-10.129-40.826-17.931-62.423-23.188C 302.141,98.746, 279.134,96, 256,96 + c-23.133,0-46.141,2.746-68.384,8.162c-21.597,5.259-42.599,13.061-62.423,23.188c-31.51,16.101-60.111,38.205-83.82,64.649 + c 23.709,26.444, 52.31,48.55, 83.82,64.649c 16.168,8.261, 33.121,14.973, 50.541,20.020C 165.79,261.547, 160,243.451, 160,224 + c0-53.020, 42.981-96, 96-96c 53.019,0, 96,42.98, 96,96c0,19.451-5.791,37.547-15.733,52.67c 17.419-5.048, 34.372-11.76, 50.541-20.021 + c 31.511-16.099, 60.109-38.204, 83.819-64.649C 446.917,165.557, 418.318,143.45, 386.808,127.352z M 430.459,358.139 + C 376.099,385.916, 317.403,400, 256,400c-61.403,0-120.099-14.084-174.459-41.861C 52.155,343.123, 24.675,324.187,0,302.101l0-54.603 + c 27.669,29.283, 60.347,53.877, 96.097,72.145C 145.907,345.095, 199.706,358, 256,358s 110.093-12.905, 159.902-38.358 + c 35.751-18.268, 68.429-42.862, 96.098-72.145L 512,302.1 C 487.325,324.187, 459.846,343.123, 430.459,358.139z" data-tags="preview" /> +<glyph unicode="" d="M 256,384C 149.962,384, 64,298.039, 64,192s 85.961-192, 192-192c 106.037,0, 192,85.961, 192,192S 362.037,384, 256,384z + M 357.822,90.177C 330.626,62.979, 294.464,48, 256,48s-74.625,14.979-101.823,42.177C 126.979,117.374, 112,153.536, 112,192 + s 14.979,74.625, 42.177,101.823C 181.375,321.021, 217.536,336, 256,336s 74.626-14.979, 101.821-42.177 + C 385.022,266.625, 400,230.464, 400,192S 385.021,117.374, 357.822,90.177zM 162.965,378.069l-21.47,42.939C 92.058,396.24, 51.76,355.942, 26.992,306.504l 42.938-21.47 + C 90.054,325.202, 122.796,357.945, 162.965,378.069zM 442.067,285.035l 42.939,21.469C 460.24,355.942, 419.943,396.24, 370.504,421.008l-21.472-42.939 + C 389.201,357.945, 421.944,325.203, 442.067,285.035zM 256,288l-32,0 l0-96 c0-5.055, 2.35-9.555, 6.011-12.486l-0.006-0.008l 80-64l 19.988,24.988L 256,199.689L 256,288 z" data-tags="inserttime" /> +<glyph unicode="" d="M 160,352L 32,224L 160,96L 224,96L 96,224L 224,352 zM 352,352L 288,352L 416,224L 288,96L 352,96L 480,224 z" data-tags="code" /> +<glyph unicode="" d="M 224,128L 288,128L 288,64L 224,64zM 352,352 C 369.673,352 384,337.673 384,320 L 384,224 L 288,160 L 224,160 L 224,192 L 320,256 L 320,288 L 160,288 L 160,352 L 352,352 ZM 256,432 C 200.441,432 148.208,410.364 108.922,371.078 C 69.636,331.792 48,279.559 48,224 C 48,168.441 69.636,116.208 108.922,76.922 C 148.208,37.636 200.441,16 256,16 C 311.559,16 363.792,37.636 403.078,76.922 C 442.364,116.208 464,168.441 464,224 C 464,279.559 442.364,331.792 403.078,371.078 C 363.792,410.364 311.559,432 256,432 Z M 256,480 L 256,480 C 397.385,480 512,365.385 512,224 C 512,82.615 397.385-32 256-32 C 114.615-32 0,82.615 0,224 C 0,365.385 114.615,480 256,480 Z" data-tags="help" /> +<glyph unicode="" d="M0,416l0-384 l 512,0 L 512,416 L0,416 z M 96,64L 32,64 l0,64 l 64,0 L 96,64 z M 96,192L 32,192 l0,64 l 64,0 L 96,192 z M 96,320L 32,320 L 32,384 l 64,0 L 96,320 z M 384,64L 128,64 L 128,384 l 256,0 L 384,64 z + M 480,64l-64,0 l0,64 l 64,0 L 480,64 z M 480,192l-64,0 l0,64 l 64,0 L 480,192 z M 480,320l-64,0 L 416,384 l 64,0 L 480,320 zM 192,320L 192,128L 320,224 z" data-tags="media" /> +<glyph unicode="" d="M0,416l0-416 l 512,0 L 512,416 L0,416 z M 480,32L 32,32 L 32,384 l 448,0 L 480,32 zM 352,304A48,48 3060 1 0 448,304A48,48 3060 1 0 352,304zM 448,64 L 64,64 L 160,320 L 288,160 L 352,208 Z" data-tags="image" /> +<glyph unicode="" d="M 96,480l0-512 l 160,160l 160-160L 416,480 L 96,480 z M 384,45.255l-128,128l-128-128L 128,448 l 256,0 L 384,45.255 z" data-tags="anchor" /> +<glyph unicode="" d="M 238.444,142.443c 2.28-4.524, 3.495-9.579, 3.495-14.848c0-8.808-3.372-17.029-9.496-23.154l-81.69-81.69 + c-6.124-6.124-14.348-9.496-23.154-9.496s-17.030,3.372-23.154,9.496l-49.69,49.69c-6.124,6.125-9.496,14.348-9.496,23.154 + s 3.372,17.030, 9.496,23.154l 81.69,81.691c 6.124,6.123, 14.348,9.496, 23.154,9.496c 5.269,0, 10.322-1.215, 14.848-3.494l 32.669,32.668 + c-13.935,10.705-30.72,16.080-47.517,16.080c-19.993,0-39.986-7.583-55.154-22.751l-81.69-81.691 + c-30.335-30.335-30.335-79.975,0-110.309l 49.69-49.691c 15.167-15.166, 35.16-22.75, 55.153-22.75 + c 19.994,0, 39.987,7.584, 55.154,22.751l 81.69,81.69c 27.91,27.91, 30.119,72.149, 6.672,102.673L 238.444,142.443zM 489.248,407.558l-49.69,49.691C 424.391,472.417, 404.398,480, 384.404,480c-19.993,0-39.985-7.583-55.153-22.751l-81.691-81.691 + c-27.91-27.91-30.119-72.149-6.671-102.671l 32.669,32.67c-2.279,4.525-3.494,9.58-3.494,14.847c0,8.808, 3.372,17.030, 9.496,23.154 + l 81.691,81.691c 6.123,6.124, 14.347,9.497, 23.153,9.497c 8.808,0, 17.030-3.373, 23.154-9.497l 49.69-49.691 + c 6.124-6.124, 9.496-14.347, 9.496-23.154c0-8.807-3.372-17.030-9.496-23.154l-81.69-81.691c-6.124-6.124-14.347-9.496-23.154-9.496 + c-5.268,0-10.322,1.215-14.848,3.495l-32.669-32.669c 13.936-10.705, 30.72-16.080, 47.517-16.080c 19.994,0, 39.987,7.584, 55.154,22.752 + l 81.69,81.69C 519.584,327.584, 519.584,377.223, 489.248,407.558zM 116.684,340.688L 20.687,436.685L 43.315,459.313L 139.312,363.316zM 192,480L 224,480L 224,384L 192,384zM0,288L 96,288L 96,256L0,256zM 395.316,107.312L 491.314,11.314L 468.686-11.314L 372.688,84.684zM 288,64L 320,64L 320-32L 288-32zM 416,192L 512,192L 512,160L 416,160z" data-tags="unlink" /> +<glyph unicode="" d="M 160,128c 8.8-8.8, 23.637-8.363, 32.971,0.971L 351.030,287.029C 360.364,296.363, 360.8,311.2, 352,320 + s-23.637,8.363-32.971-0.971L 160.971,160.971C 151.637,151.637, 151.2,136.8, 160,128zM 238.444,142.444c 2.28-4.525, 3.495-9.58, 3.495-14.848c0-8.808-3.372-17.030-9.496-23.154l-81.691-81.691 + c-6.124-6.124-14.347-9.496-23.154-9.496s-17.030,3.372-23.154,9.496l-49.691,49.691c-6.124,6.124-9.496,14.347-9.496,23.154 + s 3.372,17.030, 9.496,23.154l 81.691,81.691c 6.124,6.124, 14.347,9.497, 23.154,9.497c 5.268,0, 10.322-1.215, 14.848-3.495l 32.669,32.669 + c-13.935,10.705-30.72,16.080-47.517,16.080c-19.993,0-39.986-7.583-55.154-22.751l-81.691-81.691 + c-30.335-30.335-30.335-79.974,0-110.309l 49.691-49.691C 87.611-24.416, 107.604-32, 127.597-32 + c 19.994,0, 39.987,7.584, 55.154,22.751l 81.691,81.691c 27.91,27.91, 30.119,72.149, 6.672,102.672L 238.444,142.444zM 489.249,407.558l-49.691,49.691C 424.391,472.417, 404.398,480, 384.404,480c-19.993,0-39.986-7.583-55.154-22.751l-81.691-81.691 + c-27.91-27.91-30.119-72.149-6.671-102.671l 32.669,32.67c-2.279,4.525-3.494,9.58-3.494,14.847c0,8.808, 3.372,17.030, 9.496,23.154 + l 81.691,81.691c 6.124,6.124, 14.347,9.497, 23.154,9.497s 17.030-3.373, 23.154-9.497l 49.691-49.691 + c 6.124-6.124, 9.496-14.347, 9.496-23.154s-3.372-17.030-9.496-23.154l-81.691-81.691c-6.124-6.124-14.347-9.496-23.154-9.496 + c-5.268,0-10.322,1.215-14.848,3.495l-32.669-32.669c 13.936-10.705, 30.72-16.080, 47.517-16.080c 19.994,0, 39.987,7.584, 55.154,22.751 + l 81.691,81.691C 519.584,327.584, 519.584,377.223, 489.249,407.558z" data-tags="link" /> +<glyph unicode="" d="M 288,355.814L 288,480 l 192-192L 288,96L 288,222.912 C 64.625,228.153, 74.206,71.016, 131.070-32 + C-9.286,119.707, 20.52,362.785, 288,355.814z" data-tags="redo" /> +<glyph unicode="" d="M 380.931-32C 437.794,71.016, 447.375,228.153, 224,222.912L 224,96 L 32,288L 224,480l0-124.186 + C 491.481,362.785, 521.285,119.707, 380.931-32z" data-tags="undo" /> +<glyph unicode="" d="M 112.5,256 C 174.356,256 224.5,205.855 224.5,144 C 224.5,82.144 174.356,32 112.5,32 C 50.644,32 0.5,82.144 0.5,144 L 0,160 C 0,283.712 100.288,384 224,384 L 224,320 C 181.263,320 141.083,303.357 110.863,273.137 C 105.046,267.319 99.737,261.129 94.948,254.627 C 100.667,255.527 106.528,256 112.5,256 ZM 400.5,256 C 462.355,256 512.5,205.855 512.5,144 C 512.5,82.144 462.355,32 400.5,32 C 338.645,32 288.5,82.144 288.5,144 L 288,160 C 288,283.712 388.288,384 512,384 L 512,320 C 469.263,320 429.083,303.357 398.863,273.137 C 393.045,267.319 387.736,261.129 382.947,254.627 C 388.667,255.527 394.527,256 400.5,256 Z" data-tags="blockquote" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM 192,352L 512,352L 512,288L 192,288zM 192,256L 512,256L 512,192L 192,192zM 192,160L 512,160L 512,96L 192,96zM0,64L 512,64L 512,0L0,0zM 128,320 L 128,128 L 0,224 Z" data-tags="outdent" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM 192,352L 512,352L 512,288L 192,288zM 192,256L 512,256L 512,192L 192,192zM 192,160L 512,160L 512,96L 192,96zM0,64L 512,64L 512,0L0,0zM 0,128 L 0,320 L 128,224 Z" data-tags="indent" /> +<glyph unicode="" d="M 192,64L 512,64L 512,0L 192,0zM 192,256L 512,256L 512,192L 192,192zM 192,448L 512,448L 512,384L 192,384zM 96,480 L 96,352 L 64,352 L 64,448 L 32,448 L 32,480 ZM 64,217 L 64,192 L 128,192 L 128,160 L 32,160 L 32,233 L 96,263 L 96,288 L 32,288 L 32,320 L 128,320 L 128,247 ZM 128,128 L 128-32 L 32-32 L 32,0 L 96,0 L 96,32 L 32,32 L 32,64 L 96,64 L 96,96 L 32,96 L 32,128 Z" data-tags="numlist" /> +<glyph unicode="" d="M 192,448l 320,0 l0-64 L 192,384 L 192,448 z M 192,256l 320,0 l0-64 L 192,192 L 192,256 z M 192,64l 320,0 l0-64 L 192,0 L 192,64 zM0,416A64,64 3060 1 0 128,416A64,64 3060 1 0 0,416zM0,224A64,64 3060 1 0 128,224A64,64 3060 1 0 0,224zM0,32A64,64 3060 1 0 128,32A64,64 3060 1 0 0,32z" data-tags="bullist" /> +<glyph unicode="" d="M 32,480L 224,480L 224,448L 32,448zM 288,480L 480,480L 480,448L 288,448zM 476,320l-28,0 L 448,448 L 320,448 l0-128 L 192,320 L 192,448 L 64,448 l0-128 L 36,320 c-19.8,0-36-16.2-36-36l0-280 c0-19.8, 16.2-36, 36-36l 152,0 c 19.8,0, 36,16.2, 36,36L 224,192 l 64,0 + l0-188 c0-19.8, 16.2-36, 36-36l 152,0 c 19.8,0, 36,16.2, 36,36L 512,284 C 512,303.8, 495.8,320, 476,320z M 174,0L 50,0 c-9.9,0-18,7.2-18,16 + s 8.1,16, 18,16l 124,0 c 9.9,0, 18-7.2, 18-16S 183.9,0, 174,0z M 272,224l-32,0 c-8.8,0-16,7.2-16,16s 7.2,16, 16,16l 32,0 c 8.8,0, 16-7.2, 16-16 + S 280.8,224, 272,224z M 462,0L 338,0 c-9.9,0-18,7.2-18,16s 8.1,16, 18,16l 124,0 c 9.9,0, 18-7.2, 18-16S 471.9,0, 462,0z" data-tags="searchreplace" /> +<glyph unicode="" d="M 416,320L 416,400 c0,8.8-7.2,16-16,16L 288,416 L 288,448 c0,17.6-14.4,32-32,32l-64,0 c-17.602,0-32-14.4-32-32l0-32 L 48,416 c-8.801,0-16-7.2-16-16l0-320 + c0-8.8, 7.199-16, 16-16l 144,0 l0-96 l 224,0 l 96,96L 512,320 L 416,320 z M 192,447.943c 0.017,0.019, 0.036,0.039, 0.057,0.057l 63.884,0 + c 0.021-0.018, 0.041-0.038, 0.059-0.057L 256,416 l-64,0 L 192,447.943 z M 96,352L 96,384 l 256,0 l0-32 L 96,352 z M 416,13.255L 416,64 l 50.745,0 L 416,13.255z M 480,96l-96,0 l0-96 + L 224,0 L 224,288 l 256,0 L 480,96 z" data-tags="paste" /> +<glyph unicode="" d="M 445.387,125.423c-22.827,22.778-51.864,34.536-78.973,34.536l-14.556,0 l-31.952,32.004l 127.81,128.019 + c 31.952,32.005, 31.952,96.014,0,128.019L 256.001,255.973L 64.285,448c-31.952-32.004-31.952-96.014,0-128.019l 127.811-128.017 + l-31.953-32.004l-14.557,0 c-27.11,0-56.146-11.759-78.974-34.538c-40.811-40.721-46.325-101.242-12.315-135.175 + C 69.282-24.704, 89.441-32, 110.795-32c 27.108,0, 56.145,11.757, 78.973,34.536c 26.792,26.732, 38.371,62, 33.542,92.674l 32.692,32.744 + l 32.688-32.744c-4.828-30.674, 6.753-65.941, 33.542-92.674C 345.063-20.243, 374.098-32, 401.206-32 + c 21.354,0, 41.512,7.296, 56.497,22.248C 491.713,24.181, 486.197,84.702, 445.387,125.423z M 176.512,57.231 + c-3.849-8.941-9.505-17.173-16.813-24.463c-7.318-7.302-15.586-12.959-24.574-16.812c-8.066-3.458-16.48-5.284-24.331-5.284 + c-7.573,0-18.306,1.701-26.431,9.806c-8.068,8.052-9.76,18.659-9.76,26.144c0,7.771, 1.821,16.105, 5.263,24.106 + c 3.85,8.942, 9.507,17.173, 16.813,24.463c 7.317,7.303, 15.586,12.957, 24.575,16.812c 8.067,3.457, 16.48,5.284, 24.332,5.284 + c 7.573,0, 18.306-1.7, 26.429-9.807c 8.067-8.049, 9.761-18.658, 9.761-26.142C 181.777,73.567, 179.957,65.23, 176.512,57.231z + M 256.002,146.702c-24.957,0-45.188,20.266-45.188,45.263c0,24.996, 20.231,45.26, 45.188,45.26s 45.186-20.264, 45.186-45.26 + C 301.188,166.966, 280.958,146.702, 256.002,146.702z M 427.636,20.479c-8.124-8.104-18.856-9.806-26.43-9.806 + c-7.852,0-16.265,1.826-24.333,5.284c-8.986,3.853-17.254,9.51-24.571,16.812c-7.307,7.29-12.963,15.521-16.813,24.463 + c-3.443,7.999-5.263,16.336-5.263,24.106c0,7.483, 1.692,18.094, 9.76,26.143c 8.123,8.104, 18.856,9.807, 26.43,9.807 + c 7.85,0, 16.265-1.827, 24.33-5.284c 8.989-3.854, 17.258-9.509, 24.575-16.812c 7.305-7.29, 12.962-15.521, 16.813-24.463 + c 3.442-7.999, 5.263-16.335, 5.263-24.106C 437.396,39.138, 435.702,28.53, 427.636,20.479z" data-tags="cut" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM0,352L 512,352L 512,288L0,288zM0,256L 512,256L 512,192L0,192zM0,160L 512,160L 512,96L0,96zM0,64L 512,64L 512,0L0,0z" data-tags="alignjustify" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM 192,352L 512,352L 512,288L 192,288zM 192,160L 512,160L 512,96L 192,96zM0,256L 512,256L 512,192L0,192zM0,64L 512,64L 512,0L0,0z" data-tags="alignright" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM 96,352L 416,352L 416,288L 96,288zM 96,160L 416,160L 416,96L 96,96zM0,256L 512,256L 512,192L0,192zM0,64L 512,64L 512,0L0,0z" data-tags="aligncenter" /> +<glyph unicode="" d="M0,448L 512,448L 512,384L0,384zM0,352L 320,352L 320,288L0,288zM0,160L 320,160L 320,96L0,96zM0,256L 512,256L 512,192L0,192zM0,64L 512,64L 512,0L0,0z" data-tags="alignleft" /> +<glyph unicode="" d="M 512,183.771l0,80.458 l-79.572,7.957c-4.093,15.021-10.044,29.274-17.605,42.49l 52.298,63.919L 410.595,435.12l-63.918-52.298 + c-13.217,7.562-27.471,13.513-42.491,17.604L 296.229,480l-80.458,0 l-7.957-79.573c-15.021-4.093-29.274-10.043-42.49-17.604 + L 101.405,435.12L 44.88,378.595l 52.298-63.918c-7.562-13.216-13.513-27.47-17.605-42.49L0,264.229l0-80.458 l 79.573-7.957 + c 4.093-15.021, 10.043-29.274, 17.605-42.491L 44.88,69.405l 56.524-56.524l 63.919,52.298c 13.216-7.562, 27.47-13.514, 42.49-17.605 + L 215.771-32l 80.458,0 l 7.957,79.572c 15.021,4.093, 29.274,10.044, 42.491,17.605l 63.918-52.298l 56.524,56.524l-52.298,63.918 + c 7.562,13.217, 13.514,27.471, 17.605,42.49L 512,183.771z M 352,192l-64-64l-64,0 l-64,64l0,64 l 64,64l 64,0 l 64-64L 352,192 z" data-tags="fullpage" /> +<glyph unicode="" d="M 451.716,380.285l-71.432,71.431C 364.728,467.272, 334,480, 312,480L 72,480 C 50,480, 32,462, 32,440l0-432 c0-22, 18-40, 40-40l 368,0 c 22,0, 40,18, 40,40 + L 480,312 C 480,334, 467.272,364.729, 451.716,380.285z M 429.089,357.657c 1.565-1.565, 3.125-3.487, 4.64-5.657L 352,352 L 352,433.728 + c 2.17-1.515, 4.092-3.075, 5.657-4.64L 429.089,357.657z M 448,8c0-4.336-3.664-8-8-8L 72,0 c-4.336,0-8,3.664-8,8L 64,440 c0,4.336, 3.664,8, 8,8 + l 240,0 c 2.416,0, 5.127-0.305, 8-0.852L 320,320 l 127.148,0 c 0.547-2.873, 0.852-5.583, 0.852-8L 448,8 z" data-tags="newdocument" /> +<glyph unicode="" d="M 448,480L0,480 l0-512 l 512,0 L 512,416 L 448,480z M 256,416l 64,0 l0-128 l-64,0 L 256,416 z M 448,32L 64,32 L 64,416 l 32,0 l0-160 l 288,0 L 384,416 l 37.489,0 L 448,389.491L 448,32 z" data-tags="save" /> +<glyph unicode="" d="M 64,208L 208,64L 448,304L 384,368L 208,192L 128,272 z" /> +<glyph unicode="" d="M 256,224L 256,160L 272,160L 288,192L 320,192L 320,64L 296,64L 296,32L 408,32L 408,64L 384,64L 384,192L 416,192L 432,160L 448,160L 448,224 zM 416,320L 416,400 c0,8.8-7.2,16-16,16L 288,416 L 288,448 c0,17.6-14.4,32-32,32l-64,0 c-17.602,0-32-14.4-32-32l0-32 L 48,416 c-8.801,0-16-7.2-16-16l0-320 + c0-8.8, 7.199-16, 16-16l 144,0 l0-96 l 320,0 L 512,320 L 416,320 z M 192,447.943c 0.017,0.019, 0.036,0.039, 0.057,0.057l 63.884,0 + c 0.021-0.018, 0.041-0.038, 0.059-0.057L 256,416 l-64,0 L 192,447.943 z M 96,352L 96,384 l 256,0 l0-32 L 96,352 z M 480,0L 224,0 L 224,288 l 256,0 L 480,0 z" data-tags="pastetext" /> +<glyph unicode=" " horiz-adv-x="256" /> +</font></defs></svg>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.eot b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.eot Binary files differnew file mode 100644 index 000000000..c1085bfd2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.eot diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.svg b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.svg new file mode 100644 index 000000000..feb9ba38d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.svg @@ -0,0 +1,63 @@ +<?xml version="1.0" standalone="no"?> +<!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > +<svg xmlns="http://www.w3.org/2000/svg"> +<metadata>Generated by IcoMoon</metadata> +<defs> +<font id="tinymce" horiz-adv-x="512"> +<font-face units-per-em="512" ascent="480" descent="-32" /> +<missing-glyph horiz-adv-x="512" /> +<glyph unicode=" " d="" horiz-adv-x="256" /> +<glyph unicode="" d="M448 480h-448v-512h512v448l-64 64zM256 416h64v-128h-64v128zM448 32h-384v384h32v-160h288v160h37.489l26.511-26.509v-357.491z" /> +<glyph unicode="" d="M451.716 380.285l-71.432 71.431c-15.556 15.556-46.284 28.284-68.284 28.284h-240c-22 0-40-18-40-40v-432c0-22 18-40 40-40h368c22 0 40 18 40 40v304c0 22-12.728 52.729-28.284 68.285zM429.089 357.657c1.565-1.565 3.125-3.487 4.64-5.657h-81.729v81.728c2.17-1.515 4.092-3.075 5.657-4.64l71.432-71.431zM448 8c0-4.336-3.664-8-8-8h-368c-4.336 0-8 3.664-8 8v432c0 4.336 3.664 8 8 8h240c2.416 0 5.127-0.305 8-0.852v-127.148h127.148c0.547-2.873 0.852-5.583 0.852-8v-304z" /> +<glyph unicode="" d="M512 183.771v80.458l-79.572 7.957c-4.093 15.021-10.044 29.274-17.605 42.49l52.298 63.919-56.526 56.525-63.918-52.298c-13.217 7.562-27.471 13.513-42.491 17.604l-7.957 79.574h-80.458l-7.957-79.573c-15.021-4.093-29.274-10.043-42.49-17.604l-63.919 52.297-56.525-56.525 52.298-63.918c-7.562-13.216-13.513-27.47-17.605-42.49l-79.573-7.958v-80.458l79.573-7.957c4.093-15.021 10.043-29.274 17.605-42.491l-52.298-63.918 56.524-56.524 63.919 52.298c13.216-7.562 27.47-13.514 42.49-17.605l7.958-79.574h80.458l7.957 79.572c15.021 4.093 29.274 10.044 42.491 17.605l63.918-52.298 56.524 56.524-52.298 63.918c7.562 13.217 13.514 27.471 17.605 42.49l79.574 7.96zM352 192l-64-64h-64l-64 64v64l64 64h64l64-64v-64z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM0 352h320v-64h-320zM0 160h320v-64h-320zM0 256h512v-64h-512zM0 64h512v-64h-512z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM96 352h320v-64h-320zM96 160h320v-64h-320zM0 256h512v-64h-512zM0 64h512v-64h-512z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM192 352h320v-64h-320zM192 160h320v-64h-320zM0 256h512v-64h-512zM0 64h512v-64h-512z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM0 352h512v-64h-512zM0 256h512v-64h-512zM0 160h512v-64h-512zM0 64h512v-64h-512z" /> +<glyph unicode="" d="M445.387 125.423c-22.827 22.778-51.864 34.536-78.973 34.536h-14.556l-31.952 32.004 127.81 128.019c31.952 32.005 31.952 96.014 0 128.019l-191.715-192.028-191.716 192.027c-31.952-32.004-31.952-96.014 0-128.019l127.811-128.017-31.953-32.004h-14.557c-27.11 0-56.146-11.759-78.974-34.538-40.811-40.721-46.325-101.242-12.315-135.175 14.985-14.951 35.144-22.247 56.498-22.247 27.108 0 56.145 11.757 78.973 34.536 26.792 26.732 38.371 62 33.542 92.674l32.692 32.744 32.688-32.744c-4.828-30.674 6.753-65.941 33.542-92.674 22.831-22.779 51.866-34.536 78.974-34.536 21.354 0 41.512 7.296 56.497 22.248 34.010 33.933 28.494 94.454-12.316 135.175zM176.512 57.231c-3.849-8.941-9.505-17.173-16.813-24.463-7.318-7.302-15.586-12.959-24.574-16.812-8.066-3.458-16.48-5.284-24.331-5.284-7.573 0-18.306 1.701-26.431 9.806-8.068 8.052-9.76 18.659-9.76 26.144 0 7.771 1.821 16.105 5.263 24.106 3.85 8.942 9.507 17.173 16.813 24.463 7.317 7.303 15.586 12.957 24.575 16.812 8.067 3.457 16.48 5.284 24.332 5.284 7.573 0 18.306-1.7 26.429-9.807 8.067-8.049 9.761-18.658 9.761-26.142 0.001-7.771-1.819-16.108-5.264-24.107zM256.002 146.702c-24.957 0-45.188 20.266-45.188 45.263 0 24.996 20.231 45.26 45.188 45.26s45.186-20.264 45.186-45.26c0-24.999-20.23-45.263-45.186-45.263zM427.636 20.479c-8.124-8.104-18.856-9.806-26.43-9.806-7.852 0-16.265 1.826-24.333 5.284-8.986 3.853-17.254 9.51-24.571 16.812-7.307 7.29-12.963 15.521-16.813 24.463-3.443 7.999-5.263 16.336-5.263 24.106 0 7.483 1.692 18.094 9.76 26.143 8.123 8.104 18.856 9.807 26.43 9.807 7.85 0 16.265-1.827 24.33-5.284 8.989-3.854 17.258-9.509 24.575-16.812 7.305-7.29 12.962-15.521 16.813-24.463 3.442-7.999 5.263-16.335 5.263-24.106-0.001-7.485-1.695-18.093-9.761-26.144z" /> +<glyph unicode="" d="M416 320v80c0 8.8-7.2 16-16 16h-112v32c0 17.6-14.4 32-32 32h-64c-17.602 0-32-14.4-32-32v-32h-112c-8.801 0-16-7.2-16-16v-320c0-8.8 7.199-16 16-16h144v-96h224l96 96v256h-96zM192 447.943c0.017 0.019 0.036 0.039 0.057 0.057h63.884c0.021-0.018 0.041-0.038 0.059-0.057v-31.943h-64v31.943zM96 352v32h256v-32h-256zM416 13.255v50.745h50.745l-50.745-50.745zM480 96h-96v-96h-160v288h256v-192z" /> +<glyph unicode="" d="M32 480h192v-32h-192zM288 480h192v-32h-192zM476 320h-28v128h-128v-128h-128v128h-128v-128h-28c-19.8 0-36-16.2-36-36v-280c0-19.8 16.2-36 36-36h152c19.8 0 36 16.2 36 36v188h64v-188c0-19.8 16.2-36 36-36h152c19.8 0 36 16.2 36 36v280c0 19.8-16.2 36-36 36zM174 0h-124c-9.9 0-18 7.2-18 16s8.1 16 18 16h124c9.9 0 18-7.2 18-16s-8.1-16-18-16zM272 224h-32c-8.8 0-16 7.2-16 16s7.2 16 16 16h32c8.8 0 16-7.2 16-16s-7.2-16-16-16zM462 0h-124c-9.9 0-18 7.2-18 16s8.1 16 18 16h124c9.9 0 18-7.2 18-16s-8.1-16-18-16z" /> +<glyph unicode="" d="M192 448h320v-64h-320v64zM192 256h320v-64h-320v64zM192 64h320v-64h-320v64zM0 416c0 35.346 28.654 64 64 64s64-28.654 64-64c0-35.346-28.654-64-64-64-35.346 0-64 28.654-64 64zM0 224c0 35.346 28.654 64 64 64s64-28.654 64-64c0-35.346-28.654-64-64-64-35.346 0-64 28.654-64 64zM0 32c0 35.346 28.654 64 64 64s64-28.654 64-64c0-35.346-28.654-64-64-64-35.346 0-64 28.654-64 64z" /> +<glyph unicode="" d="M192 64h320v-64h-320zM192 256h320v-64h-320zM192 448h320v-64h-320zM96 480v-128h-32v96h-32v32zM64 217v-25h64v-32h-96v73l64 30v25h-64v32h96v-73zM128 128v-160h-96v32h64v32h-64v32h64v32h-64v32z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM192 352h320v-64h-320zM192 256h320v-64h-320zM192 160h320v-64h-320zM0 64h512v-64h-512zM0 128v192l128-96z" /> +<glyph unicode="" d="M0 448h512v-64h-512zM192 352h320v-64h-320zM192 256h320v-64h-320zM192 160h320v-64h-320zM0 64h512v-64h-512zM128 320v-192l-128 96z" /> +<glyph unicode="" d="M112.5 256c61.856 0 112-50.145 112-112 0-61.856-50.144-112-112-112-61.856 0-112 50.144-112 112l-0.5 16c0 123.712 100.288 224 224 224v-64c-42.737 0-82.917-16.643-113.137-46.863-5.817-5.818-11.126-12.008-15.915-18.51 5.719 0.9 11.58 1.373 17.552 1.373zM400.5 256c61.855 0 112-50.145 112-112 0-61.856-50.145-112-112-112-61.855 0-112 50.144-112 112l-0.5 16c0 123.712 100.288 224 224 224v-64c-42.737 0-82.917-16.643-113.137-46.863-5.818-5.818-11.127-12.008-15.916-18.51 5.72 0.9 11.58 1.373 17.553 1.373z" /> +<glyph unicode="" d="M380.931-32c56.863 103.016 66.444 260.153-156.931 254.912v-126.912l-192 192 192 192v-124.186c267.481 6.971 297.285-236.107 156.931-387.814z" /> +<glyph unicode="" d="M288 355.814v124.186l192-192-192-192v126.912c-223.375 5.241-213.794-151.896-156.93-254.912-140.356 151.707-110.55 394.785 156.93 387.814z" /> +<glyph unicode="" d="M160 128c8.8-8.8 23.637-8.363 32.971 0.971l158.059 158.058c9.334 9.334 9.77 24.171 0.97 32.971s-23.637 8.363-32.971-0.971l-158.058-158.058c-9.334-9.334-9.771-24.171-0.971-32.971zM238.444 142.444c2.28-4.525 3.495-9.58 3.495-14.848 0-8.808-3.372-17.030-9.496-23.154l-81.691-81.691c-6.124-6.124-14.347-9.496-23.154-9.496s-17.030 3.372-23.154 9.496l-49.691 49.691c-6.124 6.124-9.496 14.347-9.496 23.154s3.372 17.030 9.496 23.154l81.691 81.691c6.124 6.124 14.347 9.497 23.154 9.497 5.268 0 10.322-1.215 14.848-3.495l32.669 32.669c-13.935 10.705-30.72 16.080-47.517 16.080-19.993 0-39.986-7.583-55.154-22.751l-81.691-81.691c-30.335-30.335-30.335-79.974 0-110.309l49.691-49.691c15.167-15.166 35.16-22.75 55.153-22.75 19.994 0 39.987 7.584 55.154 22.751l81.691 81.691c27.91 27.91 30.119 72.149 6.672 102.672l-32.67-32.67zM489.249 407.558l-49.691 49.691c-15.167 15.168-35.16 22.751-55.154 22.751-19.993 0-39.986-7.583-55.154-22.751l-81.691-81.691c-27.91-27.91-30.119-72.149-6.671-102.671l32.669 32.67c-2.279 4.525-3.494 9.58-3.494 14.847 0 8.808 3.372 17.030 9.496 23.154l81.691 81.691c6.124 6.124 14.347 9.497 23.154 9.497s17.030-3.373 23.154-9.497l49.691-49.691c6.124-6.124 9.496-14.347 9.496-23.154s-3.372-17.030-9.496-23.154l-81.691-81.691c-6.124-6.124-14.347-9.496-23.154-9.496-5.268 0-10.322 1.215-14.848 3.495l-32.669-32.669c13.936-10.705 30.72-16.080 47.517-16.080 19.994 0 39.987 7.584 55.154 22.751l81.691 81.691c30.335 30.333 30.335 79.972 0 110.307z" /> +<glyph unicode="" d="M238.444 142.443c2.28-4.524 3.495-9.579 3.495-14.848 0-8.808-3.372-17.029-9.496-23.154l-81.69-81.69c-6.124-6.124-14.348-9.496-23.154-9.496s-17.030 3.372-23.154 9.496l-49.69 49.69c-6.124 6.125-9.496 14.348-9.496 23.154s3.372 17.030 9.496 23.154l81.69 81.691c6.124 6.123 14.348 9.496 23.154 9.496 5.269 0 10.322-1.215 14.848-3.494l32.669 32.668c-13.935 10.705-30.72 16.080-47.517 16.080-19.993 0-39.986-7.583-55.154-22.751l-81.69-81.691c-30.335-30.335-30.335-79.975 0-110.309l49.69-49.691c15.167-15.166 35.16-22.75 55.153-22.75 19.994 0 39.987 7.584 55.154 22.751l81.69 81.69c27.91 27.91 30.119 72.149 6.672 102.673l-32.67-32.669zM489.248 407.558l-49.69 49.691c-15.167 15.168-35.16 22.751-55.154 22.751-19.993 0-39.985-7.583-55.153-22.751l-81.691-81.691c-27.91-27.91-30.119-72.149-6.671-102.671l32.669 32.67c-2.279 4.525-3.494 9.58-3.494 14.847 0 8.808 3.372 17.030 9.496 23.154l81.691 81.691c6.123 6.124 14.347 9.497 23.153 9.497 8.808 0 17.030-3.373 23.154-9.497l49.69-49.691c6.124-6.124 9.496-14.347 9.496-23.154s-3.372-17.030-9.496-23.154l-81.69-81.691c-6.124-6.124-14.347-9.496-23.154-9.496-5.268 0-10.322 1.215-14.848 3.495l-32.669-32.669c13.936-10.705 30.72-16.080 47.517-16.080 19.994 0 39.987 7.584 55.154 22.752l81.69 81.69c30.336 30.333 30.336 79.972 0 110.307zM116.684 340.688l-95.997 95.997 22.628 22.628 95.997-95.997zM192 480h32v-96h-32zM0 288h96v-32h-96zM395.316 107.312l95.998-95.998-22.628-22.628-95.998 95.998zM288 64h32v-96h-32zM416 192h96v-32h-96z" /> +<glyph unicode="" d="M96 480v-512l160 160 160-160v512h-320zM384 45.255l-128 128-128-128v402.745h256v-402.745z" /> +<glyph unicode="" d="M0 416v-416h512v416h-512zM480 32h-448v352h448v-352zM352 304c0 26.51 21.49 48 48 48s48-21.49 48-48c0-26.51-21.49-48-48-48-26.51 0-48 21.49-48 48zM448 64h-384l96 256 128-160 64 48z" /> +<glyph unicode="" d="M0 416v-384h512v384h-512zM96 64h-64v64h64v-64zM96 192h-64v64h64v-64zM96 320h-64v64h64v-64zM384 64h-256v320h256v-320zM480 64h-64v64h64v-64zM480 192h-64v64h64v-64zM480 320h-64v64h64v-64zM192 320v-192l128 96z" /> +<glyph unicode="" d="M224 128h64v-64h-64zM352 352c17.673 0 32-14.327 32-32v-96l-96-64h-64v32l96 64v32h-160v64h192zM256 432c-55.559 0-107.792-21.636-147.078-60.922s-60.922-91.519-60.922-147.078c0-55.559 21.636-107.792 60.922-147.078 39.286-39.286 91.519-60.922 147.078-60.922 55.559 0 107.792 21.636 147.078 60.922 39.286 39.286 60.922 91.519 60.922 147.078 0 55.559-21.636 107.792-60.922 147.078-39.286 39.286-91.519 60.922-147.078 60.922zM256 480v0c141.385 0 256-114.615 256-256s-114.615-256-256-256c-141.385 0-256 114.615-256 256 0 141.385 114.615 256 256 256z" /> +<glyph unicode="" d="M160 352l-128-128 128-128h64l-128 128 128 128zM352 352h-64l128-128-128-128h64l128 128z" /> +<glyph unicode="" d="M256 384c-106.038 0-192-85.961-192-192s85.961-192 192-192c106.037 0 192 85.961 192 192s-85.963 192-192 192zM357.822 90.177c-27.196-27.198-63.358-42.177-101.822-42.177s-74.625 14.979-101.823 42.177c-27.198 27.197-42.177 63.359-42.177 101.823s14.979 74.625 42.177 101.823c27.198 27.198 63.359 42.177 101.823 42.177s74.626-14.979 101.821-42.177c27.201-27.198 42.179-63.359 42.179-101.823s-14.979-74.626-42.178-101.823zM162.965 378.069l-21.47 42.939c-49.437-24.768-89.735-65.066-114.503-114.504l42.938-21.47c20.124 40.168 52.866 72.911 93.035 93.035zM442.067 285.035l42.939 21.469c-24.766 49.438-65.063 89.736-114.502 114.504l-21.472-42.939c40.169-20.124 72.912-52.866 93.035-93.034zM256 288h-32v-96c0-5.055 2.35-9.555 6.011-12.486l-0.006-0.008 80-64 19.988 24.988-73.993 59.195v88.311z" /> +<glyph unicode="" d="M256 320c-104.684 0-197.622-50.278-256-128 58.378-77.723 151.316-128 256-128 104.684 0 197.622 50.277 256 128-58.378 77.722-151.316 128-256 128zM224 256c17.673 0 32-14.327 32-32s-14.327-32-32-32-32 14.327-32 32 14.327 32 32 32zM386.808 127.352c-19.824-10.129-40.826-17.931-62.423-23.188-22.244-5.418-45.251-8.164-68.385-8.164-23.133 0-46.141 2.746-68.384 8.162-21.597 5.259-42.599 13.061-62.423 23.188-31.51 16.101-60.111 38.205-83.82 64.649 23.709 26.444 52.31 48.55 83.82 64.649 16.168 8.261 33.121 14.973 50.541 20.020-9.944-15.121-15.734-33.217-15.734-52.668 0-53.020 42.981-96 96-96 53.019 0 96 42.98 96 96 0 19.451-5.791 37.547-15.733 52.67 17.419-5.048 34.372-11.76 50.541-20.021 31.511-16.099 60.109-38.204 83.819-64.649-23.71-26.443-52.309-48.55-83.819-64.648zM430.459 358.139c-54.36 27.777-113.056 41.861-174.459 41.861-61.403 0-120.099-14.084-174.459-41.861-29.386-15.016-56.866-33.952-81.541-56.038v-54.603c27.669 29.283 60.347 53.877 96.097 72.145 49.81 25.452 103.609 38.357 159.903 38.357s110.093-12.905 159.902-38.358c35.751-18.268 68.429-42.862 96.098-72.145v54.603c-24.675 22.087-52.154 41.023-81.541 56.039z" /> +<glyph unicode="" d="M161.009 64l28.8 96h132.382l28.8-96h56.816l-95.998 320h-111.618l-96-320h56.818zM237.809 320h36.382l28.8-96h-93.982l28.8 96z" /> +<glyph unicode="" d="M0 448v-448h512v448h-512zM192 160v96h128v-96h-128zM320 128v-96h-128v96h128zM320 384v-96h-128v96h128zM160 384v-96h-128v96h128zM32 256h128v-96h-128v96zM352 256h128v-96h-128v96zM352 288v96h128v-96h-128zM32 128h128v-96h-128v96zM352 32v96h128v-96h-128z" /> +<glyph unicode="" d="M0 256h512v-64h-512z" /> +<glyph unicode="" d="M0 32h288v-64h-288zM96 480h352v-64h-352zM138.694 64l102.344 392.082 61.925-16.164-98.125-375.918zM464.887-32l-64.887 64.887-64.887-64.887-31.113 31.113 64.887 64.887-64.887 64.887 31.113 31.113 64.887-64.887 64.887 64.887 31.113-31.113-64.887-64.887 64.887-64.887z" /> +<glyph unicode="" d="M384 25v-25h64v-32h-96v73l64 30v25h-64v32h96v-73zM338 352h-68l-94-94-94 94h-68l128-128-128-128h68l94 94 94-94h68l-128 128z" /> +<glyph unicode="" d="M384 377v-25h64v-32h-96v73l64 30v25h-64v32h96v-73zM338 352h-68l-94-94-94 94h-68l128-128-128-128h68l94 94 94-94h68l-128 128z" /> +<glyph unicode="" d="M352 32h128l32 64v-128h-192v107.107c65.556 28.242 112 98.581 112 180.893 0 107.216-78.799 191.133-176 191.133-97.203 0-176-83.916-176-191.133 0-82.312 46.443-152.651 112-180.893v-107.107h-192v128l32-64h128v16.295c-93.815 33.23-160 113.701-160 207.705 0 123.712 114.615 224 256 224 141.385 0 256-100.288 256-224 0-94.004-66.185-174.475-160-207.705v-16.295z" /> +<glyph unicode="" d="M256 480c-141.385 0-256-114.614-256-256 0-141.385 114.614-256 256-256 141.385 0 256 114.615 256 256 0 141.386-114.615 256-256 256zM256 8c-119.293 0-216 96.706-216 216 0 119.293 96.707 216 216 216 119.295 0 216-96.707 216-216 0-119.294-96.705-216-216-216zM192 320c0-17.673-14.327-32-32-32s-32 14.327-32 32 14.327 32 32 32 32-14.327 32-32zM384 320c0-17.673-14.326-32-32-32s-32 14.327-32 32 14.326 32 32 32 32-14.327 32-32zM256 154c70.537 0 131.344 28.766 159.231 61.596-10.436-85.61-78.144-151.596-159.231-151.596-81.059 0-148.749 66.013-159.222 151.584 27.893-32.823 88.693-61.584 159.222-61.584z" /> +<glyph unicode="" d="M128 448h256v-64h-256zM480 352h-448c-17.6 0-32-14.4-32-32v-160c0-17.6 14.398-32 32-32h96v-128h256v128h96c17.6 0 32 14.4 32 32v160c0 17.6-14.4 32-32 32zM352 32h-192v160h192v-160zM487.2 304c0-12.813-10.387-23.2-23.199-23.2-12.813 0-23.201 10.387-23.201 23.2s10.388 23.2 23.201 23.2c12.813 0 23.199-10.387 23.199-23.2z" /> +<glyph unicode="" d="M512 480v-192l-69.13 69.13-106-106-53.74 53.74 106 106-69.13 69.13zM122.87 410.87l106-106-53.74-53.74-106 106-69.13-69.13v192h192zM442.87 90.87l69.13 69.13v-192h-192l69.13 69.13-106 106 53.74 53.74zM228.87 143.13l-106-106 69.13-69.13h-192v192l69.13-69.13 106 106z" /> +<glyph unicode="" d="M64 352h64v-96h32v192c0 17.6-14.4 32-32 32h-64c-17.6 0-32-14.4-32-32v-192h32v96zM64 448h64v-64h-64v64zM480 448v32h-96c-17.601 0-32-14.4-32-32v-160c0-17.6 14.399-32 32-32h96v32h-96v160h96zM320 400v48c0 17.6-14.4 32-32 32h-96v-224h96c17.6 0 32 14.4 32 32v48c0 17.6-4.4 32-22 32 17.6 0 22 14.4 22 32zM288 288h-64v64h64v-64zM288 384h-64v64h64v-64zM416 192l-208-224-112 144 41 35 71-74 176 151z" /> +<glyph unicode="" d="M224 192h-96v64h96v96h64v-96h96v-64h-96v-96h-64zM512 160v-192h-512v192h64v-128h384v128z" /> +<glyph unicode="" d="M192 384h64v-32h-64zM288 384h64v-32h-64zM448 384v-128h-96v32h64v64h-32v32zM160 288h64v-32h-64zM256 288h64v-32h-64zM96 352v-64h32v-32h-64v128h96v-32zM192 192h64v-32h-64zM288 192h64v-32h-64zM448 192v-128h-96v32h64v64h-32v32zM160 96h64v-32h-64zM256 96h64v-32h-64zM96 160v-64h32v-32h-64v128h96v-32zM480 448h-448v-448h448v448zM512 480v0-512h-512v512h512z" /> +<glyph unicode="" d="M0 224h64v-32h-64zM96 224h96v-32h-96zM224 224h64v-32h-64zM320 224h96v-32h-96zM448 224h64v-32h-64zM440 480l8-224h-384l8 224h16l8-192h320l8 192zM72-32l-8 192h384l-8-192h-16l-8 160h-320l-8-160z" /> +<glyph unicode="" d="M288 448c123.712 0 224-100.288 224-224s-100.288-224-224-224v48c47.012 0 91.209 18.307 124.451 51.549 33.242 33.242 51.549 77.439 51.549 124.451 0 47.011-18.307 91.209-51.549 124.451-33.242 33.242-77.439 51.549-124.451 51.549-47.011 0-91.209-18.307-124.451-51.549-25.57-25.569-42.291-57.623-48.653-92.451h93.104l-112-128-112 128h82.285c15.53 108.551 108.869 192 221.715 192zM384 256v-64h-128v160h64v-96z" /> +<glyph unicode="" d="M353.94 237.674c18.749 22.271 30.060 51.004 30.060 82.326 0 70.58-57.421 128-128 128h-160v-448h192c70.579 0 128 57.421 128 128 0 46.478-24.899 87.248-62.060 109.674zM192 384h50.75c27.984 0 50.75-28.71 50.75-64s-22.766-64-50.75-64h-50.75v128zM271.5 64h-79.5v128h79.5c29.225 0 53-28.71 53-64s-23.775-64-53-64z" /> +<glyph unicode="" d="M448 448v-32h-64l-160-384h64v-32h-224v32h64l160 384h-64v32z" /> +<glyph unicode="" d="M352 448h64v-208c0-79.529-71.634-144-160-144-88.365 0-160 64.471-160 144v208h64v-208c0-20.083 9.119-39.352 25.677-54.253 18.448-16.602 43.423-25.747 70.323-25.747 26.9 0 51.875 9.145 70.323 25.747 16.558 14.901 25.677 34.17 25.677 54.253v208zM96 64h320v-64h-320z" /> +<glyph unicode="" d="M365.71 221.482c31.96-23.969 50.29-58.043 50.29-93.482s-18.33-69.513-50.29-93.482c-29.679-22.259-68.642-34.518-109.71-34.518-41.069 0-80.031 12.259-109.71 34.518-31.96 23.969-50.29 58.043-50.29 93.482h64c0-34.691 43.963-64 96-64s96 29.309 96 64c0 34.691-43.963 64-96 64-41.069 0-80.031 12.259-109.71 34.518-31.96 23.97-50.29 58.043-50.29 93.482 0 35.439 18.33 69.512 50.29 93.482 29.679 22.259 68.641 34.518 109.71 34.518 41.068 0 80.031-12.259 109.71-34.518 31.96-23.97 50.29-58.043 50.29-93.482h-64c0 34.691-43.963 64-96 64-52.037 0-96-29.309-96-64 0-34.691 43.963-64 96-64 41.068 0 80.031-12.259 109.71-34.518zM0 224h512v-32h-512z" /> +<glyph unicode="" d="M192 448h256v-64h-64v-384h-64v384h-64v-384h-64v224c-61.856 0-112 50.144-112 112s50.144 112 112 112z" /> +<glyph unicode="" d="M224 448h256v-64h-64v-384h-64v384h-64v-384h-64v224c-61.856 0-112 50.144-112 112s50.144 112 112 112zM32 256l128-112-128-112z" /> +<glyph unicode="" d="M128 448h256v-64h-64v-384h-64v384h-64v-384h-64v224c-61.856 0-112 50.144-112 112s50.144 112 112 112zM480 32l-128 112 128 112z" /> +<glyph unicode="" d="M416 352h-96v32l-96 96h-224v-384h192v-128h320v288l-96 96zM416 306.745l50.745-50.745h-50.745v50.745zM224 434.745l50.745-50.745h-50.745v50.745zM32 448h160v-96h96v-224h-256v320zM480 0h-256v96h96v224h64v-96h96v-224z" /> +<glyph unicode="" d="M384 352h32v-32h-32zM320 288h32v-32h-32zM320 224h32v-32h-32zM320 160h32v-32h-32zM256 224h32v-32h-32zM256 160h32v-32h-32zM192 160h32v-32h-32zM384 288h32v-32h-32zM384 224h32v-32h-32zM384 160h32v-32h-32zM384 96h32v-32h-32zM320 96h32v-32h-32zM256 96h32v-32h-32zM192 96h32v-32h-32zM128 96h32v-32h-32z" /> +<glyph unicode="" d="M64 208l144-144 240 240-64 64-176-176-80 80z" /> +<glyph unicode="" d="M464 416h-208l-16 32h-176l-32-64h448zM452.17 128h37.43l22.4 224h-512l32-320h242.040c-52.441 18.888-90.040 69.133-90.040 128 0 74.991 61.009 136 136 136 74.99 0 136-61.009 136-136 0-10.839-1.311-21.575-3.83-32zM501.498 23.125l-99.248 87.346c8.727 14.46 13.75 31.407 13.75 49.529 0 53.020-42.98 96-96 96s-96-42.98-96-96 42.98-96 96-96c18.122 0 35.069 5.023 49.529 13.75l87.346-99.248c11.481-13.339 31.059-14.070 43.503-1.626l2.746 2.746c12.444 12.444 11.713 32.022-1.626 43.503zM320 98c-34.242 0-62 27.758-62 62s27.758 62 62 62 62-27.758 62-62-27.758-62-62-62z" /> +<glyph unicode="" d="M256 224v-64h16l16 32h32v-128h-24v-32h112v32h-24v128h32l16-32h16v64zM416 320v80c0 8.8-7.2 16-16 16h-112v32c0 17.6-14.4 32-32 32h-64c-17.602 0-32-14.4-32-32v-32h-112c-8.801 0-16-7.2-16-16v-320c0-8.8 7.199-16 16-16h144v-96h320v352h-96zM192 447.943c0.017 0.019 0.036 0.039 0.057 0.057h63.884c0.021-0.018 0.041-0.038 0.059-0.057v-31.943h-64v31.943zM96 352v32h256v-32h-256zM480 0h-256v288h256v-288z" /> +</font></defs></svg>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.ttf b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.ttf Binary files differnew file mode 100644 index 000000000..58103c2b6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.ttf diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.woff b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.woff Binary files differnew file mode 100644 index 000000000..ad1ae396a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/fonts/tinymce.woff diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/anchor.gif b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/anchor.gif Binary files differnew file mode 100644 index 000000000..606348c7f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/anchor.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/loader.gif b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/loader.gif Binary files differnew file mode 100644 index 000000000..c69e93723 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/loader.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/object.gif b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/object.gif Binary files differnew file mode 100644 index 000000000..cccd7f023 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/object.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/trans.gif b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/trans.gif Binary files differnew file mode 100644 index 000000000..388486517 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/img/trans.gif diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.ie7.min.css b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.ie7.min.css new file mode 100644 index 000000000..cd2bbdf3f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.ie7.min.css @@ -0,0 +1 @@ +.mce-container,.mce-container *,.mce-widget,.mce-widget *,.mce-reset{margin:0;padding:0;border:0;outline:0;vertical-align:top;background:transparent;text-decoration:none;color:#333;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;text-shadow:none;float:none;position:static;width:auto;height:auto;white-space:nowrap;cursor:inherit;-webkit-tap-highlight-color:transparent;line-height:normal;font-weight:normal;text-align:left;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box;direction:ltr}.mce-widget button{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.mce-container *[unselectable]{-moz-user-select:none;-webkit-user-select:none;-o-user-select:none;user-select:none}.mce-fade{opacity:0;-webkit-transition:opacity .15s linear;transition:opacity .15s linear}.mce-fade.mce-in{opacity:1}.mce-tinymce{visibility:visible !important;position:relative}.mce-fullscreen{border:0;padding:0;margin:0;overflow:hidden;height:100%;z-index:100}div.mce-fullscreen{position:fixed;top:0;left:0;width:100%;height:auto}.mce-tinymce{display:block;-webkit-border-radius:2px;-moz-border-radius:2px;border-radius:2px}.mce-wordcount{position:absolute;top:0;right:0;padding:8px}div.mce-edit-area{background:#FFF;filter:none}.mce-statusbar{position:relative}.mce-statusbar .mce-container-body{position:relative}.mce-fullscreen .mce-resizehandle{display:none}.mce-charmap{border-collapse:collapse}.mce-charmap td{cursor:default;border:1px solid #9e9e9e;width:20px;height:20px;line-height:20px;text-align:center;vertical-align:middle;padding:2px}.mce-charmap td div{text-align:center}.mce-charmap td:hover{background:#d9d9d9}.mce-grid td div{border:1px solid #d6d6d6;width:12px;height:12px;margin:2px;cursor:pointer}.mce-grid td div:focus{border-color:#a1a1a1}.mce-grid{border-spacing:2px;border-collapse:separate}.mce-grid a{display:block;border:1px solid transparent}.mce-grid a:hover,.mce-grid a:focus{border-color:#a1a1a1}.mce-grid-border{margin:0 4px 0 4px}.mce-grid-border a{border-color:#d6d6d6;width:13px;height:13px}.mce-grid-border a:hover,.mce-grid-border a.mce-active{border-color:#a1a1a1;background:#c8def4}.mce-text-center{text-align:center}div.mce-tinymce-inline{width:100%;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.mce-toolbar-grp{padding-bottom:2px}.mce-toolbar-grp .mce-flow-layout-item{margin-bottom:0}.mce-rtl .mce-wordcount{left:0;right:auto}.mce-container,.mce-container-body{display:block}.mce-autoscroll{overflow:hidden}.mce-scrollbar{position:absolute;width:7px;height:100%;top:2px;right:2px;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-scrollbar-h{top:auto;right:auto;left:2px;bottom:2px;width:100%;height:7px}.mce-scrollbar-thumb{position:absolute;background-color:#000;border:1px solid #888;border-color:rgba(85,85,85,0.6);width:5px;height:100%;-webkit-border-radius:7px;-moz-border-radius:7px;border-radius:7px}.mce-scrollbar-h .mce-scrollbar-thumb{width:100%;height:5px}.mce-scrollbar:hover,.mce-scrollbar.mce-active{background-color:#AAA;opacity:.6;filter:alpha(opacity=60);zoom:1;-webkit-border-radius:7px;-moz-border-radius:7px;border-radius:7px}.mce-scroll{position:relative}.mce-panel{border:0 solid #9e9e9e;background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fdfdfd, #ddd);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fdfdfd), to(#ddd));background-image:-webkit-linear-gradient(top, #fdfdfd, #ddd);background-image:-o-linear-gradient(top, #fdfdfd, #ddd);background-image:linear-gradient(to bottom, #fdfdfd, #ddd);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffdfdfd', endColorstr='#ffdddddd', GradientType=0);zoom:1}.mce-floatpanel{position:absolute;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2)}.mce-floatpanel.mce-fixed{position:fixed}.mce-floatpanel .mce-arrow,.mce-floatpanel .mce-arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.mce-floatpanel .mce-arrow{border-width:11px}.mce-floatpanel .mce-arrow:after{border-width:10px;content:""}.mce-floatpanel.mce-popover{filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);top:0;left:0;background:#fff;border:1px solid #9e9e9e;border:1px solid rgba(0,0,0,0.25)}.mce-floatpanel.mce-popover.mce-bottom{margin-top:10px;*margin-top:0}.mce-floatpanel.mce-popover.mce-bottom>.mce-arrow{left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#9e9e9e;border-bottom-color:rgba(0,0,0,0.25);top:-11px}.mce-floatpanel.mce-popover.mce-bottom>.mce-arrow:after{top:1px;margin-left:-10px;border-top-width:0;border-bottom-color:#fff}.mce-floatpanel.mce-popover.mce-bottom.mce-start{margin-left:-22px}.mce-floatpanel.mce-popover.mce-bottom.mce-start>.mce-arrow{left:20px}.mce-floatpanel.mce-popover.mce-bottom.mce-end{margin-left:22px}.mce-floatpanel.mce-popover.mce-bottom.mce-end>.mce-arrow{right:10px;left:auto}.mce-fullscreen{border:0;padding:0;margin:0;overflow:hidden;background:#fff;height:100%}div.mce-fullscreen{position:fixed;top:0;left:0}#mce-modal-block{opacity:0;filter:alpha(opacity=0);zoom:1;position:fixed;left:0;top:0;width:100%;height:100%;background:#000}#mce-modal-block.mce-in{opacity:.3;filter:alpha(opacity=30);zoom:1}.mce-window-move{cursor:move}.mce-window{-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);-moz-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;background:#fff;position:fixed;top:0;left:0;opacity:0;-webkit-transition:opacity 150ms ease-in;transition:opacity 150ms ease-in}.mce-window.mce-in{opacity:1}.mce-window-head{padding:9px 15px;border-bottom:1px solid #c5c5c5;position:relative}.mce-window-head .mce-close{position:absolute;right:15px;top:9px;font-size:20px;font-weight:bold;line-height:20px;color:#858585;cursor:pointer;height:20px;overflow:hidden}.mce-close:hover{color:#adadad}.mce-window-head .mce-title{line-height:20px;font-size:20px;font-weight:bold;text-rendering:optimizelegibility;padding-right:10px}.mce-window .mce-container-body{display:block}.mce-foot{display:block;background-color:#fff;border-top:1px solid #c5c5c5;-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px}.mce-window-head .mce-dragh{position:absolute;top:0;left:0;cursor:move;width:90%;height:100%}.mce-window iframe{width:100%;height:100%}.mce-window.mce-fullscreen,.mce-window.mce-fullscreen .mce-foot{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.mce-rtl .mce-window-head .mce-close{position:absolute;right:auto;left:15px}.mce-rtl .mce-window-head .mce-dragh{left:auto;right:0}.mce-rtl .mce-window-head .mce-title{direction:rtl;text-align:right}.mce-abs-layout{position:relative}body .mce-abs-layout-item,.mce-abs-end{position:absolute}.mce-abs-end{width:1px;height:1px}.mce-container-body.mce-abs-layout{overflow:hidden}.mce-tooltip{position:absolute;padding:5px;opacity:.8;filter:alpha(opacity=80);zoom:1}.mce-tooltip-inner{font-size:11px;background-color:#000;color:#fff;max-width:200px;padding:5px 8px 4px 8px;text-align:center;white-space:normal}.mce-tooltip-inner{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-tooltip-inner{-webkit-box-shadow:0 0 5px #000000;-moz-box-shadow:0 0 5px #000000;box-shadow:0 0 5px #000000}.mce-tooltip-arrow{position:absolute;width:0;height:0;line-height:0;border:5px dashed #000}.mce-tooltip-arrow-n{border-bottom-color:#000}.mce-tooltip-arrow-s{border-top-color:#000}.mce-tooltip-arrow-e{border-left-color:#000}.mce-tooltip-arrow-w{border-right-color:#000}.mce-tooltip-nw,.mce-tooltip-sw{margin-left:-14px}.mce-tooltip-n .mce-tooltip-arrow{top:0px;left:50%;margin-left:-5px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-nw .mce-tooltip-arrow{top:0;left:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-ne .mce-tooltip-arrow{top:0;right:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-s .mce-tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-sw .mce-tooltip-arrow{bottom:0;left:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-se .mce-tooltip-arrow{bottom:0;right:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-e .mce-tooltip-arrow{right:0;top:50%;margin-top:-5px;border-left-style:solid;border-right:none;border-top-color:transparent;border-bottom-color:transparent}.mce-tooltip-w .mce-tooltip-arrow{left:0;top:50%;margin-top:-5px;border-right-style:solid;border-left:none;border-top-color:transparent;border-bottom-color:transparent}.mce-btn{border:1px solid #b1b1b1;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25) rgba(0,0,0,0.25);position:relative;text-shadow:0 1px 1px rgba(255,255,255,0.75);display:inline-block;*display:inline;*zoom:1;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fff, #d9d9d9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fff), to(#d9d9d9));background-image:-webkit-linear-gradient(top, #fff, #d9d9d9);background-image:-o-linear-gradient(top, #fff, #d9d9d9);background-image:linear-gradient(to bottom, #fff, #d9d9d9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffd9d9d9', GradientType=0);zoom:1}.mce-btn:hover,.mce-btn:focus{color:#333;background-color:#e3e3e3;background-image:-moz-linear-gradient(top, #f2f2f2, #ccc);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#f2f2f2), to(#ccc));background-image:-webkit-linear-gradient(top, #f2f2f2, #ccc);background-image:-o-linear-gradient(top, #f2f2f2, #ccc);background-image:linear-gradient(to bottom, #f2f2f2, #ccc);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2f2f2', endColorstr='#ffcccccc', GradientType=0);zoom:1}.mce-btn.mce-disabled button,.mce-btn.mce-disabled:hover button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-btn.mce-active,.mce-btn.mce-active:hover{background-color:#d6d6d6;background-image:-moz-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#e6e6e6), to(#c0c0c0));background-image:-webkit-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-o-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:linear-gradient(to bottom, #e6e6e6, #c0c0c0);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe6e6e6', endColorstr='#ffc0c0c0', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-btn:not(.mce-disabled):active{background-color:#d6d6d6;background-image:-moz-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#e6e6e6), to(#c0c0c0));background-image:-webkit-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-o-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:linear-gradient(to bottom, #e6e6e6, #c0c0c0);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe6e6e6', endColorstr='#ffc0c0c0', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-btn button{padding:4px 10px;font-size:14px;line-height:20px;*line-height:16px;cursor:pointer;color:#333;text-align:center;overflow:visible;-webkit-appearance:none}.mce-btn button::-moz-focus-inner{border:0;padding:0}.mce-btn i{text-shadow:1px 1px #fff}.mce-primary{min-width:50px;color:#fff;border:1px solid #b1b1b1;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25) rgba(0,0,0,0.25);background-color:#006dcc;background-image:-moz-linear-gradient(top, #08c, #04c);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#08c), to(#04c));background-image:-webkit-linear-gradient(top, #08c, #04c);background-image:-o-linear-gradient(top, #08c, #04c);background-image:linear-gradient(to bottom, #08c, #04c);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);zoom:1}.mce-primary:hover,.mce-primary:focus{background-color:#005fb3;background-image:-moz-linear-gradient(top, #0077b3, #003cb3);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#0077b3), to(#003cb3));background-image:-webkit-linear-gradient(top, #0077b3, #003cb3);background-image:-o-linear-gradient(top, #0077b3, #003cb3);background-image:linear-gradient(to bottom, #0077b3, #003cb3);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0077b3', endColorstr='#ff003cb3', GradientType=0);zoom:1}.mce-primary.mce-disabled button,.mce-primary.mce-disabled:hover button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-primary.mce-active,.mce-primary.mce-active:hover,.mce-primary:not(.mce-disabled):active{background-color:#005299;background-image:-moz-linear-gradient(top, #069, #039);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#069), to(#039));background-image:-webkit-linear-gradient(top, #069, #039);background-image:-o-linear-gradient(top, #069, #039);background-image:linear-gradient(to bottom, #069, #039);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff006699', endColorstr='#ff003399', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-primary button,.mce-primary button i{color:#fff;text-shadow:1px 1px #333}.mce-btn-large button{padding:9px 14px;font-size:16px;line-height:normal;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px}.mce-btn-large i{margin-top:2px}.mce-btn-small button{padding:1px 5px;font-size:12px;*padding-bottom:2px}.mce-btn-small i{line-height:20px;vertical-align:top;*line-height:18px}.mce-btn .mce-caret{margin-top:8px;margin-left:0}.mce-btn-small .mce-caret{margin-top:8px;margin-left:0}.mce-caret{display:inline-block;*display:inline;*zoom:1;width:0;height:0;vertical-align:top;border-top:4px solid #333;border-right:4px solid transparent;border-left:4px solid transparent;content:""}.mce-disabled .mce-caret{border-top-color:#aaa}.mce-caret.mce-up{border-bottom:4px solid #333;border-top:0}.mce-rtl .mce-btn button{direction:rtl}.mce-btn-group .mce-btn{border-width:1px 0 1px 0;margin:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.mce-btn-group .mce-first{border-left:1px solid #b1b1b1;border-left:1px solid rgba(0,0,0,0.25);-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.mce-btn-group .mce-last{border-right:1px solid #b1b1b1;border-right:1px solid rgba(0,0,0,0.1);-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.mce-btn-group .mce-first.mce-last{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-btn-group .mce-btn.mce-flow-layout-item{margin:0}.mce-checkbox{cursor:pointer}i.mce-i-checkbox{margin:0 3px 0 0;border:1px solid #c5c5c5;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fff, #d9d9d9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fff), to(#d9d9d9));background-image:-webkit-linear-gradient(top, #fff, #d9d9d9);background-image:-o-linear-gradient(top, #fff, #d9d9d9);background-image:linear-gradient(to bottom, #fff, #d9d9d9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffd9d9d9', GradientType=0);zoom:1;text-indent:-10em;*font-size:0;*line-height:0;*text-indent:0;overflow:hidden}.mce-checked i.mce-i-checkbox{color:#333;font-size:16px;line-height:16px;text-indent:0}.mce-checkbox:focus i.mce-i-checkbox,.mce-checkbox.mce-focus i.mce-i-checkbox{border:1px solid rgba(82,168,236,0.8);-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65)}.mce-checkbox.mce-disabled .mce-label,.mce-checkbox.mce-disabled i.mce-i-checkbox{color:#acacac}.mce-rtl .mce-checkbox{direction:rtl;text-align:right}.mce-rtl i.mce-i-checkbox{margin:0 0 0 3px}.mce-colorbutton .mce-ico{position:relative}.mce-colorbutton-grid{margin:4px}.mce-colorbutton button{padding-right:4px}.mce-colorbutton .mce-preview{padding-right:3px;display:block;position:absolute;left:50%;top:50%;margin-left:-14px;margin-top:7px;background:gray;width:13px;height:2px;overflow:hidden}.mce-colorbutton.mce-btn-small .mce-preview{margin-left:-16px;padding-right:0;width:16px}.mce-colorbutton .mce-open{padding-left:4px;border-left:1px solid transparent;border-right:1px solid transparent}.mce-colorbutton:hover .mce-open{border-left-color:#bdbdbd;border-right-color:#bdbdbd}.mce-colorbutton.mce-btn-small .mce-open{padding:0 3px 0 3px}.mce-rtl .mce-colorbutton{direction:rtl}.mce-rtl .mce-colorbutton .mce-preview{margin-left:0;padding-right:0;padding-left:4px;margin-right:-14px}.mce-rtl .mce-colorbutton.mce-btn-small .mce-preview{margin-left:0;padding-right:0;margin-right:-17px;padding-left:0}.mce-rtl .mce-colorbutton button{padding-right:10px;padding-left:10px}.mce-rtl .mce-colorbutton .mce-open{padding-left:4px;padding-right:4px}.mce-combobox{display:inline-block;*display:inline;*zoom:1;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);*height:32px}.mce-combobox input{border:1px solid #c5c5c5;border-right-color:#c5c5c5;height:28px}.mce-combobox.mce-disabled input{color:#adadad}.mce-combobox.mce-has-open input{-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.mce-combobox .mce-btn{border-left:0;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.mce-combobox button{padding-right:8px;padding-left:8px}.mce-combobox.mce-disabled .mce-btn button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-path{display:inline-block;*display:inline;*zoom:1;padding:8px;white-space:normal}.mce-path .mce-txt{display:inline-block;padding-right:3px}.mce-path .mce-path-body{display:inline-block}.mce-path-item{display:inline-block;*display:inline;*zoom:1;cursor:pointer;color:#333}.mce-path-item:hover{text-decoration:underline}.mce-path-item:focus{background:#666;color:#fff}.mce-path .mce-divider{display:inline}.mce-disabled .mce-path-item{color:#aaa}.mce-rtl .mce-path{direction:rtl}.mce-fieldset{border:0 solid #9E9E9E;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-fieldset>.mce-container-body{margin-top:-15px}.mce-fieldset-title{margin-left:5px;padding:0 5px 0 5px}.mce-fit-layout{display:inline-block;*display:inline;*zoom:1}.mce-fit-layout-item{position:absolute}.mce-flow-layout-item{display:inline-block;*display:inline;*zoom:1}.mce-flow-layout-item{margin:2px 0 2px 2px}.mce-flow-layout-item.mce-last{margin-right:2px}.mce-flow-layout{white-space:normal}.mce-tinymce-inline .mce-flow-layout{white-space:nowrap}.mce-rtl .mce-flow-layout{text-align:right;direction:rtl}.mce-rtl .mce-flow-layout-item{margin:2px 2px 2px 0}.mce-rtl .mce-flow-layout-item.mce-last{margin-left:2px}.mce-iframe{border:0 solid #9e9e9e;width:100%;height:100%}.mce-label{display:inline-block;*display:inline;*zoom:1;text-shadow:0 1px 1px rgba(255,255,255,0.75);overflow:hidden}.mce-label.mce-autoscroll{overflow:auto}.mce-label.mce-disabled{color:#aaa}.mce-label.mce-multiline{white-space:pre-wrap}.mce-label.mce-error{color:#a00}.mce-rtl .mce-label{text-align:right;direction:rtl}.mce-menubar .mce-menubtn{border-color:transparent;background:transparent;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;filter:none}.mce-menubar{border:1px solid #c4c4c4}.mce-menubar .mce-menubtn button span{color:#333}.mce-menubar .mce-caret{border-top-color:#333}.mce-menubar .mce-menubtn:hover,.mce-menubar .mce-menubtn.mce-active,.mce-menubar .mce-menubtn:focus{border-color:transparent;background:#e6e6e6;filter:none;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.mce-menubtn span{color:#333;margin-right:2px;line-height:20px;*line-height:16px}.mce-menubtn.mce-btn-small span{font-size:12px}.mce-menubtn.mce-fixed-width span{display:inline-block;overflow-x:hidden;text-overflow:ellipsis;width:90px}.mce-menubtn.mce-fixed-width.mce-btn-small span{width:70px}.mce-menubtn .mce-caret{*margin-top:6px}.mce-rtl .mce-menubtn button{direction:rtl;text-align:right}.mce-listbox button{text-align:left;padding-right:20px;position:relative}.mce-listbox .mce-caret{position:absolute;margin-top:-2px;right:8px;top:50%}.mce-rtl .mce-listbox .mce-caret{right:auto;left:8px}.mce-rtl .mce-listbox button{padding-right:10px;padding-left:20px}.mce-menu-item{display:block;padding:6px 15px 6px 12px;clear:both;font-weight:normal;line-height:20px;color:#333;white-space:nowrap;cursor:pointer;line-height:normal;border-left:4px solid transparent;margin-bottom:1px}.mce-menu-item .mce-ico,.mce-menu-item .mce-text{color:#333}.mce-menu-item.mce-disabled .mce-text,.mce-menu-item.mce-disabled .mce-ico{color:#adadad}.mce-menu-item:hover .mce-text,.mce-menu-item.mce-selected .mce-text,.mce-menu-item:focus .mce-text{color:#fff}.mce-menu-item:hover .mce-ico,.mce-menu-item.mce-selected .mce-ico,.mce-menu-item:focus .mce-ico{color:#fff}.mce-menu-item.mce-disabled:hover{background:#ccc}.mce-menu-shortcut{display:inline-block;color:#adadad}.mce-menu-shortcut{display:inline-block;*display:inline;*zoom:1;padding:0 15px 0 20px}.mce-menu-item:hover .mce-menu-shortcut,.mce-menu-item.mce-selected .mce-menu-shortcut,.mce-menu-item:focus .mce-menu-shortcut{color:#fff}.mce-menu-item .mce-caret{margin-top:4px;*margin-top:3px;margin-right:6px;border-top:4px solid transparent;border-bottom:4px solid transparent;border-left:4px solid #333}.mce-menu-item.mce-selected .mce-caret,.mce-menu-item:focus .mce-caret,.mce-menu-item:hover .mce-caret{border-left-color:#fff}.mce-menu-align .mce-menu-shortcut{*margin-top:-2px}.mce-menu-align .mce-menu-shortcut,.mce-menu-align .mce-caret{position:absolute;right:0}.mce-menu-item.mce-active i{visibility:visible}.mce-menu-item-normal.mce-active{background-color:#c8def4}.mce-menu-item-preview.mce-active{border-left:5px solid #aaa}.mce-menu-item-normal.mce-active .mce-text{color:#333}.mce-menu-item-normal.mce-active:hover .mce-text,.mce-menu-item-normal.mce-active:hover .mce-ico{color:#fff}.mce-menu-item-normal.mce-active:focus .mce-text,.mce-menu-item-normal.mce-active:focus .mce-ico{color:#fff}.mce-menu-item:hover,.mce-menu-item.mce-selected,.mce-menu-item:focus{text-decoration:none;color:#fff;background-color:#0081c2;background-image:-moz-linear-gradient(top, #08c, #0077b3);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#08c), to(#0077b3));background-image:-webkit-linear-gradient(top, #08c, #0077b3);background-image:-o-linear-gradient(top, #08c, #0077b3);background-image:linear-gradient(to bottom, #08c, #0077b3);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0077b3', GradientType=0);zoom:1}div.mce-menu .mce-menu-item-sep,.mce-menu-item-sep:hover{border:0;padding:0;height:1px;margin:9px 1px;overflow:hidden;background:#cbcbcb;border-bottom:1px solid #fff;cursor:default;filter:none}.mce-menu.mce-rtl{direction:rtl}.mce-rtl .mce-menu-item{text-align:right;direction:rtl;padding:6px 12px 6px 15px}.mce-menu-align.mce-rtl .mce-menu-shortcut,.mce-menu-align.mce-rtl .mce-caret{right:auto;left:0}.mce-rtl .mce-menu-item .mce-caret{margin-left:6px;margin-right:0;border-right:4px solid #333;border-left:0}.mce-rtl .mce-menu-item.mce-selected .mce-caret,.mce-rtl .mce-menu-item:focus .mce-caret,.mce-rtl .mce-menu-item:hover .mce-caret{border-left-color:transparent;border-right-color:#fff}.mce-menu{position:absolute;left:0;top:0;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;z-index:1000;padding:5px 0 5px 0;margin:2px 0 0;min-width:160px;background:#fff;border:1px solid #989898;border:1px solid rgba(0,0,0,0.2);z-index:1002;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);max-height:400px;overflow:auto;overflow-x:hidden}.mce-menu i{display:none}.mce-menu-has-icons i{display:inline-block;*display:inline}.mce-menu-sub-tr-tl{margin:-6px 0 0 -1px}.mce-menu-sub-br-bl{margin:6px 0 0 -1px}.mce-menu-sub-tl-tr{margin:-6px 0 0 1px}.mce-menu-sub-bl-br{margin:6px 0 0 1px}.mce-container-body .mce-resizehandle{position:absolute;right:0;bottom:0;width:16px;height:16px;visibility:visible;cursor:s-resize;margin:0}.mce-container-body .mce-resizehandle-both{cursor:se-resize}i.mce-i-resize{color:#333}.mce-spacer{visibility:hidden}.mce-splitbtn .mce-open{border-left:1px solid transparent;border-right:1px solid transparent}.mce-splitbtn:hover .mce-open{border-left-color:#bdbdbd;border-right-color:#bdbdbd}.mce-splitbtn button{padding-right:4px}.mce-splitbtn .mce-open{padding-left:4px}.mce-splitbtn .mce-open.mce-active{-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-splitbtn.mce-btn-small .mce-open{padding:0 3px 0 3px}.mce-rtl .mce-splitbtn{direction:rtl;text-align:right}.mce-rtl .mce-splitbtn button{padding-right:10px;padding-left:10px}.mce-rtl .mce-splitbtn .mce-open{padding-left:4px;padding-right:4px}.mce-stack-layout-item{display:block}.mce-tabs{display:block;border-bottom:1px solid #c5c5c5}.mce-tab{display:inline-block;*display:inline;*zoom:1;border:1px solid #c5c5c5;border-width:0 1px 0 0;background:#e3e3e3;padding:8px;text-shadow:0 1px 1px rgba(255,255,255,0.75);height:13px;cursor:pointer}.mce-tab:hover{background:#fdfdfd}.mce-tab.mce-active{background:#fdfdfd;border-bottom-color:transparent;margin-bottom:-1px;height:14px}.mce-rtl .mce-tabs{text-align:right;direction:rtl}.mce-rtl .mce-tab{border-width:0 0 0 1px}.mce-textbox{background:#fff;border:1px solid #c5c5c5;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);display:inline-block;-webkit-transition:border linear .2s, box-shadow linear .2s;transition:border linear .2s, box-shadow linear .2s;height:28px;resize:none;padding:0 4px 0 4px;white-space:pre-wrap;*white-space:pre;color:#333}.mce-textbox:focus,.mce-textbox.mce-focus{border-color:rgba(82,168,236,0.8);-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65)}.mce-placeholder .mce-textbox{color:#aaa}.mce-textbox.mce-multiline{padding:4px}.mce-textbox.mce-disabled{color:#adadad}.mce-rtl .mce-textbox{text-align:right;direction:rtl}.mce-throbber{position:absolute;top:0;left:0;width:100%;height:100%;opacity:.6;filter:alpha(opacity=60);zoom:1;background:#fff url('img/loader.gif') no-repeat center center}.mce-throbber-inline{position:static;height:50px}@font-face{font-family:'tinymce';src:url('fonts/tinymce.eot');src:url('fonts/tinymce.eot?#iefix') format('embedded-opentype'),url('fonts/tinymce.woff') format('woff'),url('fonts/tinymce.ttf') format('truetype'),url('fonts/tinymce.svg#tinymce') format('svg');font-weight:normal;font-style:normal}@font-face{font-family:'tinymce-small';src:url('fonts/tinymce-small.eot');src:url('fonts/tinymce-small.eot?#iefix') format('embedded-opentype'),url('fonts/tinymce-small.woff') format('woff'),url('fonts/tinymce-small.ttf') format('truetype'),url('fonts/tinymce-small.svg#tinymce') format('svg');font-weight:normal;font-style:normal}.mce-ico{font-family:'tinymce';font-style:normal;font-weight:normal;font-size:16px;line-height:16px;vertical-align:text-top;-webkit-font-smoothing:antialiased;display:inline-block;background:transparent center center;width:16px;height:16px;color:#333;-ie7-icon:' '}.mce-btn-small .mce-ico{font-family:'tinymce-small'}.mce-ico,i.mce-i-checkbox{zoom:expression(this.runtimeStyle['zoom'] = '1', this.innerHTML = this.currentStyle['-ie7-icon'].substr(1, 1) + ' ')}.mce-i-save{-ie7-icon:"\e000"}.mce-i-newdocument{-ie7-icon:"\e001"}.mce-i-fullpage{-ie7-icon:"\e002"}.mce-i-alignleft{-ie7-icon:"\e003"}.mce-i-aligncenter{-ie7-icon:"\e004"}.mce-i-alignright{-ie7-icon:"\e005"}.mce-i-alignjustify{-ie7-icon:"\e006"}.mce-i-cut{-ie7-icon:"\e007"}.mce-i-paste{-ie7-icon:"\e008"}.mce-i-searchreplace{-ie7-icon:"\e009"}.mce-i-bullist{-ie7-icon:"\e00a"}.mce-i-numlist{-ie7-icon:"\e00b"}.mce-i-indent{-ie7-icon:"\e00c"}.mce-i-outdent{-ie7-icon:"\e00d"}.mce-i-blockquote{-ie7-icon:"\e00e"}.mce-i-undo{-ie7-icon:"\e00f"}.mce-i-redo{-ie7-icon:"\e010"}.mce-i-link{-ie7-icon:"\e011"}.mce-i-unlink{-ie7-icon:"\e012"}.mce-i-anchor{-ie7-icon:"\e013"}.mce-i-image{-ie7-icon:"\e014"}.mce-i-media{-ie7-icon:"\e015"}.mce-i-help{-ie7-icon:"\e016"}.mce-i-code{-ie7-icon:"\e017"}.mce-i-insertdatetime{-ie7-icon:"\e018"}.mce-i-preview{-ie7-icon:"\e019"}.mce-i-forecolor{-ie7-icon:"\e01a"}.mce-i-backcolor{-ie7-icon:"\e01a"}.mce-i-table{-ie7-icon:"\e01b"}.mce-i-hr{-ie7-icon:"\e01c"}.mce-i-removeformat{-ie7-icon:"\e01d"}.mce-i-subscript{-ie7-icon:"\e01e"}.mce-i-superscript{-ie7-icon:"\e01f"}.mce-i-charmap{-ie7-icon:"\e020"}.mce-i-emoticons{-ie7-icon:"\e021"}.mce-i-print{-ie7-icon:"\e022"}.mce-i-fullscreen{-ie7-icon:"\e023"}.mce-i-spellchecker{-ie7-icon:"\e024"}.mce-i-nonbreaking{-ie7-icon:"\e025"}.mce-i-template{-ie7-icon:"\e026"}.mce-i-pagebreak{-ie7-icon:"\e027"}.mce-i-restoredraft{-ie7-icon:"\e028"}.mce-i-untitled{-ie7-icon:"\e029"}.mce-i-bold{-ie7-icon:"\e02a"}.mce-i-italic{-ie7-icon:"\e02b"}.mce-i-underline{-ie7-icon:"\e02c"}.mce-i-strikethrough{-ie7-icon:"\e02d"}.mce-i-visualchars{-ie7-icon:"\e02e"}.mce-i-ltr{-ie7-icon:"\e02f"}.mce-i-rtl{-ie7-icon:"\e030"}.mce-i-copy{-ie7-icon:"\e031"}.mce-i-resize{-ie7-icon:"\e032"}.mce-i-browse{-ie7-icon:"\e034"}.mce-i-pastetext{-ie7-icon:"\e035"}.mce-i-checkbox,.mce-i-selected{-ie7-icon:"\e033"}.mce-i-selected{visibility:hidden}.mce-i-backcolor{background:#BBB}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.min.css b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.min.css new file mode 100644 index 000000000..284ac1dea --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/skins/lightgray/skin.min.css @@ -0,0 +1 @@ +.mce-container,.mce-container *,.mce-widget,.mce-widget *,.mce-reset{margin:0;padding:0;border:0;outline:0;vertical-align:top;background:transparent;text-decoration:none;color:#333;font-family:"Helvetica Neue",Helvetica,Arial,sans-serif;font-size:14px;text-shadow:none;float:none;position:static;width:auto;height:auto;white-space:nowrap;cursor:inherit;-webkit-tap-highlight-color:transparent;line-height:normal;font-weight:normal;text-align:left;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box;direction:ltr}.mce-widget button{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}.mce-container *[unselectable]{-moz-user-select:none;-webkit-user-select:none;-o-user-select:none;user-select:none}.mce-fade{opacity:0;-webkit-transition:opacity .15s linear;transition:opacity .15s linear}.mce-fade.mce-in{opacity:1}.mce-tinymce{visibility:visible !important;position:relative}.mce-fullscreen{border:0;padding:0;margin:0;overflow:hidden;height:100%;z-index:100}div.mce-fullscreen{position:fixed;top:0;left:0;width:100%;height:auto}.mce-tinymce{display:block;-webkit-border-radius:2px;-moz-border-radius:2px;border-radius:2px}.mce-wordcount{position:absolute;top:0;right:0;padding:8px}div.mce-edit-area{background:#FFF;filter:none}.mce-statusbar{position:relative}.mce-statusbar .mce-container-body{position:relative}.mce-fullscreen .mce-resizehandle{display:none}.mce-charmap{border-collapse:collapse}.mce-charmap td{cursor:default;border:1px solid #9e9e9e;width:20px;height:20px;line-height:20px;text-align:center;vertical-align:middle;padding:2px}.mce-charmap td div{text-align:center}.mce-charmap td:hover{background:#d9d9d9}.mce-grid td div{border:1px solid #d6d6d6;width:12px;height:12px;margin:2px;cursor:pointer}.mce-grid td div:focus{border-color:#a1a1a1}.mce-grid{border-spacing:2px;border-collapse:separate}.mce-grid a{display:block;border:1px solid transparent}.mce-grid a:hover,.mce-grid a:focus{border-color:#a1a1a1}.mce-grid-border{margin:0 4px 0 4px}.mce-grid-border a{border-color:#d6d6d6;width:13px;height:13px}.mce-grid-border a:hover,.mce-grid-border a.mce-active{border-color:#a1a1a1;background:#c8def4}.mce-text-center{text-align:center}div.mce-tinymce-inline{width:100%;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.mce-toolbar-grp{padding-bottom:2px}.mce-toolbar-grp .mce-flow-layout-item{margin-bottom:0}.mce-rtl .mce-wordcount{left:0;right:auto}.mce-container,.mce-container-body{display:block}.mce-autoscroll{overflow:hidden}.mce-scrollbar{position:absolute;width:7px;height:100%;top:2px;right:2px;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-scrollbar-h{top:auto;right:auto;left:2px;bottom:2px;width:100%;height:7px}.mce-scrollbar-thumb{position:absolute;background-color:#000;border:1px solid #888;border-color:rgba(85,85,85,0.6);width:5px;height:100%;-webkit-border-radius:7px;-moz-border-radius:7px;border-radius:7px}.mce-scrollbar-h .mce-scrollbar-thumb{width:100%;height:5px}.mce-scrollbar:hover,.mce-scrollbar.mce-active{background-color:#AAA;opacity:.6;filter:alpha(opacity=60);zoom:1;-webkit-border-radius:7px;-moz-border-radius:7px;border-radius:7px}.mce-scroll{position:relative}.mce-panel{border:0 solid #9e9e9e;background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fdfdfd, #ddd);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fdfdfd), to(#ddd));background-image:-webkit-linear-gradient(top, #fdfdfd, #ddd);background-image:-o-linear-gradient(top, #fdfdfd, #ddd);background-image:linear-gradient(to bottom, #fdfdfd, #ddd);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fffdfdfd', endColorstr='#ffdddddd', GradientType=0);zoom:1}.mce-floatpanel{position:absolute;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2)}.mce-floatpanel.mce-fixed{position:fixed}.mce-floatpanel .mce-arrow,.mce-floatpanel .mce-arrow:after{position:absolute;display:block;width:0;height:0;border-color:transparent;border-style:solid}.mce-floatpanel .mce-arrow{border-width:11px}.mce-floatpanel .mce-arrow:after{border-width:10px;content:""}.mce-floatpanel.mce-popover{filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);top:0;left:0;background:#fff;border:1px solid #9e9e9e;border:1px solid rgba(0,0,0,0.25)}.mce-floatpanel.mce-popover.mce-bottom{margin-top:10px;*margin-top:0}.mce-floatpanel.mce-popover.mce-bottom>.mce-arrow{left:50%;margin-left:-11px;border-top-width:0;border-bottom-color:#9e9e9e;border-bottom-color:rgba(0,0,0,0.25);top:-11px}.mce-floatpanel.mce-popover.mce-bottom>.mce-arrow:after{top:1px;margin-left:-10px;border-top-width:0;border-bottom-color:#fff}.mce-floatpanel.mce-popover.mce-bottom.mce-start{margin-left:-22px}.mce-floatpanel.mce-popover.mce-bottom.mce-start>.mce-arrow{left:20px}.mce-floatpanel.mce-popover.mce-bottom.mce-end{margin-left:22px}.mce-floatpanel.mce-popover.mce-bottom.mce-end>.mce-arrow{right:10px;left:auto}.mce-fullscreen{border:0;padding:0;margin:0;overflow:hidden;background:#fff;height:100%}div.mce-fullscreen{position:fixed;top:0;left:0}#mce-modal-block{opacity:0;filter:alpha(opacity=0);zoom:1;position:fixed;left:0;top:0;width:100%;height:100%;background:#000}#mce-modal-block.mce-in{opacity:.3;filter:alpha(opacity=30);zoom:1}.mce-window-move{cursor:move}.mce-window{-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);-moz-box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);box-shadow:0 3px 7px rgba(0, 0, 0, 0.3);filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;background:#fff;position:fixed;top:0;left:0;opacity:0;-webkit-transition:opacity 150ms ease-in;transition:opacity 150ms ease-in}.mce-window.mce-in{opacity:1}.mce-window-head{padding:9px 15px;border-bottom:1px solid #c5c5c5;position:relative}.mce-window-head .mce-close{position:absolute;right:15px;top:9px;font-size:20px;font-weight:bold;line-height:20px;color:#858585;cursor:pointer;height:20px;overflow:hidden}.mce-close:hover{color:#adadad}.mce-window-head .mce-title{line-height:20px;font-size:20px;font-weight:bold;text-rendering:optimizelegibility;padding-right:10px}.mce-window .mce-container-body{display:block}.mce-foot{display:block;background-color:#fff;border-top:1px solid #c5c5c5;-webkit-border-radius:0 0 6px 6px;-moz-border-radius:0 0 6px 6px;border-radius:0 0 6px 6px}.mce-window-head .mce-dragh{position:absolute;top:0;left:0;cursor:move;width:90%;height:100%}.mce-window iframe{width:100%;height:100%}.mce-window.mce-fullscreen,.mce-window.mce-fullscreen .mce-foot{-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.mce-rtl .mce-window-head .mce-close{position:absolute;right:auto;left:15px}.mce-rtl .mce-window-head .mce-dragh{left:auto;right:0}.mce-rtl .mce-window-head .mce-title{direction:rtl;text-align:right}.mce-abs-layout{position:relative}body .mce-abs-layout-item,.mce-abs-end{position:absolute}.mce-abs-end{width:1px;height:1px}.mce-container-body.mce-abs-layout{overflow:hidden}.mce-tooltip{position:absolute;padding:5px;opacity:.8;filter:alpha(opacity=80);zoom:1}.mce-tooltip-inner{font-size:11px;background-color:#000;color:#fff;max-width:200px;padding:5px 8px 4px 8px;text-align:center;white-space:normal}.mce-tooltip-inner{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-tooltip-inner{-webkit-box-shadow:0 0 5px #000000;-moz-box-shadow:0 0 5px #000000;box-shadow:0 0 5px #000000}.mce-tooltip-arrow{position:absolute;width:0;height:0;line-height:0;border:5px dashed #000}.mce-tooltip-arrow-n{border-bottom-color:#000}.mce-tooltip-arrow-s{border-top-color:#000}.mce-tooltip-arrow-e{border-left-color:#000}.mce-tooltip-arrow-w{border-right-color:#000}.mce-tooltip-nw,.mce-tooltip-sw{margin-left:-14px}.mce-tooltip-n .mce-tooltip-arrow{top:0px;left:50%;margin-left:-5px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-nw .mce-tooltip-arrow{top:0;left:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-ne .mce-tooltip-arrow{top:0;right:10px;border-bottom-style:solid;border-top:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-s .mce-tooltip-arrow{bottom:0;left:50%;margin-left:-5px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-sw .mce-tooltip-arrow{bottom:0;left:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-se .mce-tooltip-arrow{bottom:0;right:10px;border-top-style:solid;border-bottom:none;border-left-color:transparent;border-right-color:transparent}.mce-tooltip-e .mce-tooltip-arrow{right:0;top:50%;margin-top:-5px;border-left-style:solid;border-right:none;border-top-color:transparent;border-bottom-color:transparent}.mce-tooltip-w .mce-tooltip-arrow{left:0;top:50%;margin-top:-5px;border-right-style:solid;border-left:none;border-top-color:transparent;border-bottom-color:transparent}.mce-btn{border:1px solid #b1b1b1;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25) rgba(0,0,0,0.25);position:relative;text-shadow:0 1px 1px rgba(255,255,255,0.75);display:inline-block;*display:inline;*zoom:1;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fff, #d9d9d9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fff), to(#d9d9d9));background-image:-webkit-linear-gradient(top, #fff, #d9d9d9);background-image:-o-linear-gradient(top, #fff, #d9d9d9);background-image:linear-gradient(to bottom, #fff, #d9d9d9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffd9d9d9', GradientType=0);zoom:1}.mce-btn:hover,.mce-btn:focus{color:#333;background-color:#e3e3e3;background-image:-moz-linear-gradient(top, #f2f2f2, #ccc);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#f2f2f2), to(#ccc));background-image:-webkit-linear-gradient(top, #f2f2f2, #ccc);background-image:-o-linear-gradient(top, #f2f2f2, #ccc);background-image:linear-gradient(to bottom, #f2f2f2, #ccc);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#fff2f2f2', endColorstr='#ffcccccc', GradientType=0);zoom:1}.mce-btn.mce-disabled button,.mce-btn.mce-disabled:hover button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-btn.mce-active,.mce-btn.mce-active:hover{background-color:#d6d6d6;background-image:-moz-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#e6e6e6), to(#c0c0c0));background-image:-webkit-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-o-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:linear-gradient(to bottom, #e6e6e6, #c0c0c0);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe6e6e6', endColorstr='#ffc0c0c0', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-btn:not(.mce-disabled):active{background-color:#d6d6d6;background-image:-moz-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#e6e6e6), to(#c0c0c0));background-image:-webkit-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:-o-linear-gradient(top, #e6e6e6, #c0c0c0);background-image:linear-gradient(to bottom, #e6e6e6, #c0c0c0);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffe6e6e6', endColorstr='#ffc0c0c0', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-btn button{padding:4px 10px;font-size:14px;line-height:20px;*line-height:16px;cursor:pointer;color:#333;text-align:center;overflow:visible;-webkit-appearance:none}.mce-btn button::-moz-focus-inner{border:0;padding:0}.mce-btn i{text-shadow:1px 1px #fff}.mce-primary{min-width:50px;color:#fff;border:1px solid #b1b1b1;border-color:rgba(0,0,0,0.1) rgba(0,0,0,0.1) rgba(0,0,0,0.25) rgba(0,0,0,0.25);background-color:#006dcc;background-image:-moz-linear-gradient(top, #08c, #04c);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#08c), to(#04c));background-image:-webkit-linear-gradient(top, #08c, #04c);background-image:-o-linear-gradient(top, #08c, #04c);background-image:linear-gradient(to bottom, #08c, #04c);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0044cc', GradientType=0);zoom:1}.mce-primary:hover,.mce-primary:focus{background-color:#005fb3;background-image:-moz-linear-gradient(top, #0077b3, #003cb3);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#0077b3), to(#003cb3));background-image:-webkit-linear-gradient(top, #0077b3, #003cb3);background-image:-o-linear-gradient(top, #0077b3, #003cb3);background-image:linear-gradient(to bottom, #0077b3, #003cb3);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0077b3', endColorstr='#ff003cb3', GradientType=0);zoom:1}.mce-primary.mce-disabled button,.mce-primary.mce-disabled:hover button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-primary.mce-active,.mce-primary.mce-active:hover,.mce-primary:not(.mce-disabled):active{background-color:#005299;background-image:-moz-linear-gradient(top, #069, #039);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#069), to(#039));background-image:-webkit-linear-gradient(top, #069, #039);background-image:-o-linear-gradient(top, #069, #039);background-image:linear-gradient(to bottom, #069, #039);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff006699', endColorstr='#ff003399', GradientType=0);zoom:1;-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-primary button,.mce-primary button i{color:#fff;text-shadow:1px 1px #333}.mce-btn-large button{padding:9px 14px;font-size:16px;line-height:normal;-webkit-border-radius:5px;-moz-border-radius:5px;border-radius:5px}.mce-btn-large i{margin-top:2px}.mce-btn-small button{padding:1px 5px;font-size:12px;*padding-bottom:2px}.mce-btn-small i{line-height:20px;vertical-align:top;*line-height:18px}.mce-btn .mce-caret{margin-top:8px;margin-left:0}.mce-btn-small .mce-caret{margin-top:8px;margin-left:0}.mce-caret{display:inline-block;*display:inline;*zoom:1;width:0;height:0;vertical-align:top;border-top:4px solid #333;border-right:4px solid transparent;border-left:4px solid transparent;content:""}.mce-disabled .mce-caret{border-top-color:#aaa}.mce-caret.mce-up{border-bottom:4px solid #333;border-top:0}.mce-rtl .mce-btn button{direction:rtl}.mce-btn-group .mce-btn{border-width:1px 0 1px 0;margin:0;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0}.mce-btn-group .mce-first{border-left:1px solid #b1b1b1;border-left:1px solid rgba(0,0,0,0.25);-webkit-border-radius:3px 0 0 3px;-moz-border-radius:3px 0 0 3px;border-radius:3px 0 0 3px}.mce-btn-group .mce-last{border-right:1px solid #b1b1b1;border-right:1px solid rgba(0,0,0,0.1);-webkit-border-radius:0 3px 3px 0;-moz-border-radius:0 3px 3px 0;border-radius:0 3px 3px 0}.mce-btn-group .mce-first.mce-last{-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-btn-group .mce-btn.mce-flow-layout-item{margin:0}.mce-checkbox{cursor:pointer}i.mce-i-checkbox{margin:0 3px 0 0;border:1px solid #c5c5c5;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 1px 0 rgba(255, 255, 255, 0.2), 0 1px 2px rgba(0, 0, 0, 0.05);background-color:#f0f0f0;background-image:-moz-linear-gradient(top, #fff, #d9d9d9);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#fff), to(#d9d9d9));background-image:-webkit-linear-gradient(top, #fff, #d9d9d9);background-image:-o-linear-gradient(top, #fff, #d9d9d9);background-image:linear-gradient(to bottom, #fff, #d9d9d9);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffffffff', endColorstr='#ffd9d9d9', GradientType=0);zoom:1;text-indent:-10em;*font-size:0;*line-height:0;*text-indent:0;overflow:hidden}.mce-checked i.mce-i-checkbox{color:#333;font-size:16px;line-height:16px;text-indent:0}.mce-checkbox:focus i.mce-i-checkbox,.mce-checkbox.mce-focus i.mce-i-checkbox{border:1px solid rgba(82,168,236,0.8);-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65)}.mce-checkbox.mce-disabled .mce-label,.mce-checkbox.mce-disabled i.mce-i-checkbox{color:#acacac}.mce-rtl .mce-checkbox{direction:rtl;text-align:right}.mce-rtl i.mce-i-checkbox{margin:0 0 0 3px}.mce-colorbutton .mce-ico{position:relative}.mce-colorbutton-grid{margin:4px}.mce-colorbutton button{padding-right:4px}.mce-colorbutton .mce-preview{padding-right:3px;display:block;position:absolute;left:50%;top:50%;margin-left:-14px;margin-top:7px;background:gray;width:13px;height:2px;overflow:hidden}.mce-colorbutton.mce-btn-small .mce-preview{margin-left:-16px;padding-right:0;width:16px}.mce-colorbutton .mce-open{padding-left:4px;border-left:1px solid transparent;border-right:1px solid transparent}.mce-colorbutton:hover .mce-open{border-left-color:#bdbdbd;border-right-color:#bdbdbd}.mce-colorbutton.mce-btn-small .mce-open{padding:0 3px 0 3px}.mce-rtl .mce-colorbutton{direction:rtl}.mce-rtl .mce-colorbutton .mce-preview{margin-left:0;padding-right:0;padding-left:4px;margin-right:-14px}.mce-rtl .mce-colorbutton.mce-btn-small .mce-preview{margin-left:0;padding-right:0;margin-right:-17px;padding-left:0}.mce-rtl .mce-colorbutton button{padding-right:10px;padding-left:10px}.mce-rtl .mce-colorbutton .mce-open{padding-left:4px;padding-right:4px}.mce-combobox{display:inline-block;*display:inline;*zoom:1;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);*height:32px}.mce-combobox input{border:1px solid #c5c5c5;border-right-color:#c5c5c5;height:28px}.mce-combobox.mce-disabled input{color:#adadad}.mce-combobox.mce-has-open input{-webkit-border-radius:4px 0 0 4px;-moz-border-radius:4px 0 0 4px;border-radius:4px 0 0 4px}.mce-combobox .mce-btn{border-left:0;-webkit-border-radius:0 4px 4px 0;-moz-border-radius:0 4px 4px 0;border-radius:0 4px 4px 0}.mce-combobox button{padding-right:8px;padding-left:8px}.mce-combobox.mce-disabled .mce-btn button{cursor:default;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;opacity:.4;filter:alpha(opacity=40);zoom:1}.mce-path{display:inline-block;*display:inline;*zoom:1;padding:8px;white-space:normal}.mce-path .mce-txt{display:inline-block;padding-right:3px}.mce-path .mce-path-body{display:inline-block}.mce-path-item{display:inline-block;*display:inline;*zoom:1;cursor:pointer;color:#333}.mce-path-item:hover{text-decoration:underline}.mce-path-item:focus{background:#666;color:#fff}.mce-path .mce-divider{display:inline}.mce-disabled .mce-path-item{color:#aaa}.mce-rtl .mce-path{direction:rtl}.mce-fieldset{border:0 solid #9E9E9E;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px}.mce-fieldset>.mce-container-body{margin-top:-15px}.mce-fieldset-title{margin-left:5px;padding:0 5px 0 5px}.mce-fit-layout{display:inline-block;*display:inline;*zoom:1}.mce-fit-layout-item{position:absolute}.mce-flow-layout-item{display:inline-block;*display:inline;*zoom:1}.mce-flow-layout-item{margin:2px 0 2px 2px}.mce-flow-layout-item.mce-last{margin-right:2px}.mce-flow-layout{white-space:normal}.mce-tinymce-inline .mce-flow-layout{white-space:nowrap}.mce-rtl .mce-flow-layout{text-align:right;direction:rtl}.mce-rtl .mce-flow-layout-item{margin:2px 2px 2px 0}.mce-rtl .mce-flow-layout-item.mce-last{margin-left:2px}.mce-iframe{border:0 solid #9e9e9e;width:100%;height:100%}.mce-label{display:inline-block;*display:inline;*zoom:1;text-shadow:0 1px 1px rgba(255,255,255,0.75);overflow:hidden}.mce-label.mce-autoscroll{overflow:auto}.mce-label.mce-disabled{color:#aaa}.mce-label.mce-multiline{white-space:pre-wrap}.mce-label.mce-error{color:#a00}.mce-rtl .mce-label{text-align:right;direction:rtl}.mce-menubar .mce-menubtn{border-color:transparent;background:transparent;-webkit-border-radius:0;-moz-border-radius:0;border-radius:0;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none;filter:none}.mce-menubar{border:1px solid #c4c4c4}.mce-menubar .mce-menubtn button span{color:#333}.mce-menubar .mce-caret{border-top-color:#333}.mce-menubar .mce-menubtn:hover,.mce-menubar .mce-menubtn.mce-active,.mce-menubar .mce-menubtn:focus{border-color:transparent;background:#e6e6e6;filter:none;-webkit-box-shadow:none;-moz-box-shadow:none;box-shadow:none}.mce-menubtn span{color:#333;margin-right:2px;line-height:20px;*line-height:16px}.mce-menubtn.mce-btn-small span{font-size:12px}.mce-menubtn.mce-fixed-width span{display:inline-block;overflow-x:hidden;text-overflow:ellipsis;width:90px}.mce-menubtn.mce-fixed-width.mce-btn-small span{width:70px}.mce-menubtn .mce-caret{*margin-top:6px}.mce-rtl .mce-menubtn button{direction:rtl;text-align:right}.mce-listbox button{text-align:left;padding-right:20px;position:relative}.mce-listbox .mce-caret{position:absolute;margin-top:-2px;right:8px;top:50%}.mce-rtl .mce-listbox .mce-caret{right:auto;left:8px}.mce-rtl .mce-listbox button{padding-right:10px;padding-left:20px}.mce-menu-item{display:block;padding:6px 15px 6px 12px;clear:both;font-weight:normal;line-height:20px;color:#333;white-space:nowrap;cursor:pointer;line-height:normal;border-left:4px solid transparent;margin-bottom:1px}.mce-menu-item .mce-ico,.mce-menu-item .mce-text{color:#333}.mce-menu-item.mce-disabled .mce-text,.mce-menu-item.mce-disabled .mce-ico{color:#adadad}.mce-menu-item:hover .mce-text,.mce-menu-item.mce-selected .mce-text,.mce-menu-item:focus .mce-text{color:#fff}.mce-menu-item:hover .mce-ico,.mce-menu-item.mce-selected .mce-ico,.mce-menu-item:focus .mce-ico{color:#fff}.mce-menu-item.mce-disabled:hover{background:#ccc}.mce-menu-shortcut{display:inline-block;color:#adadad}.mce-menu-shortcut{display:inline-block;*display:inline;*zoom:1;padding:0 15px 0 20px}.mce-menu-item:hover .mce-menu-shortcut,.mce-menu-item.mce-selected .mce-menu-shortcut,.mce-menu-item:focus .mce-menu-shortcut{color:#fff}.mce-menu-item .mce-caret{margin-top:4px;*margin-top:3px;margin-right:6px;border-top:4px solid transparent;border-bottom:4px solid transparent;border-left:4px solid #333}.mce-menu-item.mce-selected .mce-caret,.mce-menu-item:focus .mce-caret,.mce-menu-item:hover .mce-caret{border-left-color:#fff}.mce-menu-align .mce-menu-shortcut{*margin-top:-2px}.mce-menu-align .mce-menu-shortcut,.mce-menu-align .mce-caret{position:absolute;right:0}.mce-menu-item.mce-active i{visibility:visible}.mce-menu-item-normal.mce-active{background-color:#c8def4}.mce-menu-item-preview.mce-active{border-left:5px solid #aaa}.mce-menu-item-normal.mce-active .mce-text{color:#333}.mce-menu-item-normal.mce-active:hover .mce-text,.mce-menu-item-normal.mce-active:hover .mce-ico{color:#fff}.mce-menu-item-normal.mce-active:focus .mce-text,.mce-menu-item-normal.mce-active:focus .mce-ico{color:#fff}.mce-menu-item:hover,.mce-menu-item.mce-selected,.mce-menu-item:focus{text-decoration:none;color:#fff;background-color:#0081c2;background-image:-moz-linear-gradient(top, #08c, #0077b3);background-image:-webkit-gradient(linear, 0 0, 0 100%, from(#08c), to(#0077b3));background-image:-webkit-linear-gradient(top, #08c, #0077b3);background-image:-o-linear-gradient(top, #08c, #0077b3);background-image:linear-gradient(to bottom, #08c, #0077b3);background-repeat:repeat-x;filter:progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0088cc', endColorstr='#ff0077b3', GradientType=0);zoom:1}div.mce-menu .mce-menu-item-sep,.mce-menu-item-sep:hover{border:0;padding:0;height:1px;margin:9px 1px;overflow:hidden;background:#cbcbcb;border-bottom:1px solid #fff;cursor:default;filter:none}.mce-menu.mce-rtl{direction:rtl}.mce-rtl .mce-menu-item{text-align:right;direction:rtl;padding:6px 12px 6px 15px}.mce-menu-align.mce-rtl .mce-menu-shortcut,.mce-menu-align.mce-rtl .mce-caret{right:auto;left:0}.mce-rtl .mce-menu-item .mce-caret{margin-left:6px;margin-right:0;border-right:4px solid #333;border-left:0}.mce-rtl .mce-menu-item.mce-selected .mce-caret,.mce-rtl .mce-menu-item:focus .mce-caret,.mce-rtl .mce-menu-item:hover .mce-caret{border-left-color:transparent;border-right-color:#fff}.mce-menu{position:absolute;left:0;top:0;filter:progid:DXImageTransform.Microsoft.gradient(enabled = false);background:transparent;z-index:1000;padding:5px 0 5px 0;margin:2px 0 0;min-width:160px;background:#fff;border:1px solid #989898;border:1px solid rgba(0,0,0,0.2);z-index:1002;-webkit-border-radius:6px;-moz-border-radius:6px;border-radius:6px;-webkit-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);-moz-box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);box-shadow:0 5px 10px rgba(0, 0, 0, 0.2);max-height:400px;overflow:auto;overflow-x:hidden}.mce-menu i{display:none}.mce-menu-has-icons i{display:inline-block;*display:inline}.mce-menu-sub-tr-tl{margin:-6px 0 0 -1px}.mce-menu-sub-br-bl{margin:6px 0 0 -1px}.mce-menu-sub-tl-tr{margin:-6px 0 0 1px}.mce-menu-sub-bl-br{margin:6px 0 0 1px}.mce-container-body .mce-resizehandle{position:absolute;right:0;bottom:0;width:16px;height:16px;visibility:visible;cursor:s-resize;margin:0}.mce-container-body .mce-resizehandle-both{cursor:se-resize}i.mce-i-resize{color:#333}.mce-spacer{visibility:hidden}.mce-splitbtn .mce-open{border-left:1px solid transparent;border-right:1px solid transparent}.mce-splitbtn:hover .mce-open{border-left-color:#bdbdbd;border-right-color:#bdbdbd}.mce-splitbtn button{padding-right:4px}.mce-splitbtn .mce-open{padding-left:4px}.mce-splitbtn .mce-open.mce-active{-webkit-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);-moz-box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05);box-shadow:inset 0 2px 4px rgba(0, 0, 0, 0.15), 0 1px 2px rgba(0, 0, 0, 0.05)}.mce-splitbtn.mce-btn-small .mce-open{padding:0 3px 0 3px}.mce-rtl .mce-splitbtn{direction:rtl;text-align:right}.mce-rtl .mce-splitbtn button{padding-right:10px;padding-left:10px}.mce-rtl .mce-splitbtn .mce-open{padding-left:4px;padding-right:4px}.mce-stack-layout-item{display:block}.mce-tabs{display:block;border-bottom:1px solid #c5c5c5}.mce-tab{display:inline-block;*display:inline;*zoom:1;border:1px solid #c5c5c5;border-width:0 1px 0 0;background:#e3e3e3;padding:8px;text-shadow:0 1px 1px rgba(255,255,255,0.75);height:13px;cursor:pointer}.mce-tab:hover{background:#fdfdfd}.mce-tab.mce-active{background:#fdfdfd;border-bottom-color:transparent;margin-bottom:-1px;height:14px}.mce-rtl .mce-tabs{text-align:right;direction:rtl}.mce-rtl .mce-tab{border-width:0 0 0 1px}.mce-textbox{background:#fff;border:1px solid #c5c5c5;-webkit-border-radius:3px;-moz-border-radius:3px;border-radius:3px;-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075);display:inline-block;-webkit-transition:border linear .2s, box-shadow linear .2s;transition:border linear .2s, box-shadow linear .2s;height:28px;resize:none;padding:0 4px 0 4px;white-space:pre-wrap;*white-space:pre;color:#333}.mce-textbox:focus,.mce-textbox.mce-focus{border-color:rgba(82,168,236,0.8);-webkit-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);-moz-box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65);box-shadow:inset 0 1px 1px rgba(0, 0, 0, 0.075), 0 0 8px rgba(82, 168, 236, 0.65)}.mce-placeholder .mce-textbox{color:#aaa}.mce-textbox.mce-multiline{padding:4px}.mce-textbox.mce-disabled{color:#adadad}.mce-rtl .mce-textbox{text-align:right;direction:rtl}.mce-throbber{position:absolute;top:0;left:0;width:100%;height:100%;opacity:.6;filter:alpha(opacity=60);zoom:1;background:#fff url('img/loader.gif') no-repeat center center}.mce-throbber-inline{position:static;height:50px}@font-face{font-family:'tinymce';src:url('fonts/tinymce.eot');src:url('fonts/tinymce.eot?#iefix') format('embedded-opentype'),url('fonts/tinymce.woff') format('woff'),url('fonts/tinymce.ttf') format('truetype'),url('fonts/tinymce.svg#tinymce') format('svg');font-weight:normal;font-style:normal}@font-face{font-family:'tinymce-small';src:url('fonts/tinymce-small.eot');src:url('fonts/tinymce-small.eot?#iefix') format('embedded-opentype'),url('fonts/tinymce-small.woff') format('woff'),url('fonts/tinymce-small.ttf') format('truetype'),url('fonts/tinymce-small.svg#tinymce') format('svg');font-weight:normal;font-style:normal}.mce-ico{font-family:'tinymce',Arial;font-style:normal;font-weight:normal;font-variant:normal;font-size:16px;line-height:16px;speak:none;vertical-align:text-top;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;display:inline-block;background:transparent center center;background-size:cover;width:16px;height:16px;color:#333}.mce-btn-small .mce-ico{font-family:'tinymce-small',Arial}.mce-i-save:before{content:"\e000"}.mce-i-newdocument:before{content:"\e001"}.mce-i-fullpage:before{content:"\e002"}.mce-i-alignleft:before{content:"\e003"}.mce-i-aligncenter:before{content:"\e004"}.mce-i-alignright:before{content:"\e005"}.mce-i-alignjustify:before{content:"\e006"}.mce-i-cut:before{content:"\e007"}.mce-i-paste:before{content:"\e008"}.mce-i-searchreplace:before{content:"\e009"}.mce-i-bullist:before{content:"\e00a"}.mce-i-numlist:before{content:"\e00b"}.mce-i-indent:before{content:"\e00c"}.mce-i-outdent:before{content:"\e00d"}.mce-i-blockquote:before{content:"\e00e"}.mce-i-undo:before{content:"\e00f"}.mce-i-redo:before{content:"\e010"}.mce-i-link:before{content:"\e011"}.mce-i-unlink:before{content:"\e012"}.mce-i-anchor:before{content:"\e013"}.mce-i-image:before{content:"\e014"}.mce-i-media:before{content:"\e015"}.mce-i-help:before{content:"\e016"}.mce-i-code:before{content:"\e017"}.mce-i-insertdatetime:before{content:"\e018"}.mce-i-preview:before{content:"\e019"}.mce-i-forecolor:before{content:"\e01a"}.mce-i-backcolor:before{content:"\e01a"}.mce-i-table:before{content:"\e01b"}.mce-i-hr:before{content:"\e01c"}.mce-i-removeformat:before{content:"\e01d"}.mce-i-subscript:before{content:"\e01e"}.mce-i-superscript:before{content:"\e01f"}.mce-i-charmap:before{content:"\e020"}.mce-i-emoticons:before{content:"\e021"}.mce-i-print:before{content:"\e022"}.mce-i-fullscreen:before{content:"\e023"}.mce-i-spellchecker:before{content:"\e024"}.mce-i-nonbreaking:before{content:"\e025"}.mce-i-template:before{content:"\e026"}.mce-i-pagebreak:before{content:"\e027"}.mce-i-restoredraft:before{content:"\e028"}.mce-i-untitled:before{content:"\e029"}.mce-i-bold:before{content:"\e02a"}.mce-i-italic:before{content:"\e02b"}.mce-i-underline:before{content:"\e02c"}.mce-i-strikethrough:before{content:"\e02d"}.mce-i-visualchars:before{content:"\e02e"}.mce-i-visualblocks:before{content:"\e02e"}.mce-i-ltr:before{content:"\e02f"}.mce-i-rtl:before{content:"\e030"}.mce-i-copy:before{content:"\e031"}.mce-i-resize:before{content:"\e032"}.mce-i-browse:before{content:"\e034"}.mce-i-pastetext:before{content:"\e035"}.mce-i-checkbox:before,.mce-i-selected:before{content:"\e033"}.mce-i-selected{visibility:hidden}i.mce-i-backcolor{text-shadow:none;background:#bbb}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/themes/modern/theme.min.js b/node_modules/selenium-webdriver/lib/test/data/js/themes/modern/theme.min.js new file mode 100644 index 000000000..e25849df3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/themes/modern/theme.min.js @@ -0,0 +1 @@ +tinymce.ThemeManager.add("modern",function(e){function t(){function t(t){var n,o=[];if(t)return d(t.split(/[ ,]/),function(t){function i(){var i=e.selection;"bullist"==r&&i.selectorChanged("ul > li",function(e,i){for(var n,o=i.parents.length;o--&&(n=i.parents[o].nodeName,"OL"!=n&&"UL"!=n););t.active(e&&"UL"==n)}),"numlist"==r&&i.selectorChanged("ol > li",function(e,i){for(var n,o=i.parents.length;o--&&(n=i.parents[o].nodeName,"OL"!=n&&"UL"!=n););t.active(e&&"OL"==n)}),t.settings.stateSelector&&i.selectorChanged(t.settings.stateSelector,function(e){t.active(e)},!0),t.settings.disabledStateSelector&&i.selectorChanged(t.settings.disabledStateSelector,function(e){t.disabled(e)})}var r;"|"==t?n=null:c.has(t)?(t={type:t},u.toolbar_items_size&&(t.size=u.toolbar_items_size),o.push(t),n=null):(n||(n={type:"buttongroup",items:[]},o.push(n)),e.buttons[t]&&(r=t,t=e.buttons[r],"function"==typeof t&&(t=t()),t.type=t.type||"button",u.toolbar_items_size&&(t.size=u.toolbar_items_size),t=c.create(t),n.items.push(t),e.initialized?i():e.on("init",i)))}),i.push({type:"toolbar",layout:"flow",items:o}),!0}var i=[];if(tinymce.isArray(u.toolbar)){if(0===u.toolbar.length)return;tinymce.each(u.toolbar,function(e,t){u["toolbar"+(t+1)]=e}),delete u.toolbar}for(var n=1;10>n&&t(u["toolbar"+n]);n++);return i.length||u.toolbar===!1||t(u.toolbar||f),i.length?{type:"panel",layout:"stack",classes:"toolbar-grp",ariaRoot:!0,ariaRemember:!0,items:i}:void 0}function i(){function t(t){var i;return"|"==t?{text:"|"}:i=e.menuItems[t]}function i(i){var n,o,r,a,s;if(s=tinymce.makeMap((u.removed_menuitems||"").split(/[ ,]/)),u.menu?(o=u.menu[i],a=!0):o=h[i],o){n={text:o.title},r=[],d((o.items||"").split(/[ ,]/),function(e){var i=t(e);i&&!s[e]&&r.push(t(e))}),a||d(e.menuItems,function(e){e.context==i&&("before"==e.separator&&r.push({text:"|"}),e.prependToContext?r.unshift(e):r.push(e),"after"==e.separator&&r.push({text:"|"}))});for(var l=0;l<r.length;l++)"|"==r[l].text&&(0===l||l==r.length-1)&&r.splice(l,1);if(n.menu=r,!n.menu.length)return null}return n}var n,o=[],r=[];if(u.menu)for(n in u.menu)r.push(n);else for(n in h)r.push(n);for(var a="string"==typeof u.menubar?u.menubar.split(/[ ,]/):r,s=0;s<a.length;s++){var l=a[s];l=i(l),l&&o.push(l)}return o}function n(t){function i(e){var i=t.find(e)[0];i&&i.focus(!0)}e.shortcuts.add("Alt+F9","",function(){i("menubar")}),e.shortcuts.add("Alt+F10","",function(){i("toolbar")}),e.shortcuts.add("Alt+F11","",function(){i("elementpath")}),t.on("cancel",function(){e.focus()})}function o(t,i){function n(e){return{width:e.clientWidth,height:e.clientHeight}}var o,r,a,s;o=e.getContainer(),r=e.getContentAreaContainer().firstChild,a=n(o),s=n(r),null!==t&&(t=Math.max(u.min_width||100,t),t=Math.min(u.max_width||65535,t),m.css(o,"width",t+(a.width-s.width)),m.css(r,"width",t)),i=Math.max(u.min_height||100,i),i=Math.min(u.max_height||65535,i),m.css(r,"height",i),e.fire("ResizeEditor")}function r(t,i){var n=e.getContentAreaContainer();l.resizeTo(n.clientWidth+t,n.clientHeight+i)}function a(o){function r(){if(h&&h.moveRel&&h.visible()&&!h._fixed){var t=e.selection.getScrollContainer(),i=e.getBody(),n=0,o=0;if(t){var r=m.getPos(i),a=m.getPos(t);n=Math.max(0,a.x-r.x),o=Math.max(0,a.y-r.y)}h.fixed(!1).moveRel(i,e.rtl?["tr-br","br-tr"]:["tl-bl","bl-tl"]).moveBy(n,o)}}function a(){h&&(h.show(),r(),m.addClass(e.getBody(),"mce-edit-focus"))}function s(){h&&(h.hide(),m.removeClass(e.getBody(),"mce-edit-focus"))}function d(){return h?void(h.visible()||a()):(h=l.panel=c.create({type:f?"panel":"floatpanel",role:"application",classes:"tinymce tinymce-inline",layout:"flex",direction:"column",align:"stretch",autohide:!1,autofix:!0,fixed:!!f,border:1,items:[u.menubar===!1?null:{type:"menubar",border:"0 0 1 0",items:i()},t()]}),e.fire("BeforeRenderUI"),h.renderTo(f||document.body).reflow(),n(h),a(),e.on("nodeChange",r),e.on("activate",a),e.on("deactivate",s),void e.nodeChanged())}var h,f;return u.fixed_toolbar_container&&(f=m.select(u.fixed_toolbar_container)[0]),u.content_editable=!0,e.on("focus",function(){o.skinUiCss?tinymce.DOM.styleSheetLoader.load(o.skinUiCss,d,d):d()}),e.on("blur hide",s),e.on("remove",function(){h&&(h.remove(),h=null)}),o.skinUiCss&&tinymce.DOM.styleSheetLoader.load(o.skinUiCss),{}}function s(r){var a,s,d;return r.skinUiCss&&tinymce.DOM.loadCSS(r.skinUiCss),a=l.panel=c.create({type:"panel",role:"application",classes:"tinymce",style:"visibility: hidden",layout:"stack",border:1,items:[u.menubar===!1?null:{type:"menubar",border:"0 0 1 0",items:i()},t(),{type:"panel",name:"iframe",layout:"stack",classes:"edit-area",html:"",border:"1 0 0 0"}]}),u.resize!==!1&&(s={type:"resizehandle",direction:u.resize,onResizeStart:function(){var t=e.getContentAreaContainer().firstChild;d={width:t.clientWidth,height:t.clientHeight}},onResize:function(e){"both"==u.resize?o(d.width+e.deltaX,d.height+e.deltaY):o(null,d.height+e.deltaY)}}),u.statusbar!==!1&&a.add({type:"panel",name:"statusbar",classes:"statusbar",layout:"flow",border:"1 0 0 0",ariaRoot:!0,items:[{type:"elementpath"},s]}),u.readonly&&a.find("*").disabled(!0),e.fire("BeforeRenderUI"),a.renderBefore(r.targetNode).reflow(),u.width&&tinymce.DOM.setStyle(a.getEl(),"width",u.width),e.on("remove",function(){a.remove(),a=null}),n(a),{iframeContainer:a.find("#iframe")[0].getEl(),editorContainer:a.getEl()}}var l=this,u=e.settings,c=tinymce.ui.Factory,d=tinymce.each,m=tinymce.DOM,h={file:{title:"File",items:"newdocument"},edit:{title:"Edit",items:"undo redo | cut copy paste pastetext | selectall"},insert:{title:"Insert",items:"|"},view:{title:"View",items:"visualaid |"},format:{title:"Format",items:"bold italic underline strikethrough superscript subscript | formats | removeformat"},table:{title:"Table"},tools:{title:"Tools"}},f="undo redo | styleselect | bold italic | alignleft aligncenter alignright alignjustify | bullist numlist outdent indent | link image";l.renderUI=function(t){var i=u.skin!==!1?u.skin||"lightgray":!1;if(i){var n=u.skin_url;n=n?e.documentBaseURI.toAbsolute(n):tinymce.baseURL+"/skins/"+i,t.skinUiCss=tinymce.Env.documentMode<=7?n+"/skin.ie7.min.css":n+"/skin.min.css",e.contentCSS.push(n+"/content"+(e.inline?".inline":"")+".min.css")}return e.on("ProgressState",function(e){l.throbber=l.throbber||new tinymce.ui.Throbber(l.panel.getEl("body")),e.state?l.throbber.show(e.time):l.throbber.hide()}),u.inline?a(t):s(t)},l.resizeTo=o,l.resizeBy=r});
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/js/tinymce.min.js b/node_modules/selenium-webdriver/lib/test/data/js/tinymce.min.js new file mode 100644 index 000000000..3ab7df7fc --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/js/tinymce.min.js @@ -0,0 +1,10 @@ +// 4.0.26 (2014-05-06) +!function(e,t){"use strict";function n(e,t){for(var n,r=[],i=0;i<e.length;++i){if(n=s[e[i]]||o(e[i]),!n)throw"module definition dependecy not found: "+e[i];r.push(n)}t.apply(null,r)}function r(e,r,i){if("string"!=typeof e)throw"invalid module definition, module id must be defined and be a string";if(r===t)throw"invalid module definition, dependencies must be specified";if(i===t)throw"invalid module definition, definition function must be specified";n(r,function(){s[e]=i.apply(null,arguments)})}function i(e){return!!s[e]}function o(t){for(var n=e,r=t.split(/[.\/]/),i=0;i<r.length;++i){if(!n[r[i]])return;n=n[r[i]]}return n}function a(n){for(var r=0;r<n.length;r++){for(var i=e,o=n[r],a=o.split(/[.\/]/),l=0;l<a.length-1;++l)i[a[l]]===t&&(i[a[l]]={}),i=i[a[l]];i[a[a.length-1]]=s[o]}}var s={},l="tinymce/dom/EventUtils",c="tinymce/dom/Sizzle",u="tinymce/dom/DomQuery",d="tinymce/html/Styles",f="tinymce/dom/TreeWalker",p="tinymce/util/Tools",h="tinymce/dom/Range",m="tinymce/html/Entities",g="tinymce/Env",v="tinymce/dom/StyleSheetLoader",y="tinymce/dom/DOMUtils",b="tinymce/dom/ScriptLoader",C="tinymce/AddOnManager",x="tinymce/html/Node",w="tinymce/html/Schema",_="tinymce/html/SaxParser",N="tinymce/html/DomParser",E="tinymce/html/Writer",S="tinymce/html/Serializer",k="tinymce/dom/Serializer",T="tinymce/dom/TridentSelection",R="tinymce/util/VK",A="tinymce/dom/ControlSelection",B="tinymce/dom/RangeUtils",D="tinymce/dom/Selection",L="tinymce/fmt/Preview",M="tinymce/Formatter",H="tinymce/UndoManager",P="tinymce/EnterKey",O="tinymce/ForceBlocks",I="tinymce/EditorCommands",F="tinymce/util/URI",z="tinymce/util/Class",W="tinymce/util/EventDispatcher",V="tinymce/ui/Selector",U="tinymce/ui/Collection",q="tinymce/ui/DomUtils",$="tinymce/ui/Control",j="tinymce/ui/Factory",K="tinymce/ui/KeyboardNavigation",G="tinymce/ui/Container",Y="tinymce/ui/DragHelper",X="tinymce/ui/Scrollable",J="tinymce/ui/Panel",Q="tinymce/ui/Movable",Z="tinymce/ui/Resizable",et="tinymce/ui/FloatPanel",tt="tinymce/ui/Window",nt="tinymce/ui/MessageBox",rt="tinymce/WindowManager",it="tinymce/util/Quirks",ot="tinymce/util/Observable",at="tinymce/EditorObservable",st="tinymce/Shortcuts",lt="tinymce/Editor",ct="tinymce/util/I18n",ut="tinymce/FocusManager",dt="tinymce/EditorManager",ft="tinymce/LegacyInput",pt="tinymce/util/XHR",ht="tinymce/util/JSON",mt="tinymce/util/JSONRequest",gt="tinymce/util/JSONP",vt="tinymce/util/LocalStorage",yt="tinymce/Compat",bt="tinymce/ui/Layout",Ct="tinymce/ui/AbsoluteLayout",xt="tinymce/ui/Tooltip",wt="tinymce/ui/Widget",_t="tinymce/ui/Button",Nt="tinymce/ui/ButtonGroup",Et="tinymce/ui/Checkbox",St="tinymce/ui/PanelButton",kt="tinymce/ui/ColorButton",Tt="tinymce/ui/ComboBox",Rt="tinymce/ui/Path",At="tinymce/ui/ElementPath",Bt="tinymce/ui/FormItem",Dt="tinymce/ui/Form",Lt="tinymce/ui/FieldSet",Mt="tinymce/ui/FilePicker",Ht="tinymce/ui/FitLayout",Pt="tinymce/ui/FlexLayout",Ot="tinymce/ui/FlowLayout",It="tinymce/ui/FormatControls",Ft="tinymce/ui/GridLayout",zt="tinymce/ui/Iframe",Wt="tinymce/ui/Label",Vt="tinymce/ui/Toolbar",Ut="tinymce/ui/MenuBar",qt="tinymce/ui/MenuButton",$t="tinymce/ui/ListBox",jt="tinymce/ui/MenuItem",Kt="tinymce/ui/Menu",Gt="tinymce/ui/Radio",Yt="tinymce/ui/ResizeHandle",Xt="tinymce/ui/Spacer",Jt="tinymce/ui/SplitButton",Qt="tinymce/ui/StackLayout",Zt="tinymce/ui/TabPanel",en="tinymce/ui/TextBox",tn="tinymce/ui/Throbber";r(l,[],function(){function e(e,t,n,r){e.addEventListener?e.addEventListener(t,n,r||!1):e.attachEvent&&e.attachEvent("on"+t,n)}function t(e,t,n,r){e.removeEventListener?e.removeEventListener(t,n,r||!1):e.detachEvent&&e.detachEvent("on"+t,n)}function n(e,t){function n(){return!1}function r(){return!0}var i,o=t||{},l;for(i in e)s[i]||(o[i]=e[i]);if(o.target||(o.target=o.srcElement||document),e&&a.test(e.type)&&e.pageX===l&&e.clientX!==l){var c=o.target.ownerDocument||document,u=c.documentElement,d=c.body;o.pageX=e.clientX+(u&&u.scrollLeft||d&&d.scrollLeft||0)-(u&&u.clientLeft||d&&d.clientLeft||0),o.pageY=e.clientY+(u&&u.scrollTop||d&&d.scrollTop||0)-(u&&u.clientTop||d&&d.clientTop||0)}return o.preventDefault=function(){o.isDefaultPrevented=r,e&&(e.preventDefault?e.preventDefault():e.returnValue=!1)},o.stopPropagation=function(){o.isPropagationStopped=r,e&&(e.stopPropagation?e.stopPropagation():e.cancelBubble=!0)},o.stopImmediatePropagation=function(){o.isImmediatePropagationStopped=r,o.stopPropagation()},o.isDefaultPrevented||(o.isDefaultPrevented=n,o.isPropagationStopped=n,o.isImmediatePropagationStopped=n),o}function r(n,r,i){function o(){i.domLoaded||(i.domLoaded=!0,r(c))}function a(){("complete"===l.readyState||"interactive"===l.readyState&&l.body)&&(t(l,"readystatechange",a),o())}function s(){try{l.documentElement.doScroll("left")}catch(e){return void setTimeout(s,0)}o()}var l=n.document,c={type:"ready"};return i.domLoaded?void r(c):(l.addEventListener?"complete"===l.readyState?o():e(n,"DOMContentLoaded",o):(e(l,"readystatechange",a),l.documentElement.doScroll&&n.self===n.top&&s()),void e(n,"load",o))}function i(){function i(e,t){var n,r,i,o,a=s[t];if(n=a&&a[e.type])for(r=0,i=n.length;i>r;r++)if(o=n[r],o&&o.func.call(o.scope,e)===!1&&e.preventDefault(),e.isImmediatePropagationStopped())return}var a=this,s={},l,c,u,d,f;c=o+(+new Date).toString(32),d="onmouseenter"in document.documentElement,u="onfocusin"in document.documentElement,f={mouseenter:"mouseover",mouseleave:"mouseout"},l=1,a.domLoaded=!1,a.events=s,a.bind=function(t,o,p,h){function m(e){i(n(e||_.event),g)}var g,v,y,b,C,x,w,_=window;if(t&&3!==t.nodeType&&8!==t.nodeType){for(t[c]?g=t[c]:(g=l++,t[c]=g,s[g]={}),h=h||t,o=o.split(" "),y=o.length;y--;)b=o[y],x=m,C=w=!1,"DOMContentLoaded"===b&&(b="ready"),a.domLoaded&&"ready"===b&&"complete"==t.readyState?p.call(h,n({type:b})):(d||(C=f[b],C&&(x=function(e){var t,r;if(t=e.currentTarget,r=e.relatedTarget,r&&t.contains)r=t.contains(r);else for(;r&&r!==t;)r=r.parentNode;r||(e=n(e||_.event),e.type="mouseout"===e.type?"mouseleave":"mouseenter",e.target=t,i(e,g))})),u||"focusin"!==b&&"focusout"!==b||(w=!0,C="focusin"===b?"focus":"blur",x=function(e){e=n(e||_.event),e.type="focus"===e.type?"focusin":"focusout",i(e,g)}),v=s[g][b],v?"ready"===b&&a.domLoaded?p({type:b}):v.push({func:p,scope:h}):(s[g][b]=v=[{func:p,scope:h}],v.fakeName=C,v.capture=w,v.nativeHandler=x,"ready"===b?r(t,x,a):e(t,C||b,x,w)));return t=v=0,p}},a.unbind=function(e,n,r){var i,o,l,u,d,f;if(!e||3===e.nodeType||8===e.nodeType)return a;if(i=e[c]){if(f=s[i],n){for(n=n.split(" "),l=n.length;l--;)if(d=n[l],o=f[d]){if(r)for(u=o.length;u--;)if(o[u].func===r){var p=o.nativeHandler,h=o.fakeName,m=o.capture;o=o.slice(0,u).concat(o.slice(u+1)),o.nativeHandler=p,o.fakeName=h,o.capture=m,f[d]=o}r&&0!==o.length||(delete f[d],t(e,o.fakeName||d,o.nativeHandler,o.capture))}}else{for(d in f)o=f[d],t(e,o.fakeName||d,o.nativeHandler,o.capture);f={}}for(d in f)return a;delete s[i];try{delete e[c]}catch(g){e[c]=null}}return a},a.fire=function(e,t,r){var o;if(!e||3===e.nodeType||8===e.nodeType)return a;r=n(null,r),r.type=t,r.target=e;do o=e[c],o&&i(r,o),e=e.parentNode||e.ownerDocument||e.defaultView||e.parentWindow;while(e&&!r.isPropagationStopped());return a},a.clean=function(e){var t,n,r=a.unbind;if(!e||3===e.nodeType||8===e.nodeType)return a;if(e[c]&&r(e),e.getElementsByTagName||(e=e.document),e&&e.getElementsByTagName)for(r(e),n=e.getElementsByTagName("*"),t=n.length;t--;)e=n[t],e[c]&&r(e);return a},a.destroy=function(){s={}},a.cancel=function(e){return e&&(e.preventDefault(),e.stopImmediatePropagation()),!1}}var o="mce-data-",a=/^(?:mouse|contextmenu)|click/,s={keyLocation:1,layerX:1,layerY:1,returnValue:1};return i.Event=new i,i.Event.bind(window,"ready",function(){}),i}),r(c,[],function(){function e(e){return mt.test(e+"")}function n(){var e,t=[];return e=function(n,r){return t.push(n+=" ")>_.cacheLength&&delete e[t.shift()],e[n]=r,r}}function r(e){return e[I]=!0,e}function i(e){var t=B.createElement("div");try{return!!e(t)}catch(n){return!1}finally{t=null}}function o(e,t,n,r){var i,o,a,s,l,c,f,p,h,m;if((t?t.ownerDocument||t:F)!==B&&A(t),t=t||B,n=n||[],!e||"string"!=typeof e)return n;if(1!==(s=t.nodeType)&&9!==s)return[];if(L&&!r){if(i=gt.exec(e))if(a=i[1]){if(9===s){if(o=t.getElementById(a),!o||!o.parentNode)return n;if(o.id===a)return n.push(o),n}else if(t.ownerDocument&&(o=t.ownerDocument.getElementById(a))&&O(t,o)&&o.id===a)return n.push(o),n}else{if(i[2])return Z.apply(n,t.getElementsByTagName(e)),n;if((a=i[3])&&z.getElementsByClassName&&t.getElementsByClassName)return Z.apply(n,t.getElementsByClassName(a)),n}if(z.qsa&&!M.test(e)){if(f=!0,p=I,h=t,m=9===s&&e,1===s&&"object"!==t.nodeName.toLowerCase()){for(c=u(e),(f=t.getAttribute("id"))?p=f.replace(bt,"\\$&"):t.setAttribute("id",p),p="[id='"+p+"'] ",l=c.length;l--;)c[l]=p+d(c[l]);h=ht.test(e)&&t.parentNode||t,m=c.join(",")}if(m)try{return Z.apply(n,h.querySelectorAll(m)),n}catch(g){}finally{f||t.removeAttribute("id")}}}return b(e.replace(lt,"$1"),t,n,r)}function a(e,t){var n=t&&e,r=n&&(~t.sourceIndex||Y)-(~e.sourceIndex||Y);if(r)return r;if(n)for(;n=n.nextSibling;)if(n===t)return-1;return e?1:-1}function s(e){return function(t){var n=t.nodeName.toLowerCase();return"input"===n&&t.type===e}}function l(e){return function(t){var n=t.nodeName.toLowerCase();return("input"===n||"button"===n)&&t.type===e}}function c(e){return r(function(t){return t=+t,r(function(n,r){for(var i,o=e([],n.length,t),a=o.length;a--;)n[i=o[a]]&&(n[i]=!(r[i]=n[i]))})})}function u(e,t){var n,r,i,a,s,l,c,u=q[e+" "];if(u)return t?0:u.slice(0);for(s=e,l=[],c=_.preFilter;s;){(!n||(r=ct.exec(s)))&&(r&&(s=s.slice(r[0].length)||s),l.push(i=[])),n=!1,(r=ut.exec(s))&&(n=r.shift(),i.push({value:n,type:r[0].replace(lt," ")}),s=s.slice(n.length));for(a in _.filter)!(r=pt[a].exec(s))||c[a]&&!(r=c[a](r))||(n=r.shift(),i.push({value:n,type:a,matches:r}),s=s.slice(n.length));if(!n)break}return t?s.length:s?o.error(e):q(e,l).slice(0)}function d(e){for(var t=0,n=e.length,r="";n>t;t++)r+=e[t].value;return r}function f(e,t,n){var r=t.dir,i=n&&"parentNode"===r,o=V++;return t.first?function(t,n,o){for(;t=t[r];)if(1===t.nodeType||i)return e(t,n,o)}:function(t,n,a){var s,l,c,u=W+" "+o;if(a){for(;t=t[r];)if((1===t.nodeType||i)&&e(t,n,a))return!0}else for(;t=t[r];)if(1===t.nodeType||i)if(c=t[I]||(t[I]={}),(l=c[r])&&l[0]===u){if((s=l[1])===!0||s===w)return s===!0}else if(l=c[r]=[u],l[1]=e(t,n,a)||w,l[1]===!0)return!0}}function p(e){return e.length>1?function(t,n,r){for(var i=e.length;i--;)if(!e[i](t,n,r))return!1;return!0}:e[0]}function h(e,t,n,r,i){for(var o,a=[],s=0,l=e.length,c=null!=t;l>s;s++)(o=e[s])&&(!n||n(o,r,i))&&(a.push(o),c&&t.push(s));return a}function m(e,t,n,i,o,a){return i&&!i[I]&&(i=m(i)),o&&!o[I]&&(o=m(o,a)),r(function(r,a,s,l){var c,u,d,f=[],p=[],m=a.length,g=r||y(t||"*",s.nodeType?[s]:s,[]),v=!e||!r&&t?g:h(g,f,e,s,l),b=n?o||(r?e:m||i)?[]:a:v;if(n&&n(v,b,s,l),i)for(c=h(b,p),i(c,[],s,l),u=c.length;u--;)(d=c[u])&&(b[p[u]]=!(v[p[u]]=d));if(r){if(o||e){if(o){for(c=[],u=b.length;u--;)(d=b[u])&&c.push(v[u]=d);o(null,b=[],c,l)}for(u=b.length;u--;)(d=b[u])&&(c=o?tt.call(r,d):f[u])>-1&&(r[c]=!(a[c]=d))}}else b=h(b===a?b.splice(m,b.length):b),o?o(null,a,b,l):Z.apply(a,b)})}function g(e){for(var t,n,r,i=e.length,o=_.relative[e[0].type],a=o||_.relative[" "],s=o?1:0,l=f(function(e){return e===t},a,!0),c=f(function(e){return tt.call(t,e)>-1},a,!0),u=[function(e,n,r){return!o&&(r||n!==k)||((t=n).nodeType?l(e,n,r):c(e,n,r))}];i>s;s++)if(n=_.relative[e[s].type])u=[f(p(u),n)];else{if(n=_.filter[e[s].type].apply(null,e[s].matches),n[I]){for(r=++s;i>r&&!_.relative[e[r].type];r++);return m(s>1&&p(u),s>1&&d(e.slice(0,s-1)).replace(lt,"$1"),n,r>s&&g(e.slice(s,r)),i>r&&g(e=e.slice(r)),i>r&&d(e))}u.push(n)}return p(u)}function v(e,t){var n=0,i=t.length>0,a=e.length>0,s=function(r,s,l,c,u){var d,f,p,m=[],g=0,v="0",y=r&&[],b=null!=u,C=k,x=r||a&&_.find.TAG("*",u&&s.parentNode||s),N=W+=null==C?1:Math.random()||.1;for(b&&(k=s!==B&&s,w=n);null!=(d=x[v]);v++){if(a&&d){for(f=0;p=e[f++];)if(p(d,s,l)){c.push(d);break}b&&(W=N,w=++n)}i&&((d=!p&&d)&&g--,r&&y.push(d))}if(g+=v,i&&v!==g){for(f=0;p=t[f++];)p(y,m,s,l);if(r){if(g>0)for(;v--;)y[v]||m[v]||(m[v]=J.call(c));m=h(m)}Z.apply(c,m),b&&!r&&m.length>0&&g+t.length>1&&o.uniqueSort(c)}return b&&(W=N,k=C),y};return i?r(s):s}function y(e,t,n){for(var r=0,i=t.length;i>r;r++)o(e,t[r],n);return n}function b(e,t,n,r){var i,o,a,s,l,c=u(e);if(!r&&1===c.length){if(o=c[0]=c[0].slice(0),o.length>2&&"ID"===(a=o[0]).type&&9===t.nodeType&&L&&_.relative[o[1].type]){if(t=(_.find.ID(a.matches[0].replace(xt,wt),t)||[])[0],!t)return n;e=e.slice(o.shift().value.length)}for(i=pt.needsContext.test(e)?0:o.length;i--&&(a=o[i],!_.relative[s=a.type]);)if((l=_.find[s])&&(r=l(a.matches[0].replace(xt,wt),ht.test(o[0].type)&&t.parentNode||t))){if(o.splice(i,1),e=r.length&&d(o),!e)return Z.apply(n,r),n;break}}return S(e,c)(r,t,!L,n,ht.test(e)),n}function C(){}var x,w,_,N,E,S,k,T,R,A,B,D,L,M,H,P,O,I="sizzle"+-new Date,F=window.document,z={},W=0,V=0,U=n(),q=n(),$=n(),j=!1,K=function(){return 0},G=typeof t,Y=1<<31,X=[],J=X.pop,Q=X.push,Z=X.push,et=X.slice,tt=X.indexOf||function(e){for(var t=0,n=this.length;n>t;t++)if(this[t]===e)return t;return-1},nt="[\\x20\\t\\r\\n\\f]",rt="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",it=rt.replace("w","w#"),ot="([*^$|!~]?=)",at="\\["+nt+"*("+rt+")"+nt+"*(?:"+ot+nt+"*(?:(['\"])((?:\\\\.|[^\\\\])*?)\\3|("+it+")|)|)"+nt+"*\\]",st=":("+rt+")(?:\\(((['\"])((?:\\\\.|[^\\\\])*?)\\3|((?:\\\\.|[^\\\\()[\\]]|"+at.replace(3,8)+")*)|.*)\\)|)",lt=new RegExp("^"+nt+"+|((?:^|[^\\\\])(?:\\\\.)*)"+nt+"+$","g"),ct=new RegExp("^"+nt+"*,"+nt+"*"),ut=new RegExp("^"+nt+"*([\\x20\\t\\r\\n\\f>+~])"+nt+"*"),dt=new RegExp(st),ft=new RegExp("^"+it+"$"),pt={ID:new RegExp("^#("+rt+")"),CLASS:new RegExp("^\\.("+rt+")"),NAME:new RegExp("^\\[name=['\"]?("+rt+")['\"]?\\]"),TAG:new RegExp("^("+rt.replace("w","w*")+")"),ATTR:new RegExp("^"+at),PSEUDO:new RegExp("^"+st),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+nt+"*(even|odd|(([+-]|)(\\d*)n|)"+nt+"*(?:([+-]|)"+nt+"*(\\d+)|))"+nt+"*\\)|)","i"),needsContext:new RegExp("^"+nt+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+nt+"*((?:-\\d)?\\d*)"+nt+"*\\)|)(?=[^-]|$)","i")},ht=/[\x20\t\r\n\f]*[+~]/,mt=/^[^{]+\{\s*\[native code/,gt=/^(?:#([\w\-]+)|(\w+)|\.([\w\-]+))$/,vt=/^(?:input|select|textarea|button)$/i,yt=/^h\d$/i,bt=/'|\\/g,Ct=/\=[\x20\t\r\n\f]*([^'"\]]*)[\x20\t\r\n\f]*\]/g,xt=/\\([\da-fA-F]{1,6}[\x20\t\r\n\f]?|.)/g,wt=function(e,t){var n="0x"+t-65536;return n!==n?t:0>n?String.fromCharCode(n+65536):String.fromCharCode(n>>10|55296,1023&n|56320)};try{Z.apply(X=et.call(F.childNodes),F.childNodes),X[F.childNodes.length].nodeType}catch(_t){Z={apply:X.length?function(e,t){Q.apply(e,et.call(t))}:function(e,t){for(var n=e.length,r=0;e[n++]=t[r++];);e.length=n-1}}}E=o.isXML=function(e){var t=e&&(e.ownerDocument||e).documentElement;return t?"HTML"!==t.nodeName:!1},A=o.setDocument=function(n){var r=n?n.ownerDocument||n:F;return r!==B&&9===r.nodeType&&r.documentElement?(B=r,D=r.documentElement,L=!E(r),z.getElementsByTagName=i(function(e){return e.appendChild(r.createComment("")),!e.getElementsByTagName("*").length}),z.attributes=i(function(e){e.innerHTML="<select></select>";var t=typeof e.lastChild.getAttribute("multiple");return"boolean"!==t&&"string"!==t}),z.getElementsByClassName=i(function(e){return e.innerHTML="<div class='hidden e'></div><div class='hidden'></div>",e.getElementsByClassName&&e.getElementsByClassName("e").length?(e.lastChild.className="e",2===e.getElementsByClassName("e").length):!1}),z.getByName=i(function(e){e.id=I+0,e.appendChild(B.createElement("a")).setAttribute("name",I),e.appendChild(B.createElement("i")).setAttribute("name",I),D.appendChild(e);var t=r.getElementsByName&&r.getElementsByName(I).length===2+r.getElementsByName(I+0).length;return D.removeChild(e),t}),z.sortDetached=i(function(e){return e.compareDocumentPosition&&1&e.compareDocumentPosition(B.createElement("div"))}),_.attrHandle=i(function(e){return e.innerHTML="<a href='#'></a>",e.firstChild&&typeof e.firstChild.getAttribute!==G&&"#"===e.firstChild.getAttribute("href")})?{}:{href:function(e){return e.getAttribute("href",2)},type:function(e){return e.getAttribute("type")}},z.getByName?(_.find.ID=function(e,t){if(typeof t.getElementById!==G&&L){var n=t.getElementById(e);return n&&n.parentNode?[n]:[]}},_.filter.ID=function(e){var t=e.replace(xt,wt);return function(e){return e.getAttribute("id")===t}}):(_.find.ID=function(e,n){if(typeof n.getElementById!==G&&L){var r=n.getElementById(e);return r?r.id===e||typeof r.getAttributeNode!==G&&r.getAttributeNode("id").value===e?[r]:t:[]}},_.filter.ID=function(e){var t=e.replace(xt,wt);return function(e){var n=typeof e.getAttributeNode!==G&&e.getAttributeNode("id");return n&&n.value===t}}),_.find.TAG=z.getElementsByTagName?function(e,t){return typeof t.getElementsByTagName!==G?t.getElementsByTagName(e):void 0}:function(e,t){var n,r=[],i=0,o=t.getElementsByTagName(e);if("*"===e){for(;n=o[i++];)1===n.nodeType&&r.push(n);return r}return o},_.find.NAME=z.getByName&&function(e,t){return typeof t.getElementsByName!==G?t.getElementsByName(name):void 0},_.find.CLASS=z.getElementsByClassName&&function(e,t){return typeof t.getElementsByClassName!==G&&L?t.getElementsByClassName(e):void 0},H=[],M=[":focus"],(z.qsa=e(r.querySelectorAll))&&(i(function(e){e.innerHTML="<select><option selected=''></option></select>",e.querySelectorAll("[selected]").length||M.push("\\["+nt+"*(?:checked|disabled|ismap|multiple|readonly|selected|value)"),e.querySelectorAll(":checked").length||M.push(":checked")}),i(function(e){e.innerHTML="<input type='hidden' i=''/>",e.querySelectorAll("[i^='']").length&&M.push("[*^$]="+nt+"*(?:\"\"|'')"),e.querySelectorAll(":enabled").length||M.push(":enabled",":disabled"),e.querySelectorAll("*,:x"),M.push(",.*:")})),(z.matchesSelector=e(P=D.matchesSelector||D.mozMatchesSelector||D.webkitMatchesSelector||D.oMatchesSelector||D.msMatchesSelector))&&i(function(e){z.disconnectedMatch=P.call(e,"div"),P.call(e,"[s!='']:x"),H.push("!=",st)}),M=new RegExp(M.join("|")),H=H.length&&new RegExp(H.join("|")),O=e(D.contains)||D.compareDocumentPosition?function(e,t){var n=9===e.nodeType?e.documentElement:e,r=t&&t.parentNode;return e===r||!(!r||1!==r.nodeType||!(n.contains?n.contains(r):e.compareDocumentPosition&&16&e.compareDocumentPosition(r)))}:function(e,t){if(t)for(;t=t.parentNode;)if(t===e)return!0;return!1},K=D.compareDocumentPosition?function(e,t){if(e===t)return j=!0,0;var n=t.compareDocumentPosition&&e.compareDocumentPosition&&e.compareDocumentPosition(t);return n?1&n||T&&t.compareDocumentPosition(e)===n?e===r||O(F,e)?-1:t===r||O(F,t)?1:R?tt.call(R,e)-tt.call(R,t):0:4&n?-1:1:e.compareDocumentPosition?-1:1}:function(e,t){var n,i=0,o=e.parentNode,s=t.parentNode,l=[e],c=[t];if(e===t)return j=!0,0;if(!o||!s)return e===r?-1:t===r?1:o?-1:s?1:0;if(o===s)return a(e,t);for(n=e;n=n.parentNode;)l.unshift(n);for(n=t;n=n.parentNode;)c.unshift(n);for(;l[i]===c[i];)i++;return i?a(l[i],c[i]):l[i]===F?-1:c[i]===F?1:0},B):B},o.matches=function(e,t){return o(e,null,null,t)},o.matchesSelector=function(e,t){if((e.ownerDocument||e)!==B&&A(e),t=t.replace(Ct,"='$1']"),z.matchesSelector&&L&&(!H||!H.test(t))&&!M.test(t))try{var n=P.call(e,t);if(n||z.disconnectedMatch||e.document&&11!==e.document.nodeType)return n}catch(r){}return o(t,B,null,[e]).length>0},o.contains=function(e,t){return(e.ownerDocument||e)!==B&&A(e),O(e,t)},o.attr=function(e,t){var n;return(e.ownerDocument||e)!==B&&A(e),L&&(t=t.toLowerCase()),(n=_.attrHandle[t])?n(e):!L||z.attributes?e.getAttribute(t):((n=e.getAttributeNode(t))||e.getAttribute(t))&&e[t]===!0?t:n&&n.specified?n.value:null},o.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)},o.uniqueSort=function(e){var t,n=[],r=0,i=0;if(j=!z.detectDuplicates,T=!z.sortDetached,R=!z.sortStable&&e.slice(0),e.sort(K),j){for(;t=e[i++];)t===e[i]&&(r=n.push(i));for(;r--;)e.splice(n[r],1)}return e},N=o.getText=function(e){var t,n="",r=0,i=e.nodeType;if(i){if(1===i||9===i||11===i){if("string"==typeof e.textContent)return e.textContent;for(e=e.firstChild;e;e=e.nextSibling)n+=N(e)}else if(3===i||4===i)return e.nodeValue}else for(;t=e[r];r++)n+=N(t);return n},_=o.selectors={cacheLength:50,createPseudo:r,match:pt,find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(e){return e[1]=e[1].replace(xt,wt),e[3]=(e[4]||e[5]||"").replace(xt,wt),"~="===e[2]&&(e[3]=" "+e[3]+" "),e.slice(0,4)},CHILD:function(e){return e[1]=e[1].toLowerCase(),"nth"===e[1].slice(0,3)?(e[3]||o.error(e[0]),e[4]=+(e[4]?e[5]+(e[6]||1):2*("even"===e[3]||"odd"===e[3])),e[5]=+(e[7]+e[8]||"odd"===e[3])):e[3]&&o.error(e[0]),e},PSEUDO:function(e){var t,n=!e[5]&&e[2];return pt.CHILD.test(e[0])?null:(e[4]?e[2]=e[4]:n&&dt.test(n)&&(t=u(n,!0))&&(t=n.indexOf(")",n.length-t)-n.length)&&(e[0]=e[0].slice(0,t),e[2]=n.slice(0,t)),e.slice(0,3))}},filter:{TAG:function(e){return"*"===e?function(){return!0}:(e=e.replace(xt,wt).toLowerCase(),function(t){return t.nodeName&&t.nodeName.toLowerCase()===e})},CLASS:function(e){var t=U[e+" "];return t||(t=new RegExp("(^|"+nt+")"+e+"("+nt+"|$)"))&&U(e,function(e){return t.test(e.className||typeof e.getAttribute!==G&&e.getAttribute("class")||"")})},ATTR:function(e,t,n){return function(r){var i=o.attr(r,e);return null==i?"!="===t:t?(i+="","="===t?i===n:"!="===t?i!==n:"^="===t?n&&0===i.indexOf(n):"*="===t?n&&i.indexOf(n)>-1:"$="===t?n&&i.slice(-n.length)===n:"~="===t?(" "+i+" ").indexOf(n)>-1:"|="===t?i===n||i.slice(0,n.length+1)===n+"-":!1):!0}},CHILD:function(e,t,n,r,i){var o="nth"!==e.slice(0,3),a="last"!==e.slice(-4),s="of-type"===t;return 1===r&&0===i?function(e){return!!e.parentNode}:function(t,n,l){var c,u,d,f,p,h,m=o!==a?"nextSibling":"previousSibling",g=t.parentNode,v=s&&t.nodeName.toLowerCase(),y=!l&&!s;if(g){if(o){for(;m;){for(d=t;d=d[m];)if(s?d.nodeName.toLowerCase()===v:1===d.nodeType)return!1;h=m="only"===e&&!h&&"nextSibling"}return!0}if(h=[a?g.firstChild:g.lastChild],a&&y){for(u=g[I]||(g[I]={}),c=u[e]||[],p=c[0]===W&&c[1],f=c[0]===W&&c[2],d=p&&g.childNodes[p];d=++p&&d&&d[m]||(f=p=0)||h.pop();)if(1===d.nodeType&&++f&&d===t){u[e]=[W,p,f];break}}else if(y&&(c=(t[I]||(t[I]={}))[e])&&c[0]===W)f=c[1];else for(;(d=++p&&d&&d[m]||(f=p=0)||h.pop())&&((s?d.nodeName.toLowerCase()!==v:1!==d.nodeType)||!++f||(y&&((d[I]||(d[I]={}))[e]=[W,f]),d!==t)););return f-=i,f===r||f%r===0&&f/r>=0}}},PSEUDO:function(e,t){var n,i=_.pseudos[e]||_.setFilters[e.toLowerCase()]||o.error("unsupported pseudo: "+e);return i[I]?i(t):i.length>1?(n=[e,e,"",t],_.setFilters.hasOwnProperty(e.toLowerCase())?r(function(e,n){for(var r,o=i(e,t),a=o.length;a--;)r=tt.call(e,o[a]),e[r]=!(n[r]=o[a])}):function(e){return i(e,0,n)}):i}},pseudos:{not:r(function(e){var t=[],n=[],i=S(e.replace(lt,"$1"));return i[I]?r(function(e,t,n,r){for(var o,a=i(e,null,r,[]),s=e.length;s--;)(o=a[s])&&(e[s]=!(t[s]=o))}):function(e,r,o){return t[0]=e,i(t,null,o,n),!n.pop()}}),has:r(function(e){return function(t){return o(e,t).length>0}}),contains:r(function(e){return function(t){return(t.textContent||t.innerText||N(t)).indexOf(e)>-1}}),lang:r(function(e){return ft.test(e||"")||o.error("unsupported lang: "+e),e=e.replace(xt,wt).toLowerCase(),function(t){var n;do if(n=L?t.lang:t.getAttribute("xml:lang")||t.getAttribute("lang"))return n=n.toLowerCase(),n===e||0===n.indexOf(e+"-");while((t=t.parentNode)&&1===t.nodeType);return!1}}),target:function(e){var t=window.location&&window.location.hash;return t&&t.slice(1)===e.id},root:function(e){return e===D},focus:function(e){return e===B.activeElement&&(!B.hasFocus||B.hasFocus())&&!!(e.type||e.href||~e.tabIndex)},enabled:function(e){return e.disabled===!1},disabled:function(e){return e.disabled===!0},checked:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&!!e.checked||"option"===t&&!!e.selected},selected:function(e){return e.parentNode&&e.parentNode.selectedIndex,e.selected===!0},empty:function(e){for(e=e.firstChild;e;e=e.nextSibling)if(e.nodeName>"@"||3===e.nodeType||4===e.nodeType)return!1;return!0},parent:function(e){return!_.pseudos.empty(e)},header:function(e){return yt.test(e.nodeName)},input:function(e){return vt.test(e.nodeName)},button:function(e){var t=e.nodeName.toLowerCase();return"input"===t&&"button"===e.type||"button"===t},text:function(e){var t;return"input"===e.nodeName.toLowerCase()&&"text"===e.type&&(null==(t=e.getAttribute("type"))||t.toLowerCase()===e.type)},first:c(function(){return[0]}),last:c(function(e,t){return[t-1]}),eq:c(function(e,t,n){return[0>n?n+t:n]}),even:c(function(e,t){for(var n=0;t>n;n+=2)e.push(n);return e}),odd:c(function(e,t){for(var n=1;t>n;n+=2)e.push(n);return e}),lt:c(function(e,t,n){for(var r=0>n?n+t:n;--r>=0;)e.push(r);return e}),gt:c(function(e,t,n){for(var r=0>n?n+t:n;++r<t;)e.push(r);return e})}};for(x in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})_.pseudos[x]=s(x);for(x in{submit:!0,reset:!0})_.pseudos[x]=l(x);return S=o.compile=function(e,t){var n,r=[],i=[],o=$[e+" "];if(!o){for(t||(t=u(e)),n=t.length;n--;)o=g(t[n]),o[I]?r.push(o):i.push(o);o=$(e,v(i,r))}return o},_.pseudos.nth=_.pseudos.eq,C.prototype=_.filters=_.pseudos,_.setFilters=new C,z.sortStable=I.split("").sort(K).join("")===I,A(),[0,0].sort(K),z.detectDuplicates=j,o}),r(u,[l,c],function(e,n){function r(e){return"undefined"!=typeof e}function i(e){return"string"==typeof e}function o(e){var t,n,r;for(r=v.createElement("div"),t=v.createDocumentFragment(),r.innerHTML=e;n=r.firstChild;)t.appendChild(n);return t}function a(e,t,n){var r;if("string"==typeof t)t=o(t);else if(t.length){for(r=0;r<t.length;r++)a(e,t[r],n);return e}for(r=e.length;r--;)n.call(e[r],t.parentNode?t:t);return e}function s(e,t){return e&&t&&-1!==(" "+e.className+" ").indexOf(" "+t+" ")}function l(e,t){var n;for(e=e||[],"string"==typeof e&&(e=e.split(" ")),t=t||{},n=e.length;n--;)t[e[n]]={};return t}function c(e,t){return new c.fn.init(e,t)}function u(e){var t=arguments,n,r,i;for(r=1;r<t.length;r++){n=t[r];for(i in n)e[i]=n[i]}return e}function d(e){var t=[],n,r;for(n=0,r=e.length;r>n;n++)t[n]=e[n];return t}function f(e,t){var n;if(t.indexOf)return t.indexOf(e);for(n=t.length;n--;)if(t[n]===e)return n;return-1}function p(e){return null===e||e===t?"":(""+e).replace(N,"")}function h(e,t){var n,r,i,o,a;if(e)if(n=e.length,n===o){for(r in e)if(e.hasOwnProperty(r)&&(a=e[r],t.call(a,a,r)===!1))break}else for(i=0;n>i&&(a=e[i],t.call(a,a,r)!==!1);i++);return e}function m(e,n,r){for(var i=[],o=e[n];o&&9!==o.nodeType&&(r===t||1!==o.nodeType||!c(o).is(r));)1===o.nodeType&&i.push(o),o=o[n];return i}function g(e,t,n,r){for(var i=[];e;e=e[n])r&&e.nodeType!==r||e===t||i.push(e);return i}var v=document,y=Array.prototype.push,b=Array.prototype.slice,C=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,x=e.Event,w=l("fillOpacity fontWeight lineHeight opacity orphans widows zIndex zoom"),_=Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)},N=/^\s*|\s*$/g;return c.fn=c.prototype={constructor:c,selector:"",length:0,init:function(e,t){var n=this,r,a;if(!e)return n;if(e.nodeType)return n.context=n[0]=e,n.length=1,n;if(i(e)){if(r="<"===e.charAt(0)&&">"===e.charAt(e.length-1)&&e.length>=3?[null,e,null]:C.exec(e),!r)return c(t||document).find(e);if(r[1])for(a=o(e).firstChild;a;)this.add(a),a=a.nextSibling;else{if(a=v.getElementById(r[2]),a.id!==r[2])return n.find(e);n.length=1,n[0]=a}}else this.add(e);return n},toArray:function(){return d(this)},add:function(e){var t=this;return _(e)?y.apply(t,e):e instanceof c?t.add(e.toArray()):y.call(t,e),t},attr:function(e,n){var i=this;if("object"==typeof e)h(e,function(e,t){i.attr(t,e)});else{if(!r(n))return i[0]&&1===i[0].nodeType?i[0].getAttribute(e):t;this.each(function(){1===this.nodeType&&this.setAttribute(e,n)})}return i},css:function(e,n){var i=this;if("object"==typeof e)h(e,function(e,t){i.css(t,e)});else{if(e=e.replace(/-(\D)/g,function(e,t){return t.toUpperCase()}),!r(n))return i[0]?i[0].style[e]:t;"number"!=typeof n||w[e]||(n+="px"),i.each(function(){var t=this.style;"opacity"===e&&this.runtimeStyle&&"undefined"==typeof this.runtimeStyle.opacity&&(t.filter=""===n?"":"alpha(opacity="+100*n+")");try{t[e]=n}catch(r){}})}return i},remove:function(){for(var e=this,t,n=this.length;n--;)t=e[n],x.clean(t),t.parentNode&&t.parentNode.removeChild(t);return this},empty:function(){for(var e=this,t,n=this.length;n--;)for(t=e[n];t.firstChild;)t.removeChild(t.firstChild);return this},html:function(e){var t=this,n;if(r(e)){for(n=t.length;n--;)t[n].innerHTML=e;return t}return t[0]?t[0].innerHTML:""},text:function(e){var t=this,n;if(r(e)){for(n=t.length;n--;)t[n].innerText=t[0].textContent=e;return t}return t[0]?t[0].innerText||t[0].textContent:""},append:function(){return a(this,arguments,function(e){1===this.nodeType&&this.appendChild(e)})},prepend:function(){return a(this,arguments,function(e){1===this.nodeType&&this.insertBefore(e,this.firstChild)})},before:function(){var e=this;return e[0]&&e[0].parentNode?a(e,arguments,function(e){this.parentNode.insertBefore(e,this.nextSibling)}):e},after:function(){var e=this;return e[0]&&e[0].parentNode?a(e,arguments,function(e){this.parentNode.insertBefore(e,this)}):e},appendTo:function(e){return c(e).append(this),this},addClass:function(e){return this.toggleClass(e,!0)},removeClass:function(e){return this.toggleClass(e,!1)},toggleClass:function(e,t){var n=this;return-1!==e.indexOf(" ")?h(e.split(" "),function(){n.toggleClass(this,t)}):n.each(function(n){var r;s(n,e)!==t&&(r=n.className,t?n.className+=r?" "+e:e:n.className=p((" "+r+" ").replace(" "+e+" "," ")))}),n},hasClass:function(e){return s(this[0],e)},each:function(e){return h(this,e)},on:function(e,t){return this.each(function(){x.bind(this,e,t)})},off:function(e,t){return this.each(function(){x.unbind(this,e,t)})},show:function(){return this.css("display","")},hide:function(){return this.css("display","none")},slice:function(){return new c(b.apply(this,arguments))},eq:function(e){return-1===e?this.slice(e):this.slice(e,+e+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},replaceWith:function(e){var t=this;return t[0]&&t[0].parentNode.replaceChild(c(e)[0],t[0]),t},wrap:function(e){return e=c(e)[0],this.each(function(){var t=this,n=e.cloneNode(!1);t.parentNode.insertBefore(n,t),n.appendChild(t)})},unwrap:function(){return this.each(function(){for(var e=this,t=e.firstChild,n;t;)n=t,t=t.nextSibling,e.parentNode.insertBefore(n,e)})},clone:function(){var e=[];return this.each(function(){e.push(this.cloneNode(!0))}),c(e)},find:function(e){var t,n,r=[];for(t=0,n=this.length;n>t;t++)c.find(e,this[t],r);return c(r)},push:y,sort:[].sort,splice:[].splice},u(c,{extend:u,toArray:d,inArray:f,isArray:_,each:h,trim:p,makeMap:l,find:n,expr:n.selectors,unique:n.uniqueSort,text:n.getText,isXMLDoc:n.isXML,contains:n.contains,filter:function(e,t,n){return n&&(e=":not("+e+")"),t=1===t.length?c.find.matchesSelector(t[0],e)?[t[0]]:[]:c.find.matches(e,t)}}),h({parent:function(e){var t=e.parentNode;return t&&11!==t.nodeType?t:null},parents:function(e){return m(e,"parentNode")},parentsUntil:function(e,t){return m(e,"parentNode",t)},next:function(e){return g(e,"nextSibling",1)},prev:function(e){return g(e,"previousSibling",1)},nextNodes:function(e){return g(e,"nextSibling")},prevNodes:function(e){return g(e,"previousSibling")},children:function(e){return g(e.firstChild,"nextSibling",1)},contents:function(e){return d(("iframe"===e.nodeName?e.contentDocument||e.contentWindow.document:e).childNodes)}},function(e,t){c.fn[e]=function(n){var r=this,i;if(r.length>1)throw new Error("DomQuery only supports traverse functions on a single node.");return r[0]&&(i=t(r[0],n)),i=c(i),n&&"parentsUntil"!==e?i.filter(n):i}}),c.fn.filter=function(e){return c.filter(e)},c.fn.is=function(e){return!!e&&this.filter(e).length>0},c.fn.init.prototype=c.fn,c}),r(d,[],function(){return function(e,t){function n(e,t,n,r){function i(e){return e=parseInt(e,10).toString(16),e.length>1?e:"0"+e +}return"#"+i(t)+i(n)+i(r)}var r=/rgb\s*\(\s*([0-9]+)\s*,\s*([0-9]+)\s*,\s*([0-9]+)\s*\)/gi,i=/(?:url(?:(?:\(\s*\"([^\"]+)\"\s*\))|(?:\(\s*\'([^\']+)\'\s*\))|(?:\(\s*([^)\s]+)\s*\))))|(?:\'([^\']+)\')|(?:\"([^\"]+)\")/gi,o=/\s*([^:]+):\s*([^;]+);?/g,a=/\s+$/,s,l,c={},u,d="\ufeff";for(e=e||{},u=("\\\" \\' \\; \\: ; : "+d).split(" "),l=0;l<u.length;l++)c[u[l]]=d+l,c[d+l]=u[l];return{toHex:function(e){return e.replace(r,n)},parse:function(t){function s(e,t,n){var r,i,o,a;if(r=m[e+"-top"+t],r&&(i=m[e+"-right"+t],i&&(o=m[e+"-bottom"+t],o&&(a=m[e+"-left"+t])))){var s=[r,i,o,a];for(l=s.length-1;l--&&s[l]===s[l+1];);l>-1&&n||(m[e+t]=-1==l?s[0]:s.join(" "),delete m[e+"-top"+t],delete m[e+"-right"+t],delete m[e+"-bottom"+t],delete m[e+"-left"+t])}}function u(e){var t=m[e],n;if(t){for(t=t.split(" "),n=t.length;n--;)if(t[n]!==t[0])return!1;return m[e]=t[0],!0}}function d(e,t,n,r){u(t)&&u(n)&&u(r)&&(m[e]=m[t]+" "+m[n]+" "+m[r],delete m[t],delete m[n],delete m[r])}function f(e){return b=!0,c[e]}function p(e,t){return b&&(e=e.replace(/\uFEFF[0-9]/g,function(e){return c[e]})),t||(e=e.replace(/\\([\'\";:])/g,"$1")),e}function h(t,n,r,i,o,a){if(o=o||a)return o=p(o),"'"+o.replace(/\'/g,"\\'")+"'";if(n=p(n||r||i),!e.allow_script_urls){var s=n.replace(/[\s\r\n]+/,"");if(/(java|vb)script:/i.test(s))return"";if(!e.allow_svg_data_urls&&/^data:image\/svg/i.test(s))return""}return C&&(n=C.call(x,n,"style")),"url('"+n.replace(/\'/g,"\\'")+"')"}var m={},g,v,y,b,C=e.url_converter,x=e.url_converter_scope||this;if(t){for(t=t.replace(/[\u0000-\u001F]/g,""),t=t.replace(/\\[\"\';:\uFEFF]/g,f).replace(/\"[^\"]+\"|\'[^\']+\'/g,function(e){return e.replace(/[;:]/g,f)});g=o.exec(t);){if(v=g[1].replace(a,"").toLowerCase(),y=g[2].replace(a,""),y=y.replace(/\\[0-9a-f]+/g,function(e){return String.fromCharCode(parseInt(e.substr(1),16))}),v&&y.length>0){if(!e.allow_script_urls&&("behavior"==v||/expression\s*\(|\/\*|\*\//.test(y)))continue;"font-weight"===v&&"700"===y?y="bold":("color"===v||"background-color"===v)&&(y=y.toLowerCase()),y=y.replace(r,n),y=y.replace(i,h),m[v]=b?p(y,!0):y}o.lastIndex=g.index+g[0].length}s("border","",!0),s("border","-width"),s("border","-color"),s("border","-style"),s("padding",""),s("margin",""),d("border","border-width","border-style","border-color"),"medium none"===m.border&&delete m.border,"none"===m["border-image"]&&delete m["border-image"]}return m},serialize:function(e,n){function r(n){var r,o,a,l;if(r=t.styles[n])for(o=0,a=r.length;a>o;o++)n=r[o],l=e[n],l!==s&&l.length>0&&(i+=(i.length>0?" ":"")+n+": "+l+";")}var i="",o,a;if(n&&t&&t.styles)r("*"),r(n);else for(o in e)a=e[o],a!==s&&a.length>0&&(i+=(i.length>0?" ":"")+o+": "+a+";");return i}}}}),r(f,[],function(){return function(e,t){function n(e,n,r,i){var o,a;if(e){if(!i&&e[n])return e[n];if(e!=t){if(o=e[r])return o;for(a=e.parentNode;a&&a!=t;a=a.parentNode)if(o=a[r])return o}}}var r=e;this.current=function(){return r},this.next=function(e){return r=n(r,"firstChild","nextSibling",e)},this.prev=function(e){return r=n(r,"lastChild","previousSibling",e)}}}),r(p,[],function(){function e(e){return null===e||e===t?"":(""+e).replace(m,"")}function n(e,n){return n?"array"==n&&g(e)?!0:typeof e==n:e!==t}function r(e){var t=[],n,r;for(n=0,r=e.length;r>n;n++)t[n]=e[n];return t}function i(e,t,n){var r;for(e=e||[],t=t||",","string"==typeof e&&(e=e.split(t)),n=n||{},r=e.length;r--;)n[e[r]]={};return n}function o(e,n,r){var i,o;if(!e)return 0;if(r=r||e,e.length!==t){for(i=0,o=e.length;o>i;i++)if(n.call(r,e[i],i,e)===!1)return 0}else for(i in e)if(e.hasOwnProperty(i)&&n.call(r,e[i],i,e)===!1)return 0;return 1}function a(e,t){var n=[];return o(e,function(e){n.push(t(e))}),n}function s(e,t){var n=[];return o(e,function(e){(!t||t(e))&&n.push(e)}),n}function l(e,t,n){var r=this,i,o,a,s,l,c=0;if(e=/^((static) )?([\w.]+)(:([\w.]+))?/.exec(e),a=e[3].match(/(^|\.)(\w+)$/i)[2],o=r.createNS(e[3].replace(/\.\w+$/,""),n),!o[a]){if("static"==e[2])return o[a]=t,void(this.onCreate&&this.onCreate(e[2],e[3],o[a]));t[a]||(t[a]=function(){},c=1),o[a]=t[a],r.extend(o[a].prototype,t),e[5]&&(i=r.resolve(e[5]).prototype,s=e[5].match(/\.(\w+)$/i)[1],l=o[a],o[a]=c?function(){return i[s].apply(this,arguments)}:function(){return this.parent=i[s],l.apply(this,arguments)},o[a].prototype[a]=o[a],r.each(i,function(e,t){o[a].prototype[t]=i[t]}),r.each(t,function(e,t){i[t]?o[a].prototype[t]=function(){return this.parent=i[t],e.apply(this,arguments)}:t!=a&&(o[a].prototype[t]=e)})),r.each(t["static"],function(e,t){o[a][t]=e})}}function c(e,t){var n,r;if(e)for(n=0,r=e.length;r>n;n++)if(e[n]===t)return n;return-1}function u(e,n){var r,i,o,a=arguments,s;for(r=1,i=a.length;i>r;r++){n=a[r];for(o in n)n.hasOwnProperty(o)&&(s=n[o],s!==t&&(e[o]=s))}return e}function d(e,t,n,r){r=r||this,e&&(n&&(e=e[n]),o(e,function(e,i){return t.call(r,e,i,n)===!1?!1:void d(e,t,n,r)}))}function f(e,t){var n,r;for(t=t||window,e=e.split("."),n=0;n<e.length;n++)r=e[n],t[r]||(t[r]={}),t=t[r];return t}function p(e,t){var n,r;for(t=t||window,e=e.split("."),n=0,r=e.length;r>n&&(t=t[e[n]],t);n++);return t}function h(t,r){return!t||n(t,"array")?t:a(t.split(r||","),e)}var m=/^\s*|\s*$/g,g=Array.isArray||function(e){return"[object Array]"===Object.prototype.toString.call(e)};return{trim:e,isArray:g,is:n,toArray:r,makeMap:i,each:o,map:a,grep:s,inArray:c,extend:u,create:l,walk:d,createNS:f,resolve:p,explode:h}}),r(h,[p],function(e){function t(n){function r(){return H.createDocumentFragment()}function i(e,t){_(F,e,t)}function o(e,t){_(z,e,t)}function a(e){i(e.parentNode,j(e))}function s(e){i(e.parentNode,j(e)+1)}function l(e){o(e.parentNode,j(e))}function c(e){o(e.parentNode,j(e)+1)}function u(e){e?(M[U]=M[V],M[q]=M[W]):(M[V]=M[U],M[W]=M[q]),M.collapsed=F}function d(e){a(e),c(e)}function f(e){i(e,0),o(e,1===e.nodeType?e.childNodes.length:e.nodeValue.length)}function p(e,t){var n=M[V],r=M[W],i=M[U],o=M[q],a=t.startContainer,s=t.startOffset,l=t.endContainer,c=t.endOffset;return 0===e?w(n,r,a,s):1===e?w(i,o,a,s):2===e?w(i,o,l,c):3===e?w(n,r,l,c):void 0}function h(){N(I)}function m(){return N(P)}function g(){return N(O)}function v(e){var t=this[V],r=this[W],i,o;3!==t.nodeType&&4!==t.nodeType||!t.nodeValue?(t.childNodes.length>0&&(o=t.childNodes[r]),o?t.insertBefore(e,o):3==t.nodeType?n.insertAfter(e,t):t.appendChild(e)):r?r>=t.nodeValue.length?n.insertAfter(e,t):(i=t.splitText(r),t.parentNode.insertBefore(e,i)):t.parentNode.insertBefore(e,t)}function y(e){var t=M.extractContents();M.insertNode(e),e.appendChild(t),M.selectNode(e)}function b(){return $(new t(n),{startContainer:M[V],startOffset:M[W],endContainer:M[U],endOffset:M[q],collapsed:M.collapsed,commonAncestorContainer:M.commonAncestorContainer})}function C(e,t){var n;if(3==e.nodeType)return e;if(0>t)return e;for(n=e.firstChild;n&&t>0;)--t,n=n.nextSibling;return n?n:e}function x(){return M[V]==M[U]&&M[W]==M[q]}function w(e,t,r,i){var o,a,s,l,c,u;if(e==r)return t==i?0:i>t?-1:1;for(o=r;o&&o.parentNode!=e;)o=o.parentNode;if(o){for(a=0,s=e.firstChild;s!=o&&t>a;)a++,s=s.nextSibling;return a>=t?-1:1}for(o=e;o&&o.parentNode!=r;)o=o.parentNode;if(o){for(a=0,s=r.firstChild;s!=o&&i>a;)a++,s=s.nextSibling;return i>a?-1:1}for(l=n.findCommonAncestor(e,r),c=e;c&&c.parentNode!=l;)c=c.parentNode;for(c||(c=l),u=r;u&&u.parentNode!=l;)u=u.parentNode;if(u||(u=l),c==u)return 0;for(s=l.firstChild;s;){if(s==c)return-1;if(s==u)return 1;s=s.nextSibling}}function _(e,t,r){var i,o;for(e?(M[V]=t,M[W]=r):(M[U]=t,M[q]=r),i=M[U];i.parentNode;)i=i.parentNode;for(o=M[V];o.parentNode;)o=o.parentNode;o==i?w(M[V],M[W],M[U],M[q])>0&&M.collapse(e):M.collapse(e),M.collapsed=x(),M.commonAncestorContainer=n.findCommonAncestor(M[V],M[U])}function N(e){var t,n=0,r=0,i,o,a,s,l,c;if(M[V]==M[U])return E(e);for(t=M[U],i=t.parentNode;i;t=i,i=i.parentNode){if(i==M[V])return S(t,e);++n}for(t=M[V],i=t.parentNode;i;t=i,i=i.parentNode){if(i==M[U])return k(t,e);++r}for(o=r-n,a=M[V];o>0;)a=a.parentNode,o--;for(s=M[U];0>o;)s=s.parentNode,o++;for(l=a.parentNode,c=s.parentNode;l!=c;l=l.parentNode,c=c.parentNode)a=l,s=c;return T(a,s,e)}function E(e){var t,n,i,o,a,s,l,c,u;if(e!=I&&(t=r()),M[W]==M[q])return t;if(3==M[V].nodeType){if(n=M[V].nodeValue,i=n.substring(M[W],M[q]),e!=O&&(o=M[V],c=M[W],u=M[q]-M[W],0===c&&u>=o.nodeValue.length-1?o.parentNode.removeChild(o):o.deleteData(c,u),M.collapse(F)),e==I)return;return i.length>0&&t.appendChild(H.createTextNode(i)),t}for(o=C(M[V],M[W]),a=M[q]-M[W];o&&a>0;)s=o.nextSibling,l=D(o,e),t&&t.appendChild(l),--a,o=s;return e!=O&&M.collapse(F),t}function S(e,t){var n,i,o,a,s,l;if(t!=I&&(n=r()),i=R(e,t),n&&n.appendChild(i),o=j(e),a=o-M[W],0>=a)return t!=O&&(M.setEndBefore(e),M.collapse(z)),n;for(i=e.previousSibling;a>0;)s=i.previousSibling,l=D(i,t),n&&n.insertBefore(l,n.firstChild),--a,i=s;return t!=O&&(M.setEndBefore(e),M.collapse(z)),n}function k(e,t){var n,i,o,a,s,l;for(t!=I&&(n=r()),o=A(e,t),n&&n.appendChild(o),i=j(e),++i,a=M[q]-i,o=e.nextSibling;o&&a>0;)s=o.nextSibling,l=D(o,t),n&&n.appendChild(l),--a,o=s;return t!=O&&(M.setStartAfter(e),M.collapse(F)),n}function T(e,t,n){var i,o,a,s,l,c,u;for(n!=I&&(o=r()),i=A(e,n),o&&o.appendChild(i),a=j(e),s=j(t),++a,l=s-a,c=e.nextSibling;l>0;)u=c.nextSibling,i=D(c,n),o&&o.appendChild(i),c=u,--l;return i=R(t,n),o&&o.appendChild(i),n!=O&&(M.setStartAfter(e),M.collapse(F)),o}function R(e,t){var n=C(M[U],M[q]-1),r,i,o,a,s,l=n!=M[U];if(n==e)return B(n,l,z,t);for(r=n.parentNode,i=B(r,z,z,t);r;){for(;n;)o=n.previousSibling,a=B(n,l,z,t),t!=I&&i.insertBefore(a,i.firstChild),l=F,n=o;if(r==e)return i;n=r.previousSibling,r=r.parentNode,s=B(r,z,z,t),t!=I&&s.appendChild(i),i=s}}function A(e,t){var n=C(M[V],M[W]),r=n!=M[V],i,o,a,s,l;if(n==e)return B(n,r,F,t);for(i=n.parentNode,o=B(i,z,F,t);i;){for(;n;)a=n.nextSibling,s=B(n,r,F,t),t!=I&&o.appendChild(s),r=F,n=a;if(i==e)return o;n=i.nextSibling,i=i.parentNode,l=B(i,z,F,t),t!=I&&l.appendChild(o),o=l}}function B(e,t,r,i){var o,a,s,l,c;if(t)return D(e,i);if(3==e.nodeType){if(o=e.nodeValue,r?(l=M[W],a=o.substring(l),s=o.substring(0,l)):(l=M[q],a=o.substring(0,l),s=o.substring(l)),i!=O&&(e.nodeValue=s),i==I)return;return c=n.clone(e,z),c.nodeValue=a,c}if(i!=I)return n.clone(e,z)}function D(e,t){return t!=I?t==O?n.clone(e,F):e:void e.parentNode.removeChild(e)}function L(){return n.create("body",null,g()).outerText}var M=this,H=n.doc,P=0,O=1,I=2,F=!0,z=!1,W="startOffset",V="startContainer",U="endContainer",q="endOffset",$=e.extend,j=n.nodeIndex;return $(M,{startContainer:H,startOffset:0,endContainer:H,endOffset:0,collapsed:F,commonAncestorContainer:H,START_TO_START:0,START_TO_END:1,END_TO_END:2,END_TO_START:3,setStart:i,setEnd:o,setStartBefore:a,setStartAfter:s,setEndBefore:l,setEndAfter:c,collapse:u,selectNode:d,selectNodeContents:f,compareBoundaryPoints:p,deleteContents:h,extractContents:m,cloneContents:g,insertNode:v,surroundContents:y,cloneRange:b,toStringIE:L}),M}return t.prototype.toString=function(){return this.toStringIE()},t}),r(m,[p],function(e){function t(e){var t;return t=document.createElement("div"),t.innerHTML=e,t.textContent||t.innerText||e}function n(e,t){var n,r,i,a={};if(e){for(e=e.split(","),t=t||10,n=0;n<e.length;n+=2)r=String.fromCharCode(parseInt(e[n],t)),o[r]||(i="&"+e[n+1]+";",a[r]=i,a[i]=r);return a}}var r=e.makeMap,i,o,a,s=/[&<>\"\u0060\u007E-\uD7FF\uE000-\uFFEF]|[\uD800-\uDBFF][\uDC00-\uDFFF]/g,l=/[<>&\u007E-\uD7FF\uE000-\uFFEF]|[\uD800-\uDBFF][\uDC00-\uDFFF]/g,c=/[<>&\"\']/g,u=/&(#x|#)?([\w]+);/g,d={128:"\u20ac",130:"\u201a",131:"\u0192",132:"\u201e",133:"\u2026",134:"\u2020",135:"\u2021",136:"\u02c6",137:"\u2030",138:"\u0160",139:"\u2039",140:"\u0152",142:"\u017d",145:"\u2018",146:"\u2019",147:"\u201c",148:"\u201d",149:"\u2022",150:"\u2013",151:"\u2014",152:"\u02dc",153:"\u2122",154:"\u0161",155:"\u203a",156:"\u0153",158:"\u017e",159:"\u0178"};o={'"':""","'":"'","<":"<",">":">","&":"&","`":"`"},a={"<":"<",">":">","&":"&",""":'"',"'":"'"},i=n("50,nbsp,51,iexcl,52,cent,53,pound,54,curren,55,yen,56,brvbar,57,sect,58,uml,59,copy,5a,ordf,5b,laquo,5c,not,5d,shy,5e,reg,5f,macr,5g,deg,5h,plusmn,5i,sup2,5j,sup3,5k,acute,5l,micro,5m,para,5n,middot,5o,cedil,5p,sup1,5q,ordm,5r,raquo,5s,frac14,5t,frac12,5u,frac34,5v,iquest,60,Agrave,61,Aacute,62,Acirc,63,Atilde,64,Auml,65,Aring,66,AElig,67,Ccedil,68,Egrave,69,Eacute,6a,Ecirc,6b,Euml,6c,Igrave,6d,Iacute,6e,Icirc,6f,Iuml,6g,ETH,6h,Ntilde,6i,Ograve,6j,Oacute,6k,Ocirc,6l,Otilde,6m,Ouml,6n,times,6o,Oslash,6p,Ugrave,6q,Uacute,6r,Ucirc,6s,Uuml,6t,Yacute,6u,THORN,6v,szlig,70,agrave,71,aacute,72,acirc,73,atilde,74,auml,75,aring,76,aelig,77,ccedil,78,egrave,79,eacute,7a,ecirc,7b,euml,7c,igrave,7d,iacute,7e,icirc,7f,iuml,7g,eth,7h,ntilde,7i,ograve,7j,oacute,7k,ocirc,7l,otilde,7m,ouml,7n,divide,7o,oslash,7p,ugrave,7q,uacute,7r,ucirc,7s,uuml,7t,yacute,7u,thorn,7v,yuml,ci,fnof,sh,Alpha,si,Beta,sj,Gamma,sk,Delta,sl,Epsilon,sm,Zeta,sn,Eta,so,Theta,sp,Iota,sq,Kappa,sr,Lambda,ss,Mu,st,Nu,su,Xi,sv,Omicron,t0,Pi,t1,Rho,t3,Sigma,t4,Tau,t5,Upsilon,t6,Phi,t7,Chi,t8,Psi,t9,Omega,th,alpha,ti,beta,tj,gamma,tk,delta,tl,epsilon,tm,zeta,tn,eta,to,theta,tp,iota,tq,kappa,tr,lambda,ts,mu,tt,nu,tu,xi,tv,omicron,u0,pi,u1,rho,u2,sigmaf,u3,sigma,u4,tau,u5,upsilon,u6,phi,u7,chi,u8,psi,u9,omega,uh,thetasym,ui,upsih,um,piv,812,bull,816,hellip,81i,prime,81j,Prime,81u,oline,824,frasl,88o,weierp,88h,image,88s,real,892,trade,89l,alefsym,8cg,larr,8ch,uarr,8ci,rarr,8cj,darr,8ck,harr,8dl,crarr,8eg,lArr,8eh,uArr,8ei,rArr,8ej,dArr,8ek,hArr,8g0,forall,8g2,part,8g3,exist,8g5,empty,8g7,nabla,8g8,isin,8g9,notin,8gb,ni,8gf,prod,8gh,sum,8gi,minus,8gn,lowast,8gq,radic,8gt,prop,8gu,infin,8h0,ang,8h7,and,8h8,or,8h9,cap,8ha,cup,8hb,int,8hk,there4,8hs,sim,8i5,cong,8i8,asymp,8j0,ne,8j1,equiv,8j4,le,8j5,ge,8k2,sub,8k3,sup,8k4,nsub,8k6,sube,8k7,supe,8kl,oplus,8kn,otimes,8l5,perp,8m5,sdot,8o8,lceil,8o9,rceil,8oa,lfloor,8ob,rfloor,8p9,lang,8pa,rang,9ea,loz,9j0,spades,9j3,clubs,9j5,hearts,9j6,diams,ai,OElig,aj,oelig,b0,Scaron,b1,scaron,bo,Yuml,m6,circ,ms,tilde,802,ensp,803,emsp,809,thinsp,80c,zwnj,80d,zwj,80e,lrm,80f,rlm,80j,ndash,80k,mdash,80o,lsquo,80p,rsquo,80q,sbquo,80s,ldquo,80t,rdquo,80u,bdquo,810,dagger,811,Dagger,81g,permil,81p,lsaquo,81q,rsaquo,85c,euro",32);var f={encodeRaw:function(e,t){return e.replace(t?s:l,function(e){return o[e]||e})},encodeAllRaw:function(e){return(""+e).replace(c,function(e){return o[e]||e})},encodeNumeric:function(e,t){return e.replace(t?s:l,function(e){return e.length>1?"&#"+(1024*(e.charCodeAt(0)-55296)+(e.charCodeAt(1)-56320)+65536)+";":o[e]||"&#"+e.charCodeAt(0)+";"})},encodeNamed:function(e,t,n){return n=n||i,e.replace(t?s:l,function(e){return o[e]||n[e]||e})},getEncodeFunc:function(e,t){function a(e,n){return e.replace(n?s:l,function(e){return o[e]||t[e]||"&#"+e.charCodeAt(0)+";"||e})}function c(e,n){return f.encodeNamed(e,n,t)}return t=n(t)||i,e=r(e.replace(/\+/g,",")),e.named&&e.numeric?a:e.named?t?c:f.encodeNamed:e.numeric?f.encodeNumeric:f.encodeRaw},decode:function(e){return e.replace(u,function(e,n,r){return n?(r=parseInt(r,2===n.length?16:10),r>65535?(r-=65536,String.fromCharCode(55296+(r>>10),56320+(1023&r))):d[r]||String.fromCharCode(r)):a[e]||i[e]||t(e)})}};return f}),r(g,[],function(){var e=navigator,t=e.userAgent,n,r,i,o,a,s,l;n=window.opera&&window.opera.buildNumber,r=/WebKit/.test(t),i=!r&&!n&&/MSIE/gi.test(t)&&/Explorer/gi.test(e.appName),i=i&&/MSIE (\w+)\./.exec(t)[1],o=-1==t.indexOf("Trident/")||-1==t.indexOf("rv:")&&-1==e.appName.indexOf("Netscape")?!1:11,i=i||o,a=!r&&!o&&/Gecko/.test(t),s=-1!=t.indexOf("Mac"),l=/(iPad|iPhone)/.test(t);var c=!l||t.match(/AppleWebKit\/(\d*)/)[1]>=534;return{opera:n,webkit:r,ie:i,gecko:a,mac:s,iOS:l,contentEditable:c,transparentSrc:"data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7",caretAfter:8!=i,range:window.getSelection&&"Range"in window,documentMode:i?document.documentMode||7:10}}),r(v,[],function(){return function(e,t){function n(t){e.getElementsByTagName("head")[0].appendChild(t)}function r(t,r,s){function l(){for(var e=v.passed,t=e.length;t--;)e[t]();v.status=2,v.passed=[],v.failed=[]}function c(){for(var e=v.failed,t=e.length;t--;)e[t]();v.status=3,v.passed=[],v.failed=[]}function u(){var e=navigator.userAgent.match(/WebKit\/(\d*)/);return!!(e&&e[1]<536)}function d(e,t){e()||((new Date).getTime()-g<a?window.setTimeout(t,0):c())}function f(){d(function(){for(var t=e.styleSheets,n,r=t.length,i;r--;)if(n=t[r],i=n.ownerNode?n.ownerNode:n.owningElement,i&&i.id===h.id)return l(),!0},f)}function p(){d(function(){try{var e=m.sheet.cssRules;return l(),!!e}catch(t){}},p)}var h,m,g,v;if(o[t]?v=o[t]:(v={passed:[],failed:[]},o[t]=v),r&&v.passed.push(r),s&&v.failed.push(s),1!=v.status){if(2==v.status)return void l();if(3==v.status)return void c();if(v.status=1,h=e.createElement("link"),h.rel="stylesheet",h.type="text/css",h.id="u"+i++,h.async=!1,h.defer=!1,g=(new Date).getTime(),"onload"in h&&!u())h.onload=f,h.onerror=c;else{if(navigator.userAgent.indexOf("Firefox")>0)return m=e.createElement("style"),m.textContent='@import "'+t+'"',p(),void n(m);f()}n(h),h.href=t}}var i=0,o={},a;t=t||{},a=t.maxLoadTime||5e3,this.load=r}}),r(y,[c,d,l,f,h,m,g,p,v],function(e,n,r,i,o,a,s,l,c){function u(e,t){var i=this,o;i.doc=e,i.win=window,i.files={},i.counter=0,i.stdMode=!v||e.documentMode>=8,i.boxModel=!v||"CSS1Compat"==e.compatMode||i.stdMode,i.hasOuterHTML="outerHTML"in e.createElement("a"),i.styleSheetLoader=new c(e),this.boundEvents=[],i.settings=t=m({keep_values:!1,hex_colors:1},t),i.schema=t.schema,i.styles=new n({url_converter:t.url_converter,url_converter_scope:t.url_converter_scope},t.schema),i.fixDoc(e),i.events=t.ownEvents?new r(t.proxy):r.Event,o=t.schema?t.schema.getBlockElements():{},i.isBlock=function(e){if(!e)return!1;var t=e.nodeType;return t?!(1!==t||!o[e.nodeName]):!!o[e]}}var d=l.each,f=l.is,p=l.grep,h=l.trim,m=l.extend,g=s.webkit,v=s.ie,y=/^([a-z0-9],?)+$/i,b=/^[ \t\r\n]*$/,C=l.makeMap("fillOpacity fontWeight lineHeight opacity orphans widows zIndex zoom"," ");return u.prototype={root:null,props:{"for":"htmlFor","class":"className",className:"className",checked:"checked",disabled:"disabled",maxlength:"maxLength",readonly:"readOnly",selected:"selected",value:"value",id:"id",name:"name",type:"type"},fixDoc:function(e){var t=this.settings,n;if(v&&t.schema){"abbr article aside audio canvas details figcaption figure footer header hgroup mark menu meter nav output progress section summary time video".replace(/\w+/g,function(t){e.createElement(t)});for(n in t.schema.getCustomElements())e.createElement(n)}},clone:function(e,t){var n=this,r,i;return!v||1!==e.nodeType||t?e.cloneNode(t):(i=n.doc,t?r.firstChild:(r=i.createElement(e.nodeName),d(n.getAttribs(e),function(t){n.setAttrib(r,t.nodeName,n.getAttrib(e,t.nodeName))}),r))},getRoot:function(){var e=this;return e.get(e.settings.root_element)||e.doc.body},getViewPort:function(e){var t,n;return e=e?e:this.win,t=e.document,n=this.boxModel?t.documentElement:t.body,{x:e.pageXOffset||n.scrollLeft,y:e.pageYOffset||n.scrollTop,w:e.innerWidth||n.clientWidth,h:e.innerHeight||n.clientHeight}},getRect:function(e){var t=this,n,r;return e=t.get(e),n=t.getPos(e),r=t.getSize(e),{x:n.x,y:n.y,w:r.w,h:r.h}},getSize:function(e){var t=this,n,r;return e=t.get(e),n=t.getStyle(e,"width"),r=t.getStyle(e,"height"),-1===n.indexOf("px")&&(n=0),-1===r.indexOf("px")&&(r=0),{w:parseInt(n,10)||e.offsetWidth||e.clientWidth,h:parseInt(r,10)||e.offsetHeight||e.clientHeight}},getParent:function(e,t,n){return this.getParents(e,t,n,!1)},getParents:function(e,n,r,i){var o=this,a,s=[];for(e=o.get(e),i=i===t,r=r||("BODY"!=o.getRoot().nodeName?o.getRoot().parentNode:null),f(n,"string")&&(a=n,n="*"===n?function(e){return 1==e.nodeType}:function(e){return o.is(e,a)});e&&e!=r&&e.nodeType&&9!==e.nodeType;){if(!n||n(e)){if(!i)return e;s.push(e)}e=e.parentNode}return i?s:null},get:function(e){var t;return e&&this.doc&&"string"==typeof e&&(t=e,e=this.doc.getElementById(e),e&&e.id!==t)?this.doc.getElementsByName(t)[1]:e},getNext:function(e,t){return this._findSib(e,t,"nextSibling")},getPrev:function(e,t){return this._findSib(e,t,"previousSibling")},select:function(t,n){var r=this;return e(t,r.get(n)||r.get(r.settings.root_element)||r.doc,[])},is:function(n,r){var i;if(n.length===t){if("*"===r)return 1==n.nodeType;if(y.test(r)){for(r=r.toLowerCase().split(/,/),n=n.nodeName.toLowerCase(),i=r.length-1;i>=0;i--)if(r[i]==n)return!0;return!1}}if(n.nodeType&&1!=n.nodeType)return!1;var o=n.nodeType?[n]:n;return e(r,o[0].ownerDocument||o[0],null,o).length>0},add:function(e,t,n,r,i){var o=this;return this.run(e,function(e){var a;return a=f(t,"string")?o.doc.createElement(t):t,o.setAttribs(a,n),r&&(r.nodeType?a.appendChild(r):o.setHTML(a,r)),i?a:e.appendChild(a)})},create:function(e,t,n){return this.add(this.doc.createElement(e),e,t,n,1)},createHTML:function(e,t,n){var r="",i;r+="<"+e;for(i in t)t.hasOwnProperty(i)&&null!==t[i]&&(r+=" "+i+'="'+this.encode(t[i])+'"');return"undefined"!=typeof n?r+">"+n+"</"+e+">":r+" />"},createFragment:function(e){var t,n,r=this.doc,i;for(i=r.createElement("div"),t=r.createDocumentFragment(),e&&(i.innerHTML=e);n=i.firstChild;)t.appendChild(n);return t},remove:function(e,t){return this.run(e,function(e){var n,r=e.parentNode;if(!r)return null;if(t)for(;n=e.firstChild;)!v||3!==n.nodeType||n.nodeValue?r.insertBefore(n,e):e.removeChild(n);return r.removeChild(e)})},setStyle:function(e,t,n){return this.run(e,function(e){var r=this,i,o;if(t)if("string"==typeof t){i=e.style,t=t.replace(/-(\D)/g,function(e,t){return t.toUpperCase()}),"number"!=typeof n||C[t]||(n+="px"),"opacity"===t&&e.runtimeStyle&&"undefined"==typeof e.runtimeStyle.opacity&&(i.filter=""===n?"":"alpha(opacity="+100*n+")"),"float"==t&&(t="cssFloat"in e.style?"cssFloat":"styleFloat");try{i[t]=n}catch(a){}r.settings.update_styles&&e.removeAttribute("data-mce-style")}else for(o in t)r.setStyle(e,o,t[o])})},getStyle:function(e,n,r){if(e=this.get(e)){if(this.doc.defaultView&&r){n=n.replace(/[A-Z]/g,function(e){return"-"+e});try{return this.doc.defaultView.getComputedStyle(e,null).getPropertyValue(n)}catch(i){return null}}return n=n.replace(/-(\D)/g,function(e,t){return t.toUpperCase()}),"float"==n&&(n=v?"styleFloat":"cssFloat"),e.currentStyle&&r?e.currentStyle[n]:e.style?e.style[n]:t}},setStyles:function(e,t){this.setStyle(e,t)},css:function(e,t,n){this.setStyle(e,t,n)},removeAllAttribs:function(e){return this.run(e,function(e){var t,n=e.attributes;for(t=n.length-1;t>=0;t--)e.removeAttributeNode(n.item(t))})},setAttrib:function(e,t,n){var r=this;if(e&&t)return this.run(e,function(e){var i=r.settings,o=e.getAttribute(t);if(null!==n)switch(t){case"style":if(!f(n,"string"))return void d(n,function(t,n){r.setStyle(e,n,t)});i.keep_values&&(n?e.setAttribute("data-mce-style",n,2):e.removeAttribute("data-mce-style",2)),e.style.cssText=n;break;case"class":e.className=n||"";break;case"src":case"href":i.keep_values&&(i.url_converter&&(n=i.url_converter.call(i.url_converter_scope||r,n,t,e)),r.setAttrib(e,"data-mce-"+t,n,2));break;case"shape":e.setAttribute("data-mce-style",n)}f(n)&&null!==n&&0!==n.length?e.setAttribute(t,""+n,2):e.removeAttribute(t,2),o!=n&&i.onSetAttrib&&i.onSetAttrib({attrElm:e,attrName:t,attrValue:n})})},setAttribs:function(e,t){var n=this;return this.run(e,function(e){d(t,function(t,r){n.setAttrib(e,r,t)})})},getAttrib:function(e,t,n){var r,i=this,o;if(e=i.get(e),!e||1!==e.nodeType)return n===o?!1:n;if(f(n)||(n=""),/^(src|href|style|coords|shape)$/.test(t)&&(r=e.getAttribute("data-mce-"+t)))return r;if(v&&i.props[t]&&(r=e[i.props[t]],r=r&&r.nodeValue?r.nodeValue:r),r||(r=e.getAttribute(t,2)),/^(checked|compact|declare|defer|disabled|ismap|multiple|nohref|noshade|nowrap|readonly|selected)$/.test(t))return e[i.props[t]]===!0&&""===r?t:r?t:"";if("FORM"===e.nodeName&&e.getAttributeNode(t))return e.getAttributeNode(t).nodeValue;if("style"===t&&(r=r||e.style.cssText,r&&(r=i.serializeStyle(i.parseStyle(r),e.nodeName),i.settings.keep_values&&e.setAttribute("data-mce-style",r))),g&&"class"===t&&r&&(r=r.replace(/(apple|webkit)\-[a-z\-]+/gi,"")),v)switch(t){case"rowspan":case"colspan":1===r&&(r="");break;case"size":("+0"===r||20===r||0===r)&&(r="");break;case"width":case"height":case"vspace":case"checked":case"disabled":case"readonly":0===r&&(r="");break;case"hspace":-1===r&&(r="");break;case"maxlength":case"tabindex":(32768===r||2147483647===r||"32768"===r)&&(r="");break;case"multiple":case"compact":case"noshade":case"nowrap":return 65535===r?t:n;case"shape":r=r.toLowerCase();break;default:0===t.indexOf("on")&&r&&(r=(""+r).replace(/^function\s+\w+\(\)\s+\{\s+(.*)\s+\}$/,"$1"))}return r!==o&&null!==r&&""!==r?""+r:n},getPos:function(e,t){var n=this,r=0,i=0,o,a=n.doc,s;if(e=n.get(e),t=t||a.body,e){if(t===a.body&&e.getBoundingClientRect)return s=e.getBoundingClientRect(),t=n.boxModel?a.documentElement:a.body,r=s.left+(a.documentElement.scrollLeft||a.body.scrollLeft)-t.clientLeft,i=s.top+(a.documentElement.scrollTop||a.body.scrollTop)-t.clientTop,{x:r,y:i};for(o=e;o&&o!=t&&o.nodeType;)r+=o.offsetLeft||0,i+=o.offsetTop||0,o=o.offsetParent;for(o=e.parentNode;o&&o!=t&&o.nodeType;)r-=o.scrollLeft||0,i-=o.scrollTop||0,o=o.parentNode}return{x:r,y:i}},parseStyle:function(e){return this.styles.parse(e)},serializeStyle:function(e,t){return this.styles.serialize(e,t)},addStyle:function(e){var t=this,n=t.doc,r,i;if(t!==u.DOM&&n===document){var o=u.DOM.addedStyles;if(o=o||[],o[e])return;o[e]=!0,u.DOM.addedStyles=o}i=n.getElementById("mceDefaultStyles"),i||(i=n.createElement("style"),i.id="mceDefaultStyles",i.type="text/css",r=n.getElementsByTagName("head")[0],r.firstChild?r.insertBefore(i,r.firstChild):r.appendChild(i)),i.styleSheet?i.styleSheet.cssText+=e:i.appendChild(n.createTextNode(e))},loadCSS:function(e){var t=this,n=t.doc,r;return t!==u.DOM&&n===document?void u.DOM.loadCSS(e):(e||(e=""),r=n.getElementsByTagName("head")[0],void d(e.split(","),function(e){var i;t.files[e]||(t.files[e]=!0,i=t.create("link",{rel:"stylesheet",href:e}),v&&n.documentMode&&n.recalc&&(i.onload=function(){n.recalc&&n.recalc(),i.onload=null}),r.appendChild(i))}))},addClass:function(e,t){return this.run(e,function(e){var n;return t?this.hasClass(e,t)?e.className:(n=this.removeClass(e,t),e.className=n=(""!==n?n+" ":"")+t,n):0})},removeClass:function(e,t){var n=this,r;return n.run(e,function(e){var i;return n.hasClass(e,t)?(r||(r=new RegExp("(^|\\s+)"+t+"(\\s+|$)","g")),i=e.className.replace(r," "),i=h(" "!=i?i:""),e.className=i,i||(e.removeAttribute("class"),e.removeAttribute("className")),i):e.className})},hasClass:function(e,t){return e=this.get(e),e&&t?-1!==(" "+e.className+" ").indexOf(" "+t+" "):!1},toggleClass:function(e,n,r){r=r===t?!this.hasClass(e,n):r,this.hasClass(e,n)!==r&&(r?this.addClass(e,n):this.removeClass(e,n))},show:function(e){return this.setStyle(e,"display","block")},hide:function(e){return this.setStyle(e,"display","none")},isHidden:function(e){return e=this.get(e),!e||"none"==e.style.display||"none"==this.getStyle(e,"display")},uniqueId:function(e){return(e?e:"mce_")+this.counter++},setHTML:function(e,t){var n=this;return n.run(e,function(e){if(v){for(;e.firstChild;)e.removeChild(e.firstChild);try{e.innerHTML="<br />"+t,e.removeChild(e.firstChild)}catch(r){var i=n.create("div");i.innerHTML="<br />"+t,d(p(i.childNodes),function(t,n){n&&e.canHaveHTML&&e.appendChild(t)})}}else e.innerHTML=t;return t})},getOuterHTML:function(e){var t,n=this;return(e=n.get(e))?1===e.nodeType&&n.hasOuterHTML?e.outerHTML:(t=(e.ownerDocument||n.doc).createElement("body"),t.appendChild(e.cloneNode(!0)),t.innerHTML):null},setOuterHTML:function(e,t,n){var r=this;return r.run(e,function(e){function i(){var i,o;for(o=n.createElement("body"),o.innerHTML=t,i=o.lastChild;i;)r.insertAfter(i.cloneNode(!0),e),i=i.previousSibling;r.remove(e)}if(1==e.nodeType)if(n=n||e.ownerDocument||r.doc,v)try{1==e.nodeType&&r.hasOuterHTML?e.outerHTML=t:i()}catch(o){i()}else i()})},decode:a.decode,encode:a.encodeAllRaw,insertAfter:function(e,t){return t=this.get(t),this.run(e,function(e){var n,r;return n=t.parentNode,r=t.nextSibling,r?n.insertBefore(e,r):n.appendChild(e),e})},replace:function(e,t,n){var r=this;return r.run(t,function(t){return f(t,"array")&&(e=e.cloneNode(!0)),n&&d(p(t.childNodes),function(t){e.appendChild(t)}),t.parentNode.replaceChild(e,t)})},rename:function(e,t){var n=this,r;return e.nodeName!=t.toUpperCase()&&(r=n.create(t),d(n.getAttribs(e),function(t){n.setAttrib(r,t.nodeName,n.getAttrib(e,t.nodeName))}),n.replace(r,e,1)),r||e},findCommonAncestor:function(e,t){for(var n=e,r;n;){for(r=t;r&&n!=r;)r=r.parentNode;if(n==r)break;n=n.parentNode}return!n&&e.ownerDocument?e.ownerDocument.documentElement:n},toHex:function(e){return this.styles.toHex(l.trim(e))},run:function(e,t,n){var r=this,i;return"string"==typeof e&&(e=r.get(e)),e?(n=n||this,e.nodeType||!e.length&&0!==e.length?t.call(n,e):(i=[],d(e,function(e,o){e&&("string"==typeof e&&(e=r.get(e)),i.push(t.call(n,e,o)))}),i)):!1},getAttribs:function(e){var t;if(e=this.get(e),!e)return[];if(v){if(t=[],"OBJECT"==e.nodeName)return e.attributes;"OPTION"===e.nodeName&&this.getAttrib(e,"selected")&&t.push({specified:1,nodeName:"selected"});var n=/<\/?[\w:\-]+ ?|=[\"][^\"]+\"|=\'[^\']+\'|=[\w\-]+|>/gi;return e.cloneNode(!1).outerHTML.replace(n,"").replace(/[\w:\-]+/gi,function(e){t.push({specified:1,nodeName:e})}),t}return e.attributes},isEmpty:function(e,t){var n=this,r,o,a,s,l,c=0;if(e=e.firstChild){s=new i(e,e.parentNode),t=t||n.schema?n.schema.getNonEmptyElements():null;do{if(a=e.nodeType,1===a){if(e.getAttribute("data-mce-bogus"))continue;if(l=e.nodeName.toLowerCase(),t&&t[l]){if("br"===l){c++;continue}return!1}for(o=n.getAttribs(e),r=o.length;r--;)if(l=o[r].nodeName,"name"===l||"data-mce-bookmark"===l)return!1}if(8==a)return!1;if(3===a&&!b.test(e.nodeValue))return!1}while(e=s.next())}return 1>=c},createRng:function(){var e=this.doc;return e.createRange?e.createRange():new o(this)},nodeIndex:function(e,t){var n=0,r,i;if(e)for(r=e.nodeType,e=e.previousSibling;e;e=e.previousSibling)i=e.nodeType,(!t||3!=i||i!=r&&e.nodeValue.length)&&(n++,r=i);return n},split:function(e,t,n){function r(e){function t(e){var t=e.previousSibling&&"SPAN"==e.previousSibling.nodeName,n=e.nextSibling&&"SPAN"==e.nextSibling.nodeName;return t&&n}var n,o=e.childNodes,a=e.nodeType;if(1!=a||"bookmark"!=e.getAttribute("data-mce-type")){for(n=o.length-1;n>=0;n--)r(o[n]);if(9!=a){if(3==a&&e.nodeValue.length>0){var s=h(e.nodeValue).length;if(!i.isBlock(e.parentNode)||s>0||0===s&&t(e))return}else if(1==a&&(o=e.childNodes,1==o.length&&o[0]&&1==o[0].nodeType&&"bookmark"==o[0].getAttribute("data-mce-type")&&e.parentNode.insertBefore(o[0],e),o.length||/^(br|hr|input|img)$/i.test(e.nodeName)))return;i.remove(e)}return e}}var i=this,o=i.createRng(),a,s,l;return e&&t?(o.setStart(e.parentNode,i.nodeIndex(e)),o.setEnd(t.parentNode,i.nodeIndex(t)),a=o.extractContents(),o=i.createRng(),o.setStart(t.parentNode,i.nodeIndex(t)+1),o.setEnd(e.parentNode,i.nodeIndex(e)+1),s=o.extractContents(),l=e.parentNode,l.insertBefore(r(a),e),n?l.replaceChild(n,t):l.insertBefore(t,e),l.insertBefore(r(s),e),i.remove(e),n||t):void 0},bind:function(e,t,n,r){var i=this;if(l.isArray(e)){for(var o=e.length;o--;)e[o]=i.bind(e[o],t,n,r);return e}return!i.settings.collect||e!==i.doc&&e!==i.win||i.boundEvents.push([e,t,n,r]),i.events.bind(e,t,n,r||i)},unbind:function(e,t,n){var r=this,i;if(l.isArray(e)){for(i=e.length;i--;)e[i]=r.unbind(e[i],t,n);return e}if(r.boundEvents&&(e===r.doc||e===r.win))for(i=r.boundEvents.length;i--;){var o=r.boundEvents[i];e!=o[0]||t&&t!=o[1]||n&&n!=o[2]||this.events.unbind(o[0],o[1],o[2])}return this.events.unbind(e,t,n)},fire:function(e,t,n){return this.events.fire(e,t,n)},getContentEditable:function(e){var t;return e&&1==e.nodeType?(t=e.getAttribute("data-mce-contenteditable"),t&&"inherit"!==t?t:"inherit"!==e.contentEditable?e.contentEditable:null):null},getContentEditableParent:function(e){for(var t=this.getRoot(),n=null;e&&e!==t&&(n=this.getContentEditable(e),null===n);e=e.parentNode);return n},destroy:function(){var t=this;if(t.boundEvents){for(var n=t.boundEvents.length;n--;){var r=t.boundEvents[n]; +this.events.unbind(r[0],r[1],r[2])}t.boundEvents=null}e.setDocument&&e.setDocument(),t.win=t.doc=t.root=t.events=t.frag=null},isChildOf:function(e,t){for(;e;){if(t===e)return!0;e=e.parentNode}return!1},dumpRng:function(e){return"startContainer: "+e.startContainer.nodeName+", startOffset: "+e.startOffset+", endContainer: "+e.endContainer.nodeName+", endOffset: "+e.endOffset},_findSib:function(e,t,n){var r=this,i=t;if(e)for("string"==typeof i&&(i=function(e){return r.is(e,t)}),e=e[n];e;e=e[n])if(i(e))return e;return null}},u.DOM=new u(document),u}),r(b,[y,p],function(e,t){function n(){function e(e,t){function n(){o.remove(s),a&&(a.onreadystatechange=a.onload=a=null),t()}function i(){"undefined"!=typeof console&&console.log&&console.log("Failed to load: "+e)}var o=r,a,s;s=o.uniqueId(),a=document.createElement("script"),a.id=s,a.type="text/javascript",a.src=e,"onreadystatechange"in a?a.onreadystatechange=function(){/loaded|complete/.test(a.readyState)&&n()}:a.onload=n,a.onerror=i,(document.getElementsByTagName("head")[0]||document.body).appendChild(a)}var t=0,n=1,a=2,s={},l=[],c={},u=[],d=0,f;this.isDone=function(e){return s[e]==a},this.markDone=function(e){s[e]=a},this.add=this.load=function(e,n,r){var i=s[e];i==f&&(l.push(e),s[e]=t),n&&(c[e]||(c[e]=[]),c[e].push({func:n,scope:r||this}))},this.loadQueue=function(e,t){this.loadScripts(l,e,t)},this.loadScripts=function(t,r,l){function p(e){i(c[e],function(e){e.func.call(e.scope)}),c[e]=f}var h;u.push({func:r,scope:l||this}),(h=function(){var r=o(t);t.length=0,i(r,function(t){return s[t]==a?void p(t):void(s[t]!=n&&(s[t]=n,d++,e(t,function(){s[t]=a,d--,p(t),h()})))}),d||(i(u,function(e){e.func.call(e.scope)}),u.length=0)})()}}var r=e.DOM,i=t.each,o=t.grep;return n.ScriptLoader=new n,n}),r(C,[b,p],function(e,n){function r(){var e=this;e.items=[],e.urls={},e.lookup={}}var i=n.each;return r.prototype={get:function(e){return this.lookup[e]?this.lookup[e].instance:t},dependencies:function(e){var t;return this.lookup[e]&&(t=this.lookup[e].dependencies),t||[]},requireLangPack:function(t,n){var i=r.language;if(i&&r.languageLoad!==!1){if(n)if(n=","+n+",",-1!=n.indexOf(","+i.substr(0,2)+","))i=i.substr(0,2);else if(-1==n.indexOf(","+i+","))return;e.ScriptLoader.add(this.urls[t]+"/langs/"+i+".js")}},add:function(e,t,n){return this.items.push(t),this.lookup[e]={instance:t,dependencies:n},t},createUrl:function(e,t){return"object"==typeof t?t:{prefix:e.prefix,resource:t,suffix:e.suffix}},addComponents:function(t,n){var r=this.urls[t];i(n,function(t){e.ScriptLoader.add(r+"/"+t)})},load:function(n,o,a,s){function l(){var r=c.dependencies(n);i(r,function(e){var n=c.createUrl(o,e);c.load(n.resource,n,t,t)}),a&&a.call(s?s:e)}var c=this,u=o;c.urls[n]||("object"==typeof o&&(u=o.prefix+o.resource+o.suffix),0!==u.indexOf("/")&&-1==u.indexOf("://")&&(u=r.baseURL+"/"+u),c.urls[n]=u.substring(0,u.lastIndexOf("/")),c.lookup[n]?l():e.ScriptLoader.add(u,l,s))}},r.PluginManager=new r,r.ThemeManager=new r,r}),r(x,[],function(){function e(e,t,n){var r,i,o=n?"lastChild":"firstChild",a=n?"prev":"next";if(e[o])return e[o];if(e!==t){if(r=e[a])return r;for(i=e.parent;i&&i!==t;i=i.parent)if(r=i[a])return r}}function t(e,t){this.name=e,this.type=t,1===t&&(this.attributes=[],this.attributes.map={})}var n=/^[ \t\r\n]*$/,r={"#text":3,"#comment":8,"#cdata":4,"#pi":7,"#doctype":10,"#document-fragment":11};return t.prototype={replace:function(e){var t=this;return e.parent&&e.remove(),t.insert(e,t),t.remove(),t},attr:function(e,t){var n=this,r,i,o;if("string"!=typeof e){for(i in e)n.attr(i,e[i]);return n}if(r=n.attributes){if(t!==o){if(null===t){if(e in r.map)for(delete r.map[e],i=r.length;i--;)if(r[i].name===e)return r=r.splice(i,1),n;return n}if(e in r.map){for(i=r.length;i--;)if(r[i].name===e){r[i].value=t;break}}else r.push({name:e,value:t});return r.map[e]=t,n}return r.map[e]}},clone:function(){var e=this,n=new t(e.name,e.type),r,i,o,a,s;if(o=e.attributes){for(s=[],s.map={},r=0,i=o.length;i>r;r++)a=o[r],"id"!==a.name&&(s[s.length]={name:a.name,value:a.value},s.map[a.name]=a.value);n.attributes=s}return n.value=e.value,n.shortEnded=e.shortEnded,n},wrap:function(e){var t=this;return t.parent.insert(e,t),e.append(t),t},unwrap:function(){var e=this,t,n;for(t=e.firstChild;t;)n=t.next,e.insert(t,e,!0),t=n;e.remove()},remove:function(){var e=this,t=e.parent,n=e.next,r=e.prev;return t&&(t.firstChild===e?(t.firstChild=n,n&&(n.prev=null)):r.next=n,t.lastChild===e?(t.lastChild=r,r&&(r.next=null)):n.prev=r,e.parent=e.next=e.prev=null),e},append:function(e){var t=this,n;return e.parent&&e.remove(),n=t.lastChild,n?(n.next=e,e.prev=n,t.lastChild=e):t.lastChild=t.firstChild=e,e.parent=t,e},insert:function(e,t,n){var r;return e.parent&&e.remove(),r=t.parent||this,n?(t===r.firstChild?r.firstChild=e:t.prev.next=e,e.prev=t.prev,e.next=t,t.prev=e):(t===r.lastChild?r.lastChild=e:t.next.prev=e,e.next=t.next,e.prev=t,t.next=e),e.parent=r,e},getAll:function(t){var n=this,r,i=[];for(r=n.firstChild;r;r=e(r,n))r.name===t&&i.push(r);return i},empty:function(){var t=this,n,r,i;if(t.firstChild){for(n=[],i=t.firstChild;i;i=e(i,t))n.push(i);for(r=n.length;r--;)i=n[r],i.parent=i.firstChild=i.lastChild=i.next=i.prev=null}return t.firstChild=t.lastChild=null,t},isEmpty:function(t){var r=this,i=r.firstChild,o,a;if(i)do{if(1===i.type){if(i.attributes.map["data-mce-bogus"])continue;if(t[i.name])return!1;for(o=i.attributes.length;o--;)if(a=i.attributes[o].name,"name"===a||0===a.indexOf("data-mce-"))return!1}if(8===i.type)return!1;if(3===i.type&&!n.test(i.value))return!1}while(i=e(i,r));return!0},walk:function(t){return e(this,null,t)}},t.create=function(e,n){var i,o;if(i=new t(e,r[e]||1),n)for(o in n)i.attr(o,n[o]);return i},t}),r(w,[p],function(e){function t(e,t){return e?e.split(t||" "):[]}function n(e){function n(e,n,r){function i(e){var t={},n,r;for(n=0,r=e.length;r>n;n++)t[e[n]]={};return t}var o,l,c,u=arguments;for(r=r||[],n=n||"","string"==typeof r&&(r=t(r)),l=3;l<u.length;l++)"string"==typeof u[l]&&(u[l]=t(u[l])),r.push.apply(r,u[l]);for(e=t(e),o=e.length;o--;)c=[].concat(s,t(n)),a[e[o]]={attributes:i(c),attributesOrder:c,children:i(r)}}function i(e,n){var r,i,o,s;for(e=t(e),r=e.length,n=t(n);r--;)for(i=a[e[r]],o=0,s=n.length;s>o;o++)i.attributes[n[o]]={},i.attributesOrder.push(n[o])}var a={},s,l,c,u,d,f;return r[e]?r[e]:(s=t("id accesskey class dir lang style tabindex title"),l=t("address blockquote div dl fieldset form h1 h2 h3 h4 h5 h6 hr menu ol p pre table ul"),c=t("a abbr b bdo br button cite code del dfn em embed i iframe img input ins kbd label map noscript object q s samp script select small span strong sub sup textarea u var #text #comment"),"html4"!=e&&(s.push.apply(s,t("contenteditable contextmenu draggable dropzone hidden spellcheck translate")),l.push.apply(l,t("article aside details dialog figure header footer hgroup section nav")),c.push.apply(c,t("audio canvas command datalist mark meter output progress time wbr video ruby bdi keygen"))),"html5-strict"!=e&&(s.push("xml:lang"),f=t("acronym applet basefont big font strike tt"),c.push.apply(c,f),o(f,function(e){n(e,"",c)}),d=t("center dir isindex noframes"),l.push.apply(l,d),u=[].concat(l,c),o(d,function(e){n(e,"",u)})),u=u||[].concat(l,c),n("html","manifest","head body"),n("head","","base command link meta noscript script style title"),n("title hr noscript br"),n("base","href target"),n("link","href rel media hreflang type sizes hreflang"),n("meta","name http-equiv content charset"),n("style","media type scoped"),n("script","src async defer type charset"),n("body","onafterprint onbeforeprint onbeforeunload onblur onerror onfocus onhashchange onload onmessage onoffline ononline onpagehide onpageshow onpopstate onresize onscroll onstorage onunload",u),n("address dt dd div caption","",u),n("h1 h2 h3 h4 h5 h6 pre p abbr code var samp kbd sub sup i b u bdo span legend em strong small s cite dfn","",c),n("blockquote","cite",u),n("ol","reversed start type","li"),n("ul","","li"),n("li","value",u),n("dl","","dt dd"),n("a","href target rel media hreflang type",c),n("q","cite",c),n("ins del","cite datetime",u),n("img","src alt usemap ismap width height"),n("iframe","src name width height",u),n("embed","src type width height"),n("object","data type typemustmatch name usemap form width height",u,"param"),n("param","name value"),n("map","name",u,"area"),n("area","alt coords shape href target rel media hreflang type"),n("table","border","caption colgroup thead tfoot tbody tr"+("html4"==e?" col":"")),n("colgroup","span","col"),n("col","span"),n("tbody thead tfoot","","tr"),n("tr","","td th"),n("td","colspan rowspan headers",u),n("th","colspan rowspan headers scope abbr",u),n("form","accept-charset action autocomplete enctype method name novalidate target",u),n("fieldset","disabled form name",u,"legend"),n("label","form for",c),n("input","accept alt autocomplete checked dirname disabled form formaction formenctype formmethod formnovalidate formtarget height list max maxlength min multiple name pattern readonly required size src step type value width"),n("button","disabled form formaction formenctype formmethod formnovalidate formtarget name type value","html4"==e?u:c),n("select","disabled form multiple name required size","option optgroup"),n("optgroup","disabled label","option"),n("option","disabled label selected value"),n("textarea","cols dirname disabled form maxlength name readonly required rows wrap"),n("menu","type label",u,"li"),n("noscript","",u),"html4"!=e&&(n("wbr"),n("ruby","",c,"rt rp"),n("figcaption","",u),n("mark rt rp summary bdi","",c),n("canvas","width height",u),n("video","src crossorigin poster preload autoplay mediagroup loop muted controls width height buffered",u,"track source"),n("audio","src crossorigin preload autoplay mediagroup loop muted controls buffered volume",u,"track source"),n("source","src type media"),n("track","kind src srclang label default"),n("datalist","",c,"option"),n("article section nav aside header footer","",u),n("hgroup","","h1 h2 h3 h4 h5 h6"),n("figure","",u,"figcaption"),n("time","datetime",c),n("dialog","open",u),n("command","type label icon disabled checked radiogroup command"),n("output","for form name",c),n("progress","value max",c),n("meter","value min max low high optimum",c),n("details","open",u,"summary"),n("keygen","autofocus challenge disabled form keytype name")),"html5-strict"!=e&&(i("script","language xml:space"),i("style","xml:space"),i("object","declare classid codebase codetype archive standby align border hspace vspace"),i("param","valuetype type"),i("a","charset name rev shape coords"),i("br","clear"),i("applet","codebase archive code object alt name width height align hspace vspace"),i("img","name longdesc align border hspace vspace"),i("iframe","longdesc frameborder marginwidth marginheight scrolling align"),i("font basefont","size color face"),i("input","usemap align"),i("select","onchange"),i("textarea"),i("h1 h2 h3 h4 h5 h6 div p legend caption","align"),i("ul","type compact"),i("li","type"),i("ol dl menu dir","compact"),i("pre","width xml:space"),i("hr","align noshade size width"),i("isindex","prompt"),i("table","summary width frame rules cellspacing cellpadding align bgcolor"),i("col","width align char charoff valign"),i("colgroup","width align char charoff valign"),i("thead","align char charoff valign"),i("tr","align char charoff valign bgcolor"),i("th","axis align char charoff valign nowrap bgcolor width height"),i("form","accept"),i("td","abbr axis scope align char charoff valign nowrap bgcolor width height"),i("tfoot","align char charoff valign"),i("tbody","align char charoff valign"),i("area","nohref"),i("body","background bgcolor text link vlink alink")),"html4"!=e&&(i("input button select textarea","autofocus"),i("input textarea","placeholder"),i("a","download"),i("link script img","crossorigin"),i("iframe","sandbox seamless allowfullscreen")),o(t("a form meter progress dfn"),function(e){a[e]&&delete a[e].children[e]}),delete a.caption.children.table,r[e]=a,a)}var r={},i=e.makeMap,o=e.each,a=e.extend,s=e.explode,l=e.inArray;return function(e){function c(t,n,o){var s=e[t];return s?s=i(s,/[, ]/,i(s.toUpperCase(),/[, ]/)):(s=r[t],s||(s=i(n," ",i(n.toUpperCase()," ")),s=a(s,o),r[t]=s)),s}function u(e){return new RegExp("^"+e.replace(/([?+*])/g,".$1")+"$")}function d(e){var n,r,o,a,s,c,d,f,p,h,m,g,y,C,x,w,_,N,E,S=/^([#+\-])?([^\[!\/]+)(?:\/([^\[!]+))?(?:(!?)\[([^\]]+)\])?$/,k=/^([!\-])?(\w+::\w+|[^=:<]+)?(?:([=:<])(.*))?$/,T=/[*?+]/;if(e)for(e=t(e,","),v["@"]&&(w=v["@"].attributes,_=v["@"].attributesOrder),n=0,r=e.length;r>n;n++)if(s=S.exec(e[n])){if(C=s[1],p=s[2],x=s[3],f=s[5],g={},y=[],c={attributes:g,attributesOrder:y},"#"===C&&(c.paddEmpty=!0),"-"===C&&(c.removeEmpty=!0),"!"===s[4]&&(c.removeEmptyAttrs=!0),w){for(N in w)g[N]=w[N];y.push.apply(y,_)}if(f)for(f=t(f,"|"),o=0,a=f.length;a>o;o++)if(s=k.exec(f[o])){if(d={},m=s[1],h=s[2].replace(/::/g,":"),C=s[3],E=s[4],"!"===m&&(c.attributesRequired=c.attributesRequired||[],c.attributesRequired.push(h),d.required=!0),"-"===m){delete g[h],y.splice(l(y,h),1);continue}C&&("="===C&&(c.attributesDefault=c.attributesDefault||[],c.attributesDefault.push({name:h,value:E}),d.defaultValue=E),":"===C&&(c.attributesForced=c.attributesForced||[],c.attributesForced.push({name:h,value:E}),d.forcedValue=E),"<"===C&&(d.validValues=i(E,"?"))),T.test(h)?(c.attributePatterns=c.attributePatterns||[],d.pattern=u(h),c.attributePatterns.push(d)):(g[h]||y.push(h),g[h]=d)}w||"@"!=p||(w=g,_=y),x&&(c.outputName=p,v[x]=c),T.test(p)?(c.pattern=u(p),b.push(c)):v[p]=c}}function f(e){v={},b=[],d(e),o(x,function(e,t){y[t]=e.children})}function p(e){var n=/^(~)?(.+)$/;e&&(r.text_block_elements=r.block_elements=null,o(t(e,","),function(e){var t=n.exec(e),r="~"===t[1],i=r?"span":"div",s=t[2];if(y[s]=y[i],R[s]=i,r||(S[s.toUpperCase()]={},S[s]={}),!v[s]){var l=v[i];l=a({},l),delete l.removeEmptyAttrs,delete l.removeEmpty,v[s]=l}o(y,function(e,t){e[i]&&(y[t]=e=a({},y[t]),e[s]=e[i])})}))}function h(e){var n=/^([+\-]?)(\w+)\[([^\]]+)\]$/;e&&o(t(e,","),function(e){var r=n.exec(e),i,s;r&&(s=r[1],i=s?y[r[2]]:y[r[2]]={"#comment":{}},i=y[r[2]],o(t(r[3],"|"),function(e){"-"===s?(y[r[2]]=i=a({},y[r[2]]),delete i[e]):i[e]={}}))})}function m(e){var t=v[e],n;if(t)return t;for(n=b.length;n--;)if(t=b[n],t.pattern.test(e))return t}var g=this,v={},y={},b=[],C,x,w,_,N,E,S,k,T,R={},A={};e=e||{},x=n(e.schema),e.verify_html===!1&&(e.valid_elements="*[*]"),e.valid_styles&&(C={},o(e.valid_styles,function(e,t){C[t]=s(e)})),w=c("whitespace_elements","pre script noscript style textarea video audio iframe object"),_=c("self_closing_elements","colgroup dd dt li option p td tfoot th thead tr"),N=c("short_ended_elements","area base basefont br col frame hr img input isindex link meta param embed source wbr track"),E=c("boolean_attributes","checked compact declare defer disabled ismap multiple nohref noresize noshade nowrap readonly selected autoplay loop controls"),k=c("non_empty_elements","td th iframe video audio object script",N),T=c("text_block_elements","h1 h2 h3 h4 h5 h6 p div address pre form blockquote center dir fieldset header footer article section hgroup aside nav figure"),S=c("block_elements","hr table tbody thead tfoot th tr td li ol ul caption dl dt dd noscript menu isindex option datalist select optgroup",T),o((e.special||"script noscript style textarea").split(" "),function(e){A[e]=new RegExp("</"+e+"[^>]*>","gi")}),e.valid_elements?f(e.valid_elements):(o(x,function(e,t){v[t]={attributes:e.attributes,attributesOrder:e.attributesOrder},y[t]=e.children}),"html5"!=e.schema&&o(t("strong/b em/i"),function(e){e=t(e,"/"),v[e[1]].outputName=e[0]}),v.img.attributesDefault=[{name:"alt",value:""}],o(t("ol ul sub sup blockquote span font a table tbody tr strong em b i"),function(e){v[e]&&(v[e].removeEmpty=!0)}),o(t("p h1 h2 h3 h4 h5 h6 th td pre div address caption"),function(e){v[e].paddEmpty=!0}),o(t("span"),function(e){v[e].removeEmptyAttrs=!0})),p(e.custom_elements),h(e.valid_children),d(e.extended_valid_elements),h("+ol[ul|ol],+ul[ul|ol]"),e.invalid_elements&&o(s(e.invalid_elements),function(e){v[e]&&delete v[e]}),m("span")||d("span[!data-mce-type|*]"),g.children=y,g.styles=C,g.getBoolAttrs=function(){return E},g.getBlockElements=function(){return S},g.getTextBlockElements=function(){return T},g.getShortEndedElements=function(){return N},g.getSelfClosingElements=function(){return _},g.getNonEmptyElements=function(){return k},g.getWhiteSpaceElements=function(){return w},g.getSpecialElements=function(){return A},g.isValidChild=function(e,t){var n=y[e];return!(!n||!n[t])},g.isValid=function(e,t){var n,r,i=m(e);if(i){if(!t)return!0;if(i.attributes[t])return!0;if(n=i.attributePatterns)for(r=n.length;r--;)if(n[r].pattern.test(e))return!0}return!1},g.getElementRule=m,g.getCustomElements=function(){return R},g.addValidElements=d,g.setValidElements=f,g.addCustomElements=p,g.addValidChildren=h,g.elements=v}}),r(_,[w,m,p],function(e,t,n){var r=n.each;return function(i,o){function a(){}var s=this;i=i||{},s.schema=o=o||new e,i.fix_self_closing!==!1&&(i.fix_self_closing=!0),r("comment cdata text start end pi doctype".split(" "),function(e){e&&(s[e]=i[e]||a)}),s.parse=function(e){function r(e){var t,n;for(t=f.length;t--&&f[t].name!==e;);if(t>=0){for(n=f.length-1;n>=t;n--)e=f[n],e.valid&&s.end(e.name);f.length=t}}function a(e,t,n,r,o){var a,s,l=/[\s\u0000-\u001F]+/g;if(t=t.toLowerCase(),n=t in C?t:F(n||r||o||""),w&&!v&&0!==t.indexOf("data-")){if(a=k[t],!a&&T){for(s=T.length;s--&&(a=T[s],!a.pattern.test(t)););-1===s&&(a=null)}if(!a)return;if(a.validValues&&!(n in a.validValues))return}if(W[t]&&!i.allow_script_urls){var c=n.replace(l,"");try{c=decodeURIComponent(c)}catch(u){c=unescape(c)}if(V.test(c))return;if(!i.allow_html_data_urls&&U.test(c)&&!/^data:image\//i.test(c))return}p.map[t]=n,p.push({name:t,value:n})}var s=this,l,c=0,u,d,f=[],p,h,m,g,v,y,b,C,x,w,_,N,E,S,k,T,R,A,B,D,L,M,H,P,O,I=0,F=t.decode,z,W=n.makeMap("src,href,data,background,formaction,poster"),V=/((java|vb)script|mhtml):/i,U=/^data:/i;for(M=new RegExp("<(?:(?:!--([\\w\\W]*?)-->)|(?:!\\[CDATA\\[([\\w\\W]*?)\\]\\]>)|(?:!DOCTYPE([\\w\\W]*?)>)|(?:\\?([^\\s\\/<>]+) ?([\\w\\W]*?)[?/]>)|(?:\\/([^>]+)>)|(?:([A-Za-z0-9\\-\\:\\.]+)((?:\\s+[^\"'>]+(?:(?:\"[^\"]*\")|(?:'[^']*')|[^>]*))*|\\/|\\s+)>))","g"),H=/([\w:\-]+)(?:\s*=\s*(?:(?:\"((?:[^\"])*)\")|(?:\'((?:[^\'])*)\')|([^>\s]+)))?/g,b=o.getShortEndedElements(),L=i.self_closing_elements||o.getSelfClosingElements(),C=o.getBoolAttrs(),w=i.validate,y=i.remove_internals,z=i.fix_self_closing,P=o.getSpecialElements();l=M.exec(e);){if(c<l.index&&s.text(F(e.substr(c,l.index-c))),u=l[6])u=u.toLowerCase(),":"===u.charAt(0)&&(u=u.substr(1)),r(u);else if(u=l[7]){if(u=u.toLowerCase(),":"===u.charAt(0)&&(u=u.substr(1)),x=u in b,z&&L[u]&&f.length>0&&f[f.length-1].name===u&&r(u),!w||(_=o.getElementRule(u))){if(N=!0,w&&(k=_.attributes,T=_.attributePatterns),(S=l[8])?(v=-1!==S.indexOf("data-mce-type"),v&&y&&(N=!1),p=[],p.map={},S.replace(H,a)):(p=[],p.map={}),w&&!v){if(R=_.attributesRequired,A=_.attributesDefault,B=_.attributesForced,D=_.removeEmptyAttrs,D&&!p.length&&(N=!1),B)for(h=B.length;h--;)E=B[h],g=E.name,O=E.value,"{$uid}"===O&&(O="mce_"+I++),p.map[g]=O,p.push({name:g,value:O});if(A)for(h=A.length;h--;)E=A[h],g=E.name,g in p.map||(O=E.value,"{$uid}"===O&&(O="mce_"+I++),p.map[g]=O,p.push({name:g,value:O}));if(R){for(h=R.length;h--&&!(R[h]in p.map););-1===h&&(N=!1)}p.map["data-mce-bogus"]&&(N=!1)}N&&s.start(u,p,x)}else N=!1;if(d=P[u]){d.lastIndex=c=l.index+l[0].length,(l=d.exec(e))?(N&&(m=e.substr(c,l.index-c)),c=l.index+l[0].length):(m=e.substr(c),c=e.length),N&&(m.length>0&&s.text(m,!0),s.end(u)),M.lastIndex=c;continue}x||(S&&S.indexOf("/")==S.length-1?N&&s.end(u):f.push({name:u,valid:N}))}else(u=l[1])?(">"===u.charAt(0)&&(u=" "+u),i.allow_conditional_comments||"[if"!==u.substr(0,3)||(u=" "+u),s.comment(u)):(u=l[2])?s.cdata(u):(u=l[3])?s.doctype(u):(u=l[4])&&s.pi(u,l[5]);c=l.index+l[0].length}for(c<e.length&&s.text(F(e.substr(c))),h=f.length-1;h>=0;h--)u=f[h],u.valid&&s.end(u.name)}}}),r(N,[x,w,_,p],function(e,t,n,r){var i=r.makeMap,o=r.each,a=r.explode,s=r.extend;return function(r,l){function c(t){var n,r,o,a,s,c,d,f,p,h,m,g,v,y;for(m=i("tr,td,th,tbody,thead,tfoot,table"),h=l.getNonEmptyElements(),g=l.getTextBlockElements(),n=0;n<t.length;n++)if(r=t[n],r.parent&&!r.fixed)if(g[r.name]&&"li"==r.parent.name){for(v=r.next;v&&g[v.name];)v.name="li",v.fixed=!0,r.parent.insert(v,r.parent),v=v.next;r.unwrap(r)}else{for(a=[r],o=r.parent;o&&!l.isValidChild(o.name,r.name)&&!m[o.name];o=o.parent)a.push(o);if(o&&a.length>1){for(a.reverse(),s=c=u.filterNode(a[0].clone()),p=0;p<a.length-1;p++){for(l.isValidChild(c.name,a[p].name)?(d=u.filterNode(a[p].clone()),c.append(d)):d=c,f=a[p].firstChild;f&&f!=a[p+1];)y=f.next,d.append(f),f=y;c=d}s.isEmpty(h)?o.insert(r,a[0],!0):(o.insert(s,a[0],!0),o.insert(r,s)),o=a[0],(o.isEmpty(h)||o.firstChild===o.lastChild&&"br"===o.firstChild.name)&&o.empty().remove()}else if(r.parent){if("li"===r.name){if(v=r.prev,v&&("ul"===v.name||"ul"===v.name)){v.append(r);continue}if(v=r.next,v&&("ul"===v.name||"ul"===v.name)){v.insert(r,v.firstChild,!0);continue}r.wrap(u.filterNode(new e("ul",1)));continue}l.isValidChild(r.parent.name,"div")&&l.isValidChild("div",r.name)?r.wrap(u.filterNode(new e("div",1))):"style"===r.name||"script"===r.name?r.empty().remove():r.unwrap()}}}var u=this,d={},f=[],p={},h={};r=r||{},r.validate="validate"in r?r.validate:!0,r.root_name=r.root_name||"body",u.schema=l=l||new t,u.filterNode=function(e){var t,n,r;n in d&&(r=p[n],r?r.push(e):p[n]=[e]),t=f.length;for(;t--;)n=f[t].name,n in e.attributes.map&&(r=h[n],r?r.push(e):h[n]=[e]);return e},u.addNodeFilter=function(e,t){o(a(e),function(e){var n=d[e];n||(d[e]=n=[]),n.push(t)})},u.addAttributeFilter=function(e,t){o(a(e),function(e){var n;for(n=0;n<f.length;n++)if(f[n].name===e)return void f[n].callbacks.push(t);f.push({name:e,callbacks:[t]})})},u.parse=function(t,o){function a(){function e(e){e&&(t=e.firstChild,t&&3==t.type&&(t.value=t.value.replace(R,"")),t=e.lastChild,t&&3==t.type&&(t.value=t.value.replace(D,"")))}var t=y.firstChild,n,i;if(l.isValidChild(y.name,I.toLowerCase())){for(;t;)n=t.next,3==t.type||1==t.type&&"p"!==t.name&&!T[t.name]&&!t.attr("data-mce-type")?i?i.append(t):(i=u(I,1),i.attr(r.forced_root_block_attrs),y.insert(i,t),i.append(t)):(e(i),i=null),t=n;e(i)}}function u(t,n){var r=new e(t,n),i;return t in d&&(i=p[t],i?i.push(r):p[t]=[r]),r}function m(e){var t,n,r;for(t=e.prev;t&&3===t.type;)n=t.value.replace(D,""),n.length>0?(t.value=n,t=t.prev):(r=t.prev,t.remove(),t=r)}function g(e){var t,n={};for(t in e)"li"!==t&&"p"!=t&&(n[t]=e[t]);return n}var v,y,b,C,x,w,_,N,E,S,k,T,R,A=[],B,D,L,M,H,P,O,I;if(o=o||{},p={},h={},T=s(i("script,style,head,html,body,title,meta,param"),l.getBlockElements()),O=l.getNonEmptyElements(),P=l.children,k=r.validate,I="forced_root_block"in o?o.forced_root_block:r.forced_root_block,H=l.getWhiteSpaceElements(),R=/^[ \t\r\n]+/,D=/[ \t\r\n]+$/,L=/[ \t\r\n]+/g,M=/^[ \t\r\n]+$/,v=new n({validate:k,allow_script_urls:r.allow_script_urls,allow_conditional_comments:r.allow_conditional_comments,self_closing_elements:g(l.getSelfClosingElements()),cdata:function(e){b.append(u("#cdata",4)).value=e},text:function(e,t){var n;B||(e=e.replace(L," "),b.lastChild&&T[b.lastChild.name]&&(e=e.replace(R,""))),0!==e.length&&(n=u("#text",3),n.raw=!!t,b.append(n).value=e)},comment:function(e){b.append(u("#comment",8)).value=e},pi:function(e,t){b.append(u(e,7)).value=t,m(b)},doctype:function(e){var t;t=b.append(u("#doctype",10)),t.value=e,m(b)},start:function(e,t,n){var r,i,o,a,s;if(o=k?l.getElementRule(e):{}){for(r=u(o.outputName||e,1),r.attributes=t,r.shortEnded=n,b.append(r),s=P[b.name],s&&P[r.name]&&!s[r.name]&&A.push(r),i=f.length;i--;)a=f[i].name,a in t.map&&(E=h[a],E?E.push(r):h[a]=[r]);T[e]&&m(r),n||(b=r),!B&&H[e]&&(B=!0)}},end:function(t){var n,r,i,o,a;if(r=k?l.getElementRule(t):{}){if(T[t]&&!B){if(n=b.firstChild,n&&3===n.type)if(i=n.value.replace(R,""),i.length>0)n.value=i,n=n.next;else for(o=n.next,n.remove(),n=o;n&&3===n.type;)i=n.value,o=n.next,(0===i.length||M.test(i))&&(n.remove(),n=o),n=o;if(n=b.lastChild,n&&3===n.type)if(i=n.value.replace(D,""),i.length>0)n.value=i,n=n.prev;else for(o=n.prev,n.remove(),n=o;n&&3===n.type;)i=n.value,o=n.prev,(0===i.length||M.test(i))&&(n.remove(),n=o),n=o}if(B&&H[t]&&(B=!1),(r.removeEmpty||r.paddEmpty)&&b.isEmpty(O))if(r.paddEmpty)b.empty().append(new e("#text","3")).value="\xa0";else if(!b.attributes.map.name&&!b.attributes.map.id)return a=b.parent,b.empty().remove(),void(b=a);b=b.parent}}},l),y=b=new e(o.context||r.root_name,11),v.parse(t),k&&A.length&&(o.context?o.invalid=!0:c(A)),I&&("body"==y.name||o.isRootContent)&&a(),!o.invalid){for(S in p){for(E=d[S],C=p[S],_=C.length;_--;)C[_].parent||C.splice(_,1);for(x=0,w=E.length;w>x;x++)E[x](C,S,o)}for(x=0,w=f.length;w>x;x++)if(E=f[x],E.name in h){for(C=h[E.name],_=C.length;_--;)C[_].parent||C.splice(_,1);for(_=0,N=E.callbacks.length;N>_;_++)E.callbacks[_](C,E.name,o)}}return y},r.remove_trailing_brs&&u.addNodeFilter("br",function(t){var n,r=t.length,i,o=s({},l.getBlockElements()),a=l.getNonEmptyElements(),c,u,d,f,p,h;for(o.body=1,n=0;r>n;n++)if(i=t[n],c=i.parent,o[i.parent.name]&&i===c.lastChild){for(d=i.prev;d;){if(f=d.name,"span"!==f||"bookmark"!==d.attr("data-mce-type")){if("br"!==f)break;if("br"===f){i=null;break}}d=d.prev}i&&(i.remove(),c.isEmpty(a)&&(p=l.getElementRule(c.name),p&&(p.removeEmpty?c.remove():p.paddEmpty&&(c.empty().append(new e("#text",3)).value="\xa0"))))}else{for(u=i;c&&c.firstChild===u&&c.lastChild===u&&(u=c,!o[c.name]);)c=c.parent;u===c&&(h=new e("#text",3),h.value="\xa0",i.replace(h))}}),r.allow_html_in_named_anchor||u.addAttributeFilter("id,name",function(e){for(var t=e.length,n,r,i,o;t--;)if(o=e[t],"a"===o.name&&o.firstChild&&!o.attr("href")){i=o.parent,n=o.lastChild;do r=n.prev,i.insert(n,o),n=r;while(n)}})}}),r(E,[m,p],function(e,t){var n=t.makeMap;return function(t){var r=[],i,o,a,s,l;return t=t||{},i=t.indent,o=n(t.indent_before||""),a=n(t.indent_after||""),s=e.getEncodeFunc(t.entity_encoding||"raw",t.entities),l="html"==t.element_format,{start:function(e,t,n){var c,u,d,f;if(i&&o[e]&&r.length>0&&(f=r[r.length-1],f.length>0&&"\n"!==f&&r.push("\n")),r.push("<",e),t)for(c=0,u=t.length;u>c;c++)d=t[c],r.push(" ",d.name,'="',s(d.value,!0),'"');r[r.length]=!n||l?">":" />",n&&i&&a[e]&&r.length>0&&(f=r[r.length-1],f.length>0&&"\n"!==f&&r.push("\n"))},end:function(e){var t;r.push("</",e,">"),i&&a[e]&&r.length>0&&(t=r[r.length-1],t.length>0&&"\n"!==t&&r.push("\n"))},text:function(e,t){e.length>0&&(r[r.length]=t?e:s(e))},cdata:function(e){r.push("<![CDATA[",e,"]]>")},comment:function(e){r.push("<!--",e,"-->")},pi:function(e,t){t?r.push("<?",e," ",t,"?>"):r.push("<?",e,"?>"),i&&r.push("\n")},doctype:function(e){r.push("<!DOCTYPE",e,">",i?"\n":"")},reset:function(){r.length=0},getContent:function(){return r.join("").replace(/\n$/,"")}}}}),r(S,[E,w],function(e,t){return function(n,r){var i=this,o=new e(n);n=n||{},n.validate="validate"in n?n.validate:!0,i.schema=r=r||new t,i.writer=o,i.serialize=function(e){function t(e){var n=i[e.type],s,l,c,u,d,f,p,h,m;if(n)n(e);else{if(s=e.name,l=e.shortEnded,c=e.attributes,a&&c&&c.length>1){for(f=[],f.map={},m=r.getElementRule(e.name),p=0,h=m.attributesOrder.length;h>p;p++)u=m.attributesOrder[p],u in c.map&&(d=c.map[u],f.map[u]=d,f.push({name:u,value:d}));for(p=0,h=c.length;h>p;p++)u=c[p].name,u in f.map||(d=c.map[u],f.map[u]=d,f.push({name:u,value:d}));c=f}if(o.start(e.name,c,l),!l){if(e=e.firstChild)do t(e);while(e=e.next);o.end(s)}}}var i,a;return a=n.validate,i={3:function(e){o.text(e.value,e.raw)},8:function(e){o.comment(e.value)},7:function(e){o.pi(e.name,e.value)},10:function(e){o.doctype(e.value)},4:function(e){o.cdata(e.value)},11:function(e){if(e=e.firstChild)do t(e);while(e=e.next)}},o.reset(),1!=e.type||n.inner?i[11](e):t(e),o.getContent()}}}),r(k,[y,N,m,S,x,w,g,p],function(e,t,n,r,i,o,a,s){var l=s.each,c=s.trim,u=e.DOM;return function(e,i){var s,d,f;return i&&(s=i.dom,d=i.schema),s=s||u,d=d||new o(e),e.entity_encoding=e.entity_encoding||"named",e.remove_trailing_brs="remove_trailing_brs"in e?e.remove_trailing_brs:!0,f=new t(e,d),f.addAttributeFilter("data-mce-tabindex",function(e,t){for(var n=e.length,r;n--;)r=e[n],r.attr("tabindex",r.attributes.map["data-mce-tabindex"]),r.attr(t,null)}),f.addAttributeFilter("src,href,style",function(t,n){for(var r=t.length,i,o,a="data-mce-"+n,l=e.url_converter,c=e.url_converter_scope,u;r--;)i=t[r],o=i.attributes.map[a],o!==u?(i.attr(n,o.length>0?o:null),i.attr(a,null)):(o=i.attributes.map[n],"style"===n?o=s.serializeStyle(s.parseStyle(o),i.name):l&&(o=l.call(c,o,n,i.name)),i.attr(n,o.length>0?o:null))}),f.addAttributeFilter("class",function(e){for(var t=e.length,n,r;t--;)n=e[t],r=n.attr("class").replace(/(?:^|\s)mce-item-\w+(?!\S)/g,""),n.attr("class",r.length>0?r:null)}),f.addAttributeFilter("data-mce-type",function(e,t,n){for(var r=e.length,i;r--;)i=e[r],"bookmark"!==i.attributes.map["data-mce-type"]||n.cleanup||i.remove()}),f.addAttributeFilter("data-mce-expando",function(e,t){for(var n=e.length;n--;)e[n].attr(t,null)}),f.addNodeFilter("noscript",function(e){for(var t=e.length,r;t--;)r=e[t].firstChild,r&&(r.value=n.decode(r.value))}),f.addNodeFilter("script,style",function(e,t){function n(e){return e.replace(/(<!--\[CDATA\[|\]\]-->)/g,"\n").replace(/^[\r\n]*|[\r\n]*$/g,"").replace(/^\s*((<!--)?(\s*\/\/)?\s*<!\[CDATA\[|(<!--\s*)?\/\*\s*<!\[CDATA\[\s*\*\/|(\/\/)?\s*<!--|\/\*\s*<!--\s*\*\/)\s*[\r\n]*/gi,"").replace(/\s*(\/\*\s*\]\]>\s*\*\/(-->)?|\s*\/\/\s*\]\]>(-->)?|\/\/\s*(-->)?|\]\]>|\/\*\s*-->\s*\*\/|\s*-->\s*)\s*$/g,"")}for(var r=e.length,i,o;r--;)if(i=e[r],o=i.firstChild?i.firstChild.value:"","script"===t){var a=(i.attr("type")||"text/javascript").replace(/^mce\-/,"");i.attr("type","text/javascript"===a?null:a),o.length>0&&(i.firstChild.value="// <![CDATA[\n"+n(o)+"\n// ]]>")}else o.length>0&&(i.firstChild.value="<!--\n"+n(o)+"\n-->")}),f.addNodeFilter("#comment",function(e){for(var t=e.length,n;t--;)n=e[t],0===n.value.indexOf("[CDATA[")?(n.name="#cdata",n.type=4,n.value=n.value.replace(/^\[CDATA\[|\]\]$/g,"")):0===n.value.indexOf("mce:protected ")&&(n.name="#text",n.type=3,n.raw=!0,n.value=unescape(n.value).substr(14))}),f.addNodeFilter("xml:namespace,input",function(e,t){for(var n=e.length,r;n--;)r=e[n],7===r.type?r.remove():1===r.type&&("input"!==t||"type"in r.attributes.map||r.attr("type","text"))}),e.fix_list_elements&&f.addNodeFilter("ul,ol",function(e){for(var t=e.length,n,r;t--;)n=e[t],r=n.parent,("ul"===r.name||"ol"===r.name)&&n.prev&&"li"===n.prev.name&&n.prev.append(n)}),f.addAttributeFilter("data-mce-src,data-mce-href,data-mce-style,data-mce-selected",function(e,t){for(var n=e.length;n--;)e[n].attr(t,null)}),{schema:d,addNodeFilter:f.addNodeFilter,addAttributeFilter:f.addAttributeFilter,serialize:function(t,n){var i=this,o,u,p,h,m;return a.ie&&s.select("script,style,select,map").length>0?(m=t.innerHTML,t=t.cloneNode(!1),s.setHTML(t,m)):t=t.cloneNode(!0),o=t.ownerDocument.implementation,o.createHTMLDocument&&(u=o.createHTMLDocument(""),l("BODY"==t.nodeName?t.childNodes:[t],function(e){u.body.appendChild(u.importNode(e,!0))}),t="BODY"!=t.nodeName?u.body.firstChild:u.body,p=s.doc,s.doc=u),n=n||{},n.format=n.format||"html",n.selection&&(n.forced_root_block=""),n.no_events||(n.node=t,i.onPreProcess(n)),h=new r(e,d),n.content=h.serialize(f.parse(c(n.getInner?t.innerHTML:s.getOuterHTML(t)),n)),n.cleanup||(n.content=n.content.replace(/\uFEFF/g,"")),n.no_events||i.onPostProcess(n),p&&(s.doc=p),n.node=null,n.content},addRules:function(e){d.addValidElements(e)},setRules:function(e){d.setValidElements(e)},onPreProcess:function(e){i&&i.fire("PreProcess",e)},onPostProcess:function(e){i&&i.fire("PostProcess",e)}}}}),r(T,[],function(){function e(e){function t(t,n){var r,i=0,o,a,s,l,c,u,d=-1,f;if(r=t.duplicate(),r.collapse(n),f=r.parentElement(),f.ownerDocument===e.dom.doc){for(;"false"===f.contentEditable;)f=f.parentNode; +if(!f.hasChildNodes())return{node:f,inside:1};for(s=f.children,o=s.length-1;o>=i;)if(u=Math.floor((i+o)/2),l=s[u],r.moveToElementText(l),d=r.compareEndPoints(n?"StartToStart":"EndToEnd",t),d>0)o=u-1;else{if(!(0>d))return{node:l};i=u+1}if(0>d)for(l?r.collapse(!1):(r.moveToElementText(f),r.collapse(!0),l=f,a=!0),c=0;0!==r.compareEndPoints(n?"StartToStart":"StartToEnd",t)&&0!==r.move("character",1)&&f==r.parentElement();)c++;else for(r.collapse(!0),c=0;0!==r.compareEndPoints(n?"StartToStart":"StartToEnd",t)&&0!==r.move("character",-1)&&f==r.parentElement();)c++;return{node:l,position:d,offset:c,inside:a}}}function n(){function n(e){var n=t(o,e),r,i,s=0,l,c,u;if(r=n.node,i=n.offset,n.inside&&!r.hasChildNodes())return void a[e?"setStart":"setEnd"](r,0);if(i===c)return void a[e?"setStartBefore":"setEndAfter"](r);if(n.position<0){if(l=n.inside?r.firstChild:r.nextSibling,!l)return void a[e?"setStartAfter":"setEndAfter"](r);if(!i)return void(3==l.nodeType?a[e?"setStart":"setEnd"](l,0):a[e?"setStartBefore":"setEndBefore"](l));for(;l;){if(u=l.nodeValue,s+=u.length,s>=i){r=l,s-=i,s=u.length-s;break}l=l.nextSibling}}else{if(l=r.previousSibling,!l)return a[e?"setStartBefore":"setEndBefore"](r);if(!i)return void(3==r.nodeType?a[e?"setStart":"setEnd"](l,r.nodeValue.length):a[e?"setStartAfter":"setEndAfter"](l));for(;l;){if(s+=l.nodeValue.length,s>=i){r=l,s-=i;break}l=l.previousSibling}}a[e?"setStart":"setEnd"](r,s)}var o=e.getRng(),a=i.createRng(),s,l,c,u,d;if(s=o.item?o.item(0):o.parentElement(),s.ownerDocument!=i.doc)return a;if(l=e.isCollapsed(),o.item)return a.setStart(s.parentNode,i.nodeIndex(s)),a.setEnd(a.startContainer,a.startOffset+1),a;try{n(!0),l||n()}catch(f){if(-2147024809!=f.number)throw f;d=r.getBookmark(2),c=o.duplicate(),c.collapse(!0),s=c.parentElement(),l||(c=o.duplicate(),c.collapse(!1),u=c.parentElement(),u.innerHTML=u.innerHTML),s.innerHTML=s.innerHTML,r.moveToBookmark(d),o=e.getRng(),n(!0),l||n()}return a}var r=this,i=e.dom,o=!1;this.getBookmark=function(n){function r(e){var t,n,r,o,a=[];for(t=e.parentNode,n=i.getRoot().parentNode;t!=n&&9!==t.nodeType;){for(r=t.children,o=r.length;o--;)if(e===r[o]){a.push(o);break}e=t,t=t.parentNode}return a}function o(e){var n;return n=t(a,e),n?{position:n.position,offset:n.offset,indexes:r(n.node),inside:n.inside}:void 0}var a=e.getRng(),s={};return 2===n&&(a.item?s.start={ctrl:!0,indexes:r(a.item(0))}:(s.start=o(!0),e.isCollapsed()||(s.end=o()))),s},this.moveToBookmark=function(e){function t(e){var t,n,r,o;for(t=i.getRoot(),n=e.length-1;n>=0;n--)o=t.children,r=e[n],r<=o.length-1&&(t=o[r]);return t}function n(n){var i=e[n?"start":"end"],a,s,l,c;i&&(a=i.position>0,s=o.createTextRange(),s.moveToElementText(t(i.indexes)),c=i.offset,c!==l?(s.collapse(i.inside||a),s.moveStart("character",a?-c:c)):s.collapse(n),r.setEndPoint(n?"StartToStart":"EndToStart",s),n&&r.collapse(!0))}var r,o=i.doc.body;e.start&&(e.start.ctrl?(r=o.createControlRange(),r.addElement(t(e.start.indexes)),r.select()):(r=o.createTextRange(),n(!0),n(),r.select()))},this.addRange=function(t){function n(e){var t,n,a,d,h;a=i.create("a"),t=e?s:c,n=e?l:u,d=r.duplicate(),(t==f||t==f.documentElement)&&(t=p,n=0),3==t.nodeType?(t.parentNode.insertBefore(a,t),d.moveToElementText(a),d.moveStart("character",n),i.remove(a),r.setEndPoint(e?"StartToStart":"EndToEnd",d)):(h=t.childNodes,h.length?(n>=h.length?i.insertAfter(a,h[h.length-1]):t.insertBefore(a,h[n]),d.moveToElementText(a)):t.canHaveHTML&&(t.innerHTML="<span></span>",a=t.firstChild,d.moveToElementText(a),d.collapse(o)),r.setEndPoint(e?"StartToStart":"EndToEnd",d),i.remove(a))}var r,a,s,l,c,u,d,f=e.dom.doc,p=f.body,h,m;if(s=t.startContainer,l=t.startOffset,c=t.endContainer,u=t.endOffset,r=p.createTextRange(),s==c&&1==s.nodeType){if(l==u&&!s.hasChildNodes()){if(s.canHaveHTML)return d=s.previousSibling,d&&!d.hasChildNodes()&&i.isBlock(d)?d.innerHTML="":d=null,s.innerHTML="<span></span><span></span>",r.moveToElementText(s.lastChild),r.select(),i.doc.selection.clear(),s.innerHTML="",void(d&&(d.innerHTML=""));l=i.nodeIndex(s),s=s.parentNode}if(l==u-1)try{if(m=s.childNodes[l],a=p.createControlRange(),a.addElement(m),a.select(),h=e.getRng(),h.item&&m===h.item(0))return}catch(g){}}n(!0),n(),r.select()},this.getRangeAt=n}return e}),r(R,[g],function(e){return{BACKSPACE:8,DELETE:46,DOWN:40,ENTER:13,LEFT:37,RIGHT:39,SPACEBAR:32,TAB:9,UP:38,modifierPressed:function(e){return e.shiftKey||e.ctrlKey||e.altKey},metaKeyPressed:function(t){return(e.mac?t.metaKey:t.ctrlKey)&&!t.altKey}}}),r(A,[R,p,g],function(e,t,n){return function(r,i){function o(e){var t=i.settings.object_resizing;return t===!1||n.iOS?!1:("string"!=typeof t&&(t="table,img,div"),"false"===e.getAttribute("data-mce-resize")?!1:i.dom.is(e,t))}function a(t){var n,r;n=t.screenX-k,r=t.screenY-T,H=n*E[2]+B,P=r*E[3]+D,H=5>H?5:H,P=5>P?5:P,(e.modifierPressed(t)||"IMG"==w.nodeName&&E[2]*E[3]!==0)&&(H=Math.round(P/L),P=Math.round(H*L)),C.setStyles(_,{width:H,height:P}),E[2]<0&&_.clientWidth<=H&&C.setStyle(_,"left",R+(B-H)),E[3]<0&&_.clientHeight<=P&&C.setStyle(_,"top",A+(D-P)),M||(i.fire("ObjectResizeStart",{target:w,width:B,height:D}),M=!0)}function s(){function e(e,t){t&&(w.style[e]||!i.schema.isValid(w.nodeName.toLowerCase(),e)?C.setStyle(w,e,t):C.setAttrib(w,e,t))}M=!1,e("width",H),e("height",P),C.unbind(O,"mousemove",a),C.unbind(O,"mouseup",s),I!=O&&(C.unbind(I,"mousemove",a),C.unbind(I,"mouseup",s)),C.remove(_),F&&"TABLE"!=w.nodeName||l(w),i.fire("ObjectResized",{target:w,width:H,height:P}),i.nodeChanged()}function l(e,t,r){var l,u,d,f,p,h=i.getBody();g(),l=C.getPos(e,h),R=l.x,A=l.y,p=e.getBoundingClientRect(),u=p.width||p.right-p.left,d=p.height||p.bottom-p.top,w!=e&&(m(),w=e,H=P=0),f=i.fire("ObjectSelected",{target:e}),o(e)&&!f.isDefaultPrevented()?x(N,function(e,o){function l(t){k=t.screenX,T=t.screenY,B=w.clientWidth,D=w.clientHeight,L=D/B,E=e,_=w.cloneNode(!0),C.addClass(_,"mce-clonedresizable"),_.contentEditable=!1,_.unSelectabe=!0,C.setStyles(_,{left:R,top:A,margin:0}),_.removeAttribute("data-mce-selected"),i.getBody().appendChild(_),C.bind(O,"mousemove",a),C.bind(O,"mouseup",s),I!=O&&(C.bind(I,"mousemove",a),C.bind(I,"mouseup",s))}var c,f;return t?void(o==t&&l(r)):(c=C.get("mceResizeHandle"+o),c?C.show(c):(f=i.getBody(),c=C.add(f,"div",{id:"mceResizeHandle"+o,"data-mce-bogus":!0,"class":"mce-resizehandle",unselectable:!0,style:"cursor:"+o+"-resize; margin:0; padding:0"}),n.ie&&(c.contentEditable=!1)),e.elm||(C.bind(c,"mousedown",function(e){e.stopImmediatePropagation(),e.preventDefault(),l(e)}),e.elm=c),void C.setStyles(c,{left:u*e[0]+R-c.offsetWidth/2,top:d*e[1]+A-c.offsetHeight/2}))}):c(),w.setAttribute("data-mce-selected","1")}function c(){var e,t;g(),w&&w.removeAttribute("data-mce-selected");for(e in N)t=C.get("mceResizeHandle"+e),t&&(C.unbind(t),C.remove(t))}function u(e){function t(e,t){if(e)do if(e===t)return!0;while(e=e.parentNode)}var n;return x(C.select("img[data-mce-selected],hr[data-mce-selected]"),function(e){e.removeAttribute("data-mce-selected")}),n="mousedown"==e.type?e.target:r.getNode(),n=C.getParent(n,F?"table":"table,img,hr"),t(n,i.getBody())&&(v(),t(r.getStart(),n)&&t(r.getEnd(),n)&&(!F||n!=r.getStart()&&"IMG"!==r.getStart().nodeName))?void l(n):void c()}function d(e,t,n){e&&e.attachEvent&&e.attachEvent("on"+t,n)}function f(e,t,n){e&&e.detachEvent&&e.detachEvent("on"+t,n)}function p(e){var t=e.srcElement,n,r,o,a,s,c,u;n=t.getBoundingClientRect(),c=S.clientX-n.left,u=S.clientY-n.top;for(r in N)if(o=N[r],a=t.offsetWidth*o[0],s=t.offsetHeight*o[1],Math.abs(a-c)<8&&Math.abs(s-u)<8){E=o;break}M=!0,i.getDoc().selection.empty(),l(t,r,S)}function h(e){var t=e.srcElement;if(t!=w){if(m(),0===t.id.indexOf("mceResizeHandle"))return void(e.returnValue=!1);("IMG"==t.nodeName||"TABLE"==t.nodeName)&&(c(),w=t,d(t,"resizestart",p))}}function m(){f(w,"resizestart",p)}function g(){for(var e in N){var t=N[e];t.elm&&(C.unbind(t.elm),delete t.elm)}}function v(){try{i.getDoc().execCommand("enableObjectResizing",!1,!1)}catch(e){}}function y(e){var t;if(F){t=O.body.createControlRange();try{return t.addElement(e),t.select(),!0}catch(n){}}}function b(){w=_=null,F&&(m(),f(i.getBody(),"controlselect",h))}var C=i.dom,x=t.each,w,_,N,E,S,k,T,R,A,B,D,L,M,H,P,O=i.getDoc(),I=document,F=n.ie&&n.ie<11;N={n:[.5,0,0,-1],e:[1,.5,1,0],s:[.5,1,0,1],w:[0,.5,-1,0],nw:[0,0,-1,-1],ne:[1,0,1,-1],se:[1,1,1,1],sw:[0,1,-1,1]};var z=".mce-content-body";return i.contentStyles.push(z+" div.mce-resizehandle {position: absolute;border: 1px solid black;background: #FFF;width: 5px;height: 5px;z-index: 10000}"+z+" .mce-resizehandle:hover {background: #000}"+z+" img[data-mce-selected], hr[data-mce-selected] {outline: 1px solid black;resize: none}"+z+" .mce-clonedresizable {position: absolute;"+(n.gecko?"":"outline: 1px dashed black;")+"opacity: .5;filter: alpha(opacity=50);z-index: 10000}"),i.on("init",function(){F?(i.on("ObjectResized",function(e){"TABLE"!=e.target.nodeName&&(c(),y(e.target))}),d(i.getBody(),"controlselect",h),i.on("mousedown",function(e){S=e})):(v(),n.ie>=11&&(i.on("mouseup",function(e){var t=e.target.nodeName;/^(TABLE|IMG|HR)$/.test(t)&&(i.selection.select(e.target,"TABLE"==t),i.nodeChanged())}),i.dom.bind(i.getBody(),"mscontrolselect",function(e){/^(TABLE|IMG|HR)$/.test(e.target.nodeName)&&(e.preventDefault(),"IMG"==e.target.tagName&&window.setTimeout(function(){i.selection.select(e.target)},0))}))),i.on("nodechange mousedown mouseup ResizeEditor",u),i.on("keydown keyup",function(e){w&&"TABLE"==w.nodeName&&u(e)}),i.on("hide",c)}),i.on("remove",g),{isResizable:o,showResizeRect:l,hideResizeRect:c,updateResizeRect:u,controlSelect:y,destroy:b}}}),r(B,[p,f],function(e,t){function n(e){this.walk=function(t,n){function i(e){var t;return t=e[0],3===t.nodeType&&t===l&&c>=t.nodeValue.length&&e.splice(0,1),t=e[e.length-1],0===d&&e.length>0&&t===u&&3===t.nodeType&&e.splice(e.length-1,1),e}function o(e,t,n){for(var r=[];e&&e!=n;e=e[t])r.push(e);return r}function a(e,t){do{if(e.parentNode==t)return e;e=e.parentNode}while(e)}function s(e,t,r){var a=r?"nextSibling":"previousSibling";for(m=e,g=m.parentNode;m&&m!=t;m=g)g=m.parentNode,v=o(m==e?m:m[a],a),v.length&&(r||v.reverse(),n(i(v)))}var l=t.startContainer,c=t.startOffset,u=t.endContainer,d=t.endOffset,f,p,h,m,g,v,y;if(y=e.select("td.mce-item-selected,th.mce-item-selected"),y.length>0)return void r(y,function(e){n([e])});if(1==l.nodeType&&l.hasChildNodes()&&(l=l.childNodes[c]),1==u.nodeType&&u.hasChildNodes()&&(u=u.childNodes[Math.min(d-1,u.childNodes.length-1)]),l==u)return n(i([l]));for(f=e.findCommonAncestor(l,u),m=l;m;m=m.parentNode){if(m===u)return s(l,f,!0);if(m===f)break}for(m=u;m;m=m.parentNode){if(m===l)return s(u,f);if(m===f)break}p=a(l,f)||l,h=a(u,f)||u,s(l,p,!0),v=o(p==l?p:p.nextSibling,"nextSibling",h==u?h.nextSibling:h),v.length&&n(i(v)),s(u,h)},this.split=function(e){function t(e,t){return e.splitText(t)}var n=e.startContainer,r=e.startOffset,i=e.endContainer,o=e.endOffset;return n==i&&3==n.nodeType?r>0&&r<n.nodeValue.length&&(i=t(n,r),n=i.previousSibling,o>r?(o-=r,n=i=t(i,o).previousSibling,o=i.nodeValue.length,r=0):o=0):(3==n.nodeType&&r>0&&r<n.nodeValue.length&&(n=t(n,r),r=0),3==i.nodeType&&o>0&&o<i.nodeValue.length&&(i=t(i,o).previousSibling,o=i.nodeValue.length)),{startContainer:n,startOffset:r,endContainer:i,endOffset:o}},this.normalize=function(n){function r(r){function a(n,r){for(var i=new t(n,e.getParent(n.parentNode,e.isBlock)||f);n=i[r?"prev":"next"]();)if("BR"===n.nodeName)return!0}function s(e,t){return e.previousSibling&&e.previousSibling.nodeName==t}function l(n,r){var a,s,l;if(r=r||c,l=e.getParent(r.parentNode,e.isBlock)||f,n&&"BR"==r.nodeName&&g&&e.isEmpty(l))return c=r.parentNode,u=e.nodeIndex(r),void(i=!0);for(a=new t(r,l);p=a[n?"prev":"next"]();){if("false"===e.getContentEditableParent(p))return;if(3===p.nodeType&&p.nodeValue.length>0)return c=p,u=n?p.nodeValue.length:0,void(i=!0);if(e.isBlock(p)||h[p.nodeName.toLowerCase()])return;s=p}o&&s&&(c=s,i=!0,u=0)}var c,u,d,f=e.getRoot(),p,h,m,g;if(c=n[(r?"start":"end")+"Container"],u=n[(r?"start":"end")+"Offset"],g=1==c.nodeType&&u===c.childNodes.length,h=e.schema.getNonEmptyElements(),m=r,1==c.nodeType&&u>c.childNodes.length-1&&(m=!1),9===c.nodeType&&(c=e.getRoot(),u=0),c===f){if(m&&(p=c.childNodes[u>0?u-1:0],p&&(h[p.nodeName]||"TABLE"==p.nodeName)))return;if(c.hasChildNodes()&&(u=Math.min(!m&&u>0?u-1:u,c.childNodes.length-1),c=c.childNodes[u],u=0,c.hasChildNodes()&&!/TABLE/.test(c.nodeName))){p=c,d=new t(c,f);do{if(3===p.nodeType&&p.nodeValue.length>0){u=m?0:p.nodeValue.length,c=p,i=!0;break}if(h[p.nodeName.toLowerCase()]){u=e.nodeIndex(p),c=p.parentNode,"IMG"!=p.nodeName||m||u++,i=!0;break}}while(p=m?d.next():d.prev())}}o&&(3===c.nodeType&&0===u&&l(!0),1===c.nodeType&&(p=c.childNodes[u],p||(p=c.childNodes[u-1]),!p||"BR"!==p.nodeName||s(p,"A")||a(p)||a(p,!0)||l(!0,p))),m&&!o&&3===c.nodeType&&u===c.nodeValue.length&&l(!1),i&&n["set"+(r?"Start":"End")](c,u)}var i,o;return o=n.collapsed,r(!0),o||r(),i&&o&&n.collapse(!0),i}}var r=e.each;return n.compareRanges=function(e,t){if(e&&t){if(!e.item&&!e.duplicate)return e.startContainer==t.startContainer&&e.startOffset==t.startOffset;if(e.item&&t.item&&e.item(0)===t.item(0))return!0;if(e.isEqual&&t.isEqual&&t.isEqual(e))return!0}return!1},n}),r(D,[f,T,A,B,g,p],function(e,n,r,i,o,a){function s(e,t,i,o){var a=this;a.dom=e,a.win=t,a.serializer=i,a.editor=o,a.controlSelection=new r(a,o),a.win.getSelection||(a.tridentSel=new n(a))}var l=a.each,c=a.grep,u=a.trim,d=o.ie,f=o.opera;return s.prototype={setCursorLocation:function(e,t){var n=this,r=n.dom.createRng();e?(r.setStart(e,t),r.setEnd(e,t),n.setRng(r),n.collapse(!1)):(n._moveEndPoint(r,n.editor.getBody(),!0),n.setRng(r))},getContent:function(e){var n=this,r=n.getRng(),i=n.dom.create("body"),o=n.getSel(),a,s,l;return e=e||{},a=s="",e.get=!0,e.format=e.format||"html",e.selection=!0,n.editor.fire("BeforeGetContent",e),"text"==e.format?n.isCollapsed()?"":r.text||(o.toString?o.toString():""):(r.cloneContents?(l=r.cloneContents(),l&&i.appendChild(l)):r.item!==t||r.htmlText!==t?(i.innerHTML="<br>"+(r.item?r.item(0).outerHTML:r.htmlText),i.removeChild(i.firstChild)):i.innerHTML=r.toString(),/^\s/.test(i.innerHTML)&&(a=" "),/\s+$/.test(i.innerHTML)&&(s=" "),e.getInner=!0,e.content=n.isCollapsed()?"":a+n.serializer.serialize(i,e)+s,n.editor.fire("GetContent",e),e.content)},setContent:function(e,t){var n=this,r=n.getRng(),i,o=n.win.document,a,s;if(t=t||{format:"html"},t.set=!0,t.selection=!0,e=t.content=e,t.no_events||n.editor.fire("BeforeSetContent",t),e=t.content,r.insertNode){e+='<span id="__caret">_</span>',r.startContainer==o&&r.endContainer==o?o.body.innerHTML=e:(r.deleteContents(),0===o.body.childNodes.length?o.body.innerHTML=e:r.createContextualFragment?r.insertNode(r.createContextualFragment(e)):(a=o.createDocumentFragment(),s=o.createElement("div"),a.appendChild(s),s.outerHTML=e,r.insertNode(a))),i=n.dom.get("__caret"),r=o.createRange(),r.setStartBefore(i),r.setEndBefore(i),n.setRng(r),n.dom.remove("__caret");try{n.setRng(r)}catch(l){}}else r.item&&(o.execCommand("Delete",!1,null),r=n.getRng()),/^\s+/.test(e)?(r.pasteHTML('<span id="__mce_tmp">_</span>'+e),n.dom.remove("__mce_tmp")):r.pasteHTML(e);t.no_events||n.editor.fire("SetContent",t)},getStart:function(){var e=this,t=e.getRng(),n,r,i,o;if(t.duplicate||t.item){if(t.item)return t.item(0);for(i=t.duplicate(),i.collapse(1),n=i.parentElement(),n.ownerDocument!==e.dom.doc&&(n=e.dom.getRoot()),r=o=t.parentElement();o=o.parentNode;)if(o==n){n=r;break}return n}return n=t.startContainer,1==n.nodeType&&n.hasChildNodes()&&(n=n.childNodes[Math.min(n.childNodes.length-1,t.startOffset)]),n&&3==n.nodeType?n.parentNode:n},getEnd:function(){var e=this,t=e.getRng(),n,r;return t.duplicate||t.item?t.item?t.item(0):(t=t.duplicate(),t.collapse(0),n=t.parentElement(),n.ownerDocument!==e.dom.doc&&(n=e.dom.getRoot()),n&&"BODY"==n.nodeName?n.lastChild||n:n):(n=t.endContainer,r=t.endOffset,1==n.nodeType&&n.hasChildNodes()&&(n=n.childNodes[r>0?r-1:r]),n&&3==n.nodeType?n.parentNode:n)},getBookmark:function(e,t){function n(e,t){var n=0;return l(a.select(e),function(e,r){e==t&&(n=r)}),n}function r(e){function t(t){var n,r,i,o=t?"start":"end";n=e[o+"Container"],r=e[o+"Offset"],1==n.nodeType&&"TR"==n.nodeName&&(i=n.childNodes,n=i[Math.min(t?r:r-1,i.length-1)],n&&(r=t?0:n.childNodes.length,e["set"+(t?"Start":"End")](n,r)))}return t(!0),t(),e}function i(){function e(e,n){var i=e[n?"startContainer":"endContainer"],a=e[n?"startOffset":"endOffset"],s=[],l,c,u=0;if(3==i.nodeType){if(t)for(l=i.previousSibling;l&&3==l.nodeType;l=l.previousSibling)a+=l.nodeValue.length;s.push(a)}else c=i.childNodes,a>=c.length&&c.length&&(u=1,a=Math.max(0,c.length-1)),s.push(o.dom.nodeIndex(c[a],t)+u);for(;i&&i!=r;i=i.parentNode)s.push(o.dom.nodeIndex(i,t));return s}var n=o.getRng(!0),r=a.getRoot(),i={};return i.start=e(n,!0),o.isCollapsed()||(i.end=e(n)),i}var o=this,a=o.dom,s,c,u,d,f,p,h="",m;if(2==e)return p=o.getNode(),f=p?p.nodeName:null,"IMG"==f?{name:f,index:n(f,p)}:o.tridentSel?o.tridentSel.getBookmark(e):i();if(e)return{rng:o.getRng()};if(s=o.getRng(),u=a.uniqueId(),d=o.isCollapsed(),m="overflow:hidden;line-height:0px",s.duplicate||s.item){if(s.item)return p=s.item(0),f=p.nodeName,{name:f,index:n(f,p)};c=s.duplicate();try{s.collapse(),s.pasteHTML('<span data-mce-type="bookmark" id="'+u+'_start" style="'+m+'">'+h+"</span>"),d||(c.collapse(!1),s.moveToElementText(c.parentElement()),0===s.compareEndPoints("StartToEnd",c)&&c.move("character",-1),c.pasteHTML('<span data-mce-type="bookmark" id="'+u+'_end" style="'+m+'">'+h+"</span>"))}catch(g){return null}}else{if(p=o.getNode(),f=p.nodeName,"IMG"==f)return{name:f,index:n(f,p)};c=r(s.cloneRange()),d||(c.collapse(!1),c.insertNode(a.create("span",{"data-mce-type":"bookmark",id:u+"_end",style:m},h))),s=r(s),s.collapse(!0),s.insertNode(a.create("span",{"data-mce-type":"bookmark",id:u+"_start",style:m},h))}return o.moveToBookmark({id:u,keep:1}),{id:u}},moveToBookmark:function(e){function t(t){var n=e[t?"start":"end"],r,i,o,l;if(n){for(o=n[0],i=s,r=n.length-1;r>=1;r--){if(l=i.childNodes,n[r]>l.length-1)return;i=l[n[r]]}3===i.nodeType&&(o=Math.min(n[0],i.nodeValue.length)),1===i.nodeType&&(o=Math.min(n[0],i.childNodes.length)),t?a.setStart(i,o):a.setEnd(i,o)}return!0}function n(t){var n=o.get(e.id+"_"+t),r,i,a,s,d=e.keep;if(n&&(r=n.parentNode,"start"==t?(d?(r=n.firstChild,i=1):i=o.nodeIndex(n),u=p=r,h=m=i):(d?(r=n.firstChild,i=1):i=o.nodeIndex(n),p=r,m=i),!d)){for(s=n.previousSibling,a=n.nextSibling,l(c(n.childNodes),function(e){3==e.nodeType&&(e.nodeValue=e.nodeValue.replace(/\uFEFF/g,""))});n=o.get(e.id+"_"+t);)o.remove(n,1);s&&a&&s.nodeType==a.nodeType&&3==s.nodeType&&!f&&(i=s.nodeValue.length,s.appendData(a.nodeValue),o.remove(a),"start"==t?(u=p=s,h=m=i):(p=s,m=i))}}function r(e){return!o.isBlock(e)||e.innerHTML||d||(e.innerHTML='<br data-mce-bogus="1" />'),e}var i=this,o=i.dom,a,s,u,p,h,m;if(e)if(e.start){if(a=o.createRng(),s=o.getRoot(),i.tridentSel)return i.tridentSel.moveToBookmark(e);t(!0)&&t()&&i.setRng(a)}else e.id?(n("start"),n("end"),u&&(a=o.createRng(),a.setStart(r(u),h),a.setEnd(r(p),m),i.setRng(a))):e.name?i.select(o.select(e.name)[e.index]):e.rng&&i.setRng(e.rng)},select:function(e,t){var n=this,r=n.dom,i=r.createRng(),o;if(n.lastFocusBookmark=null,e){if(!t&&n.controlSelection.controlSelect(e))return;o=r.nodeIndex(e),i.setStart(e.parentNode,o),i.setEnd(e.parentNode,o+1),t&&(n._moveEndPoint(i,e,!0),n._moveEndPoint(i,e)),n.setRng(i)}return e},isCollapsed:function(){var e=this,t=e.getRng(),n=e.getSel();return!t||t.item?!1:t.compareEndPoints?0===t.compareEndPoints("StartToEnd",t):!n||t.collapsed},collapse:function(e){var t=this,n=t.getRng(),r;n.item&&(r=n.item(0),n=t.win.document.body.createTextRange(),n.moveToElementText(r)),n.collapse(!!e),t.setRng(n)},getSel:function(){var e=this.win;return e.getSelection?e.getSelection():e.document.selection},getRng:function(e){function t(e,t,n){try{return t.compareBoundaryPoints(e,n)}catch(r){return-1}}var n=this,r,i,o,a=n.win.document,s;if(!e&&n.lastFocusBookmark){var l=n.lastFocusBookmark;return l.startContainer?(i=a.createRange(),i.setStart(l.startContainer,l.startOffset),i.setEnd(l.endContainer,l.endOffset)):i=l,i}if(e&&n.tridentSel)return n.tridentSel.getRangeAt(0);try{(r=n.getSel())&&(i=r.rangeCount>0?r.getRangeAt(0):r.createRange?r.createRange():a.createRange())}catch(c){}if(d&&i&&i.setStart&&a.selection){try{s=a.selection.createRange()}catch(c){}s&&s.item&&(o=s.item(0),i=a.createRange(),i.setStartBefore(o),i.setEndAfter(o))}return i||(i=a.createRange?a.createRange():a.body.createTextRange()),i.setStart&&9===i.startContainer.nodeType&&i.collapsed&&(o=n.dom.getRoot(),i.setStart(o,0),i.setEnd(o,0)),n.selectedRange&&n.explicitRange&&(0===t(i.START_TO_START,i,n.selectedRange)&&0===t(i.END_TO_END,i,n.selectedRange)?i=n.explicitRange:(n.selectedRange=null,n.explicitRange=null)),i},setRng:function(e,t){var n=this,r;if(e.select)try{e.select()}catch(i){}else if(n.tridentSel){if(e.cloneRange)try{return void n.tridentSel.addRange(e)}catch(i){}}else if(r=n.getSel()){n.explicitRange=e;try{r.removeAllRanges(),r.addRange(e)}catch(i){}t===!1&&r.extend&&(r.collapse(e.endContainer,e.endOffset),r.extend(e.startContainer,e.startOffset)),n.selectedRange=r.rangeCount>0?r.getRangeAt(0):null}},setNode:function(e){var t=this;return t.setContent(t.dom.getOuterHTML(e)),e},getNode:function(){function e(e,t){for(var n=e;e&&3===e.nodeType&&0===e.length;)e=t?e.nextSibling:e.previousSibling;return e||n}var t=this,n=t.getRng(),r,i=n.startContainer,o=n.endContainer,a=n.startOffset,s=n.endOffset,l=t.dom.getRoot();return n?n.setStart?(r=n.commonAncestorContainer,!n.collapsed&&(i==o&&2>s-a&&i.hasChildNodes()&&(r=i.childNodes[a]),3===i.nodeType&&3===o.nodeType&&(i=i.length===a?e(i.nextSibling,!0):i.parentNode,o=0===s?e(o.previousSibling,!1):o.parentNode,i&&i===o))?i:r&&3==r.nodeType?r.parentNode:r):(r=n.item?n.item(0):n.parentElement(),r.ownerDocument!==t.win.document&&(r=l),r):l},getSelectedBlocks:function(t,n){var r=this,i=r.dom,o,a,s=[];if(a=i.getRoot(),t=i.getParent(t||r.getStart(),i.isBlock),n=i.getParent(n||r.getEnd(),i.isBlock),t&&t!=a&&s.push(t),t&&n&&t!=n){o=t;for(var l=new e(t,a);(o=l.next())&&o!=n;)i.isBlock(o)&&s.push(o)}return n&&t!=n&&n!=a&&s.push(n),s},isForward:function(){var e=this.dom,t=this.getSel(),n,r;return t&&t.anchorNode&&t.focusNode?(n=e.createRng(),n.setStart(t.anchorNode,t.anchorOffset),n.collapse(!0),r=e.createRng(),r.setStart(t.focusNode,t.focusOffset),r.collapse(!0),n.compareBoundaryPoints(n.START_TO_START,r)<=0):!0},normalize:function(){var e=this,t=e.getRng();return!d&&new i(e.dom).normalize(t)&&e.setRng(t,e.isForward()),t},selectorChanged:function(e,t){var n=this,r;return n.selectorChangedData||(n.selectorChangedData={},r={},n.editor.on("NodeChange",function(e){var t=e.element,i=n.dom,o=i.getParents(t,null,i.getRoot()),a={};l(n.selectorChangedData,function(e,t){l(o,function(n){return i.is(n,t)?(r[t]||(l(e,function(e){e(!0,{node:n,selector:t,parents:o})}),r[t]=e),a[t]=e,!1):void 0})}),l(r,function(e,n){a[n]||(delete r[n],l(e,function(e){e(!1,{node:t,selector:n,parents:o})}))})})),n.selectorChangedData[e]||(n.selectorChangedData[e]=[]),n.selectorChangedData[e].push(t),n},getScrollContainer:function(){for(var e,t=this.dom.getRoot();t&&"BODY"!=t.nodeName;){if(t.scrollHeight>t.clientHeight){e=t;break}t=t.parentNode}return e},scrollIntoView:function(e){function t(e){for(var t=0,n=0,r=e;r&&r.nodeType;)t+=r.offsetLeft||0,n+=r.offsetTop||0,r=r.offsetParent;return{x:t,y:n}}var n,r,i=this,o=i.dom,a=o.getRoot(),s,l;if("BODY"!=a.nodeName){var c=i.getScrollContainer();if(c)return n=t(e).y-t(c).y,l=c.clientHeight,s=c.scrollTop,void((s>n||n+25>s+l)&&(c.scrollTop=s>n?n:n-l+25))}r=o.getViewPort(i.editor.getWin()),n=o.getPos(e).y,s=r.y,l=r.h,(n<r.y||n+25>s+l)&&i.editor.getWin().scrollTo(0,s>n?n:n-l+25)},_moveEndPoint:function(t,n,r){var i=n,a=new e(n,i),s=this.dom.schema.getNonEmptyElements();do{if(3==n.nodeType&&0!==u(n.nodeValue).length)return void(r?t.setStart(n,0):t.setEnd(n,n.nodeValue.length));if(s[n.nodeName])return void(r?t.setStartBefore(n):"BR"==n.nodeName?t.setEndBefore(n):t.setEndAfter(n));if(o.ie&&o.ie<11&&this.dom.isBlock(n)&&this.dom.isEmpty(n))return void(r?t.setStart(n,0):t.setEnd(n,0))}while(n=r?a.next():a.prev());"BODY"==i.nodeName&&(r?t.setStart(i,0):t.setEnd(i,i.childNodes.length))},destroy:function(){this.win=null,this.controlSelection.destroy()}},s}),r(L,[p],function(e){function t(e,t){function r(e){return e.replace(/%(\w+)/g,"")}var i,o,a=e.dom,s="",l,c;if(c=e.settings.preview_styles,c===!1)return"";if(c||(c="font-family font-size font-weight font-style text-decoration text-transform color background-color border border-radius outline text-shadow"),"string"==typeof t){if(t=e.formatter.get(t),!t)return;t=t[0]}return i=t.block||t.inline||"span",o=a.create(i),n(t.styles,function(e,t){e=r(e),e&&a.setStyle(o,t,e)}),n(t.attributes,function(e,t){e=r(e),e&&a.setAttrib(o,t,e)}),n(t.classes,function(e){e=r(e),a.hasClass(o,e)||a.addClass(o,e)}),e.fire("PreviewFormats"),a.setStyles(o,{position:"absolute",left:-65535}),e.getBody().appendChild(o),l=a.getStyle(e.getBody(),"fontSize",!0),l=/px$/.test(l)?parseInt(l,10):0,n(c.split(" "),function(t){var n=a.getStyle(o,t,!0);if(!("background-color"==t&&/transparent|rgba\s*\([^)]+,\s*0\)/.test(n)&&(n=a.getStyle(e.getBody(),t,!0),"#ffffff"==a.toHex(n).toLowerCase())||"color"==t&&"#000000"==a.toHex(n).toLowerCase())){if("font-size"==t&&/em|%$/.test(n)){if(0===l)return;n=parseFloat(n,10)/(/%$/.test(n)?100:1),n=n*l+"px"}"border"==t&&n&&(s+="padding:0 2px;"),s+=t+":"+n+";"}}),e.fire("AfterPreviewFormats"),a.remove(o),s}var n=e.each;return{getCssText:t}}),r(M,[f,B,p,L],function(e,t,n,r){return function(i){function o(e){return e.nodeType&&(e=e.nodeName),!!i.schema.getTextBlockElements()[e.toLowerCase()]}function a(e,t){return z.getParents(e,t,z.getRoot())}function s(e){return 1===e.nodeType&&"_mce_caret"===e.id}function l(){d({valigntop:[{selector:"td,th",styles:{verticalAlign:"top"}}],valignmiddle:[{selector:"td,th",styles:{verticalAlign:"middle"}}],valignbottom:[{selector:"td,th",styles:{verticalAlign:"bottom"}}],alignleft:[{selector:"figure,p,h1,h2,h3,h4,h5,h6,td,th,tr,div,ul,ol,li",styles:{textAlign:"left"},defaultBlock:"div"},{selector:"img,table",collapsed:!1,styles:{"float":"left"}}],aligncenter:[{selector:"figure,p,h1,h2,h3,h4,h5,h6,td,th,tr,div,ul,ol,li",styles:{textAlign:"center"},defaultBlock:"div"},{selector:"img",collapsed:!1,styles:{display:"block",marginLeft:"auto",marginRight:"auto"}},{selector:"table",collapsed:!1,styles:{marginLeft:"auto",marginRight:"auto"}}],alignright:[{selector:"figure,p,h1,h2,h3,h4,h5,h6,td,th,tr,div,ul,ol,li",styles:{textAlign:"right"},defaultBlock:"div"},{selector:"img,table",collapsed:!1,styles:{"float":"right"}}],alignjustify:[{selector:"figure,p,h1,h2,h3,h4,h5,h6,td,th,tr,div,ul,ol,li",styles:{textAlign:"justify"},defaultBlock:"div"}],bold:[{inline:"strong",remove:"all"},{inline:"span",styles:{fontWeight:"bold"}},{inline:"b",remove:"all"}],italic:[{inline:"em",remove:"all"},{inline:"span",styles:{fontStyle:"italic"}},{inline:"i",remove:"all"}],underline:[{inline:"span",styles:{textDecoration:"underline"},exact:!0},{inline:"u",remove:"all"}],strikethrough:[{inline:"span",styles:{textDecoration:"line-through"},exact:!0},{inline:"strike",remove:"all"}],forecolor:{inline:"span",styles:{color:"%value"},wrap_links:!1},hilitecolor:{inline:"span",styles:{backgroundColor:"%value"},wrap_links:!1},fontname:{inline:"span",styles:{fontFamily:"%value"}},fontsize:{inline:"span",styles:{fontSize:"%value"}},fontsize_class:{inline:"span",attributes:{"class":"%value"}},blockquote:{block:"blockquote",wrapper:1,remove:"all"},subscript:{inline:"sub"},superscript:{inline:"sup"},code:{inline:"code"},link:{inline:"a",selector:"a",remove:"all",split:!0,deep:!0,onmatch:function(){return!0},onformat:function(e,t,n){nt(n,function(t,n){z.setAttrib(e,n,t)})}},removeformat:[{selector:"b,strong,em,i,font,u,strike,sub,sup,dfn,code,samp,kbd,var,cite,mark,q",remove:"all",split:!0,expand:!1,block_expand:!0,deep:!0},{selector:"span",attributes:["style","class"],remove:"empty",split:!0,expand:!1,deep:!0},{selector:"*",attributes:["style","class"],split:!1,expand:!1,deep:!0}]}),nt("p h1 h2 h3 h4 h5 h6 div address pre div dt dd samp".split(/\s/),function(e){d(e,{block:e,remove:"all"})}),d(i.settings.formats)}function c(){i.addShortcut("ctrl+b","bold_desc","Bold"),i.addShortcut("ctrl+i","italic_desc","Italic"),i.addShortcut("ctrl+u","underline_desc","Underline");for(var e=1;6>=e;e++)i.addShortcut("ctrl+"+e,"",["FormatBlock",!1,"h"+e]);i.addShortcut("ctrl+7","",["FormatBlock",!1,"p"]),i.addShortcut("ctrl+8","",["FormatBlock",!1,"div"]),i.addShortcut("ctrl+9","",["FormatBlock",!1,"address"])}function u(e){return e?F[e]:F}function d(e,t){e&&("string"!=typeof e?nt(e,function(e,t){d(t,e)}):(t=t.length?t:[t],nt(t,function(e){e.deep===Q&&(e.deep=!e.selector),e.split===Q&&(e.split=!e.selector||e.inline),e.remove===Q&&e.selector&&!e.inline&&(e.remove="none"),e.selector&&e.inline&&(e.mixed=!0,e.block_expand=!0),"string"==typeof e.classes&&(e.classes=e.classes.split(/\s+/))}),F[e]=t))}function f(e){var t;return i.dom.getParent(e,function(e){return t=i.dom.getStyle(e,"text-decoration"),t&&"none"!==t}),t}function p(e){var t;1===e.nodeType&&e.parentNode&&1===e.parentNode.nodeType&&(t=f(e.parentNode),i.dom.getStyle(e,"color")&&t?i.dom.setStyle(e,"text-decoration",t):i.dom.getStyle(e,"textdecoration")===t&&i.dom.setStyle(e,"text-decoration",null))}function h(t,n,r){function a(e,t){if(t=t||m,e){if(t.onformat&&t.onformat(e,t,n,r),nt(t.styles,function(t,r){z.setStyle(e,r,k(t,n))}),t.styles){var i=z.getAttrib(e,"style");i&&e.setAttribute("data-mce-style",i)}nt(t.attributes,function(t,r){z.setAttrib(e,r,k(t,n))}),nt(t.classes,function(t){t=k(t,n),z.hasClass(e,t)||z.addClass(e,t)})}}function l(){function t(t,n){var i=new e(n);for(r=i.current();r;r=i.prev())if(r.childNodes.length>1||r==t||"BR"==r.tagName)return r}var n=i.selection.getRng(),o=n.startContainer,a=n.endContainer;if(o!=a&&0===n.endOffset){var s=t(o,a),l=3==s.nodeType?s.length:s.childNodes.length;n.setEnd(s,l)}return n}function c(e,t,n,r,i){var o=[],a=-1,s,l=-1,c=-1,u;return nt(e.childNodes,function(e,t){return"UL"===e.nodeName||"OL"===e.nodeName?(a=t,s=e,!1):void 0}),nt(e.childNodes,function(e,n){"SPAN"===e.nodeName&&"bookmark"==z.getAttrib(e,"data-mce-type")&&(e.id==t.id+"_start"?l=n:e.id==t.id+"_end"&&(c=n))}),0>=a||a>l&&c>a?(nt(rt(e.childNodes),i),0):(u=z.clone(n,Y),nt(rt(e.childNodes),function(e,t){(a>l&&a>t||l>a&&t>a)&&(o.push(e),e.parentNode.removeChild(e))}),a>l?e.insertBefore(u,s):l>a&&e.insertBefore(u,s.nextSibling),r.push(u),nt(o,function(e){u.appendChild(e)}),u)}function d(e,r,i){var l=[],u,d,p=!0;u=m.inline||m.block,d=z.create(u),a(d),V.walk(e,function(e){function h(e){var y,C,x,w,_;return _=p,y=e.nodeName.toLowerCase(),C=e.parentNode.nodeName.toLowerCase(),1===e.nodeType&&Z(e)&&(_=p,p="true"===Z(e),w=!0),N(y,"br")?(g=0,void(m.block&&z.remove(e))):m.wrapper&&v(e,t,n)?void(g=0):p&&!w&&m.block&&!m.wrapper&&o(y)&&U(C,u)?(e=z.rename(e,u),a(e),l.push(e),void(g=0)):m.selector&&(nt(f,function(t){"collapsed"in t&&t.collapsed!==b||z.is(e,t.selector)&&!s(e)&&(a(e,t),x=!0)}),!m.inline||x)?void(g=0):void(!p||w||!U(u,y)||!U(C,u)||!i&&3===e.nodeType&&1===e.nodeValue.length&&65279===e.nodeValue.charCodeAt(0)||s(e)||m.inline&&q(e)?"li"==y&&r?g=c(e,r,d,l,h):(g=0,nt(rt(e.childNodes),h),w&&(p=_),g=0):(g||(g=z.clone(d,Y),e.parentNode.insertBefore(g,e),l.push(g)),g.appendChild(e)))}var g;nt(e,h)}),m.wrap_links===!1&&nt(l,function(e){function t(e){var n,r,i;if("A"===e.nodeName){for(r=z.clone(d,Y),l.push(r),i=rt(e.childNodes),n=0;n<i.length;n++)r.appendChild(i[n]);e.appendChild(r)}nt(rt(e.childNodes),t)}t(e)}),nt(l,function(e){function r(e){var t=0;return nt(e.childNodes,function(e){T(e)||M(e)||t++}),t}function i(e){var t,n;return nt(e.childNodes,function(e){return 1!=e.nodeType||M(e)||s(e)?void 0:(t=e,Y) +}),t&&!M(t)&&_(t,m)&&(n=z.clone(t,Y),a(n),z.replace(n,e,X),z.remove(t,1)),n||e}var o;if(o=r(e),(l.length>1||!q(e))&&0===o)return void z.remove(e,1);if(m.inline||m.wrapper){if(m.exact||1!==o||(e=i(e)),nt(f,function(t){nt(z.select(t.inline,e),function(e){var r;if(!M(e)){if(t.wrap_links===!1){r=e.parentNode;do if("A"===r.nodeName)return;while(r=r.parentNode)}B(t,n,e,t.exact?e:null)}})}),v(e.parentNode,t,n))return z.remove(e,1),e=0,X;m.merge_with_parents&&z.getParent(e.parentNode,function(r){return v(r,t,n)?(z.remove(e,1),e=0,X):void 0}),e&&m.merge_siblings!==!1&&(e=H(L(e),e),e=H(e,L(e,X)))}})}var f=u(t),m=f[0],g,y,b=!r&&W.isCollapsed();if(m)if(r)r.nodeType?(y=z.createRng(),y.setStartBefore(r),y.setEndAfter(r),d(A(y,f),null,!0)):d(r,null,!0);else if(b&&m.inline&&!z.select("td.mce-item-selected,th.mce-item-selected").length)O("apply",t,n);else{var C=i.selection.getNode();$||!f[0].defaultBlock||z.getParent(C,z.isBlock)||h(f[0].defaultBlock),i.selection.setRng(l()),g=W.getBookmark(),d(A(W.getRng(X),f),g),m.styles&&(m.styles.color||m.styles.textDecoration)&&(it(C,p,"childNodes"),p(C)),W.moveToBookmark(g),I(W.getRng(X)),i.nodeChanged()}}function m(e,t,n){function r(e){var n,i,o,a,s;if(1===e.nodeType&&Z(e)&&(a=b,b="true"===Z(e),s=!0),n=rt(e.childNodes),b&&!s)for(i=0,o=p.length;o>i&&!B(p[i],t,e,e);i++);if(h.deep&&n.length){for(i=0,o=n.length;o>i;i++)r(n[i]);s&&(b=a)}}function o(n){var r;return nt(a(n.parentNode).reverse(),function(n){var i;r||"_start"==n.id||"_end"==n.id||(i=v(n,e,t),i&&i.split!==!1&&(r=n))}),r}function s(e,n,r,i){var o,a,s,l,c,u;if(e){for(u=e.parentNode,o=n.parentNode;o&&o!=u;o=o.parentNode){for(a=z.clone(o,Y),c=0;c<p.length;c++)if(B(p[c],t,a,a)){a=0;break}a&&(s&&a.appendChild(s),l||(l=a),s=a)}!i||h.mixed&&q(e)||(n=z.split(e,n)),s&&(r.parentNode.insertBefore(s,r),l.appendChild(r))}return n}function l(e){return s(o(e),e,e,!0)}function c(e){var t=z.get(e?"_start":"_end"),n=t[e?"firstChild":"lastChild"];return M(n)&&(n=n[e?"firstChild":"lastChild"]),z.remove(t,!0),n}function d(e){var t,n,o=e.commonAncestorContainer;e=A(e,p,X),h.split&&(t=P(e,X),n=P(e),t!=n?(/^(TR|TH|TD)$/.test(t.nodeName)&&t.firstChild&&(t="TR"==t.nodeName?t.firstChild.firstChild||t:t.firstChild||t),o&&/^T(HEAD|BODY|FOOT|R)$/.test(o.nodeName)&&/^(TH|TD)$/.test(n.nodeName)&&n.firstChild&&(n=n.firstChild||n),t=R(t,"span",{id:"_start","data-mce-type":"bookmark"}),n=R(n,"span",{id:"_end","data-mce-type":"bookmark"}),l(t),l(n),t=c(X),n=c()):t=n=l(t),e.startContainer=t.parentNode,e.startOffset=j(t),e.endContainer=n.parentNode,e.endOffset=j(n)+1),V.walk(e,function(e){nt(e,function(e){r(e),1===e.nodeType&&"underline"===i.dom.getStyle(e,"text-decoration")&&e.parentNode&&"underline"===f(e.parentNode)&&B({deep:!1,exact:!0,inline:"span",styles:{textDecoration:"underline"}},null,e)})})}var p=u(e),h=p[0],m,g,b=!0;return n?void(n.nodeType?(g=z.createRng(),g.setStartBefore(n),g.setEndAfter(n),d(g)):d(n)):void(W.isCollapsed()&&h.inline&&!z.select("td.mce-item-selected,th.mce-item-selected").length?O("remove",e,t):(m=W.getBookmark(),d(W.getRng(X)),W.moveToBookmark(m),h.inline&&y(e,t,W.getStart())&&I(W.getRng(!0)),i.nodeChanged()))}function g(e,t,n){var r=u(e);!y(e,t,n)||"toggle"in r[0]&&!r[0].toggle?h(e,t,n):m(e,t,n)}function v(e,t,n,r){function i(e,t,i){var o,a,s=t[i],l;if(t.onmatch)return t.onmatch(e,t,i);if(s)if(s.length===Q){for(o in s)if(s.hasOwnProperty(o)){if(a="attributes"===i?z.getAttrib(e,o):E(e,o),r&&!a&&!t.exact)return;if((!r||t.exact)&&!N(a,S(k(s[o],n),o)))return}}else for(l=0;l<s.length;l++)if("attributes"===i?z.getAttrib(e,s[l]):E(e,s[l]))return t;return t}var o=u(t),a,s,l;if(o&&e)for(s=0;s<o.length;s++)if(a=o[s],_(e,a)&&i(e,a,"attributes")&&i(e,a,"styles")){if(l=a.classes)for(s=0;s<l.length;s++)if(!z.hasClass(e,l[s]))return;return a}}function y(e,t,n){function r(n){var r=z.getRoot();return n===r?!1:(n=z.getParent(n,function(n){return n.parentNode===r||!!v(n,e,t,!0)}),v(n,e,t))}var i;return n?r(n):(n=W.getNode(),r(n)?X:(i=W.getStart(),i!=n&&r(i)?X:Y))}function b(e,t){var n,r=[],i={};return n=W.getStart(),z.getParent(n,function(n){var o,a;for(o=0;o<e.length;o++)a=e[o],!i[a]&&v(n,a,t)&&(i[a]=!0,r.push(a))},z.getRoot()),r}function C(e){var t=u(e),n,r,i,o,s;if(t)for(n=W.getStart(),r=a(n),o=t.length-1;o>=0;o--){if(s=t[o].selector,!s||t[o].defaultBlock)return X;for(i=r.length-1;i>=0;i--)if(z.is(r[i],s))return X}return Y}function x(e,t,n){var r;return J||(J={},r={},i.on("NodeChange",function(e){var t=a(e.element),n={};nt(J,function(e,i){nt(t,function(o){return v(o,i,{},e.similar)?(r[i]||(nt(e,function(e){e(!0,{node:o,format:i,parents:t})}),r[i]=e),n[i]=e,!1):void 0})}),nt(r,function(i,o){n[o]||(delete r[o],nt(i,function(n){n(!1,{node:e.element,format:o,parents:t})}))})})),nt(e.split(","),function(e){J[e]||(J[e]=[],J[e].similar=n),J[e].push(t)}),this}function w(e){return r.getCssText(i,e)}function _(e,t){return N(e,t.inline)?X:N(e,t.block)?X:t.selector?1==e.nodeType&&z.is(e,t.selector):void 0}function N(e,t){return e=e||"",t=t||"",e=""+(e.nodeName||e),t=""+(t.nodeName||t),e.toLowerCase()==t.toLowerCase()}function E(e,t){return S(z.getStyle(e,t),t)}function S(e,t){return("color"==t||"backgroundColor"==t)&&(e=z.toHex(e)),"fontWeight"==t&&700==e&&(e="bold"),"fontFamily"==t&&(e=e.replace(/[\'\"]/g,"").replace(/,\s+/g,",")),""+e}function k(e,t){return"string"!=typeof e?e=e(t):t&&(e=e.replace(/%(\w+)/g,function(e,n){return t[n]||e})),e}function T(e){return e&&3===e.nodeType&&/^([\t \r\n]+|)$/.test(e.nodeValue)}function R(e,t,n){var r=z.create(t,n);return e.parentNode.insertBefore(r,e),r.appendChild(e),r}function A(t,n,r){function s(e){function t(e){return"BR"==e.nodeName&&e.getAttribute("data-mce-bogus")&&!e.nextSibling}var r,i,o,a,s;if(r=i=e?g:y,a=e?"previousSibling":"nextSibling",s=z.getRoot(),3==r.nodeType&&!T(r)&&(e?v>0:b<r.nodeValue.length))return r;for(;;){if(!n[0].block_expand&&q(i))return i;for(o=i[a];o;o=o[a])if(!M(o)&&!T(o)&&!t(o))return i;if(i.parentNode==s){r=i;break}i=i.parentNode}return r}function l(e,t){for(t===Q&&(t=3===e.nodeType?e.length:e.childNodes.length);e&&e.hasChildNodes();)e=e.childNodes[t],e&&(t=3===e.nodeType?e.length:e.childNodes.length);return{node:e,offset:t}}function c(e){for(var t=e;t;){if(1===t.nodeType&&Z(t))return"false"===Z(t)?t:e;t=t.parentNode}return e}function u(t,n,o){function a(e,t){var n,i,a=e.nodeValue;return"undefined"==typeof t&&(t=o?a.length:0),o?(n=a.lastIndexOf(" ",t),i=a.lastIndexOf("\xa0",t),n=n>i?n:i,-1===n||r||n++):(n=a.indexOf(" ",t),i=a.indexOf("\xa0",t),n=-1!==n&&(-1===i||i>n)?n:i),n}var s,l,c,u;if(3===t.nodeType){if(c=a(t,n),-1!==c)return{container:t,offset:c};u=t}for(s=new e(t,z.getParent(t,q)||i.getBody());l=s[o?"prev":"next"]();)if(3===l.nodeType){if(u=l,c=a(l),-1!==c)return{container:l,offset:c}}else if(q(l))break;return u?(n=o?0:u.length,{container:u,offset:n}):void 0}function d(e,r){var i,o,s,l;for(3==e.nodeType&&0===e.nodeValue.length&&e[r]&&(e=e[r]),i=a(e),o=0;o<i.length;o++)for(s=0;s<n.length;s++)if(l=n[s],!("collapsed"in l&&l.collapsed!==t.collapsed)&&z.is(i[o],l.selector))return i[o];return e}function f(e,t){var r,i=z.getRoot();if(n[0].wrapper||(r=z.getParent(e,n[0].block,i)),r||(r=z.getParent(3==e.nodeType?e.parentNode:e,function(e){return e!=i&&o(e)})),r&&n[0].wrapper&&(r=a(r,"ul,ol").reverse()[0]||r),!r)for(r=e;r[t]&&!q(r[t])&&(r=r[t],!N(r,"br")););return r||e}var p,h,m,g=t.startContainer,v=t.startOffset,y=t.endContainer,b=t.endOffset;if(1==g.nodeType&&g.hasChildNodes()&&(p=g.childNodes.length-1,g=g.childNodes[v>p?p:v],3==g.nodeType&&(v=0)),1==y.nodeType&&y.hasChildNodes()&&(p=y.childNodes.length-1,y=y.childNodes[b>p?p:b-1],3==y.nodeType&&(b=y.nodeValue.length)),g=c(g),y=c(y),(M(g.parentNode)||M(g))&&(g=M(g)?g:g.parentNode,g=g.nextSibling||g,3==g.nodeType&&(v=0)),(M(y.parentNode)||M(y))&&(y=M(y)?y:y.parentNode,y=y.previousSibling||y,3==y.nodeType&&(b=y.length)),n[0].inline&&(t.collapsed&&(m=u(g,v,!0),m&&(g=m.container,v=m.offset),m=u(y,b),m&&(y=m.container,b=m.offset)),h=l(y,b),h.node)){for(;h.node&&0===h.offset&&h.node.previousSibling;)h=l(h.node.previousSibling);h.node&&h.offset>0&&3===h.node.nodeType&&" "===h.node.nodeValue.charAt(h.offset-1)&&h.offset>1&&(y=h.node,y.splitText(h.offset-1))}return(n[0].inline||n[0].block_expand)&&(n[0].inline&&3==g.nodeType&&0!==v||(g=s(!0)),n[0].inline&&3==y.nodeType&&b!==y.nodeValue.length||(y=s())),n[0].selector&&n[0].expand!==Y&&!n[0].inline&&(g=d(g,"previousSibling"),y=d(y,"nextSibling")),(n[0].block||n[0].selector)&&(g=f(g,"previousSibling"),y=f(y,"nextSibling"),n[0].block&&(q(g)||(g=s(!0)),q(y)||(y=s()))),1==g.nodeType&&(v=j(g),g=g.parentNode),1==y.nodeType&&(b=j(y)+1,y=y.parentNode),{startContainer:g,startOffset:v,endContainer:y,endOffset:b}}function B(e,t,n,r){var i,o,a;if(!_(n,e))return Y;if("all"!=e.remove)for(nt(e.styles,function(e,i){e=S(k(e,t),i),"number"==typeof i&&(i=e,r=0),(!r||N(E(r,i),e))&&z.setStyle(n,i,""),a=1}),a&&""===z.getAttrib(n,"style")&&(n.removeAttribute("style"),n.removeAttribute("data-mce-style")),nt(e.attributes,function(e,i){var o;if(e=k(e,t),"number"==typeof i&&(i=e,r=0),!r||N(z.getAttrib(r,i),e)){if("class"==i&&(e=z.getAttrib(n,i),e&&(o="",nt(e.split(/\s+/),function(e){/mce\w+/.test(e)&&(o+=(o?" ":"")+e)}),o)))return void z.setAttrib(n,i,o);"class"==i&&n.removeAttribute("className"),G.test(i)&&n.removeAttribute("data-mce-"+i),n.removeAttribute(i)}}),nt(e.classes,function(e){e=k(e,t),(!r||z.hasClass(r,e))&&z.removeClass(n,e)}),o=z.getAttribs(n),i=0;i<o.length;i++)if(0!==o[i].nodeName.indexOf("_"))return Y;return"none"!=e.remove?(D(n,e),X):void 0}function D(e,t){function n(e,t,n){return e=L(e,t,n),!e||"BR"==e.nodeName||q(e)}var r=e.parentNode,o;t.block&&($?r==z.getRoot()&&(t.list_block&&N(e,t.list_block)||nt(rt(e.childNodes),function(e){U($,e.nodeName.toLowerCase())?o?o.appendChild(e):(o=R(e,$),z.setAttribs(o,i.settings.forced_root_block_attrs)):o=0})):q(e)&&!q(r)&&(n(e,Y)||n(e.firstChild,X,1)||e.insertBefore(z.create("br"),e.firstChild),n(e,X)||n(e.lastChild,Y,1)||e.appendChild(z.create("br")))),t.selector&&t.inline&&!N(t.inline,e)||z.remove(e,1)}function L(e,t,n){if(e)for(t=t?"nextSibling":"previousSibling",e=n?e:e[t];e;e=e[t])if(1==e.nodeType||!T(e))return e}function M(e){return e&&1==e.nodeType&&"bookmark"==e.getAttribute("data-mce-type")}function H(e,t){function n(e,t){function n(e){var t={};return nt(z.getAttribs(e),function(n){var r=n.nodeName.toLowerCase();0!==r.indexOf("_")&&"style"!==r&&"data-mce-style"!==r&&(t[r]=z.getAttrib(e,r))}),t}function r(e,t){var n,r;for(r in e)if(e.hasOwnProperty(r)){if(n=t[r],n===Q)return Y;if(e[r]!=n)return Y;delete t[r]}for(r in t)if(t.hasOwnProperty(r))return Y;return X}return e.nodeName!=t.nodeName?Y:r(n(e),n(t))&&r(z.parseStyle(z.getAttrib(e,"style")),z.parseStyle(z.getAttrib(t,"style")))?!M(e)&&!M(t):Y}function r(e,t){for(i=e;i;i=i[t]){if(3==i.nodeType&&0!==i.nodeValue.length)return e;if(1==i.nodeType&&!M(i))return i}return e}var i,o;if(e&&t&&(e=r(e,"previousSibling"),t=r(t,"nextSibling"),n(e,t))){for(i=e.nextSibling;i&&i!=t;)o=i,i=i.nextSibling,e.appendChild(o);return z.remove(t),nt(rt(t.childNodes),function(t){e.appendChild(t)}),e}return t}function P(t,n){var r,o,a;return r=t[n?"startContainer":"endContainer"],o=t[n?"startOffset":"endOffset"],1==r.nodeType&&(a=r.childNodes.length-1,!n&&o&&o--,r=r.childNodes[o>a?a:o]),3===r.nodeType&&n&&o>=r.nodeValue.length&&(r=new e(r,i.getBody()).next()||r),3!==r.nodeType||n||0!==o||(r=new e(r,i.getBody()).prev()||r),r}function O(t,n,r){function a(e){var t=z.create("span",{id:y,"data-mce-bogus":!0,style:b?"color:red":""});return e&&t.appendChild(i.getDoc().createTextNode(K)),t}function s(e,t){for(;e;){if(3===e.nodeType&&e.nodeValue!==K||e.childNodes.length>1)return!1;t&&1===e.nodeType&&t.push(e),e=e.firstChild}return!0}function l(e){for(;e;){if(e.id===y)return e;e=e.parentNode}}function c(t){var n;if(t)for(n=new e(t,t),t=n.current();t;t=n.next())if(3===t.nodeType)return t}function d(e,t){var n,r;if(e)r=W.getRng(!0),s(e)?(t!==!1&&(r.setStartBefore(e),r.setEndBefore(e)),z.remove(e)):(n=c(e),n.nodeValue.charAt(0)===K&&(n=n.deleteData(0,1)),z.remove(e,1)),W.setRng(r);else if(e=l(W.getStart()),!e)for(;e=z.get(y);)d(e,!1)}function f(){var e,t,i,o,s,d,f;e=W.getRng(!0),o=e.startOffset,d=e.startContainer,f=d.nodeValue,t=l(W.getStart()),t&&(i=c(t)),f&&o>0&&o<f.length&&/\w/.test(f.charAt(o))&&/\w/.test(f.charAt(o-1))?(s=W.getBookmark(),e.collapse(!0),e=A(e,u(n)),e=V.split(e),h(n,r,e),W.moveToBookmark(s)):(t&&i.nodeValue===K?h(n,r,t):(t=a(!0),i=t.firstChild,e.insertNode(t),o=1,h(n,r,t)),W.setCursorLocation(i,o))}function p(){var e=W.getRng(!0),t,i,s,l,c,d,f=[],p,h;for(t=e.startContainer,i=e.startOffset,c=t,3==t.nodeType&&((i!=t.nodeValue.length||t.nodeValue===K)&&(l=!0),c=c.parentNode);c;){if(v(c,n,r)){d=c;break}c.nextSibling&&(l=!0),f.push(c),c=c.parentNode}if(d)if(l)s=W.getBookmark(),e.collapse(!0),e=A(e,u(n),!0),e=V.split(e),m(n,r,e),W.moveToBookmark(s);else{for(h=a(),c=h,p=f.length-1;p>=0;p--)c.appendChild(z.clone(f[p],!1)),c=c.firstChild;c.appendChild(z.doc.createTextNode(K)),c=c.firstChild;var g=z.getParent(d,o);g&&z.isEmpty(g)?d.parentNode.replaceChild(h,d):z.insertAfter(h,d),W.setCursorLocation(c,1),z.isEmpty(d)&&z.remove(d)}}function g(){var e;e=l(W.getStart()),e&&!z.isEmpty(e)&&it(e,function(e){1!=e.nodeType||e.id===y||z.isEmpty(e)||z.setAttrib(e,"data-mce-bogus",null)},"childNodes")}var y="_mce_caret",b=i.settings.caret_debug;i._hasCaretEvents||(tt=function(){var e=[],t;if(s(l(W.getStart()),e))for(t=e.length;t--;)z.setAttrib(e[t],"data-mce-bogus","1")},et=function(e){var t=e.keyCode;d(),(8==t||37==t||39==t)&&d(l(W.getStart())),g()},i.on("SetContent",function(e){e.selection&&g()}),i._hasCaretEvents=!0),"apply"==t?f():p()}function I(t){var n=t.startContainer,r=t.startOffset,i,o,a,s,l;if(3==n.nodeType&&r>=n.nodeValue.length&&(r=j(n),n=n.parentNode,i=!0),1==n.nodeType)for(s=n.childNodes,n=s[Math.min(r,s.length-1)],o=new e(n,z.getParent(n,z.isBlock)),(r>s.length-1||i)&&o.next(),a=o.current();a;a=o.next())if(3==a.nodeType&&!T(a))return l=z.create("a",null,K),a.parentNode.insertBefore(l,a),t.setStart(a,0),W.setRng(t),void z.remove(l)}var F={},z=i.dom,W=i.selection,V=new t(z),U=i.schema.isValidChild,q=z.isBlock,$=i.settings.forced_root_block,j=z.nodeIndex,K="\ufeff",G=/^(src|href|style)$/,Y=!1,X=!0,J,Q,Z=z.getContentEditable,et,tt,nt=n.each,rt=n.grep,it=n.walk,ot=n.extend;ot(this,{get:u,register:d,apply:h,remove:m,toggle:g,match:y,matchAll:b,matchNode:v,canApply:C,formatChanged:x,getCssText:w}),l(),c(),i.on("BeforeGetContent",function(){tt&&tt()}),i.on("mouseup keydown",function(e){et&&et(e)})}}),r(H,[g,p],function(e,t){var n=t.trim,r;return r=new RegExp(["<span[^>]+data-mce-bogus[^>]+>[\u200b\ufeff]+<\\/span>","<div[^>]+data-mce-bogus[^>]+><\\/div>",'\\s?data-mce-selected="[^"]+"'].join("|"),"gi"),function(t){function i(){return n(t.getContent({format:"raw",no_events:1}).replace(r,""))}function o(e){a.typing=!1,a.add({},e)}var a=this,s=0,l=[],c,u,d=0;return t.on("init",function(){a.add()}),t.on("BeforeExecCommand",function(e){var t=e.command;"Undo"!=t&&"Redo"!=t&&"mceRepaint"!=t&&a.beforeChange()}),t.on("ExecCommand",function(e){var t=e.command;"Undo"!=t&&"Redo"!=t&&"mceRepaint"!=t&&o(e)}),t.on("ObjectResizeStart",function(){a.beforeChange()}),t.on("SaveContent ObjectResized blur",o),t.on("DragEnd",o),t.on("KeyUp",function(n){var r=n.keyCode;(r>=33&&36>=r||r>=37&&40>=r||45==r||13==r||n.ctrlKey)&&(o(),t.nodeChanged()),(46==r||8==r||e.mac&&(91==r||93==r))&&t.nodeChanged(),u&&a.typing&&(t.isDirty()||(t.isNotDirty=!l[0]||i()==l[0].content,t.isNotDirty||t.fire("change",{level:l[0],lastLevel:null})),t.fire("TypingUndo"),u=!1,t.nodeChanged())}),t.on("KeyDown",function(e){var t=e.keyCode;return t>=33&&36>=t||t>=37&&40>=t||45==t?void(a.typing&&o(e)):void((16>t||t>20)&&224!=t&&91!=t&&!a.typing&&(a.beforeChange(),a.typing=!0,a.add({},e),u=!0))}),t.on("MouseDown",function(e){a.typing&&o(e)}),t.addShortcut("ctrl+z","","Undo"),t.addShortcut("ctrl+y,ctrl+shift+z","","Redo"),t.on("AddUndo Undo Redo ClearUndos MouseUp",function(e){e.isDefaultPrevented()||t.nodeChanged()}),a={data:l,typing:!1,beforeChange:function(){d||(c=t.selection.getBookmark(2,!0))},add:function(e,n){var r,o=t.settings,a;if(e=e||{},e.content=i(),d||t.removed)return null;if(a=l[s],t.fire("BeforeAddUndo",{level:e,lastLevel:a,originalEvent:n}).isDefaultPrevented())return null;if(a&&a.content==e.content)return null;if(l[s]&&(l[s].beforeBookmark=c),o.custom_undo_redo_levels&&l.length>o.custom_undo_redo_levels){for(r=0;r<l.length-1;r++)l[r]=l[r+1];l.length--,s=l.length}e.bookmark=t.selection.getBookmark(2,!0),s<l.length-1&&(l.length=s+1),l.push(e),s=l.length-1;var u={level:e,lastLevel:a,originalEvent:n};return t.fire("AddUndo",u),s>0&&(t.isNotDirty=!1,t.fire("change",u)),e},undo:function(){var e;return a.typing&&(a.add(),a.typing=!1),s>0&&(e=l[--s],0===s&&(t.isNotDirty=!0),t.setContent(e.content,{format:"raw"}),t.selection.moveToBookmark(e.beforeBookmark),t.fire("undo",{level:e})),e},redo:function(){var e;return s<l.length-1&&(e=l[++s],t.setContent(e.content,{format:"raw"}),t.selection.moveToBookmark(e.bookmark),t.fire("redo",{level:e})),e},clear:function(){l=[],s=0,a.typing=!1,t.fire("ClearUndos")},hasUndo:function(){return s>0||a.typing&&l[0]&&i()!=l[0].content},hasRedo:function(){return s<l.length-1&&!this.typing},transact:function(e){a.beforeChange();try{d++,e()}finally{d--}a.add()}}}}),r(P,[f,B,g],function(e,t,n){var r=n.ie&&n.ie<11;return function(i){function o(o){function f(e){return e&&a.isBlock(e)&&!/^(TD|TH|CAPTION|FORM)$/.test(e.nodeName)&&!/^(fixed|absolute)/i.test(e.style.position)&&"true"!==a.getContentEditable(e)}function p(e){var t;a.isBlock(e)&&(t=s.getRng(),e.appendChild(a.create("span",null,"\xa0")),s.select(e),e.lastChild.outerHTML="",s.setRng(t))}function h(e){for(var t=e,n=[],r;t=t.firstChild;){if(a.isBlock(t))return;1!=t.nodeType||d[t.nodeName.toLowerCase()]||n.push(t)}for(r=n.length;r--;)t=n[r],!t.hasChildNodes()||t.firstChild==t.lastChild&&""===t.firstChild.nodeValue?a.remove(t):"A"==t.nodeName&&" "===(t.innerText||t.textContent)&&a.remove(t)}function m(t){function r(e){for(;e;){if(1==e.nodeType||3==e.nodeType&&e.data&&/[\r\n\s]/.test(e.data))return e;e=e.nextSibling}}var i,o,l,c=t,u;if(n.ie&&n.ie<9&&B&&B.firstChild&&B.firstChild==B.lastChild&&"BR"==B.firstChild.tagName&&a.remove(B.firstChild),"LI"==t.nodeName){var f=r(t.firstChild);f&&/^(UL|OL)$/.test(f.nodeName)&&t.insertBefore(a.doc.createTextNode("\xa0"),t.firstChild)}if(l=a.createRng(),t.hasChildNodes()){for(i=new e(t,t);o=i.current();){if(3==o.nodeType){l.setStart(o,0),l.setEnd(o,0);break}if(d[o.nodeName.toLowerCase()]){l.setStartBefore(o),l.setEndBefore(o);break}c=o,o=i.next()}o||(l.setStart(c,0),l.setEnd(c,0))}else"BR"==t.nodeName?t.nextSibling&&a.isBlock(t.nextSibling)?((!D||9>D)&&(u=a.create("br"),t.parentNode.insertBefore(u,t)),l.setStartBefore(t),l.setEndBefore(t)):(l.setStartAfter(t),l.setEndAfter(t)):(l.setStart(t,0),l.setEnd(t,0));s.setRng(l),a.remove(u),s.scrollIntoView(t)}function g(e){var t=l.forced_root_block;t&&t.toLowerCase()===e.tagName.toLowerCase()&&a.setAttribs(e,l.forced_root_block_attrs)}function v(e){var t=R,n,i,o;if(e||"TABLE"==O?(n=a.create(e||F),g(n)):n=B.cloneNode(!1),o=n,l.keep_styles!==!1)do if(/^(SPAN|STRONG|B|EM|I|FONT|STRIKE|U|VAR|CITE|DFN|CODE|MARK|Q|SUP|SUB|SAMP)$/.test(t.nodeName)){if("_mce_caret"==t.id)continue;i=t.cloneNode(!1),a.setAttrib(i,"id",""),n.hasChildNodes()?(i.appendChild(n.firstChild),n.appendChild(i)):(o=i,n.appendChild(i))}while(t=t.parentNode);return r||(o.innerHTML='<br data-mce-bogus="1">'),n}function y(t){var n,r,i;if(3==R.nodeType&&(t?A>0:A<R.nodeValue.length))return!1;if(R.parentNode==B&&z&&!t)return!0;if(t&&1==R.nodeType&&R==B.firstChild)return!0;if("TABLE"===R.nodeName||R.previousSibling&&"TABLE"==R.previousSibling.nodeName)return z&&!t||!z&&t;for(n=new e(R,B),3==R.nodeType&&(t&&0===A?n.prev():t||A!=R.nodeValue.length||n.next());r=n.current();){if(1===r.nodeType){if(!r.getAttribute("data-mce-bogus")&&(i=r.nodeName.toLowerCase(),d[i]&&"br"!==i))return!1}else if(3===r.nodeType&&!/^[ \t\r\n]*$/.test(r.nodeValue))return!1;t?n.prev():n.next()}return!0}function b(e,t){var n,r,o,s,l,c,d=F||"P";if(r=a.getParent(e,a.isBlock),c=i.getBody().nodeName.toLowerCase(),!r||!f(r)){if(r=r||T,!r.hasChildNodes())return n=a.create(d),g(n),r.appendChild(n),S.setStart(n,0),S.setEnd(n,0),n;for(s=e;s.parentNode!=r;)s=s.parentNode;for(;s&&!a.isBlock(s);)o=s,s=s.previousSibling;if(o&&u.isValidChild(c,d.toLowerCase())){for(n=a.create(d),g(n),o.parentNode.insertBefore(n,o),s=o;s&&!a.isBlock(s);)l=s.nextSibling,n.appendChild(s),s=l;S.setStart(e,t),S.setEnd(e,t)}}return e}function C(){function e(e){for(var t=P[e?"firstChild":"lastChild"];t&&1!=t.nodeType;)t=t[e?"nextSibling":"previousSibling"];return t===B}function t(){var e=P.parentNode;return"LI"==e.nodeName?e:P}var n=P.parentNode.nodeName;/^(OL|UL|LI)$/.test(n)&&(F="LI"),M=F?v(F):a.create("BR"),e(!0)&&e()?"LI"==n?a.insertAfter(M,t()):a.replace(M,P):e(!0)?"LI"==n?(a.insertAfter(M,t()),M.appendChild(a.doc.createTextNode(" ")),M.appendChild(P)):P.parentNode.insertBefore(M,P):e()?(a.insertAfter(M,t()),p(M)):(P=t(),k=S.cloneRange(),k.setStartAfter(B),k.setEndAfter(P),H=k.extractContents(),"LI"==F&&"LI"==H.firstChild.nodeName?(M=H.firstChild,a.insertAfter(H,P)):(a.insertAfter(H,P),a.insertAfter(M,P))),a.remove(B),m(M),c.add()}function x(){for(var t=new e(R,B),n;n=t.next();)if(d[n.nodeName.toLowerCase()]||n.length>0)return!0}function w(){var e,t,n;R&&3==R.nodeType&&A>=R.nodeValue.length&&(r||x()||(e=a.create("br"),S.insertNode(e),S.setStartAfter(e),S.setEndAfter(e),t=!0)),e=a.create("br"),S.insertNode(e),r&&"PRE"==O&&(!D||8>D)&&e.parentNode.insertBefore(a.doc.createTextNode("\r"),e),n=a.create("span",{}," "),e.parentNode.insertBefore(n,e),s.scrollIntoView(n),a.remove(n),t?(S.setStartBefore(e),S.setEndBefore(e)):(S.setStartAfter(e),S.setEndAfter(e)),s.setRng(S),c.add()}function _(e){do 3===e.nodeType&&(e.nodeValue=e.nodeValue.replace(/^[\r\n]+/,"")),e=e.firstChild;while(e)}function N(e){var t=a.getRoot(),n,r;for(n=e;n!==t&&"false"!==a.getContentEditable(n);)"true"===a.getContentEditable(n)&&(r=n),n=n.parentNode;return n!==t?r:t}function E(e){var t;r||(e.normalize(),t=e.lastChild,(!t||/^(left|right)$/gi.test(a.getStyle(t,"float",!0)))&&a.add(e,"br"))}var S,k,T,R,A,B,D,L,M,H,P,O,I,F,z;if(S=s.getRng(!0),!o.isDefaultPrevented()){if(!S.collapsed)return void i.execCommand("Delete");if(new t(a).normalize(S),R=S.startContainer,A=S.startOffset,F=(l.force_p_newlines?"p":"")||l.forced_root_block,F=F?F.toUpperCase():"",D=a.doc.documentMode,L=o.shiftKey,1==R.nodeType&&R.hasChildNodes()&&(z=A>R.childNodes.length-1,R=R.childNodes[Math.min(A,R.childNodes.length-1)]||R,A=z&&3==R.nodeType?R.nodeValue.length:0),T=N(R)){if(c.beforeChange(),!a.isBlock(T)&&T!=a.getRoot())return void((!F||L)&&w());if((F&&!L||!F&&L)&&(R=b(R,A)),B=a.getParent(R,a.isBlock),P=B?a.getParent(B.parentNode,a.isBlock):null,O=B?B.nodeName.toUpperCase():"",I=P?P.nodeName.toUpperCase():"","LI"!=I||o.ctrlKey||(B=P,O=I),"LI"==O){if(!F&&L)return void w();if(a.isEmpty(B))return void C()}if("PRE"==O&&l.br_in_pre!==!1){if(!L)return void w()}else if(!F&&!L&&"LI"!=O||F&&L)return void w();F&&B===i.getBody()||(F=F||"P",y()?(M=/^(H[1-6]|PRE|FIGURE)$/.test(O)&&"HGROUP"!=I?v(F):v(),l.end_container_on_empty_block&&f(P)&&a.isEmpty(B)?M=a.split(P,B):a.insertAfter(M,B),m(M)):y(!0)?(M=B.parentNode.insertBefore(v(),B),p(M),m(B)):(k=S.cloneRange(),k.setEndAfter(B),H=k.extractContents(),_(H),M=H.firstChild,a.insertAfter(H,B),h(M),E(B),m(M)),a.setAttrib(M,"id",""),i.fire("NewBlock",{newBlock:M}),c.add())}}}var a=i.dom,s=i.selection,l=i.settings,c=i.undoManager,u=i.schema,d=u.getNonEmptyElements();i.on("keydown",function(e){13==e.keyCode&&o(e)!==!1&&e.preventDefault()})}}),r(O,[],function(){return function(e){function t(){var t=i.getStart(),s=e.getBody(),l,c,u,d,f,p,h,m=-16777215,g,v,y,b,C;if(C=n.forced_root_block,t&&1===t.nodeType&&C){for(;t&&t!=s;){if(a[t.nodeName])return;t=t.parentNode}if(l=i.getRng(),l.setStart){c=l.startContainer,u=l.startOffset,d=l.endContainer,f=l.endOffset;try{v=e.getDoc().activeElement===s}catch(x){}}else l.item&&(t=l.item(0),l=e.getDoc().body.createTextRange(),l.moveToElementText(t)),v=l.parentElement().ownerDocument===e.getDoc(),y=l.duplicate(),y.collapse(!0),u=-1*y.move("character",m),y.collapsed||(y=l.duplicate(),y.collapse(!1),f=-1*y.move("character",m)-u);for(t=s.firstChild,b=s.nodeName.toLowerCase();t;)if((3===t.nodeType||1==t.nodeType&&!a[t.nodeName])&&o.isValidChild(b,C.toLowerCase())){if(3===t.nodeType&&0===t.nodeValue.length){h=t,t=t.nextSibling,r.remove(h);continue}p||(p=r.create(C,e.settings.forced_root_block_attrs),t.parentNode.insertBefore(p,t),g=!0),h=t,t=t.nextSibling,p.appendChild(h)}else p=null,t=t.nextSibling;if(g&&v){if(l.setStart)l.setStart(c,u),l.setEnd(d,f),i.setRng(l);else try{l=e.getDoc().body.createTextRange(),l.moveToElementText(s),l.collapse(!0),l.moveStart("character",u),f>0&&l.moveEnd("character",f),l.select()}catch(x){}e.nodeChanged()}}}var n=e.settings,r=e.dom,i=e.selection,o=e.schema,a=o.getBlockElements();n.forced_root_block&&e.on("NodeChange",t)}}),r(I,[S,g,p],function(e,n,r){var i=r.each,o=r.extend,a=r.map,s=r.inArray,l=r.explode,c=n.gecko,u=n.ie,d=!0,f=!1;return function(r){function p(e,t,n){var r;return e=e.toLowerCase(),(r=N.exec[e])?(r(e,t,n),d):f}function h(e){var t;return e=e.toLowerCase(),(t=N.state[e])?t(e):-1}function m(e){var t;return e=e.toLowerCase(),(t=N.value[e])?t(e):f}function g(e,t){t=t||"exec",i(e,function(e,n){i(n.toLowerCase().split(","),function(n){N[t][n]=e})})}function v(e,n,i){return n===t&&(n=f),i===t&&(i=null),r.getDoc().execCommand(e,n,i)}function y(e){return S.match(e)}function b(e,n){S.toggle(e,n?{value:n}:t),r.nodeChanged()}function C(e){k=_.getBookmark(e)}function x(){_.moveToBookmark(k)}var w=r.dom,_=r.selection,N={state:{},exec:{},value:{}},E=r.settings,S=r.formatter,k;o(this,{execCommand:p,queryCommandState:h,queryCommandValue:m,addCommands:g}),g({"mceResetDesignMode,mceBeginUndoLevel":function(){},"mceEndUndoLevel,mceAddUndoLevel":function(){r.undoManager.add()},"Cut,Copy,Paste":function(e){var t=r.getDoc(),i;try{v(e)}catch(o){i=d}if(i||!t.queryCommandSupported(e)){var a=r.translate("Your browser doesn't support direct access to the clipboard. Please use the Ctrl+X/C/V keyboard shortcuts instead.");n.mac&&(a=a.replace(/Ctrl\+/g,"\u2318+")),r.windowManager.alert(a)}},unlink:function(){if(_.isCollapsed()){var e=_.getNode();return void("A"==e.tagName&&r.dom.remove(e,!0))}S.remove("link")},"JustifyLeft,JustifyCenter,JustifyRight,JustifyFull":function(e){var t=e.substring(7);"full"==t&&(t="justify"),i("left,center,right,justify".split(","),function(e){t!=e&&S.remove("align"+e)}),b("align"+t),p("mceRepaint")},"InsertUnorderedList,InsertOrderedList":function(e){var t,n;v(e),t=w.getParent(_.getNode(),"ol,ul"),t&&(n=t.parentNode,/^(H[1-6]|P|ADDRESS|PRE)$/.test(n.nodeName)&&(C(),w.split(n,t),x()))},"Bold,Italic,Underline,Strikethrough,Superscript,Subscript":function(e){b(e)},"ForeColor,HiliteColor,FontName":function(e,t,n){b(e,n)},FontSize:function(e,t,n){var r,i;n>=1&&7>=n&&(i=l(E.font_size_style_values),r=l(E.font_size_classes),n=r?r[n-1]||n:i[n-1]||n),b(e,n)},RemoveFormat:function(e){S.remove(e)},mceBlockQuote:function(){b("blockquote")},FormatBlock:function(e,t,n){return b(n||"p")},mceCleanup:function(){var e=_.getBookmark();r.setContent(r.getContent({cleanup:d}),{cleanup:d}),_.moveToBookmark(e)},mceRemoveNode:function(e,t,n){var i=n||_.getNode();i!=r.getBody()&&(C(),r.dom.remove(i,d),x())},mceSelectNodeDepth:function(e,t,n){var i=0;w.getParent(_.getNode(),function(e){return 1==e.nodeType&&i++==n?(_.select(e),f):void 0},r.getBody())},mceSelectNode:function(e,t,n){_.select(n)},mceInsertContent:function(t,n,i){function o(e){function t(e){return r[e]&&3==r[e].nodeType}var n,r,i;return n=_.getRng(!0),r=n.startContainer,i=n.startOffset,3==r.nodeType&&(i>0?e=e.replace(/^ /," "):t("previousSibling")||(e=e.replace(/^ /," ")),i<r.length?e=e.replace(/ (<br>|)$/," "):t("nextSibling")||(e=e.replace(/( | )(<br>|)$/," "))),e}var a,s,l,c,d,f,p,h,m,g,v;/^ | $/.test(i)&&(i=o(i)),a=r.parser,s=new e({},r.schema),v='<span id="mce_marker" data-mce-type="bookmark">ÈB;</span>',f={content:i,format:"html",selection:!0},r.fire("BeforeSetContent",f),i=f.content,-1==i.indexOf("{$caret}")&&(i+="{$caret}"),i=i.replace(/\{\$caret\}/,v),h=_.getRng();var y=h.startContainer||(h.parentElement?h.parentElement():null),b=r.getBody();y===b&&_.isCollapsed()&&w.isBlock(b.firstChild)&&w.isEmpty(b.firstChild)&&(h=w.createRng(),h.setStart(b.firstChild,0),h.setEnd(b.firstChild,0),_.setRng(h)),_.isCollapsed()||r.getDoc().execCommand("Delete",!1,null),l=_.getNode();var C={context:l.nodeName.toLowerCase()};if(d=a.parse(i,C),m=d.lastChild,"mce_marker"==m.attr("id"))for(p=m,m=m.prev;m;m=m.walk(!0))if(3==m.type||!w.isBlock(m.name)){m.parent.insert(p,m,"br"===m.name);break}if(C.invalid){for(_.setContent(v),l=_.getNode(),c=r.getBody(),9==l.nodeType?l=m=c:m=l;m!==c;)l=m,m=m.parentNode;i=l==c?c.innerHTML:w.getOuterHTML(l),i=s.serialize(a.parse(i.replace(/<span (id="mce_marker"|id=mce_marker).+?<\/span>/i,function(){return s.serialize(d)}))),l==c?w.setHTML(c,i):w.setOuterHTML(l,i)}else i=s.serialize(d),m=l.firstChild,g=l.lastChild,!m||m===g&&"BR"===m.nodeName?w.setHTML(l,i):_.setContent(i);p=w.get("mce_marker"),_.scrollIntoView(p),h=w.createRng(),m=p.previousSibling,m&&3==m.nodeType?(h.setStart(m,m.nodeValue.length),u||(g=p.nextSibling,g&&3==g.nodeType&&(m.appendData(g.data),g.parentNode.removeChild(g)))):(h.setStartBefore(p),h.setEndBefore(p)),w.remove(p),_.setRng(h),r.fire("SetContent",f),r.addVisual()},mceInsertRawHTML:function(e,t,n){_.setContent("tiny_mce_marker"),r.setContent(r.getContent().replace(/tiny_mce_marker/g,function(){return n}))},mceToggleFormat:function(e,t,n){b(n)},mceSetContent:function(e,t,n){r.setContent(n)},"Indent,Outdent":function(e){var t,n,o;t=E.indentation,n=/[a-z%]+$/i.exec(t),t=parseInt(t,10),h("InsertUnorderedList")||h("InsertOrderedList")?v(e):(E.forced_root_block||w.getParent(_.getNode(),w.isBlock)||S.apply("div"),i(_.getSelectedBlocks(),function(i){if("LI"!=i.nodeName){var a=r.getParam("indent_use_margin",!1)?"margin":"padding";a+="rtl"==w.getStyle(i,"direction",!0)?"Right":"Left","outdent"==e?(o=Math.max(0,parseInt(i.style[a]||0,10)-t),w.setStyle(i,a,o?o+n:"")):(o=parseInt(i.style[a]||0,10)+t+n,w.setStyle(i,a,o))}}))},mceRepaint:function(){if(c)try{C(d),_.getSel()&&_.getSel().selectAllChildren(r.getBody()),_.collapse(d),x()}catch(e){}},InsertHorizontalRule:function(){r.execCommand("mceInsertContent",!1,"<hr />")},mceToggleVisualAid:function(){r.hasVisual=!r.hasVisual,r.addVisual()},mceReplaceContent:function(e,t,n){r.execCommand("mceInsertContent",!1,n.replace(/\{\$selection\}/g,_.getContent({format:"text"})))},mceInsertLink:function(e,t,n){var r;"string"==typeof n&&(n={href:n}),r=w.getParent(_.getNode(),"a"),n.href=n.href.replace(" ","%20"),r&&n.href||S.remove("link"),n.href&&S.apply("link",n,r)},selectAll:function(){var e=w.getRoot(),t;_.getRng().setStart?(t=w.createRng(),t.setStart(e,0),t.setEnd(e,e.childNodes.length),_.setRng(t)):(t=_.getRng(),t.item||(t.moveToElementText(e),t.select()))},"delete":function(){v("Delete");var e=r.getBody();w.isEmpty(e)&&(r.setContent(""),e.firstChild&&w.isBlock(e.firstChild)?r.selection.setCursorLocation(e.firstChild,0):r.selection.setCursorLocation(e,0))},mceNewDocument:function(){r.setContent("")}}),g({"JustifyLeft,JustifyCenter,JustifyRight,JustifyFull":function(e){var t="align"+e.substring(7),n=_.isCollapsed()?[w.getParent(_.getNode(),w.isBlock)]:_.getSelectedBlocks(),r=a(n,function(e){return!!S.matchNode(e,t)});return-1!==s(r,d)},"Bold,Italic,Underline,Strikethrough,Superscript,Subscript":function(e){return y(e)},mceBlockQuote:function(){return y("blockquote")},Outdent:function(){var e;if(E.inline_styles){if((e=w.getParent(_.getStart(),w.isBlock))&&parseInt(e.style.paddingLeft,10)>0)return d;if((e=w.getParent(_.getEnd(),w.isBlock))&&parseInt(e.style.paddingLeft,10)>0)return d +}return h("InsertUnorderedList")||h("InsertOrderedList")||!E.inline_styles&&!!w.getParent(_.getNode(),"BLOCKQUOTE")},"InsertUnorderedList,InsertOrderedList":function(e){var t=w.getParent(_.getNode(),"ul,ol");return t&&("insertunorderedlist"===e&&"UL"===t.tagName||"insertorderedlist"===e&&"OL"===t.tagName)}},"state"),g({"FontSize,FontName":function(e){var t=0,n;return(n=w.getParent(_.getNode(),"span"))&&(t="fontsize"==e?n.style.fontSize:n.style.fontFamily.replace(/, /g,",").replace(/[\'\"]/g,"").toLowerCase()),t}},"value"),g({Undo:function(){r.undoManager.undo()},Redo:function(){r.undoManager.redo()}})}}),r(F,[p],function(e){function t(e,i){var o=this,a,s;if(e=r(e),i=o.settings=i||{},/^([\w\-]+):([^\/]{2})/i.test(e)||/^\s*#/.test(e))return void(o.source=e);var l=0===e.indexOf("//");0!==e.indexOf("/")||l||(e=(i.base_uri?i.base_uri.protocol||"http":"http")+"://mce_host"+e),/^[\w\-]*:?\/\//.test(e)||(s=i.base_uri?i.base_uri.path:new t(location.href).directory,e=""===i.base_uri.protocol?"//mce_host"+o.toAbsPath(s,e):(i.base_uri&&i.base_uri.protocol||"http")+"://mce_host"+o.toAbsPath(s,e)),e=e.replace(/@@/g,"(mce_at)"),e=/^(?:(?![^:@]+:[^:@\/]*@)([^:\/?#.]+):)?(?:\/\/)?((?:(([^:@\/]*):?([^:@\/]*))?@)?([^:\/?#]*)(?::(\d*))?)(((\/(?:[^?#](?![^?#\/]*\.[^?#\/.]+(?:[?#]|$)))*\/?)?([^?#\/]*))(?:\?([^#]*))?(?:#(.*))?)/.exec(e),n(["source","protocol","authority","userInfo","user","password","host","port","relative","path","directory","file","query","anchor"],function(t,n){var r=e[n];r&&(r=r.replace(/\(mce_at\)/g,"@@")),o[t]=r}),a=i.base_uri,a&&(o.protocol||(o.protocol=a.protocol),o.userInfo||(o.userInfo=a.userInfo),o.port||"mce_host"!==o.host||(o.port=a.port),o.host&&"mce_host"!==o.host||(o.host=a.host),o.source=""),l&&(o.protocol="")}var n=e.each,r=e.trim,i={ftp:21,http:80,https:443,mailto:25};return t.prototype={setPath:function(e){var t=this;e=/^(.*?)\/?(\w+)?$/.exec(e),t.path=e[0],t.directory=e[1],t.file=e[2],t.source="",t.getURI()},toRelative:function(e){var n=this,r;if("./"===e)return e;if(e=new t(e,{base_uri:n}),"mce_host"!=e.host&&n.host!=e.host&&e.host||n.port!=e.port||n.protocol!=e.protocol&&""!==e.protocol)return e.getURI();var i=n.getURI(),o=e.getURI();return i==o||"/"==i.charAt(i.length-1)&&i.substr(0,i.length-1)==o?i:(r=n.toRelPath(n.path,e.path),e.query&&(r+="?"+e.query),e.anchor&&(r+="#"+e.anchor),r)},toAbsolute:function(e,n){return e=new t(e,{base_uri:this}),e.getURI(n&&this.isSameOrigin(e))},isSameOrigin:function(e){if(this.host==e.host&&this.protocol==e.protocol){if(this.port==e.port)return!0;var t=i[this.protocol];if(t&&(this.port||t)==(e.port||t))return!0}return!1},toRelPath:function(e,t){var n,r=0,i="",o,a;if(e=e.substring(0,e.lastIndexOf("/")),e=e.split("/"),n=t.split("/"),e.length>=n.length)for(o=0,a=e.length;a>o;o++)if(o>=n.length||e[o]!=n[o]){r=o+1;break}if(e.length<n.length)for(o=0,a=n.length;a>o;o++)if(o>=e.length||e[o]!=n[o]){r=o+1;break}if(1===r)return t;for(o=0,a=e.length-(r-1);a>o;o++)i+="../";for(o=r-1,a=n.length;a>o;o++)i+=o!=r-1?"/"+n[o]:n[o];return i},toAbsPath:function(e,t){var r,i=0,o=[],a,s;for(a=/\/$/.test(t)?"/":"",e=e.split("/"),t=t.split("/"),n(e,function(e){e&&o.push(e)}),e=o,r=t.length-1,o=[];r>=0;r--)0!==t[r].length&&"."!==t[r]&&(".."!==t[r]?i>0?i--:o.push(t[r]):i++);return r=e.length-i,s=0>=r?o.reverse().join("/"):e.slice(0,r).join("/")+"/"+o.reverse().join("/"),0!==s.indexOf("/")&&(s="/"+s),a&&s.lastIndexOf("/")!==s.length-1&&(s+=a),s},getURI:function(e){var t,n=this;return(!n.source||e)&&(t="",e||(t+=n.protocol?n.protocol+"://":"//",n.userInfo&&(t+=n.userInfo+"@"),n.host&&(t+=n.host),n.port&&(t+=":"+n.port)),n.path&&(t+=n.path),n.query&&(t+="?"+n.query),n.anchor&&(t+="#"+n.anchor),n.source=t),n.source}},t}),r(z,[p],function(e){function t(){}var n=e.each,r=e.extend,i,o;return t.extend=i=function(e){function t(){var e,t,n,r=this;if(!o&&(r.init&&r.init.apply(r,arguments),t=r.Mixins))for(e=t.length;e--;)n=t[e],n.init&&n.init.apply(r,arguments)}function a(){return this}function s(e,t){return function(){var n=this,r=n._super,i;return n._super=c[e],i=t.apply(n,arguments),n._super=r,i}}var l=this,c=l.prototype,u,d,f;o=!0,u=new l,o=!1,e.Mixins&&(n(e.Mixins,function(t){t=t;for(var n in t)"init"!==n&&(e[n]=t[n])}),c.Mixins&&(e.Mixins=c.Mixins.concat(e.Mixins))),e.Methods&&n(e.Methods.split(","),function(t){e[t]=a}),e.Properties&&n(e.Properties.split(","),function(t){var n="_"+t;e[t]=function(e){var t=this,r;return e!==r?(t[n]=e,t):t[n]}}),e.Statics&&n(e.Statics,function(e,n){t[n]=e}),e.Defaults&&c.Defaults&&(e.Defaults=r({},c.Defaults,e.Defaults));for(d in e)f=e[d],u[d]="function"==typeof f&&c[d]?s(d,f):f;return t.prototype=u,t.constructor=t,t.extend=i,t},t}),r(W,[p],function(e){function t(e){function t(){return!1}function n(){return!0}function r(r,i){var o,a,s,u;if(r=r.toLowerCase(),i=i||{},i.type=r,i.target||(i.target=l),i.preventDefault||(i.preventDefault=function(){i.isDefaultPrevented=n},i.stopPropagation=function(){i.isPropagationStopped=n},i.stopImmediatePropagation=function(){i.isImmediatePropagationStopped=n},i.isDefaultPrevented=t,i.isPropagationStopped=t,i.isImmediatePropagationStopped=t),e.beforeFire&&e.beforeFire(i),o=c[r])for(a=0,s=o.length;s>a;a++){if(o[a]=u=o[a],i.isImmediatePropagationStopped())return i.stopPropagation(),i;if(u.call(l,i)===!1)return i.preventDefault(),i}return i}function i(e,n,r){var i,o,a;if(n===!1&&(n=t),n)for(o=e.toLowerCase().split(" "),a=o.length;a--;)e=o[a],i=c[e],i||(i=c[e]=[],u(e,!0)),r?i.unshift(n):i.push(n);return s}function o(e,t){var n,r,i,o,a;if(e)for(o=e.toLowerCase().split(" "),n=o.length;n--;){if(e=o[n],r=c[e],!e){for(i in c)u(i,!1),delete c[i];return s}if(r){if(t)for(a=r.length;a--;)r[a]===t&&r.splice(a,1);else r.length=0;r.length||(u(e,!1),delete c[e])}}else{for(e in c)u(e,!1);c={}}return s}function a(e){return e=e.toLowerCase(),!(!c[e]||0===c[e].length)}var s=this,l,c={},u;e=e||{},l=e.scope||s,u=e.toggleEvent||t,s.fire=r,s.on=i,s.off=o,s.has=a}var n=e.makeMap("focus blur focusin focusout click dblclick mousedown mouseup mousemove mouseover beforepaste paste cut copy selectionchange mouseout mouseenter mouseleave wheel keydown keypress keyup input contextmenu dragstart dragend dragover draggesture dragdrop drop drag submit"," ");return t.isNative=function(e){return!!n[e.toLowerCase()]},t}),r(V,[z],function(e){function t(e){for(var t=[],n=e.length,r;n--;)r=e[n],r.__checked||(t.push(r),r.__checked=1);for(n=t.length;n--;)delete t[n].__checked;return t}var n=/^([\w\\*]+)?(?:#([\w\\]+))?(?:\.([\w\\\.]+))?(?:\[\@?([\w\\]+)([\^\$\*!~]?=)([\w\\]+)\])?(?:\:(.+))?/i,r=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,i=/^\s*|\s*$/g,o,a=e.extend({init:function(e){function t(e){return e?(e=e.toLowerCase(),function(t){return"*"===e||t.type===e}):void 0}function o(e){return e?function(t){return t._name===e}:void 0}function a(e){return e?(e=e.split("."),function(t){for(var n=e.length;n--;)if(!t.hasClass(e[n]))return!1;return!0}):void 0}function s(e,t,n){return e?function(r){var i=r[e]?r[e]():"";return t?"="===t?i===n:"*="===t?i.indexOf(n)>=0:"~="===t?(" "+i+" ").indexOf(" "+n+" ")>=0:"!="===t?i!=n:"^="===t?0===i.indexOf(n):"$="===t?i.substr(i.length-n.length)===n:!1:!!n}:void 0}function l(e){var t;return e?(e=/(?:not\((.+)\))|(.+)/i.exec(e),e[1]?(t=u(e[1],[]),function(e){return!d(e,t)}):(e=e[2],function(t,n,r){return"first"===e?0===n:"last"===e?n===r-1:"even"===e?n%2===0:"odd"===e?n%2===1:t[e]?t[e]():!1})):void 0}function c(e,r,c){function u(e){e&&r.push(e)}var d;return d=n.exec(e.replace(i,"")),u(t(d[1])),u(o(d[2])),u(a(d[3])),u(s(d[4],d[5],d[6])),u(l(d[7])),r.psuedo=!!d[7],r.direct=c,r}function u(e,t){var n=[],i,o,a;do if(r.exec(""),o=r.exec(e),o&&(e=o[3],n.push(o[1]),o[2])){i=o[3];break}while(o);for(i&&u(i,t),e=[],a=0;a<n.length;a++)">"!=n[a]&&e.push(c(n[a],[],">"===n[a-1]));return t.push(e),t}var d=this.match;this._selectors=u(e,[])},match:function(e,t){var n,r,i,o,a,s,l,c,u,d,f,p,h;for(t=t||this._selectors,n=0,r=t.length;r>n;n++){for(a=t[n],o=a.length,h=e,p=0,i=o-1;i>=0;i--)for(c=a[i];h;){if(c.psuedo)for(f=h.parent().items(),u=d=f.length;u--&&f[u]!==h;);for(s=0,l=c.length;l>s;s++)if(!c[s](h,u,d)){s=l+1;break}if(s===l){p++;break}if(i===o-1)break;h=h.parent()}if(p===o)return!0}return!1},find:function(e){function n(e,t,i){var o,a,s,l,c,u=t[i];for(o=0,a=e.length;a>o;o++){for(c=e[o],s=0,l=u.length;l>s;s++)if(!u[s](c,o,a)){s=l+1;break}if(s===l)i==t.length-1?r.push(c):c.items&&n(c.items(),t,i+1);else if(u.direct)return;c.items&&n(c.items(),t,i)}}var r=[],i,s,l=this._selectors;if(e.items){for(i=0,s=l.length;s>i;i++)n(e.items(),l[i],0);s>1&&(r=t(r))}return o||(o=a.Collection),new o(r)}});return a}),r(U,[p,V,z],function(e,t,n){var r,i,o=Array.prototype.push,a=Array.prototype.slice;return i={length:0,init:function(e){e&&this.add(e)},add:function(t){var n=this;return e.isArray(t)?o.apply(n,t):t instanceof r?n.add(t.toArray()):o.call(n,t),n},set:function(e){var t=this,n=t.length,r;for(t.length=0,t.add(e),r=t.length;n>r;r++)delete t[r];return t},filter:function(e){var n=this,i,o,a=[],s,l;for("string"==typeof e?(e=new t(e),l=function(t){return e.match(t)}):l=e,i=0,o=n.length;o>i;i++)s=n[i],l(s)&&a.push(s);return new r(a)},slice:function(){return new r(a.apply(this,arguments))},eq:function(e){return-1===e?this.slice(e):this.slice(e,+e+1)},each:function(t){return e.each(this,t),this},toArray:function(){return e.toArray(this)},indexOf:function(e){for(var t=this,n=t.length;n--&&t[n]!==e;);return n},reverse:function(){return new r(e.toArray(this).reverse())},hasClass:function(e){return this[0]?this[0].hasClass(e):!1},prop:function(e,t){var n=this,r,i;return t!==r?(n.each(function(n){n[e]&&n[e](t)}),n):(i=n[0],i&&i[e]?i[e]():void 0)},exec:function(t){var n=this,r=e.toArray(arguments).slice(1);return n.each(function(e){e[t]&&e[t].apply(e,r)}),n},remove:function(){for(var e=this.length;e--;)this[e].remove();return this}},e.each("fire on off show hide addClass removeClass append prepend before after reflow".split(" "),function(t){i[t]=function(){var n=e.toArray(arguments);return this.each(function(e){t in e&&e[t].apply(e,n)}),this}}),e.each("text name disabled active selected checked visible parent value data".split(" "),function(e){i[e]=function(t){return this.prop(e,t)}}),r=n.extend(i),t.Collection=r,r}),r(q,[p,y],function(e,t){return{id:function(){return t.DOM.uniqueId()},createFragment:function(e){return t.DOM.createFragment(e)},getWindowSize:function(){return t.DOM.getViewPort()},getSize:function(e){var t,n;if(e.getBoundingClientRect){var r=e.getBoundingClientRect();t=Math.max(r.width||r.right-r.left,e.offsetWidth),n=Math.max(r.height||r.bottom-r.bottom,e.offsetHeight)}else t=e.offsetWidth,n=e.offsetHeight;return{width:t,height:n}},getPos:function(e,n){return t.DOM.getPos(e,n)},getViewPort:function(e){return t.DOM.getViewPort(e)},get:function(e){return document.getElementById(e)},addClass:function(e,n){return t.DOM.addClass(e,n)},removeClass:function(e,n){return t.DOM.removeClass(e,n)},hasClass:function(e,n){return t.DOM.hasClass(e,n)},toggleClass:function(e,n,r){return t.DOM.toggleClass(e,n,r)},css:function(e,n,r){return t.DOM.setStyle(e,n,r)},on:function(e,n,r,i){return t.DOM.bind(e,n,r,i)},off:function(e,n,r){return t.DOM.unbind(e,n,r)},fire:function(e,n,r){return t.DOM.fire(e,n,r)},innerHtml:function(e,n){t.DOM.setHTML(e,n)}}}),r($,[z,p,W,U,q],function(e,t,n,r,i){function o(e){return e._eventDispatcher||(e._eventDispatcher=new n({scope:e,toggleEvent:function(t,r){r&&n.isNative(t)&&(e._nativeEvents||(e._nativeEvents={}),e._nativeEvents[t]=!0,e._rendered&&e.bindPendingEvents())}})),e._eventDispatcher}var a={},s="onmousewheel"in document,l=!1,c="mce-",u=e.extend({Statics:{elementIdCache:a,classPrefix:c},isRtl:function(){return u.rtl},classPrefix:c,init:function(e){var n=this,r,o;if(n.settings=e=t.extend({},n.Defaults,e),n._id=e.id||i.id(),n._text=n._name="",n._width=n._height=0,n._aria={role:e.role},r=e.classes)for(r=r.split(" "),r.map={},o=r.length;o--;)r.map[r[o]]=!0;n._classes=r||[],n.visible(!0),t.each("title text width height name classes visible disabled active value".split(" "),function(t){var r=e[t],i;r!==i?n[t](r):n["_"+t]===i&&(n["_"+t]=!1)}),n.on("click",function(){return n.disabled()?!1:void 0}),e.classes&&t.each(e.classes.split(" "),function(e){n.addClass(e)}),n.settings=e,n._borderBox=n.parseBox(e.border),n._paddingBox=n.parseBox(e.padding),n._marginBox=n.parseBox(e.margin),e.hidden&&n.hide()},Properties:"parent,title,text,width,height,disabled,active,name,value",Methods:"renderHtml",getContainerElm:function(){return document.body},getParentCtrl:function(e){for(var t,n=this.getRoot().controlIdLookup;e&&n&&!(t=n[e.id]);)e=e.parentNode;return t},parseBox:function(e){var t,n=10;if(e)return"number"==typeof e?(e=e||0,{top:e,left:e,bottom:e,right:e}):(e=e.split(" "),t=e.length,1===t?e[1]=e[2]=e[3]=e[0]:2===t?(e[2]=e[0],e[3]=e[1]):3===t&&(e[3]=e[1]),{top:parseInt(e[0],n)||0,right:parseInt(e[1],n)||0,bottom:parseInt(e[2],n)||0,left:parseInt(e[3],n)||0})},borderBox:function(){return this._borderBox},paddingBox:function(){return this._paddingBox},marginBox:function(){return this._marginBox},measureBox:function(e,t){function n(t){var n=document.defaultView;return n?(t=t.replace(/[A-Z]/g,function(e){return"-"+e}),n.getComputedStyle(e,null).getPropertyValue(t)):e.currentStyle[t]}function r(e){var t=parseFloat(n(e),10);return isNaN(t)?0:t}return{top:r(t+"TopWidth"),right:r(t+"RightWidth"),bottom:r(t+"BottomWidth"),left:r(t+"LeftWidth")}},initLayoutRect:function(){var e=this,t=e.settings,n,r,o=e.getEl(),a,s,l,c,u,d,f,p;n=e._borderBox=e._borderBox||e.measureBox(o,"border"),e._paddingBox=e._paddingBox||e.measureBox(o,"padding"),e._marginBox=e._marginBox||e.measureBox(o,"margin"),p=i.getSize(o),d=t.minWidth,f=t.minHeight,l=d||p.width,c=f||p.height,a=t.width,s=t.height,u=t.autoResize,u="undefined"!=typeof u?u:!a&&!s,a=a||l,s=s||c;var h=n.left+n.right,m=n.top+n.bottom,g=t.maxWidth||65535,v=t.maxHeight||65535;return e._layoutRect=r={x:t.x||0,y:t.y||0,w:a,h:s,deltaW:h,deltaH:m,contentW:a-h,contentH:s-m,innerW:a-h,innerH:s-m,startMinWidth:d||0,startMinHeight:f||0,minW:Math.min(l,g),minH:Math.min(c,v),maxW:g,maxH:v,autoResize:u,scrollW:0},e._lastLayoutRect={},r},layoutRect:function(e){var t=this,n=t._layoutRect,r,i,o,a,s,l;return n||(n=t.initLayoutRect()),e?(o=n.deltaW,a=n.deltaH,e.x!==s&&(n.x=e.x),e.y!==s&&(n.y=e.y),e.minW!==s&&(n.minW=e.minW),e.minH!==s&&(n.minH=e.minH),i=e.w,i!==s&&(i=i<n.minW?n.minW:i,i=i>n.maxW?n.maxW:i,n.w=i,n.innerW=i-o),i=e.h,i!==s&&(i=i<n.minH?n.minH:i,i=i>n.maxH?n.maxH:i,n.h=i,n.innerH=i-a),i=e.innerW,i!==s&&(i=i<n.minW-o?n.minW-o:i,i=i>n.maxW-o?n.maxW-o:i,n.innerW=i,n.w=i+o),i=e.innerH,i!==s&&(i=i<n.minH-a?n.minH-a:i,i=i>n.maxH-a?n.maxH-a:i,n.innerH=i,n.h=i+a),e.contentW!==s&&(n.contentW=e.contentW),e.contentH!==s&&(n.contentH=e.contentH),r=t._lastLayoutRect,(r.x!==n.x||r.y!==n.y||r.w!==n.w||r.h!==n.h)&&(l=u.repaintControls,l&&l.map&&!l.map[t._id]&&(l.push(t),l.map[t._id]=!0),r.x=n.x,r.y=n.y,r.w=n.w,r.h=n.h),t):n},repaint:function(){var e=this,t,n,r,i,o=0,a=0,s,l;l=document.createRange?function(e){return e}:Math.round,t=e.getEl().style,r=e._layoutRect,s=e._lastRepaintRect||{},i=e._borderBox,o=i.left+i.right,a=i.top+i.bottom,r.x!==s.x&&(t.left=l(r.x)+"px",s.x=r.x),r.y!==s.y&&(t.top=l(r.y)+"px",s.y=r.y),r.w!==s.w&&(t.width=l(r.w-o)+"px",s.w=r.w),r.h!==s.h&&(t.height=l(r.h-a)+"px",s.h=r.h),e._hasBody&&r.innerW!==s.innerW&&(n=e.getEl("body").style,n.width=l(r.innerW)+"px",s.innerW=r.innerW),e._hasBody&&r.innerH!==s.innerH&&(n=n||e.getEl("body").style,n.height=l(r.innerH)+"px",s.innerH=r.innerH),e._lastRepaintRect=s,e.fire("repaint",{},!1)},on:function(e,t){function n(e){var t,n;return"string"!=typeof e?e:function(i){return t||r.parentsAndSelf().each(function(r){var i=r.settings.callbacks;return i&&(t=i[e])?(n=r,!1):void 0}),t.call(n,i)}}var r=this;return o(r).on(e,n(t)),r},off:function(e,t){return o(this).off(e,t),this},fire:function(e,t,n){var r=this;if(t=t||{},t.control||(t.control=r),t=o(r).fire(e,t),n!==!1&&r.parent)for(var i=r.parent();i&&!t.isPropagationStopped();)i.fire(e,t,!1),i=i.parent();return t},hasEventListeners:function(e){return o(this).has(e)},parents:function(e){var t=this,n,i=new r;for(n=t.parent();n;n=n.parent())i.add(n);return e&&(i=i.filter(e)),i},parentsAndSelf:function(e){return new r(this).add(this.parents(e))},next:function(){var e=this.parent().items();return e[e.indexOf(this)+1]},prev:function(){var e=this.parent().items();return e[e.indexOf(this)-1]},findCommonAncestor:function(e,t){for(var n;e;){for(n=t;n&&e!=n;)n=n.parent();if(e==n)break;e=e.parent()}return e},hasClass:function(e,t){var n=this._classes[t||"control"];return e=this.classPrefix+e,n&&!!n.map[e]},addClass:function(e,t){var n=this,r,i;return e=this.classPrefix+e,r=n._classes[t||"control"],r||(r=[],r.map={},n._classes[t||"control"]=r),r.map[e]||(r.map[e]=e,r.push(e),n._rendered&&(i=n.getEl(t),i&&(i.className=r.join(" ")))),n},removeClass:function(e,t){var n=this,r,i,o;if(e=this.classPrefix+e,r=n._classes[t||"control"],r&&r.map[e])for(delete r.map[e],i=r.length;i--;)r[i]===e&&r.splice(i,1);return n._rendered&&(o=n.getEl(t),o&&(o.className=r.join(" "))),n},toggleClass:function(e,t,n){var r=this;return t?r.addClass(e,n):r.removeClass(e,n),r},classes:function(e){var t=this._classes[e||"control"];return t?t.join(" "):""},innerHtml:function(e){return i.innerHtml(this.getEl(),e),this},getEl:function(e,t){var n,r=e?this._id+"-"+e:this._id;return n=a[r]=(t===!0?null:a[r])||i.get(r)},visible:function(e){var t=this,n;return"undefined"!=typeof e?(t._visible!==e&&(t._rendered&&(t.getEl().style.display=e?"":"none"),t._visible=e,n=t.parent(),n&&(n._lastRect=null),t.fire(e?"show":"hide")),t):t._visible},show:function(){return this.visible(!0)},hide:function(){return this.visible(!1)},focus:function(){try{this.getEl().focus()}catch(e){}return this},blur:function(){return this.getEl().blur(),this},aria:function(e,t){var n=this,r=n.getEl(n.ariaTarget);return"undefined"==typeof t?n._aria[e]:(n._aria[e]=t,n._rendered&&r.setAttribute("role"==e?e:"aria-"+e,t),n)},encode:function(e,t){return t!==!1&&(e=this.translate(e)),(e||"").replace(/[&<>"]/g,function(e){return"&#"+e.charCodeAt(0)+";"})},translate:function(e){return u.translate?u.translate(e):e},before:function(e){var t=this,n=t.parent();return n&&n.insert(e,n.items().indexOf(t),!0),t},after:function(e){var t=this,n=t.parent();return n&&n.insert(e,n.items().indexOf(t)),t},remove:function(){var e=this,t=e.getEl(),n=e.parent(),r,o;if(e.items){var s=e.items().toArray();for(o=s.length;o--;)s[o].remove()}n&&n.items&&(r=[],n.items().each(function(t){t!==e&&r.push(t)}),n.items().set(r),n._lastRect=null),e._eventsRoot&&e._eventsRoot==e&&i.off(t);var l=e.getRoot().controlIdLookup;if(l&&delete l[e._id],delete a[e._id],t&&t.parentNode){var c=t.getElementsByTagName("*");for(o=c.length;o--;)delete a[c[o].id];t.parentNode.removeChild(t)}return e._rendered=!1,e},renderBefore:function(e){var t=this;return e.parentNode.insertBefore(i.createFragment(t.renderHtml()),e),t.postRender(),t},renderTo:function(e){var t=this;return e=e||t.getContainerElm(),e.appendChild(i.createFragment(t.renderHtml())),t.postRender(),t},postRender:function(){var e=this,t=e.settings,n,r,o,a,s;for(a in t)0===a.indexOf("on")&&e.on(a.substr(2),t[a]);if(e._eventsRoot){for(o=e.parent();!s&&o;o=o.parent())s=o._eventsRoot;if(s)for(a in s._nativeEvents)e._nativeEvents[a]=!0}e.bindPendingEvents(),t.style&&(n=e.getEl(),n&&(n.setAttribute("style",t.style),n.style.cssText=t.style)),e._visible||i.css(e.getEl(),"display","none"),e.settings.border&&(r=e.borderBox(),i.css(e.getEl(),{"border-top-width":r.top,"border-right-width":r.right,"border-bottom-width":r.bottom,"border-left-width":r.left}));var l=e.getRoot();l.controlIdLookup||(l.controlIdLookup={}),l.controlIdLookup[e._id]=e;for(var c in e._aria)e.aria(c,e._aria[c]);e.fire("postrender",{},!1)},scrollIntoView:function(e){function t(e,t){var n,r,i=e;for(n=r=0;i&&i!=t&&i.nodeType;)n+=i.offsetLeft||0,r+=i.offsetTop||0,i=i.offsetParent;return{x:n,y:r}}var n=this.getEl(),r=n.parentNode,i,o,a,s,l,c,u=t(n,r);return i=u.x,o=u.y,a=n.offsetWidth,s=n.offsetHeight,l=r.clientWidth,c=r.clientHeight,"end"==e?(i-=l-a,o-=c-s):"center"==e&&(i-=l/2-a/2,o-=c/2-s/2),r.scrollLeft=i,r.scrollTop=o,this},bindPendingEvents:function(){function e(e){var t=o.getParentCtrl(e.target);t&&t.fire(e.type,e)}function t(){var e=d._lastHoverCtrl;e&&(e.fire("mouseleave",{target:e.getEl()}),e.parents().each(function(e){e.fire("mouseleave",{target:e.getEl()})}),d._lastHoverCtrl=null)}function n(e){var t=o.getParentCtrl(e.target),n=d._lastHoverCtrl,r=0,i,a,s;if(t!==n){if(d._lastHoverCtrl=t,a=t.parents().toArray().reverse(),a.push(t),n){for(s=n.parents().toArray().reverse(),s.push(n),r=0;r<s.length&&a[r]===s[r];r++);for(i=s.length-1;i>=r;i--)n=s[i],n.fire("mouseleave",{target:n.getEl()})}for(i=r;i<a.length;i++)t=a[i],t.fire("mouseenter",{target:t.getEl()})}}function r(e){e.preventDefault(),"mousewheel"==e.type?(e.deltaY=-1/40*e.wheelDelta,e.wheelDeltaX&&(e.deltaX=-1/40*e.wheelDeltaX)):(e.deltaX=0,e.deltaY=e.detail),e=o.fire("wheel",e)}var o=this,a,c,u,d,f,p;if(o._rendered=!0,f=o._nativeEvents){for(u=o.parents().toArray(),u.unshift(o),a=0,c=u.length;!d&&c>a;a++)d=u[a]._eventsRoot;for(d||(d=u[u.length-1]||o),o._eventsRoot=d,c=a,a=0;c>a;a++)u[a]._eventsRoot=d;var h=d._delegates;h||(h=d._delegates={});for(p in f){if(!f)return!1;"wheel"!==p||l?("mouseenter"===p||"mouseleave"===p?d._hasMouseEnter||(i.on(d.getEl(),"mouseleave",t),i.on(d.getEl(),"mouseover",n),d._hasMouseEnter=1):h[p]||(i.on(d.getEl(),p,e),h[p]=!0),f[p]=!1):s?i.on(o.getEl(),"mousewheel",r):i.on(o.getEl(),"DOMMouseScroll",r)}}},getRoot:function(){for(var e=this,t,n=[];e;){if(e.rootControl){t=e.rootControl;break}n.push(e),t=e,e=e.parent()}t||(t=this);for(var r=n.length;r--;)n[r].rootControl=t;return t},reflow:function(){return this.repaint(),this}});return u}),r(j,[],function(){var e={},t;return{add:function(t,n){e[t.toLowerCase()]=n},has:function(t){return!!e[t.toLowerCase()]},create:function(n,r){var i,o,a;if(!t){a=tinymce.ui;for(o in a)e[o.toLowerCase()]=a[o];t=!0}if("string"==typeof n?(r=r||{},r.type=n):(r=n,n=r.type),n=n.toLowerCase(),i=e[n],!i)throw new Error("Could not find control by type: "+n);return i=new i(r),i.type=n,i}}}),r(K,[],function(){return function(e){function t(e){return e=e||b,e&&e.getAttribute("role")}function n(e){for(var n,r=e||b;r=r.parentNode;)if(n=t(r))return n}function r(e){var t=b;return t?t.getAttribute("aria-"+e):void 0}function i(e){var t=e.tagName.toUpperCase();return"INPUT"==t||"TEXTAREA"==t}function o(e){return i(e)&&!e.hidden?!0:/^(button|menuitem|checkbox|tab|menuitemcheckbox|option|gridcell)$/.test(t(e))?!0:!1}function a(e){function t(e){if(1==e.nodeType&&"none"!=e.style.display){o(e)&&n.push(e);for(var r=0;r<e.childNodes.length;r++)t(e.childNodes[r])}}var n=[];return t(e||y.getEl()),n}function s(e){var t,n;e=e||C,n=e.parents().toArray(),n.unshift(e);for(var r=0;r<n.length&&(t=n[r],!t.settings.ariaRoot);r++);return t}function l(e){var t=s(e),n=a(t.getEl());t.settings.ariaRemember&&"lastAriaIndex"in t?c(t.lastAriaIndex,n):c(0,n)}function c(e,t){return 0>e?e=t.length-1:e>=t.length&&(e=0),t[e]&&t[e].focus(),e}function u(e,t){var n=-1,r=s();t=t||a(r.getEl());for(var i=0;i<t.length;i++)t[i]===b&&(n=i);n+=e,r.lastAriaIndex=c(n,t)}function d(){var e=n();"tablist"==e?u(-1,a(b.parentNode)):C.parent().submenu?g():u(-1)}function f(){var e=t(),i=n();"tablist"==i?u(1,a(b.parentNode)):"menuitem"==e&&"menu"==i&&r("haspopup")?v():u(1)}function p(){u(-1)}function h(){var e=t(),i=n();"menuitem"==e&&"menubar"==i?v():"button"==e&&r("haspopup")?v({key:"down"}):u(1)}function m(e){var t=n();if("tablist"==t){var r=a(C.getEl("body"))[0];r&&r.focus()}else u(e.shiftKey?-1:1)}function g(){C.fire("cancel")}function v(e){e=e||{},C.fire("click",{target:b,aria:e})}var y=e.root,b,C;return b=document.activeElement,C=y.getParentCtrl(b),y.on("keydown",function(e){function t(e,t){i(b)||t(e)!==!1&&e.preventDefault()}if(!e.isDefaultPrevented())switch(e.keyCode){case 37:t(e,d);break;case 39:t(e,f);break;case 38:t(e,p);break;case 40:t(e,h);break;case 27:g();break;case 14:case 13:case 32:t(e,v);break;case 9:m(e)!==!1&&e.preventDefault()}}),y.on("focusin",function(e){b=e.target,C=e.control}),{focusFirst:l}}}),r(G,[$,U,V,j,K,p,q],function(e,t,n,r,i,o,a){var s={};return e.extend({layout:"",innerClass:"container-inner",init:function(e){var n=this;n._super(e),e=n.settings,n._fixed=e.fixed,n._items=new t,n.isRtl()&&n.addClass("rtl"),n.addClass("container"),n.addClass("container-body","body"),e.containerCls&&n.addClass(e.containerCls),n._layout=r.create((e.layout||n.layout)+"layout"),n.settings.items&&n.add(n.settings.items),n._hasBody=!0},items:function(){return this._items},find:function(e){return e=s[e]=s[e]||new n(e),e.find(this)},add:function(e){var t=this;return t.items().add(t.create(e)).parent(t),t},focus:function(e){var t=this,n,r,i;return e&&(r=t.keyboardNav||t.parents().eq(-1)[0].keyboardNav)?void r.focusFirst(t):(i=t.find("*"),t.statusbar&&i.add(t.statusbar.items()),i.each(function(e){return e.settings.autofocus?(n=null,!1):void(e.canFocus&&(n=n||e))}),n&&n.focus(),t)},replace:function(e,t){for(var n,r=this.items(),i=r.length;i--;)if(r[i]===e){r[i]=t;break}i>=0&&(n=t.getEl(),n&&n.parentNode.removeChild(n),n=e.getEl(),n&&n.parentNode.removeChild(n)),t.parent(this)},create:function(t){var n=this,i,a=[];return o.isArray(t)||(t=[t]),o.each(t,function(t){t&&(t instanceof e||("string"==typeof t&&(t={type:t}),i=o.extend({},n.settings.defaults,t),t.type=i.type=i.type||t.type||n.settings.defaultType||(i.defaults?i.defaults.type:null),t=r.create(i)),a.push(t))}),a},renderNew:function(){var e=this;return e.items().each(function(t,n){var r,i;t.parent(e),t._rendered||(r=e.getEl("body"),i=a.createFragment(t.renderHtml()),r.hasChildNodes()&&n<=r.childNodes.length-1?r.insertBefore(i,r.childNodes[n]):r.appendChild(i),t.postRender())}),e._layout.applyClasses(e),e._lastRect=null,e},append:function(e){return this.add(e).renderNew()},prepend:function(e){var t=this;return t.items().set(t.create(e).concat(t.items().toArray())),t.renderNew()},insert:function(e,t,n){var r=this,i,o,a;return e=r.create(e),i=r.items(),!n&&t<i.length-1&&(t+=1),t>=0&&t<i.length&&(o=i.slice(0,t).toArray(),a=i.slice(t).toArray(),i.set(o.concat(e,a))),r.renderNew()},fromJSON:function(e){var t=this;for(var n in e)t.find("#"+n).value(e[n]);return t},toJSON:function(){var e=this,t={};return e.find("*").each(function(e){var n=e.name(),r=e.value();n&&"undefined"!=typeof r&&(t[n]=r)}),t},preRender:function(){},renderHtml:function(){var e=this,t=e._layout,n=this.settings.role;return e.preRender(),t.preRender(e),'<div id="'+e._id+'" class="'+e.classes()+'"'+(n?' role="'+this.settings.role+'"':"")+'><div id="'+e._id+'-body" class="'+e.classes("body")+'">'+(e.settings.html||"")+t.renderHtml(e)+"</div></div>"},postRender:function(){var e=this,t;return e.items().exec("postRender"),e._super(),e._layout.postRender(e),e._rendered=!0,e.settings.style&&a.css(e.getEl(),e.settings.style),e.settings.border&&(t=e.borderBox(),a.css(e.getEl(),{"border-top-width":t.top,"border-right-width":t.right,"border-bottom-width":t.bottom,"border-left-width":t.left})),e.parent()||(e.keyboardNav=new i({root:e})),e},initLayoutRect:function(){var e=this,t=e._super();return e._layout.recalc(e),t},recalc:function(){var e=this,t=e._layoutRect,n=e._lastRect;return n&&n.w==t.w&&n.h==t.h?void 0:(e._layout.recalc(e),t=e.layoutRect(),e._lastRect={x:t.x,y:t.y,w:t.w,h:t.h},!0)},reflow:function(){var t;if(this.visible()){for(e.repaintControls=[],e.repaintControls.map={},this.recalc(),t=e.repaintControls.length;t--;)e.repaintControls[t].repaint();"flow"!==this.settings.layout&&"stack"!==this.settings.layout&&this.repaint(),e.repaintControls=[]}return this}})}),r(Y,[q],function(e){function t(){var e=document,t,n,r,i,o,a,s,l,c=Math.max;return t=e.documentElement,n=e.body,r=c(t.scrollWidth,n.scrollWidth),i=c(t.clientWidth,n.clientWidth),o=c(t.offsetWidth,n.offsetWidth),a=c(t.scrollHeight,n.scrollHeight),s=c(t.clientHeight,n.clientHeight),l=c(t.offsetHeight,n.offsetHeight),{width:o>r?i:r,height:l>a?s:a}}return function(n,r){function i(){return a.getElementById(r.handle||n)}var o,a=document,s,l,c,u,d,f;r=r||{},l=function(n){var l=t(),p,h;n.preventDefault(),s=n.button,p=i(),d=n.screenX,f=n.screenY,h=window.getComputedStyle?window.getComputedStyle(p,null).getPropertyValue("cursor"):p.runtimeStyle.cursor,o=a.createElement("div"),e.css(o,{position:"absolute",top:0,left:0,width:l.width,height:l.height,zIndex:2147483647,opacity:1e-4,background:"red",cursor:h}),a.body.appendChild(o),e.on(a,"mousemove",u),e.on(a,"mouseup",c),r.start(n)},u=function(e){return e.button!==s?c(e):(e.deltaX=e.screenX-d,e.deltaY=e.screenY-f,e.preventDefault(),void r.drag(e))},c=function(t){e.off(a,"mousemove",u),e.off(a,"mouseup",c),o.parentNode.removeChild(o),r.stop&&r.stop(t)},this.destroy=function(){e.off(i())},e.on(i(),"mousedown",l)}}),r(X,[q,Y],function(e,t){return{init:function(){var e=this;e.on("repaint",e.renderScroll)},renderScroll:function(){function n(){function t(t,a,s,l,c,u){var d,f,p,h,m,g,v,y,b;if(f=i.getEl("scroll"+t)){if(y=a.toLowerCase(),b=s.toLowerCase(),i.getEl("absend")&&e.css(i.getEl("absend"),y,i.layoutRect()[l]-1),!c)return void e.css(f,"display","none");e.css(f,"display","block"),d=i.getEl("body"),p=i.getEl("scroll"+t+"t"),h=d["client"+s]-2*o,h-=n&&r?f["client"+u]:0,m=d["scroll"+s],g=h/m,v={},v[y]=d["offset"+a]+o,v[b]=h,e.css(f,v),v={},v[y]=d["scroll"+a]*g,v[b]=h*g,e.css(p,v)}}var n,r,a;a=i.getEl("body"),n=a.scrollWidth>a.clientWidth,r=a.scrollHeight>a.clientHeight,t("h","Left","Width","contentW",n,"Height"),t("v","Top","Height","contentH",r,"Width")}function r(){function n(n,r,a,s,l){var c,u=i._id+"-scroll"+n,d=i.classPrefix;i.getEl().appendChild(e.createFragment('<div id="'+u+'" class="'+d+"scrollbar "+d+"scrollbar-"+n+'"><div id="'+u+'t" class="'+d+'scrollbar-thumb"></div></div>')),i.draghelper=new t(u+"t",{start:function(){c=i.getEl("body")["scroll"+r],e.addClass(e.get(u),d+"active")},drag:function(e){var t,u,d,f,p=i.layoutRect();u=p.contentW>p.innerW,d=p.contentH>p.innerH,f=i.getEl("body")["client"+a]-2*o,f-=u&&d?i.getEl("scroll"+n)["client"+l]:0,t=f/i.getEl("body")["scroll"+a],i.getEl("body")["scroll"+r]=c+e["delta"+s]/t},stop:function(){e.removeClass(e.get(u),d+"active")}})}i.addClass("scroll"),n("v","Top","Height","Y","Width"),n("h","Left","Width","X","Height")}var i=this,o=2;i.settings.autoScroll&&(i._hasScroll||(i._hasScroll=!0,r(),i.on("wheel",function(e){var t=i.getEl("body");t.scrollLeft+=10*(e.deltaX||0),t.scrollTop+=10*e.deltaY,n()}),e.on(i.getEl("body"),"scroll",n)),n())}}}),r(J,[G,X],function(e,t){return e.extend({Defaults:{layout:"fit",containerCls:"panel"},Mixins:[t],renderHtml:function(){var e=this,t=e._layout,n=e.settings.html;return e.preRender(),t.preRender(e),"undefined"==typeof n?n='<div id="'+e._id+'-body" class="'+e.classes("body")+'">'+t.renderHtml(e)+"</div>":("function"==typeof n&&(n=n.call(e)),e._hasBody=!1),'<div id="'+e._id+'" class="'+e.classes()+'" hidefocus="1" tabindex="-1" role="group">'+(e._preBodyHtml||"")+n+"</div>"}})}),r(Q,[q],function(e){function t(t,n,r){var i,o,a,s,l,c,u,d,f,p;return f=e.getViewPort(),o=e.getPos(n),a=o.x,s=o.y,t._fixed&&(a-=f.x,s-=f.y),i=t.getEl(),p=e.getSize(i),l=p.width,c=p.height,p=e.getSize(n),u=p.width,d=p.height,r=(r||"").split(""),"b"===r[0]&&(s+=d),"r"===r[1]&&(a+=u),"c"===r[0]&&(s+=Math.round(d/2)),"c"===r[1]&&(a+=Math.round(u/2)),"b"===r[3]&&(s-=c),"r"===r[4]&&(a-=l),"c"===r[3]&&(s-=Math.round(c/2)),"c"===r[4]&&(a-=Math.round(l/2)),{x:a,y:s,w:l,h:c}}return{testMoveRel:function(n,r){for(var i=e.getViewPort(),o=0;o<r.length;o++){var a=t(this,n,r[o]);if(this._fixed){if(a.x>0&&a.x+a.w<i.w&&a.y>0&&a.y+a.h<i.h)return r[o]}else if(a.x>i.x&&a.x+a.w<i.w+i.x&&a.y>i.y&&a.y+a.h<i.h+i.y)return r[o]}return r[0]},moveRel:function(e,n){"string"!=typeof n&&(n=this.testMoveRel(e,n)); +var r=t(this,e,n);return this.moveTo(r.x,r.y)},moveBy:function(e,t){var n=this,r=n.layoutRect();return n.moveTo(r.x+e,r.y+t),n},moveTo:function(t,n){function r(e,t,n){return 0>e?0:e+n>t?(e=t-n,0>e?0:e):e}var i=this;if(i.settings.constrainToViewport){var o=e.getViewPort(window),a=i.layoutRect();t=r(t,o.w+o.x,a.w),n=r(n,o.h+o.y,a.h)}return i._rendered?i.layoutRect({x:t,y:n}).repaint():(i.settings.x=t,i.settings.y=n),i.fire("move",{x:t,y:n}),i}}}),r(Z,[q],function(e){return{resizeToContent:function(){this._layoutRect.autoResize=!0,this._lastRect=null,this.reflow()},resizeTo:function(t,n){if(1>=t||1>=n){var r=e.getWindowSize();t=1>=t?t*r.w:t,n=1>=n?n*r.h:n}return this._layoutRect.autoResize=!1,this.layoutRect({minW:t,minH:n,w:t,h:n}).reflow()},resizeBy:function(e,t){var n=this,r=n.layoutRect();return n.resizeTo(r.w+e,r.h+t)}}}),r(et,[J,Q,Z,q],function(e,t,n,r){function i(e){var t;for(t=s.length;t--;)s[t]===e&&s.splice(t,1);for(t=l.length;t--;)l[t]===e&&l.splice(t,1)}var o,a,s=[],l=[],c,u=e.extend({Mixins:[t,n],init:function(e){function t(){var e,t=u.zIndex||65535,n;if(l.length)for(e=0;e<l.length;e++)l[e].modal&&(t++,n=l[e]),l[e].getEl().style.zIndex=t,l[e].zIndex=t,t++;var i=document.getElementById(d.classPrefix+"modal-block");n?r.css(i,"z-index",n.zIndex-1):i&&(i.parentNode.removeChild(i),c=!1),u.currentZIndex=t}function n(e,t){for(;e;){if(e==t)return!0;e=e.parent()}}function i(e){function t(t,n){for(var r,i=0;i<s.length;i++)if(s[i]!=e)for(r=s[i].parent();r&&(r=r.parent());)r==e&&s[i].fixed(t).moveBy(0,n).repaint()}var n=r.getViewPort().y;e.settings.autofix&&(e._fixed?e._autoFixY>n&&(e.fixed(!1).layoutRect({y:e._autoFixY}).repaint(),t(!1,e._autoFixY-n)):(e._autoFixY=e.layoutRect().y,e._autoFixY<n&&(e.fixed(!0).layoutRect({y:0}).repaint(),t(!0,n-e._autoFixY))))}var d=this;d._super(e),d._eventsRoot=d,d.addClass("floatpanel"),e.autohide&&(o||(o=function(e){for(var t=s.length;t--;){var r=s[t],i=r.getParentCtrl(e.target);if(r.settings.autohide){if(i&&(n(i,r)||r.parent()===i))continue;e=r.fire("autohide",{target:e.target}),e.isDefaultPrevented()||r.hide()}}},r.on(document,"click",o)),s.push(d)),e.autofix&&(a||(a=function(){var e;for(e=s.length;e--;)i(s[e])},r.on(window,"scroll",a)),d.on("move",function(){i(this)})),d.on("postrender show",function(e){if(e.control==d){var n,i=d.classPrefix;d.modal&&!c&&(n=r.createFragment('<div id="'+i+'modal-block" class="'+i+"reset "+i+'fade"></div>'),n=n.firstChild,d.getContainerElm().appendChild(n),setTimeout(function(){r.addClass(n,i+"in"),r.addClass(d.getEl(),i+"in")},0),c=!0),l.push(d),t()}}),d.on("close hide",function(e){if(e.control==d){for(var n=l.length;n--;)l[n]===d&&l.splice(n,1);t()}}),d.on("show",function(){d.parents().each(function(e){return e._fixed?(d.fixed(!0),!1):void 0})}),e.popover&&(d._preBodyHtml='<div class="'+d.classPrefix+'arrow"></div>',d.addClass("popover").addClass("bottom").addClass(d.isRtl()?"end":"start"))},fixed:function(e){var t=this;if(t._fixed!=e){if(t._rendered){var n=r.getViewPort();e?t.layoutRect().y-=n.y:t.layoutRect().y+=n.y}t.toggleClass("fixed",e),t._fixed=e}return t},show:function(){var e=this,t,n=e._super();for(t=s.length;t--&&s[t]!==e;);return-1===t&&s.push(e),n},hide:function(){return i(this),this._super()},hideAll:function(){u.hideAll()},close:function(){var e=this;return e.fire("close"),e.remove()},remove:function(){i(this),this._super()},postRender:function(){var e=this;return e.settings.bodyRole&&this.getEl("body").setAttribute("role",e.settings.bodyRole),e._super()}});return u.hideAll=function(){for(var e=s.length;e--;){var t=s[e];t&&t.settings.autohide&&(t.hide(),s.splice(e,1))}},u}),r(tt,[et,J,q,Y],function(e,t,n,r){var i=e.extend({modal:!0,Defaults:{border:1,layout:"flex",containerCls:"panel",role:"dialog",callbacks:{submit:function(){this.fire("submit",{data:this.toJSON()})},close:function(){this.close()}}},init:function(e){var n=this;n._super(e),n.isRtl()&&n.addClass("rtl"),n.addClass("window"),n._fixed=!0,e.buttons&&(n.statusbar=new t({layout:"flex",border:"1 0 0 0",spacing:3,padding:10,align:"center",pack:n.isRtl()?"start":"end",defaults:{type:"button"},items:e.buttons}),n.statusbar.addClass("foot"),n.statusbar.parent(n)),n.on("click",function(e){-1!=e.target.className.indexOf(n.classPrefix+"close")&&n.close()}),n.on("cancel",function(){n.close()}),n.aria("describedby",n.describedBy||n._id+"-none"),n.aria("label",e.title),n._fullscreen=!1},recalc:function(){var e=this,t=e.statusbar,r,i,o,a;e._fullscreen&&(e.layoutRect(n.getWindowSize()),e.layoutRect().contentH=e.layoutRect().innerH),e._super(),r=e.layoutRect(),e.settings.title&&!e._fullscreen&&(i=r.headerW,i>r.w&&(o=r.x-Math.max(0,i/2),e.layoutRect({w:i,x:o}),a=!0)),t&&(t.layoutRect({w:e.layoutRect().innerW}).recalc(),i=t.layoutRect().minW+r.deltaW,i>r.w&&(o=r.x-Math.max(0,i-r.w),e.layoutRect({w:i,x:o}),a=!0)),a&&e.recalc()},initLayoutRect:function(){var e=this,t=e._super(),r=0,i;if(e.settings.title&&!e._fullscreen){i=e.getEl("head");var o=n.getSize(i);t.headerW=o.width,t.headerH=o.height,r+=t.headerH}e.statusbar&&(r+=e.statusbar.layoutRect().h),t.deltaH+=r,t.minH+=r,t.h+=r;var a=n.getWindowSize();return t.x=Math.max(0,a.w/2-t.w/2),t.y=Math.max(0,a.h/2-t.h/2),t},renderHtml:function(){var e=this,t=e._layout,n=e._id,r=e.classPrefix,i=e.settings,o="",a="",s=i.html;return e.preRender(),t.preRender(e),i.title&&(o='<div id="'+n+'-head" class="'+r+'window-head"><div id="'+n+'-title" class="'+r+'title">'+e.encode(i.title)+'</div><button type="button" class="'+r+'close" aria-hidden="true">\xd7</button><div id="'+n+'-dragh" class="'+r+'dragh"></div></div>'),i.url&&(s='<iframe src="'+i.url+'" tabindex="-1"></iframe>'),"undefined"==typeof s&&(s=t.renderHtml(e)),e.statusbar&&(a=e.statusbar.renderHtml()),'<div id="'+n+'" class="'+e.classes()+'" hidefocus="1"><div class="'+e.classPrefix+'reset" role="application">'+o+'<div id="'+n+'-body" class="'+e.classes("body")+'">'+s+"</div>"+a+"</div></div>"},fullscreen:function(e){var t=this,r=document.documentElement,i,o=t.classPrefix,a;if(e!=t._fullscreen)if(n.on(window,"resize",function(){var e;if(t._fullscreen)if(i)t._timer||(t._timer=setTimeout(function(){var e=n.getWindowSize();t.moveTo(0,0).resizeTo(e.w,e.h),t._timer=0},50));else{e=(new Date).getTime();var r=n.getWindowSize();t.moveTo(0,0).resizeTo(r.w,r.h),(new Date).getTime()-e>50&&(i=!0)}}),a=t.layoutRect(),t._fullscreen=e,e){t._initial={x:a.x,y:a.y,w:a.w,h:a.h},t._borderBox=t.parseBox("0"),t.getEl("head").style.display="none",a.deltaH-=a.headerH+2,n.addClass(r,o+"fullscreen"),n.addClass(document.body,o+"fullscreen"),t.addClass("fullscreen");var s=n.getWindowSize();t.moveTo(0,0).resizeTo(s.w,s.h)}else t._borderBox=t.parseBox(t.settings.border),t.getEl("head").style.display="",a.deltaH+=a.headerH,n.removeClass(r,o+"fullscreen"),n.removeClass(document.body,o+"fullscreen"),t.removeClass("fullscreen"),t.moveTo(t._initial.x,t._initial.y).resizeTo(t._initial.w,t._initial.h);return t.reflow()},postRender:function(){var e=this,t;setTimeout(function(){e.addClass("in")},0),e._super(),e.statusbar&&e.statusbar.postRender(),e.focus(),this.dragHelper=new r(e._id+"-dragh",{start:function(){t={x:e.layoutRect().x,y:e.layoutRect().y}},drag:function(n){e.moveTo(t.x+n.deltaX,t.y+n.deltaY)}}),e.on("submit",function(t){t.isDefaultPrevented()||e.close()})},submit:function(){return this.fire("submit",{data:this.toJSON()})},remove:function(){var e=this,t=e.classPrefix;e.dragHelper.destroy(),e._super(),e.statusbar&&this.statusbar.remove(),e._fullscreen&&(n.removeClass(document.documentElement,t+"fullscreen"),n.removeClass(document.body,t+"fullscreen"))},getContentWindow:function(){var e=this.getEl().getElementsByTagName("iframe")[0];return e?e.contentWindow:null}});return i}),r(nt,[tt],function(e){var t=e.extend({init:function(e){e={border:1,padding:20,layout:"flex",pack:"center",align:"center",containerCls:"panel",autoScroll:!0,buttons:{type:"button",text:"Ok",action:"ok"},items:{type:"label",multiline:!0,maxWidth:500,maxHeight:200}},this._super(e)},Statics:{OK:1,OK_CANCEL:2,YES_NO:3,YES_NO_CANCEL:4,msgBox:function(n){var r,i=n.callback||function(){};switch(n.buttons){case t.OK_CANCEL:r=[{type:"button",text:"Ok",subtype:"primary",onClick:function(e){e.control.parents()[1].close(),i(!0)}},{type:"button",text:"Cancel",onClick:function(e){e.control.parents()[1].close(),i(!1)}}];break;case t.YES_NO:r=[{type:"button",text:"Ok",subtype:"primary",onClick:function(e){e.control.parents()[1].close(),i(!0)}}];break;case t.YES_NO_CANCEL:r=[{type:"button",text:"Ok",subtype:"primary",onClick:function(e){e.control.parents()[1].close()}}];break;default:r=[{type:"button",text:"Ok",subtype:"primary",onClick:function(e){e.control.parents()[1].close(),i(!0)}}]}return new e({padding:20,x:n.x,y:n.y,minWidth:300,minHeight:100,layout:"flex",pack:"center",align:"center",buttons:r,title:n.title,role:"alertdialog",items:{type:"label",multiline:!0,maxWidth:500,maxHeight:200,text:n.text},onPostRender:function(){this.aria("describedby",this.items()[0]._id)},onClose:n.onClose,onCancel:function(){i(!1)}}).renderTo(document.body).reflow()},alert:function(e,n){return"string"==typeof e&&(e={text:e}),e.callback=n,t.msgBox(e)},confirm:function(e,n){return"string"==typeof e&&(e={text:e}),e.callback=n,e.buttons=t.OK_CANCEL,t.msgBox(e)}}});return t}),r(rt,[tt,nt],function(e,t){return function(n){function r(){return o.length?o[o.length-1]:void 0}var i=this,o=[];i.windows=o,i.open=function(t,r){var i;return n.editorManager.activeEditor=n,t.title=t.title||" ",t.url=t.url||t.file,t.url&&(t.width=parseInt(t.width||320,10),t.height=parseInt(t.height||240,10)),t.body&&(t.items={defaults:t.defaults,type:t.bodyType||"form",items:t.body}),t.url||t.buttons||(t.buttons=[{text:"Ok",subtype:"primary",onclick:function(){i.find("form")[0].submit()}},{text:"Cancel",onclick:function(){i.close()}}]),i=new e(t),o.push(i),i.on("close",function(){for(var e=o.length;e--;)o[e]===i&&o.splice(e,1);n.focus()}),t.data&&i.on("postRender",function(){this.find("*").each(function(e){var n=e.name();n in t.data&&e.value(t.data[n])})}),i.features=t||{},i.params=r||{},n.nodeChanged(),i.renderTo().reflow()},i.alert=function(e,r,i){t.alert(e,function(){r?r.call(i||this):n.focus()})},i.confirm=function(e,n,r){t.confirm(e,function(e){n.call(r||this,e)})},i.close=function(){r()&&r().close()},i.getParams=function(){return r()?r().params:null},i.setParams=function(e){r()&&(r().params=e)},i.getWindows=function(){return o}}}),r(it,[R,B,x,m,g,p],function(e,t,n,r,i,o){return function(a){function s(e,t){try{a.getDoc().execCommand(e,!1,t)}catch(n){}}function l(){var e=a.getDoc().documentMode;return e?e:6}function c(e){return e.isDefaultPrevented()}function u(){function t(e){var t=new i(function(){});o.each(a.getBody().getElementsByTagName("*"),function(e){"SPAN"==e.tagName&&e.setAttribute("mce-data-marked",1),!e.hasAttribute("data-mce-style")&&e.hasAttribute("style")&&a.dom.setAttrib(e,"style",e.getAttribute("style"))}),t.observe(a.getDoc(),{childList:!0,attributes:!0,subtree:!0,attributeFilter:["style"]}),a.getDoc().execCommand(e?"ForwardDelete":"Delete",!1,null);var n=a.selection.getRng(),r=n.startContainer.parentNode;o.each(t.takeRecords(),function(e){if(q.isChildOf(e.target,a.getBody())){if("style"==e.attributeName){var t=e.target.getAttribute("data-mce-style");t?e.target.setAttribute("style",t):e.target.removeAttribute("style")}o.each(e.addedNodes,function(e){if("SPAN"==e.nodeName&&!e.getAttribute("mce-data-marked")){var t,i;e==r&&(t=n.startOffset,i=e.firstChild),q.remove(e,!0),i&&(n.setStart(i,t),n.setEnd(i,t),a.selection.setRng(n))}})}}),t.disconnect(),o.each(a.dom.select("span[mce-data-marked]"),function(e){e.removeAttribute("mce-data-marked")})}var n=a.getDoc(),r="data:text/mce-internal,",i=window.MutationObserver,s,l;i||(s=!0,i=function(){function e(e){var t=e.relatedNode||e.target;n.push({target:t,addedNodes:[t]})}function t(e){var t=e.relatedNode||e.target;n.push({target:t,attributeName:e.attrName})}var n=[],r;this.observe=function(n){r=n,r.addEventListener("DOMSubtreeModified",e,!1),r.addEventListener("DOMNodeInsertedIntoDocument",e,!1),r.addEventListener("DOMNodeInserted",e,!1),r.addEventListener("DOMAttrModified",t,!1)},this.disconnect=function(){r.removeEventListener("DOMSubtreeModified",e,!1),r.removeEventListener("DOMNodeInsertedIntoDocument",e,!1),r.removeEventListener("DOMNodeInserted",e,!1),r.removeEventListener("DOMAttrModified",t,!1)},this.takeRecords=function(){return n}}),a.on("keydown",function(n){var r=n.keyCode==U,i=e.metaKeyPressed(n);if(!c(n)&&(r||n.keyCode==V)){var o=a.selection.getRng(),s=o.startContainer,l=o.startOffset;if(!i&&o.collapsed&&3==s.nodeType&&(r?l<s.data.length:l>0))return;n.preventDefault(),i&&a.selection.getSel().modify("extend",r?"forward":"backward","word"),t(r)}}),a.on("keypress",function(n){c(n)||$.isCollapsed()||!n.charCode||e.metaKeyPressed(n)||(n.preventDefault(),t(!0),a.selection.setContent(String.fromCharCode(n.charCode)))}),a.addCommand("Delete",function(){t()}),a.addCommand("ForwardDelete",function(){t(!0)}),s||(a.on("dragstart",function(e){var t;a.selection.isCollapsed()&&"IMG"==e.target.tagName&&$.select(e.target),l=$.getRng(),t=a.selection.getContent(),t.length>0&&e.dataTransfer.setData("URL","data:text/mce-internal,"+escape(t))}),a.on("drop",function(e){if(!c(e)){var i=e.dataTransfer.getData("URL");if(!i||-1==i.indexOf(r)||!n.caretRangeFromPoint)return;i=unescape(i.substr(r.length)),n.caretRangeFromPoint&&(e.preventDefault(),window.setTimeout(function(){var r=n.caretRangeFromPoint(e.x,e.y);l&&($.setRng(l),l=null),t(),$.setRng(r),a.insertContent(i)},0))}}),a.on("cut",function(e){!c(e)&&e.clipboardData&&(e.preventDefault(),e.clipboardData.clearData(),e.clipboardData.setData("text/html",a.selection.getContent()),e.clipboardData.setData("text/plain",a.selection.getContent({format:"text"})),t(!0))}))}function d(){function e(e){var t=q.create("body"),n=e.cloneContents();return t.appendChild(n),$.serializer.serialize(t,{format:"html"})}function n(n){if(!n.setStart){if(n.item)return!1;var r=n.duplicate();return r.moveToElementText(a.getBody()),t.compareRanges(n,r)}var i=e(n),o=q.createRng();o.selectNode(a.getBody());var s=e(o);return i===s}a.on("keydown",function(e){var t=e.keyCode,r,i;if(!c(e)&&(t==U||t==V)){if(r=a.selection.isCollapsed(),i=a.getBody(),r&&!q.isEmpty(i))return;if(!r&&!n(a.selection.getRng()))return;e.preventDefault(),a.setContent(""),i.firstChild&&q.isBlock(i.firstChild)?a.selection.setCursorLocation(i.firstChild,0):a.selection.setCursorLocation(i,0),a.nodeChanged()}})}function f(){a.on("keydown",function(t){!c(t)&&65==t.keyCode&&e.metaKeyPressed(t)&&(t.preventDefault(),a.execCommand("SelectAll"))})}function p(){a.settings.content_editable||(q.bind(a.getDoc(),"focusin",function(){$.setRng($.getRng())}),q.bind(a.getDoc(),"mousedown",function(e){e.target==a.getDoc().documentElement&&(a.getBody().focus(),$.setRng($.getRng()))}))}function h(){a.on("keydown",function(e){if(!c(e)&&e.keyCode===V&&$.isCollapsed()&&0===$.getRng(!0).startOffset){var t=$.getNode(),n=t.previousSibling;if("HR"==t.nodeName)return q.remove(t),void e.preventDefault();n&&n.nodeName&&"hr"===n.nodeName.toLowerCase()&&(q.remove(n),e.preventDefault())}})}function m(){window.Range.prototype.getClientRects||a.on("mousedown",function(e){if(!c(e)&&"HTML"===e.target.nodeName){var t=a.getBody();t.blur(),setTimeout(function(){t.focus()},0)}})}function g(){a.on("click",function(e){e=e.target,/^(IMG|HR)$/.test(e.nodeName)&&$.getSel().setBaseAndExtent(e,0,e,1),"A"==e.nodeName&&q.hasClass(e,"mce-item-anchor")&&$.select(e),a.nodeChanged()})}function v(){function e(){var e=q.getAttribs($.getStart().cloneNode(!1));return function(){var t=$.getStart();t!==a.getBody()&&(q.setAttrib(t,"style",null),W(e,function(e){t.setAttributeNode(e.cloneNode(!0))}))}}function t(){return!$.isCollapsed()&&q.getParent($.getStart(),q.isBlock)!=q.getParent($.getEnd(),q.isBlock)}a.on("keypress",function(n){var r;return c(n)||8!=n.keyCode&&46!=n.keyCode||!t()?void 0:(r=e(),a.getDoc().execCommand("delete",!1,null),r(),n.preventDefault(),!1)}),q.bind(a.getDoc(),"cut",function(n){var r;!c(n)&&t()&&(r=e(),setTimeout(function(){r()},0))})}function y(){var e,n;a.on("selectionchange",function(){n&&(clearTimeout(n),n=0),n=window.setTimeout(function(){if(!a.removed){var n=$.getRng();e&&t.compareRanges(n,e)||(a.nodeChanged(),e=n)}},50)})}function b(){document.body.setAttribute("role","application")}function C(){a.on("keydown",function(e){if(!c(e)&&e.keyCode===V&&$.isCollapsed()&&0===$.getRng(!0).startOffset){var t=$.getNode().previousSibling;if(t&&t.nodeName&&"table"===t.nodeName.toLowerCase())return e.preventDefault(),!1}})}function x(){l()>7||(s("RespectVisibilityInDesign",!0),a.contentStyles.push(".mceHideBrInPre pre br {display: none}"),q.addClass(a.getBody(),"mceHideBrInPre"),K.addNodeFilter("pre",function(e){for(var t=e.length,r,i,o,a;t--;)for(r=e[t].getAll("br"),i=r.length;i--;)o=r[i],a=o.prev,a&&3===a.type&&"\n"!=a.value.charAt(a.value-1)?a.value+="\n":o.parent.insert(new n("#text",3),o,!0).value="\n"}),G.addNodeFilter("pre",function(e){for(var t=e.length,n,r,i,o;t--;)for(n=e[t].getAll("br"),r=n.length;r--;)i=n[r],o=i.prev,o&&3==o.type&&(o.value=o.value.replace(/\r?\n$/,""))}))}function w(){q.bind(a.getBody(),"mouseup",function(){var e,t=$.getNode();"IMG"==t.nodeName&&((e=q.getStyle(t,"width"))&&(q.setAttrib(t,"width",e.replace(/[^0-9%]+/g,"")),q.setStyle(t,"width","")),(e=q.getStyle(t,"height"))&&(q.setAttrib(t,"height",e.replace(/[^0-9%]+/g,"")),q.setStyle(t,"height","")))})}function _(){a.on("keydown",function(t){var n,r,i,o,s;if(!c(t)&&t.keyCode==e.BACKSPACE&&(n=$.getRng(),r=n.startContainer,i=n.startOffset,o=q.getRoot(),s=r,n.collapsed&&0===i)){for(;s&&s.parentNode&&s.parentNode.firstChild==s&&s.parentNode!=o;)s=s.parentNode;"BLOCKQUOTE"===s.tagName&&(a.formatter.toggle("blockquote",null,s),n=q.createRng(),n.setStart(r,0),n.setEnd(r,0),$.setRng(n))}})}function N(){function e(){a._refreshContentEditable(),s("StyleWithCSS",!1),s("enableInlineTableEditing",!1),j.object_resizing||s("enableObjectResizing",!1)}j.readonly||a.on("BeforeExecCommand MouseDown",e)}function E(){function e(){W(q.select("a"),function(e){var t=e.parentNode,n=q.getRoot();if(t.lastChild===e){for(;t&&!q.isBlock(t);){if(t.parentNode.lastChild!==t||t===n)return;t=t.parentNode}q.add(t,"br",{"data-mce-bogus":1})}})}a.on("SetContent ExecCommand",function(t){("setcontent"==t.type||"mceInsertLink"===t.command)&&e()})}function S(){j.forced_root_block&&a.on("init",function(){s("DefaultParagraphSeparator",j.forced_root_block)})}function k(){a.on("Undo Redo SetContent",function(e){e.initial||a.execCommand("mceRepaint")})}function T(){a.on("keydown",function(e){var t;c(e)||e.keyCode!=V||(t=a.getDoc().selection.createRange(),t&&t.item&&(e.preventDefault(),a.undoManager.beforeChange(),q.remove(t.item(0)),a.undoManager.add()))})}function R(){var e;l()>=10&&(e="",W("p div h1 h2 h3 h4 h5 h6".split(" "),function(t,n){e+=(n>0?",":"")+t+":empty"}),a.contentStyles.push(e+"{padding-right: 1px !important}"))}function A(){l()<9&&(K.addNodeFilter("noscript",function(e){for(var t=e.length,n,r;t--;)n=e[t],r=n.firstChild,r&&n.attr("data-mce-innertext",r.value)}),G.addNodeFilter("noscript",function(e){for(var t=e.length,i,o,a;t--;)i=e[t],o=e[t].firstChild,o?o.value=r.decode(o.value):(a=i.attributes.map["data-mce-innertext"],a&&(i.attr("data-mce-innertext",null),o=new n("#text",3),o.value=a,o.raw=!0,i.append(o)))}))}function B(){function e(e,t){var n=i.createTextRange();try{n.moveToPoint(e,t)}catch(r){n=null}return n}function t(t){var r;t.button?(r=e(t.x,t.y),r&&(r.compareEndPoints("StartToStart",a)>0?r.setEndPoint("StartToStart",a):r.setEndPoint("EndToEnd",a),r.select())):n()}function n(){var e=r.selection.createRange();a&&!e.item&&0===e.compareEndPoints("StartToEnd",e)&&a.select(),q.unbind(r,"mouseup",n),q.unbind(r,"mousemove",t),a=o=0}var r=q.doc,i=r.body,o,a,s;r.documentElement.unselectable=!0,q.bind(r,"mousedown contextmenu",function(i){if("HTML"===i.target.nodeName){if(o&&n(),s=r.documentElement,s.scrollHeight>s.clientHeight)return;o=1,a=e(i.x,i.y),a&&(q.bind(r,"mouseup",n),q.bind(r,"mousemove",t),q.getRoot().focus(),a.select())}})}function D(){a.on("keyup focusin mouseup",function(t){65==t.keyCode&&e.metaKeyPressed(t)||$.normalize()},!0)}function L(){a.contentStyles.push("img:-moz-broken {-moz-force-broken-image-icon:1;min-width:24px;min-height:24px}")}function M(){a.inline||a.on("keydown",function(){document.activeElement==document.body&&a.getWin().focus()})}function H(){a.inline||(a.contentStyles.push("body {min-height: 150px}"),a.on("click",function(e){"HTML"==e.target.nodeName&&(a.getBody().focus(),a.selection.normalize(),a.nodeChanged())}))}function P(){i.mac&&a.on("keydown",function(t){!e.metaKeyPressed(t)||37!=t.keyCode&&39!=t.keyCode||(t.preventDefault(),a.selection.getSel().modify("move",37==t.keyCode?"backward":"forward","word"))})}function O(){s("AutoUrlDetect",!1)}function I(){a.inline||a.on("focus blur beforegetcontent",function(){var e=a.dom.create("br");a.getBody().appendChild(e),e.parentNode.removeChild(e)},!0)}function F(){a.on("click",function(e){var t=e.target;do if("A"===t.tagName)return void e.preventDefault();while(t=t.parentNode)}),a.contentStyles.push(".mce-content-body {-webkit-touch-callout: none}")}function z(){a.on("init",function(){a.dom.bind(a.getBody(),"submit",function(e){e.preventDefault()})})}var W=o.each,V=e.BACKSPACE,U=e.DELETE,q=a.dom,$=a.selection,j=a.settings,K=a.parser,G=a.serializer,Y=i.gecko,X=i.ie,J=i.webkit;C(),_(),d(),D(),J&&(u(),p(),g(),S(),z(),i.iOS?(y(),M(),H(),F()):f()),X&&i.ie<11&&(h(),b(),x(),w(),T(),R(),A(),B()),i.ie>=11&&(H(),I()),i.ie&&(f(),O()),Y&&(h(),m(),v(),N(),E(),k(),L(),P())}}),r(ot,[W],function(e){function t(t){return t._eventDispatcher||(t._eventDispatcher=new e({scope:t,toggleEvent:function(n,r){e.isNative(n)&&t.toggleNativeEvent&&t.toggleNativeEvent(n,r)}})),t._eventDispatcher}return{fire:function(e,n,r){var i=this;if(i.removed&&"remove"!==e)return n;if(n=t(i).fire(e,n,r),r!==!1&&i.parent)for(var o=i.parent();o&&!n.isPropagationStopped();)o.fire(e,n,!1),o=o.parent();return n},on:function(e,n,r){return t(this).on(e,n,r)},off:function(e,n){return t(this).off(e,n)},hasEventListeners:function(e){return t(this).has(e)}}}),r(at,[ot,y,p],function(e,t,n){function r(e,t){return"selectionchange"==t?e.getDoc():!e.inline&&/^mouse|click|contextmenu|drop/.test(t)?e.getDoc():e.getBody()}function i(e,t){var n=e.settings.event_root,i=e.editorManager,a=i.eventRootElm||r(e,t);if(n){if(i.rootEvents||(i.rootEvents={},i.on("RemoveEditor",function(){i.activeEditor||(o.unbind(a),delete i.rootEvents)})),i.rootEvents[t])return;a==e.getBody()&&(a=o.select(n)[0],i.eventRootElm=a),i.rootEvents[t]=!0,o.bind(a,t,function(e){for(var n=e.target,r=i.editors,a=r.length;a--;){var s=r[a].getBody();(s===n||o.isChildOf(n,s))&&(r[a].hidden||r[a].fire(t,e))}})}else e.dom.bind(a,t,function(n){e.hidden||e.fire(t,n)})}var o=t.DOM,a={bindPendingEventDelegates:function(){var e=this;n.each(e._pendingNativeEvents,function(t){i(e,t)})},toggleNativeEvent:function(e,t){var n=this;n.settings.readonly||"focus"!=e&&"blur"!=e&&(t?n.initialized?i(n,e):n._pendingNativeEvents?n._pendingNativeEvents.push(e):n._pendingNativeEvents=[e]:n.initialized&&n.dom.unbind(r(n,e),e))}};return a=n.extend({},e,a)}),r(st,[p,g],function(e,t){var n=e.each,r=e.explode,i={f9:120,f10:121,f11:122};return function(o){var a=this,s={};o.on("keyup keypress keydown",function(e){(e.altKey||e.ctrlKey||e.metaKey)&&n(s,function(n){var r=t.mac?e.metaKey:e.ctrlKey;if(n.ctrl==r&&n.alt==e.altKey&&n.shift==e.shiftKey)return e.keyCode==n.keyCode||e.charCode&&e.charCode==n.charCode?(e.preventDefault(),"keydown"==e.type&&n.func.call(n.scope),!0):void 0})}),a.add=function(t,a,l,c){var u;return u=l,"string"==typeof l?l=function(){o.execCommand(u,!1,null)}:e.isArray(u)&&(l=function(){o.execCommand(u[0],u[1],u[2])}),n(r(t.toLowerCase()),function(e){var t={func:l,scope:c||o,desc:o.translate(a),alt:!1,ctrl:!1,shift:!1};n(r(e,"+"),function(e){switch(e){case"alt":case"ctrl":case"shift":t[e]=!0;break;default:t.charCode=e.charCodeAt(0),t.keyCode=i[e]||e.toUpperCase().charCodeAt(0)}}),s[(t.ctrl?"ctrl":"")+","+(t.alt?"alt":"")+","+(t.shift?"shift":"")+","+t.keyCode]=t}),!0}}}),r(lt,[y,C,x,k,S,D,M,H,P,O,I,F,b,l,rt,w,N,it,g,p,at,st],function(e,n,r,i,o,a,s,l,c,u,d,f,p,h,m,g,v,y,b,C,x,w){function _(e,t,r){var i=this,o,a;o=i.documentBaseUrl=r.documentBaseURL,a=r.baseURI,i.settings=t=k({id:e,theme:"modern",delta_width:0,delta_height:0,popup_css:"",plugins:"",document_base_url:o,add_form_submit_trigger:!0,submit_patch:!0,add_unload_trigger:!0,convert_urls:!0,relative_urls:!0,remove_script_host:!0,object_resizing:!0,doctype:"<!DOCTYPE html>",visual:!0,font_size_style_values:"xx-small,x-small,small,medium,large,x-large,xx-large",font_size_legacy_values:"xx-small,small,medium,large,x-large,xx-large,300%",forced_root_block:"p",hidden_input:!0,padd_empty_editor:!0,render_ui:!0,indentation:"30px",inline_styles:!0,convert_fonts_to_spans:!0,indent:"simple",indent_before:"p,h1,h2,h3,h4,h5,h6,blockquote,div,title,style,pre,script,td,ul,li,area,table,thead,tfoot,tbody,tr,section,article,hgroup,aside,figure,option,optgroup,datalist",indent_after:"p,h1,h2,h3,h4,h5,h6,blockquote,div,title,style,pre,script,td,ul,li,area,table,thead,tfoot,tbody,tr,section,article,hgroup,aside,figure,option,optgroup,datalist",validate:!0,entity_encoding:"named",url_converter:i.convertURL,url_converter_scope:i,ie7_compat:!0},t),n.language=t.language||"en",n.languageLoad=t.language_load,n.baseURL=r.baseURL,i.id=t.id=e,i.isNotDirty=!0,i.plugins={},i.documentBaseURI=new f(t.document_base_url||o,{base_uri:a}),i.baseURI=a,i.contentCSS=[],i.contentStyles=[],i.shortcuts=new w(i),i.execCommands={},i.queryStateCommands={},i.queryValueCommands={},i.loadedCSS={},i.suffix=r.suffix,i.editorManager=r,i.inline=t.inline,r.fire("SetupEditor",i),i.execCallback("setup",i)}var N=e.DOM,E=n.ThemeManager,S=n.PluginManager,k=C.extend,T=C.each,R=C.explode,A=C.inArray,B=C.trim,D=C.resolve,L=h.Event,M=b.gecko,H=b.ie;return _.prototype={render:function(){function e(){N.unbind(window,"ready",e),n.render()}function t(){var e=p.ScriptLoader;if(r.language&&"en"!=r.language&&!r.language_url&&(r.language_url=n.editorManager.baseURL+"/langs/"+r.language+".js"),r.language_url&&e.add(r.language_url),r.theme&&"function"!=typeof r.theme&&"-"!=r.theme.charAt(0)&&!E.urls[r.theme]){var t=r.theme_url;t=t?n.documentBaseURI.toAbsolute(t):"themes/"+r.theme+"/theme"+o+".js",E.load(r.theme,t)}C.isArray(r.plugins)&&(r.plugins=r.plugins.join(" ")),T(r.external_plugins,function(e,t){S.load(t,e),r.plugins+=" "+t}),T(r.plugins.split(/[ ,]/),function(e){if(e=B(e),e&&!S.urls[e])if("-"==e.charAt(0)){e=e.substr(1,e.length);var t=S.dependencies(e);T(t,function(e){var t={prefix:"plugins/",resource:e,suffix:"/plugin"+o+".js"};e=S.createUrl(t,e),S.load(e.resource,e)})}else S.load(e,{prefix:"plugins/",resource:e,suffix:"/plugin"+o+".js"})}),e.loadQueue(function(){n.removed||n.init()})}var n=this,r=n.settings,i=n.id,o=n.suffix;if(!L.domLoaded)return void N.bind(window,"ready",e);if(n.getElement()&&b.contentEditable){r.inline?n.inline=!0:(n.orgVisibility=n.getElement().style.visibility,n.getElement().style.visibility="hidden");var a=n.getElement().form||N.getParent(i,"form");a&&(n.formElement=a,r.hidden_input&&!/TEXTAREA|INPUT/i.test(n.getElement().nodeName)&&(N.insertAfter(N.create("input",{type:"hidden",name:i}),i),n.hasHiddenInput=!0),n.formEventDelegate=function(e){n.fire(e.type,e)},N.bind(a,"submit reset",n.formEventDelegate),n.on("reset",function(){n.setContent(n.startContent,{format:"raw"})}),!r.submit_patch||a.submit.nodeType||a.submit.length||a._mceOldSubmit||(a._mceOldSubmit=a.submit,a.submit=function(){return n.editorManager.triggerSave(),n.isNotDirty=!0,a._mceOldSubmit(a)})),n.windowManager=new m(n),"xml"==r.encoding&&n.on("GetContent",function(e){e.save&&(e.content=N.encode(e.content))}),r.add_form_submit_trigger&&n.on("submit",function(){n.initialized&&n.save()}),r.add_unload_trigger&&(n._beforeUnload=function(){!n.initialized||n.destroyed||n.isHidden()||n.save({format:"raw",no_events:!0,set_dirty:!1})},n.editorManager.on("BeforeUnload",n._beforeUnload)),t()}},init:function(){function e(n){var r=S.get(n),i,o;i=S.urls[n]||t.documentBaseUrl.replace(/\/$/,""),n=B(n),r&&-1===A(m,n)&&(T(S.dependencies(n),function(t){e(t)}),o=new r(t,i),t.plugins[n]=o,o.init&&(o.init(t,i),m.push(n)))}var t=this,n=t.settings,r=t.getElement(),i,o,a,s,l,c,u,d,f,p,h,m=[];if(t.rtl=this.editorManager.i18n.rtl,t.editorManager.add(t),n.aria_label=n.aria_label||N.getAttrib(r,"aria-label",t.getLang("aria.rich_text_area")),n.theme&&("function"!=typeof n.theme?(n.theme=n.theme.replace(/-/,""),c=E.get(n.theme),t.theme=new c(t,E.urls[n.theme]),t.theme.init&&t.theme.init(t,E.urls[n.theme]||t.documentBaseUrl.replace(/\/$/,""))):t.theme=n.theme),T(n.plugins.replace(/\-/g,"").split(/[ ,]/),e),n.render_ui&&t.theme&&(t.orgDisplay=r.style.display,"function"!=typeof n.theme?(i=n.width||r.style.width||r.offsetWidth,o=n.height||r.style.height||r.offsetHeight,a=n.min_height||100,p=/^[0-9\.]+(|px)$/i,p.test(""+i)&&(i=Math.max(parseInt(i,10),100)),p.test(""+o)&&(o=Math.max(parseInt(o,10),a)),l=t.theme.renderUI({targetNode:r,width:i,height:o,deltaWidth:n.delta_width,deltaHeight:n.delta_height}),n.content_editable||(N.setStyles(l.sizeContainer||l.editorContainer,{wi2dth:i,h2eight:o}),o=(l.iframeHeight||o)+("number"==typeof o?l.deltaHeight||0:""),a>o&&(o=a))):(l=n.theme(t,r),l.editorContainer.nodeType&&(l.editorContainer=l.editorContainer.id=l.editorContainer.id||t.id+"_parent"),l.iframeContainer.nodeType&&(l.iframeContainer=l.iframeContainer.id=l.iframeContainer.id||t.id+"_iframecontainer"),o=l.iframeHeight||r.offsetHeight),t.editorContainer=l.editorContainer),n.content_css&&T(R(n.content_css),function(e){t.contentCSS.push(t.documentBaseURI.toAbsolute(e))}),n.content_style&&t.contentStyles.push(n.content_style),n.content_editable)return r=s=l=null,t.initContentBody();for(t.iframeHTML=n.doctype+"<html><head>",n.document_base_url!=t.documentBaseUrl&&(t.iframeHTML+='<base href="'+t.documentBaseURI.getURI()+'" />'),!b.caretAfter&&n.ie7_compat&&(t.iframeHTML+='<meta http-equiv="X-UA-Compatible" content="IE=7" />'),t.iframeHTML+='<meta http-equiv="Content-Type" content="text/html; charset=UTF-8" />',h=0;h<t.contentCSS.length;h++){var g=t.contentCSS[h];t.iframeHTML+='<link type="text/css" rel="stylesheet" href="'+g+'" />',t.loadedCSS[g]=!0}d=n.body_id||"tinymce",-1!=d.indexOf("=")&&(d=t.getParam("body_id","","hash"),d=d[t.id]||d),f=n.body_class||"",-1!=f.indexOf("=")&&(f=t.getParam("body_class","","hash"),f=f[t.id]||""),t.iframeHTML+='</head><body id="'+d+'" class="mce-content-body '+f+'" onload="window.parent.tinymce.get(\''+t.id+"').fire('load');\"><br></body></html>";var v='javascript:(function(){document.open();document.domain="'+document.domain+'";var ed = window.parent.tinymce.get("'+t.id+'");document.write(ed.iframeHTML);document.close();ed.initContentBody(true);})()';if(document.domain!=location.hostname&&(u=v),s=N.add(l.iframeContainer,"iframe",{id:t.id+"_ifr",src:u||'javascript:""',frameBorder:"0",allowTransparency:"true",title:t.editorManager.translate("Rich Text Area. Press ALT-F9 for menu. Press ALT-F10 for toolbar. Press ALT-0 for help"),style:{width:"100%",height:o,display:"block"}}),H)try{t.getDoc()}catch(y){s.src=u=v}t.contentAreaContainer=l.iframeContainer,l.editorContainer&&(N.get(l.editorContainer).style.display=t.orgDisplay),N.get(t.id).style.display="none",N.setAttrib(t.id,"aria-hidden",!0),u||t.initContentBody(),r=s=l=null},initContentBody:function(t){var n=this,o=n.settings,f=N.get(n.id),p=n.getDoc(),h,m;o.inline||(n.getElement().style.visibility=n.orgVisibility),t||o.content_editable||(p.open(),p.write(n.iframeHTML),p.close()),o.content_editable&&(n.on("remove",function(){var e=this.getBody();N.removeClass(e,"mce-content-body"),N.removeClass(e,"mce-edit-focus"),N.setAttrib(e,"contentEditable",null)}),N.addClass(f,"mce-content-body"),n.contentDocument=p=o.content_document||document,n.contentWindow=o.content_window||window,n.bodyElement=f,o.content_document=o.content_window=null,o.root_name=f.nodeName.toLowerCase()),h=n.getBody(),h.disabled=!0,o.readonly||(n.inline&&"static"==N.getStyle(h,"position",!0)&&(h.style.position="relative"),h.contentEditable=n.getParam("content_editable_state",!0)),h.disabled=!1,n.schema=new g(o),n.dom=new e(p,{keep_values:!0,url_converter:n.convertURL,url_converter_scope:n,hex_colors:o.force_hex_style_colors,class_filter:o.class_filter,update_styles:!0,root_element:o.content_editable?n.id:null,collect:o.content_editable,schema:n.schema,onSetAttrib:function(e){n.fire("SetAttrib",e) +}}),n.parser=new v(o,n.schema),n.parser.addAttributeFilter("src,href,style,tabindex",function(e,t){for(var r=e.length,i,o=n.dom,a,s;r--;)i=e[r],a=i.attr(t),s="data-mce-"+t,i.attributes.map[s]||("style"===t?i.attr(s,o.serializeStyle(o.parseStyle(a),i.name)):"tabindex"===t?(i.attr(s,a),i.attr(t,null)):i.attr(s,n.convertURL(a,t,i.name)))}),n.parser.addNodeFilter("script",function(e){for(var t=e.length,n;t--;)n=e[t],n.attr("type","mce-"+(n.attr("type")||"text/javascript"))}),n.parser.addNodeFilter("#cdata",function(e){for(var t=e.length,n;t--;)n=e[t],n.type=8,n.name="#comment",n.value="[CDATA["+n.value+"]]"}),n.parser.addNodeFilter("p,h1,h2,h3,h4,h5,h6,div",function(e){for(var t=e.length,i,o=n.schema.getNonEmptyElements();t--;)i=e[t],i.isEmpty(o)&&(i.empty().append(new r("br",1)).shortEnded=!0)}),n.serializer=new i(o,n),n.selection=new a(n.dom,n.getWin(),n.serializer,n),n.formatter=new s(n),n.undoManager=new l(n),n.forceBlocks=new u(n),n.enterKey=new c(n),n.editorCommands=new d(n),n.fire("PreInit"),o.browser_spellcheck||o.gecko_spellcheck||(p.body.spellcheck=!1,N.setAttrib(h,"spellcheck","false")),n.fire("PostRender"),n.quirks=y(n),o.directionality&&(h.dir=o.directionality),o.nowrap&&(h.style.whiteSpace="nowrap"),o.protect&&n.on("BeforeSetContent",function(e){T(o.protect,function(t){e.content=e.content.replace(t,function(e){return"<!--mce:protected "+escape(e)+"-->"})})}),n.on("SetContent",function(){n.addVisual(n.getBody())}),o.padd_empty_editor&&n.on("PostProcess",function(e){e.content=e.content.replace(/^(<p[^>]*>( | |\s|\u00a0|)<\/p>[\r\n]*|<br \/>[\r\n]*)$/,"")}),n.load({initial:!0,format:"html"}),n.startContent=n.getContent({format:"raw"}),n.initialized=!0,n.bindPendingEventDelegates(),n.fire("init"),n.focus(!0),n.nodeChanged({initial:!0}),n.execCallback("init_instance_callback",n),n.contentStyles.length>0&&(m="",T(n.contentStyles,function(e){m+=e+"\r\n"}),n.dom.addStyle(m)),T(n.contentCSS,function(e){n.loadedCSS[e]||(n.dom.loadCSS(e),n.loadedCSS[e]=!0)}),o.auto_focus&&setTimeout(function(){var e=n.editorManager.get(o.auto_focus);e.selection.select(e.getBody(),1),e.selection.collapse(1),e.getBody().focus(),e.getWin().focus()},100),f=p=h=null},focus:function(e){var t,n=this,r=n.selection,i=n.settings.content_editable,o,a,s=n.getDoc(),l;if(!e){if(o=r.getRng(),o.item&&(a=o.item(0)),n._refreshContentEditable(),i||(b.opera||n.getBody().focus(),n.getWin().focus()),M||i){if(l=n.getBody(),l.setActive)try{l.setActive()}catch(c){l.focus()}else l.focus();i&&r.normalize()}a&&a.ownerDocument==s&&(o=s.body.createControlRange(),o.addElement(a),o.select())}n.editorManager.activeEditor!=n&&((t=n.editorManager.activeEditor)&&t.fire("deactivate",{relatedTarget:n}),n.fire("activate",{relatedTarget:t})),n.editorManager.activeEditor=n},execCallback:function(e){var t=this,n=t.settings[e],r;if(n)return t.callbackLookup&&(r=t.callbackLookup[e])&&(n=r.func,r=r.scope),"string"==typeof n&&(r=n.replace(/\.\w+$/,""),r=r?D(r):0,n=D(n),t.callbackLookup=t.callbackLookup||{},t.callbackLookup[e]={func:n,scope:r}),n.apply(r||t,Array.prototype.slice.call(arguments,1))},translate:function(e){var t=this.settings.language||"en",n=this.editorManager.i18n;return e?n.data[t+"."+e]||e.replace(/\{\#([^\}]+)\}/g,function(e,r){return n.data[t+"."+r]||"{#"+r+"}"}):""},getLang:function(e,n){return this.editorManager.i18n.data[(this.settings.language||"en")+"."+e]||(n!==t?n:"{#"+e+"}")},getParam:function(e,t,n){var r=e in this.settings?this.settings[e]:t,i;return"hash"===n?(i={},"string"==typeof r?T(r.split(r.indexOf("=")>0?/[;,](?![^=;,]*(?:[;,]|$))/:","),function(e){e=e.split("="),i[B(e[0])]=B(e.length>1?e[1]:e)}):i=r,i):r},nodeChanged:function(){var e=this,t=e.selection,n,r,i;!e.initialized||e.settings.disable_nodechange||e.settings.readonly||(i=e.getBody(),n=t.getStart()||i,n=H&&n.ownerDocument!=e.getDoc()?e.getBody():n,"IMG"==n.nodeName&&t.isCollapsed()&&(n=n.parentNode),r=[],e.dom.getParent(n,function(e){return e===i?!0:void r.push(e)}),e.fire("NodeChange",{element:n,parents:r}))},addButton:function(e,t){var n=this;t.cmd&&(t.onclick=function(){n.execCommand(t.cmd)}),t.text||t.icon||(t.icon=e),n.buttons=n.buttons||{},t.tooltip=t.tooltip||t.title,n.buttons[e]=t},addMenuItem:function(e,t){var n=this;t.cmd&&(t.onclick=function(){n.execCommand(t.cmd)}),n.menuItems=n.menuItems||{},n.menuItems[e]=t},addCommand:function(e,t,n){this.execCommands[e]={func:t,scope:n||this}},addQueryStateHandler:function(e,t,n){this.queryStateCommands[e]={func:t,scope:n||this}},addQueryValueHandler:function(e,t,n){this.queryValueCommands[e]={func:t,scope:n||this}},addShortcut:function(e,t,n,r){this.shortcuts.add(e,t,n,r)},execCommand:function(e,t,n,r){var i=this,o=0,a;return/^(mceAddUndoLevel|mceEndUndoLevel|mceBeginUndoLevel|mceRepaint)$/.test(e)||r&&r.skip_focus||i.focus(),r=k({},r),r=i.fire("BeforeExecCommand",{command:e,ui:t,value:n}),r.isDefaultPrevented()?!1:(a=i.execCommands[e])&&a.func.call(a.scope,t,n)!==!0?(i.fire("ExecCommand",{command:e,ui:t,value:n}),!0):(T(i.plugins,function(r){return r.execCommand&&r.execCommand(e,t,n)?(i.fire("ExecCommand",{command:e,ui:t,value:n}),o=!0,!1):void 0}),o?o:i.theme&&i.theme.execCommand&&i.theme.execCommand(e,t,n)?(i.fire("ExecCommand",{command:e,ui:t,value:n}),!0):i.editorCommands.execCommand(e,t,n)?(i.fire("ExecCommand",{command:e,ui:t,value:n}),!0):(i.getDoc().execCommand(e,t,n),void i.fire("ExecCommand",{command:e,ui:t,value:n})))},queryCommandState:function(e){var t=this,n,r;if(!t._isHidden()){if((n=t.queryStateCommands[e])&&(r=n.func.call(n.scope),r!==!0))return r;if(r=t.editorCommands.queryCommandState(e),-1!==r)return r;try{return t.getDoc().queryCommandState(e)}catch(i){}}},queryCommandValue:function(e){var n=this,r,i;if(!n._isHidden()){if((r=n.queryValueCommands[e])&&(i=r.func.call(r.scope),i!==!0))return i;if(i=n.editorCommands.queryCommandValue(e),i!==t)return i;try{return n.getDoc().queryCommandValue(e)}catch(o){}}},show:function(){var e=this;e.hidden&&(e.hidden=!1,e.inline?e.getBody().contentEditable=!0:(N.show(e.getContainer()),N.hide(e.id)),e.load(),e.fire("show"))},hide:function(){var e=this,t=e.getDoc();e.hidden||(e.hidden=!0,H&&t&&!e.inline&&t.execCommand("SelectAll"),e.save(),e.inline?(e.getBody().contentEditable=!1,e==e.editorManager.focusedEditor&&(e.editorManager.focusedEditor=null)):(N.hide(e.getContainer()),N.setStyle(e.id,"display",e.orgDisplay)),e.fire("hide"))},isHidden:function(){return!!this.hidden},setProgressState:function(e,t){this.fire("ProgressState",{state:e,time:t})},load:function(e){var n=this,r=n.getElement(),i;return r?(e=e||{},e.load=!0,i=n.setContent(r.value!==t?r.value:r.innerHTML,e),e.element=r,e.no_events||n.fire("LoadContent",e),e.element=r=null,i):void 0},save:function(e){var t=this,n=t.getElement(),r,i;if(n&&t.initialized)return e=e||{},e.save=!0,e.element=n,r=e.content=t.getContent(e),e.no_events||t.fire("SaveContent",e),r=e.content,/TEXTAREA|INPUT/i.test(n.nodeName)?n.value=r:(t.inline||(n.innerHTML=r),(i=N.getParent(t.id,"form"))&&T(i.elements,function(e){return e.name==t.id?(e.value=r,!1):void 0})),e.element=n=null,e.set_dirty!==!1&&(t.isNotDirty=!0),r},setContent:function(e,t){var n=this,r=n.getBody(),i;return t=t||{},t.format=t.format||"html",t.set=!0,t.content=e,t.no_events||n.fire("BeforeSetContent",t),e=t.content,0===e.length||/^\s+$/.test(e)?(i=n.settings.forced_root_block,i&&n.schema.isValidChild(r.nodeName.toLowerCase(),i.toLowerCase())?(e=H&&11>H?"":'<br data-mce-bogus="1">',e=n.dom.createHTML(i,n.settings.forced_root_block_attrs,e)):H||(e='<br data-mce-bogus="1">'),r.innerHTML=e,n.fire("SetContent",t)):("raw"!==t.format&&(e=new o({},n.schema).serialize(n.parser.parse(e,{isRootContent:!0}))),t.content=B(e),n.dom.setHTML(r,t.content),t.no_events||n.fire("SetContent",t)),t.content},getContent:function(e){var t=this,n,r=t.getBody();return e=e||{},e.format=e.format||"html",e.get=!0,e.getInner=!0,e.no_events||t.fire("BeforeGetContent",e),n="raw"==e.format?r.innerHTML:"text"==e.format?r.innerText||r.textContent:t.serializer.serialize(r,e),e.content="text"!=e.format?B(n):n,e.no_events||t.fire("GetContent",e),e.content},insertContent:function(e){this.execCommand("mceInsertContent",!1,e)},isDirty:function(){return!this.isNotDirty},getContainer:function(){var e=this;return e.container||(e.container=N.get(e.editorContainer||e.id+"_parent")),e.container},getContentAreaContainer:function(){return this.contentAreaContainer},getElement:function(){return N.get(this.settings.content_element||this.id)},getWin:function(){var e=this,t;return e.contentWindow||(t=N.get(e.id+"_ifr"),t&&(e.contentWindow=t.contentWindow)),e.contentWindow},getDoc:function(){var e=this,t;return e.contentDocument||(t=e.getWin(),t&&(e.contentDocument=t.document)),e.contentDocument},getBody:function(){return this.bodyElement||this.getDoc().body},convertURL:function(e,t,n){var r=this,i=r.settings;return i.urlconverter_callback?r.execCallback("urlconverter_callback",e,n,!0,t):!i.convert_urls||n&&"LINK"==n.nodeName||0===e.indexOf("file:")||0===e.length?e:i.relative_urls?r.documentBaseURI.toRelative(e):e=r.documentBaseURI.toAbsolute(e,i.remove_script_host)},addVisual:function(e){var n=this,r=n.settings,i=n.dom,o;e=e||n.getBody(),n.hasVisual===t&&(n.hasVisual=r.visual),T(i.select("table,a",e),function(e){var t;switch(e.nodeName){case"TABLE":return o=r.visual_table_class||"mce-item-table",t=i.getAttrib(e,"border"),void(t&&"0"!=t||(n.hasVisual?i.addClass(e,o):i.removeClass(e,o)));case"A":return void(i.getAttrib(e,"href",!1)||(t=i.getAttrib(e,"name")||e.id,o=r.visual_anchor_class||"mce-item-anchor",t&&(n.hasVisual?i.addClass(e,o):i.removeClass(e,o))))}}),n.fire("VisualAid",{element:e,hasVisual:n.hasVisual})},remove:function(){var e=this;if(!e.removed){e.removed=1,e.save(),e.hasHiddenInput&&N.remove(e.getElement().nextSibling),e.inline||(H&&10>H&&e.getDoc().execCommand("SelectAll",!1,null),N.setStyle(e.id,"display",e.orgDisplay),e.getBody().onload=null,L.unbind(e.getWin()),L.unbind(e.getDoc()));var t=e.getContainer();L.unbind(e.getBody()),L.unbind(t),e.fire("remove"),e.editorManager.remove(e),N.remove(t),e.destroy()}},destroy:function(e){var t=this,n;if(!t.destroyed){if(!e&&!t.removed)return void t.remove();e&&M&&(L.unbind(t.getDoc()),L.unbind(t.getWin()),L.unbind(t.getBody())),e||(t.editorManager.off("beforeunload",t._beforeUnload),t.theme&&t.theme.destroy&&t.theme.destroy(),t.selection.destroy(),t.dom.destroy()),n=t.formElement,n&&(n._mceOldSubmit&&(n.submit=n._mceOldSubmit,n._mceOldSubmit=null),N.unbind(n,"submit reset",t.formEventDelegate)),t.contentAreaContainer=t.formElement=t.container=t.editorContainer=null,t.settings.content_element=t.bodyElement=t.contentDocument=t.contentWindow=null,t.selection&&(t.selection=t.selection.win=t.selection.dom=t.selection.dom.doc=null),t.destroyed=1}},_refreshContentEditable:function(){var e=this,t,n;e._isHidden()&&(t=e.getBody(),n=t.parentNode,n.removeChild(t),n.appendChild(t),t.focus())},_isHidden:function(){var e;return M?(e=this.selection.getSel(),!e||!e.rangeCount||0===e.rangeCount):0}},k(_.prototype,x),_}),r(ct,[],function(){var e={};return{rtl:!1,add:function(t,n){for(var r in n)e[r]=n[r];this.rtl=this.rtl||"rtl"===e._dir},translate:function(t){if("undefined"==typeof t)return t;if("string"!=typeof t&&t.raw)return t.raw;if(t.push){var n=t.slice(1);t=(e[t[0]]||t[0]).replace(/\{([^\}]+)\}/g,function(e,t){return n[t]})}return e[t]||t},data:e}}),r(ut,[y,g],function(e,t){function n(e){function s(){try{return document.activeElement}catch(e){return document.body}}function l(e,t){if(t&&t.startContainer){if(!e.isChildOf(t.startContainer,e.getRoot())||!e.isChildOf(t.endContainer,e.getRoot()))return;return{startContainer:t.startContainer,startOffset:t.startOffset,endContainer:t.endContainer,endOffset:t.endOffset}}return t}function c(e,t){var n;return t.startContainer?(n=e.getDoc().createRange(),n.setStart(t.startContainer,t.startOffset),n.setEnd(t.endContainer,t.endOffset)):n=t,n}function u(e){return!!a.getParent(e,n.isEditorUIElement)}function d(n){var d=n.editor;d.on("init",function(){(d.inline||t.ie)&&(d.on("nodechange keyup",function(){var e=document.activeElement;e&&e.id==d.id+"_ifr"&&(e=d.getBody()),d.dom.isChildOf(e,d.getBody())&&(d.lastRng=d.selection.getRng())}),t.webkit&&!r&&(r=function(){var t=e.activeEditor;if(t&&t.selection){var n=t.selection.getRng();n&&!n.collapsed&&(d.lastRng=n)}},a.bind(document,"selectionchange",r)))}),d.on("setcontent",function(){d.lastRng=null}),d.on("mousedown",function(){d.selection.lastFocusBookmark=null}),d.on("focusin",function(){var t=e.focusedEditor;d.selection.lastFocusBookmark&&(d.selection.setRng(c(d,d.selection.lastFocusBookmark)),d.selection.lastFocusBookmark=null),t!=d&&(t&&t.fire("blur",{focusedEditor:d}),e.activeEditor=d,e.focusedEditor=d,d.fire("focus",{blurredEditor:t}),d.focus(!0)),d.lastRng=null}),d.on("focusout",function(){window.setTimeout(function(){var t=e.focusedEditor;u(s())||t!=d||(d.fire("blur",{focusedEditor:null}),e.focusedEditor=null,d.selection&&(d.selection.lastFocusBookmark=null))},0)}),i||(i=function(t){var n=e.activeEditor;n&&t.target.ownerDocument==document&&(n.selection&&(n.selection.lastFocusBookmark=l(n.dom,n.lastRng)),u(t.target)||e.focusedEditor!=n||(n.fire("blur",{focusedEditor:null}),e.focusedEditor=null))},a.bind(document,"focusin",i)),d.inline&&!o&&(o=function(t){var n=e.activeEditor;if(n.inline&&!n.dom.isChildOf(t.target,n.getBody())){var r=n.selection.getRng();r.collapsed||(n.lastRng=r)}},a.bind(document,"mouseup",o))}function f(t){e.focusedEditor==t.editor&&(e.focusedEditor=null),e.activeEditor||(a.unbind(document,"selectionchange",r),a.unbind(document,"focusin",i),a.unbind(document,"mouseup",o),r=i=o=null)}e.on("AddEditor",d),e.on("RemoveEditor",f)}var r,i,o,a=e.DOM;return n.isEditorUIElement=function(e){return-1!==e.className.toString().indexOf("mce-")},n}),r(dt,[lt,y,F,g,p,ot,ct,ut],function(e,t,n,r,i,o,a,s){function l(e){var t=g.editors,n;delete t[e.id];for(var r=0;r<t.length;r++)if(t[r]==e){t.splice(r,1),n=!0;break}return g.activeEditor==e&&(g.activeEditor=t[0]),g.focusedEditor==e&&(g.focusedEditor=null),n}function c(e){return e&&!(e.getContainer()||e.getBody()).parentNode&&(l(e),e.destroy(!0),e=null),e}var u=t.DOM,d=i.explode,f=i.each,p=i.extend,h=0,m,g;return g={majorVersion:"4",minorVersion:"0.26",releaseDate:"2014-05-06",editors:[],i18n:a,activeEditor:null,setup:function(){var e=this,t,r,i="",o,a;if(r=document.location.href.replace(/[\?#].*$/,"").replace(/[\/\\][^\/]+$/,""),/[\/\\]$/.test(r)||(r+="/"),o=window.tinymce||window.tinyMCEPreInit)t=o.base||o.baseURL,i=o.suffix;else{for(var l=document.getElementsByTagName("script"),c=0;c<l.length;c++)if(a=l[c].src,/tinymce(\.full|\.jquery|)(\.min|\.dev|)\.js/.test(a)){-1!=a.indexOf(".min")&&(i=".min"),t=a.substring(0,a.lastIndexOf("/"));break}!t&&document.currentScript&&(a=document.currentScript.src,-1!=a.indexOf(".min")&&(i=".min"),t=a.substring(0,a.lastIndexOf("/")))}e.baseURL=new n(r).toAbsolute(t),e.documentBaseURL=r,e.baseURI=new n(e.baseURL),e.suffix=i,e.focusManager=new s(e)},init:function(t){function n(e){var t=e.id;return t||(t=e.name,t=t&&!u.get(t)?e.name:u.uniqueId(),e.setAttribute("id",t)),t}function r(t,n){if(!c(s.get(t))){var r=new e(t,n,s);l.push(r),r.render()}}function i(e,t,n){var r=e[t];if(r)return r.apply(n||this,Array.prototype.slice.call(arguments,2))}function o(e,t){return t.constructor===RegExp?t.test(e.className):u.hasClass(e,t)}function a(){var c,g;if(u.unbind(window,"ready",a),i(t,"onpageload"),t.types)return void f(t.types,function(e){f(u.select(e.selector),function(i){r(n(i),p({},t,e))})});if(t.selector)return void f(u.select(t.selector),function(e){r(n(e),t)});switch(t.mode){case"exact":c=t.elements||"",c.length>0&&f(d(c),function(n){u.get(n)?(m=new e(n,t,s),l.push(m),m.render()):f(document.forms,function(e){f(e.elements,function(e){e.name===n&&(n="mce_editor_"+h++,u.setAttrib(e,"id",n),r(n,t))})})});break;case"textareas":case"specific_textareas":f(u.select("textarea"),function(e){t.editor_deselector&&o(e,t.editor_deselector)||(!t.editor_selector||o(e,t.editor_selector))&&r(n(e),t)})}t.oninit&&(c=g=0,f(l,function(e){g++,e.initialized?c++:e.on("init",function(){c++,c==g&&i(t,"oninit")}),c==g&&i(t,"oninit")}))}var s=this,l=[],m;s.settings=t,u.bind(window,"ready",a)},get:function(e){return arguments.length?e in this.editors?this.editors[e]:null:this.editors},add:function(e){var t=this,n=t.editors;return n[e.id]=e,n.push(e),t.activeEditor=e,t.fire("AddEditor",{editor:e}),m||(m=function(){t.fire("BeforeUnload")},u.bind(window,"beforeunload",m)),e},createEditor:function(t,n){return this.add(new e(t,n,this))},remove:function(e){var t=this,n,r=t.editors,i;{if(e)return"string"==typeof e?(e=e.selector||e,void f(u.select(e),function(e){t.remove(r[e.id])})):(i=e,r[i.id]?(l(i)&&t.fire("RemoveEditor",{editor:i}),r.length||u.unbind(window,"beforeunload",m),i.remove(),i):null);for(n=r.length-1;n>=0;n--)t.remove(r[n])}},execCommand:function(t,n,r){var i=this,o=i.get(r);switch(t){case"mceAddEditor":return i.get(r)||new e(r,i.settings,i).render(),!0;case"mceRemoveEditor":return o&&o.remove(),!0;case"mceToggleEditor":return o?(o.isHidden()?o.show():o.hide(),!0):(i.execCommand("mceAddEditor",0,r),!0)}return i.activeEditor?i.activeEditor.execCommand(t,n,r):!1},triggerSave:function(){f(this.editors,function(e){e.save()})},addI18n:function(e,t){a.add(e,t)},translate:function(e){return a.translate(e)}},p(g,o),g.setup(),window.tinymce=window.tinyMCE=g,g}),r(ft,[dt,p],function(e,t){var n=t.each,r=t.explode;e.on("AddEditor",function(e){var t=e.editor;t.on("preInit",function(){function e(e,t){n(t,function(t,n){t&&s.setStyle(e,n,t)}),s.rename(e,"span")}function i(e){s=t.dom,l.convert_fonts_to_spans&&n(s.select("font,u,strike",e.node),function(e){o[e.nodeName.toLowerCase()](s,e)})}var o,a,s,l=t.settings;l.inline_styles&&(a=r(l.font_size_legacy_values),o={font:function(t,n){e(n,{backgroundColor:n.style.backgroundColor,color:n.color,fontFamily:n.face,fontSize:a[parseInt(n.size,10)-1]})},u:function(t,n){e(n,{textDecoration:"underline"})},strike:function(t,n){e(n,{textDecoration:"line-through"})}},t.on("PreProcess SetContent",i))})})}),r(pt,[],function(){return{send:function(e){function t(){!e.async||4==n.readyState||r++>1e4?(e.success&&1e4>r&&200==n.status?e.success.call(e.success_scope,""+n.responseText,n,e):e.error&&e.error.call(e.error_scope,r>1e4?"TIMED_OUT":"GENERAL",n,e),n=null):setTimeout(t,10)}var n,r=0;if(e.scope=e.scope||this,e.success_scope=e.success_scope||e.scope,e.error_scope=e.error_scope||e.scope,e.async=e.async===!1?!1:!0,e.data=e.data||"",n=new XMLHttpRequest){if(n.overrideMimeType&&n.overrideMimeType(e.content_type),n.open(e.type||(e.data?"POST":"GET"),e.url,e.async),e.content_type&&n.setRequestHeader("Content-Type",e.content_type),n.setRequestHeader("X-Requested-With","XMLHttpRequest"),n.send(e.data),!e.async)return t();setTimeout(t,10)}}}}),r(ht,[],function(){function e(t,n){var r,i,o,a;if(n=n||'"',null===t)return"null";if(o=typeof t,"string"==o)return i="\bb t\nn\ff\rr\"\"''\\\\",n+t.replace(/([\u0080-\uFFFF\x00-\x1f\"\'\\])/g,function(e,t){return'"'===n&&"'"===e?e:(r=i.indexOf(t),r+1?"\\"+i.charAt(r+1):(e=t.charCodeAt().toString(16),"\\u"+"0000".substring(e.length)+e))})+n;if("object"==o){if(t.hasOwnProperty&&"[object Array]"===Object.prototype.toString.call(t)){for(r=0,i="[";r<t.length;r++)i+=(r>0?",":"")+e(t[r],n);return i+"]"}i="{";for(a in t)t.hasOwnProperty(a)&&(i+="function"!=typeof t[a]?(i.length>1?","+n:n)+a+n+":"+e(t[a],n):"");return i+"}"}return""+t}return{serialize:e,parse:function(e){try{return window[String.fromCharCode(101)+"val"]("("+e+")")}catch(t){}}}}),r(mt,[ht,pt,p],function(e,t,n){function r(e){this.settings=i({},e),this.count=0}var i=n.extend;return r.sendRPC=function(e){return(new r).send(e)},r.prototype={send:function(n){var r=n.error,o=n.success;n=i(this.settings,n),n.success=function(t,i){t=e.parse(t),"undefined"==typeof t&&(t={error:"JSON Parse error."}),t.error?r.call(n.error_scope||n.scope,t.error,i):o.call(n.success_scope||n.scope,t.result)},n.error=function(e,t){r&&r.call(n.error_scope||n.scope,e,t)},n.data=e.serialize({id:n.id||"c"+this.count++,method:n.method,params:n.params}),n.content_type="application/json",t.send(n)}},r}),r(gt,[y],function(e){return{callbacks:{},count:0,send:function(n){var r=this,i=e.DOM,o=n.count!==t?n.count:r.count,a="tinymce_jsonp_"+o;r.callbacks[o]=function(e){i.remove(a),delete r.callbacks[o],n.callback(e)},i.add(i.doc.body,"script",{id:a,src:n.url,type:"text/javascript"}),r.count++}}}),r(vt,[],function(){function e(){s=[];for(var e in a)s.push(e);i.length=s.length}function n(){function n(e){var n,r;return r=e!==t?u+e:i.indexOf(",",u),-1===r||r>i.length?null:(n=i.substring(u,r),u=r+1,n)}var r,i,s,u=0;if(a={},c){o.load(l),i=o.getAttribute(l)||"";do{var d=n();if(null===d)break;if(r=n(parseInt(d,32)||0),null!==r){if(d=n(),null===d)break;s=n(parseInt(d,32)||0),r&&(a[r]=s)}}while(null!==r);e()}}function r(){var t,n="";if(c){for(var r in a)t=a[r],n+=(n?",":"")+r.length.toString(32)+","+r+","+t.length.toString(32)+","+t;o.setAttribute(l,n);try{o.save(l)}catch(i){}e()}}var i,o,a,s,l,c;try{if(window.localStorage)return localStorage}catch(u){}return l="tinymce",o=document.documentElement,c=!!o.addBehavior,c&&o.addBehavior("#default#userData"),i={key:function(e){return s[e]},getItem:function(e){return e in a?a[e]:null},setItem:function(e,t){a[e]=""+t,r()},removeItem:function(e){delete a[e],r()},clear:function(){a={},r()}},n(),i}),r(yt,[y,l,b,C,p,g],function(e,t,n,r,i,o){var a=window.tinymce;return a.DOM=e.DOM,a.ScriptLoader=n.ScriptLoader,a.PluginManager=r.PluginManager,a.ThemeManager=r.ThemeManager,a.dom=a.dom||{},a.dom.Event=t.Event,i.each(i,function(e,t){a[t]=e}),i.each("isOpera isWebKit isIE isGecko isMac".split(" "),function(e){a[e]=o[e.substr(2).toLowerCase()]}),{}}),r(bt,[z,p],function(e,t){return e.extend({Defaults:{firstControlClass:"first",lastControlClass:"last"},init:function(e){this.settings=t.extend({},this.Defaults,e)},preRender:function(e){e.addClass(this.settings.containerClass,"body")},applyClasses:function(e){var t=this,n=t.settings,r,i,o;r=e.items().filter(":visible"),i=n.firstControlClass,o=n.lastControlClass,r.each(function(e){e.removeClass(i).removeClass(o),n.controlClass&&e.addClass(n.controlClass)}),r.eq(0).addClass(i),r.eq(-1).addClass(o)},renderHtml:function(e){var t=this,n=t.settings,r,i="";return r=e.items(),r.eq(0).addClass(n.firstControlClass),r.eq(-1).addClass(n.lastControlClass),r.each(function(e){n.controlClass&&e.addClass(n.controlClass),i+=e.renderHtml()}),i},recalc:function(){},postRender:function(){}})}),r(Ct,[bt],function(e){return e.extend({Defaults:{containerClass:"abs-layout",controlClass:"abs-layout-item"},recalc:function(e){e.items().filter(":visible").each(function(e){var t=e.settings;e.layoutRect({x:t.x,y:t.y,w:t.w,h:t.h}),e.recalc&&e.recalc()})},renderHtml:function(e){return'<div id="'+e._id+'-absend" class="'+e.classPrefix+'abs-end"></div>'+this._super(e)}})}),r(xt,[$,Q],function(e,t){return e.extend({Mixins:[t],Defaults:{classes:"widget tooltip tooltip-n"},text:function(e){var t=this;return"undefined"!=typeof e?(t._value=e,t._rendered&&(t.getEl().lastChild.innerHTML=t.encode(e)),t):t._value},renderHtml:function(){var e=this,t=e.classPrefix;return'<div id="'+e._id+'" class="'+e.classes()+'" role="presentation"><div class="'+t+'tooltip-arrow"></div><div class="'+t+'tooltip-inner">'+e.encode(e._text)+"</div></div>"},repaint:function(){var e=this,t,n;t=e.getEl().style,n=e._layoutRect,t.left=n.x+"px",t.top=n.y+"px",t.zIndex=131070}})}),r(wt,[$,xt],function(e,t){var n,r=e.extend({init:function(e){var t=this;t._super(e),e=t.settings,t.canFocus=!0,e.tooltip&&r.tooltips!==!1&&(t.on("mouseenter",function(n){var r=t.tooltip().moveTo(-65535);if(n.control==t){var i=r.text(e.tooltip).show().testMoveRel(t.getEl(),["bc-tc","bc-tl","bc-tr"]);r.toggleClass("tooltip-n","bc-tc"==i),r.toggleClass("tooltip-nw","bc-tl"==i),r.toggleClass("tooltip-ne","bc-tr"==i),r.moveRel(t.getEl(),i)}else r.hide()}),t.on("mouseleave mousedown click",function(){t.tooltip().hide()})),t.aria("label",e.ariaLabel||e.tooltip)},tooltip:function(){return n||(n=new t({type:"tooltip"}),n.renderTo()),n},active:function(e){var t=this,n;return e!==n&&(t.aria("pressed",e),t.toggleClass("active",e)),t._super(e)},disabled:function(e){var t=this,n;return e!==n&&(t.aria("disabled",e),t.toggleClass("disabled",e)),t._super(e)},postRender:function(){var e=this,t=e.settings;e._rendered=!0,e._super(),e.parent()||!t.width&&!t.height||(e.initLayoutRect(),e.repaint()),t.autofocus&&e.focus()},remove:function(){this._super(),n&&(n.remove(),n=null)}});return r}),r(_t,[wt],function(e){return e.extend({Defaults:{classes:"widget btn",role:"button"},init:function(e){var t=this,n;t.on("click mousedown",function(e){e.preventDefault()}),t._super(e),n=e.size,e.subtype&&t.addClass(e.subtype),n&&t.addClass("btn-"+n)},icon:function(e){var t=this,n=t.classPrefix;if("undefined"==typeof e)return t.settings.icon;if(t.settings.icon=e,e=e?n+"ico "+n+"i-"+t.settings.icon:"",t._rendered){var r=t.getEl().firstChild,i=r.getElementsByTagName("i")[0];e?(i&&i==r.firstChild||(i=document.createElement("i"),r.insertBefore(i,r.firstChild)),i.className=e):i&&r.removeChild(i),t.text(t._text)}return t},repaint:function(){var e=this.getEl().firstChild.style;e.width=e.height="100%",this._super()},text:function(e){var t=this;if(t._rendered){var n=t.getEl().lastChild.lastChild;n&&(n.data=t.translate(e))}return t._super(e)},renderHtml:function(){var e=this,t=e._id,n=e.classPrefix,r=e.settings.icon,i;return i=e.settings.image,i?(r="none","string"!=typeof i&&(i=window.getSelection?i[0]:i[1]),i=" style=\"background-image: url('"+i+"')\""):i="",r=e.settings.icon?n+"ico "+n+"i-"+r:"",'<div id="'+t+'" class="'+e.classes()+'" tabindex="-1" aria-labelledby="'+t+'"><button role="presentation" type="button" tabindex="-1">'+(r?'<i class="'+r+'"'+i+"></i>":"")+(e._text?(r?"\xa0":"")+e.encode(e._text):"")+"</button></div>"}})}),r(Nt,[G],function(e){return e.extend({Defaults:{defaultType:"button",role:"group"},renderHtml:function(){var e=this,t=e._layout;return e.addClass("btn-group"),e.preRender(),t.preRender(e),'<div id="'+e._id+'" class="'+e.classes()+'"><div id="'+e._id+'-body">'+(e.settings.html||"")+t.renderHtml(e)+"</div></div>"}})}),r(Et,[wt],function(e){return e.extend({Defaults:{classes:"checkbox",role:"checkbox",checked:!1},init:function(e){var t=this;t._super(e),t.on("click mousedown",function(e){e.preventDefault()}),t.on("click",function(e){e.preventDefault(),t.disabled()||t.checked(!t.checked())}),t.checked(t.settings.checked)},checked:function(e){var t=this;return"undefined"!=typeof e?(e?t.addClass("checked"):t.removeClass("checked"),t._checked=e,t.aria("checked",e),t):t._checked},value:function(e){return this.checked(e)},renderHtml:function(){var e=this,t=e._id,n=e.classPrefix;return'<div id="'+t+'" class="'+e.classes()+'" unselectable="on" aria-labelledby="'+t+'-al" tabindex="-1"><i class="'+n+"ico "+n+'i-checkbox"></i><span id="'+t+'-al" class="'+n+'label">'+e.encode(e._text)+"</span></div>"}})}),r(St,[_t,et],function(e,t){return e.extend({showPanel:function(){var e=this,n=e.settings;if(e.active(!0),e.panel)e.panel.show();else{var r=n.panel;r.type&&(r={layout:"grid",items:r}),r.role=r.role||"dialog",r.popover=!0,r.autohide=!0,r.ariaRoot=!0,e.panel=new t(r).on("hide",function(){e.active(!1)}).on("cancel",function(t){t.stopPropagation(),e.focus(),e.hidePanel()}).parent(e).renderTo(e.getContainerElm()),e.panel.fire("show"),e.panel.reflow()}e.panel.moveRel(e.getEl(),n.popoverAlign||(e.isRtl()?["bc-tr","bc-tc"]:["bc-tl","bc-tc"]))},hidePanel:function(){var e=this;e.panel&&e.panel.hide()},postRender:function(){var e=this;return e.aria("haspopup",!0),e.on("click",function(t){t.control===e&&(e.panel&&e.panel.visible()?e.hidePanel():(e.showPanel(),e.panel.focus(!!t.aria)))}),e._super()}})}),r(kt,[St,y],function(e,t){var n=t.DOM;return e.extend({init:function(e){this._super(e),this.addClass("colorbutton")},color:function(e){return e?(this._color=e,this.getEl("preview").style.backgroundColor=e,this):this._color},renderHtml:function(){var e=this,t=e._id,n=e.classPrefix,r=e.settings.icon?n+"ico "+n+"i-"+e.settings.icon:"",i=e.settings.image?" style=\"background-image: url('"+e.settings.image+"')\"":"";return'<div id="'+t+'" class="'+e.classes()+'" role="button" tabindex="-1" aria-haspopup="true"><button role="presentation" hidefocus="1" type="button" tabindex="-1">'+(r?'<i class="'+r+'"'+i+"></i>":"")+'<span id="'+t+'-preview" class="'+n+'preview"></span>'+(e._text?(r?" ":"")+e._text:"")+'</button><button type="button" class="'+n+'open" hidefocus="1" tabindex="-1"> <i class="'+n+'caret"></i></button></div>'},postRender:function(){var e=this,t=e.settings.onclick;return e.on("click",function(r){r.aria&&"down"==r.aria.key||r.control!=e||n.getParent(r.target,"."+e.classPrefix+"open")||(r.stopImmediatePropagation(),t.call(e,r))}),delete e.settings.onclick,e._super()}})}),r(Tt,[wt,j,q],function(e,t,n){return e.extend({init:function(e){var t=this;t._super(e),t.addClass("combobox"),t.subinput=!0,t.ariaTarget="inp",e=t.settings,e.menu=e.menu||e.values,e.menu&&(e.icon="caret"),t.on("click",function(n){for(var r=n.target,i=t.getEl();r&&r!=i;)r.id&&-1!=r.id.indexOf("-open")&&(t.fire("action"),e.menu&&(t.showMenu(),n.aria&&t.menu.items()[0].focus())),r=r.parentNode}),t.on("keydown",function(e){"INPUT"==e.target.nodeName&&13==e.keyCode&&t.parents().reverse().each(function(n){return e.preventDefault(),t.fire("change"),n.hasEventListeners("submit")&&n.toJSON?(n.fire("submit",{data:n.toJSON()}),!1):void 0})}),e.placeholder&&(t.addClass("placeholder"),t.on("focusin",function(){t._hasOnChange||(n.on(t.getEl("inp"),"change",function(){t.fire("change")}),t._hasOnChange=!0),t.hasClass("placeholder")&&(t.getEl("inp").value="",t.removeClass("placeholder"))}),t.on("focusout",function(){0===t.value().length&&(t.getEl("inp").value=e.placeholder,t.addClass("placeholder"))}))},showMenu:function(){var e=this,n=e.settings,r;e.menu||(r=n.menu||[],r.length?r={type:"menu",items:r}:r.type=r.type||"menu",e.menu=t.create(r).parent(e).renderTo(e.getContainerElm()),e.fire("createmenu"),e.menu.reflow(),e.menu.on("cancel",function(t){t.control===e.menu&&e.focus()}),e.menu.on("show hide",function(t){t.control.items().each(function(t){t.active(t.value()==e.value())})}).fire("show"),e.menu.on("select",function(t){e.value(t.control.value())}),e.on("focusin",function(t){"INPUT"==t.target.tagName.toUpperCase()&&e.menu.hide()}),e.aria("expanded",!0)),e.menu.show(),e.menu.layoutRect({w:e.layoutRect().w}),e.menu.moveRel(e.getEl(),e.isRtl()?["br-tr","tr-br"]:["bl-tl","tl-bl"])},value:function(e){var t=this;return"undefined"!=typeof e?(t._value=e,t.removeClass("placeholder"),t._rendered&&(t.getEl("inp").value=e),t):t._rendered?(e=t.getEl("inp").value,e!=t.settings.placeholder?e:""):t._value},disabled:function(e){var t=this;return t._rendered&&"undefined"!=typeof e&&(t.getEl("inp").disabled=e),t._super(e)},focus:function(){this.getEl("inp").focus()},repaint:function(){var e=this,t=e.getEl(),r=e.getEl("open"),i=e.layoutRect(),o,a;o=r?i.w-n.getSize(r).width-10:i.w-10;var s=document;return s.all&&(!s.documentMode||s.documentMode<=8)&&(a=e.layoutRect().h-2+"px"),n.css(t.firstChild,{width:o,lineHeight:a}),e._super(),e},postRender:function(){var e=this;return n.on(this.getEl("inp"),"change",function(){e.fire("change")}),e._super()},remove:function(){n.off(this.getEl("inp")),this._super()},renderHtml:function(){var e=this,t=e._id,n=e.settings,r=e.classPrefix,i=n.value||n.placeholder||"",o,a,s="",l="";return"spellcheck"in n&&(l+=' spellcheck="'+n.spellcheck+'"'),n.maxLength&&(l+=' maxlength="'+n.maxLength+'"'),n.size&&(l+=' size="'+n.size+'"'),n.subtype&&(l+=' type="'+n.subtype+'"'),e.disabled()&&(l+=' disabled="disabled"'),o=n.icon,o&&"caret"!=o&&(o=r+"ico "+r+"i-"+n.icon),a=e._text,(o||a)&&(s='<div id="'+t+'-open" class="'+r+"btn "+r+'open" tabIndex="-1" role="button"><button id="'+t+'-action" type="button" hidefocus="1" tabindex="-1">'+("caret"!=o?'<i class="'+o+'"></i>':'<i class="'+r+'caret"></i>')+(a?(o?" ":"")+a:"")+"</button></div>",e.addClass("has-open")),'<div id="'+t+'" class="'+e.classes()+'"><input id="'+t+'-inp" class="'+r+"textbox "+r+'placeholder" value="'+i+'" hidefocus="1"'+l+" />"+s+"</div>" +}})}),r(Rt,[wt],function(e){return e.extend({init:function(e){var t=this;e.delimiter||(e.delimiter="\xbb"),t._super(e),t.addClass("path"),t.canFocus=!0,t.on("click",function(e){var n,r=e.target;(n=r.getAttribute("data-index"))&&t.fire("select",{value:t.data()[n],index:n})})},focus:function(){var e=this;return e.getEl().firstChild.focus(),e},data:function(e){var t=this;return"undefined"!=typeof e?(t._data=e,t.update(),t):t._data},update:function(){this.innerHtml(this._getPathHtml())},postRender:function(){var e=this;e._super(),e.data(e.settings.data)},renderHtml:function(){var e=this;return'<div id="'+e._id+'" class="'+e.classes()+'">'+e._getPathHtml()+"</div>"},_getPathHtml:function(){var e=this,t=e._data||[],n,r,i="",o=e.classPrefix;for(n=0,r=t.length;r>n;n++)i+=(n>0?'<div class="'+o+'divider" aria-hidden="true"> '+e.settings.delimiter+" </div>":"")+'<div role="button" class="'+o+"path-item"+(n==r-1?" "+o+"last":"")+'" data-index="'+n+'" tabindex="-1" id="'+e._id+"-"+n+'" aria-level="'+n+'">'+t[n].name+"</div>";return i||(i='<div class="'+o+'path-item">\xa0</div>'),i}})}),r(At,[Rt,dt],function(e,t){return e.extend({postRender:function(){function e(e){if(1===e.nodeType){if("BR"==e.nodeName||e.getAttribute("data-mce-bogus"))return!0;if("bookmark"===e.getAttribute("data-mce-type"))return!0}return!1}var n=this,r=t.activeEditor;return n.on("select",function(t){var n=[],i,o=r.getBody();for(r.focus(),i=r.selection.getStart();i&&i!=o;)e(i)||n.push(i),i=i.parentNode;r.selection.select(n[n.length-1-t.index]),r.nodeChanged()}),r.on("nodeChange",function(t){for(var i=[],o=t.parents,a=o.length;a--;)if(1==o[a].nodeType&&!e(o[a])){var s=r.fire("ResolveName",{name:o[a].nodeName.toLowerCase(),target:o[a]});i.push({name:s.name})}n.data(i)}),n._super()}})}),r(Bt,[G],function(e){return e.extend({Defaults:{layout:"flex",align:"center",defaults:{flex:1}},renderHtml:function(){var e=this,t=e._layout,n=e.classPrefix;return e.addClass("formitem"),t.preRender(e),'<div id="'+e._id+'" class="'+e.classes()+'" hidefocus="1" tabindex="-1">'+(e.settings.title?'<div id="'+e._id+'-title" class="'+n+'title">'+e.settings.title+"</div>":"")+'<div id="'+e._id+'-body" class="'+e.classes("body")+'">'+(e.settings.html||"")+t.renderHtml(e)+"</div></div>"}})}),r(Dt,[G,Bt],function(e,t){return e.extend({Defaults:{containerCls:"form",layout:"flex",direction:"column",align:"stretch",flex:1,padding:20,labelGap:30,spacing:10,callbacks:{submit:function(){this.submit()}}},preRender:function(){var e=this,n=e.items();n.each(function(n){var r,i=n.settings.label;i&&(r=new t({layout:"flex",autoResize:"overflow",defaults:{flex:1},items:[{type:"label",id:n._id+"-l",text:i,flex:0,forId:n._id,disabled:n.disabled()}]}),r.type="formitem",n.aria("labelledby",n._id+"-l"),"undefined"==typeof n.settings.flex&&(n.settings.flex=1),e.replace(n,r),r.add(n))})},recalcLabels:function(){var e=this,t=0,n=[],r,i;if(e.settings.labelGapCalc!==!1)for(e.items().filter("formitem").each(function(e){var r=e.items()[0],i=r.getEl().clientWidth;t=i>t?i:t,n.push(r)}),i=e.settings.labelGap||0,r=n.length;r--;)n[r].settings.minWidth=t+i},visible:function(e){var t=this._super(e);return e===!0&&this._rendered&&this.recalcLabels(),t},submit:function(){return this.fire("submit",{data:this.toJSON()})},postRender:function(){var e=this;e._super(),e.recalcLabels(),e.fromJSON(e.settings.data)}})}),r(Lt,[Dt],function(e){return e.extend({Defaults:{containerCls:"fieldset",layout:"flex",direction:"column",align:"stretch",flex:1,padding:"25 15 5 15",labelGap:30,spacing:10,border:1},renderHtml:function(){var e=this,t=e._layout,n=e.classPrefix;return e.preRender(),t.preRender(e),'<fieldset id="'+e._id+'" class="'+e.classes()+'" hidefocus="1" tabindex="-1">'+(e.settings.title?'<legend id="'+e._id+'-title" class="'+n+'fieldset-title">'+e.settings.title+"</legend>":"")+'<div id="'+e._id+'-body" class="'+e.classes("body")+'">'+(e.settings.html||"")+t.renderHtml(e)+"</div></fieldset>"}})}),r(Mt,[Tt],function(e){return e.extend({init:function(e){var t=this,n=tinymce.activeEditor,r;e.spellcheck=!1,r=n.settings.file_browser_callback,r&&(e.icon="browse",e.onaction=function(){r(t.getEl("inp").id,t.getEl("inp").value,e.filetype,window)}),t._super(e)}})}),r(Ht,[Ct],function(e){return e.extend({recalc:function(e){var t=e.layoutRect(),n=e.paddingBox();e.items().filter(":visible").each(function(e){e.layoutRect({x:n.left,y:n.top,w:t.innerW-n.right-n.left,h:t.innerH-n.top-n.bottom}),e.recalc&&e.recalc()})}})}),r(Pt,[Ct],function(e){return e.extend({recalc:function(e){var t,n,r,i,o,a,s,l,c,u,d,f,p,h,m,g,v=[],y,b,C,x,w,_,N,E,S,k,T,R,A,B,D,L,M,H,P,O,I,F,z=Math.max,W=Math.min;for(r=e.items().filter(":visible"),i=e.layoutRect(),o=e._paddingBox,a=e.settings,f=e.isRtl()?a.direction||"row-reversed":a.direction,s=a.align,l=e.isRtl()?a.pack||"end":a.pack,c=a.spacing||0,("row-reversed"==f||"column-reverse"==f)&&(r=r.set(r.toArray().reverse()),f=f.split("-")[0]),"column"==f?(S="y",N="h",E="minH",k="maxH",R="innerH",T="top",A="deltaH",B="contentH",P="left",M="w",D="x",L="innerW",H="minW",O="right",I="deltaW",F="contentW"):(S="x",N="w",E="minW",k="maxW",R="innerW",T="left",A="deltaW",B="contentW",P="top",M="h",D="y",L="innerH",H="minH",O="bottom",I="deltaH",F="contentH"),d=i[R]-o[T]-o[T],_=u=0,t=0,n=r.length;n>t;t++)p=r[t],h=p.layoutRect(),m=p.settings,g=m.flex,d-=n-1>t?c:0,g>0&&(u+=g,h[k]&&v.push(p),h.flex=g),d-=h[E],y=o[P]+h[H]+o[O],y>_&&(_=y);if(x={},x[E]=0>d?i[E]-d+i[A]:i[R]-d+i[A],x[H]=_+i[I],x[B]=i[R]-d,x[F]=_,x.minW=W(x.minW,i.maxW),x.minH=W(x.minH,i.maxH),x.minW=z(x.minW,i.startMinWidth),x.minH=z(x.minH,i.startMinHeight),!i.autoResize||x.minW==i.minW&&x.minH==i.minH){for(C=d/u,t=0,n=v.length;n>t;t++)p=v[t],h=p.layoutRect(),b=h[k],y=h[E]+h.flex*C,y>b?(d-=h[k]-h[E],u-=h.flex,h.flex=0,h.maxFlexSize=b):h.maxFlexSize=0;for(C=d/u,w=o[T],x={},0===u&&("end"==l?w=d+o[T]:"center"==l?(w=Math.round(i[R]/2-(i[R]-d)/2)+o[T],0>w&&(w=o[T])):"justify"==l&&(w=o[T],c=Math.floor(d/(r.length-1)))),x[D]=o[P],t=0,n=r.length;n>t;t++)p=r[t],h=p.layoutRect(),y=h.maxFlexSize||h[E],"center"===s?x[D]=Math.round(i[L]/2-h[M]/2):"stretch"===s?(x[M]=z(h[H]||0,i[L]-o[P]-o[O]),x[D]=o[P]):"end"===s&&(x[D]=i[L]-h[M]-o.top),h.flex>0&&(y+=h.flex*C),x[N]=y,x[S]=w,p.layoutRect(x),p.recalc&&p.recalc(),w+=y+c}else if(x.w=x.minW,x.h=x.minH,e.layoutRect(x),this.recalc(e),null===e._lastRect){var V=e.parent();V&&(V._lastRect=null,V.recalc())}}})}),r(Ot,[bt],function(e){return e.extend({Defaults:{containerClass:"flow-layout",controlClass:"flow-layout-item",endClass:"break"},recalc:function(e){e.items().filter(":visible").each(function(e){e.recalc&&e.recalc()})}})}),r(It,[$,wt,et,p,dt,g],function(e,t,n,r,i,o){function a(e){function t(t,n){return function(){var r=this;e.on("nodeChange",function(i){var o=e.formatter,a=null;s(i.parents,function(e){return s(t,function(t){return n?o.matchNode(e,n,{value:t.value})&&(a=t.value):o.matchNode(e,t.value)&&(a=t.value),a?!1:void 0}),a?!1:void 0}),r.value(a)})}}function r(e){e=e.replace(/;$/,"").split(";");for(var t=e.length;t--;)e[t]=e[t].split("=");return e}function i(){function t(e){var n=[];if(e)return s(e,function(e){var o={text:e.title,icon:e.icon};if(e.items)o.menu=t(e.items);else{var a=e.format||"custom"+r++;e.format||(e.name=a,i.push(e)),o.format=a}n.push(o)}),n}function n(){var n;return n=t(e.settings.style_formats_merge?e.settings.style_formats?o.concat(e.settings.style_formats):o:e.settings.style_formats||o)}var r=0,i=[],o=[{title:"Headings",items:[{title:"Heading 1",format:"h1"},{title:"Heading 2",format:"h2"},{title:"Heading 3",format:"h3"},{title:"Heading 4",format:"h4"},{title:"Heading 5",format:"h5"},{title:"Heading 6",format:"h6"}]},{title:"Inline",items:[{title:"Bold",icon:"bold",format:"bold"},{title:"Italic",icon:"italic",format:"italic"},{title:"Underline",icon:"underline",format:"underline"},{title:"Strikethrough",icon:"strikethrough",format:"strikethrough"},{title:"Superscript",icon:"superscript",format:"superscript"},{title:"Subscript",icon:"subscript",format:"subscript"},{title:"Code",icon:"code",format:"code"}]},{title:"Blocks",items:[{title:"Paragraph",format:"p"},{title:"Blockquote",format:"blockquote"},{title:"Div",format:"div"},{title:"Pre",format:"pre"}]},{title:"Alignment",items:[{title:"Left",icon:"alignleft",format:"alignleft"},{title:"Center",icon:"aligncenter",format:"aligncenter"},{title:"Right",icon:"alignright",format:"alignright"},{title:"Justify",icon:"alignjustify",format:"alignjustify"}]}];return e.on("init",function(){s(i,function(t){e.formatter.register(t.name,t)})}),{type:"menu",items:n(),onPostRender:function(t){e.fire("renderFormatsMenu",{control:t.control})},itemDefaults:{preview:!0,textStyle:function(){return this.settings.format?e.formatter.getCssText(this.settings.format):void 0},onPostRender:function(){var t=this,n=this.settings.format;n&&t.parent().on("show",function(){t.disabled(!e.formatter.canApply(n)),t.active(e.formatter.match(n))})},onclick:function(){this.settings.format&&d(this.settings.format)}}}}function o(){return e.undoManager?e.undoManager.hasUndo():!1}function a(){return e.undoManager?e.undoManager.hasRedo():!1}function l(){var t=this;t.disabled(!o()),e.on("Undo Redo AddUndo TypingUndo",function(){t.disabled(!o())})}function c(){var t=this;t.disabled(!a()),e.on("Undo Redo AddUndo TypingUndo",function(){t.disabled(!a())})}function u(){var t=this;e.on("VisualAid",function(e){t.active(e.hasVisual)}),t.active(e.hasVisual)}function d(t){t.control&&(t=t.control.value()),t&&e.execCommand("mceToggleFormat",!1,t)}var f;f=i(),s({bold:"Bold",italic:"Italic",underline:"Underline",strikethrough:"Strikethrough",subscript:"Subscript",superscript:"Superscript"},function(t,n){e.addButton(n,{tooltip:t,onPostRender:function(){var t=this;e.formatter?e.formatter.formatChanged(n,function(e){t.active(e)}):e.on("init",function(){e.formatter.formatChanged(n,function(e){t.active(e)})})},onclick:function(){d(n)}})}),s({outdent:["Decrease indent","Outdent"],indent:["Increase indent","Indent"],cut:["Cut","Cut"],copy:["Copy","Copy"],paste:["Paste","Paste"],help:["Help","mceHelp"],selectall:["Select all","SelectAll"],hr:["Insert horizontal rule","InsertHorizontalRule"],removeformat:["Clear formatting","RemoveFormat"],visualaid:["Visual aids","mceToggleVisualAid"],newdocument:["New document","mceNewDocument"]},function(t,n){e.addButton(n,{tooltip:t[0],cmd:t[1]})}),s({blockquote:["Blockquote","mceBlockQuote"],numlist:["Numbered list","InsertOrderedList"],bullist:["Bullet list","InsertUnorderedList"],subscript:["Subscript","Subscript"],superscript:["Superscript","Superscript"],alignleft:["Align left","JustifyLeft"],aligncenter:["Align center","JustifyCenter"],alignright:["Align right","JustifyRight"],alignjustify:["Justify","JustifyFull"]},function(t,n){e.addButton(n,{tooltip:t[0],cmd:t[1],onPostRender:function(){var t=this;e.formatter?e.formatter.formatChanged(n,function(e){t.active(e)}):e.on("init",function(){e.formatter.formatChanged(n,function(e){t.active(e)})})}})}),e.addButton("undo",{tooltip:"Undo",onPostRender:l,cmd:"undo"}),e.addButton("redo",{tooltip:"Redo",onPostRender:c,cmd:"redo"}),e.addMenuItem("newdocument",{text:"New document",shortcut:"Ctrl+N",icon:"newdocument",cmd:"mceNewDocument"}),e.addMenuItem("undo",{text:"Undo",icon:"undo",shortcut:"Ctrl+Z",onPostRender:l,cmd:"undo"}),e.addMenuItem("redo",{text:"Redo",icon:"redo",shortcut:"Ctrl+Y",onPostRender:c,cmd:"redo"}),e.addMenuItem("visualaid",{text:"Visual aids",selectable:!0,onPostRender:u,cmd:"mceToggleVisualAid"}),s({cut:["Cut","Cut","Ctrl+X"],copy:["Copy","Copy","Ctrl+C"],paste:["Paste","Paste","Ctrl+V"],selectall:["Select all","SelectAll","Ctrl+A"],bold:["Bold","Bold","Ctrl+B"],italic:["Italic","Italic","Ctrl+I"],underline:["Underline","Underline"],strikethrough:["Strikethrough","Strikethrough"],subscript:["Subscript","Subscript"],superscript:["Superscript","Superscript"],removeformat:["Clear formatting","RemoveFormat"]},function(t,n){e.addMenuItem(n,{text:t[0],icon:n,shortcut:t[2],cmd:t[1]})}),e.on("mousedown",function(){n.hideAll()}),e.addButton("styleselect",{type:"menubutton",text:"Formats",menu:f}),e.addButton("formatselect",function(){var n=[],i=r(e.settings.block_formats||"Paragraph=p;Address=address;Pre=pre;Heading 1=h1;Heading 2=h2;Heading 3=h3;Heading 4=h4;Heading 5=h5;Heading 6=h6");return s(i,function(t){n.push({text:t[0],value:t[1],textStyle:function(){return e.formatter.getCssText(t[1])}})}),{type:"listbox",text:i[0][0],values:n,fixedWidth:!0,onselect:d,onPostRender:t(n)}}),e.addButton("fontselect",function(){var n="Andale Mono=andale mono,times;Arial=arial,helvetica,sans-serif;Arial Black=arial black,avant garde;Book Antiqua=book antiqua,palatino;Comic Sans MS=comic sans ms,sans-serif;Courier New=courier new,courier;Georgia=georgia,palatino;Helvetica=helvetica;Impact=impact,chicago;Symbol=symbol;Tahoma=tahoma,arial,helvetica,sans-serif;Terminal=terminal,monaco;Times New Roman=times new roman,times;Trebuchet MS=trebuchet ms,geneva;Verdana=verdana,geneva;Webdings=webdings;Wingdings=wingdings,zapf dingbats",i=[],o=r(e.settings.font_formats||n);return s(o,function(e){i.push({text:{raw:e[0]},value:e[1],textStyle:-1==e[1].indexOf("dings")?"font-family:"+e[1]:""})}),{type:"listbox",text:"Font Family",tooltip:"Font Family",values:i,fixedWidth:!0,onPostRender:t(i,"fontname"),onselect:function(t){t.control.settings.value&&e.execCommand("FontName",!1,t.control.settings.value)}}}),e.addButton("fontsizeselect",function(){var n=[],r="8pt 10pt 12pt 14pt 18pt 24pt 36pt",i=e.settings.fontsize_formats||r;return s(i.split(" "),function(e){n.push({text:e,value:e})}),{type:"listbox",text:"Font Sizes",tooltip:"Font Sizes",values:n,fixedWidth:!0,onPostRender:t(n,"fontsize"),onclick:function(t){t.control.settings.value&&e.execCommand("FontSize",!1,t.control.settings.value)}}}),e.addMenuItem("formats",{text:"Formats",menu:f})}var s=r.each;i.on("AddEditor",function(t){t.editor.rtl&&(e.rtl=!0),a(t.editor)}),e.translate=function(e){return i.translate(e)},t.tooltips=!o.iOS}),r(Ft,[Ct],function(e){return e.extend({recalc:function(e){var t=e.settings,n,r,i,o,a,s,l,c,u,d,f,p,h,m,g,v,y,b,C,x,w,_,N=[],E=[],S,k,T,R;for(t=e.settings,i=e.items().filter(":visible"),o=e.layoutRect(),r=t.columns||Math.ceil(Math.sqrt(i.length)),n=Math.ceil(i.length/r),y=t.spacingH||t.spacing||0,b=t.spacingV||t.spacing||0,C=t.alignH||t.align,x=t.alignV||t.align,g=e._paddingBox,C&&"string"==typeof C&&(C=[C]),x&&"string"==typeof x&&(x=[x]),d=0;r>d;d++)N.push(0);for(f=0;n>f;f++)E.push(0);for(f=0;n>f;f++)for(d=0;r>d&&(u=i[f*r+d],u);d++)c=u.layoutRect(),S=c.minW,k=c.minH,N[d]=S>N[d]?S:N[d],E[f]=k>E[f]?k:E[f];for(T=o.innerW-g.left-g.right,w=0,d=0;r>d;d++)w+=N[d]+(d>0?y:0),T-=(d>0?y:0)+N[d];for(R=o.innerH-g.top-g.bottom,_=0,f=0;n>f;f++)_+=E[f]+(f>0?b:0),R-=(f>0?b:0)+E[f];if(w+=g.left+g.right,_+=g.top+g.bottom,l={},l.minW=w+(o.w-o.innerW),l.minH=_+(o.h-o.innerH),l.contentW=l.minW-o.deltaW,l.contentH=l.minH-o.deltaH,l.minW=Math.min(l.minW,o.maxW),l.minH=Math.min(l.minH,o.maxH),l.minW=Math.max(l.minW,o.startMinWidth),l.minH=Math.max(l.minH,o.startMinHeight),!o.autoResize||l.minW==o.minW&&l.minH==o.minH){o.autoResize&&(l=e.layoutRect(l),l.contentW=l.minW-o.deltaW,l.contentH=l.minH-o.deltaH);var A;A="start"==t.packV?0:R>0?Math.floor(R/n):0;var B=0,D=t.flexWidths;if(D)for(d=0;d<D.length;d++)B+=D[d];else B=r;var L=T/B;for(d=0;r>d;d++)N[d]+=D?D[d]*L:L;for(h=g.top,f=0;n>f;f++){for(p=g.left,s=E[f]+A,d=0;r>d&&(u=i[f*r+d],u);d++)m=u.settings,c=u.layoutRect(),a=Math.max(N[d],c.startMinWidth),c.x=p,c.y=h,v=m.alignH||(C?C[d]||C[0]:null),"center"==v?c.x=p+a/2-c.w/2:"right"==v?c.x=p+a-c.w:"stretch"==v&&(c.w=a),v=m.alignV||(x?x[d]||x[0]:null),"center"==v?c.y=h+s/2-c.h/2:"bottom"==v?c.y=h+s-c.h:"stretch"==v&&(c.h=s),u.layoutRect(c),p+=a+y,u.recalc&&u.recalc();h+=s+b}}else if(l.w=l.minW,l.h=l.minH,e.layoutRect(l),this.recalc(e),null===e._lastRect){var M=e.parent();M&&(M._lastRect=null,M.recalc())}}})}),r(zt,[wt],function(e){return e.extend({renderHtml:function(){var e=this;return e.addClass("iframe"),e.canFocus=!1,'<iframe id="'+e._id+'" class="'+e.classes()+'" tabindex="-1" src="'+(e.settings.url||"javascript:''")+'" frameborder="0"></iframe>'},src:function(e){this.getEl().src=e},html:function(e,t){var n=this,r=this.getEl().contentWindow.document.body;return r?(r.innerHTML=e,t&&t()):setTimeout(function(){n.html(e)},0),this}})}),r(Wt,[wt,q],function(e,t){return e.extend({init:function(e){var t=this;t._super(e),t.addClass("widget"),t.addClass("label"),t.canFocus=!1,e.multiline&&t.addClass("autoscroll"),e.strong&&t.addClass("strong")},initLayoutRect:function(){var e=this,n=e._super();if(e.settings.multiline){var r=t.getSize(e.getEl());r.width>n.maxW&&(n.minW=n.maxW,e.addClass("multiline")),e.getEl().style.width=n.minW+"px",n.startMinH=n.h=n.minH=Math.min(n.maxH,t.getSize(e.getEl()).height)}return n},repaint:function(){var e=this;return e.settings.multiline||(e.getEl().style.lineHeight=e.layoutRect().h+"px"),e._super()},text:function(e){var t=this;return t._rendered&&e&&this.innerHtml(t.encode(e)),t._super(e)},renderHtml:function(){var e=this,t=e.settings.forId;return'<label id="'+e._id+'" class="'+e.classes()+'"'+(t?' for="'+t+'"':"")+">"+e.encode(e._text)+"</label>"}})}),r(Vt,[G],function(e){return e.extend({Defaults:{role:"toolbar",layout:"flow"},init:function(e){var t=this;t._super(e),t.addClass("toolbar")},postRender:function(){var e=this;return e.items().addClass("toolbar-item"),e._super()}})}),r(Ut,[Vt],function(e){return e.extend({Defaults:{role:"menubar",containerCls:"menubar",ariaRoot:!0,defaults:{type:"menubutton"}}})}),r(qt,[_t,j,Ut],function(e,t,n){function r(e,t){for(;e;){if(t===e)return!0;e=e.parentNode}return!1}var i=e.extend({init:function(e){var t=this;t._renderOpen=!0,t._super(e),t.addClass("menubtn"),e.fixedWidth&&t.addClass("fixed-width"),t.aria("haspopup",!0),t.hasPopup=!0},showMenu:function(){var e=this,n=e.settings,r;return e.menu&&e.menu.visible()?e.hideMenu():(e.menu||(r=n.menu||[],r.length?r={type:"menu",items:r}:r.type=r.type||"menu",e.menu=t.create(r).parent(e).renderTo(),e.fire("createmenu"),e.menu.reflow(),e.menu.on("cancel",function(t){t.control.parent()===e.menu&&(t.stopPropagation(),e.focus(),e.hideMenu())}),e.menu.on("select",function(){e.focus()}),e.menu.on("show hide",function(t){t.control==e.menu&&e.activeMenu("show"==t.type),e.aria("expanded","show"==t.type)}).fire("show")),e.menu.show(),e.menu.layoutRect({w:e.layoutRect().w}),void e.menu.moveRel(e.getEl(),e.isRtl()?["br-tr","tr-br"]:["bl-tl","tl-bl"]))},hideMenu:function(){var e=this;e.menu&&(e.menu.items().each(function(e){e.hideMenu&&e.hideMenu()}),e.menu.hide())},activeMenu:function(e){this.toggleClass("active",e)},renderHtml:function(){var e=this,t=e._id,r=e.classPrefix,i=e.settings.icon?r+"ico "+r+"i-"+e.settings.icon:"";return e.aria("role",e.parent()instanceof n?"menuitem":"button"),'<div id="'+t+'" class="'+e.classes()+'" tabindex="-1" aria-labelledby="'+t+'"><button id="'+t+'-open" role="presentation" type="button" tabindex="-1">'+(i?'<i class="'+i+'"></i>':"")+"<span>"+(e._text?(i?"\xa0":"")+e.encode(e._text):"")+'</span> <i class="'+r+'caret"></i></button></div>'},postRender:function(){var e=this;return e.on("click",function(t){t.control===e&&r(t.target,e.getEl())&&(e.showMenu(),t.aria&&e.menu.items()[0].focus())}),e.on("mouseenter",function(t){var n=t.control,r=e.parent(),o;n&&r&&n instanceof i&&n.parent()==r&&(r.items().filter("MenuButton").each(function(e){e.hideMenu&&e!=n&&(e.menu&&e.menu.visible()&&(o=!0),e.hideMenu())}),o&&(n.focus(),n.showMenu()))}),e._super()},text:function(e){var t=this,n,r;if(t._rendered)for(r=t.getEl("open").getElementsByTagName("span"),n=0;n<r.length;n++)r[n].innerHTML=(t.settings.icon&&e?"\xa0":"")+t.encode(e);return this._super(e)},remove:function(){this._super(),this.menu&&this.menu.remove()}});return i}),r($t,[qt],function(e){return e.extend({init:function(e){var t=this,n,r,i,o,a;if(t._values=n=e.values,n){for(r=0;r<n.length;r++)if(i=n[r].selected||e.value===n[r].value){o=o||n[r].text,t._value=n[r].value;break}!i&&n.length>0&&(o=n[0].text,t._value=n[0].value),e.menu=n}e.text=e.text||o||n[0].text,t._super(e),t.addClass("listbox"),t.on("select",function(n){var r=n.control;a&&(n.lastControl=a),e.multiple?r.active(!r.active()):t.value(n.control.settings.value),a=r})},value:function(e){function t(e,n){e.items().each(function(e){r=e.value()===n,r&&(i=i||e.text()),e.active(r),e.menu&&t(e.menu,n)})}var n=this,r,i,o,a;if("undefined"!=typeof e){if(n.menu)t(n.menu,e);else for(o=n.settings.menu,a=0;a<o.length;a++)r=o[a].value==e,r&&(i=i||o[a].text),o[a].active=r;n.text(i||this.settings.text)}return n._super(e)}})}),r(jt,[wt,j,g],function(e,t,n){return e.extend({Defaults:{border:0,role:"menuitem"},init:function(e){var t=this;t.hasPopup=!0,t._super(e),e=t.settings,t.addClass("menu-item"),e.menu&&t.addClass("menu-item-expand"),e.preview&&t.addClass("menu-item-preview"),("-"===t._text||"|"===t._text)&&(t.addClass("menu-item-sep"),t.aria("role","separator"),t._text="-"),e.selectable&&(t.aria("role","menuitemcheckbox"),t.addClass("menu-item-checkbox"),e.icon="selected"),e.preview||e.selectable||t.addClass("menu-item-normal"),t.on("mousedown",function(e){e.preventDefault()}),e.menu&&!e.ariaHideMenu&&t.aria("haspopup",!0)},hasMenus:function(){return!!this.settings.menu},showMenu:function(){var e=this,n=e.settings,r,i=e.parent();if(i.items().each(function(t){t!==e&&t.hideMenu()}),n.menu){r=e.menu,r?r.show():(r=n.menu,r.length?r={type:"menu",items:r}:r.type=r.type||"menu",i.settings.itemDefaults&&(r.itemDefaults=i.settings.itemDefaults),r=e.menu=t.create(r).parent(e).renderTo(),r.reflow(),r.fire("show"),r.on("cancel",function(t){t.stopPropagation(),e.focus(),r.hide()}),r.on("hide",function(t){t.control===r&&e.removeClass("selected")}),r.submenu=!0),r._parentMenu=i,r.addClass("menu-sub");var o=r.testMoveRel(e.getEl(),e.isRtl()?["tl-tr","bl-br","tr-tl","br-bl"]:["tr-tl","br-bl","tl-tr","bl-br"]);r.moveRel(e.getEl(),o),r.rel=o,o="menu-sub-"+o,r.removeClass(r._lastRel),r.addClass(o),r._lastRel=o,e.addClass("selected"),e.aria("expanded",!0)}},hideMenu:function(){var e=this;return e.menu&&(e.menu.items().each(function(e){e.hideMenu&&e.hideMenu()}),e.menu.hide(),e.aria("expanded",!1)),e},renderHtml:function(){var e=this,t=e._id,r=e.settings,i=e.classPrefix,o=e.encode(e._text),a=e.settings.icon,s="",l=r.shortcut;return a&&e.parent().addClass("menu-has-icons"),r.image&&(a="none",s=" style=\"background-image: url('"+r.image+"')\""),l&&n.mac&&(l=l.replace(/ctrl\+alt\+/i,"⌥⌘"),l=l.replace(/ctrl\+/i,"⌘"),l=l.replace(/alt\+/i,"⌥"),l=l.replace(/shift\+/i,"⇧")),a=i+"ico "+i+"i-"+(e.settings.icon||"none"),'<div id="'+t+'" class="'+e.classes()+'" tabindex="-1">'+("-"!==o?'<i class="'+a+'"'+s+"></i>\xa0":"")+("-"!==o?'<span id="'+t+'-text" class="'+i+'text">'+o+"</span>":"")+(l?'<div id="'+t+'-shortcut" class="'+i+'menu-shortcut">'+l+"</div>":"")+(r.menu?'<div class="'+i+'caret"></div>':"")+"</div>"},postRender:function(){var e=this,t=e.settings,n=t.textStyle;if("function"==typeof n&&(n=n.call(this)),n){var r=e.getEl("text");r&&r.setAttribute("style",n)}return e.on("mouseenter click",function(n){n.control===e&&(t.menu||"click"!==n.type?(e.showMenu(),n.aria&&e.menu.focus(!0)):(e.fire("select"),e.parent().hideAll()))}),e._super(),e},active:function(e){return"undefined"!=typeof e&&this.aria("checked",e),this._super(e)},remove:function(){this._super(),this.menu&&this.menu.remove()}})}),r(Kt,[et,jt,p],function(e,t,n){var r=e.extend({Defaults:{defaultType:"menuitem",border:1,layout:"stack",role:"application",bodyRole:"menu",ariaRoot:!0},init:function(e){var t=this;if(e.autohide=!0,e.constrainToViewport=!0,e.itemDefaults)for(var r=e.items,i=r.length;i--;)r[i]=n.extend({},e.itemDefaults,r[i]);t._super(e),t.addClass("menu")},repaint:function(){return this.toggleClass("menu-align",!0),this._super(),this.getEl().style.height="",this.getEl("body").style.height="",this},cancel:function(){var e=this;e.hideAll(),e.fire("select")},hideAll:function(){var e=this;return this.find("menuitem").exec("hideMenu"),e._super()},preRender:function(){var e=this;return e.items().each(function(t){var n=t.settings;return n.icon||n.selectable?(e._hasIcons=!0,!1):void 0}),e._super()}});return r}),r(Gt,[Et],function(e){return e.extend({Defaults:{classes:"radio",role:"radio"}})}),r(Yt,[wt,Y],function(e,t){return e.extend({renderHtml:function(){var e=this,t=e.classPrefix;return e.addClass("resizehandle"),"both"==e.settings.direction&&e.addClass("resizehandle-both"),e.canFocus=!1,'<div id="'+e._id+'" class="'+e.classes()+'"><i class="'+t+"ico "+t+'i-resize"></i></div>'},postRender:function(){var e=this;e._super(),e.resizeDragHelper=new t(this._id,{start:function(){e.fire("ResizeStart")},drag:function(t){"both"!=e.settings.direction&&(t.deltaX=0),e.fire("Resize",t)},stop:function(){e.fire("ResizeEnd")}})},remove:function(){return this.resizeDragHelper&&this.resizeDragHelper.destroy(),this._super()}})}),r(Xt,[wt],function(e){return e.extend({renderHtml:function(){var e=this;return e.addClass("spacer"),e.canFocus=!1,'<div id="'+e._id+'" class="'+e.classes()+'"></div>'}})}),r(Jt,[qt,q],function(e,t){return e.extend({Defaults:{classes:"widget btn splitbtn",role:"button"},repaint:function(){var e=this,n=e.getEl(),r=e.layoutRect(),i,o;return e._super(),i=n.firstChild,o=n.lastChild,t.css(i,{width:r.w-t.getSize(o).width,height:r.h-2}),t.css(o,{height:r.h-2}),e},activeMenu:function(e){var n=this;t.toggleClass(n.getEl().lastChild,n.classPrefix+"active",e)},renderHtml:function(){var e=this,t=e._id,n=e.classPrefix,r=e.settings.icon?n+"ico "+n+"i-"+e.settings.icon:"";return'<div id="'+t+'" class="'+e.classes()+'" role="button" tabindex="-1"><button type="button" hidefocus="1" tabindex="-1">'+(r?'<i class="'+r+'"></i>':"")+(e._text?(r?" ":"")+e._text:"")+'</button><button type="button" class="'+n+'open" hidefocus="1" tabindex="-1">'+(e._menuBtnText?(r?"\xa0":"")+e._menuBtnText:"")+' <i class="'+n+'caret"></i></button></div>'},postRender:function(){var e=this,t=e.settings.onclick;return e.on("click",function(e){var n=e.target;if(e.control==this)for(;n;){if(e.aria&&"down"!=e.aria.key||"BUTTON"==n.nodeName&&-1==n.className.indexOf("open"))return e.stopImmediatePropagation(),void t.call(this,e);n=n.parentNode}}),delete e.settings.onclick,e._super()}})}),r(Qt,[Ot],function(e){return e.extend({Defaults:{containerClass:"stack-layout",controlClass:"stack-layout-item",endClass:"break"}})}),r(Zt,[J,q],function(e,t){return e.extend({lastIdx:0,Defaults:{layout:"absolute",defaults:{type:"panel"}},activateTab:function(e){var n;this.activeTabId&&(n=this.getEl(this.activeTabId),t.removeClass(n,this.classPrefix+"active"),n.setAttribute("aria-selected","false")),this.activeTabId="t"+e,n=this.getEl("t"+e),n.setAttribute("aria-selected","true"),t.addClass(n,this.classPrefix+"active"),e!=this.lastIdx&&(this.items()[this.lastIdx].hide(),this.lastIdx=e),this.items()[e].show().fire("showtab"),this.reflow()},renderHtml:function(){var e=this,t=e._layout,n="",r=e.classPrefix;return e.preRender(),t.preRender(e),e.items().each(function(t,i){var o=e._id+"-t"+i;t.aria("role","tabpanel"),t.aria("labelledby",o),n+='<div id="'+o+'" class="'+r+'tab" unselectable="on" role="tab" aria-controls="'+t._id+'" aria-selected="false" tabIndex="-1">'+e.encode(t.settings.title)+"</div>"}),'<div id="'+e._id+'" class="'+e.classes()+'" hidefocus="1" tabindex="-1"><div id="'+e._id+'-head" class="'+r+'tabs" role="tablist">'+n+'</div><div id="'+e._id+'-body" class="'+e.classes("body")+'">'+t.renderHtml(e)+"</div></div>"},postRender:function(){var e=this;e._super(),e.settings.activeTab=e.settings.activeTab||0,e.activateTab(e.settings.activeTab),this.on("click",function(t){var n=t.target.parentNode;if(t.target.parentNode.id==e._id+"-head")for(var r=n.childNodes.length;r--;)n.childNodes[r]==t.target&&e.activateTab(r)})},initLayoutRect:function(){var e=this,n,r,i;r=t.getSize(e.getEl("head")).width,r=0>r?0:r,i=0,e.items().each(function(t,n){r=Math.max(r,t.layoutRect().minW),i=Math.max(i,t.layoutRect().minH),e.settings.activeTab!=n&&t.hide()}),e.items().each(function(e){e.settings.x=0,e.settings.y=0,e.settings.w=r,e.settings.h=i,e.layoutRect({x:0,y:0,w:r,h:i})});var o=t.getSize(e.getEl("head")).height;return e.settings.minWidth=r,e.settings.minHeight=i+o,n=e._super(),n.deltaH+=o,n.innerH=n.h-n.deltaH,n}})}),r(en,[wt,q],function(e,t){return e.extend({init:function(e){var t=this;t._super(e),t._value=e.value||"",t.addClass("textbox"),e.multiline?t.addClass("multiline"):t.on("keydown",function(e){13==e.keyCode&&t.parents().reverse().each(function(t){return e.preventDefault(),t.hasEventListeners("submit")&&t.toJSON?(t.fire("submit",{data:t.toJSON()}),!1):void 0})})},disabled:function(e){var t=this;return t._rendered&&"undefined"!=typeof e&&(t.getEl().disabled=e),t._super(e)},value:function(e){var t=this;return"undefined"!=typeof e?(t._value=e,t._rendered&&(t.getEl().value=e),t):t._rendered?t.getEl().value:t._value},repaint:function(){var e=this,t,n,r,i=0,o=0,a;t=e.getEl().style,n=e._layoutRect,a=e._lastRepaintRect||{};var s=document;return!e.settings.multiline&&s.all&&(!s.documentMode||s.documentMode<=8)&&(t.lineHeight=n.h-o+"px"),r=e._borderBox,i=r.left+r.right+8,o=r.top+r.bottom+(e.settings.multiline?8:0),n.x!==a.x&&(t.left=n.x+"px",a.x=n.x),n.y!==a.y&&(t.top=n.y+"px",a.y=n.y),n.w!==a.w&&(t.width=n.w-i+"px",a.w=n.w),n.h!==a.h&&(t.height=n.h-o+"px",a.h=n.h),e._lastRepaintRect=a,e.fire("repaint",{},!1),e},renderHtml:function(){var e=this,t=e._id,n=e.settings,r=e.encode(e._value,!1),i="";return"spellcheck"in n&&(i+=' spellcheck="'+n.spellcheck+'"'),n.maxLength&&(i+=' maxlength="'+n.maxLength+'"'),n.size&&(i+=' size="'+n.size+'"'),n.subtype&&(i+=' type="'+n.subtype+'"'),e.disabled()&&(i+=' disabled="disabled"'),n.multiline?'<textarea id="'+t+'" class="'+e.classes()+'" '+(n.rows?' rows="'+n.rows+'"':"")+' hidefocus="1"'+i+">"+r+"</textarea>":'<input id="'+t+'" class="'+e.classes()+'" value="'+r+'" hidefocus="1"'+i+" />"},postRender:function(){var e=this;return t.on(e.getEl(),"change",function(t){e.fire("change",t)}),e._super()},remove:function(){t.off(this.getEl()),this._super()}})}),r(tn,[q,$],function(e,t){return function(n,r){var i=this,o,a=t.classPrefix;i.show=function(t){return i.hide(),o=!0,window.setTimeout(function(){o&&n.appendChild(e.createFragment('<div class="'+a+"throbber"+(r?" "+a+"throbber-inline":"")+'"></div>'))},t||0),i},i.hide=function(){var e=n.lastChild;return e&&-1!=e.className.indexOf("throbber")&&e.parentNode.removeChild(e),o=!1,i}}}),a([l,c,u,d,f,p,h,m,g,v,y,b,C,x,w,_,N,E,S,k,T,R,A,B,D,L,M,H,P,O,I,F,z,W,V,U,q,$,j,K,G,Y,X,J,Q,Z,et,tt,nt,rt,it,ot,at,st,lt,ct,ut,dt,ft,pt,ht,mt,gt,vt,yt,bt,Ct,xt,wt,_t,Nt,Et,St,kt,Tt,Rt,At,Bt,Dt,Lt,Mt,Ht,Pt,Ot,It,Ft,zt,Wt,Vt,Ut,qt,$t,jt,Kt,Gt,Yt,Xt,Jt,Qt,Zt,en,tn])}(this);tinymce.PluginManager.add("advlist",function(t){function e(t,e){var n=[];return tinymce.each(e.split(/[ ,]/),function(t){n.push({text:t.replace(/\-/g," ").replace(/\b\w/g,function(t){return t.toUpperCase()}),data:"default"==t?"":t})}),n}function n(e,n){var o,l=t.dom,a=t.selection;o=l.getParent(a.getNode(),"ol,ul"),o&&o.nodeName==e&&n!==!1||t.execCommand("UL"==e?"InsertUnorderedList":"InsertOrderedList"),n=n===!1?i[e]:n,i[e]=n,o=l.getParent(a.getNode(),"ol,ul"),o&&(l.setStyle(o,"listStyleType",n),o.removeAttribute("data-mce-style")),t.focus()}function o(e){var n=t.dom.getStyle(t.dom.getParent(t.selection.getNode(),"ol,ul"),"listStyleType")||"";e.control.items().each(function(t){t.active(t.settings.data===n)})}var l,a,i={};l=e("OL",t.getParam("advlist_number_styles","default,lower-alpha,lower-greek,lower-roman,upper-alpha,upper-roman")),a=e("UL",t.getParam("advlist_bullet_styles","default,circle,disc,square")),t.addButton("numlist",{type:"splitbutton",tooltip:"Numbered list",menu:l,onshow:o,onselect:function(t){n("OL",t.control.settings.data)},onclick:function(){n("OL",!1)}}),t.addButton("bullist",{type:"splitbutton",tooltip:"Bullet list",menu:a,onshow:o,onselect:function(t){n("UL",t.control.settings.data)},onclick:function(){n("UL",!1)}})});tinymce.PluginManager.add("anchor",function(n){function e(){var e=n.selection.getNode();n.windowManager.open({title:"Anchor",body:{type:"textbox",name:"name",size:40,label:"Name",value:e.name||e.id},onsubmit:function(e){n.execCommand("mceInsertContent",!1,n.dom.createHTML("a",{id:e.data.name}))}})}n.addButton("anchor",{icon:"anchor",tooltip:"Anchor",onclick:e,stateSelector:"a:not([href])"}),n.addMenuItem("anchor",{icon:"anchor",text:"Anchor",context:"insert",onclick:e})});tinymce.PluginManager.add("autolink",function(t){function n(t){o(t,-1,"(",!0)}function e(t){o(t,0,"",!0)}function i(t){o(t,-1,"",!1)}function o(t,n,e){function i(t,n){if(0>n&&(n=0),3==t.nodeType){var e=t.data.length;n>e&&(n=e)}return n}function o(t,n){f.setStart(t,i(t,n))}function r(t,n){f.setEnd(t,i(t,n))}var f,d,a,s,c,l,u,g,h;if(f=t.selection.getRng(!0).cloneRange(),f.startOffset<5){if(g=f.endContainer.previousSibling,!g){if(!f.endContainer.firstChild||!f.endContainer.firstChild.nextSibling)return;g=f.endContainer.firstChild.nextSibling}if(h=g.length,o(g,h),r(g,h),f.endOffset<5)return;d=f.endOffset,s=g}else{if(s=f.endContainer,3!=s.nodeType&&s.firstChild){for(;3!=s.nodeType&&s.firstChild;)s=s.firstChild;3==s.nodeType&&(o(s,0),r(s,s.nodeValue.length))}d=1==f.endOffset?2:f.endOffset-1-n}a=d;do o(s,d>=2?d-2:0),r(s,d>=1?d-1:0),d-=1;while(" "!=f.toString()&&""!==f.toString()&&160!=f.toString().charCodeAt(0)&&d-2>=0&&f.toString()!=e);f.toString()==e||160==f.toString().charCodeAt(0)?(o(s,d),r(s,a),d+=1):0===f.startOffset?(o(s,0),r(s,a)):(o(s,d),r(s,a)),l=f.toString(),"."==l.charAt(l.length-1)&&r(s,a-1),l=f.toString(),u=l.match(/^(https?:\/\/|ssh:\/\/|ftp:\/\/|file:\/|www\.|(?:mailto:)?[A-Z0-9._%+\-]+@)(.+)$/i),u&&("www."==u[1]?u[1]="http://www.":/@$/.test(u[1])&&!/^mailto:/.test(u[1])&&(u[1]="mailto:"+u[1]),c=t.selection.getBookmark(),t.selection.setRng(f),t.execCommand("createlink",!1,u[1]+u[2]),t.selection.moveToBookmark(c),t.nodeChanged())}var r;return t.on("keydown",function(n){return 13==n.keyCode?i(t):void 0}),tinymce.Env.ie?void t.on("focus",function(){if(!r){r=!0;try{t.execCommand("AutoUrlDetect",!1,!0)}catch(n){}}}):(t.on("keypress",function(e){return 41==e.keyCode?n(t):void 0}),void t.on("keyup",function(n){return 32==n.keyCode?e(t):void 0}))});tinymce.PluginManager.add("autoresize",function(e){function t(){return e.plugins.fullscreen&&e.plugins.fullscreen.isFullscreen()}function i(n){var s,r,g,u,l,m,h,d,f=tinymce.DOM;if(r=e.getDoc()){if(g=r.body,u=r.documentElement,l=o.autoresize_min_height,!g||n&&"setcontent"===n.type&&n.initial||t())return void(g&&u&&(g.style.overflowY="auto",u.style.overflowY="auto"));h=e.dom.getStyle(g,"margin-top",!0),d=e.dom.getStyle(g,"margin-bottom",!0),m=g.offsetHeight+parseInt(h,10)+parseInt(d,10),(isNaN(m)||0>=m)&&(m=tinymce.Env.ie?g.scrollHeight:tinymce.Env.webkit&&0===g.clientHeight?0:g.offsetHeight),m>o.autoresize_min_height&&(l=m),o.autoresize_max_height&&m>o.autoresize_max_height?(l=o.autoresize_max_height,g.style.overflowY="auto",u.style.overflowY="auto"):(g.style.overflowY="hidden",u.style.overflowY="hidden",g.scrollTop=0),l!==a&&(s=l-a,f.setStyle(f.get(e.id+"_ifr"),"height",l+"px"),a=l,tinymce.isWebKit&&0>s&&i(n))}}function n(e,t,o){setTimeout(function(){i({}),e--?n(e,t,o):o&&o()},t)}var o=e.settings,a=0;e.settings.inline||(o.autoresize_min_height=parseInt(e.getParam("autoresize_min_height",e.getElement().offsetHeight),10),o.autoresize_max_height=parseInt(e.getParam("autoresize_max_height",0),10),e.on("init",function(){var t=e.getParam("autoresize_overflow_padding",1);e.dom.setStyles(e.getBody(),{paddingBottom:e.getParam("autoresize_bottom_margin",50),paddingLeft:t,paddingRight:t})}),e.on("nodechange setcontent keyup FullscreenStateChanged",i),e.getParam("autoresize_on_init",!0)&&e.on("init",function(){n(20,100,function(){n(5,1e3)})}),e.addCommand("mceAutoResize",i))});tinymce.PluginManager.add("autosave",function(e){function t(e,t){var n={s:1e3,m:6e4};return e=/^(\d+)([ms]?)$/.exec(""+(e||t)),(e[2]?n[e[2]]:1)*parseInt(e,10)}function n(){var e=parseInt(l.getItem(d+"time"),10)||0;return(new Date).getTime()-e>v.autosave_retention?(a(!1),!1):!0}function a(t){l.removeItem(d+"draft"),l.removeItem(d+"time"),t!==!1&&e.fire("RemoveDraft")}function r(){!c()&&e.isDirty()&&(l.setItem(d+"draft",e.getContent({format:"raw",no_events:!0})),l.setItem(d+"time",(new Date).getTime()),e.fire("StoreDraft"))}function o(){n()&&(e.setContent(l.getItem(d+"draft"),{format:"raw"}),e.fire("RestoreDraft"))}function i(){m||(setInterval(function(){e.removed||r()},v.autosave_interval),m=!0)}function s(){var t=this;t.disabled(!n()),e.on("StoreDraft RestoreDraft RemoveDraft",function(){t.disabled(!n())}),i()}function u(){e.undoManager.beforeChange(),o(),a(),e.undoManager.add()}function f(){var e;return tinymce.each(tinymce.editors,function(t){t.plugins.autosave&&t.plugins.autosave.storeDraft(),!e&&t.isDirty()&&t.getParam("autosave_ask_before_unload",!0)&&(e=t.translate("You have unsaved changes are you sure you want to navigate away?"))}),e}function c(t){var n=e.settings.forced_root_block;return t=tinymce.trim("undefined"==typeof t?e.getBody().innerHTML:t),""===t||new RegExp("^<"+n+"[^>]*>(( | |[ ]|<br[^>]*>)+?|)</"+n+">|<br>$","i").test(t)}var d,m,v=e.settings,l=tinymce.util.LocalStorage;d=v.autosave_prefix||"tinymce-autosave-{path}{query}-{id}-",d=d.replace(/\{path\}/g,document.location.pathname),d=d.replace(/\{query\}/g,document.location.search),d=d.replace(/\{id\}/g,e.id),v.autosave_interval=t(v.autosave_interval,"30s"),v.autosave_retention=t(v.autosave_retention,"20m"),e.addButton("restoredraft",{title:"Restore last draft",onclick:u,onPostRender:s}),e.addMenuItem("restoredraft",{text:"Restore last draft",onclick:u,onPostRender:s,context:"file"}),e.settings.autosave_restore_when_empty!==!1&&(e.on("init",function(){n()&&c()&&o()}),e.on("saveContent",function(){a()})),window.onbeforeunload=f,this.hasDraft=n,this.storeDraft=r,this.restoreDraft=o,this.removeDraft=a,this.isEmpty=c});!function(){tinymce.create("tinymce.plugins.BBCodePlugin",{init:function(o){var e=this,t=o.getParam("bbcode_dialect","punbb").toLowerCase();o.on("beforeSetContent",function(o){o.content=e["_"+t+"_bbcode2html"](o.content)}),o.on("postProcess",function(o){o.set&&(o.content=e["_"+t+"_bbcode2html"](o.content)),o.get&&(o.content=e["_"+t+"_html2bbcode"](o.content))})},getInfo:function(){return{longname:"BBCode Plugin",author:"Moxiecode Systems AB",authorurl:"http://www.tinymce.com",infourl:"http://www.tinymce.com/wiki.php/Plugin:bbcode"}},_punbb_html2bbcode:function(o){function e(e,t){o=o.replace(e,t)}return o=tinymce.trim(o),e(/<a.*?href=\"(.*?)\".*?>(.*?)<\/a>/gi,"[url=$1]$2[/url]"),e(/<font.*?color=\"(.*?)\".*?class=\"codeStyle\".*?>(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"),e(/<font.*?color=\"(.*?)\".*?class=\"quoteStyle\".*?>(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"),e(/<font.*?class=\"codeStyle\".*?color=\"(.*?)\".*?>(.*?)<\/font>/gi,"[code][color=$1]$2[/color][/code]"),e(/<font.*?class=\"quoteStyle\".*?color=\"(.*?)\".*?>(.*?)<\/font>/gi,"[quote][color=$1]$2[/color][/quote]"),e(/<span style=\"color: ?(.*?);\">(.*?)<\/span>/gi,"[color=$1]$2[/color]"),e(/<font.*?color=\"(.*?)\".*?>(.*?)<\/font>/gi,"[color=$1]$2[/color]"),e(/<span style=\"font-size:(.*?);\">(.*?)<\/span>/gi,"[size=$1]$2[/size]"),e(/<font>(.*?)<\/font>/gi,"$1"),e(/<img.*?src=\"(.*?)\".*?\/>/gi,"[img]$1[/img]"),e(/<span class=\"codeStyle\">(.*?)<\/span>/gi,"[code]$1[/code]"),e(/<span class=\"quoteStyle\">(.*?)<\/span>/gi,"[quote]$1[/quote]"),e(/<strong class=\"codeStyle\">(.*?)<\/strong>/gi,"[code][b]$1[/b][/code]"),e(/<strong class=\"quoteStyle\">(.*?)<\/strong>/gi,"[quote][b]$1[/b][/quote]"),e(/<em class=\"codeStyle\">(.*?)<\/em>/gi,"[code][i]$1[/i][/code]"),e(/<em class=\"quoteStyle\">(.*?)<\/em>/gi,"[quote][i]$1[/i][/quote]"),e(/<u class=\"codeStyle\">(.*?)<\/u>/gi,"[code][u]$1[/u][/code]"),e(/<u class=\"quoteStyle\">(.*?)<\/u>/gi,"[quote][u]$1[/u][/quote]"),e(/<\/(strong|b)>/gi,"[/b]"),e(/<(strong|b)>/gi,"[b]"),e(/<\/(em|i)>/gi,"[/i]"),e(/<(em|i)>/gi,"[i]"),e(/<\/u>/gi,"[/u]"),e(/<span style=\"text-decoration: ?underline;\">(.*?)<\/span>/gi,"[u]$1[/u]"),e(/<u>/gi,"[u]"),e(/<blockquote[^>]*>/gi,"[quote]"),e(/<\/blockquote>/gi,"[/quote]"),e(/<br \/>/gi,"\n"),e(/<br\/>/gi,"\n"),e(/<br>/gi,"\n"),e(/<p>/gi,""),e(/<\/p>/gi,"\n"),e(/ |\u00a0/gi," "),e(/"/gi,'"'),e(/</gi,"<"),e(/>/gi,">"),e(/&/gi,"&"),o},_punbb_bbcode2html:function(o){function e(e,t){o=o.replace(e,t)}return o=tinymce.trim(o),e(/\n/gi,"<br />"),e(/\[b\]/gi,"<strong>"),e(/\[\/b\]/gi,"</strong>"),e(/\[i\]/gi,"<em>"),e(/\[\/i\]/gi,"</em>"),e(/\[u\]/gi,"<u>"),e(/\[\/u\]/gi,"</u>"),e(/\[url=([^\]]+)\](.*?)\[\/url\]/gi,'<a href="$1">$2</a>'),e(/\[url\](.*?)\[\/url\]/gi,'<a href="$1">$1</a>'),e(/\[img\](.*?)\[\/img\]/gi,'<img src="$1" />'),e(/\[color=(.*?)\](.*?)\[\/color\]/gi,'<font color="$1">$2</font>'),e(/\[code\](.*?)\[\/code\]/gi,'<span class="codeStyle">$1</span> '),e(/\[quote.*?\](.*?)\[\/quote\]/gi,'<span class="quoteStyle">$1</span> '),o}}),tinymce.PluginManager.add("bbcode",tinymce.plugins.BBCodePlugin)}();tinymce.PluginManager.add("charmap",function(e){function a(){function a(e){for(;e;){if("TD"==e.nodeName)return e;e=e.parentNode}}var t,r,o,n;t='<table role="presentation" cellspacing="0" class="mce-charmap"><tbody>';var l=25;for(o=0;10>o;o++){for(t+="<tr>",r=0;l>r;r++){var s=i[o*l+r];t+='<td title="'+s[1]+'"><div tabindex="-1" title="'+s[1]+'" role="button">'+(s?String.fromCharCode(parseInt(s[0],10)):" ")+"</div></td>"}t+="</tr>"}t+="</tbody></table>";var c={type:"container",html:t,onclick:function(a){var i=a.target;"TD"==i.tagName&&(i=i.firstChild),"DIV"==i.tagName&&(e.execCommand("mceInsertContent",!1,i.firstChild.data),a.ctrlKey||n.close())},onmouseover:function(e){var i=a(e.target);i&&n.find("#preview").text(i.firstChild.firstChild.data)}};n=e.windowManager.open({title:"Special character",spacing:10,padding:10,items:[c,{type:"label",name:"preview",text:" ",style:"font-size: 40px; text-align: center",border:1,minWidth:100,minHeight:80}],buttons:[{text:"Close",onclick:function(){n.close()}}]})}var i=[["160","no-break space"],["38","ampersand"],["34","quotation mark"],["162","cent sign"],["8364","euro sign"],["163","pound sign"],["165","yen sign"],["169","copyright sign"],["174","registered sign"],["8482","trade mark sign"],["8240","per mille sign"],["181","micro sign"],["183","middle dot"],["8226","bullet"],["8230","three dot leader"],["8242","minutes / feet"],["8243","seconds / inches"],["167","section sign"],["182","paragraph sign"],["223","sharp s / ess-zed"],["8249","single left-pointing angle quotation mark"],["8250","single right-pointing angle quotation mark"],["171","left pointing guillemet"],["187","right pointing guillemet"],["8216","left single quotation mark"],["8217","right single quotation mark"],["8220","left double quotation mark"],["8221","right double quotation mark"],["8218","single low-9 quotation mark"],["8222","double low-9 quotation mark"],["60","less-than sign"],["62","greater-than sign"],["8804","less-than or equal to"],["8805","greater-than or equal to"],["8211","en dash"],["8212","em dash"],["175","macron"],["8254","overline"],["164","currency sign"],["166","broken bar"],["168","diaeresis"],["161","inverted exclamation mark"],["191","turned question mark"],["710","circumflex accent"],["732","small tilde"],["176","degree sign"],["8722","minus sign"],["177","plus-minus sign"],["247","division sign"],["8260","fraction slash"],["215","multiplication sign"],["185","superscript one"],["178","superscript two"],["179","superscript three"],["188","fraction one quarter"],["189","fraction one half"],["190","fraction three quarters"],["402","function / florin"],["8747","integral"],["8721","n-ary sumation"],["8734","infinity"],["8730","square root"],["8764","similar to"],["8773","approximately equal to"],["8776","almost equal to"],["8800","not equal to"],["8801","identical to"],["8712","element of"],["8713","not an element of"],["8715","contains as member"],["8719","n-ary product"],["8743","logical and"],["8744","logical or"],["172","not sign"],["8745","intersection"],["8746","union"],["8706","partial differential"],["8704","for all"],["8707","there exists"],["8709","diameter"],["8711","backward difference"],["8727","asterisk operator"],["8733","proportional to"],["8736","angle"],["180","acute accent"],["184","cedilla"],["170","feminine ordinal indicator"],["186","masculine ordinal indicator"],["8224","dagger"],["8225","double dagger"],["192","A - grave"],["193","A - acute"],["194","A - circumflex"],["195","A - tilde"],["196","A - diaeresis"],["197","A - ring above"],["198","ligature AE"],["199","C - cedilla"],["200","E - grave"],["201","E - acute"],["202","E - circumflex"],["203","E - diaeresis"],["204","I - grave"],["205","I - acute"],["206","I - circumflex"],["207","I - diaeresis"],["208","ETH"],["209","N - tilde"],["210","O - grave"],["211","O - acute"],["212","O - circumflex"],["213","O - tilde"],["214","O - diaeresis"],["216","O - slash"],["338","ligature OE"],["352","S - caron"],["217","U - grave"],["218","U - acute"],["219","U - circumflex"],["220","U - diaeresis"],["221","Y - acute"],["376","Y - diaeresis"],["222","THORN"],["224","a - grave"],["225","a - acute"],["226","a - circumflex"],["227","a - tilde"],["228","a - diaeresis"],["229","a - ring above"],["230","ligature ae"],["231","c - cedilla"],["232","e - grave"],["233","e - acute"],["234","e - circumflex"],["235","e - diaeresis"],["236","i - grave"],["237","i - acute"],["238","i - circumflex"],["239","i - diaeresis"],["240","eth"],["241","n - tilde"],["242","o - grave"],["243","o - acute"],["244","o - circumflex"],["245","o - tilde"],["246","o - diaeresis"],["248","o slash"],["339","ligature oe"],["353","s - caron"],["249","u - grave"],["250","u - acute"],["251","u - circumflex"],["252","u - diaeresis"],["253","y - acute"],["254","thorn"],["255","y - diaeresis"],["913","Alpha"],["914","Beta"],["915","Gamma"],["916","Delta"],["917","Epsilon"],["918","Zeta"],["919","Eta"],["920","Theta"],["921","Iota"],["922","Kappa"],["923","Lambda"],["924","Mu"],["925","Nu"],["926","Xi"],["927","Omicron"],["928","Pi"],["929","Rho"],["931","Sigma"],["932","Tau"],["933","Upsilon"],["934","Phi"],["935","Chi"],["936","Psi"],["937","Omega"],["945","alpha"],["946","beta"],["947","gamma"],["948","delta"],["949","epsilon"],["950","zeta"],["951","eta"],["952","theta"],["953","iota"],["954","kappa"],["955","lambda"],["956","mu"],["957","nu"],["958","xi"],["959","omicron"],["960","pi"],["961","rho"],["962","final sigma"],["963","sigma"],["964","tau"],["965","upsilon"],["966","phi"],["967","chi"],["968","psi"],["969","omega"],["8501","alef symbol"],["982","pi symbol"],["8476","real part symbol"],["978","upsilon - hook symbol"],["8472","Weierstrass p"],["8465","imaginary part"],["8592","leftwards arrow"],["8593","upwards arrow"],["8594","rightwards arrow"],["8595","downwards arrow"],["8596","left right arrow"],["8629","carriage return"],["8656","leftwards double arrow"],["8657","upwards double arrow"],["8658","rightwards double arrow"],["8659","downwards double arrow"],["8660","left right double arrow"],["8756","therefore"],["8834","subset of"],["8835","superset of"],["8836","not a subset of"],["8838","subset of or equal to"],["8839","superset of or equal to"],["8853","circled plus"],["8855","circled times"],["8869","perpendicular"],["8901","dot operator"],["8968","left ceiling"],["8969","right ceiling"],["8970","left floor"],["8971","right floor"],["9001","left-pointing angle bracket"],["9002","right-pointing angle bracket"],["9674","lozenge"],["9824","black spade suit"],["9827","black club suit"],["9829","black heart suit"],["9830","black diamond suit"],["8194","en space"],["8195","em space"],["8201","thin space"],["8204","zero width non-joiner"],["8205","zero width joiner"],["8206","left-to-right mark"],["8207","right-to-left mark"],["173","soft hyphen"]];e.addButton("charmap",{icon:"charmap",tooltip:"Special character",onclick:a}),e.addMenuItem("charmap",{icon:"charmap",text:"Special character",onclick:a,context:"insert"})});tinymce.PluginManager.add("code",function(e){function o(){e.windowManager.open({title:"Source code",body:{type:"textbox",name:"code",multiline:!0,minWidth:e.getParam("code_dialog_width",600),minHeight:e.getParam("code_dialog_height",Math.min(tinymce.DOM.getViewPort().h-200,500)),value:e.getContent({source_view:!0}),spellcheck:!1,style:"direction: ltr; text-align: left"},onSubmit:function(o){e.focus(),e.undoManager.transact(function(){e.setContent(o.data.code)}),e.selection.setCursorLocation(),e.nodeChanged()}})}e.addCommand("mceCodeEditor",o),e.addButton("code",{icon:"code",tooltip:"Source code",onclick:o}),e.addMenuItem("code",{icon:"code",text:"Source code",context:"tools",onclick:o})});tinymce.PluginManager.add("contextmenu",function(e){var n,t=e.settings.contextmenu_never_use_native;e.on("contextmenu",function(i){var o;if(!i.ctrlKey||t){if(i.preventDefault(),o=e.settings.contextmenu||"link image inserttable | cell row column deletetable",n)n.show();else{var c=[];tinymce.each(o.split(/[ ,]/),function(n){var t=e.menuItems[n];"|"==n&&(t={text:n}),t&&(t.shortcut="",c.push(t))});for(var a=0;a<c.length;a++)"|"==c[a].text&&(0===a||a==c.length-1)&&c.splice(a,1);n=new tinymce.ui.Menu({items:c,context:"contextmenu"}).addClass("contextmenu").renderTo(),e.on("remove",function(){n.remove(),n=null})}var l={x:i.pageX,y:i.pageY};e.inline||(l=tinymce.DOM.getPos(e.getContentAreaContainer()),l.x+=i.clientX,l.y+=i.clientY),n.moveTo(l.x,l.y)}})});tinymce.PluginManager.add("directionality",function(t){function e(e){var i,n=t.dom,r=t.selection.getSelectedBlocks();r.length&&(i=n.getAttrib(r[0],"dir"),tinymce.each(r,function(t){n.getParent(t.parentNode,"*[dir='"+e+"']",n.getRoot())||(i!=e?n.setAttrib(t,"dir",e):n.setAttrib(t,"dir",null))}),t.nodeChanged())}function i(t){var e=[];return tinymce.each("h1 h2 h3 h4 h5 h6 div p".split(" "),function(i){e.push(i+"[dir="+t+"]")}),e.join(",")}t.addCommand("mceDirectionLTR",function(){e("ltr")}),t.addCommand("mceDirectionRTL",function(){e("rtl")}),t.addButton("ltr",{title:"Left to right",cmd:"mceDirectionLTR",stateSelector:i("ltr")}),t.addButton("rtl",{title:"Right to left",cmd:"mceDirectionRTL",stateSelector:i("rtl")})});tinymce.PluginManager.add("emoticons",function(t,e){function a(){var t;return t='<table role="list" class="mce-grid">',tinymce.each(i,function(a){t+="<tr>",tinymce.each(a,function(a){var i=e+"/img/smiley-"+a+".gif";t+='<td><a href="#" data-mce-url="'+i+'" data-mce-alt="'+a+'" tabindex="-1" role="option" aria-label="'+a+'"><img src="'+i+'" style="width: 18px; height: 18px" role="presentation" /></a></td>'}),t+="</tr>"}),t+="</table>"}var i=[["cool","cry","embarassed","foot-in-mouth"],["frown","innocent","kiss","laughing"],["money-mouth","sealed","smile","surprised"],["tongue-out","undecided","wink","yell"]];t.addButton("emoticons",{type:"panelbutton",panel:{role:"application",autohide:!0,html:a,onclick:function(e){var a=t.dom.getParent(e.target,"a");a&&(t.insertContent('<img src="'+a.getAttribute("data-mce-url")+'" alt="'+a.getAttribute("data-mce-alt")+'" />'),this.hide())}},tooltip:"Emoticons"})});tinymce.PluginManager.add("fullpage",function(e){function t(){var t=n();e.windowManager.open({title:"Document properties",data:t,defaults:{type:"textbox",size:40},body:[{name:"title",label:"Title"},{name:"keywords",label:"Keywords"},{name:"description",label:"Description"},{name:"robots",label:"Robots"},{name:"author",label:"Author"},{name:"docencoding",label:"Encoding"}],onSubmit:function(e){l(tinymce.extend(t,e.data))}})}function n(){function t(e,t){var n=e.attr(t);return n||""}var n,l,a=i(),r={};return r.fontface=e.getParam("fullpage_default_fontface",""),r.fontsize=e.getParam("fullpage_default_fontsize",""),n=a.firstChild,7==n.type&&(r.xml_pi=!0,l=/encoding="([^"]+)"/.exec(n.value),l&&(r.docencoding=l[1])),n=a.getAll("#doctype")[0],n&&(r.doctype="<!DOCTYPE"+n.value+">"),n=a.getAll("title")[0],n&&n.firstChild&&(r.title=n.firstChild.value),s(a.getAll("meta"),function(e){var t,n=e.attr("name"),l=e.attr("http-equiv");n?r[n.toLowerCase()]=e.attr("content"):"Content-Type"==l&&(t=/charset\s*=\s*(.*)\s*/gi.exec(e.attr("content")),t&&(r.docencoding=t[1]))}),n=a.getAll("html")[0],n&&(r.langcode=t(n,"lang")||t(n,"xml:lang")),r.stylesheets=[],tinymce.each(a.getAll("link"),function(e){"stylesheet"==e.attr("rel")&&r.stylesheets.push(e.attr("href"))}),n=a.getAll("body")[0],n&&(r.langdir=t(n,"dir"),r.style=t(n,"style"),r.visited_color=t(n,"vlink"),r.link_color=t(n,"link"),r.active_color=t(n,"alink")),r}function l(t){function n(e,t,n){e.attr(t,n?n:void 0)}function l(e){r.firstChild?r.insert(e,r.firstChild):r.append(e)}var a,r,o,c,u,f=e.dom;a=i(),r=a.getAll("head")[0],r||(c=a.getAll("html")[0],r=new m("head",1),c.firstChild?c.insert(r,c.firstChild,!0):c.append(r)),c=a.firstChild,t.xml_pi?(u='version="1.0"',t.docencoding&&(u+=' encoding="'+t.docencoding+'"'),7!=c.type&&(c=new m("xml",7),a.insert(c,a.firstChild,!0)),c.value=u):c&&7==c.type&&c.remove(),c=a.getAll("#doctype")[0],t.doctype?(c||(c=new m("#doctype",10),t.xml_pi?a.insert(c,a.firstChild):l(c)),c.value=t.doctype.substring(9,t.doctype.length-1)):c&&c.remove(),c=null,s(a.getAll("meta"),function(e){"Content-Type"==e.attr("http-equiv")&&(c=e)}),t.docencoding?(c||(c=new m("meta",1),c.attr("http-equiv","Content-Type"),c.shortEnded=!0,l(c)),c.attr("content","text/html; charset="+t.docencoding)):c.remove(),c=a.getAll("title")[0],t.title?(c?c.empty():(c=new m("title",1),l(c)),c.append(new m("#text",3)).value=t.title):c&&c.remove(),s("keywords,description,author,copyright,robots".split(","),function(e){var n,i,r=a.getAll("meta"),o=t[e];for(n=0;n<r.length;n++)if(i=r[n],i.attr("name")==e)return void(o?i.attr("content",o):i.remove());o&&(c=new m("meta",1),c.attr("name",e),c.attr("content",o),c.shortEnded=!0,l(c))});var g={};tinymce.each(a.getAll("link"),function(e){"stylesheet"==e.attr("rel")&&(g[e.attr("href")]=e)}),tinymce.each(t.stylesheets,function(e){g[e]||(c=new m("link",1),c.attr({rel:"stylesheet",text:"text/css",href:e}),c.shortEnded=!0,l(c)),delete g[e]}),tinymce.each(g,function(e){e.remove()}),c=a.getAll("body")[0],c&&(n(c,"dir",t.langdir),n(c,"style",t.style),n(c,"vlink",t.visited_color),n(c,"link",t.link_color),n(c,"alink",t.active_color),f.setAttribs(e.getBody(),{style:t.style,dir:t.dir,vLink:t.visited_color,link:t.link_color,aLink:t.active_color})),c=a.getAll("html")[0],c&&(n(c,"lang",t.langcode),n(c,"xml:lang",t.langcode)),r.firstChild||r.remove(),o=new tinymce.html.Serializer({validate:!1,indent:!0,apply_source_formatting:!0,indent_before:"head,html,body,meta,title,script,link,style",indent_after:"head,html,body,meta,title,script,link,style"}).serialize(a),d=o.substring(0,o.indexOf("</body>"))}function i(){return new tinymce.html.DomParser({validate:!1,root_name:"#document"}).parse(d)}function a(t){function n(e){return e.replace(/<\/?[A-Z]+/g,function(e){return e.toLowerCase()})}var l,a,o,m,u=t.content,f="",g=e.dom;if(!t.selection&&!("raw"==t.format&&d||t.source_view&&e.getParam("fullpage_hide_in_source_view"))){u=u.replace(/<(\/?)BODY/gi,"<$1body"),l=u.indexOf("<body"),-1!=l?(l=u.indexOf(">",l),d=n(u.substring(0,l+1)),a=u.indexOf("</body",l),-1==a&&(a=u.length),t.content=u.substring(l+1,a),c=n(u.substring(a))):(d=r(),c="\n</body>\n</html>"),o=i(),s(o.getAll("style"),function(e){e.firstChild&&(f+=e.firstChild.value)}),m=o.getAll("body")[0],m&&g.setAttribs(e.getBody(),{style:m.attr("style")||"",dir:m.attr("dir")||"",vLink:m.attr("vlink")||"",link:m.attr("link")||"",aLink:m.attr("alink")||""}),g.remove("fullpage_styles");var y=e.getDoc().getElementsByTagName("head")[0];f&&(g.add(y,"style",{id:"fullpage_styles"},f),m=g.get("fullpage_styles"),m.styleSheet&&(m.styleSheet.cssText=f));var h={};tinymce.each(y.getElementsByTagName("link"),function(e){"stylesheet"==e.rel&&e.getAttribute("data-mce-fullpage")&&(h[e.href]=e)}),tinymce.each(o.getAll("link"),function(e){var t=e.attr("href");h[t]||"stylesheet"!=e.attr("rel")||g.add(y,"link",{rel:"stylesheet",text:"text/css",href:t,"data-mce-fullpage":"1"}),delete h[t]}),tinymce.each(h,function(e){e.parentNode.removeChild(e)})}}function r(){var t,n="",l="";return e.getParam("fullpage_default_xml_pi")&&(n+='<?xml version="1.0" encoding="'+e.getParam("fullpage_default_encoding","ISO-8859-1")+'" ?>\n'),n+=e.getParam("fullpage_default_doctype","<!DOCTYPE html>"),n+="\n<html>\n<head>\n",(t=e.getParam("fullpage_default_title"))&&(n+="<title>"+t+"</title>\n"),(t=e.getParam("fullpage_default_encoding"))&&(n+='<meta http-equiv="Content-Type" content="text/html; charset='+t+'" />\n'),(t=e.getParam("fullpage_default_font_family"))&&(l+="font-family: "+t+";"),(t=e.getParam("fullpage_default_font_size"))&&(l+="font-size: "+t+";"),(t=e.getParam("fullpage_default_text_color"))&&(l+="color: "+t+";"),n+="</head>\n<body"+(l?' style="'+l+'"':"")+">\n"}function o(t){t.selection||t.source_view&&e.getParam("fullpage_hide_in_source_view")||(t.content=tinymce.trim(d)+"\n"+tinymce.trim(t.content)+"\n"+tinymce.trim(c))}var d,c,s=tinymce.each,m=tinymce.html.Node;e.addCommand("mceFullPageProperties",t),e.addButton("fullpage",{title:"Document properties",cmd:"mceFullPageProperties"}),e.addMenuItem("fullpage",{text:"Document properties",cmd:"mceFullPageProperties",context:"file"}),e.on("BeforeSetContent",a),e.on("GetContent",o)});tinymce.PluginManager.add("fullscreen",function(e){function t(){var e,t,n=window,i=document,l=i.body;return l.offsetWidth&&(e=l.offsetWidth,t=l.offsetHeight),n.innerWidth&&n.innerHeight&&(e=n.innerWidth,t=n.innerHeight),{w:e,h:t}}function n(){function n(){d.setStyle(a,"height",t().h-(h.clientHeight-a.clientHeight))}var u,h,a,f,m=document.body,g=document.documentElement;s=!s,h=e.getContainer(),u=h.style,a=e.getContentAreaContainer().firstChild,f=a.style,s?(i=f.width,l=f.height,f.width=f.height="100%",c=u.width,o=u.height,u.width=u.height="",d.addClass(m,"mce-fullscreen"),d.addClass(g,"mce-fullscreen"),d.addClass(h,"mce-fullscreen"),d.bind(window,"resize",n),n(),r=n):(f.width=i,f.height=l,c&&(u.width=c),o&&(u.height=o),d.removeClass(m,"mce-fullscreen"),d.removeClass(g,"mce-fullscreen"),d.removeClass(h,"mce-fullscreen"),d.unbind(window,"resize",r)),e.fire("FullscreenStateChanged",{state:s})}var i,l,r,c,o,s=!1,d=tinymce.DOM;return e.settings.inline?void 0:(e.on("init",function(){e.addShortcut("Ctrl+Alt+F","",n)}),e.on("remove",function(){r&&d.unbind(window,"resize",r)}),e.addCommand("mceFullScreen",n),e.addMenuItem("fullscreen",{text:"Fullscreen",shortcut:"Ctrl+Alt+F",selectable:!0,onClick:n,onPostRender:function(){var t=this;e.on("FullscreenStateChanged",function(e){t.active(e.state)})},context:"view"}),e.addButton("fullscreen",{tooltip:"Fullscreen",shortcut:"Ctrl+Alt+F",onClick:n,onPostRender:function(){var t=this;e.on("FullscreenStateChanged",function(e){t.active(e.state)})}}),{isFullscreen:function(){return s}})});tinymce.PluginManager.add("hr",function(n){n.addCommand("InsertHorizontalRule",function(){n.execCommand("mceInsertContent",!1,"<hr />")}),n.addButton("hr",{icon:"hr",tooltip:"Horizontal line",cmd:"InsertHorizontalRule"}),n.addMenuItem("hr",{icon:"hr",text:"Horizontal line",cmd:"InsertHorizontalRule",context:"insert"})});tinymce.PluginManager.add("image",function(e){function t(e,t){function i(e,i){n.parentNode&&n.parentNode.removeChild(n),t({width:e,height:i})}var n=document.createElement("img");n.onload=function(){i(n.clientWidth,n.clientHeight)},n.onerror=function(){i()};var a=n.style;a.visibility="hidden",a.position="fixed",a.bottom=a.left=0,a.width=a.height="auto",document.body.appendChild(n),n.src=e}function i(t){return tinymce.each(t,function(t){t.textStyle=function(){return e.formatter.getCssText({inline:"img",classes:[t.value]})}}),t}function n(t){return function(){var i=e.settings.image_list;"string"==typeof i?tinymce.util.XHR.send({url:i,success:function(e){t(tinymce.util.JSON.parse(e))}}):"function"==typeof i?i(t):t(i)}}function a(n){function a(t,i,n){var a,l=[];return tinymce.each(e.settings[t]||n,function(e){var t={text:e.text||e.title,value:e.value};l.push(t),(f[i]===e.value||!a&&e.selected)&&(a=t)}),a&&!f[i]&&(f[i]=a.value,a.selected=!0),l}function l(){var t=[{text:"None",value:""}];return tinymce.each(n,function(i){t.push({text:i.text||i.title,value:e.convertURL(i.value||i.url,"src"),menu:i.menu})}),t}function o(){var e,t,i,n;e=u.find("#width")[0],t=u.find("#height")[0],i=e.value(),n=t.value(),u.find("#constrain")[0].checked()&&g&&h&&i&&n&&(g!=i?(n=Math.round(i/g*n),t.value(n)):(i=Math.round(n/h*i),e.value(i))),g=i,h=n}function s(){function t(t){function i(){t.onload=t.onerror=null,e.selection.select(t),e.nodeChanged()}t.onload=function(){f.width||f.height||y.setAttribs(t,{width:t.clientWidth,height:t.clientHeight}),i()},t.onerror=i}d(),o(),f=tinymce.extend(f,u.toJSON()),f.alt||(f.alt=""),""===f.width&&(f.width=null),""===f.height&&(f.height=null),f.style||(f.style=null),f={src:f.src,alt:f.alt,width:f.width,height:f.height,style:f.style,"class":f["class"]},f["class"]||delete f["class"],e.undoManager.transact(function(){return f.src?(v?y.setAttribs(v,f):(f.id="__mcenew",e.focus(),e.selection.setContent(y.createHTML("img",f)),v=y.get("__mcenew"),y.setAttrib(v,"id",null)),void t(v)):void(v&&(y.remove(v),e.focus(),e.nodeChanged()))})}function r(e){return e&&(e=e.replace(/px$/,"")),e}function c(){m&&m.value(e.convertURL(this.value(),"src")),t(this.value(),function(e){e.width&&e.height&&(g=e.width,h=e.height,u.find("#width").value(g),u.find("#height").value(h))})}function d(){function t(e){return e.length>0&&/^[0-9]+$/.test(e)&&(e+="px"),e}if(e.settings.image_advtab){var i=u.toJSON(),n=y.parseStyle(i.style);delete n.margin,n["margin-top"]=n["margin-bottom"]=t(i.vspace),n["margin-left"]=n["margin-right"]=t(i.hspace),n["border-width"]=t(i.border),u.find("#style").value(y.serializeStyle(y.parseStyle(y.serializeStyle(n))))}}var u,g,h,m,p,f={},y=e.dom,v=e.selection.getNode();g=y.getAttrib(v,"width"),h=y.getAttrib(v,"height"),"IMG"!=v.nodeName||v.getAttribute("data-mce-object")||v.getAttribute("data-mce-placeholder")?v=null:f={src:y.getAttrib(v,"src"),alt:y.getAttrib(v,"alt"),"class":y.getAttrib(v,"class"),width:g,height:h},n&&(m={type:"listbox",label:"Image list",values:l(),value:f.src&&e.convertURL(f.src,"src"),onselect:function(e){var t=u.find("#alt");(!t.value()||e.lastControl&&t.value()==e.lastControl.text())&&t.value(e.control.text()),u.find("#src").value(e.control.value())},onPostRender:function(){m=this}}),e.settings.image_class_list&&(p={name:"class",type:"listbox",label:"Class",values:i(a("image_class_list","class"))});var b=[{name:"src",type:"filepicker",filetype:"image",label:"Source",autofocus:!0,onchange:c},m];e.settings.image_description!==!1&&b.push({name:"alt",type:"textbox",label:"Image description"}),e.settings.image_dimensions!==!1&&b.push({type:"container",label:"Dimensions",layout:"flex",direction:"row",align:"center",spacing:5,items:[{name:"width",type:"textbox",maxLength:5,size:3,onchange:o,ariaLabel:"Width"},{type:"label",text:"x"},{name:"height",type:"textbox",maxLength:5,size:3,onchange:o,ariaLabel:"Height"},{name:"constrain",type:"checkbox",checked:!0,text:"Constrain proportions"}]}),b.push(p),e.settings.image_advtab?(v&&(f.hspace=r(v.style.marginLeft||v.style.marginRight),f.vspace=r(v.style.marginTop||v.style.marginBottom),f.border=r(v.style.borderWidth),f.style=e.dom.serializeStyle(e.dom.parseStyle(e.dom.getAttrib(v,"style")))),u=e.windowManager.open({title:"Insert/edit image",data:f,bodyType:"tabpanel",body:[{title:"General",type:"form",items:b},{title:"Advanced",type:"form",pack:"start",items:[{label:"Style",name:"style",type:"textbox"},{type:"form",layout:"grid",packV:"start",columns:2,padding:0,alignH:["left","right"],defaults:{type:"textbox",maxWidth:50,onchange:d},items:[{label:"Vertical space",name:"vspace"},{label:"Horizontal space",name:"hspace"},{label:"Border",name:"border"}]}]}],onSubmit:s})):u=e.windowManager.open({title:"Insert/edit image",data:f,body:b,onSubmit:s})}e.addButton("image",{icon:"image",tooltip:"Insert/edit image",onclick:n(a),stateSelector:"img:not([data-mce-object],[data-mce-placeholder])"}),e.addMenuItem("image",{icon:"image",text:"Insert image",onclick:n(a),context:"insert",prependToContext:!0})});tinymce.PluginManager.add("importcss",function(t){function e(t){return"string"==typeof t?function(e){return-1!==e.indexOf(t)}:t instanceof RegExp?function(e){return t.test(e)}:t}function n(e,n){function i(t,e){var c,o=t.href;if(o&&n(o,e)){s(t.imports,function(t){i(t,!0)});try{c=t.cssRules||t.rules}catch(a){}s(c,function(t){t.styleSheet?i(t.styleSheet,!0):t.selectorText&&s(t.selectorText.split(","),function(t){r.push(tinymce.trim(t))})})}}var r=[],c={};s(t.contentCSS,function(t){c[t]=!0}),n||(n=function(t,e){return e||c[t]});try{s(e.styleSheets,function(t){i(t)})}catch(o){}return r}function i(e){var n,i=/^(?:([a-z0-9\-_]+))?(\.[a-z0-9_\-\.]+)$/i.exec(e);if(i){var r=i[1],s=i[2].substr(1).split(".").join(" "),c=tinymce.makeMap("a,img");return i[1]?(n={title:e},t.schema.getTextBlockElements()[r]?n.block=r:t.schema.getBlockElements()[r]||c[r.toLowerCase()]?n.selector=r:n.inline=r):i[2]&&(n={inline:"span",title:e.substr(1),classes:s}),t.settings.importcss_merge_classes!==!1?n.classes=s:n.attributes={"class":s},n}}var r=this,s=tinymce.each;t.on("renderFormatsMenu",function(c){var o=t.settings,a={},l=o.importcss_selector_converter||i,f=e(o.importcss_selector_filter),m=c.control;t.settings.importcss_append||m.items().remove();var u=[];tinymce.each(o.importcss_groups,function(t){t=tinymce.extend({},t),t.filter=e(t.filter),u.push(t)}),s(n(c.doc||t.getDoc(),e(o.importcss_file_filter)),function(e){if(-1===e.indexOf(".mce-")&&!a[e]&&(!f||f(e))){var n,i=l.call(r,e);if(i){var s=i.name||tinymce.DOM.uniqueId();if(u)for(var c=0;c<u.length;c++)if(!u[c].filter||u[c].filter(e)){u[c].item||(u[c].item={text:u[c].title,menu:[]}),n=u[c].item.menu;break}t.formatter.register(s,i);var o=tinymce.extend({},m.settings.itemDefaults,{text:i.title,format:s});n?n.push(o):m.add(o)}a[e]=!0}}),s(u,function(t){m.add(t.item)}),c.control.renderNew()}),r.convertSelectorToFormat=i});tinymce.PluginManager.add("insertdatetime",function(e){function t(t,a){function n(e,t){if(e=""+e,e.length<t)for(var a=0;a<t-e.length;a++)e="0"+e;return e}return a=a||new Date,t=t.replace("%D","%m/%d/%Y"),t=t.replace("%r","%I:%M:%S %p"),t=t.replace("%Y",""+a.getFullYear()),t=t.replace("%y",""+a.getYear()),t=t.replace("%m",n(a.getMonth()+1,2)),t=t.replace("%d",n(a.getDate(),2)),t=t.replace("%H",""+n(a.getHours(),2)),t=t.replace("%M",""+n(a.getMinutes(),2)),t=t.replace("%S",""+n(a.getSeconds(),2)),t=t.replace("%I",""+((a.getHours()+11)%12+1)),t=t.replace("%p",""+(a.getHours()<12?"AM":"PM")),t=t.replace("%B",""+e.translate(m[a.getMonth()])),t=t.replace("%b",""+e.translate(c[a.getMonth()])),t=t.replace("%A",""+e.translate(d[a.getDay()])),t=t.replace("%a",""+e.translate(i[a.getDay()])),t=t.replace("%%","%")}function a(a){var n=t(a);if(e.settings.insertdatetime_element){var r;r=t(/%[HMSIp]/.test(a)?"%Y-%m-%dT%H:%M":"%Y-%m-%d"),n='<time datetime="'+r+'">'+n+"</time>";var i=e.dom.getParent(e.selection.getStart(),"time");if(i)return void e.dom.setOuterHTML(i,n)}e.insertContent(n)}var n,r,i="Sun Mon Tue Wed Thu Fri Sat Sun".split(" "),d="Sunday Monday Tuesday Wednesday Thursday Friday Saturday Sunday".split(" "),c="Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec".split(" "),m="January February March April May June July August September October November December".split(" "),u=[];e.addCommand("mceInsertDate",function(){a(e.getParam("insertdatetime_dateformat",e.translate("%Y-%m-%d")))}),e.addCommand("mceInsertTime",function(){a(e.getParam("insertdatetime_timeformat",e.translate("%H:%M:%S")))}),e.addButton("insertdatetime",{type:"splitbutton",title:"Insert date/time",onclick:function(){a(n||r)},menu:u}),tinymce.each(e.settings.insertdatetime_formats||["%H:%M:%S","%Y-%m-%d","%I:%M:%S %p","%D"],function(e){r||(r=e),u.push({text:t(e),onclick:function(){n=e,a(e)}})}),e.addMenuItem("insertdatetime",{icon:"date",text:"Insert date/time",menu:u,context:"insert"})});!function(e){e.on("AddEditor",function(e){e.editor.settings.inline_styles=!1}),e.PluginManager.add("legacyoutput",function(t){t.on("init",function(){var i="p,h1,h2,h3,h4,h5,h6,td,th,div,ul,ol,li,table,img",n=e.explode(t.settings.font_size_style_values),l=t.schema;t.formatter.register({alignleft:{selector:i,attributes:{align:"left"}},aligncenter:{selector:i,attributes:{align:"center"}},alignright:{selector:i,attributes:{align:"right"}},alignjustify:{selector:i,attributes:{align:"justify"}},bold:[{inline:"b",remove:"all"},{inline:"strong",remove:"all"},{inline:"span",styles:{fontWeight:"bold"}}],italic:[{inline:"i",remove:"all"},{inline:"em",remove:"all"},{inline:"span",styles:{fontStyle:"italic"}}],underline:[{inline:"u",remove:"all"},{inline:"span",styles:{textDecoration:"underline"},exact:!0}],strikethrough:[{inline:"strike",remove:"all"},{inline:"span",styles:{textDecoration:"line-through"},exact:!0}],fontname:{inline:"font",attributes:{face:"%value"}},fontsize:{inline:"font",attributes:{size:function(t){return e.inArray(n,t.value)+1}}},forecolor:{inline:"font",attributes:{color:"%value"}},hilitecolor:{inline:"font",styles:{backgroundColor:"%value"}}}),e.each("b,i,u,strike".split(","),function(e){l.addValidElements(e+"[*]")}),l.getElementRule("font")||l.addValidElements("font[face|size|color|style]"),e.each(i.split(","),function(e){var t=l.getElementRule(e);t&&(t.attributes.align||(t.attributes.align={},t.attributesOrder.push("align")))})})})}(tinymce);tinymce.PluginManager.add("link",function(t){function e(e){return function(){var n=t.settings.link_list;"string"==typeof n?tinymce.util.XHR.send({url:n,success:function(t){e(tinymce.util.JSON.parse(t))}}):"function"==typeof n?n(e):e(n)}}function n(e){function n(t){var e=d.find("#text");(!e.value()||t.lastControl&&e.value()==t.lastControl.text())&&e.value(t.control.text()),d.find("#href").value(t.control.value())}function l(){var n=[{text:"None",value:""}];return tinymce.each(e,function(e){n.push({text:e.text||e.title,value:t.convertURL(e.value||e.url,"href"),menu:e.menu})}),n}function i(e){return tinymce.each(e,function(e){e.textStyle=function(){return t.formatter.getCssText({inline:"a",classes:[e.value]})}}),e}function a(e,n,l){var i,a=[];return tinymce.each(t.settings[e]||l,function(t){var e={text:t.text||t.title,value:t.value};a.push(e),(b[n]===t.value||!i&&t.selected)&&(i=e)}),i&&!b[n]&&(b[n]=i.value,i.selected=!0),a}function r(e){var l=[];return tinymce.each(t.dom.select("a:not([href])"),function(t){var n=t.name||t.id;n&&l.push({text:n,value:"#"+n,selected:-1!=e.indexOf("#"+n)})}),l.length?(l.unshift({text:"None",value:""}),{name:"anchor",type:"listbox",label:"Anchors",values:l,onselect:n}):void 0}function o(){h&&h.value(t.convertURL(this.value(),"href")),!f&&0===b.text.length&&x&&this.parent().parent().find("#text")[0].value(this.value())}function s(t){var e=k.getContent();if(/</.test(e)&&(!/^<a [^>]+>[^<]+<\/a>$/.test(e)||-1==e.indexOf("href=")))return!1;if(t){var n,l=t.childNodes;if(0===l.length)return!1;for(n=l.length-1;n>=0;n--)if(3!=l[n].nodeType)return!1}return!0}var u,c,f,d,x,v,h,g,m,p,y,b={},k=t.selection,w=t.dom;u=k.getNode(),c=w.getParent(u,"a[href]"),x=s(),b.text=f=c?c.innerText||c.textContent:k.getContent({format:"text"}),b.href=c?w.getAttrib(c,"href"):"",b.target=c?w.getAttrib(c,"target"):t.settings.default_link_target||null,b.rel=c?w.getAttrib(c,"rel"):null,b["class"]=c?w.getAttrib(c,"class"):null,b.title=c?w.getAttrib(c,"title"):"",x&&(v={name:"text",type:"textbox",size:40,label:"Text to display",onchange:function(){b.text=this.value()}}),e&&(h={type:"listbox",label:"Link list",values:l(),onselect:n,value:t.convertURL(b.href,"href"),onPostRender:function(){h=this}}),t.settings.target_list!==!1&&(m={name:"target",type:"listbox",label:"Target",values:a("target_list","target",[{text:"None",value:""},{text:"New window",value:"_blank"}])}),t.settings.rel_list&&(g={name:"rel",type:"listbox",label:"Rel",values:a("rel_list","rel",[{text:"None",value:""}])}),t.settings.link_class_list&&(p={name:"class",type:"listbox",label:"Class",values:i(a("link_class_list","class"))}),t.settings.link_title!==!1&&(y={name:"title",type:"textbox",label:"Title",value:b.title}),d=t.windowManager.open({title:"Insert link",data:b,body:[{name:"href",type:"filepicker",filetype:"file",size:40,autofocus:!0,label:"Url",onchange:o,onkeyup:o},v,y,r(b.href),h,g,m,p],onSubmit:function(e){function n(e,n){var l=t.selection.getRng();window.setTimeout(function(){t.windowManager.confirm(e,function(e){t.selection.setRng(l),n(e)})},0)}function l(){var e={href:i,target:b.target?b.target:null,rel:b.rel?b.rel:null,"class":b["class"]?b["class"]:null,title:b.title?b.title:null};c?(t.focus(),x&&b.text!=f&&("innerText"in c?c.innerText=b.text:c.textContent=b.text),w.setAttribs(c,e),k.select(c),t.undoManager.add()):x?t.insertContent(w.createHTML("a",e,w.encode(b.text))):t.execCommand("mceInsertLink",!1,e)}var i;return b=tinymce.extend(b,e.data),(i=b.href)?i.indexOf("@")>0&&-1==i.indexOf("//")&&-1==i.indexOf("mailto:")?void n("The URL you entered seems to be an email address. Do you want to add the required mailto: prefix?",function(t){t&&(i="mailto:"+i),l()}):/^\s*www\./i.test(i)?void n("The URL you entered seems to be an external link. Do you want to add the required http:// prefix?",function(t){t&&(i="http://"+i),l()}):void l():void t.execCommand("unlink")}})}t.addButton("link",{icon:"link",tooltip:"Insert/edit link",shortcut:"Ctrl+K",onclick:e(n),stateSelector:"a[href]"}),t.addButton("unlink",{icon:"unlink",tooltip:"Remove link",cmd:"unlink",stateSelector:"a[href]"}),t.addShortcut("Ctrl+K","",e(n)),this.showDialog=n,t.addMenuItem("link",{icon:"link",text:"Insert link",shortcut:"Ctrl+K",onclick:e(n),stateSelector:"a[href]",context:"insert",prependToContext:!0})});tinymce.PluginManager.add("lists",function(e){function t(e){return e&&/^(OL|UL)$/.test(e.nodeName)}function n(e){return e.parentNode.firstChild==e}function r(e){return e.parentNode.lastChild==e}function o(t){return t&&!!e.schema.getTextBlockElements()[t.nodeName]}function i(e){return e&&"SPAN"===e.nodeName&&"bookmark"===e.getAttribute("data-mce-type")}var a=this;e.on("init",function(){function d(e){function t(t){var r,o,i;o=e[t?"startContainer":"endContainer"],i=e[t?"startOffset":"endOffset"],1==o.nodeType&&(r=b.create("span",{"data-mce-type":"bookmark"}),o.hasChildNodes()?(i=Math.min(i,o.childNodes.length-1),t?o.insertBefore(r,o.childNodes[i]):b.insertAfter(r,o.childNodes[i])):o.appendChild(r),o=r,i=0),n[t?"startContainer":"endContainer"]=o,n[t?"startOffset":"endOffset"]=i}var n={};return t(!0),e.collapsed||t(),n}function s(e){function t(t){function n(e){for(var t=e.parentNode.firstChild,n=0;t;){if(t==e)return n;(1!=t.nodeType||"bookmark"!=t.getAttribute("data-mce-type"))&&n++,t=t.nextSibling}return-1}var r,o,i;r=i=e[t?"startContainer":"endContainer"],o=e[t?"startOffset":"endOffset"],r&&(1==r.nodeType&&(o=n(r),r=r.parentNode,b.remove(i)),e[t?"startContainer":"endContainer"]=r,e[t?"startOffset":"endOffset"]=o)}t(!0),t();var n=b.createRng();n.setStart(e.startContainer,e.startOffset),e.endContainer&&n.setEnd(e.endContainer,e.endOffset),k.setRng(n)}function f(t,n){var r,o,i,a=b.createFragment(),d=e.schema.getBlockElements();if(e.settings.forced_root_block&&(n=n||e.settings.forced_root_block),n&&(o=b.create(n),o.tagName===e.settings.forced_root_block&&b.setAttribs(o,e.settings.forced_root_block_attrs),a.appendChild(o)),t)for(;r=t.firstChild;){var s=r.nodeName;i||"SPAN"==s&&"bookmark"==r.getAttribute("data-mce-type")||(i=!0),d[s]?(a.appendChild(r),o=null):n?(o||(o=b.create(n),a.appendChild(o)),o.appendChild(r)):a.appendChild(r)}return e.settings.forced_root_block?i||tinymce.Env.ie&&!(tinymce.Env.ie>10)||o.appendChild(b.create("br",{"data-mce-bogus":"1"})):a.appendChild(b.create("br")),a}function l(){return tinymce.grep(k.getSelectedBlocks(),function(e){return"LI"==e.nodeName})}function c(e,t,n){var r,o,i=b.select('span[data-mce-type="bookmark"]',e);n=n||f(t),r=b.createRng(),r.setStartAfter(t),r.setEndAfter(e),o=r.extractContents(),b.isEmpty(o)||b.insertAfter(o,e),b.insertAfter(n,e),b.isEmpty(t.parentNode)&&(tinymce.each(i,function(e){t.parentNode.parentNode.insertBefore(e,t.parentNode)}),b.remove(t.parentNode)),b.remove(t)}function p(e){var n,r;if(n=e.nextSibling,n&&t(n)&&n.nodeName==e.nodeName){for(;r=n.firstChild;)e.appendChild(r);b.remove(n)}if(n=e.previousSibling,n&&t(n)&&n.nodeName==e.nodeName){for(;r=n.firstChild;)e.insertBefore(r,e.firstChild);b.remove(n)}}function u(e){tinymce.each(tinymce.grep(b.select("ol,ul",e)),function(e){var n,r=e.parentNode;"LI"==r.nodeName&&r.firstChild==e&&(n=r.previousSibling,n&&"LI"==n.nodeName&&(n.appendChild(e),b.isEmpty(r)&&b.remove(r))),t(r)&&(n=r.previousSibling,n&&"LI"==n.nodeName&&n.appendChild(e))})}function m(e){function o(e){b.isEmpty(e)&&b.remove(e)}var i,a=e.parentNode,d=a.parentNode;return n(e)&&r(e)?("LI"==d.nodeName?(b.insertAfter(e,d),o(d),b.remove(a)):t(d)?b.remove(a,!0):(d.insertBefore(f(e),a),b.remove(a)),!0):n(e)?("LI"==d.nodeName?(b.insertAfter(e,d),e.appendChild(a),o(d)):t(d)?d.insertBefore(e,a):(d.insertBefore(f(e),a),b.remove(e)),!0):r(e)?("LI"==d.nodeName?b.insertAfter(e,d):t(d)?b.insertAfter(e,a):(b.insertAfter(f(e),a),b.remove(e)),!0):("LI"==d.nodeName?(a=d,i=f(e,"LI")):i=t(d)?f(e,"LI"):f(e),c(a,e,i),u(a.parentNode),!0)}function h(e){function n(n,r){var o;if(t(n)){for(;o=e.lastChild.firstChild;)r.appendChild(o);b.remove(n)}}var r,o;return r=e.previousSibling,r&&t(r)?(r.appendChild(e),!0):r&&"LI"==r.nodeName&&t(r.lastChild)?(r.lastChild.appendChild(e),n(e.lastChild,r.lastChild),!0):(r=e.nextSibling,r&&t(r)?(r.insertBefore(e,r.firstChild),!0):r&&"LI"==r.nodeName&&t(e.lastChild)?!1:(r=e.previousSibling,r&&"LI"==r.nodeName?(o=b.create(e.parentNode.nodeName),r.appendChild(o),o.appendChild(e),n(e.lastChild,o),!0):!1))}function v(){var t=l();if(t.length){for(var n=d(k.getRng(!0)),r=0;r<t.length&&(h(t[r])||0!==r);r++);return s(n),e.nodeChanged(),!0}}function C(){var t=l();if(t.length){var n,r,o=d(k.getRng(!0)),i=e.getBody();for(n=t.length;n--;)for(var a=t[n].parentNode;a&&a!=i;){for(r=t.length;r--;)if(t[r]===a){t.splice(n,1);break}a=a.parentNode}for(n=0;n<t.length&&(m(t[n])||0!==n);n++);return s(o),e.nodeChanged(),!0}}function g(n){function r(){function t(e){var t,n;for(t=a[e?"startContainer":"endContainer"],n=a[e?"startOffset":"endOffset"],1==t.nodeType&&(t=t.childNodes[Math.min(n,t.childNodes.length-1)]||t);t.parentNode!=d;){if(o(t))return t;if(/^(TD|TH)$/.test(t.parentNode.nodeName))return t;t=t.parentNode}return t}for(var n,r=[],d=e.getBody(),s=t(!0),f=t(),l=[],c=s;c&&(l.push(c),c!=f);c=c.nextSibling);return tinymce.each(l,function(e){if(o(e))return r.push(e),void(n=null);if(b.isBlock(e)||"BR"==e.nodeName)return"BR"==e.nodeName&&b.remove(e),void(n=null);var t=e.nextSibling;return i(e)&&(o(t)||!t&&e.parentNode==d)?void(n=null):(n||(n=b.create("p"),e.parentNode.insertBefore(n,e),r.push(n)),void n.appendChild(e))}),r}var a=k.getRng(!0),f=d(a),l=r();tinymce.each(l,function(e){var r,o;o=e.previousSibling,o&&t(o)&&o.nodeName==n?(r=o,e=b.rename(e,"LI"),o.appendChild(e)):(r=b.create(n),e.parentNode.insertBefore(r,e),r.appendChild(e),e=b.rename(e,"LI")),p(r)}),s(f)}function N(){var n=d(k.getRng(!0)),r=e.getBody();tinymce.each(l(),function(e){var n,o;if(b.isEmpty(e))return void m(e);for(n=e;n&&n!=r;n=n.parentNode)t(n)&&(o=n);c(o,e)}),s(n)}function y(e){var t=b.getParent(k.getStart(),"OL,UL");if(t)if(t.nodeName==e)N(e);else{var n=d(k.getRng(!0));p(b.rename(t,e)),s(n)}else g(e)}var b=e.dom,k=e.selection;a.backspaceDelete=function(e){function n(e,t){var n=e.startContainer,r=e.startOffset;if(3==n.nodeType&&(t?r<n.data.length:r>0))return n;for(var o=new tinymce.dom.TreeWalker(e.startContainer);n=o[t?"next":"prev"]();)if(3==n.nodeType&&n.data.length>0)return n}function r(e,n){var r,o,i=e.parentNode;for(t(n.lastChild)&&(o=n.lastChild),r=n.lastChild,r&&"BR"==r.nodeName&&e.hasChildNodes()&&b.remove(r);r=e.firstChild;)n.appendChild(r);o&&n.appendChild(o),b.remove(e),b.isEmpty(i)&&b.remove(i)}if(k.isCollapsed()){var o=b.getParent(k.getStart(),"LI");if(o){var i=k.getRng(!0),a=b.getParent(n(i,e),"LI");if(a&&a!=o){var f=d(i);return e?r(a,o):r(o,a),s(f),!0}if(!a&&!e&&N(o.parentNode.nodeName))return!0}}},e.addCommand("Indent",function(){return v()?void 0:!0}),e.addCommand("Outdent",function(){return C()?void 0:!0}),e.addCommand("InsertUnorderedList",function(){y("UL")}),e.addCommand("InsertOrderedList",function(){y("OL")}),e.on("keydown",function(t){9==t.keyCode&&e.dom.getParent(e.selection.getStart(),"LI")&&(t.preventDefault(),t.shiftKey?C():v())})}),e.addButton("indent",{icon:"indent",title:"Increase indent",cmd:"Indent",onPostRender:function(){var t=this;e.on("nodechange",function(){for(var r=e.selection.getSelectedBlocks(),o=!1,i=0,a=r.length;!o&&a>i;i++){var d=r[i].nodeName;o="LI"==d&&n(r[i])||"UL"==d||"OL"==d}t.disabled(o)})}}),e.on("keydown",function(e){e.keyCode==tinymce.util.VK.BACKSPACE?a.backspaceDelete()&&e.preventDefault():e.keyCode==tinymce.util.VK.DELETE&&a.backspaceDelete(!0)&&e.preventDefault()})});tinymce.PluginManager.add("media",function(e,t){function i(e){return-1!=e.indexOf(".mp3")?"audio/mpeg":-1!=e.indexOf(".wav")?"audio/wav":-1!=e.indexOf(".mp4")?"video/mp4":-1!=e.indexOf(".webm")?"video/webm":-1!=e.indexOf(".ogg")?"video/ogg":-1!=e.indexOf(".swf")?"application/x-shockwave-flash":""}function r(t){var i=e.settings.media_scripts;if(i)for(var r=0;r<i.length;r++)if(-1!==t.indexOf(i[r].filter))return i[r]}function o(){function t(e){var t,a,c,s;t=i.find("#width")[0],a=i.find("#height")[0],c=t.value(),s=a.value(),i.find("#constrain")[0].checked()&&r&&o&&c&&s&&(e.control==t?(s=Math.round(c/r*s),a.value(s)):(c=Math.round(s/o*c),t.value(c))),r=c,o=s}var i,r,o,m,u=[{name:"source1",type:"filepicker",filetype:"media",size:40,autofocus:!0,label:"Source"}];e.settings.media_alt_source!==!1&&u.push({name:"source2",type:"filepicker",filetype:"media",size:40,label:"Alternative source"}),e.settings.media_poster!==!1&&u.push({name:"poster",type:"filepicker",filetype:"image",size:40,label:"Poster"}),e.settings.media_dimensions!==!1&&u.push({type:"container",label:"Dimensions",layout:"flex",align:"center",spacing:5,items:[{name:"width",type:"textbox",maxLength:3,size:3,onchange:t},{type:"label",text:"x"},{name:"height",type:"textbox",maxLength:3,size:3,onchange:t},{name:"constrain",type:"checkbox",checked:!0,text:"Constrain proportions"}]}),m=n(e.selection.getNode()),r=m.width,o=m.height,i=e.windowManager.open({title:"Insert/edit video",data:m,bodyType:"tabpanel",body:[{title:"General",type:"form",onShowTab:function(){m=s(this.next().find("#embed").value()),this.fromJSON(m)},items:u},{title:"Embed",type:"panel",layout:"flex",direction:"column",align:"stretch",padding:10,spacing:10,onShowTab:function(){this.find("#embed").value(c(this.parent().toJSON()))},items:[{type:"label",text:"Paste your embed code below:",forId:"mcemediasource"},{id:"mcemediasource",type:"textbox",flex:1,name:"embed",value:a(),multiline:!0,label:"Source"}]}],onSubmit:function(){e.insertContent(c(this.toJSON()))}})}function a(){var t=e.selection.getNode();return t.getAttribute("data-mce-object")?e.selection.getContent():void 0}function c(o){var a="";if(!o.source1&&(tinymce.extend(o,s(o.embed)),!o.source1))return"";if(o.source2||(o.source2=""),o.poster||(o.poster=""),o.source1=e.convertURL(o.source1,"source"),o.source2=e.convertURL(o.source2,"source"),o.source1mime=i(o.source1),o.source2mime=i(o.source2),o.poster=e.convertURL(o.poster,"poster"),o.flashPlayerUrl=e.convertURL(t+"/moxieplayer.swf","movie"),tinymce.each(u,function(e){var t,i,r;if(t=e.regex.exec(o.source1)){for(r=e.url,i=0;t[i];i++)r=r.replace("$"+i,function(){return t[i]});o.source1=r,o.type=e.type,o.width=o.width||e.w,o.height=o.height||e.h}}),o.embed)a=m(o.embed,o,!0);else{var c=r(o.source1);c&&(o.type="script",o.width=c.width,o.height=c.height),o.width=o.width||300,o.height=o.height||150,tinymce.each(o,function(t,i){o[i]=e.dom.encode(t)}),"iframe"==o.type?a+='<iframe src="'+o.source1+'" width="'+o.width+'" height="'+o.height+'"></iframe>':"application/x-shockwave-flash"==o.source1mime?(a+='<object data="'+o.source1+'" width="'+o.width+'" height="'+o.height+'" type="application/x-shockwave-flash">',o.poster&&(a+='<img src="'+o.poster+'" width="'+o.width+'" height="'+o.height+'" />'),a+="</object>"):-1!=o.source1mime.indexOf("audio")?e.settings.audio_template_callback?a=e.settings.audio_template_callback(o):a+='<audio controls="controls" src="'+o.source1+'">'+(o.source2?'\n<source src="'+o.source2+'"'+(o.source2mime?' type="'+o.source2mime+'"':"")+" />\n":"")+"</audio>":"script"==o.type?a+='<script src="'+o.source1+'"></script>':a=e.settings.video_template_callback?e.settings.video_template_callback(o):'<video width="'+o.width+'" height="'+o.height+'"'+(o.poster?' poster="'+o.poster+'"':"")+' controls="controls">\n<source src="'+o.source1+'"'+(o.source1mime?' type="'+o.source1mime+'"':"")+" />\n"+(o.source2?'<source src="'+o.source2+'"'+(o.source2mime?' type="'+o.source2mime+'"':"")+" />\n":"")+"</video>"}return a}function s(e){var t={};return new tinymce.html.SaxParser({validate:!1,allow_conditional_comments:!0,special:"script,noscript",start:function(e,i){if(t.source1||"param"!=e||(t.source1=i.map.movie),("iframe"==e||"object"==e||"embed"==e||"video"==e||"audio"==e)&&(t.type||(t.type=e),t=tinymce.extend(i.map,t)),"script"==e){var o=r(i.map.src);if(!o)return;t={type:"script",source1:i.map.src,width:o.width,height:o.height}}"source"==e&&(t.source1?t.source2||(t.source2=i.map.src):t.source1=i.map.src),"img"!=e||t.poster||(t.poster=i.map.src)}}).parse(e),t.source1=t.source1||t.src||t.data,t.source2=t.source2||"",t.poster=t.poster||"",t}function n(t){return t.getAttribute("data-mce-object")?s(e.serializer.serialize(t,{selection:!0})):{}}function m(e,t,i){function r(e,t){var i,r,o,a;for(i in t)if(o=""+t[i],e.map[i])for(r=e.length;r--;)a=e[r],a.name==i&&(o?(e.map[i]=o,a.value=o):(delete e.map[i],e.splice(r,1)));else o&&(e.push({name:i,value:o}),e.map[i]=o)}var o,a=new tinymce.html.Writer,c=0;return new tinymce.html.SaxParser({validate:!1,allow_conditional_comments:!0,special:"script,noscript",comment:function(e){a.comment(e)},cdata:function(e){a.cdata(e)},text:function(e,t){a.text(e,t)},start:function(e,s,n){switch(e){case"video":case"object":case"embed":case"img":case"iframe":r(s,{width:t.width,height:t.height})}if(i)switch(e){case"video":r(s,{poster:t.poster,src:""}),t.source2&&r(s,{src:""});break;case"iframe":r(s,{src:t.source1});break;case"source":if(c++,2>=c&&(r(s,{src:t["source"+c],type:t["source"+c+"mime"]}),!t["source"+c]))return;break;case"img":if(!t.poster)return;o=!0}a.start(e,s,n)},end:function(e){if("video"==e&&i)for(var s=1;2>=s;s++)if(t["source"+s]){var n=[];n.map={},s>c&&(r(n,{src:t["source"+s],type:t["source"+s+"mime"]}),a.start("source",n,!0))}if(t.poster&&"object"==e&&i&&!o){var m=[];m.map={},r(m,{src:t.poster,width:t.width,height:t.height}),a.start("img",m,!0)}a.end(e)}},new tinymce.html.Schema({})).parse(e),a.getContent()}var u=[{regex:/youtu\.be\/([\w\-.]+)/,type:"iframe",w:425,h:350,url:"//www.youtube.com/embed/$1"},{regex:/youtube\.com(.+)v=([^&]+)/,type:"iframe",w:425,h:350,url:"//www.youtube.com/embed/$2"},{regex:/vimeo\.com\/([0-9]+)/,type:"iframe",w:425,h:350,url:"//player.vimeo.com/video/$1?title=0&byline=0&portrait=0&color=8dc7dc"},{regex:/maps\.google\.([a-z]{2,3})\/maps\/(.+)msid=(.+)/,type:"iframe",w:425,h:350,url:'//maps.google.com/maps/ms?msid=$2&output=embed"'}];e.on("ResolveName",function(e){var t;1==e.target.nodeType&&(t=e.target.getAttribute("data-mce-object"))&&(e.name=t)}),e.on("preInit",function(){var t=e.schema.getSpecialElements();tinymce.each("video audio iframe object".split(" "),function(e){t[e]=new RegExp("</"+e+"[^>]*>","gi")});var i=e.schema.getBoolAttrs();tinymce.each("webkitallowfullscreen mozallowfullscreen allowfullscreen".split(" "),function(e){i[e]={}}),e.parser.addNodeFilter("iframe,video,audio,object,embed,script",function(t,i){for(var o,a,c,s,n,m,u,d,l=t.length;l--;)if(a=t[l],a.parent&&("script"!=a.name||(d=r(a.attr("src"))))){for(c=new tinymce.html.Node("img",1),c.shortEnded=!0,d&&(d.width&&a.attr("width",d.width.toString()),d.height&&a.attr("height",d.height.toString())),m=a.attributes,o=m.length;o--;)s=m[o].name,n=m[o].value,"width"!==s&&"height"!==s&&"style"!==s&&(("data"==s||"src"==s)&&(n=e.convertURL(n,s)),c.attr("data-mce-p-"+s,n));u=a.firstChild&&a.firstChild.value,u&&(c.attr("data-mce-html",escape(u)),c.firstChild=null),c.attr({width:a.attr("width")||"300",height:a.attr("height")||("audio"==i?"30":"150"),style:a.attr("style"),src:tinymce.Env.transparentSrc,"data-mce-object":i,"class":"mce-object mce-object-"+i}),a.replace(c)}}),e.serializer.addAttributeFilter("data-mce-object",function(e,t){for(var i,r,o,a,c,s,n,m=e.length;m--;)if(i=e[m],i.parent){for(n=i.attr(t),r=new tinymce.html.Node(n,1),"audio"!=n&&"script"!=n&&r.attr({width:i.attr("width"),height:i.attr("height")}),r.attr({style:i.attr("style")}),a=i.attributes,o=a.length;o--;){var u=a[o].name;0===u.indexOf("data-mce-p-")&&r.attr(u.substr(11),a[o].value)}"script"==n&&r.attr("type","text/javascript"),c=i.attr("data-mce-html"),c&&(s=new tinymce.html.Node("#text",3),s.raw=!0,s.value=unescape(c),r.append(s)),i.replace(r)}})}),e.on("ObjectSelected",function(e){var t=e.target.getAttribute("data-mce-object");("audio"==t||"script"==t)&&e.preventDefault()}),e.on("objectResized",function(e){var t,i=e.target;i.getAttribute("data-mce-object")&&(t=i.getAttribute("data-mce-html"),t&&(t=unescape(t),i.setAttribute("data-mce-html",escape(m(t,{width:e.width,height:e.height})))))}),e.addButton("media",{tooltip:"Insert/edit video",onclick:o,stateSelector:["img[data-mce-object=video]","img[data-mce-object=iframe]"]}),e.addMenuItem("media",{icon:"media",text:"Insert video",onclick:o,context:"insert",prependToContext:!0})});tinymce.PluginManager.add("nonbreaking",function(n){var e=n.getParam("nonbreaking_force_tab");if(n.addCommand("mceNonBreaking",function(){n.insertContent(n.plugins.visualchars&&n.plugins.visualchars.state?'<span class="mce-nbsp"> </span>':" "),n.dom.setAttrib(n.dom.select("span.mce-nbsp"),"data-mce-bogus","1")}),n.addButton("nonbreaking",{title:"Insert nonbreaking space",cmd:"mceNonBreaking"}),n.addMenuItem("nonbreaking",{text:"Nonbreaking space",cmd:"mceNonBreaking",context:"insert"}),e){var a=+e>1?+e:3;n.on("keydown",function(e){if(9==e.keyCode){if(e.shiftKey)return;e.preventDefault();for(var t=0;a>t;t++)n.execCommand("mceNonBreaking")}})}});tinymce.PluginManager.add("noneditable",function(e){function t(e){var t;if(1===e.nodeType){if(t=e.getAttribute(u),t&&"inherit"!==t)return t;if(t=e.contentEditable,"inherit"!==t)return t}return null}function n(e){for(var n;e;){if(n=t(e))return"false"===n?e:null;e=e.parentNode}}function r(){function r(e){for(;e;){if(e.id===g)return e;e=e.parentNode}}function a(e){var t;if(e)for(t=new f(e,e),e=t.current();e;e=t.next())if(3===e.nodeType)return e}function i(n,r){var a,i;return"false"===t(n)&&u.isBlock(n)?void s.select(n):(i=u.createRng(),"true"===t(n)&&(n.firstChild||n.appendChild(e.getDoc().createTextNode(" ")),n=n.firstChild,r=!0),a=u.create("span",{id:g,"data-mce-bogus":!0},m),r?n.parentNode.insertBefore(a,n):u.insertAfter(a,n),i.setStart(a.firstChild,1),i.collapse(!0),s.setRng(i),a)}function o(e){var t,n,i,o;if(e)t=s.getRng(!0),t.setStartBefore(e),t.setEndBefore(e),n=a(e),n&&n.nodeValue.charAt(0)==m&&(n=n.deleteData(0,1)),u.remove(e,!0),s.setRng(t);else for(i=r(s.getStart());(e=u.get(g))&&e!==o;)i!==e&&(n=a(e),n&&n.nodeValue.charAt(0)==m&&(n=n.deleteData(0,1)),u.remove(e,!0)),o=e}function l(){function e(e,n){var r,a,i,o,l;if(r=d.startContainer,a=d.startOffset,3==r.nodeType){if(l=r.nodeValue.length,a>0&&l>a||(n?a==l:0===a))return}else{if(!(a<r.childNodes.length))return n?null:e;var u=!n&&a>0?a-1:a;r=r.childNodes[u],r.hasChildNodes()&&(r=r.firstChild)}for(i=new f(r,e);o=i[n?"prev":"next"]();){if(3===o.nodeType&&o.nodeValue.length>0)return;if("true"===t(o))return o}return e}var r,a,l,d,u;o(),l=s.isCollapsed(),r=n(s.getStart()),a=n(s.getEnd()),(r||a)&&(d=s.getRng(!0),l?(r=r||a,(u=e(r,!0))?i(u,!0):(u=e(r,!1))?i(u,!1):s.select(r)):(d=s.getRng(!0),r&&d.setStartBefore(r),a&&d.setEndAfter(a),s.setRng(d)))}function d(a){function i(e,t){for(;e=e[t?"previousSibling":"nextSibling"];)if(3!==e.nodeType||e.nodeValue.length>0)return e}function d(e,t){s.select(e),s.collapse(t)}function g(a){function i(e){for(var t=d;t;){if(t===e)return;t=t.parentNode}u.remove(e),l()}function o(){var r,o,l=e.schema.getNonEmptyElements();for(o=new tinymce.dom.TreeWalker(d,e.getBody());(r=a?o.prev():o.next())&&!l[r.nodeName.toLowerCase()]&&!(3===r.nodeType&&tinymce.trim(r.nodeValue).length>0);)if("false"===t(r))return i(r),!0;return n(r)?!0:!1}var f,d,c,g;if(s.isCollapsed()){if(f=s.getRng(!0),d=f.startContainer,c=f.startOffset,d=r(d)||d,g=n(d))return i(g),!1;if(3==d.nodeType&&(a?c>0:c<d.nodeValue.length))return!0;if(1==d.nodeType&&(d=d.childNodes[c]||d),o())return!1}return!0}var m,p,v,E,h=a.keyCode;if(v=s.getStart(),E=s.getEnd(),m=n(v)||n(E),m&&(112>h||h>124)&&h!=c.DELETE&&h!=c.BACKSPACE){if((tinymce.isMac?a.metaKey:a.ctrlKey)&&(67==h||88==h||86==h))return;if(a.preventDefault(),h==c.LEFT||h==c.RIGHT){var y=h==c.LEFT;if(e.dom.isBlock(m)){var T=y?m.previousSibling:m.nextSibling,C=new f(T,T),b=y?C.prev():C.next();d(b,!y)}else d(m,y)}}else if(h==c.LEFT||h==c.RIGHT||h==c.BACKSPACE||h==c.DELETE){if(p=r(v)){if(h==c.LEFT||h==c.BACKSPACE)if(m=i(p,!0),m&&"false"===t(m)){if(a.preventDefault(),h!=c.LEFT)return void u.remove(m);d(m,!0)}else o(p);if(h==c.RIGHT||h==c.DELETE)if(m=i(p),m&&"false"===t(m)){if(a.preventDefault(),h!=c.RIGHT)return void u.remove(m);d(m,!1)}else o(p)}if((h==c.BACKSPACE||h==c.DELETE)&&!g(h==c.BACKSPACE))return a.preventDefault(),!1}}var u=e.dom,s=e.selection,g="mce_noneditablecaret",m="";e.on("mousedown",function(n){var r=e.selection.getNode();"false"===t(r)&&r==n.target&&l()}),e.on("mouseup keyup",l),e.on("keydown",d)}function a(t){var n=l.length,r=t.content,a=tinymce.trim(o);if("raw"!=t.format){for(;n--;)r=r.replace(l[n],function(t){var n=arguments,i=n[n.length-2];return i>0&&'"'==r.charAt(i-1)?t:'<span class="'+a+'" data-mce-content="'+e.dom.encode(n[0])+'">'+e.dom.encode("string"==typeof n[1]?n[1]:n[0])+"</span>"});t.content=r}}var i,o,l,f=tinymce.dom.TreeWalker,d="contenteditable",u="data-mce-"+d,c=tinymce.util.VK;i=" "+tinymce.trim(e.getParam("noneditable_editable_class","mceEditable"))+" ",o=" "+tinymce.trim(e.getParam("noneditable_noneditable_class","mceNonEditable"))+" ",l=e.getParam("noneditable_regexp"),l&&!l.length&&(l=[l]),e.on("PreInit",function(){r(),l&&e.on("BeforeSetContent",a),e.parser.addAttributeFilter("class",function(e){for(var t,n,r=e.length;r--;)n=e[r],t=" "+n.attr("class")+" ",-1!==t.indexOf(i)?n.attr(u,"true"):-1!==t.indexOf(o)&&n.attr(u,"false")}),e.serializer.addAttributeFilter(u,function(e){for(var t,n=e.length;n--;)t=e[n],l&&t.attr("data-mce-content")?(t.name="#text",t.type=3,t.raw=!0,t.value=t.attr("data-mce-content")):(t.attr(d,null),t.attr(u,null))}),e.parser.addAttributeFilter(d,function(e){for(var t,n=e.length;n--;)t=e[n],t.attr(u,t.attr(d)),t.attr(d,null)})}),e.on("drop",function(e){n(e.target)&&e.preventDefault()})});tinymce.PluginManager.add("pagebreak",function(e){var a="mce-pagebreak",t=e.getParam("pagebreak_separator","<!-- pagebreak -->"),n=new RegExp(t.replace(/[\?\.\*\[\]\(\)\{\}\+\^\$\:]/g,function(e){return"\\"+e}),"gi"),r='<img src="'+tinymce.Env.transparentSrc+'" class="'+a+'" data-mce-resize="false" />';e.addCommand("mcePageBreak",function(){e.insertContent(e.settings.pagebreak_split_block?"<p>"+r+"</p>":r)}),e.addButton("pagebreak",{title:"Page break",cmd:"mcePageBreak"}),e.addMenuItem("pagebreak",{text:"Page break",icon:"pagebreak",cmd:"mcePageBreak",context:"insert"}),e.on("ResolveName",function(t){"IMG"==t.target.nodeName&&e.dom.hasClass(t.target,a)&&(t.name="pagebreak")}),e.on("click",function(t){t=t.target,"IMG"===t.nodeName&&e.dom.hasClass(t,a)&&e.selection.select(t)}),e.on("BeforeSetContent",function(e){e.content=e.content.replace(n,r)}),e.on("PreInit",function(){e.serializer.addNodeFilter("img",function(a){for(var n,r,c=a.length;c--;)if(n=a[c],r=n.attr("class"),r&&-1!==r.indexOf("mce-pagebreak")){var o=n.parent;if(e.schema.getBlockElements()[o.name]&&e.settings.pagebreak_split_block){o.type=3,o.value=t,o.raw=!0,n.remove();continue}n.type=3,n.value=t,n.raw=!0}})})});!function(e,t){"use strict";function n(e,t){for(var n,i=[],r=0;r<e.length;++r){if(n=s[e[r]]||o(e[r]),!n)throw"module definition dependecy not found: "+e[r];i.push(n)}t.apply(null,i)}function i(e,i,r){if("string"!=typeof e)throw"invalid module definition, module id must be defined and be a string";if(i===t)throw"invalid module definition, dependencies must be specified";if(r===t)throw"invalid module definition, definition function must be specified";n(i,function(){s[e]=r.apply(null,arguments)})}function r(e){return!!s[e]}function o(t){for(var n=e,i=t.split(/[.\/]/),r=0;r<i.length;++r){if(!n[i[r]])return;n=n[i[r]]}return n}function a(n){for(var i=0;i<n.length;i++){for(var r=e,o=n[i],a=o.split(/[.\/]/),l=0;l<a.length-1;++l)r[a[l]]===t&&(r[a[l]]={}),r=r[a[l]];r[a[a.length-1]]=s[o]}}var s={},l="tinymce/pasteplugin/Utils",c="tinymce/util/Tools",d="tinymce/html/DomParser",u="tinymce/html/Schema",f="tinymce/pasteplugin/Clipboard",m="tinymce/Env",p="tinymce/util/VK",g="tinymce/pasteplugin/WordFilter",h="tinymce/html/Serializer",v="tinymce/html/Node",b="tinymce/pasteplugin/Quirks",y="tinymce/pasteplugin/Plugin",x="tinymce/PluginManager";i(l,[c,d,u],function(e,t,n){function i(t,n){return e.each(n,function(e){t=e.constructor==RegExp?t.replace(e,""):t.replace(e[0],e[1])}),t}function r(i){function r(e){var t=e.name,n=e;if("br"===t)return void(s+="\n");if(l[t]&&(s+=" "),c[t])return void(s+=" ");if(3==e.type&&(s+=e.value),!e.shortEnded&&(e=e.firstChild))do r(e);while(e=e.next);d[t]&&n.next&&(s+="\n","p"==t&&(s+="\n"))}var o=new n,a=new t({},o),s="",l=o.getShortEndedElements(),c=e.makeMap("script noscript style textarea video audio iframe object"," "),d=o.getBlockElements();return r(a.parse(i)),s}return{filter:i,innerText:r}}),i(f,[m,p,l],function(e,t,n){return function(i){function r(e){var t,n=i.dom;if(t=i.fire("BeforePastePreProcess",{content:e}),t=i.fire("PastePreProcess",t),e=t.content,!t.isDefaultPrevented()){if(i.hasEventListeners("PastePostProcess")&&!t.isDefaultPrevented()){var r=n.add(i.getBody(),"div",{style:"display:none"},e);t=i.fire("PastePostProcess",{node:r}),n.remove(r),e=t.node.innerHTML}t.isDefaultPrevented()||i.insertContent(e)}}function o(e){e=i.dom.encode(e).replace(/\r\n/g,"\n");var t=i.dom.getParent(i.selection.getStart(),i.dom.isBlock),o=i.settings.forced_root_block,a;o&&(a=i.dom.createHTML(o,i.settings.forced_root_block_attrs),a=a.substr(0,a.length-3)+">"),t&&/^(PRE|DIV)$/.test(t.nodeName)||!o?e=n.filter(e,[[/\n/g,"<br>"]]):(e=n.filter(e,[[/\n\n/g,"</p>"+a],[/^(.*<\/p>)(<p>)$/,a+"$1"],[/\n/g,"<br />"]]),-1!=e.indexOf("<p>")&&(e=a+e)),r(e)}function a(){var t=i.dom,n=i.getBody(),r=i.dom.getViewPort(i.getWin()),o=r.y,a=20,s;if(v=i.selection.getRng(),i.inline&&(s=i.selection.getScrollContainer(),s&&s.scrollTop>0&&(o=s.scrollTop)),v.getClientRects){var l=v.getClientRects();if(l.length)a=o+(l[0].top-t.getPos(n).y);else{a=o;var c=v.startContainer;c&&(3==c.nodeType&&c.parentNode!=n&&(c=c.parentNode),1==c.nodeType&&(a=t.getPos(c,s||n).y))}}h=t.add(i.getBody(),"div",{id:"mcepastebin",contentEditable:!0,"data-mce-bogus":"1",style:"position: absolute; top: "+a+"px;width: 10px; height: 10px; overflow: hidden; opacity: 0"},y),(e.ie||e.gecko)&&t.setStyle(h,"left","rtl"==t.getStyle(n,"direction",!0)?65535:-65535),t.bind(h,"beforedeactivate focusin focusout",function(e){e.stopPropagation()}),h.focus(),i.selection.select(h,!0)}function s(){if(h){for(var e;e=i.dom.get("mcepastebin");)i.dom.remove(e),i.dom.unbind(e);v&&i.selection.setRng(v)}x=!1,h=v=null}function l(){var e=y,t,n;for(t=i.dom.select("div[id=mcepastebin]"),n=t.length;n--;){var r=t[n].innerHTML;e==y&&(e=""),r.length>e.length&&(e=r)}return e}function c(e){var t={};if(e&&e.types){var n=e.getData("Text");n&&n.length>0&&(t["text/plain"]=n);for(var i=0;i<e.types.length;i++){var r=e.types[i];t[r]=e.getData(r)}}return t}function d(e){return c(e.clipboardData||i.getDoc().dataTransfer)}function u(e,t){function n(e){if("image/png"==o[a].type){var t=new FileReader;return t.onload=function(){r('<img src="'+t.result+'">')},t.readAsDataURL(e.getAsFile()),!0}}if(!(!i.settings.paste_data_images||"text/html"in t||"text/plain"in t)&&e.clipboardData){var o=e.clipboardData.items;if(o)for(var a=0;a<o.length;a++)if(n(o[a]))return!0}}function f(e){var t=i.getDoc(),n;if(t.caretPositionFromPoint){var r=t.caretPositionFromPoint(e.clientX,e.clientY);n=t.createRange(),n.setStart(r.offsetNode,r.offset),n.collapse(!0)}else t.caretRangeFromPoint&&(n=t.caretRangeFromPoint(e.clientX,e.clientY));return n}function m(e,t){return t in e&&e[t].length>0}function p(){i.on("keydown",function(n){if(!n.isDefaultPrevented()&&(t.metaKeyPressed(n)&&86==n.keyCode||n.shiftKey&&45==n.keyCode)){if(x=n.shiftKey&&86==n.keyCode,n.stopImmediatePropagation(),b=(new Date).getTime(),e.ie&&x)return n.preventDefault(),void i.fire("paste",{ieFake:!0});s(),a()}}),i.on("paste",function(t){var c=d(t),f=(new Date).getTime()-b<1e3,p="text"==g.pasteFormat||x;return t.isDefaultPrevented()?void s():u(t,c)?void s():(f||t.preventDefault(),!e.ie||f&&!t.ieFake||(a(),i.dom.bind(h,"paste",function(e){e.stopPropagation()}),i.getDoc().execCommand("Paste",!1,null),c["text/html"]=l()),void setTimeout(function(){var e=l();return h&&h.firstChild&&"mcepastebin"===h.firstChild.id&&(p=!0),s(),!p&&f&&e&&e!=y&&(c["text/html"]=e),e!=y&&f||(e=c["text/html"]||c["text/plain"]||y,e!=y)?(!m(c,"text/html")&&m(c,"text/plain")&&(p=!0),void(p?o(c["text/plain"]||n.innerText(e)):r(e))):void(f||i.windowManager.alert("Please use Ctrl+V/Cmd+V keyboard shortcuts to paste contents."))},0))}),i.on("dragstart",function(e){if(e.dataTransfer.types)try{e.dataTransfer.setData("mce-internal",i.selection.getContent())}catch(t){}}),i.on("drop",function(e){var t=f(e);if(t&&!e.isDefaultPrevented()){var n=c(e.dataTransfer),a=n["mce-internal"]||n["text/html"]||n["text/plain"];a&&(e.preventDefault(),i.undoManager.transact(function(){n["mce-internal"]&&i.execCommand("Delete"),i.selection.setRng(t),n["text/html"]?r(a):o(a)}))}})}var g=this,h,v,b=0,y="%MCEPASTEBIN%",x;g.pasteHtml=r,g.pasteText=o,i.on("preInit",function(){p(),i.parser.addNodeFilter("img",function(t){if(!i.settings.paste_data_images)for(var n=t.length;n--;){var r=t[n].attributes.map.src;r&&0===r.indexOf("data:image")&&(t[n].attr("data-mce-object")||r===e.transparentSrc||t[n].remove())}})}),i.on("PreProcess",function(){i.dom.remove(i.dom.get("mcepastebin"))})}}),i(g,[c,d,u,h,v,l],function(e,t,n,i,r,o){function a(e){return/<font face="Times New Roman"|class="?Mso|style="[^"]*\bmso-|style='[^'']*\bmso-|w:WordDocument/i.test(e)||/class="OutlineElement/.test(e)||/id="?docs\-internal\-guid\-/.test(e)}function s(s){var l=s.settings;s.on("BeforePastePreProcess",function(c){function d(e){function t(e,t,a,s){var l=e._listLevel||o;l!=o&&(o>l?n&&(n=n.parent.parent):(i=n,n=null)),n&&n.name==a?n.append(e):(i=i||n,n=new r(a,1),s>1&&n.attr("start",""+s),e.wrap(n)),e.name="li",t.value="";var c=t.next;c&&3==c.type&&(c.value=c.value.replace(/^\u00a0+/,"")),l>o&&i&&i.lastChild.append(n),o=l}for(var n,i,o=1,a=e.getAll("p"),s=0;s<a.length;s++)if(e=a[s],"p"==e.name&&e.firstChild){for(var l="",c=e.firstChild;c&&!(l=c.value);)c=c.firstChild;if(/^\s*[\u2022\u00b7\u00a7\u00d8\u25CF]\s*$/.test(l)){t(e,c,"ul");continue}if(/^\s*\w+\.$/.test(l)){var d=/([0-9])\./.exec(l),u=1;d&&(u=parseInt(d[1],10)),t(e,c,"ol",u);continue}n=null}}function u(t,n){var i={},o=s.dom.parseStyle(n);if("p"===t.name){var a=/mso-list:\w+ \w+([0-9]+)/.exec(n);a&&(t._listLevel=parseInt(a[1],10))}return e.each(o,function(e,n){switch(n){case"horiz-align":n="text-align";break;case"vert-align":n="vertical-align";break;case"font-color":case"mso-foreground":n="color";break;case"mso-background":case"mso-highlight":n="background";break;case"font-weight":case"font-style":return void("normal"!=e&&(i[n]=e));case"mso-element":if(/^(comment|comment-list)$/i.test(e))return void t.remove()}return 0===n.indexOf("mso-comment")?void t.remove():void(0!==n.indexOf("mso-")&&("all"==m||p&&p[n])&&(i[n]=e))}),/(bold)/i.test(i["font-weight"])&&(delete i["font-weight"],t.wrap(new r("b",1))),/(italic)/i.test(i["font-style"])&&(delete i["font-style"],t.wrap(new r("i",1))),i=s.dom.serializeStyle(i,t.name),i?i:null}var f=c.content,m,p;if(m=l.paste_retain_style_properties,m&&(p=e.makeMap(m.split(/[, ]/))),l.paste_enable_default_filters!==!1&&a(c.content)){c.wordContent=!0,f=o.filter(f,[/<!--[\s\S]+?-->/gi,/<(!|script[^>]*>.*?<\/script(?=[>\s])|\/?(\?xml(:\w+)?|img|meta|link|style|\w:\w+)(?=[\s\/>]))[^>]*>/gi,[/<(\/?)s>/gi,"<$1strike>"],[/ /gi,"\xa0"],[/<span\s+style\s*=\s*"\s*mso-spacerun\s*:\s*yes\s*;?\s*"\s*>([\s\u00a0]*)<\/span>/gi,function(e,t){return t.length>0?t.replace(/./," ").slice(Math.floor(t.length/2)).split("").join("\xa0"):""}]]);var g=l.paste_word_valid_elements;g||(g="-strong/b,-em/i,-span,-p,-ol,-ul,-li,-h1,-h2,-h3,-h4,-h5,-h6,-p/div,-table[width],-tr,-td[colspan|rowspan|width],-th,-thead,-tfoot,-tbody,-a[href|name],sub,sup,strike,br,del");var h=new n({valid_elements:g,valid_children:"-li[p]"});e.each(h.elements,function(e){e.attributes["class"]||(e.attributes["class"]={},e.attributesOrder.push("class")),e.attributes.style||(e.attributes.style={},e.attributesOrder.push("style"))});var v=new t({},h);v.addAttributeFilter("style",function(e){for(var t=e.length,n;t--;)n=e[t],n.attr("style",u(n,n.attr("style"))),"span"==n.name&&n.parent&&!n.attributes.length&&n.unwrap()}),v.addAttributeFilter("class",function(e){for(var t=e.length,n,i;t--;)n=e[t],i=n.attr("class"),/^(MsoCommentReference|MsoCommentText|msoDel)$/i.test(i)&&n.remove(),n.attr("class",null)}),v.addNodeFilter("del",function(e){for(var t=e.length;t--;)e[t].remove()}),v.addNodeFilter("a",function(e){for(var t=e.length,n,i,r;t--;)if(n=e[t],i=n.attr("href"),r=n.attr("name"),i&&-1!=i.indexOf("#_msocom_"))n.remove();else if(i&&0===i.indexOf("file://")&&(i=i.split("#")[1],i&&(i="#"+i)),i||r){if(r&&!/^_?(?:toc|edn|ftn)/i.test(r)){n.unwrap();continue}n.attr({href:i,name:r})}else n.unwrap()});var b=v.parse(f);d(b),c.content=new i({},h).serialize(b)}})}return s.isWordContent=a,s}),i(b,[m,c,g,l],function(e,t,n,i){return function(r){function o(e){r.on("BeforePastePreProcess",function(t){t.content=e(t.content)})}function a(e){return e=i.filter(e,[/^[\s\S]*<body[^>]*>\s*<!--StartFragment-->|<!--EndFragment-->\s*<\/body[^>]*>[\s\S]*$/g,/<!--StartFragment-->|<!--EndFragment-->/g,[/<span class="Apple-converted-space">\u00a0<\/span>/g,"\xa0"],/<br>$/i])}function s(e){if(!n.isWordContent(e))return e;var o=[];t.each(r.schema.getBlockElements(),function(e,t){o.push(t)});var a=new RegExp("(?:<br> [\\s\\r\\n]+|<br>)*(<\\/?("+o.join("|")+")[^>]*>)(?:<br> [\\s\\r\\n]+|<br>)*","g");return e=i.filter(e,[[a,"$1"]]),e=i.filter(e,[[/<br><br>/g,"<BR><BR>"],[/<br>/g," "],[/<BR><BR>/g,"<br>"]])}function l(e){if(n.isWordContent(e))return e;var t=r.settings.paste_webkit_styles;if(r.settings.paste_remove_styles_if_webkit===!1||"all"==t)return e;if(t&&(t=t.split(/[, ]/)),t){var i=r.dom,o=r.selection.getNode();e=e.replace(/(<[^>]+) style="([^"]*)"([^>]*>)/gi,function(e,n,r,a){var s=i.parseStyle(r,"span"),l={};if("none"===t)return n+a;for(var c=0;c<t.length;c++){var d=s[t[c]],u=i.getStyle(o,t[c],!0);/color/.test(t[c])&&(d=i.toHex(d),u=i.toHex(u)),u!=d&&(l[t[c]]=d)}return l=i.serializeStyle(l,"span"),l?n+' style="'+l+'"'+a:""})}else e=e.replace(/(<[^>]+) style="([^"]*)"([^>]*>)/gi,"$1$3");return e=e.replace(/(<[^>]+) data-mce-style="([^"]+)"([^>]*>)/gi,function(e,t,n,i){return t+' style="'+n+'"'+i})}e.webkit&&(o(l),o(a)),e.ie&&o(s)}}),i(y,[x,f,g,b],function(e,t,n,i){var r;e.add("paste",function(e){function o(){"text"==s.pasteFormat?(this.active(!1),s.pasteFormat="html"):(s.pasteFormat="text",this.active(!0),r||(e.windowManager.alert("Paste is now in plain text mode. Contents will now be pasted as plain text until you toggle this option off."),r=!0))}var a=this,s,l=e.settings;a.clipboard=s=new t(e),a.quirks=new i(e),a.wordFilter=new n(e),e.settings.paste_as_text&&(a.clipboard.pasteFormat="text"),l.paste_preprocess&&e.on("PastePreProcess",function(e){l.paste_preprocess.call(a,a,e)}),l.paste_postprocess&&e.on("PastePostProcess",function(e){l.paste_postprocess.call(a,a,e)}),e.addCommand("mceInsertClipboardContent",function(e,t){t.content&&a.clipboard.pasteHtml(t.content),t.text&&a.clipboard.pasteText(t.text)}),e.paste_block_drop&&e.on("dragend dragover draggesture dragdrop drop drag",function(e){e.preventDefault(),e.stopPropagation()}),e.settings.paste_data_images||e.on("drop",function(e){var t=e.dataTransfer;t&&t.files&&t.files.length>0&&e.preventDefault()}),e.addButton("pastetext",{icon:"pastetext",tooltip:"Paste as text",onclick:o,active:"text"==a.clipboard.pasteFormat}),e.addMenuItem("pastetext",{text:"Paste as text",selectable:!0,active:s.pasteFormat,onclick:o})})}),a([l,f,g,b,y])}(this);tinymce.PluginManager.add("preview",function(e){var t=e.settings,i=!tinymce.Env.ie;e.addCommand("mcePreview",function(){e.windowManager.open({title:"Preview",width:parseInt(e.getParam("plugin_preview_width","650"),10),height:parseInt(e.getParam("plugin_preview_height","500"),10),html:'<iframe src="javascript:\'\'" frameborder="0"'+(i?' sandbox="allow-scripts"':"")+"></iframe>",buttons:{text:"Close",onclick:function(){this.parent().parent().close()}},onPostRender:function(){var n,a="";a+='<base href="'+e.documentBaseURI.getURI()+'">',tinymce.each(e.contentCSS,function(t){a+='<link type="text/css" rel="stylesheet" href="'+e.documentBaseURI.toAbsolute(t)+'">'});var r=t.body_id||"tinymce";-1!=r.indexOf("=")&&(r=e.getParam("body_id","","hash"),r=r[e.id]||r);var d=t.body_class||"";-1!=d.indexOf("=")&&(d=e.getParam("body_class","","hash"),d=d[e.id]||"");var o=e.settings.directionality?' dir="'+e.settings.directionality+'"':"";if(n="<!DOCTYPE html><html><head>"+a+'</head><body id="'+r+'" class="mce-content-body '+d+'"'+o+">"+e.getContent()+"</body></html>",i)this.getEl("body").firstChild.src="data:text/html;charset=utf-8,"+encodeURIComponent(n);else{var s=this.getEl("body").firstChild.contentWindow.document;s.open(),s.write(n),s.close()}}})}),e.addButton("preview",{title:"Preview",cmd:"mcePreview"}),e.addMenuItem("preview",{text:"Preview",cmd:"mcePreview",context:"view"})});tinymce.PluginManager.add("print",function(t){t.addCommand("mcePrint",function(){t.getWin().print()}),t.addButton("print",{title:"Print",cmd:"mcePrint"}),t.addShortcut("Ctrl+P","","mcePrint"),t.addMenuItem("print",{text:"Print",cmd:"mcePrint",icon:"print",shortcut:"Ctrl+P",context:"file"})});tinymce.PluginManager.add("save",function(e){function a(){var a;return a=tinymce.DOM.getParent(e.id,"form"),!e.getParam("save_enablewhendirty",!0)||e.isDirty()?(tinymce.triggerSave(),e.getParam("save_onsavecallback")?void(e.execCallback("save_onsavecallback",e)&&(e.startContent=tinymce.trim(e.getContent({format:"raw"})),e.nodeChanged())):void(a?(e.isNotDirty=!0,(!a.onsubmit||a.onsubmit())&&("function"==typeof a.submit?a.submit():e.windowManager.alert("Error: Form submit field collision.")),e.nodeChanged()):e.windowManager.alert("Error: No form element found."))):void 0}function n(){var a=tinymce.trim(e.startContent);return e.getParam("save_oncancelcallback")?void e.execCallback("save_oncancelcallback",e):(e.setContent(a),e.undoManager.clear(),void e.nodeChanged())}function t(){var a=this;e.on("nodeChange",function(){a.disabled(e.getParam("save_enablewhendirty",!0)&&!e.isDirty())})}e.addCommand("mceSave",a),e.addCommand("mceCancel",n),e.addButton("save",{icon:"save",text:"Save",cmd:"mceSave",disabled:!0,onPostRender:t}),e.addButton("cancel",{text:"Cancel",icon:!1,cmd:"mceCancel",disabled:!0,onPostRender:t}),e.addShortcut("ctrl+s","","mceSave")});!function(){function e(e,t,n,a,r){function i(e,t){if(t=t||0,!e[0])throw"findAndReplaceDOMText cannot handle zero-length matches";var n=e.index;if(t>0){var a=e[t];if(!a)throw"Invalid capture group";n+=e[0].indexOf(a),e[0]=a}return[n,n+e[0].length,[e[0]]]}function d(e){var t;if(3===e.nodeType)return e.data;if(h[e.nodeName]&&!u[e.nodeName])return"";if(t="",(u[e.nodeName]||m[e.nodeName])&&(t+="\n"),e=e.firstChild)do t+=d(e);while(e=e.nextSibling);return t}function o(e,t,n){var a,r,i,d,o=[],l=0,c=e,s=t.shift(),f=0;e:for(;;){if((u[c.nodeName]||m[c.nodeName])&&l++,3===c.nodeType&&(!r&&c.length+l>=s[1]?(r=c,d=s[1]-l):a&&o.push(c),!a&&c.length+l>s[0]&&(a=c,i=s[0]-l),l+=c.length),a&&r){if(c=n({startNode:a,startNodeIndex:i,endNode:r,endNodeIndex:d,innerNodes:o,match:s[2],matchIndex:f}),l-=r.length-d,a=null,r=null,o=[],s=t.shift(),f++,!s)break}else{if((!h[c.nodeName]||u[c.nodeName])&&c.firstChild){c=c.firstChild;continue}if(c.nextSibling){c=c.nextSibling;continue}}for(;;){if(c.nextSibling){c=c.nextSibling;break}if(c.parentNode===e)break e;c=c.parentNode}}}function l(e){var t;if("function"!=typeof e){var n=e.nodeType?e:f.createElement(e);t=function(e,t){var a=n.cloneNode(!1);return a.setAttribute("data-mce-index",t),e&&a.appendChild(f.createTextNode(e)),a}}else t=e;return function(e){var n,a,r,i=e.startNode,d=e.endNode,o=e.matchIndex;if(i===d){var l=i;r=l.parentNode,e.startNodeIndex>0&&(n=f.createTextNode(l.data.substring(0,e.startNodeIndex)),r.insertBefore(n,l));var c=t(e.match[0],o);return r.insertBefore(c,l),e.endNodeIndex<l.length&&(a=f.createTextNode(l.data.substring(e.endNodeIndex)),r.insertBefore(a,l)),l.parentNode.removeChild(l),c}n=f.createTextNode(i.data.substring(0,e.startNodeIndex)),a=f.createTextNode(d.data.substring(e.endNodeIndex));for(var s=t(i.data.substring(e.startNodeIndex),o),u=[],h=0,m=e.innerNodes.length;m>h;++h){var g=e.innerNodes[h],p=t(g.data,o);g.parentNode.replaceChild(p,g),u.push(p)}var x=t(d.data.substring(0,e.endNodeIndex),o);return r=i.parentNode,r.insertBefore(n,i),r.insertBefore(s,i),r.removeChild(i),r=d.parentNode,r.insertBefore(x,d),r.insertBefore(a,d),r.removeChild(d),x}}var c,s,f,u,h,m,g=[],p=0;if(f=t.ownerDocument,u=r.getBlockElements(),h=r.getWhiteSpaceElements(),m=r.getShortEndedElements(),s=d(t)){if(e.global)for(;c=e.exec(s);)g.push(i(c,a));else c=s.match(e),g.push(i(c,a));return g.length&&(p=g.length,o(t,g,l(n))),p}}function t(t){function n(){function e(){r.statusbar.find("#next").disabled(!d(s+1).length),r.statusbar.find("#prev").disabled(!d(s-1).length)}function n(){tinymce.ui.MessageBox.alert("Could not find the specified string.",function(){r.find("#find")[0].focus()})}var a={},r=tinymce.ui.Factory.create({type:"window",layout:"flex",pack:"center",align:"center",onClose:function(){t.focus(),c.done()},onSubmit:function(t){var i,o,l,f;return t.preventDefault(),o=r.find("#case").checked(),f=r.find("#words").checked(),l=r.find("#find").value(),l.length?a.text==l&&a.caseState==o&&a.wholeWord==f?0===d(s+1).length?void n():(c.next(),void e()):(i=c.find(l,o,f),i||n(),r.statusbar.items().slice(1).disabled(0===i),e(),void(a={text:l,caseState:o,wholeWord:f})):(c.done(!1),void r.statusbar.items().slice(1).disabled(!0))},buttons:[{text:"Find",onclick:function(){r.submit()}},{text:"Replace",disabled:!0,onclick:function(){c.replace(r.find("#replace").value())||(r.statusbar.items().slice(1).disabled(!0),s=-1,a={})}},{text:"Replace all",disabled:!0,onclick:function(){c.replace(r.find("#replace").value(),!0,!0),r.statusbar.items().slice(1).disabled(!0),a={}}},{type:"spacer",flex:1},{text:"Prev",name:"prev",disabled:!0,onclick:function(){c.prev(),e()}},{text:"Next",name:"next",disabled:!0,onclick:function(){c.next(),e()}}],title:"Find and replace",items:{type:"form",padding:20,labelGap:30,spacing:10,items:[{type:"textbox",name:"find",size:40,label:"Find",value:t.selection.getNode().src},{type:"textbox",name:"replace",size:40,label:"Replace with"},{type:"checkbox",name:"case",text:"Match case",label:" "},{type:"checkbox",name:"words",text:"Whole words",label:" "}]}}).renderTo().reflow()}function a(e){var t=e.getAttribute("data-mce-index");return"number"==typeof t?""+t:t}function r(n){var a,r;return r=t.dom.create("span",{"data-mce-bogus":1}),r.className="mce-match-marker",a=t.getBody(),c.done(!1),e(n,a,r,!1,t.schema)}function i(e){var t=e.parentNode;e.firstChild&&t.insertBefore(e.firstChild,e),e.parentNode.removeChild(e)}function d(e){var n,r=[];if(n=tinymce.toArray(t.getBody().getElementsByTagName("span")),n.length)for(var i=0;i<n.length;i++){var d=a(n[i]);null!==d&&d.length&&d===e.toString()&&r.push(n[i])}return r}function o(e){var n=s,a=t.dom;e=e!==!1,e?n++:n--,a.removeClass(d(s),"mce-match-marker-selected");var r=d(n);return r.length?(a.addClass(d(n),"mce-match-marker-selected"),t.selection.scrollIntoView(r[0]),n):-1}function l(e){e.parentNode.removeChild(e)}var c=this,s=-1;c.init=function(e){e.addMenuItem("searchreplace",{text:"Find and replace",shortcut:"Ctrl+F",onclick:n,separator:"before",context:"edit"}),e.addButton("searchreplace",{tooltip:"Find and replace",shortcut:"Ctrl+F",onclick:n}),e.addCommand("SearchReplace",n),e.shortcuts.add("Ctrl+F","",n)},c.find=function(e,t,n){e=e.replace(/[\-\[\]\/\{\}\(\)\*\+\?\.\\\^\$\|]/g,"\\$&"),e=n?"\\b"+e+"\\b":e;var a=r(new RegExp(e,t?"g":"gi"));return a&&(s=-1,s=o(!0)),a},c.next=function(){var e=o(!0);-1!==e&&(s=e)},c.prev=function(){var e=o(!1);-1!==e&&(s=e)},c.replace=function(e,n,r){var o,f,u,h,m,g,p=s;for(n=n!==!1,u=t.getBody(),f=tinymce.toArray(u.getElementsByTagName("span")),o=0;o<f.length;o++){var x=a(f[o]);if(null!==x&&x.length)if(h=m=parseInt(x,10),r||h===s){for(e.length?(f[o].firstChild.nodeValue=e,i(f[o])):l(f[o]);f[++o];)if(h=a(f[o]),null!==x&&x.length){if(h!==m){o--;break}l(f[o])}n&&p--}else m>s&&f[o].setAttribute("data-mce-index",m-1)}return t.undoManager.add(),s=p,n?(g=d(p+1).length>0,c.next()):(g=d(p-1).length>0,c.prev()),!r&&g},c.done=function(e){var n,r,d,o;for(r=tinymce.toArray(t.getBody().getElementsByTagName("span")),n=0;n<r.length;n++){var l=a(r[n]);null!==l&&l.length&&(l===s.toString()&&(d||(d=r[n].firstChild),o=r[n].firstChild),i(r[n]))}if(d&&o){var c=t.dom.createRng();return c.setStart(d,0),c.setEnd(o,o.data.length),e!==!1&&t.selection.setRng(c),c}}}tinymce.PluginManager.add("searchreplace",t)}();!function(e,t){"use strict";function n(e,t){for(var n,o=[],r=0;r<e.length;++r){if(n=l[e[r]]||i(e[r]),!n)throw"module definition dependecy not found: "+e[r];o.push(n)}t.apply(null,o)}function o(e,o,r){if("string"!=typeof e)throw"invalid module definition, module id must be defined and be a string";if(o===t)throw"invalid module definition, dependencies must be specified";if(r===t)throw"invalid module definition, definition function must be specified";n(o,function(){l[e]=r.apply(null,arguments)})}function r(e){return!!l[e]}function i(t){for(var n=e,o=t.split(/[.\/]/),r=0;r<o.length;++r){if(!n[o[r]])return;n=n[o[r]]}return n}function a(n){for(var o=0;o<n.length;o++){for(var r=e,i=n[o],a=i.split(/[.\/]/),s=0;s<a.length-1;++s)r[a[s]]===t&&(r[a[s]]={}),r=r[a[s]];r[a[a.length-1]]=l[i]}}var l={},s="tinymce/spellcheckerplugin/DomTextMatcher",c="tinymce/spellcheckerplugin/Plugin",d="tinymce/PluginManager",u="tinymce/util/Tools",f="tinymce/ui/Menu",m="tinymce/dom/DOMUtils",p="tinymce/util/XHR",g="tinymce/util/URI",h="tinymce/util/JSON";o(s,[],function(){return function(e,t){function n(e,t){if(!e[0])throw"findAndReplaceDOMText cannot handle zero-length matches";return{start:e.index,end:e.index+e[0].length,text:e[0],data:t}}function o(e){var t;if(3===e.nodeType)return e.data;if(P[e.nodeName]&&!S[e.nodeName])return"";if(t="",(S[e.nodeName]||N[e.nodeName])&&(t+="\n"),e=e.firstChild)do t+=o(e);while(e=e.nextSibling);return t}function r(e,t,n){var o,r,i,a,l=[],s=0,c=e,d,u=0;t=t.slice(0),t.sort(function(e,t){return e.start-t.start}),d=t.shift();e:for(;;){if((S[c.nodeName]||N[c.nodeName])&&s++,3===c.nodeType&&(!r&&c.length+s>=d.end?(r=c,a=d.end-s):o&&l.push(c),!o&&c.length+s>d.start&&(o=c,i=d.start-s),s+=c.length),o&&r){if(c=n({startNode:o,startNodeIndex:i,endNode:r,endNodeIndex:a,innerNodes:l,match:d.text,matchIndex:u}),s-=r.length-a,o=null,r=null,l=[],d=t.shift(),u++,!d)break}else{if((!P[c.nodeName]||S[c.nodeName])&&c.firstChild){c=c.firstChild;continue}if(c.nextSibling){c=c.nextSibling;continue}}for(;;){if(c.nextSibling){c=c.nextSibling;break}if(c.parentNode===e)break e;c=c.parentNode}}}function i(e){function t(t,n){var o=w[n];o.stencil||(o.stencil=e(o));var r=o.stencil.cloneNode(!1);return r.setAttribute("data-mce-index",n),t&&r.appendChild(k.doc.createTextNode(t)),r}return function(e){var n,o,r,i=e.startNode,a=e.endNode,l=e.matchIndex,s=k.doc;if(i===a){var c=i;r=c.parentNode,e.startNodeIndex>0&&(n=s.createTextNode(c.data.substring(0,e.startNodeIndex)),r.insertBefore(n,c));var d=t(e.match,l);return r.insertBefore(d,c),e.endNodeIndex<c.length&&(o=s.createTextNode(c.data.substring(e.endNodeIndex)),r.insertBefore(o,c)),c.parentNode.removeChild(c),d}n=s.createTextNode(i.data.substring(0,e.startNodeIndex)),o=s.createTextNode(a.data.substring(e.endNodeIndex));for(var u=t(i.data.substring(e.startNodeIndex),l),f=[],m=0,p=e.innerNodes.length;p>m;++m){var g=e.innerNodes[m],h=t(g.data,l);g.parentNode.replaceChild(h,g),f.push(h)}var v=t(a.data.substring(0,e.endNodeIndex),l);return r=i.parentNode,r.insertBefore(n,i),r.insertBefore(u,i),r.removeChild(i),r=a.parentNode,r.insertBefore(v,a),r.insertBefore(o,a),r.removeChild(a),v}}function a(e){var t=e.parentNode;t.insertBefore(e.firstChild,e),e.parentNode.removeChild(e)}function l(t){var n=e.getElementsByTagName("*"),o=[];t="number"==typeof t?""+t:null;for(var r=0;r<n.length;r++){var i=n[r],a=i.getAttribute("data-mce-index");null!==a&&a.length&&(a===t||null===t)&&o.push(i)}return o}function s(e){for(var t=w.length;t--;)if(w[t]===e)return t;return-1}function c(e){var t=[];return d(function(n,o){e(n,o)&&t.push(n)}),w=t,this}function d(e){for(var t=0,n=w.length;n>t&&e(w[t],t)!==!1;t++);return this}function u(t){return w.length&&r(e,w,i(t)),this}function f(e,t){if(C&&e.global)for(;x=e.exec(C);)w.push(n(x,t));return this}function m(e){var t,n=l(e?s(e):null);for(t=n.length;t--;)a(n[t]);return this}function p(e){return w[e.getAttribute("data-mce-index")]}function g(e){return l(s(e))[0]}function h(e,t,n){return w.push({start:e,end:e+t,text:C.substr(e,t),data:n}),this}function v(e){var n=l(s(e)),o=t.dom.createRng();return o.setStartBefore(n[0]),o.setEndAfter(n[n.length-1]),o}function b(e,n){var o=v(e);return o.deleteContents(),n.length>0&&o.insertNode(t.dom.doc.createTextNode(n)),o}function y(){return w.splice(0,w.length),m(),this}var x,w=[],C,k=t.dom,S,P,N;return S=t.schema.getBlockElements(),P=t.schema.getWhiteSpaceElements(),N=t.schema.getShortEndedElements(),C=o(e),{text:C,matches:w,each:d,filter:c,reset:y,matchFromElement:p,elementFromMatch:g,find:f,add:h,wrap:u,unwrap:m,replace:b,rangeFromMatch:v,indexOf:s}}}),o(c,[s,d,u,f,m,p,g,h],function(e,t,n,o,r,i,a,l){t.add("spellchecker",function(t,s){function c(){return C.textMatcher||(C.textMatcher=new e(t.getBody(),t)),C.textMatcher}function d(e,t){var o=[];return n.each(t,function(e){o.push({selectable:!0,text:e.name,data:e.value})}),o}function u(e){for(var t in e)return!1;return!0}function f(e,i){var a=[],l=k[e];n.each(l,function(e){a.push({text:e,onclick:function(){t.insertContent(t.dom.encode(e)),t.dom.remove(i),g()}})}),a.push.apply(a,[{text:"-"},{text:"Ignore",onclick:function(){h(e,i)}},{text:"Ignore all",onclick:function(){h(e,i,!0)}},{text:"Finish",onclick:v}]),P=new o({items:a,context:"contextmenu",onautohide:function(e){-1!=e.target.className.indexOf("spellchecker")&&e.preventDefault()},onhide:function(){P.remove(),P=null}}),P.renderTo(document.body);var s=r.DOM.getPos(t.getContentAreaContainer()),c=t.dom.getPos(i[0]),d=t.dom.getRoot();"BODY"==d.nodeName?(c.x-=d.ownerDocument.documentElement.scrollLeft||d.scrollLeft,c.y-=d.ownerDocument.documentElement.scrollTop||d.scrollTop):(c.x-=d.scrollLeft,c.y-=d.scrollTop),s.x+=c.x,s.y+=c.y,P.moveTo(s.x,s.y+i[0].offsetHeight)}function m(){return t.getParam("spellchecker_wordchar_pattern")||new RegExp('[^\\s!"#$%&()*+,-./:;<=>?@[\\]^_{|}`\xa7\xa9\xab\xae\xb1\xb6\xb7\xb8\xbb\xbc\xbd\xbe\xbf\xd7\xf7\xa4\u201d\u201c\u201e]+',"g")}function p(){function e(e){return t.setProgressState(!1),u(e)?(t.windowManager.alert("No misspellings found"),void(S=!1)):(k=e,c().find(m()).filter(function(t){return!!e[t.text]}).wrap(function(e){return t.dom.create("span",{"class":"mce-spellchecker-word","data-mce-bogus":1,"data-mce-word":e.text})}),void t.fire("SpellcheckStart"))}function n(e){t.windowManager.alert(e),t.setProgressState(!1),v()}function o(e,t,o){i.send({url:new a(s).toAbsolute(N.spellchecker_rpc_url),type:"post",content_type:"application/x-www-form-urlencoded",data:"text="+encodeURIComponent(t)+"&lang="+N.spellchecker_language,success:function(e){e=l.parse(e),e?e.error?n(e.error):o(e.words):n("Sever response wasn't proper JSON.")},error:function(e,t){n("Spellchecker request error: "+t.status)}})}if(S)return void v();v(),S=!0,t.setProgressState(!0);var r=N.spellchecker_callback||o;r.call(C,"spellcheck",c().text,e,n),t.focus()}function g(){t.dom.select("span.mce-spellchecker-word").length||v()}function h(e,o,r){t.selection.collapse(),r?n.each(t.dom.select("span.mce-spellchecker-word"),function(n){n.getAttribute("data-mce-word")==e&&t.dom.remove(n,!0)}):t.dom.remove(o,!0),g()}function v(){c().reset(),C.textMatcher=null,S&&(S=!1,t.fire("SpellcheckEnd"))}function b(e){var t=e.getAttribute("data-mce-index");return"number"==typeof t?""+t:t}function y(e){var o,r=[];if(o=n.toArray(t.getBody().getElementsByTagName("span")),o.length)for(var i=0;i<o.length;i++){var a=b(o[i]);null!==a&&a.length&&a===e.toString()&&r.push(o[i])}return r}function x(e){var t=N.spellchecker_language;e.control.items().each(function(e){e.active(e.settings.data===t)})}var w,C=this,k,S,P,N=t.settings,R=N.spellchecker_languages||"English=en,Danish=da,Dutch=nl,Finnish=fi,French=fr_FR,German=de,Italian=it,Polish=pl,Portuguese=pt_BR,Spanish=es,Swedish=sv";w=d("Language",n.map(R.split(","),function(e){var t=e.split("=");return{name:t[0],value:t[1]}})),t.on("click",function(e){var n=e.target;if("mce-spellchecker-word"==n.className){e.preventDefault();var o=y(b(n));if(o.length>0){var r=t.dom.createRng();r.setStartBefore(o[0]),r.setEndAfter(o[o.length-1]),t.selection.setRng(r),f(n.getAttribute("data-mce-word"),o)}}}),t.addMenuItem("spellchecker",{text:"Spellcheck",context:"tools",onclick:p,selectable:!0,onPostRender:function(){var e=this;t.on("SpellcheckStart SpellcheckEnd",function(){e.active(S)})}});var T={tooltip:"Spellcheck",onclick:p,onPostRender:function(){var e=this;t.on("SpellcheckStart SpellcheckEnd",function(){e.active(S)})}};w.length>1&&(T.type="splitbutton",T.menu=w,T.onshow=x,T.onselect=function(e){N.spellchecker_language=e.control.settings.data}),t.addButton("spellchecker",T),t.addCommand("mceSpellCheck",p),t.on("remove",function(){P&&(P.remove(),P=null)}),t.on("change",g),this.getTextMatcher=c,this.getWordCharPattern=m,this.getLanguage=function(){return N.spellchecker_language},N.spellchecker_language=N.spellchecker_language||N.language||"en"})}),a([s,c])}(this);tinymce.PluginManager.add("tabfocus",function(e){function n(e){9!==e.keyCode||e.ctrlKey||e.altKey||e.metaKey||e.preventDefault()}function t(n){function t(n){function t(e){return"BODY"===e.nodeName||"hidden"!=e.type&&"none"!=e.style.display&&"hidden"!=e.style.visibility&&t(e.parentNode)}function r(e){return e.tabIndex||"INPUT"==e.nodeName||"TEXTAREA"==e.nodeName}function c(e){return!r(e)&&"-1"!=e.getAttribute("tabindex")&&t(e)}if(u=i.select(":input:enabled,*[tabindex]:not(iframe)"),o(u,function(n,t){return n.id==e.id?(a=t,!1):void 0}),n>0){for(d=a+1;d<u.length;d++)if(c(u[d]))return u[d]}else for(d=a-1;d>=0;d--)if(c(u[d]))return u[d];return null}var a,u,c,d;if(!(9!==n.keyCode||n.ctrlKey||n.altKey||n.metaKey)&&(c=r(e.getParam("tab_focus",e.getParam("tabfocus_elements",":prev,:next"))),1==c.length&&(c[1]=c[0],c[0]=":prev"),u=n.shiftKey?":prev"==c[0]?t(-1):i.get(c[0]):":next"==c[1]?t(1):i.get(c[1]))){var y=tinymce.get(u.id||u.name);u.id&&y?y.focus():window.setTimeout(function(){tinymce.Env.webkit||window.focus(),u.focus()},10),n.preventDefault()}}var i=tinymce.DOM,o=tinymce.each,r=tinymce.explode;e.on("init",function(){e.inline&&tinymce.DOM.setAttrib(e.getBody(),"tabIndex",null)}),e.on("keyup",n),tinymce.Env.gecko?e.on("keypress keydown",t):e.on("keydown",t)});!function(e,t){"use strict";function n(e,t){for(var n,o=[],i=0;i<e.length;++i){if(n=l[e[i]]||r(e[i]),!n)throw"module definition dependecy not found: "+e[i];o.push(n)}t.apply(null,o)}function o(e,o,i){if("string"!=typeof e)throw"invalid module definition, module id must be defined and be a string";if(o===t)throw"invalid module definition, dependencies must be specified";if(i===t)throw"invalid module definition, definition function must be specified";n(o,function(){l[e]=i.apply(null,arguments)})}function i(e){return!!l[e]}function r(t){for(var n=e,o=t.split(/[.\/]/),i=0;i<o.length;++i){if(!n[o[i]])return;n=n[o[i]]}return n}function a(n){for(var o=0;o<n.length;o++){for(var i=e,r=n[o],a=r.split(/[.\/]/),s=0;s<a.length-1;++s)i[a[s]]===t&&(i[a[s]]={}),i=i[a[s]];i[a[a.length-1]]=l[r]}}var l={},s="tinymce/tableplugin/TableGrid",c="tinymce/util/Tools",d="tinymce/Env",u="tinymce/tableplugin/Quirks",f="tinymce/util/VK",m="tinymce/tableplugin/CellSelection",p="tinymce/dom/TreeWalker",g="tinymce/tableplugin/Plugin",h="tinymce/PluginManager";o(s,[c,d],function(e,n){function o(e,t){return parseInt(e.getAttribute(t)||1,10)}var i=e.each;return function(r,a){function l(){var e=0;A=[],i(["thead","tbody","tfoot"],function(t){var n=I.select("> "+t+" tr",a);i(n,function(n,r){r+=e,i(I.select("> td, > th",n),function(e,n){var i,a,l,s;if(A[r])for(;A[r][n];)n++;for(l=o(e,"rowspan"),s=o(e,"colspan"),a=r;r+l>a;a++)for(A[a]||(A[a]=[]),i=n;n+s>i;i++)A[a][i]={part:t,real:a==r&&i==n,elm:e,rowspan:l,colspan:s}})}),e+=n.length})}function s(e,t){return e=e.cloneNode(t),e.removeAttribute("id"),e}function c(e,t){var n;return n=A[t],n?n[e]:void 0}function d(e,t,n){e&&(n=parseInt(n,10),1===n?e.removeAttribute(t,1):e.setAttribute(t,n,1))}function u(e){return e&&(I.hasClass(e.elm,"mce-item-selected")||e==M)}function f(){var e=[];return i(a.rows,function(t){i(t.cells,function(n){return I.hasClass(n,"mce-item-selected")||M&&n==M.elm?(e.push(t),!1):void 0})}),e}function m(){var e=I.createRng();e.setStartAfter(a),e.setEndAfter(a),E.setRng(e),I.remove(a)}function p(t){var o,a={};return r.settings.table_clone_elements!==!1&&(a=e.makeMap((r.settings.table_clone_elements||"strong em b i span font h1 h2 h3 h4 h5 h6 p div").toUpperCase(),/[ ,]/)),e.walk(t,function(e){var r;return 3==e.nodeType?(i(I.getParents(e.parentNode,null,t).reverse(),function(e){a[e.nodeName]&&(e=s(e,!1),o?r&&r.appendChild(e):o=r=e,r=e)}),r&&(r.innerHTML=n.ie?" ":'<br data-mce-bogus="1" />'),!1):void 0},"childNodes"),t=s(t,!1),d(t,"rowSpan",1),d(t,"colSpan",1),o?t.appendChild(o):n.ie||(t.innerHTML='<br data-mce-bogus="1" />'),t}function g(){var e=I.createRng(),t;return i(I.select("tr",a),function(e){0===e.cells.length&&I.remove(e)}),0===I.select("tr",a).length?(e.setStartBefore(a),e.setEndBefore(a),E.setRng(e),void I.remove(a)):(i(I.select("thead,tbody,tfoot",a),function(e){0===e.rows.length&&I.remove(e)}),l(),void(B&&(t=A[Math.min(A.length-1,B.y)],t&&(E.select(t[Math.min(t.length-1,B.x)].elm,!0),E.collapse(!0)))))}function h(e,t,n,o){var i,r,a,l,s;for(i=A[t][e].elm.parentNode,a=1;n>=a;a++)if(i=I.getNext(i,"tr")){for(r=e;r>=0;r--)if(s=A[t+a][r].elm,s.parentNode==i){for(l=1;o>=l;l++)I.insertAfter(p(s),s);break}if(-1==r)for(l=1;o>=l;l++)i.insertBefore(p(i.cells[0]),i.cells[0])}}function v(){i(A,function(e,t){i(e,function(e,n){var i,r,a;if(u(e)&&(e=e.elm,i=o(e,"colspan"),r=o(e,"rowspan"),i>1||r>1)){for(d(e,"rowSpan",1),d(e,"colSpan",1),a=0;i-1>a;a++)I.insertAfter(p(e),e);h(n,t,r-1,i)}})})}function b(t,n,o){var r,a,s,f,m,p,h,b,y,w,x;if(t?(r=T(t),a=r.x,s=r.y,f=a+(n-1),m=s+(o-1)):(B=D=null,i(A,function(e,t){i(e,function(e,n){u(e)&&(B||(B={x:n,y:t}),D={x:n,y:t})})}),B&&(a=B.x,s=B.y,f=D.x,m=D.y)),b=c(a,s),y=c(f,m),b&&y&&b.part==y.part){for(v(),l(),b=c(a,s).elm,d(b,"colSpan",f-a+1),d(b,"rowSpan",m-s+1),h=s;m>=h;h++)for(p=a;f>=p;p++)A[h]&&A[h][p]&&(t=A[h][p].elm,t!=b&&(w=e.grep(t.childNodes),i(w,function(e){b.appendChild(e)}),w.length&&(w=e.grep(b.childNodes),x=0,i(w,function(e){"BR"==e.nodeName&&I.getAttrib(e,"data-mce-bogus")&&x++<w.length-1&&b.removeChild(e)})),I.remove(t)));g()}}function y(e){var n,r,a,l,c,f,m,g,h;if(i(A,function(t,o){return i(t,function(t){return u(t)&&(t=t.elm,c=t.parentNode,f=s(c,!1),n=o,e)?!1:void 0}),e?!n:void 0}),n!==t){for(l=0;l<A[0].length;l++)if(A[n][l]&&(r=A[n][l].elm,r!=a)){if(e){if(n>0&&A[n-1][l]&&(g=A[n-1][l].elm,h=o(g,"rowSpan"),h>1)){d(g,"rowSpan",h+1);continue}}else if(h=o(r,"rowspan"),h>1){d(r,"rowSpan",h+1);continue}m=p(r),d(m,"colSpan",r.colSpan),f.appendChild(m),a=r}f.hasChildNodes()&&(e?c.parentNode.insertBefore(f,c):I.insertAfter(f,c))}}function w(e){var t,n;i(A,function(n){return i(n,function(n,o){return u(n)&&(t=o,e)?!1:void 0}),e?!t:void 0}),i(A,function(i,r){var a,l,s;i[t]&&(a=i[t].elm,a!=n&&(s=o(a,"colspan"),l=o(a,"rowspan"),1==s?e?(a.parentNode.insertBefore(p(a),a),h(t,r,l-1,s)):(I.insertAfter(p(a),a),h(t,r,l-1,s)):d(a,"colSpan",a.colSpan+1),n=a))})}function x(){var t=[];i(A,function(n){i(n,function(n,r){u(n)&&-1===e.inArray(t,r)&&(i(A,function(e){var t=e[r].elm,n;n=o(t,"colSpan"),n>1?d(t,"colSpan",n-1):I.remove(t)}),t.push(r))})}),g()}function C(){function e(e){var t,n,r;t=I.getNext(e,"tr"),i(e.cells,function(e){var t=o(e,"rowSpan");t>1&&(d(e,"rowSpan",t-1),n=T(e),h(n.x,n.y,1,1))}),n=T(e.cells[0]),i(A[n.y],function(e){var t;e=e.elm,e!=r&&(t=o(e,"rowSpan"),1>=t?I.remove(e):d(e,"rowSpan",t-1),r=e)})}var t;t=f(),i(t.reverse(),function(t){e(t)}),g()}function P(){var e=f();return I.remove(e),g(),e}function S(){var e=f();return i(e,function(t,n){e[n]=s(t,!0)}),e}function R(e,t){var n=f(),o=n[t?0:n.length-1],r=o.cells.length;e&&(i(A,function(e){var t;return r=0,i(e,function(e){e.real&&(r+=e.colspan),e.elm.parentNode==o&&(t=1)}),t?!1:void 0}),t||e.reverse(),i(e,function(e){var n,i=e.cells.length,a;for(n=0;i>n;n++)a=e.cells[n],d(a,"colSpan",1),d(a,"rowSpan",1);for(n=i;r>n;n++)e.appendChild(p(e.cells[i-1]));for(n=r;i>n;n++)I.remove(e.cells[n]);t?o.parentNode.insertBefore(e,o):I.insertAfter(e,o)}),I.removeClass(I.select("td.mce-item-selected,th.mce-item-selected"),"mce-item-selected"))}function T(e){var t;return i(A,function(n,o){return i(n,function(n,i){return n.elm==e?(t={x:i,y:o},!1):void 0}),!t}),t}function k(e){B=T(e)}function N(){var e,t;return e=t=0,i(A,function(n,o){i(n,function(n,i){var r,a;u(n)&&(n=A[o][i],i>e&&(e=i),o>t&&(t=o),n.real&&(r=n.colspan-1,a=n.rowspan-1,r&&i+r>e&&(e=i+r),a&&o+a>t&&(t=o+a)))})}),{x:e,y:t}}function _(e){var t,n,o,i,r,a,l,s,c,d;if(D=T(e),B&&D){for(t=Math.min(B.x,D.x),n=Math.min(B.y,D.y),o=Math.max(B.x,D.x),i=Math.max(B.y,D.y),r=o,a=i,d=n;a>=d;d++)e=A[d][t],e.real||t-(e.colspan-1)<t&&(t-=e.colspan-1);for(c=t;r>=c;c++)e=A[n][c],e.real||n-(e.rowspan-1)<n&&(n-=e.rowspan-1);for(d=n;i>=d;d++)for(c=t;o>=c;c++)e=A[d][c],e.real&&(l=e.colspan-1,s=e.rowspan-1,l&&c+l>r&&(r=c+l),s&&d+s>a&&(a=d+s));for(I.removeClass(I.select("td.mce-item-selected,th.mce-item-selected"),"mce-item-selected"),d=n;a>=d;d++)for(c=t;r>=c;c++)A[d][c]&&I.addClass(A[d][c].elm,"mce-item-selected")}}var A,B,D,M,E=r.selection,I=E.dom;a=a||I.getParent(E.getStart(),"table"),l(),M=I.getParent(E.getStart(),"th,td"),M&&(B=T(M),D=N(),M=c(B.x,B.y)),e.extend(this,{deleteTable:m,split:v,merge:b,insertRow:y,insertCol:w,deleteCols:x,deleteRows:C,cutRows:P,copyRows:S,pasteRows:R,getPos:T,setStartCell:k,setEndCell:_})}}),o(u,[f,d,c],function(e,t,n){function o(e,t){return parseInt(e.getAttribute(t)||1,10)}var i=n.each;return function(n){function r(){function t(t){function r(e,o){var i=e?"previousSibling":"nextSibling",r=n.dom.getParent(o,"tr"),l=r[i];if(l)return h(n,o,l,e),t.preventDefault(),!0;var d=n.dom.getParent(r,"table"),u=r.parentNode,f=u.nodeName.toLowerCase();if("tbody"===f||f===(e?"tfoot":"thead")){var m=a(e,d,u,"tbody");if(null!==m)return s(e,m,o)}return c(e,r,i,d)}function a(e,t,o,i){var r=n.dom.select(">"+i,t),a=r.indexOf(o);if(e&&0===a||!e&&a===r.length-1)return l(e,t);if(-1===a){var s="thead"===o.tagName.toLowerCase()?0:r.length-1;return r[s]}return r[a+(e?-1:1)]}function l(e,t){var o=e?"thead":"tfoot",i=n.dom.select(">"+o,t);return 0!==i.length?i[0]:null}function s(e,o,i){var r=d(o,e);return r&&h(n,i,r,e),t.preventDefault(),!0}function c(e,o,i,a){var l=a[i];if(l)return u(l),!0;var s=n.dom.getParent(a,"td,th");if(s)return r(e,s,t);var c=d(o,!e);return u(c),t.preventDefault(),!1}function d(e,t){var o=e&&e[t?"lastChild":"firstChild"];return o&&"BR"===o.nodeName?n.dom.getParent(o,"td,th"):o}function u(e){n.selection.setCursorLocation(e,0)}function f(){return y==e.UP||y==e.DOWN}function m(e){var t=e.selection.getNode(),n=e.dom.getParent(t,"tr");return null!==n}function p(e){for(var t=0,n=e;n.previousSibling;)n=n.previousSibling,t+=o(n,"colspan");return t}function g(e,t){var n=0,r=0;return i(e.children,function(e,i){return n+=o(e,"colspan"),r=i,n>t?!1:void 0}),r}function h(e,t,o,i){var r=p(n.dom.getParent(t,"td,th")),a=g(o,r),l=o.childNodes[a],s=d(l,i);u(s||l)}function v(e){var t=n.selection.getNode(),o=n.dom.getParent(t,"td,th"),i=n.dom.getParent(e,"td,th");return o&&o!==i&&b(o,i)}function b(e,t){return n.dom.getParent(e,"TABLE")===n.dom.getParent(t,"TABLE")}var y=t.keyCode;if(f()&&m(n)){var w=n.selection.getNode();setTimeout(function(){v(w)&&r(!t.shiftKey&&y===e.UP,w,t)},0)}}n.on("KeyDown",function(e){t(e)})}function a(){function e(e,t){var n=t.ownerDocument,o=n.createRange(),i;return o.setStartBefore(t),o.setEnd(e.endContainer,e.endOffset),i=n.createElement("body"),i.appendChild(o.cloneContents()),0===i.innerHTML.replace(/<(br|img|object|embed|input|textarea)[^>]*>/gi,"-").replace(/<[^>]+>/g,"").length}n.on("KeyDown",function(t){var o,i,r=n.dom;(37==t.keyCode||38==t.keyCode)&&(o=n.selection.getRng(),i=r.getParent(o.startContainer,"table"),i&&n.getBody().firstChild==i&&e(o,i)&&(o=r.createRng(),o.setStartBefore(i),o.setEndBefore(i),n.selection.setRng(o),t.preventDefault()))})}function l(){n.on("KeyDown SetContent VisualAid",function(){var e;for(e=n.getBody().lastChild;e;e=e.previousSibling)if(3==e.nodeType){if(e.nodeValue.length>0)break}else if(1==e.nodeType&&!e.getAttribute("data-mce-bogus"))break;e&&"TABLE"==e.nodeName&&(n.settings.forced_root_block?n.dom.add(n.getBody(),n.settings.forced_root_block,n.settings.forced_root_block_attrs,t.ie&&t.ie<11?" ":'<br data-mce-bogus="1" />'):n.dom.add(n.getBody(),"br",{"data-mce-bogus":"1"}))}),n.on("PreProcess",function(e){var t=e.node.lastChild;t&&("BR"==t.nodeName||1==t.childNodes.length&&("BR"==t.firstChild.nodeName||"\xa0"==t.firstChild.nodeValue))&&t.previousSibling&&"TABLE"==t.previousSibling.nodeName&&n.dom.remove(t)})}function s(){function e(e,t,n,o){var i=3,r=e.dom.getParent(t.startContainer,"TABLE"),a,l,s;return r&&(a=r.parentNode),l=t.startContainer.nodeType==i&&0===t.startOffset&&0===t.endOffset&&o&&("TR"==n.nodeName||n==a),s=("TD"==n.nodeName||"TH"==n.nodeName)&&!o,l||s}function t(){var t=n.selection.getRng(),o=n.selection.getNode(),i=n.dom.getParent(t.startContainer,"TD,TH");if(e(n,t,o,i)){i||(i=o);for(var r=i.lastChild;r.lastChild;)r=r.lastChild;t.setEnd(r,r.nodeValue.length),n.selection.setRng(t)}}n.on("KeyDown",function(){t()}),n.on("MouseDown",function(e){2!=e.button&&t()})}function c(){n.on("keydown",function(t){if((t.keyCode==e.DELETE||t.keyCode==e.BACKSPACE)&&!t.isDefaultPrevented()){var o=n.dom.getParent(n.selection.getStart(),"table");if(o){for(var i=n.dom.select("td,th",o),r=i.length;r--;)if(!n.dom.hasClass(i[r],"mce-item-selected"))return;t.preventDefault(),n.execCommand("mceTableDelete")}}})}c(),t.webkit&&(r(),s()),t.gecko&&(a(),l()),t.ie>10&&(a(),l())}}),o(m,[s,p,c],function(e,t,n){return function(o){function i(){o.getBody().style.webkitUserSelect="",d&&(o.dom.removeClass(o.dom.select("td.mce-item-selected,th.mce-item-selected"),"mce-item-selected"),d=!1)}function r(t){var n,i,r=t.target;if(s&&(l||r!=s)&&("TD"==r.nodeName||"TH"==r.nodeName)){i=a.getParent(r,"table"),i==c&&(l||(l=new e(o,i),l.setStartCell(s),o.getBody().style.webkitUserSelect="none"),l.setEndCell(r),d=!0),n=o.selection.getSel();try{n.removeAllRanges?n.removeAllRanges():n.empty()}catch(u){}t.preventDefault()}}var a=o.dom,l,s,c,d=!0;return o.on("MouseDown",function(e){2!=e.button&&(i(),s=a.getParent(e.target,"td,th"),c=a.getParent(s,"table"))}),o.on("mouseover",r),o.on("remove",function(){a.unbind(o.getDoc(),"mouseover",r)}),o.on("MouseUp",function(){function e(e,o){var r=new t(e,e);do{if(3==e.nodeType&&0!==n.trim(e.nodeValue).length)return void(o?i.setStart(e,0):i.setEnd(e,e.nodeValue.length));if("BR"==e.nodeName)return void(o?i.setStartBefore(e):i.setEndBefore(e))}while(e=o?r.next():r.prev())}var i,r=o.selection,d,u,f,m,p;if(s){if(l&&(o.getBody().style.webkitUserSelect=""),d=a.select("td.mce-item-selected,th.mce-item-selected"),d.length>0){i=a.createRng(),f=d[0],p=d[d.length-1],i.setStartBefore(f),i.setEndAfter(f),e(f,1),u=new t(f,a.getParent(d[0],"table"));do if("TD"==f.nodeName||"TH"==f.nodeName){if(!a.hasClass(f,"mce-item-selected"))break;m=f}while(f=u.next());e(m),r.setRng(i)}o.nodeChanged(),s=l=c=null}}),o.on("KeyUp Drop",function(){i(),s=l=c=null}),{clear:i}}}),o(g,[s,u,m,c,p,d,h],function(e,t,n,o,i,r,a){function l(o){function i(e){return e?e.replace(/px$/,""):""}function a(e){return/^[0-9]+$/.test(e)&&(e+="px"),e}function l(e){s("left center right".split(" "),function(t){o.formatter.remove("align"+t,{},e)})}function c(e){s("top middle bottom".split(" "),function(t){o.formatter.remove("valign"+t,{},e)})}function d(){var e=o.dom,t,n,c,d;t=e.getParent(o.selection.getStart(),"table"),d={width:i(e.getStyle(t,"width")||e.getAttrib(t,"width")),height:i(e.getStyle(t,"height")||e.getAttrib(t,"height")),cellspacing:t?e.getAttrib(t,"cellspacing"):"",cellpadding:t?e.getAttrib(t,"cellpadding"):"",border:t?e.getAttrib(t,"border"):"",caption:!!e.select("caption",t)[0]},s("left center right".split(" "),function(e){o.formatter.matchNode(t,"align"+e)&&(d.align=e)}),t||(n={label:"Cols",name:"cols"},c={label:"Rows",name:"rows"}),o.windowManager.open({title:"Table properties",items:{type:"form",layout:"grid",columns:2,data:d,defaults:{type:"textbox",maxWidth:50},items:[n,c,{label:"Width",name:"width"},{label:"Height",name:"height"},{label:"Cell spacing",name:"cellspacing"},{label:"Cell padding",name:"cellpadding"},{label:"Border",name:"border"},{label:"Caption",name:"caption",type:"checkbox"},{label:"Alignment",minWidth:90,name:"align",type:"listbox",text:"None",maxWidth:null,values:[{text:"None",value:""},{text:"Left",value:"left"},{text:"Center",value:"center"},{text:"Right",value:"right"}]}]},onsubmit:function(){var n=this.toJSON(),i;o.undoManager.transact(function(){t||(t=g(n.cols||1,n.rows||1)),o.dom.setAttribs(t,{cellspacing:n.cellspacing,cellpadding:n.cellpadding,border:n.border}),o.dom.setStyles(t,{width:a(n.width),height:a(n.height)}),i=e.select("caption",t)[0],i&&!n.caption&&e.remove(i),!i&&n.caption&&(i=e.create("caption"),i.innerHTML=r.ie?"\xa0":'<br data-mce-bogus="1"/>',t.insertBefore(i,t.firstChild)),l(t),n.align&&o.formatter.apply("align"+n.align,{},t),o.focus(),o.addVisual()})}})}function u(e,t){o.windowManager.open({title:"Merge cells",body:[{label:"Cols",name:"cols",type:"textbox",size:10},{label:"Rows",name:"rows",type:"textbox",size:10}],onsubmit:function(){var n=this.toJSON();o.undoManager.transact(function(){e.merge(t,n.cols,n.rows)})}})}function f(){var e=o.dom,t,n,r=[];r=o.dom.select("td.mce-item-selected,th.mce-item-selected"),t=o.dom.getParent(o.selection.getStart(),"td,th"),!r.length&&t&&r.push(t),t=t||r[0],t&&(n={width:i(e.getStyle(t,"width")||e.getAttrib(t,"width")),height:i(e.getStyle(t,"height")||e.getAttrib(t,"height")),scope:e.getAttrib(t,"scope")},n.type=t.nodeName.toLowerCase(),s("left center right".split(" "),function(e){o.formatter.matchNode(t,"align"+e)&&(n.align=e)}),s("top middle bottom".split(" "),function(e){o.formatter.matchNode(t,"valign"+e)&&(n.valign=e)}),o.windowManager.open({title:"Cell properties",items:{type:"form",data:n,layout:"grid",columns:2,defaults:{type:"textbox",maxWidth:50},items:[{label:"Width",name:"width"},{label:"Height",name:"height"},{label:"Cell type",name:"type",type:"listbox",text:"None",minWidth:90,maxWidth:null,values:[{text:"Cell",value:"td"},{text:"Header cell",value:"th"}]},{label:"Scope",name:"scope",type:"listbox",text:"None",minWidth:90,maxWidth:null,values:[{text:"None",value:""},{text:"Row",value:"row"},{text:"Column",value:"col"},{text:"Row group",value:"rowgroup"},{text:"Column group",value:"colgroup"}]},{label:"H Align",name:"align",type:"listbox",text:"None",minWidth:90,maxWidth:null,values:[{text:"None",value:""},{text:"Left",value:"left"},{text:"Center",value:"center"},{text:"Right",value:"right"}]},{label:"V Align",name:"valign",type:"listbox",text:"None",minWidth:90,maxWidth:null,values:[{text:"None",value:""},{text:"Top",value:"top"},{text:"Middle",value:"middle"},{text:"Bottom",value:"bottom"}]}]},onsubmit:function(){var t=this.toJSON();o.undoManager.transact(function(){s(r,function(n){o.dom.setAttrib(n,"scope",t.scope),o.dom.setStyles(n,{width:a(t.width),height:a(t.height)}),t.type&&n.nodeName.toLowerCase()!=t.type&&(n=e.rename(n,t.type)),l(n),t.align&&o.formatter.apply("align"+t.align,{},n),c(n),t.valign&&o.formatter.apply("valign"+t.valign,{},n)}),o.focus()})}}))}function m(){var e=o.dom,t,n,r,c,d=[];t=o.dom.getParent(o.selection.getStart(),"table"),n=o.dom.getParent(o.selection.getStart(),"td,th"),s(t.rows,function(t){s(t.cells,function(o){return e.hasClass(o,"mce-item-selected")||o==n?(d.push(t),!1):void 0})}),r=d[0],r&&(c={height:i(e.getStyle(r,"height")||e.getAttrib(r,"height")),scope:e.getAttrib(r,"scope")},c.type=r.parentNode.nodeName.toLowerCase(),s("left center right".split(" "),function(e){o.formatter.matchNode(r,"align"+e)&&(c.align=e)}),o.windowManager.open({title:"Row properties",items:{type:"form",data:c,columns:2,defaults:{type:"textbox"},items:[{type:"listbox",name:"type",label:"Row type",text:"None",maxWidth:null,values:[{text:"Header",value:"thead"},{text:"Body",value:"tbody"},{text:"Footer",value:"tfoot"}]},{type:"listbox",name:"align",label:"Alignment",text:"None",maxWidth:null,values:[{text:"None",value:""},{text:"Left",value:"left"},{text:"Center",value:"center"},{text:"Right",value:"right"}]},{label:"Height",name:"height"}]},onsubmit:function(){var t=this.toJSON(),n,i,r;o.undoManager.transact(function(){var c=t.type;s(d,function(s){o.dom.setAttrib(s,"scope",t.scope),o.dom.setStyles(s,{height:a(t.height)}),c!=s.parentNode.nodeName.toLowerCase()&&(n=e.getParent(s,"table"),i=s.parentNode,r=e.select(c,n)[0],r||(r=e.create(c),n.firstChild?n.insertBefore(r,n.firstChild):n.appendChild(r)),r.appendChild(s),i.hasChildNodes()||e.remove(i)),l(s),t.align&&o.formatter.apply("align"+t.align,{},s)}),o.focus()})}}))}function p(e){return function(){o.execCommand(e)}}function g(e,t){var n,i,a;for(a='<table id="__mce"><tbody>',n=0;t>n;n++){for(a+="<tr>",i=0;e>i;i++)a+="<td>"+(r.ie?" ":"<br>")+"</td>";a+="</tr>"}a+="</tbody></table>",o.insertContent(a);var l=o.dom.get("__mce");return o.dom.setAttrib(l,"id",null),l}function h(e,t){function n(){e.disabled(!o.dom.getParent(o.selection.getStart(),t)),o.selection.selectorChanged(t,function(t){e.disabled(!t)})}o.initialized?n():o.on("init",n)}function v(){h(this,"table")}function b(){h(this,"td,th")}function y(){var e="";e='<table role="grid" class="mce-grid mce-grid-border" aria-readonly="true">';for(var t=0;10>t;t++){e+="<tr>";for(var n=0;10>n;n++)e+='<td role="gridcell" tabindex="-1"><a id="mcegrid'+(10*t+n)+'" href="#" data-mce-x="'+n+'" data-mce-y="'+t+'"></a></td>';e+="</tr>"}return e+="</table>",e+='<div class="mce-text-center" role="presentation">1 x 1</div>'}function w(e,t,n){var i=n.getEl().getElementsByTagName("table")[0],r,a,l,s,c,d=n.isRtl()||"tl-tr"==n.parent().rel;for(i.nextSibling.innerHTML=e+1+" x "+(t+1),d&&(e=9-e),a=0;10>a;a++)for(r=0;10>r;r++)s=i.rows[a].childNodes[r].firstChild,c=(d?r>=e:e>=r)&&t>=a,o.dom.toggleClass(s,"mce-active",c),c&&(l=s);return l.parentNode}var x,C,P=this;o.settings.table_grid===!1?o.addMenuItem("inserttable",{text:"Insert table",icon:"table",context:"table",onclick:d}):o.addMenuItem("inserttable",{text:"Insert table",icon:"table",context:"table",ariaHideMenu:!0,onclick:function(e){e.aria&&(this.parent().hideAll(),e.stopImmediatePropagation(),d())},onshow:function(){w(0,0,this.menu.items()[0])},onhide:function(){var e=this.menu.items()[0].getEl().getElementsByTagName("a");o.dom.removeClass(e,"mce-active"),o.dom.addClass(e[0],"mce-active")},menu:[{type:"container",html:y(),onPostRender:function(){this.lastX=this.lastY=0},onmousemove:function(e){var t=e.target,n,o;"A"==t.tagName.toUpperCase()&&(n=parseInt(t.getAttribute("data-mce-x"),10),o=parseInt(t.getAttribute("data-mce-y"),10),(this.isRtl()||"tl-tr"==this.parent().rel)&&(n=9-n),(n!==this.lastX||o!==this.lastY)&&(w(n,o,e.control),this.lastX=n,this.lastY=o))},onkeydown:function(e){var t=this.lastX,n=this.lastY,o;switch(e.keyCode){case 37:t>0&&(t--,o=!0);break;case 39:o=!0,9>t&&t++;break;case 38:o=!0,n>0&&n--;break;case 40:o=!0,9>n&&n++}o&&(e.preventDefault(),e.stopPropagation(),w(t,n,e.control).focus(),this.lastX=t,this.lastY=n)},onclick:function(e){"A"==e.target.tagName.toUpperCase()&&(e.preventDefault(),e.stopPropagation(),this.parent().cancel(),g(this.lastX+1,this.lastY+1))}}]}),o.addMenuItem("tableprops",{text:"Table properties",context:"table",onPostRender:v,onclick:d}),o.addMenuItem("deletetable",{text:"Delete table",context:"table",onPostRender:v,cmd:"mceTableDelete"}),o.addMenuItem("cell",{separator:"before",text:"Cell",context:"table",menu:[{text:"Cell properties",onclick:p("mceTableCellProps"),onPostRender:b},{text:"Merge cells",onclick:p("mceTableMergeCells"),onPostRender:b},{text:"Split cell",onclick:p("mceTableSplitCells"),onPostRender:b}]}),o.addMenuItem("row",{text:"Row",context:"table",menu:[{text:"Insert row before",onclick:p("mceTableInsertRowBefore"),onPostRender:b},{text:"Insert row after",onclick:p("mceTableInsertRowAfter"),onPostRender:b},{text:"Delete row",onclick:p("mceTableDeleteRow"),onPostRender:b},{text:"Row properties",onclick:p("mceTableRowProps"),onPostRender:b},{text:"-"},{text:"Cut row",onclick:p("mceTableCutRow"),onPostRender:b},{text:"Copy row",onclick:p("mceTableCopyRow"),onPostRender:b},{text:"Paste row before",onclick:p("mceTablePasteRowBefore"),onPostRender:b},{text:"Paste row after",onclick:p("mceTablePasteRowAfter"),onPostRender:b}]}),o.addMenuItem("column",{text:"Column",context:"table",menu:[{text:"Insert column before",onclick:p("mceTableInsertColBefore"),onPostRender:b},{text:"Insert column after",onclick:p("mceTableInsertColAfter"),onPostRender:b},{text:"Delete column",onclick:p("mceTableDeleteCol"),onPostRender:b}]});var S=[];s("inserttable tableprops deletetable | cell row column".split(" "),function(e){S.push("|"==e?{text:"-"}:o.menuItems[e])}),o.addButton("table",{type:"menubutton",title:"Table",menu:S}),r.isIE||o.on("click",function(e){e=e.target,"TABLE"===e.nodeName&&(o.selection.select(e),o.nodeChanged())}),P.quirks=new t(o),o.on("Init",function(){x=o.windowManager,P.cellSelection=new n(o)}),s({mceTableSplitCells:function(e){e.split()},mceTableMergeCells:function(e){var t,n,i;i=o.dom.getParent(o.selection.getStart(),"th,td"),i&&(t=i.rowSpan,n=i.colSpan),o.dom.select("td.mce-item-selected,th.mce-item-selected").length?e.merge():u(e,i)},mceTableInsertRowBefore:function(e){e.insertRow(!0)},mceTableInsertRowAfter:function(e){e.insertRow()},mceTableInsertColBefore:function(e){e.insertCol(!0)},mceTableInsertColAfter:function(e){e.insertCol()},mceTableDeleteCol:function(e){e.deleteCols()},mceTableDeleteRow:function(e){e.deleteRows()},mceTableCutRow:function(e){C=e.cutRows()},mceTableCopyRow:function(e){C=e.copyRows()},mceTablePasteRowBefore:function(e){e.pasteRows(C,!0)},mceTablePasteRowAfter:function(e){e.pasteRows(C)},mceTableDelete:function(e){e.deleteTable()}},function(t,n){o.addCommand(n,function(){var n=new e(o);n&&(t(n),o.execCommand("mceRepaint"),P.cellSelection.clear())})}),s({mceInsertTable:function(){d()},mceTableRowProps:m,mceTableCellProps:f},function(e,t){o.addCommand(t,function(t,n){e(n)})})}var s=o.each;a.add("table",l)}),a([s,u,m,g])}(this);tinymce.PluginManager.add("template",function(e){function t(t){return function(){var a=e.settings.templates;"string"==typeof a?tinymce.util.XHR.send({url:a,success:function(e){t(tinymce.util.JSON.parse(e))}}):t(a)}}function a(t){function a(t){function a(t){if(-1==t.indexOf("<html>")){var a="";tinymce.each(e.contentCSS,function(t){a+='<link type="text/css" rel="stylesheet" href="'+e.documentBaseURI.toAbsolute(t)+'">'}),t="<!DOCTYPE html><html><head>"+a+"</head><body>"+t+"</body></html>"}t=r(t,"template_preview_replace_values");var l=n.find("iframe")[0].getEl().contentWindow.document;l.open(),l.write(t),l.close()}var c=t.control.value();c.url?tinymce.util.XHR.send({url:c.url,success:function(e){l=e,a(l)}}):(l=c.content,a(l)),n.find("#description")[0].text(t.control.value().description)}var n,l,i=[];return t&&0!==t.length?(tinymce.each(t,function(e){i.push({selected:!i.length,text:e.title,value:{url:e.url,content:e.content,description:e.description}})}),n=e.windowManager.open({title:"Insert template",layout:"flex",direction:"column",align:"stretch",padding:15,spacing:10,items:[{type:"form",flex:0,padding:0,items:[{type:"container",label:"Templates",items:{type:"listbox",label:"Templates",name:"template",values:i,onselect:a}}]},{type:"label",name:"description",label:"Description",text:" "},{type:"iframe",flex:1,border:1}],onsubmit:function(){c(!1,l)},width:e.getParam("template_popup_width",600),height:e.getParam("template_popup_height",500)}),void n.find("listbox")[0].fire("select")):void e.windowManager.alert("No templates defined")}function n(t,a){function n(e,t){if(e=""+e,e.length<t)for(var a=0;a<t-e.length;a++)e="0"+e;return e}var l="Sun Mon Tue Wed Thu Fri Sat Sun".split(" "),r="Sunday Monday Tuesday Wednesday Thursday Friday Saturday Sunday".split(" "),c="Jan Feb Mar Apr May Jun Jul Aug Sep Oct Nov Dec".split(" "),i="January February March April May June July August September October November December".split(" ");return a=a||new Date,t=t.replace("%D","%m/%d/%Y"),t=t.replace("%r","%I:%M:%S %p"),t=t.replace("%Y",""+a.getFullYear()),t=t.replace("%y",""+a.getYear()),t=t.replace("%m",n(a.getMonth()+1,2)),t=t.replace("%d",n(a.getDate(),2)),t=t.replace("%H",""+n(a.getHours(),2)),t=t.replace("%M",""+n(a.getMinutes(),2)),t=t.replace("%S",""+n(a.getSeconds(),2)),t=t.replace("%I",""+((a.getHours()+11)%12+1)),t=t.replace("%p",""+(a.getHours()<12?"AM":"PM")),t=t.replace("%B",""+e.translate(i[a.getMonth()])),t=t.replace("%b",""+e.translate(c[a.getMonth()])),t=t.replace("%A",""+e.translate(r[a.getDay()])),t=t.replace("%a",""+e.translate(l[a.getDay()])),t=t.replace("%%","%")}function l(t){var a=e.dom,n=e.getParam("template_replace_values");i(a.select("*",t),function(e){i(n,function(t,l){a.hasClass(e,l)&&"function"==typeof n[l]&&n[l](e)})})}function r(t,a){return i(e.getParam(a),function(e,a){"function"!=typeof e&&(t=t.replace(new RegExp("\\{\\$"+a+"\\}","g"),e))}),t}function c(t,a){function c(e,t){return new RegExp("\\b"+t+"\\b","g").test(e.className)}var o,s,p=e.dom,m=e.selection.getContent();a=r(a,"template_replace_values"),o=p.create("div",null,a),s=p.select(".mceTmpl",o),s&&s.length>0&&(o=p.create("div",null),o.appendChild(s[0].cloneNode(!0))),i(p.select("*",o),function(t){c(t,e.getParam("template_cdate_classes","cdate").replace(/\s+/g,"|"))&&(t.innerHTML=n(e.getParam("template_cdate_format",e.getLang("template.cdate_format")))),c(t,e.getParam("template_mdate_classes","mdate").replace(/\s+/g,"|"))&&(t.innerHTML=n(e.getParam("template_mdate_format",e.getLang("template.mdate_format")))),c(t,e.getParam("template_selected_content_classes","selcontent").replace(/\s+/g,"|"))&&(t.innerHTML=m)}),l(o),e.execCommand("mceInsertContent",!1,o.innerHTML),e.addVisual()}var i=tinymce.each;e.addCommand("mceInsertTemplate",c),e.addButton("template",{title:"Insert template",onclick:t(a)}),e.addMenuItem("template",{text:"Insert template",onclick:t(a),context:"insert"}),e.on("PreProcess",function(t){var a=e.dom;i(a.select("div",t.node),function(t){a.hasClass(t,"mceTmpl")&&(i(a.select("*",t),function(t){a.hasClass(t,e.getParam("template_mdate_classes","mdate").replace(/\s+/g,"|"))&&(t.innerHTML=n(e.getParam("template_mdate_format",e.getLang("template.mdate_format"))))}),l(t))})})});tinymce.PluginManager.add("textcolor",function(e){function t(){var t,o,l=[];for(o=e.settings.textcolor_map||["000000","Black","993300","Burnt orange","333300","Dark olive","003300","Dark green","003366","Dark azure","000080","Navy Blue","333399","Indigo","333333","Very dark gray","800000","Maroon","FF6600","Orange","808000","Olive","008000","Green","008080","Teal","0000FF","Blue","666699","Grayish blue","808080","Gray","FF0000","Red","FF9900","Amber","99CC00","Yellow green","339966","Sea green","33CCCC","Turquoise","3366FF","Royal blue","800080","Purple","999999","Medium gray","FF00FF","Magenta","FFCC00","Gold","FFFF00","Yellow","00FF00","Lime","00FFFF","Aqua","00CCFF","Sky blue","993366","Red violet","C0C0C0","Silver","FF99CC","Pink","FFCC99","Peach","FFFF99","Light yellow","CCFFCC","Pale green","CCFFFF","Pale cyan","99CCFF","Light sky blue","CC99FF","Plum","FFFFFF","White"],t=0;t<o.length;t+=2)l.push({text:o[t+1],color:o[t]});return l}function o(){var o,l,r,a,c,i,n,F,d,s=this;for(o=t(),r='<table class="mce-grid mce-grid-border mce-colorbutton-grid" role="list" cellspacing="0"><tbody>',a=o.length-1,c=e.settings.textcolor_rows||5,i=e.settings.textcolor_cols||8,F=0;c>F;F++){for(r+="<tr>",n=0;i>n;n++)d=F*i+n,d>a?r+="<td></td>":(l=o[d],r+='<td><div id="'+s._id+"-"+d+'" data-mce-color="'+l.color+'" role="option" tabIndex="-1" style="'+(l?"background-color: #"+l.color:"")+'" title="'+l.text+'"></div></td>');r+="</tr>"}return r+="</tbody></table>"}function l(t){var o,l=this.parent();(o=t.target.getAttribute("data-mce-color"))&&(this.lastId&&document.getElementById(this.lastId).setAttribute("aria-selected",!1),t.target.setAttribute("aria-selected",!0),this.lastId=t.target.id,l.hidePanel(),o="#"+o,l.color(o),e.execCommand(l.settings.selectcmd,!1,o))}function r(){var t=this;t._color&&e.execCommand(t.settings.selectcmd,!1,t._color)}e.addButton("forecolor",{type:"colorbutton",tooltip:"Text color",selectcmd:"ForeColor",panel:{role:"application",ariaRemember:!0,html:o,onclick:l},onclick:r}),e.addButton("backcolor",{type:"colorbutton",tooltip:"Background color",selectcmd:"HiliteColor",panel:{role:"application",ariaRemember:!0,html:o,onclick:l},onclick:r})});tinymce.PluginManager.add("visualblocks",function(e,s){function o(){var s=this;s.active(a),e.on("VisualBlocks",function(){s.active(e.dom.hasClass(e.getBody(),"mce-visualblocks"))})}var l,t,a;window.NodeList&&(e.addCommand("mceVisualBlocks",function(){var o,c=e.dom;l||(l=c.uniqueId(),o=c.create("link",{id:l,rel:"stylesheet",href:s+"/css/visualblocks.css"}),e.getDoc().getElementsByTagName("head")[0].appendChild(o)),e.on("PreviewFormats AfterPreviewFormats",function(s){a&&c.toggleClass(e.getBody(),"mce-visualblocks","afterpreviewformats"==s.type)}),c.toggleClass(e.getBody(),"mce-visualblocks"),a=e.dom.hasClass(e.getBody(),"mce-visualblocks"),t&&t.active(c.hasClass(e.getBody(),"mce-visualblocks")),e.fire("VisualBlocks")}),e.addButton("visualblocks",{title:"Show blocks",cmd:"mceVisualBlocks",onPostRender:o}),e.addMenuItem("visualblocks",{text:"Show blocks",cmd:"mceVisualBlocks",onPostRender:o,selectable:!0,context:"view",prependToContext:!0}),e.on("init",function(){e.settings.visualblocks_default_state&&e.execCommand("mceVisualBlocks",!1,null,{skip_focus:!0})}),e.on("remove",function(){e.dom.removeClass(e.getBody(),"mce-visualblocks")}))});tinymce.PluginManager.add("visualchars",function(e){function a(a){var t,s,i,r,c,d,l=e.getBody(),m=e.selection;if(n=!n,o.state=n,e.fire("VisualChars",{state:n}),a&&(d=m.getBookmark()),n)for(s=[],tinymce.walk(l,function(e){3==e.nodeType&&e.nodeValue&&-1!=e.nodeValue.indexOf(" ")&&s.push(e)},"childNodes"),i=0;i<s.length;i++){for(r=s[i].nodeValue,r=r.replace(/(\u00a0)/g,'<span data-mce-bogus="1" class="mce-nbsp">$1</span>'),c=e.dom.create("div",null,r);t=c.lastChild;)e.dom.insertAfter(t,s[i]);e.dom.remove(s[i])}else for(s=e.dom.select("span.mce-nbsp",l),i=s.length-1;i>=0;i--)e.dom.remove(s[i],1);m.moveToBookmark(d)}function t(){var a=this;e.on("VisualChars",function(e){a.active(e.state)})}var n,o=this;e.addCommand("mceVisualChars",a),e.addButton("visualchars",{title:"Show invisible characters",cmd:"mceVisualChars",onPostRender:t}),e.addMenuItem("visualchars",{text:"Show invisible characters",cmd:"mceVisualChars",onPostRender:t,selectable:!0,context:"view",prependToContext:!0}),e.on("beforegetcontent",function(e){n&&"raw"!=e.format&&!e.draft&&(n=!0,a(!1))})});tinymce.PluginManager.add("wordcount",function(e){function t(){e.theme.panel.find("#wordcount").text(["Words: {0}",a.getCount()])}var n,o,a=this;n=e.getParam("wordcount_countregex",/[\w\u2019\x27\-\u00C0-\u1FFF]+/g),o=e.getParam("wordcount_cleanregex",/[0-9.(),;:!?%#$?\x27\x22_+=\\\/\-]*/g),e.on("init",function(){var n=e.theme.panel&&e.theme.panel.find("#statusbar")[0];n&&window.setTimeout(function(){n.insert({type:"label",name:"wordcount",text:["Words: {0}",a.getCount()],classes:"wordcount",disabled:e.settings.readonly},0),e.on("setcontent beforeaddundo",t),e.on("keyup",function(e){32==e.keyCode&&t()})},0)}),a.getCount=function(){var t=e.getContent({format:"raw"}),a=0;if(t){t=t.replace(/\.\.\./g," "),t=t.replace(/<.[^<>]*?>/g," ").replace(/ | /gi," "),t=t.replace(/(\w+)(&#?[a-z0-9]+;)+(\w+)/i,"$1$3").replace(/&.+?;/g," "),t=t.replace(o,"");var r=t.match(n);r&&(a=r.length)}return a}});tinymce.ThemeManager.add("modern",function(e){function t(){function t(t){var n,o=[];if(t)return d(t.split(/[ ,]/),function(t){function i(){var i=e.selection;"bullist"==r&&i.selectorChanged("ul > li",function(e,i){for(var n,o=i.parents.length;o--&&(n=i.parents[o].nodeName,"OL"!=n&&"UL"!=n););t.active(e&&"UL"==n)}),"numlist"==r&&i.selectorChanged("ol > li",function(e,i){for(var n,o=i.parents.length;o--&&(n=i.parents[o].nodeName,"OL"!=n&&"UL"!=n););t.active(e&&"OL"==n)}),t.settings.stateSelector&&i.selectorChanged(t.settings.stateSelector,function(e){t.active(e)},!0),t.settings.disabledStateSelector&&i.selectorChanged(t.settings.disabledStateSelector,function(e){t.disabled(e)})}var r;"|"==t?n=null:c.has(t)?(t={type:t},u.toolbar_items_size&&(t.size=u.toolbar_items_size),o.push(t),n=null):(n||(n={type:"buttongroup",items:[]},o.push(n)),e.buttons[t]&&(r=t,t=e.buttons[r],"function"==typeof t&&(t=t()),t.type=t.type||"button",u.toolbar_items_size&&(t.size=u.toolbar_items_size),t=c.create(t),n.items.push(t),e.initialized?i():e.on("init",i)))}),i.push({type:"toolbar",layout:"flow",items:o}),!0}var i=[];if(tinymce.isArray(u.toolbar)){if(0===u.toolbar.length)return;tinymce.each(u.toolbar,function(e,t){u["toolbar"+(t+1)]=e}),delete u.toolbar}for(var n=1;10>n&&t(u["toolbar"+n]);n++);return i.length||u.toolbar===!1||t(u.toolbar||f),i.length?{type:"panel",layout:"stack",classes:"toolbar-grp",ariaRoot:!0,ariaRemember:!0,items:i}:void 0}function i(){function t(t){var i;return"|"==t?{text:"|"}:i=e.menuItems[t]}function i(i){var n,o,r,a,s;if(s=tinymce.makeMap((u.removed_menuitems||"").split(/[ ,]/)),u.menu?(o=u.menu[i],a=!0):o=h[i],o){n={text:o.title},r=[],d((o.items||"").split(/[ ,]/),function(e){var i=t(e);i&&!s[e]&&r.push(t(e))}),a||d(e.menuItems,function(e){e.context==i&&("before"==e.separator&&r.push({text:"|"}),e.prependToContext?r.unshift(e):r.push(e),"after"==e.separator&&r.push({text:"|"}))});for(var l=0;l<r.length;l++)"|"==r[l].text&&(0===l||l==r.length-1)&&r.splice(l,1);if(n.menu=r,!n.menu.length)return null}return n}var n,o=[],r=[];if(u.menu)for(n in u.menu)r.push(n);else for(n in h)r.push(n);for(var a="string"==typeof u.menubar?u.menubar.split(/[ ,]/):r,s=0;s<a.length;s++){var l=a[s];l=i(l),l&&o.push(l)}return o}function n(t){function i(e){var i=t.find(e)[0];i&&i.focus(!0)}e.shortcuts.add("Alt+F9","",function(){i("menubar")}),e.shortcuts.add("Alt+F10","",function(){i("toolbar")}),e.shortcuts.add("Alt+F11","",function(){i("elementpath")}),t.on("cancel",function(){e.focus()})}function o(t,i){function n(e){return{width:e.clientWidth,height:e.clientHeight}}var o,r,a,s;o=e.getContainer(),r=e.getContentAreaContainer().firstChild,a=n(o),s=n(r),null!==t&&(t=Math.max(u.min_width||100,t),t=Math.min(u.max_width||65535,t),m.css(o,"width",t+(a.width-s.width)),m.css(r,"width",t)),i=Math.max(u.min_height||100,i),i=Math.min(u.max_height||65535,i),m.css(r,"height",i),e.fire("ResizeEditor")}function r(t,i){var n=e.getContentAreaContainer();l.resizeTo(n.clientWidth+t,n.clientHeight+i)}function a(o){function r(){if(h&&h.moveRel&&h.visible()&&!h._fixed){var t=e.selection.getScrollContainer(),i=e.getBody(),n=0,o=0;if(t){var r=m.getPos(i),a=m.getPos(t);n=Math.max(0,a.x-r.x),o=Math.max(0,a.y-r.y)}h.fixed(!1).moveRel(i,e.rtl?["tr-br","br-tr"]:["tl-bl","bl-tl"]).moveBy(n,o)}}function a(){h&&(h.show(),r(),m.addClass(e.getBody(),"mce-edit-focus"))}function s(){h&&(h.hide(),m.removeClass(e.getBody(),"mce-edit-focus"))}function d(){return h?void(h.visible()||a()):(h=l.panel=c.create({type:f?"panel":"floatpanel",role:"application",classes:"tinymce tinymce-inline",layout:"flex",direction:"column",align:"stretch",autohide:!1,autofix:!0,fixed:!!f,border:1,items:[u.menubar===!1?null:{type:"menubar",border:"0 0 1 0",items:i()},t()]}),e.fire("BeforeRenderUI"),h.renderTo(f||document.body).reflow(),n(h),a(),e.on("nodeChange",r),e.on("activate",a),e.on("deactivate",s),void e.nodeChanged())}var h,f;return u.fixed_toolbar_container&&(f=m.select(u.fixed_toolbar_container)[0]),u.content_editable=!0,e.on("focus",function(){o.skinUiCss?tinymce.DOM.styleSheetLoader.load(o.skinUiCss,d,d):d()}),e.on("blur hide",s),e.on("remove",function(){h&&(h.remove(),h=null)}),o.skinUiCss&&tinymce.DOM.styleSheetLoader.load(o.skinUiCss),{}}function s(r){var a,s,d;return r.skinUiCss&&tinymce.DOM.loadCSS(r.skinUiCss),a=l.panel=c.create({type:"panel",role:"application",classes:"tinymce",style:"visibility: hidden",layout:"stack",border:1,items:[u.menubar===!1?null:{type:"menubar",border:"0 0 1 0",items:i()},t(),{type:"panel",name:"iframe",layout:"stack",classes:"edit-area",html:"",border:"1 0 0 0"}]}),u.resize!==!1&&(s={type:"resizehandle",direction:u.resize,onResizeStart:function(){var t=e.getContentAreaContainer().firstChild;d={width:t.clientWidth,height:t.clientHeight}},onResize:function(e){"both"==u.resize?o(d.width+e.deltaX,d.height+e.deltaY):o(null,d.height+e.deltaY)}}),u.statusbar!==!1&&a.add({type:"panel",name:"statusbar",classes:"statusbar",layout:"flow",border:"1 0 0 0",ariaRoot:!0,items:[{type:"elementpath"},s]}),u.readonly&&a.find("*").disabled(!0),e.fire("BeforeRenderUI"),a.renderBefore(r.targetNode).reflow(),u.width&&tinymce.DOM.setStyle(a.getEl(),"width",u.width),e.on("remove",function(){a.remove(),a=null}),n(a),{iframeContainer:a.find("#iframe")[0].getEl(),editorContainer:a.getEl()}}var l=this,u=e.settings,c=tinymce.ui.Factory,d=tinymce.each,m=tinymce.DOM,h={file:{title:"File",items:"newdocument"},edit:{title:"Edit",items:"undo redo | cut copy paste pastetext | selectall"},insert:{title:"Insert",items:"|"},view:{title:"View",items:"visualaid |"},format:{title:"Format",items:"bold italic underline strikethrough superscript subscript | formats | removeformat"},table:{title:"Table"},tools:{title:"Tools"}},f="undo redo | styleselect | bold italic | alignleft aligncenter alignright alignjustify | bullist numlist outdent indent | link image";l.renderUI=function(t){var i=u.skin!==!1?u.skin||"lightgray":!1;if(i){var n=u.skin_url;n=n?e.documentBaseURI.toAbsolute(n):tinymce.baseURL+"/skins/"+i,t.skinUiCss=tinymce.Env.documentMode<=7?n+"/skin.ie7.min.css":n+"/skin.min.css",e.contentCSS.push(n+"/content"+(e.inline?".inline":"")+".min.css")}return e.on("ProgressState",function(e){l.throbber=l.throbber||new tinymce.ui.Throbber(l.panel.getEl("body")),e.state?l.throbber.show(e.time):l.throbber.hide()}),u.inline?a(t):s(t)},l.resizeTo=o,l.resizeBy=r});
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/key_tests/remove_on_keypress.html b/node_modules/selenium-webdriver/lib/test/data/key_tests/remove_on_keypress.html new file mode 100644 index 000000000..c0f3aab4c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/key_tests/remove_on_keypress.html @@ -0,0 +1,36 @@ +<!DOCTYPE html> +<div><input id="target" type="checkbox">Pressing "a" while this checkbox is + focused will remove it from the DOM.</div> +<div><textarea id="log" style="width:250px; height:250px;"></textarea></div> +<div><button id="clear">Clear log</button></div> +<script> + function removeNode(node) { + if (node && node.parentNode) { + node.parentNode.removeChild(node); + } + } + + function log(msg) { + document.getElementById('log').value += msg + '\n'; + } + + document.body.onkeyup = function() { + log('keyup (body)'); + }; + + document.getElementById('clear').onclick = function() { + document.getElementById('log').value = ''; + }; + + var target = document.getElementById('target'); + target.onkeydown = function() { log('keydown (target)'); }; + target.onkeypress = function(e) { + e = e || window.event; + var k = e.keyCode || e.which; + if (k == 97) { + log('a pressed; removing'); + removeNode(target.parentNode); + } + }; + target.onkeyup = function() { log('keyup (target)'); }; +</script> diff --git a/node_modules/selenium-webdriver/lib/test/data/keyboard_shortcut.html b/node_modules/selenium-webdriver/lib/test/data/keyboard_shortcut.html new file mode 100644 index 000000000..741d7f4b8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/keyboard_shortcut.html @@ -0,0 +1,36 @@ +<!DOCTYPE html> +<body style="background: white"> +<div style="background: red">CTRL + 1: red</div> +<div style="background: green">SHIFT + 1: green</div> +<div style="background: yellow">CTRL + SHIFT + 1: yellow</div> +<div style="background: lightblue">ALT + 1: lightblue</div> +<div style="background: lightgreen">CTRL + ALT + 1: lightgreen</div> +<div style="background: silver">SHIFT + ALT + 1: silver</div> +<div style="background: magenta">CTRL + SHIFT + ALT + 1: magenta</div> +<script> + var colors = {}; + colors[0x001] = 'red'; + colors[0x010] = 'green'; + colors[0x011] = 'yellow'; + colors[0x100] = 'lightblue'; + colors[0x101] = 'lightgreen'; + colors[0x110] = 'silver'; + colors[0x111] = 'magenta'; + + document.onkeydown = function(e) { + if (e.keyCode != 49) return; + var mask = 0; + if (e.ctrlKey) mask |= 0x001; + if (e.shiftKey) mask |= 0x010; + if (e.altKey) mask |= 0x100; + + console.log(mask); + if (mask) { + document.body.style.backgroundColor = colors[mask]; + } + + e.preventDefault(); + e.stopPropagation(); + return false; + }; +</script> diff --git a/node_modules/selenium-webdriver/lib/test/data/linked_image.html b/node_modules/selenium-webdriver/lib/test/data/linked_image.html new file mode 100644 index 000000000..7c8df0031 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/linked_image.html @@ -0,0 +1,16 @@ +<!DOCTYPE html> +<html> +<head> +<META HTTP-EQUIV="Content-Type" CONTENT="text/html"> +<title>Linking with an image</title> +</head> +<body> +<img style="width: 644px; height: 41px;" alt="banner" src="banner.gif"><br> +<a id="link" href="./resultPage.html">Click here for next page</a><br> +<a id="linkWithEnclosedImage" href="./resultPage.html"><img id="enclosedImage" src="./banner.gif"></a><br/> +<a id="linkToAnchorOnThisPage" href="#link">link to other link</a><br/> +<a id="justanotherLink" href="./resultPage.html">Just another link.</a><br/> +<a id="linkWithExtraEnclosedImage" href="./resultPage.html"><div><img id="extraEnclosedImage" src="./banner.gif"></div></a><br/> +</body> + +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected.html b/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected.html new file mode 100644 index 000000000..42b0442b0 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected.html @@ -0,0 +1,13 @@ +<html> +<head> + <title>Boolean Attribute Selected</title> +</head> +<body> +<form method="get" action="#" name="myForm"> + <select name="myDropdown"> + <option value="one">One</option> + <option selected="selected" value="two">Two</option> + <option value="four">Four</option> + </select> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected_html4.html b/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected_html4.html new file mode 100644 index 000000000..60cd03381 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/locators_tests/boolean_attribute_selected_html4.html @@ -0,0 +1,13 @@ +<html> +<head> + <title>Boolean Attribute Selected</title> +</head> +<body> +<form method="get" action="#" name="myForm"> + <select name="myDropdown"> + <option value="one">One</option> + <option selected value="two">Two</option> + <option value="four">Four</option> + </select> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/longContentPage.html b/node_modules/selenium-webdriver/lib/test/data/longContentPage.html new file mode 100644 index 000000000..99a45e773 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/longContentPage.html @@ -0,0 +1,55 @@ +<html> +<head> + <title>TouchLongContent</title> +</head> + +<body> + <h1>Touch API</h1> + <h2>Page with long content</h2> + <pre> <a id="imagestart"><img src="icon.gif"></a></pre></br></br></br> + <p><pre>Long text: This is a very long text to make the screen horizontally movable, to test the flick gesture at a long horizontal distance <a href="xhtmlTest.html" id="link1">Normal link</a> at normal and fast speeds to see results of it <a href="xhtmlTest.html" id="link2">Normal link end</a></pre></p> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + Middle of the screen <a href="xhtmlTest.html" id="link3">Normal link</a> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + </br></br></br></br></br></br></br></br></br></br></br> + Bottom of the screen <a href="xhtmlTest.html" id="link4">Normal link</a></br></br></br> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/macbeth.html b/node_modules/selenium-webdriver/lib/test/data/macbeth.html new file mode 100644 index 000000000..9fa39d566 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/macbeth.html @@ -0,0 +1,5255 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.0 Transitional//EN" "http://www.w3.org/TR/REC-html40/loose.dtd"> + <html> + <head> + <title>Macbeth: Entire Play + </title> + <meta http-equiv="Content-Type" content="text/html; charset=iso-8859-1"> + </HEAD> + <body bgcolor="#ffffff" text="#000000"> + + <!-- Originally from http://shakespeare.mit.edu/macbeth/full.html --> + +<a href="#5.8.86">Quick link to last speech</a> + +<H3>ACT I</h3> +<h3>SCENE I. A desert place.</h3> +<p><blockquote> +<i>Thunder and lightning. Enter three Witches</i> +</blockquote> + +<A NAME=speech1><b>First Witch</b></a> +<blockquote> +<A NAME=1.1.1>When shall we three meet again</A><br> +<A NAME=1.1.2>In thunder, lightning, or in rain?</A><br> +</blockquote> + +<A NAME=speech2><b>Second Witch</b></a> +<blockquote> +<A NAME=1.1.3>When the hurlyburly's done,</A><br> +<A NAME=1.1.4>When the battle's lost and won.</A><br> +</blockquote> + +<A NAME=speech3><b>Third Witch</b></a> +<blockquote> +<A NAME=1.1.5>That will be ere the set of sun.</A><br> +</blockquote> + +<A NAME=speech4><b>First Witch</b></a> +<blockquote> +<A NAME=1.1.6>Where the place?</A><br> +</blockquote> + +<A NAME=speech5><b>Second Witch</b></a> +<blockquote> +<A NAME=1.1.7> Upon the heath.</A><br> +</blockquote> + +<A NAME=speech6><b>Third Witch</b></a> +<blockquote> +<A NAME=1.1.8>There to meet with Macbeth.</A><br> +</blockquote> + +<A NAME=speech7><b>First Witch</b></a> +<blockquote> +<A NAME=1.1.9>I come, Graymalkin!</A><br> +</blockquote> + +<A NAME=speech8><b>Second Witch</b></a> +<blockquote> +<A NAME=1.1.10>Paddock calls.</A><br> +</blockquote> + +<A NAME=speech9><b>Third Witch</b></a> +<blockquote> +<A NAME=1.1.11>Anon.</A><br> +</blockquote> + +<A NAME=speech10><b>ALL</b></a> +<blockquote> +<A NAME=1.1.12>Fair is foul, and foul is fair:</A><br> +<A NAME=1.1.13>Hover through the fog and filthy air.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE II. A camp near Forres.</h3> +<p><blockquote> +<i>Alarum within. Enter DUNCAN, MALCOLM, DONALBAIN, LENNOX, with Attendants, meeting a bleeding Sergeant</i> +</blockquote> + +<A NAME=speech1><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.1>What bloody man is that? He can report,</A><br> +<A NAME=1.2.2>As seemeth by his plight, of the revolt</A><br> +<A NAME=1.2.3>The newest state.</A><br> +</blockquote> + +<A NAME=speech2><b>MALCOLM</b></a> +<blockquote> +<A NAME=1.2.4> This is the sergeant</A><br> +<A NAME=1.2.5>Who like a good and hardy soldier fought</A><br> +<A NAME=1.2.6>'Gainst my captivity. Hail, brave friend!</A><br> +<A NAME=1.2.7>Say to the king the knowledge of the broil</A><br> +<A NAME=1.2.8>As thou didst leave it.</A><br> +</blockquote> + +<A NAME=speech3><b>Sergeant</b></a> +<blockquote> +<A NAME=1.2.9>Doubtful it stood;</A><br> +<A NAME=1.2.10>As two spent swimmers, that do cling together</A><br> +<A NAME=1.2.11>And choke their art. The merciless Macdonwald--</A><br> +<A NAME=1.2.12>Worthy to be a rebel, for to that</A><br> +<A NAME=1.2.13>The multiplying villanies of nature</A><br> +<A NAME=1.2.14>Do swarm upon him--from the western isles</A><br> +<A NAME=1.2.15>Of kerns and gallowglasses is supplied;</A><br> +<A NAME=1.2.16>And fortune, on his damned quarrel smiling,</A><br> +<A NAME=1.2.17>Show'd like a rebel's whore: but all's too weak:</A><br> +<A NAME=1.2.18>For brave Macbeth--well he deserves that name--</A><br> +<A NAME=1.2.19>Disdaining fortune, with his brandish'd steel,</A><br> +<A NAME=1.2.20>Which smoked with bloody execution,</A><br> +<A NAME=1.2.21>Like valour's minion carved out his passage</A><br> +<A NAME=1.2.22>Till he faced the slave;</A><br> +<A NAME=1.2.23>Which ne'er shook hands, nor bade farewell to him,</A><br> +<A NAME=1.2.24>Till he unseam'd him from the nave to the chaps,</A><br> +<A NAME=1.2.25>And fix'd his head upon our battlements.</A><br> +</blockquote> + +<A NAME=speech4><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.26>O valiant cousin! worthy gentleman!</A><br> +</blockquote> + +<A NAME=speech5><b>Sergeant</b></a> +<blockquote> +<A NAME=1.2.27>As whence the sun 'gins his reflection</A><br> +<A NAME=1.2.28>Shipwrecking storms and direful thunders break,</A><br> +<A NAME=1.2.29>So from that spring whence comfort seem'd to come</A><br> +<A NAME=1.2.30>Discomfort swells. Mark, king of Scotland, mark:</A><br> +<A NAME=1.2.31>No sooner justice had with valour arm'd</A><br> +<A NAME=1.2.32>Compell'd these skipping kerns to trust their heels,</A><br> +<A NAME=1.2.33>But the Norweyan lord surveying vantage,</A><br> +<A NAME=1.2.34>With furbish'd arms and new supplies of men</A><br> +<A NAME=1.2.35>Began a fresh assault.</A><br> +</blockquote> + +<A NAME=speech6><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.36>Dismay'd not this</A><br> +<A NAME=1.2.37>Our captains, Macbeth and Banquo?</A><br> +</blockquote> + +<A NAME=speech7><b>Sergeant</b></a> +<blockquote> +<A NAME=1.2.38>Yes;</A><br> +<A NAME=1.2.39>As sparrows eagles, or the hare the lion.</A><br> +<A NAME=1.2.40>If I say sooth, I must report they were</A><br> +<A NAME=1.2.41>As cannons overcharged with double cracks, so they</A><br> +<A NAME=1.2.42>Doubly redoubled strokes upon the foe:</A><br> +<A NAME=1.2.43>Except they meant to bathe in reeking wounds,</A><br> +<A NAME=1.2.44>Or memorise another Golgotha,</A><br> +<A NAME=1.2.45>I cannot tell.</A><br> +<A NAME=1.2.46>But I am faint, my gashes cry for help.</A><br> +</blockquote> + +<A NAME=speech8><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.47>So well thy words become thee as thy wounds;</A><br> +<A NAME=1.2.48>They smack of honour both. Go get him surgeons.</A><br> +<p><i>Exit Sergeant, attended</i></p> +<A NAME=1.2.49>Who comes here?</A><br> +<p><i>Enter ROSS</i></p> +</blockquote> + +<A NAME=speech9><b>MALCOLM</b></a> +<blockquote> +<A NAME=1.2.50> The worthy thane of Ross.</A><br> +</blockquote> + +<A NAME=speech10><b>LENNOX</b></a> +<blockquote> +<A NAME=1.2.51>What a haste looks through his eyes! So should he look</A><br> +<A NAME=1.2.52>That seems to speak things strange.</A><br> +</blockquote> + +<A NAME=speech11><b>ROSS</b></a> +<blockquote> +<A NAME=1.2.53>God save the king!</A><br> +</blockquote> + +<A NAME=speech12><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.54>Whence camest thou, worthy thane?</A><br> +</blockquote> + +<A NAME=speech13><b>ROSS</b></a> +<blockquote> +<A NAME=1.2.55>From Fife, great king;</A><br> +<A NAME=1.2.56>Where the Norweyan banners flout the sky</A><br> +<A NAME=1.2.57>And fan our people cold. Norway himself,</A><br> +<A NAME=1.2.58>With terrible numbers,</A><br> +<A NAME=1.2.59>Assisted by that most disloyal traitor</A><br> +<A NAME=1.2.60>The thane of Cawdor, began a dismal conflict;</A><br> +<A NAME=1.2.61>Till that Bellona's bridegroom, lapp'd in proof,</A><br> +<A NAME=1.2.62>Confronted him with self-comparisons,</A><br> +<A NAME=1.2.63>Point against point rebellious, arm 'gainst arm.</A><br> +<A NAME=1.2.64>Curbing his lavish spirit: and, to conclude,</A><br> +<A NAME=1.2.65>The victory fell on us.</A><br> +</blockquote> + +<A NAME=speech14><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.66>Great happiness!</A><br> +</blockquote> + +<A NAME=speech15><b>ROSS</b></a> +<blockquote> +<A NAME=1.2.67>That now</A><br> +<A NAME=1.2.68>Sweno, the Norways' king, craves composition:</A><br> +<A NAME=1.2.69>Nor would we deign him burial of his men</A><br> +<A NAME=1.2.70>Till he disbursed at Saint Colme's inch</A><br> +<A NAME=1.2.71>Ten thousand dollars to our general use.</A><br> +</blockquote> + +<A NAME=speech16><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.72>No more that thane of Cawdor shall deceive</A><br> +<A NAME=1.2.73>Our bosom interest: go pronounce his present death,</A><br> +<A NAME=1.2.74>And with his former title greet Macbeth.</A><br> +</blockquote> + +<A NAME=speech17><b>ROSS</b></a> +<blockquote> +<A NAME=1.2.75>I'll see it done.</A><br> +</blockquote> + +<A NAME=speech18><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.2.76>What he hath lost noble Macbeth hath won.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE III. A heath near Forres.</h3> +<p><blockquote> +<i>Thunder. Enter the three Witches</i> +</blockquote> + +<A NAME=speech1><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.1>Where hast thou been, sister?</A><br> +</blockquote> + +<A NAME=speech2><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.2>Killing swine.</A><br> +</blockquote> + +<A NAME=speech3><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.3>Sister, where thou?</A><br> +</blockquote> + +<A NAME=speech4><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.4>A sailor's wife had chestnuts in her lap,</A><br> +<A NAME=1.3.5>And munch'd, and munch'd, and munch'd:--</A><br> +<A NAME=1.3.6>'Give me,' quoth I:</A><br> +<A NAME=1.3.7>'Aroint thee, witch!' the rump-fed ronyon cries.</A><br> +<A NAME=1.3.8>Her husband's to Aleppo gone, master o' the Tiger:</A><br> +<A NAME=1.3.9>But in a sieve I'll thither sail,</A><br> +<A NAME=1.3.10>And, like a rat without a tail,</A><br> +<A NAME=1.3.11>I'll do, I'll do, and I'll do.</A><br> +</blockquote> + +<A NAME=speech5><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.12>I'll give thee a wind.</A><br> +</blockquote> + +<A NAME=speech6><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.13>Thou'rt kind.</A><br> +</blockquote> + +<A NAME=speech7><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.14>And I another.</A><br> +</blockquote> + +<A NAME=speech8><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.15>I myself have all the other,</A><br> +<A NAME=1.3.16>And the very ports they blow,</A><br> +<A NAME=1.3.17>All the quarters that they know</A><br> +<A NAME=1.3.18>I' the shipman's card.</A><br> +<A NAME=1.3.19>I will drain him dry as hay:</A><br> +<A NAME=1.3.20>Sleep shall neither night nor day</A><br> +<A NAME=1.3.21>Hang upon his pent-house lid;</A><br> +<A NAME=1.3.22>He shall live a man forbid:</A><br> +<A NAME=1.3.23>Weary se'nnights nine times nine</A><br> +<A NAME=1.3.24>Shall he dwindle, peak and pine:</A><br> +<A NAME=1.3.25>Though his bark cannot be lost,</A><br> +<A NAME=1.3.26>Yet it shall be tempest-tost.</A><br> +<A NAME=1.3.27>Look what I have.</A><br> +</blockquote> + +<A NAME=speech9><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.28>Show me, show me.</A><br> +</blockquote> + +<A NAME=speech10><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.29>Here I have a pilot's thumb,</A><br> +<A NAME=1.3.30>Wreck'd as homeward he did come.</A><br> +<p><i>Drum within</i></p> +</blockquote> + +<A NAME=speech11><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.31>A drum, a drum!</A><br> +<A NAME=1.3.32>Macbeth doth come.</A><br> +</blockquote> + +<A NAME=speech12><b>ALL</b></a> +<blockquote> +<A NAME=1.3.33>The weird sisters, hand in hand,</A><br> +<A NAME=1.3.34>Posters of the sea and land,</A><br> +<A NAME=1.3.35>Thus do go about, about:</A><br> +<A NAME=1.3.36>Thrice to thine and thrice to mine</A><br> +<A NAME=1.3.37>And thrice again, to make up nine.</A><br> +<A NAME=1.3.38>Peace! the charm's wound up.</A><br> +<p><i>Enter MACBETH and BANQUO</i></p> +</blockquote> + +<A NAME=speech13><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.39>So foul and fair a day I have not seen.</A><br> +</blockquote> + +<A NAME=speech14><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.40>How far is't call'd to Forres? What are these</A><br> +<A NAME=1.3.41>So wither'd and so wild in their attire,</A><br> +<A NAME=1.3.42>That look not like the inhabitants o' the earth,</A><br> +<A NAME=1.3.43>And yet are on't? Live you? or are you aught</A><br> +<A NAME=1.3.44>That man may question? You seem to understand me,</A><br> +<A NAME=1.3.45>By each at once her chappy finger laying</A><br> +<A NAME=1.3.46>Upon her skinny lips: you should be women,</A><br> +<A NAME=1.3.47>And yet your beards forbid me to interpret</A><br> +<A NAME=1.3.48>That you are so.</A><br> +</blockquote> + +<A NAME=speech15><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.49> Speak, if you can: what are you?</A><br> +</blockquote> + +<A NAME=speech16><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.50>All hail, Macbeth! hail to thee, thane of Glamis!</A><br> +</blockquote> + +<A NAME=speech17><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.51>All hail, Macbeth, hail to thee, thane of Cawdor!</A><br> +</blockquote> + +<A NAME=speech18><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.52>All hail, Macbeth, thou shalt be king hereafter!</A><br> +</blockquote> + +<A NAME=speech19><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.53>Good sir, why do you start; and seem to fear</A><br> +<A NAME=1.3.54>Things that do sound so fair? I' the name of truth,</A><br> +<A NAME=1.3.55>Are ye fantastical, or that indeed</A><br> +<A NAME=1.3.56>Which outwardly ye show? My noble partner</A><br> +<A NAME=1.3.57>You greet with present grace and great prediction</A><br> +<A NAME=1.3.58>Of noble having and of royal hope,</A><br> +<A NAME=1.3.59>That he seems rapt withal: to me you speak not.</A><br> +<A NAME=1.3.60>If you can look into the seeds of time,</A><br> +<A NAME=1.3.61>And say which grain will grow and which will not,</A><br> +<A NAME=1.3.62>Speak then to me, who neither beg nor fear</A><br> +<A NAME=1.3.63>Your favours nor your hate.</A><br> +</blockquote> + +<A NAME=speech20><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.64>Hail!</A><br> +</blockquote> + +<A NAME=speech21><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.65>Hail!</A><br> +</blockquote> + +<A NAME=speech22><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.66>Hail!</A><br> +</blockquote> + +<A NAME=speech23><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.67>Lesser than Macbeth, and greater.</A><br> +</blockquote> + +<A NAME=speech24><b>Second Witch</b></a> +<blockquote> +<A NAME=1.3.68>Not so happy, yet much happier.</A><br> +</blockquote> + +<A NAME=speech25><b>Third Witch</b></a> +<blockquote> +<A NAME=1.3.69>Thou shalt get kings, though thou be none:</A><br> +<A NAME=1.3.70>So all hail, Macbeth and Banquo!</A><br> +</blockquote> + +<A NAME=speech26><b>First Witch</b></a> +<blockquote> +<A NAME=1.3.71>Banquo and Macbeth, all hail!</A><br> +</blockquote> + +<A NAME=speech27><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.72>Stay, you imperfect speakers, tell me more:</A><br> +<A NAME=1.3.73>By Sinel's death I know I am thane of Glamis;</A><br> +<A NAME=1.3.74>But how of Cawdor? the thane of Cawdor lives,</A><br> +<A NAME=1.3.75>A prosperous gentleman; and to be king</A><br> +<A NAME=1.3.76>Stands not within the prospect of belief,</A><br> +<A NAME=1.3.77>No more than to be Cawdor. Say from whence</A><br> +<A NAME=1.3.78>You owe this strange intelligence? or why</A><br> +<A NAME=1.3.79>Upon this blasted heath you stop our way</A><br> +<A NAME=1.3.80>With such prophetic greeting? Speak, I charge you.</A><br> +<p><i>Witches vanish</i></p> +</blockquote> + +<A NAME=speech28><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.81>The earth hath bubbles, as the water has,</A><br> +<A NAME=1.3.82>And these are of them. Whither are they vanish'd?</A><br> +</blockquote> + +<A NAME=speech29><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.83>Into the air; and what seem'd corporal melted</A><br> +<A NAME=1.3.84>As breath into the wind. Would they had stay'd!</A><br> +</blockquote> + +<A NAME=speech30><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.85>Were such things here as we do speak about?</A><br> +<A NAME=1.3.86>Or have we eaten on the insane root</A><br> +<A NAME=1.3.87>That takes the reason prisoner?</A><br> +</blockquote> + +<A NAME=speech31><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.88>Your children shall be kings.</A><br> +</blockquote> + +<A NAME=speech32><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.89>You shall be king.</A><br> +</blockquote> + +<A NAME=speech33><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.90>And thane of Cawdor too: went it not so?</A><br> +</blockquote> + +<A NAME=speech34><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.91>To the selfsame tune and words. Who's here?</A><br> +<p><i>Enter ROSS and ANGUS</i></p> +</blockquote> + +<A NAME=speech35><b>ROSS</b></a> +<blockquote> +<A NAME=1.3.92>The king hath happily received, Macbeth,</A><br> +<A NAME=1.3.93>The news of thy success; and when he reads</A><br> +<A NAME=1.3.94>Thy personal venture in the rebels' fight,</A><br> +<A NAME=1.3.95>His wonders and his praises do contend</A><br> +<A NAME=1.3.96>Which should be thine or his: silenced with that,</A><br> +<A NAME=1.3.97>In viewing o'er the rest o' the selfsame day,</A><br> +<A NAME=1.3.98>He finds thee in the stout Norweyan ranks,</A><br> +<A NAME=1.3.99>Nothing afeard of what thyself didst make,</A><br> +<A NAME=1.3.100>Strange images of death. As thick as hail</A><br> +<A NAME=1.3.101>Came post with post; and every one did bear</A><br> +<A NAME=1.3.102>Thy praises in his kingdom's great defence,</A><br> +<A NAME=1.3.103>And pour'd them down before him.</A><br> +</blockquote> + +<A NAME=speech36><b>ANGUS</b></a> +<blockquote> +<A NAME=1.3.104>We are sent</A><br> +<A NAME=1.3.105>To give thee from our royal master thanks;</A><br> +<A NAME=1.3.106>Only to herald thee into his sight,</A><br> +<A NAME=1.3.107>Not pay thee.</A><br> +</blockquote> + +<A NAME=speech37><b>ROSS</b></a> +<blockquote> +<A NAME=1.3.108>And, for an earnest of a greater honour,</A><br> +<A NAME=1.3.109>He bade me, from him, call thee thane of Cawdor:</A><br> +<A NAME=1.3.110>In which addition, hail, most worthy thane!</A><br> +<A NAME=1.3.111>For it is thine.</A><br> +</blockquote> + +<A NAME=speech38><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.112> What, can the devil speak true?</A><br> +</blockquote> + +<A NAME=speech39><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.113>The thane of Cawdor lives: why do you dress me</A><br> +<A NAME=1.3.114>In borrow'd robes?</A><br> +</blockquote> + +<A NAME=speech40><b>ANGUS</b></a> +<blockquote> +<A NAME=1.3.115> Who was the thane lives yet;</A><br> +<A NAME=1.3.116>But under heavy judgment bears that life</A><br> +<A NAME=1.3.117>Which he deserves to lose. Whether he was combined</A><br> +<A NAME=1.3.118>With those of Norway, or did line the rebel</A><br> +<A NAME=1.3.119>With hidden help and vantage, or that with both</A><br> +<A NAME=1.3.120>He labour'd in his country's wreck, I know not;</A><br> +<A NAME=1.3.121>But treasons capital, confess'd and proved,</A><br> +<A NAME=1.3.122>Have overthrown him.</A><br> +</blockquote> + +<A NAME=speech41><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.123>[Aside] Glamis, and thane of Cawdor!</A><br> +<A NAME=1.3.124>The greatest is behind.</A><br> +<p><i>To ROSS and ANGUS</i></p> +<A NAME=1.3.125>Thanks for your pains.</A><br> +<p><i>To BANQUO</i></p> +<A NAME=1.3.126>Do you not hope your children shall be kings,</A><br> +<A NAME=1.3.127>When those that gave the thane of Cawdor to me</A><br> +<A NAME=1.3.128>Promised no less to them?</A><br> +</blockquote> + +<A NAME=speech42><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.129>That trusted home</A><br> +<A NAME=1.3.130>Might yet enkindle you unto the crown,</A><br> +<A NAME=1.3.131>Besides the thane of Cawdor. But 'tis strange:</A><br> +<A NAME=1.3.132>And oftentimes, to win us to our harm,</A><br> +<A NAME=1.3.133>The instruments of darkness tell us truths,</A><br> +<A NAME=1.3.134>Win us with honest trifles, to betray's</A><br> +<A NAME=1.3.135>In deepest consequence.</A><br> +<A NAME=1.3.136>Cousins, a word, I pray you.</A><br> +</blockquote> + +<A NAME=speech43><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.137>[Aside] Two truths are told,</A><br> +<A NAME=1.3.138>As happy prologues to the swelling act</A><br> +<A NAME=1.3.139>Of the imperial theme.--I thank you, gentlemen.</A><br> +<p><i>Aside</i></p> +<A NAME=1.3.140>Cannot be ill, cannot be good: if ill,</A><br> +<A NAME=1.3.141>Why hath it given me earnest of success,</A><br> +<A NAME=1.3.142>Commencing in a truth? I am thane of Cawdor:</A><br> +<A NAME=1.3.143>If good, why do I yield to that suggestion</A><br> +<A NAME=1.3.144>Whose horrid image doth unfix my hair</A><br> +<A NAME=1.3.145>And make my seated heart knock at my ribs,</A><br> +<A NAME=1.3.146>Against the use of nature? Present fears</A><br> +<A NAME=1.3.147>Are less than horrible imaginings:</A><br> +<A NAME=1.3.148>My thought, whose murder yet is but fantastical,</A><br> +<A NAME=1.3.149>Shakes so my single state of man that function</A><br> +<A NAME=1.3.150>Is smother'd in surmise, and nothing is</A><br> +<A NAME=1.3.151>But what is not.</A><br> +</blockquote> + +<A NAME=speech44><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.152> Look, how our partner's rapt.</A><br> +</blockquote> + +<A NAME=speech45><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.153>[Aside] If chance will have me king, why, chance may crown me,</A><br> +<A NAME=1.3.154>Without my stir.</A><br> +</blockquote> + +<A NAME=speech46><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.155> New horrors come upon him,</A><br> +<A NAME=1.3.156>Like our strange garments, cleave not to their mould</A><br> +<A NAME=1.3.157>But with the aid of use.</A><br> +</blockquote> + +<A NAME=speech47><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.158>[Aside] Come what come may,</A><br> +<A NAME=1.3.159>Time and the hour runs through the roughest day.</A><br> +</blockquote> + +<A NAME=speech48><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.160>Worthy Macbeth, we stay upon your leisure.</A><br> +</blockquote> + +<A NAME=speech49><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.161>Give me your favour: my dull brain was wrought</A><br> +<A NAME=1.3.162>With things forgotten. Kind gentlemen, your pains</A><br> +<A NAME=1.3.163>Are register'd where every day I turn</A><br> +<A NAME=1.3.164>The leaf to read them. Let us toward the king.</A><br> +<A NAME=1.3.165>Think upon what hath chanced, and, at more time,</A><br> +<A NAME=1.3.166>The interim having weigh'd it, let us speak</A><br> +<A NAME=1.3.167>Our free hearts each to other.</A><br> +</blockquote> + +<A NAME=speech50><b>BANQUO</b></a> +<blockquote> +<A NAME=1.3.168>Very gladly.</A><br> +</blockquote> + +<A NAME=speech51><b>MACBETH</b></a> +<blockquote> +<A NAME=1.3.169>Till then, enough. Come, friends.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE IV. Forres. The palace.</h3> +<p><blockquote> +<i>Flourish. Enter DUNCAN, MALCOLM, DONALBAIN, LENNOX, and Attendants</i> +</blockquote> + +<A NAME=speech1><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.1>Is execution done on Cawdor? Are not</A><br> +<A NAME=1.4.2>Those in commission yet return'd?</A><br> +</blockquote> + +<A NAME=speech2><b>MALCOLM</b></a> +<blockquote> +<A NAME=1.4.3>My liege,</A><br> +<A NAME=1.4.4>They are not yet come back. But I have spoke</A><br> +<A NAME=1.4.5>With one that saw him die: who did report</A><br> +<A NAME=1.4.6>That very frankly he confess'd his treasons,</A><br> +<A NAME=1.4.7>Implored your highness' pardon and set forth</A><br> +<A NAME=1.4.8>A deep repentance: nothing in his life</A><br> +<A NAME=1.4.9>Became him like the leaving it; he died</A><br> +<A NAME=1.4.10>As one that had been studied in his death</A><br> +<A NAME=1.4.11>To throw away the dearest thing he owed,</A><br> +<A NAME=1.4.12>As 'twere a careless trifle.</A><br> +</blockquote> + +<A NAME=speech3><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.13>There's no art</A><br> +<A NAME=1.4.14>To find the mind's construction in the face:</A><br> +<A NAME=1.4.15>He was a gentleman on whom I built</A><br> +<A NAME=1.4.16>An absolute trust.</A><br> +<p><i>Enter MACBETH, BANQUO, ROSS, and ANGUS</i></p> +<A NAME=1.4.17>O worthiest cousin!</A><br> +<A NAME=1.4.18>The sin of my ingratitude even now</A><br> +<A NAME=1.4.19>Was heavy on me: thou art so far before</A><br> +<A NAME=1.4.20>That swiftest wing of recompense is slow</A><br> +<A NAME=1.4.21>To overtake thee. Would thou hadst less deserved,</A><br> +<A NAME=1.4.22>That the proportion both of thanks and payment</A><br> +<A NAME=1.4.23>Might have been mine! only I have left to say,</A><br> +<A NAME=1.4.24>More is thy due than more than all can pay.</A><br> +</blockquote> + +<A NAME=speech4><b>MACBETH</b></a> +<blockquote> +<A NAME=1.4.25>The service and the loyalty I owe,</A><br> +<A NAME=1.4.26>In doing it, pays itself. Your highness' part</A><br> +<A NAME=1.4.27>Is to receive our duties; and our duties</A><br> +<A NAME=1.4.28>Are to your throne and state children and servants,</A><br> +<A NAME=1.4.29>Which do but what they should, by doing every thing</A><br> +<A NAME=1.4.30>Safe toward your love and honour.</A><br> +</blockquote> + +<A NAME=speech5><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.31>Welcome hither:</A><br> +<A NAME=1.4.32>I have begun to plant thee, and will labour</A><br> +<A NAME=1.4.33>To make thee full of growing. Noble Banquo,</A><br> +<A NAME=1.4.34>That hast no less deserved, nor must be known</A><br> +<A NAME=1.4.35>No less to have done so, let me enfold thee</A><br> +<A NAME=1.4.36>And hold thee to my heart.</A><br> +</blockquote> + +<A NAME=speech6><b>BANQUO</b></a> +<blockquote> +<A NAME=1.4.37>There if I grow,</A><br> +<A NAME=1.4.38>The harvest is your own.</A><br> +</blockquote> + +<A NAME=speech7><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.39>My plenteous joys,</A><br> +<A NAME=1.4.40>Wanton in fulness, seek to hide themselves</A><br> +<A NAME=1.4.41>In drops of sorrow. Sons, kinsmen, thanes,</A><br> +<A NAME=1.4.42>And you whose places are the nearest, know</A><br> +<A NAME=1.4.43>We will establish our estate upon</A><br> +<A NAME=1.4.44>Our eldest, Malcolm, whom we name hereafter</A><br> +<A NAME=1.4.45>The Prince of Cumberland; which honour must</A><br> +<A NAME=1.4.46>Not unaccompanied invest him only,</A><br> +<A NAME=1.4.47>But signs of nobleness, like stars, shall shine</A><br> +<A NAME=1.4.48>On all deservers. From hence to Inverness,</A><br> +<A NAME=1.4.49>And bind us further to you.</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=1.4.50>The rest is labour, which is not used for you:</A><br> +<A NAME=1.4.51>I'll be myself the harbinger and make joyful</A><br> +<A NAME=1.4.52>The hearing of my wife with your approach;</A><br> +<A NAME=1.4.53>So humbly take my leave.</A><br> +</blockquote> + +<A NAME=speech9><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.54>My worthy Cawdor!</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=1.4.55>[Aside] The Prince of Cumberland! that is a step</A><br> +<A NAME=1.4.56>On which I must fall down, or else o'erleap,</A><br> +<A NAME=1.4.57>For in my way it lies. Stars, hide your fires;</A><br> +<A NAME=1.4.58>Let not light see my black and deep desires:</A><br> +<A NAME=1.4.59>The eye wink at the hand; yet let that be,</A><br> +<A NAME=1.4.60>Which the eye fears, when it is done, to see.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech11><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.4.61>True, worthy Banquo; he is full so valiant,</A><br> +<A NAME=1.4.62>And in his commendations I am fed;</A><br> +<A NAME=1.4.63>It is a banquet to me. Let's after him,</A><br> +<A NAME=1.4.64>Whose care is gone before to bid us welcome:</A><br> +<A NAME=1.4.65>It is a peerless kinsman.</A><br> +<p><i>Flourish. Exeunt</i></p> +</blockquote> +<h3>SCENE V. Inverness. Macbeth's castle.</h3> +<p><blockquote> +<i>Enter LADY MACBETH, reading a letter</i> +</blockquote> + +<A NAME=speech1><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.1>'They met me in the day of success: and I have</A><br> +<A NAME=1.5.2>learned by the perfectest report, they have more in</A><br> +<A NAME=1.5.3>them than mortal knowledge. When I burned in desire</A><br> +<A NAME=1.5.4>to question them further, they made themselves air,</A><br> +<A NAME=1.5.5>into which they vanished. Whiles I stood rapt in</A><br> +<A NAME=1.5.6>the wonder of it, came missives from the king, who</A><br> +<A NAME=1.5.7>all-hailed me 'Thane of Cawdor;' by which title,</A><br> +<A NAME=1.5.8>before, these weird sisters saluted me, and referred</A><br> +<A NAME=1.5.9>me to the coming on of time, with 'Hail, king that</A><br> +<A NAME=1.5.10>shalt be!' This have I thought good to deliver</A><br> +<A NAME=1.5.11>thee, my dearest partner of greatness, that thou</A><br> +<A NAME=1.5.12>mightst not lose the dues of rejoicing, by being</A><br> +<A NAME=1.5.13>ignorant of what greatness is promised thee. Lay it</A><br> +<A NAME=1.5.14>to thy heart, and farewell.'</A><br> +<A NAME=1.5.15>Glamis thou art, and Cawdor; and shalt be</A><br> +<A NAME=1.5.16>What thou art promised: yet do I fear thy nature;</A><br> +<A NAME=1.5.17>It is too full o' the milk of human kindness</A><br> +<A NAME=1.5.18>To catch the nearest way: thou wouldst be great;</A><br> +<A NAME=1.5.19>Art not without ambition, but without</A><br> +<A NAME=1.5.20>The illness should attend it: what thou wouldst highly,</A><br> +<A NAME=1.5.21>That wouldst thou holily; wouldst not play false,</A><br> +<A NAME=1.5.22>And yet wouldst wrongly win: thou'ldst have, great Glamis,</A><br> +<A NAME=1.5.23>That which cries 'Thus thou must do, if thou have it;</A><br> +<A NAME=1.5.24>And that which rather thou dost fear to do</A><br> +<A NAME=1.5.25>Than wishest should be undone.' Hie thee hither,</A><br> +<A NAME=1.5.26>That I may pour my spirits in thine ear;</A><br> +<A NAME=1.5.27>And chastise with the valour of my tongue</A><br> +<A NAME=1.5.28>All that impedes thee from the golden round,</A><br> +<A NAME=1.5.29>Which fate and metaphysical aid doth seem</A><br> +<A NAME=1.5.30>To have thee crown'd withal.</A><br> +<p><i>Enter a Messenger</i></p> +<A NAME=1.5.31>What is your tidings?</A><br> +</blockquote> + +<A NAME=speech2><b>Messenger</b></a> +<blockquote> +<A NAME=1.5.32>The king comes here to-night.</A><br> +</blockquote> + +<A NAME=speech3><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.33>Thou'rt mad to say it:</A><br> +<A NAME=1.5.34>Is not thy master with him? who, were't so,</A><br> +<A NAME=1.5.35>Would have inform'd for preparation.</A><br> +</blockquote> + +<A NAME=speech4><b>Messenger</b></a> +<blockquote> +<A NAME=1.5.36>So please you, it is true: our thane is coming:</A><br> +<A NAME=1.5.37>One of my fellows had the speed of him,</A><br> +<A NAME=1.5.38>Who, almost dead for breath, had scarcely more</A><br> +<A NAME=1.5.39>Than would make up his message.</A><br> +</blockquote> + +<A NAME=speech5><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.40>Give him tending;</A><br> +<A NAME=1.5.41>He brings great news.</A><br> +<p><i>Exit Messenger</i></p> +<A NAME=1.5.42>The raven himself is hoarse</A><br> +<A NAME=1.5.43>That croaks the fatal entrance of Duncan</A><br> +<A NAME=1.5.44>Under my battlements. Come, you spirits</A><br> +<A NAME=1.5.45>That tend on mortal thoughts, unsex me here,</A><br> +<A NAME=1.5.46>And fill me from the crown to the toe top-full</A><br> +<A NAME=1.5.47>Of direst cruelty! make thick my blood;</A><br> +<A NAME=1.5.48>Stop up the access and passage to remorse,</A><br> +<A NAME=1.5.49>That no compunctious visitings of nature</A><br> +<A NAME=1.5.50>Shake my fell purpose, nor keep peace between</A><br> +<A NAME=1.5.51>The effect and it! Come to my woman's breasts,</A><br> +<A NAME=1.5.52>And take my milk for gall, you murdering ministers,</A><br> +<A NAME=1.5.53>Wherever in your sightless substances</A><br> +<A NAME=1.5.54>You wait on nature's mischief! Come, thick night,</A><br> +<A NAME=1.5.55>And pall thee in the dunnest smoke of hell,</A><br> +<A NAME=1.5.56>That my keen knife see not the wound it makes,</A><br> +<A NAME=1.5.57>Nor heaven peep through the blanket of the dark,</A><br> +<A NAME=1.5.58>To cry 'Hold, hold!'</A><br> +<p><i>Enter MACBETH</i></p> +<A NAME=1.5.59>Great Glamis! worthy Cawdor!</A><br> +<A NAME=1.5.60>Greater than both, by the all-hail hereafter!</A><br> +<A NAME=1.5.61>Thy letters have transported me beyond</A><br> +<A NAME=1.5.62>This ignorant present, and I feel now</A><br> +<A NAME=1.5.63>The future in the instant.</A><br> +</blockquote> + +<A NAME=speech6><b>MACBETH</b></a> +<blockquote> +<A NAME=1.5.64>My dearest love,</A><br> +<A NAME=1.5.65>Duncan comes here to-night.</A><br> +</blockquote> + +<A NAME=speech7><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.66>And when goes hence?</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=1.5.67>To-morrow, as he purposes.</A><br> +</blockquote> + +<A NAME=speech9><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.68>O, never</A><br> +<A NAME=1.5.69>Shall sun that morrow see!</A><br> +<A NAME=1.5.70>Your face, my thane, is as a book where men</A><br> +<A NAME=1.5.71>May read strange matters. To beguile the time,</A><br> +<A NAME=1.5.72>Look like the time; bear welcome in your eye,</A><br> +<A NAME=1.5.73>Your hand, your tongue: look like the innocent flower,</A><br> +<A NAME=1.5.74>But be the serpent under't. He that's coming</A><br> +<A NAME=1.5.75>Must be provided for: and you shall put</A><br> +<A NAME=1.5.76>This night's great business into my dispatch;</A><br> +<A NAME=1.5.77>Which shall to all our nights and days to come</A><br> +<A NAME=1.5.78>Give solely sovereign sway and masterdom.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=1.5.79>We will speak further.</A><br> +</blockquote> + +<A NAME=speech11><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.5.80>Only look up clear;</A><br> +<A NAME=1.5.81>To alter favour ever is to fear:</A><br> +<A NAME=1.5.82>Leave all the rest to me.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE VI. Before Macbeth's castle.</h3> +<p><blockquote> +<i>Hautboys and torches. Enter DUNCAN, MALCOLM, DONALBAIN, BANQUO, LENNOX, MACDUFF, ROSS, ANGUS, and Attendants</i> +</blockquote> + +<A NAME=speech1><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.6.1>This castle hath a pleasant seat; the air</A><br> +<A NAME=1.6.2>Nimbly and sweetly recommends itself</A><br> +<A NAME=1.6.3>Unto our gentle senses.</A><br> +</blockquote> + +<A NAME=speech2><b>BANQUO</b></a> +<blockquote> +<A NAME=1.6.4>This guest of summer,</A><br> +<A NAME=1.6.5>The temple-haunting martlet, does approve,</A><br> +<A NAME=1.6.6>By his loved mansionry, that the heaven's breath</A><br> +<A NAME=1.6.7>Smells wooingly here: no jutty, frieze,</A><br> +<A NAME=1.6.8>Buttress, nor coign of vantage, but this bird</A><br> +<A NAME=1.6.9>Hath made his pendent bed and procreant cradle:</A><br> +<A NAME=1.6.10>Where they most breed and haunt, I have observed,</A><br> +<A NAME=1.6.11>The air is delicate.</A><br> +<p><i>Enter LADY MACBETH</i></p> +</blockquote> + +<A NAME=speech3><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.6.12>See, see, our honour'd hostess!</A><br> +<A NAME=1.6.13>The love that follows us sometime is our trouble,</A><br> +<A NAME=1.6.14>Which still we thank as love. Herein I teach you</A><br> +<A NAME=1.6.15>How you shall bid God 'ild us for your pains,</A><br> +<A NAME=1.6.16>And thank us for your trouble.</A><br> +</blockquote> + +<A NAME=speech4><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.6.17>All our service</A><br> +<A NAME=1.6.18>In every point twice done and then done double</A><br> +<A NAME=1.6.19>Were poor and single business to contend</A><br> +<A NAME=1.6.20>Against those honours deep and broad wherewith</A><br> +<A NAME=1.6.21>Your majesty loads our house: for those of old,</A><br> +<A NAME=1.6.22>And the late dignities heap'd up to them,</A><br> +<A NAME=1.6.23>We rest your hermits.</A><br> +</blockquote> + +<A NAME=speech5><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.6.24>Where's the thane of Cawdor?</A><br> +<A NAME=1.6.25>We coursed him at the heels, and had a purpose</A><br> +<A NAME=1.6.26>To be his purveyor: but he rides well;</A><br> +<A NAME=1.6.27>And his great love, sharp as his spur, hath holp him</A><br> +<A NAME=1.6.28>To his home before us. Fair and noble hostess,</A><br> +<A NAME=1.6.29>We are your guest to-night.</A><br> +</blockquote> + +<A NAME=speech6><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.6.30>Your servants ever</A><br> +<A NAME=1.6.31>Have theirs, themselves and what is theirs, in compt,</A><br> +<A NAME=1.6.32>To make their audit at your highness' pleasure,</A><br> +<A NAME=1.6.33>Still to return your own.</A><br> +</blockquote> + +<A NAME=speech7><b>DUNCAN</b></a> +<blockquote> +<A NAME=1.6.34>Give me your hand;</A><br> +<A NAME=1.6.35>Conduct me to mine host: we love him highly,</A><br> +<A NAME=1.6.36>And shall continue our graces towards him.</A><br> +<A NAME=1.6.37>By your leave, hostess.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE VII. Macbeth's castle.</h3> +<p><blockquote> +<i>Hautboys and torches. Enter a Sewer, and divers Servants with dishes and service, and pass over the stage. Then enter MACBETH</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.1>If it were done when 'tis done, then 'twere well</A><br> +<A NAME=1.7.2>It were done quickly: if the assassination</A><br> +<A NAME=1.7.3>Could trammel up the consequence, and catch</A><br> +<A NAME=1.7.4>With his surcease success; that but this blow</A><br> +<A NAME=1.7.5>Might be the be-all and the end-all here,</A><br> +<A NAME=1.7.6>But here, upon this bank and shoal of time,</A><br> +<A NAME=1.7.7>We'ld jump the life to come. But in these cases</A><br> +<A NAME=1.7.8>We still have judgment here; that we but teach</A><br> +<A NAME=1.7.9>Bloody instructions, which, being taught, return</A><br> +<A NAME=1.7.10>To plague the inventor: this even-handed justice</A><br> +<A NAME=1.7.11>Commends the ingredients of our poison'd chalice</A><br> +<A NAME=1.7.12>To our own lips. He's here in double trust;</A><br> +<A NAME=1.7.13>First, as I am his kinsman and his subject,</A><br> +<A NAME=1.7.14>Strong both against the deed; then, as his host,</A><br> +<A NAME=1.7.15>Who should against his murderer shut the door,</A><br> +<A NAME=1.7.16>Not bear the knife myself. Besides, this Duncan</A><br> +<A NAME=1.7.17>Hath borne his faculties so meek, hath been</A><br> +<A NAME=1.7.18>So clear in his great office, that his virtues</A><br> +<A NAME=1.7.19>Will plead like angels, trumpet-tongued, against</A><br> +<A NAME=1.7.20>The deep damnation of his taking-off;</A><br> +<A NAME=1.7.21>And pity, like a naked new-born babe,</A><br> +<A NAME=1.7.22>Striding the blast, or heaven's cherubim, horsed</A><br> +<A NAME=1.7.23>Upon the sightless couriers of the air,</A><br> +<A NAME=1.7.24>Shall blow the horrid deed in every eye,</A><br> +<A NAME=1.7.25>That tears shall drown the wind. I have no spur</A><br> +<A NAME=1.7.26>To prick the sides of my intent, but only</A><br> +<A NAME=1.7.27>Vaulting ambition, which o'erleaps itself</A><br> +<A NAME=1.7.28>And falls on the other.</A><br> +<p><i>Enter LADY MACBETH</i></p> +<A NAME=1.7.29>How now! what news?</A><br> +</blockquote> + +<A NAME=speech2><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.30>He has almost supp'd: why have you left the chamber?</A><br> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.31>Hath he ask'd for me?</A><br> +</blockquote> + +<A NAME=speech4><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.32>Know you not he has?</A><br> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.33>We will proceed no further in this business:</A><br> +<A NAME=1.7.34>He hath honour'd me of late; and I have bought</A><br> +<A NAME=1.7.35>Golden opinions from all sorts of people,</A><br> +<A NAME=1.7.36>Which would be worn now in their newest gloss,</A><br> +<A NAME=1.7.37>Not cast aside so soon.</A><br> +</blockquote> + +<A NAME=speech6><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.38>Was the hope drunk</A><br> +<A NAME=1.7.39>Wherein you dress'd yourself? hath it slept since?</A><br> +<A NAME=1.7.40>And wakes it now, to look so green and pale</A><br> +<A NAME=1.7.41>At what it did so freely? From this time</A><br> +<A NAME=1.7.42>Such I account thy love. Art thou afeard</A><br> +<A NAME=1.7.43>To be the same in thine own act and valour</A><br> +<A NAME=1.7.44>As thou art in desire? Wouldst thou have that</A><br> +<A NAME=1.7.45>Which thou esteem'st the ornament of life,</A><br> +<A NAME=1.7.46>And live a coward in thine own esteem,</A><br> +<A NAME=1.7.47>Letting 'I dare not' wait upon 'I would,'</A><br> +<A NAME=1.7.48>Like the poor cat i' the adage?</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.49>Prithee, peace:</A><br> +<A NAME=1.7.50>I dare do all that may become a man;</A><br> +<A NAME=1.7.51>Who dares do more is none.</A><br> +</blockquote> + +<A NAME=speech8><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.52>What beast was't, then,</A><br> +<A NAME=1.7.53>That made you break this enterprise to me?</A><br> +<A NAME=1.7.54>When you durst do it, then you were a man;</A><br> +<A NAME=1.7.55>And, to be more than what you were, you would</A><br> +<A NAME=1.7.56>Be so much more the man. Nor time nor place</A><br> +<A NAME=1.7.57>Did then adhere, and yet you would make both:</A><br> +<A NAME=1.7.58>They have made themselves, and that their fitness now</A><br> +<A NAME=1.7.59>Does unmake you. I have given suck, and know</A><br> +<A NAME=1.7.60>How tender 'tis to love the babe that milks me:</A><br> +<A NAME=1.7.61>I would, while it was smiling in my face,</A><br> +<A NAME=1.7.62>Have pluck'd my nipple from his boneless gums,</A><br> +<A NAME=1.7.63>And dash'd the brains out, had I so sworn as you</A><br> +<A NAME=1.7.64>Have done to this.</A><br> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.65> If we should fail?</A><br> +</blockquote> + +<A NAME=speech10><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.66>We fail!</A><br> +<A NAME=1.7.67>But screw your courage to the sticking-place,</A><br> +<A NAME=1.7.68>And we'll not fail. When Duncan is asleep--</A><br> +<A NAME=1.7.69>Whereto the rather shall his day's hard journey</A><br> +<A NAME=1.7.70>Soundly invite him--his two chamberlains</A><br> +<A NAME=1.7.71>Will I with wine and wassail so convince</A><br> +<A NAME=1.7.72>That memory, the warder of the brain,</A><br> +<A NAME=1.7.73>Shall be a fume, and the receipt of reason</A><br> +<A NAME=1.7.74>A limbeck only: when in swinish sleep</A><br> +<A NAME=1.7.75>Their drenched natures lie as in a death,</A><br> +<A NAME=1.7.76>What cannot you and I perform upon</A><br> +<A NAME=1.7.77>The unguarded Duncan? what not put upon</A><br> +<A NAME=1.7.78>His spongy officers, who shall bear the guilt</A><br> +<A NAME=1.7.79>Of our great quell?</A><br> +</blockquote> + +<A NAME=speech11><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.80>Bring forth men-children only;</A><br> +<A NAME=1.7.81>For thy undaunted mettle should compose</A><br> +<A NAME=1.7.82>Nothing but males. Will it not be received,</A><br> +<A NAME=1.7.83>When we have mark'd with blood those sleepy two</A><br> +<A NAME=1.7.84>Of his own chamber and used their very daggers,</A><br> +<A NAME=1.7.85>That they have done't?</A><br> +</blockquote> + +<A NAME=speech12><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=1.7.86>Who dares receive it other,</A><br> +<A NAME=1.7.87>As we shall make our griefs and clamour roar</A><br> +<A NAME=1.7.88>Upon his death?</A><br> +</blockquote> + +<A NAME=speech13><b>MACBETH</b></a> +<blockquote> +<A NAME=1.7.89> I am settled, and bend up</A><br> +<A NAME=1.7.90>Each corporal agent to this terrible feat.</A><br> +<A NAME=1.7.91>Away, and mock the time with fairest show:</A><br> +<A NAME=1.7.92>False face must hide what the false heart doth know.</A><br> +<p><i>Exeunt</i></p> +</blockquote><p> +<H3>ACT II</h3> +<h3>SCENE I. Court of Macbeth's castle.</h3> +<p><blockquote> +<i>Enter BANQUO, and FLEANCE bearing a torch before him</i> +</blockquote> + +<A NAME=speech1><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.1>How goes the night, boy?</A><br> +</blockquote> + +<A NAME=speech2><b>FLEANCE</b></a> +<blockquote> +<A NAME=2.1.2>The moon is down; I have not heard the clock.</A><br> +</blockquote> + +<A NAME=speech3><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.3>And she goes down at twelve.</A><br> +</blockquote> + +<A NAME=speech4><b>FLEANCE</b></a> +<blockquote> +<A NAME=2.1.4>I take't, 'tis later, sir.</A><br> +</blockquote> + +<A NAME=speech5><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.5>Hold, take my sword. There's husbandry in heaven;</A><br> +<A NAME=2.1.6>Their candles are all out. Take thee that too.</A><br> +<A NAME=2.1.7>A heavy summons lies like lead upon me,</A><br> +<A NAME=2.1.8>And yet I would not sleep: merciful powers,</A><br> +<A NAME=2.1.9>Restrain in me the cursed thoughts that nature</A><br> +<A NAME=2.1.10>Gives way to in repose!</A><br> +<p><i>Enter MACBETH, and a Servant with a torch</i></p> +<A NAME=2.1.11>Give me my sword.</A><br> +<A NAME=2.1.12>Who's there?</A><br> +</blockquote> + +<A NAME=speech6><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.13>A friend.</A><br> +</blockquote> + +<A NAME=speech7><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.14>What, sir, not yet at rest? The king's a-bed:</A><br> +<A NAME=2.1.15>He hath been in unusual pleasure, and</A><br> +<A NAME=2.1.16>Sent forth great largess to your offices.</A><br> +<A NAME=2.1.17>This diamond he greets your wife withal,</A><br> +<A NAME=2.1.18>By the name of most kind hostess; and shut up</A><br> +<A NAME=2.1.19>In measureless content.</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.20>Being unprepared,</A><br> +<A NAME=2.1.21>Our will became the servant to defect;</A><br> +<A NAME=2.1.22>Which else should free have wrought.</A><br> +</blockquote> + +<A NAME=speech9><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.23>All's well.</A><br> +<A NAME=2.1.24>I dreamt last night of the three weird sisters:</A><br> +<A NAME=2.1.25>To you they have show'd some truth.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.26>I think not of them:</A><br> +<A NAME=2.1.27>Yet, when we can entreat an hour to serve,</A><br> +<A NAME=2.1.28>We would spend it in some words upon that business,</A><br> +<A NAME=2.1.29>If you would grant the time.</A><br> +</blockquote> + +<A NAME=speech11><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.30>At your kind'st leisure.</A><br> +</blockquote> + +<A NAME=speech12><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.31>If you shall cleave to my consent, when 'tis,</A><br> +<A NAME=2.1.32>It shall make honour for you.</A><br> +</blockquote> + +<A NAME=speech13><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.33>So I lose none</A><br> +<A NAME=2.1.34>In seeking to augment it, but still keep</A><br> +<A NAME=2.1.35>My bosom franchised and allegiance clear,</A><br> +<A NAME=2.1.36>I shall be counsell'd.</A><br> +</blockquote> + +<A NAME=speech14><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.37>Good repose the while!</A><br> +</blockquote> + +<A NAME=speech15><b>BANQUO</b></a> +<blockquote> +<A NAME=2.1.38>Thanks, sir: the like to you!</A><br> +<p><i>Exeunt BANQUO and FLEANCE</i></p> +</blockquote> + +<A NAME=speech16><b>MACBETH</b></a> +<blockquote> +<A NAME=2.1.39>Go bid thy mistress, when my drink is ready,</A><br> +<A NAME=2.1.40>She strike upon the bell. Get thee to bed.</A><br> +<p><i>Exit Servant</i></p> +<A NAME=2.1.41>Is this a dagger which I see before me,</A><br> +<A NAME=2.1.42>The handle toward my hand? Come, let me clutch thee.</A><br> +<A NAME=2.1.43>I have thee not, and yet I see thee still.</A><br> +<A NAME=2.1.44>Art thou not, fatal vision, sensible</A><br> +<A NAME=2.1.45>To feeling as to sight? or art thou but</A><br> +<A NAME=2.1.46>A dagger of the mind, a false creation,</A><br> +<A NAME=2.1.47>Proceeding from the heat-oppressed brain?</A><br> +<A NAME=2.1.48>I see thee yet, in form as palpable</A><br> +<A NAME=2.1.49>As this which now I draw.</A><br> +<A NAME=2.1.50>Thou marshall'st me the way that I was going;</A><br> +<A NAME=2.1.51>And such an instrument I was to use.</A><br> +<A NAME=2.1.52>Mine eyes are made the fools o' the other senses,</A><br> +<A NAME=2.1.53>Or else worth all the rest; I see thee still,</A><br> +<A NAME=2.1.54>And on thy blade and dudgeon gouts of blood,</A><br> +<A NAME=2.1.55>Which was not so before. There's no such thing:</A><br> +<A NAME=2.1.56>It is the bloody business which informs</A><br> +<A NAME=2.1.57>Thus to mine eyes. Now o'er the one halfworld</A><br> +<A NAME=2.1.58>Nature seems dead, and wicked dreams abuse</A><br> +<A NAME=2.1.59>The curtain'd sleep; witchcraft celebrates</A><br> +<A NAME=2.1.60>Pale Hecate's offerings, and wither'd murder,</A><br> +<A NAME=2.1.61>Alarum'd by his sentinel, the wolf,</A><br> +<A NAME=2.1.62>Whose howl's his watch, thus with his stealthy pace.</A><br> +<A NAME=2.1.63>With Tarquin's ravishing strides, towards his design</A><br> +<A NAME=2.1.64>Moves like a ghost. Thou sure and firm-set earth,</A><br> +<A NAME=2.1.65>Hear not my steps, which way they walk, for fear</A><br> +<A NAME=2.1.66>Thy very stones prate of my whereabout,</A><br> +<A NAME=2.1.67>And take the present horror from the time,</A><br> +<A NAME=2.1.68>Which now suits with it. Whiles I threat, he lives:</A><br> +<A NAME=2.1.69>Words to the heat of deeds too cold breath gives.</A><br> +<p><i>A bell rings</i></p> +<A NAME=2.1.70>I go, and it is done; the bell invites me.</A><br> +<A NAME=2.1.71>Hear it not, Duncan; for it is a knell</A><br> +<A NAME=2.1.72>That summons thee to heaven or to hell.</A><br> +<p><i>Exit</i></p> +</blockquote> +<h3>SCENE II. The same.</h3> +<p><blockquote> +<i>Enter LADY MACBETH</i> +</blockquote> + +<A NAME=speech1><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.1>That which hath made them drunk hath made me bold;</A><br> +<A NAME=2.2.2>What hath quench'd them hath given me fire.</A><br> +<A NAME=2.2.3>Hark! Peace!</A><br> +<A NAME=2.2.4>It was the owl that shriek'd, the fatal bellman,</A><br> +<A NAME=2.2.5>Which gives the stern'st good-night. He is about it:</A><br> +<A NAME=2.2.6>The doors are open; and the surfeited grooms</A><br> +<A NAME=2.2.7>Do mock their charge with snores: I have drugg'd</A><br> +<A NAME=2.2.8>their possets,</A><br> +<A NAME=2.2.9>That death and nature do contend about them,</A><br> +<A NAME=2.2.10>Whether they live or die.</A><br> +</blockquote> + +<A NAME=speech2><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.11>[Within] Who's there? what, ho!</A><br> +</blockquote> + +<A NAME=speech3><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.12>Alack, I am afraid they have awaked,</A><br> +<A NAME=2.2.13>And 'tis not done. The attempt and not the deed</A><br> +<A NAME=2.2.14>Confounds us. Hark! I laid their daggers ready;</A><br> +<A NAME=2.2.15>He could not miss 'em. Had he not resembled</A><br> +<A NAME=2.2.16>My father as he slept, I had done't.</A><br> +<p><i>Enter MACBETH</i></p> +<A NAME=2.2.17>My husband!</A><br> +</blockquote> + +<A NAME=speech4><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.18>I have done the deed. Didst thou not hear a noise?</A><br> +</blockquote> + +<A NAME=speech5><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.19>I heard the owl scream and the crickets cry.</A><br> +<A NAME=2.2.20>Did not you speak?</A><br> +</blockquote> + +<A NAME=speech6><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.21> When?</A><br> +</blockquote> + +<A NAME=speech7><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.22>Now.</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.23>As I descended?</A><br> +</blockquote> + +<A NAME=speech9><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.24>Ay.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.25>Hark!</A><br> +<A NAME=2.2.26>Who lies i' the second chamber?</A><br> +</blockquote> + +<A NAME=speech11><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.27>Donalbain.</A><br> +</blockquote> + +<A NAME=speech12><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.28>This is a sorry sight.</A><br> +<p><i>Looking on his hands</i></p> +</blockquote> + +<A NAME=speech13><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.29>A foolish thought, to say a sorry sight.</A><br> +</blockquote> + +<A NAME=speech14><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.30>There's one did laugh in's sleep, and one cried</A><br> +<A NAME=2.2.31>'Murder!'</A><br> +<A NAME=2.2.32>That they did wake each other: I stood and heard them:</A><br> +<A NAME=2.2.33>But they did say their prayers, and address'd them</A><br> +<A NAME=2.2.34>Again to sleep.</A><br> +</blockquote> + +<A NAME=speech15><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.35> There are two lodged together.</A><br> +</blockquote> + +<A NAME=speech16><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.36>One cried 'God bless us!' and 'Amen' the other;</A><br> +<A NAME=2.2.37>As they had seen me with these hangman's hands.</A><br> +<A NAME=2.2.38>Listening their fear, I could not say 'Amen,'</A><br> +<A NAME=2.2.39>When they did say 'God bless us!'</A><br> +</blockquote> + +<A NAME=speech17><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.40>Consider it not so deeply.</A><br> +</blockquote> + +<A NAME=speech18><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.41>But wherefore could not I pronounce 'Amen'?</A><br> +<A NAME=2.2.42>I had most need of blessing, and 'Amen'</A><br> +<A NAME=2.2.43>Stuck in my throat.</A><br> +</blockquote> + +<A NAME=speech19><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.44>These deeds must not be thought</A><br> +<A NAME=2.2.45>After these ways; so, it will make us mad.</A><br> +</blockquote> + +<A NAME=speech20><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.46>Methought I heard a voice cry 'Sleep no more!</A><br> +<A NAME=2.2.47>Macbeth does murder sleep', the innocent sleep,</A><br> +<A NAME=2.2.48>Sleep that knits up the ravell'd sleeve of care,</A><br> +<A NAME=2.2.49>The death of each day's life, sore labour's bath,</A><br> +<A NAME=2.2.50>Balm of hurt minds, great nature's second course,</A><br> +<A NAME=2.2.51>Chief nourisher in life's feast,--</A><br> +</blockquote> + +<A NAME=speech21><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.52>What do you mean?</A><br> +</blockquote> + +<A NAME=speech22><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.53>Still it cried 'Sleep no more!' to all the house:</A><br> +<A NAME=2.2.54>'Glamis hath murder'd sleep, and therefore Cawdor</A><br> +<A NAME=2.2.55>Shall sleep no more; Macbeth shall sleep no more.'</A><br> +</blockquote> + +<A NAME=speech23><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.56>Who was it that thus cried? Why, worthy thane,</A><br> +<A NAME=2.2.57>You do unbend your noble strength, to think</A><br> +<A NAME=2.2.58>So brainsickly of things. Go get some water,</A><br> +<A NAME=2.2.59>And wash this filthy witness from your hand.</A><br> +<A NAME=2.2.60>Why did you bring these daggers from the place?</A><br> +<A NAME=2.2.61>They must lie there: go carry them; and smear</A><br> +<A NAME=2.2.62>The sleepy grooms with blood.</A><br> +</blockquote> + +<A NAME=speech24><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.63>I'll go no more:</A><br> +<A NAME=2.2.64>I am afraid to think what I have done;</A><br> +<A NAME=2.2.65>Look on't again I dare not.</A><br> +</blockquote> + +<A NAME=speech25><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.66>Infirm of purpose!</A><br> +<A NAME=2.2.67>Give me the daggers: the sleeping and the dead</A><br> +<A NAME=2.2.68>Are but as pictures: 'tis the eye of childhood</A><br> +<A NAME=2.2.69>That fears a painted devil. If he do bleed,</A><br> +<A NAME=2.2.70>I'll gild the faces of the grooms withal;</A><br> +<A NAME=2.2.71>For it must seem their guilt.</A><br> +<p><i>Exit. Knocking within</i></p> +</blockquote> + +<A NAME=speech26><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.72>Whence is that knocking?</A><br> +<A NAME=2.2.73>How is't with me, when every noise appals me?</A><br> +<A NAME=2.2.74>What hands are here? ha! they pluck out mine eyes.</A><br> +<A NAME=2.2.75>Will all great Neptune's ocean wash this blood</A><br> +<A NAME=2.2.76>Clean from my hand? No, this my hand will rather</A><br> +<A NAME=2.2.77>The multitudinous seas in incarnadine,</A><br> +<A NAME=2.2.78>Making the green one red.</A><br> +<p><i>Re-enter LADY MACBETH</i></p> +</blockquote> + +<A NAME=speech27><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.2.79>My hands are of your colour; but I shame</A><br> +<A NAME=2.2.80>To wear a heart so white.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.2.81>I hear a knocking</A><br> +<A NAME=2.2.82>At the south entry: retire we to our chamber;</A><br> +<A NAME=2.2.83>A little water clears us of this deed:</A><br> +<A NAME=2.2.84>How easy is it, then! Your constancy</A><br> +<A NAME=2.2.85>Hath left you unattended.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.2.86>Hark! more knocking.</A><br> +<A NAME=2.2.87>Get on your nightgown, lest occasion call us,</A><br> +<A NAME=2.2.88>And show us to be watchers. Be not lost</A><br> +<A NAME=2.2.89>So poorly in your thoughts.</A><br> +</blockquote> + +<A NAME=speech28><b>MACBETH</b></a> +<blockquote> +<A NAME=2.2.90>To know my deed, 'twere best not know myself.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.2.91>Wake Duncan with thy knocking! I would thou couldst!</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE III. The same.</h3> +<p><blockquote> +<i>Knocking within. Enter a Porter</i> +</blockquote> + +<A NAME=speech1><b>Porter</b></a> +<blockquote> +<A NAME=2.3.1>Here's a knocking indeed! If a</A><br> +<A NAME=2.3.2>man were porter of hell-gate, he should have</A><br> +<A NAME=2.3.3>old turning the key.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.3.4>Knock,</A><br> +<A NAME=2.3.5>knock, knock! Who's there, i' the name of</A><br> +<A NAME=2.3.6>Beelzebub? Here's a farmer, that hanged</A><br> +<A NAME=2.3.7>himself on the expectation of plenty: come in</A><br> +<A NAME=2.3.8>time; have napkins enow about you; here</A><br> +<A NAME=2.3.9>you'll sweat for't.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.3.10>Knock,</A><br> +<A NAME=2.3.11>knock! Who's there, in the other devil's</A><br> +<A NAME=2.3.12>name? Faith, here's an equivocator, that could</A><br> +<A NAME=2.3.13>swear in both the scales against either scale;</A><br> +<A NAME=2.3.14>who committed treason enough for God's sake,</A><br> +<A NAME=2.3.15>yet could not equivocate to heaven: O, come</A><br> +<A NAME=2.3.16>in, equivocator.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.3.17>Knock,</A><br> +<A NAME=2.3.18>knock, knock! Who's there? Faith, here's an</A><br> +<A NAME=2.3.19>English tailor come hither, for stealing out of</A><br> +<A NAME=2.3.20>a French hose: come in, tailor; here you may</A><br> +<A NAME=2.3.21>roast your goose.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.3.22>Knock,</A><br> +<A NAME=2.3.23>knock; never at quiet! What are you? But</A><br> +<A NAME=2.3.24>this place is too cold for hell. I'll devil-porter</A><br> +<A NAME=2.3.25>it no further: I had thought to have let in</A><br> +<A NAME=2.3.26>some of all professions that go the primrose</A><br> +<A NAME=2.3.27>way to the everlasting bonfire.</A><br> +<p><i>Knocking within</i></p> +<A NAME=2.3.28>Anon, anon! I pray you, remember the porter.</A><br> +<p><i>Opens the gate</i></p> +<p><i>Enter MACDUFF and LENNOX</i></p> +</blockquote> + +<A NAME=speech2><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.29>Was it so late, friend, ere you went to bed,</A><br> +<A NAME=2.3.30>That you do lie so late?</A><br> +</blockquote> + +<A NAME=speech3><b>Porter</b></a> +<blockquote> +<A NAME=2.3.31>'Faith sir, we were carousing till the</A><br> +<A NAME=2.3.32>second cock: and drink, sir, is a great</A><br> +<A NAME=2.3.33>provoker of three things.</A><br> +</blockquote> + +<A NAME=speech4><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.34>What three things does drink especially provoke?</A><br> +</blockquote> + +<A NAME=speech5><b>Porter</b></a> +<blockquote> +<A NAME=2.3.35>Marry, sir, nose-painting, sleep, and</A><br> +<A NAME=2.3.36>urine. Lechery, sir, it provokes, and unprovokes;</A><br> +<A NAME=2.3.37>it provokes the desire, but it takes</A><br> +<A NAME=2.3.38>away the performance: therefore, much drink</A><br> +<A NAME=2.3.39>may be said to be an equivocator with lechery:</A><br> +<A NAME=2.3.40>it makes him, and it mars him; it sets</A><br> +<A NAME=2.3.41>him on, and it takes him off; it persuades him,</A><br> +<A NAME=2.3.42>and disheartens him; makes him stand to, and</A><br> +<A NAME=2.3.43>not stand to; in conclusion, equivocates him</A><br> +<A NAME=2.3.44>in a sleep, and, giving him the lie, leaves him.</A><br> +</blockquote> + +<A NAME=speech6><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.45>I believe drink gave thee the lie last night.</A><br> +</blockquote> + +<A NAME=speech7><b>Porter</b></a> +<blockquote> +<A NAME=2.3.46>That it did, sir, i' the very throat on</A><br> +<A NAME=2.3.47>me: but I requited him for his lie; and, I</A><br> +<A NAME=2.3.48>think, being too strong for him, though he took</A><br> +<A NAME=2.3.49>up my legs sometime, yet I made a shift to cast</A><br> +<A NAME=2.3.50>him.</A><br> +</blockquote> + +<A NAME=speech8><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.51>Is thy master stirring?</A><br> +<p><i>Enter MACBETH</i></p> +<A NAME=2.3.52>Our knocking has awaked him; here he comes.</A><br> +</blockquote> + +<A NAME=speech9><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.53>Good morrow, noble sir.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.54>Good morrow, both.</A><br> +</blockquote> + +<A NAME=speech11><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.55>Is the king stirring, worthy thane?</A><br> +</blockquote> + +<A NAME=speech12><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.56>Not yet.</A><br> +</blockquote> + +<A NAME=speech13><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.57>He did command me to call timely on him:</A><br> +<A NAME=2.3.58>I have almost slipp'd the hour.</A><br> +</blockquote> + +<A NAME=speech14><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.59>I'll bring you to him.</A><br> +</blockquote> + +<A NAME=speech15><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.60>I know this is a joyful trouble to you;</A><br> +<A NAME=2.3.61>But yet 'tis one.</A><br> +</blockquote> + +<A NAME=speech16><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.62>The labour we delight in physics pain.</A><br> +<A NAME=2.3.63>This is the door.</A><br> +</blockquote> + +<A NAME=speech17><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.64> I'll make so bold to call,</A><br> +<A NAME=2.3.65>For 'tis my limited service.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech18><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.66>Goes the king hence to-day?</A><br> +</blockquote> + +<A NAME=speech19><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.67>He does: he did appoint so.</A><br> +</blockquote> + +<A NAME=speech20><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.68>The night has been unruly: where we lay,</A><br> +<A NAME=2.3.69>Our chimneys were blown down; and, as they say,</A><br> +<A NAME=2.3.70>Lamentings heard i' the air; strange screams of death,</A><br> +<A NAME=2.3.71>And prophesying with accents terrible</A><br> +<A NAME=2.3.72>Of dire combustion and confused events</A><br> +<A NAME=2.3.73>New hatch'd to the woeful time: the obscure bird</A><br> +<A NAME=2.3.74>Clamour'd the livelong night: some say, the earth</A><br> +<A NAME=2.3.75>Was feverous and did shake.</A><br> +</blockquote> + +<A NAME=speech21><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.76>'Twas a rough night.</A><br> +</blockquote> + +<A NAME=speech22><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.77>My young remembrance cannot parallel</A><br> +<A NAME=2.3.78>A fellow to it.</A><br> +<p><i>Re-enter MACDUFF</i></p> +</blockquote> + +<A NAME=speech23><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.79>O horror, horror, horror! Tongue nor heart</A><br> +<A NAME=2.3.80>Cannot conceive nor name thee!</A><br> +</blockquote> + +<A NAME=speech24><b>MACBETH</b></a> + +<A NAME=speech25><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.81>What's the matter.</A><br> +</blockquote> + +<A NAME=speech26><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.82>Confusion now hath made his masterpiece!</A><br> +<A NAME=2.3.83>Most sacrilegious murder hath broke ope</A><br> +<A NAME=2.3.84>The Lord's anointed temple, and stole thence</A><br> +<A NAME=2.3.85>The life o' the building!</A><br> +</blockquote> + +<A NAME=speech27><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.86>What is 't you say? the life?</A><br> +</blockquote> + +<A NAME=speech28><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.87>Mean you his majesty?</A><br> +</blockquote> + +<A NAME=speech29><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.88>Approach the chamber, and destroy your sight</A><br> +<A NAME=2.3.89>With a new Gorgon: do not bid me speak;</A><br> +<A NAME=2.3.90>See, and then speak yourselves.</A><br> +<p><i>Exeunt MACBETH and LENNOX</i></p> +<A NAME=2.3.91>Awake, awake!</A><br> +<A NAME=2.3.92>Ring the alarum-bell. Murder and treason!</A><br> +<A NAME=2.3.93>Banquo and Donalbain! Malcolm! awake!</A><br> +<A NAME=2.3.94>Shake off this downy sleep, death's counterfeit,</A><br> +<A NAME=2.3.95>And look on death itself! up, up, and see</A><br> +<A NAME=2.3.96>The great doom's image! Malcolm! Banquo!</A><br> +<A NAME=2.3.97>As from your graves rise up, and walk like sprites,</A><br> +<A NAME=2.3.98>To countenance this horror! Ring the bell.</A><br> +<p><i>Bell rings</i></p> +<p><i>Enter LADY MACBETH</i></p> +</blockquote> + +<A NAME=speech30><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.3.99>What's the business,</A><br> +<A NAME=2.3.100>That such a hideous trumpet calls to parley</A><br> +<A NAME=2.3.101>The sleepers of the house? speak, speak!</A><br> +</blockquote> + +<A NAME=speech31><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.102>O gentle lady,</A><br> +<A NAME=2.3.103>'Tis not for you to hear what I can speak:</A><br> +<A NAME=2.3.104>The repetition, in a woman's ear,</A><br> +<A NAME=2.3.105>Would murder as it fell.</A><br> +<p><i>Enter BANQUO</i></p> +<A NAME=2.3.106>O Banquo, Banquo,</A><br> +<A NAME=2.3.107>Our royal master 's murder'd!</A><br> +</blockquote> + +<A NAME=speech32><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.3.108>Woe, alas!</A><br> +<A NAME=2.3.109>What, in our house?</A><br> +</blockquote> + +<A NAME=speech33><b>BANQUO</b></a> +<blockquote> +<A NAME=2.3.110>Too cruel any where.</A><br> +<A NAME=2.3.111>Dear Duff, I prithee, contradict thyself,</A><br> +<A NAME=2.3.112>And say it is not so.</A><br> +<p><i>Re-enter MACBETH and LENNOX, with ROSS</i></p> +</blockquote> + +<A NAME=speech34><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.113>Had I but died an hour before this chance,</A><br> +<A NAME=2.3.114>I had lived a blessed time; for, from this instant,</A><br> +<A NAME=2.3.115>There 's nothing serious in mortality:</A><br> +<A NAME=2.3.116>All is but toys: renown and grace is dead;</A><br> +<A NAME=2.3.117>The wine of life is drawn, and the mere lees</A><br> +<A NAME=2.3.118>Is left this vault to brag of.</A><br> +<p><i>Enter MALCOLM and DONALBAIN</i></p> +</blockquote> + +<A NAME=speech35><b>DONALBAIN</b></a> +<blockquote> +<A NAME=2.3.119>What is amiss?</A><br> +</blockquote> + +<A NAME=speech36><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.120> You are, and do not know't:</A><br> +<A NAME=2.3.121>The spring, the head, the fountain of your blood</A><br> +<A NAME=2.3.122>Is stopp'd; the very source of it is stopp'd.</A><br> +</blockquote> + +<A NAME=speech37><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.123>Your royal father 's murder'd.</A><br> +</blockquote> + +<A NAME=speech38><b>MALCOLM</b></a> +<blockquote> +<A NAME=2.3.124>O, by whom?</A><br> +</blockquote> + +<A NAME=speech39><b>LENNOX</b></a> +<blockquote> +<A NAME=2.3.125>Those of his chamber, as it seem'd, had done 't:</A><br> +<A NAME=2.3.126>Their hands and faces were an badged with blood;</A><br> +<A NAME=2.3.127>So were their daggers, which unwiped we found</A><br> +<A NAME=2.3.128>Upon their pillows:</A><br> +<A NAME=2.3.129>They stared, and were distracted; no man's life</A><br> +<A NAME=2.3.130>Was to be trusted with them.</A><br> +</blockquote> + +<A NAME=speech40><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.131>O, yet I do repent me of my fury,</A><br> +<A NAME=2.3.132>That I did kill them.</A><br> +</blockquote> + +<A NAME=speech41><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.133>Wherefore did you so?</A><br> +</blockquote> + +<A NAME=speech42><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.134>Who can be wise, amazed, temperate and furious,</A><br> +<A NAME=2.3.135>Loyal and neutral, in a moment? No man:</A><br> +<A NAME=2.3.136>The expedition my violent love</A><br> +<A NAME=2.3.137>Outrun the pauser, reason. Here lay Duncan,</A><br> +<A NAME=2.3.138>His silver skin laced with his golden blood;</A><br> +<A NAME=2.3.139>And his gash'd stabs look'd like a breach in nature</A><br> +<A NAME=2.3.140>For ruin's wasteful entrance: there, the murderers,</A><br> +<A NAME=2.3.141>Steep'd in the colours of their trade, their daggers</A><br> +<A NAME=2.3.142>Unmannerly breech'd with gore: who could refrain,</A><br> +<A NAME=2.3.143>That had a heart to love, and in that heart</A><br> +<A NAME=2.3.144>Courage to make 's love kno wn?</A><br> +</blockquote> + +<A NAME=speech43><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=2.3.145>Help me hence, ho!</A><br> +</blockquote> + +<A NAME=speech44><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.146>Look to the lady.</A><br> +</blockquote> + +<A NAME=speech45><b>MALCOLM</b></a> +<blockquote> +<A NAME=2.3.147>[Aside to DONALBAIN] Why do we hold our tongues,</A><br> +<A NAME=2.3.148>That most may claim this argument for ours?</A><br> +</blockquote> + +<A NAME=speech46><b>DONALBAIN</b></a> +<blockquote> +<A NAME=2.3.149>[Aside to MALCOLM] What should be spoken here,</A><br> +<A NAME=2.3.150>where our fate,</A><br> +<A NAME=2.3.151>Hid in an auger-hole, may rush, and seize us?</A><br> +<A NAME=2.3.152>Let 's away;</A><br> +<A NAME=2.3.153>Our tears are not yet brew'd.</A><br> +</blockquote> + +<A NAME=speech47><b>MALCOLM</b></a> +<blockquote> +<A NAME=2.3.154>[Aside to DONALBAIN] Nor our strong sorrow</A><br> +<A NAME=2.3.155>Upon the foot of motion.</A><br> +</blockquote> + +<A NAME=speech48><b>BANQUO</b></a> +<blockquote> +<A NAME=2.3.156>Look to the lady:</A><br> +<p><i>LADY MACBETH is carried out</i></p> +<A NAME=2.3.157>And when we have our naked frailties hid,</A><br> +<A NAME=2.3.158>That suffer in exposure, let us meet,</A><br> +<A NAME=2.3.159>And question this most bloody piece of work,</A><br> +<A NAME=2.3.160>To know it further. Fears and scruples shake us:</A><br> +<A NAME=2.3.161>In the great hand of God I stand; and thence</A><br> +<A NAME=2.3.162>Against the undivulged pretence I fight</A><br> +<A NAME=2.3.163>Of treasonous malice.</A><br> +</blockquote> + +<A NAME=speech49><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.3.164>And so do I.</A><br> +</blockquote> + +<A NAME=speech50><b>ALL</b></a> +<blockquote> +<A NAME=2.3.165>So all.</A><br> +</blockquote> + +<A NAME=speech51><b>MACBETH</b></a> +<blockquote> +<A NAME=2.3.166>Let's briefly put on manly readiness,</A><br> +<A NAME=2.3.167>And meet i' the hall together.</A><br> +</blockquote> + +<A NAME=speech52><b>ALL</b></a> +<blockquote> +<A NAME=2.3.168>Well contented.</A><br> +<p><i>Exeunt all but Malcolm and Donalbain.</i></p> +</blockquote> + +<A NAME=speech53><b>MALCOLM</b></a> +<blockquote> +<A NAME=2.3.169>What will you do? Let's not consort with them:</A><br> +<A NAME=2.3.170>To show an unfelt sorrow is an office</A><br> +<A NAME=2.3.171>Which the false man does easy. I'll to England.</A><br> +</blockquote> + +<A NAME=speech54><b>DONALBAIN</b></a> +<blockquote> +<A NAME=2.3.172>To Ireland, I; our separated fortune</A><br> +<A NAME=2.3.173>Shall keep us both the safer: where we are,</A><br> +<A NAME=2.3.174>There's daggers in men's smiles: the near in blood,</A><br> +<A NAME=2.3.175>The nearer bloody.</A><br> +</blockquote> + +<A NAME=speech55><b>MALCOLM</b></a> +<blockquote> +<A NAME=2.3.176> This murderous shaft that's shot</A><br> +<A NAME=2.3.177>Hath not yet lighted, and our safest way</A><br> +<A NAME=2.3.178>Is to avoid the aim. Therefore, to horse;</A><br> +<A NAME=2.3.179>And let us not be dainty of leave-taking,</A><br> +<A NAME=2.3.180>But shift away: there's warrant in that theft</A><br> +<A NAME=2.3.181>Which steals itself, when there's no mercy left.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE IV. Outside Macbeth's castle.</h3> +<p><blockquote> +<i>Enter ROSS and an old Man</i> +</blockquote> + +<A NAME=speech1><b>Old Man</b></a> +<blockquote> +<A NAME=2.4.1>Threescore and ten I can remember well:</A><br> +<A NAME=2.4.2>Within the volume of which time I have seen</A><br> +<A NAME=2.4.3>Hours dreadful and things strange; but this sore night</A><br> +<A NAME=2.4.4>Hath trifled former knowings.</A><br> +</blockquote> + +<A NAME=speech2><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.5>Ah, good father,</A><br> +<A NAME=2.4.6>Thou seest, the heavens, as troubled with man's act,</A><br> +<A NAME=2.4.7>Threaten his bloody stage: by the clock, 'tis day,</A><br> +<A NAME=2.4.8>And yet dark night strangles the travelling lamp:</A><br> +<A NAME=2.4.9>Is't night's predominance, or the day's shame,</A><br> +<A NAME=2.4.10>That darkness does the face of earth entomb,</A><br> +<A NAME=2.4.11>When living light should kiss it?</A><br> +</blockquote> + +<A NAME=speech3><b>Old Man</b></a> +<blockquote> +<A NAME=2.4.12>'Tis unnatural,</A><br> +<A NAME=2.4.13>Even like the deed that's done. On Tuesday last,</A><br> +<A NAME=2.4.14>A falcon, towering in her pride of place,</A><br> +<A NAME=2.4.15>Was by a mousing owl hawk'd at and kill'd.</A><br> +</blockquote> + +<A NAME=speech4><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.16>And Duncan's horses--a thing most strange and certain--</A><br> +<A NAME=2.4.17>Beauteous and swift, the minions of their race,</A><br> +<A NAME=2.4.18>Turn'd wild in nature, broke their stalls, flung out,</A><br> +<A NAME=2.4.19>Contending 'gainst obedience, as they would make</A><br> +<A NAME=2.4.20>War with mankind.</A><br> +</blockquote> + +<A NAME=speech5><b>Old Man</b></a> +<blockquote> +<A NAME=2.4.21>'Tis said they eat each other.</A><br> +</blockquote> + +<A NAME=speech6><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.22>They did so, to the amazement of mine eyes</A><br> +<A NAME=2.4.23>That look'd upon't. Here comes the good Macduff.</A><br> +<p><i>Enter MACDUFF</i></p> +<A NAME=2.4.24>How goes the world, sir, now?</A><br> +</blockquote> + +<A NAME=speech7><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.25>Why, see you not?</A><br> +</blockquote> + +<A NAME=speech8><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.26>Is't known who did this more than bloody deed?</A><br> +</blockquote> + +<A NAME=speech9><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.27>Those that Macbeth hath slain.</A><br> +</blockquote> + +<A NAME=speech10><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.28>Alas, the day!</A><br> +<A NAME=2.4.29>What good could they pretend?</A><br> +</blockquote> + +<A NAME=speech11><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.30>They were suborn'd:</A><br> +<A NAME=2.4.31>Malcolm and Donalbain, the king's two sons,</A><br> +<A NAME=2.4.32>Are stol'n away and fled; which puts upon them</A><br> +<A NAME=2.4.33>Suspicion of the deed.</A><br> +</blockquote> + +<A NAME=speech12><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.34>'Gainst nature still!</A><br> +<A NAME=2.4.35>Thriftless ambition, that wilt ravin up</A><br> +<A NAME=2.4.36>Thine own life's means! Then 'tis most like</A><br> +<A NAME=2.4.37>The sovereignty will fall upon Macbeth.</A><br> +</blockquote> + +<A NAME=speech13><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.38>He is already named, and gone to Scone</A><br> +<A NAME=2.4.39>To be invested.</A><br> +</blockquote> + +<A NAME=speech14><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.40> Where is Duncan's body?</A><br> +</blockquote> + +<A NAME=speech15><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.41>Carried to Colmekill,</A><br> +<A NAME=2.4.42>The sacred storehouse of his predecessors,</A><br> +<A NAME=2.4.43>And guardian of their bones.</A><br> +</blockquote> + +<A NAME=speech16><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.44>Will you to Scone?</A><br> +</blockquote> + +<A NAME=speech17><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.45>No, cousin, I'll to Fife.</A><br> +</blockquote> + +<A NAME=speech18><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.46>Well, I will thither.</A><br> +</blockquote> + +<A NAME=speech19><b>MACDUFF</b></a> +<blockquote> +<A NAME=2.4.47>Well, may you see things well done there: adieu!</A><br> +<A NAME=2.4.48>Lest our old robes sit easier than our new!</A><br> +</blockquote> + +<A NAME=speech20><b>ROSS</b></a> +<blockquote> +<A NAME=2.4.49>Farewell, father.</A><br> +</blockquote> + +<A NAME=speech21><b>Old Man</b></a> +<blockquote> +<A NAME=2.4.50>God's benison go with you; and with those</A><br> +<A NAME=2.4.51>That would make good of bad, and friends of foes!</A><br> +<p><i>Exeunt</i></p> +</blockquote><p> +<H3>ACT III</h3> +<h3>SCENE I. Forres. The palace.</h3> +<p><blockquote> +<i>Enter BANQUO</i> +</blockquote> + +<A NAME=speech1><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.1>Thou hast it now: king, Cawdor, Glamis, all,</A><br> +<A NAME=3.1.2>As the weird women promised, and, I fear,</A><br> +<A NAME=3.1.3>Thou play'dst most foully for't: yet it was said</A><br> +<A NAME=3.1.4>It should not stand in thy posterity,</A><br> +<A NAME=3.1.5>But that myself should be the root and father</A><br> +<A NAME=3.1.6>Of many kings. If there come truth from them--</A><br> +<A NAME=3.1.7>As upon thee, Macbeth, their speeches shine--</A><br> +<A NAME=3.1.8>Why, by the verities on thee made good,</A><br> +<A NAME=3.1.9>May they not be my oracles as well,</A><br> +<A NAME=3.1.10>And set me up in hope? But hush! no more.</A><br> +<p><i>Sennet sounded. Enter MACBETH, as king, LADY MACBETH, as queen, LENNOX, ROSS, Lords, Ladies, and Attendants</i></p> +</blockquote> + +<A NAME=speech2><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.11>Here's our chief guest.</A><br> +</blockquote> + +<A NAME=speech3><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.1.12>If he had been forgotten,</A><br> +<A NAME=3.1.13>It had been as a gap in our great feast,</A><br> +<A NAME=3.1.14>And all-thing unbecoming.</A><br> +</blockquote> + +<A NAME=speech4><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.15>To-night we hold a solemn supper sir,</A><br> +<A NAME=3.1.16>And I'll request your presence.</A><br> +</blockquote> + +<A NAME=speech5><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.17>Let your highness</A><br> +<A NAME=3.1.18>Command upon me; to the which my duties</A><br> +<A NAME=3.1.19>Are with a most indissoluble tie</A><br> +<A NAME=3.1.20>For ever knit.</A><br> +</blockquote> + +<A NAME=speech6><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.21> Ride you this afternoon?</A><br> +</blockquote> + +<A NAME=speech7><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.22>Ay, my good lord.</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.23>We should have else desired your good advice,</A><br> +<A NAME=3.1.24>Which still hath been both grave and prosperous,</A><br> +<A NAME=3.1.25>In this day's council; but we'll take to-morrow.</A><br> +<A NAME=3.1.26>Is't far you ride?</A><br> +</blockquote> + +<A NAME=speech9><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.27>As far, my lord, as will fill up the time</A><br> +<A NAME=3.1.28>'Twixt this and supper: go not my horse the better,</A><br> +<A NAME=3.1.29>I must become a borrower of the night</A><br> +<A NAME=3.1.30>For a dark hour or twain.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.31>Fail not our feast.</A><br> +</blockquote> + +<A NAME=speech11><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.32>My lord, I will not.</A><br> +</blockquote> + +<A NAME=speech12><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.33>We hear, our bloody cousins are bestow'd</A><br> +<A NAME=3.1.34>In England and in Ireland, not confessing</A><br> +<A NAME=3.1.35>Their cruel parricide, filling their hearers</A><br> +<A NAME=3.1.36>With strange invention: but of that to-morrow,</A><br> +<A NAME=3.1.37>When therewithal we shall have cause of state</A><br> +<A NAME=3.1.38>Craving us jointly. Hie you to horse: adieu,</A><br> +<A NAME=3.1.39>Till you return at night. Goes Fleance with you?</A><br> +</blockquote> + +<A NAME=speech13><b>BANQUO</b></a> +<blockquote> +<A NAME=3.1.40>Ay, my good lord: our time does call upon 's.</A><br> +</blockquote> + +<A NAME=speech14><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.41>I wish your horses swift and sure of foot;</A><br> +<A NAME=3.1.42>And so I do commend you to their backs. Farewell.</A><br> +<p><i>Exit BANQUO</i></p> +<A NAME=3.1.43>Let every man be master of his time</A><br> +<A NAME=3.1.44>Till seven at night: to make society</A><br> +<A NAME=3.1.45>The sweeter welcome, we will keep ourself</A><br> +<A NAME=3.1.46>Till supper-time alone: while then, God be with you!</A><br> +<p><i>Exeunt all but MACBETH, and an attendant</i></p> +<A NAME=3.1.47>Sirrah, a word with you: attend those men</A><br> +<A NAME=3.1.48>Our pleasure?</A><br> +</blockquote> + +<A NAME=speech15><b>ATTENDANT</b></a> +<blockquote> +<A NAME=3.1.49>They are, my lord, without the palace gate.</A><br> +</blockquote> + +<A NAME=speech16><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.50>Bring them before us.</A><br> +<p><i>Exit Attendant</i></p> +<A NAME=3.1.51>To be thus is nothing;</A><br> +<A NAME=3.1.52>But to be safely thus.--Our fears in Banquo</A><br> +<A NAME=3.1.53>Stick deep; and in his royalty of nature</A><br> +<A NAME=3.1.54>Reigns that which would be fear'd: 'tis much he dares;</A><br> +<A NAME=3.1.55>And, to that dauntless temper of his mind,</A><br> +<A NAME=3.1.56>He hath a wisdom that doth guide his valour</A><br> +<A NAME=3.1.57>To act in safety. There is none but he</A><br> +<A NAME=3.1.58>Whose being I do fear: and, under him,</A><br> +<A NAME=3.1.59>My Genius is rebuked; as, it is said,</A><br> +<A NAME=3.1.60>Mark Antony's was by Caesar. He chid the sisters</A><br> +<A NAME=3.1.61>When first they put the name of king upon me,</A><br> +<A NAME=3.1.62>And bade them speak to him: then prophet-like</A><br> +<A NAME=3.1.63>They hail'd him father to a line of kings:</A><br> +<A NAME=3.1.64>Upon my head they placed a fruitless crown,</A><br> +<A NAME=3.1.65>And put a barren sceptre in my gripe,</A><br> +<A NAME=3.1.66>Thence to be wrench'd with an unlineal hand,</A><br> +<A NAME=3.1.67>No son of mine succeeding. If 't be so,</A><br> +<A NAME=3.1.68>For Banquo's issue have I filed my mind;</A><br> +<A NAME=3.1.69>For them the gracious Duncan have I murder'd;</A><br> +<A NAME=3.1.70>Put rancours in the vessel of my peace</A><br> +<A NAME=3.1.71>Only for them; and mine eternal jewel</A><br> +<A NAME=3.1.72>Given to the common enemy of man,</A><br> +<A NAME=3.1.73>To make them kings, the seed of Banquo kings!</A><br> +<A NAME=3.1.74>Rather than so, come fate into the list.</A><br> +<A NAME=3.1.75>And champion me to the utterance! Who's there!</A><br> +<p><i>Re-enter Attendant, with two Murderers</i></p> +<A NAME=3.1.76>Now go to the door, and stay there till we call.</A><br> +<p><i>Exit Attendant</i></p> +<A NAME=3.1.77>Was it not yesterday we spoke together?</A><br> +</blockquote> + +<A NAME=speech17><b>First Murderer</b></a> +<blockquote> +<A NAME=3.1.78>It was, so please your highness.</A><br> +</blockquote> + +<A NAME=speech18><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.79>Well then, now</A><br> +<A NAME=3.1.80>Have you consider'd of my speeches? Know</A><br> +<A NAME=3.1.81>That it was he in the times past which held you</A><br> +<A NAME=3.1.82>So under fortune, which you thought had been</A><br> +<A NAME=3.1.83>Our innocent self: this I made good to you</A><br> +<A NAME=3.1.84>In our last conference, pass'd in probation with you,</A><br> +<A NAME=3.1.85>How you were borne in hand, how cross'd,</A><br> +<A NAME=3.1.86>the instruments,</A><br> +<A NAME=3.1.87>Who wrought with them, and all things else that might</A><br> +<A NAME=3.1.88>To half a soul and to a notion crazed</A><br> +<A NAME=3.1.89>Say 'Thus did Banquo.'</A><br> +</blockquote> + +<A NAME=speech19><b>First Murderer</b></a> +<blockquote> +<A NAME=3.1.90>You made it known to us.</A><br> +</blockquote> + +<A NAME=speech20><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.91>I did so, and went further, which is now</A><br> +<A NAME=3.1.92>Our point of second meeting. Do you find</A><br> +<A NAME=3.1.93>Your patience so predominant in your nature</A><br> +<A NAME=3.1.94>That you can let this go? Are you so gospell'd</A><br> +<A NAME=3.1.95>To pray for this good man and for his issue,</A><br> +<A NAME=3.1.96>Whose heavy hand hath bow'd you to the grave</A><br> +<A NAME=3.1.97>And beggar'd yours for ever?</A><br> +</blockquote> + +<A NAME=speech21><b>First Murderer</b></a> +<blockquote> +<A NAME=3.1.98>We are men, my liege.</A><br> +</blockquote> + +<A NAME=speech22><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.99>Ay, in the catalogue ye go for men;</A><br> +<A NAME=3.1.100>As hounds and greyhounds, mongrels, spaniels, curs,</A><br> +<A NAME=3.1.101>Shoughs, water-rugs and demi-wolves, are clept</A><br> +<A NAME=3.1.102>All by the name of dogs: the valued file</A><br> +<A NAME=3.1.103>Distinguishes the swift, the slow, the subtle,</A><br> +<A NAME=3.1.104>The housekeeper, the hunter, every one</A><br> +<A NAME=3.1.105>According to the gift which bounteous nature</A><br> +<A NAME=3.1.106>Hath in him closed; whereby he does receive</A><br> +<A NAME=3.1.107>Particular addition. from the bill</A><br> +<A NAME=3.1.108>That writes them all alike: and so of men.</A><br> +<A NAME=3.1.109>Now, if you have a station in the file,</A><br> +<A NAME=3.1.110>Not i' the worst rank of manhood, say 't;</A><br> +<A NAME=3.1.111>And I will put that business in your bosoms,</A><br> +<A NAME=3.1.112>Whose execution takes your enemy off,</A><br> +<A NAME=3.1.113>Grapples you to the heart and love of us,</A><br> +<A NAME=3.1.114>Who wear our health but sickly in his life,</A><br> +<A NAME=3.1.115>Which in his death were perfect.</A><br> +</blockquote> + +<A NAME=speech23><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.1.116>I am one, my liege,</A><br> +<A NAME=3.1.117>Whom the vile blows and buffets of the world</A><br> +<A NAME=3.1.118>Have so incensed that I am reckless what</A><br> +<A NAME=3.1.119>I do to spite the world.</A><br> +</blockquote> + +<A NAME=speech24><b>First Murderer</b></a> +<blockquote> +<A NAME=3.1.120>And I another</A><br> +<A NAME=3.1.121>So weary with disasters, tugg'd with fortune,</A><br> +<A NAME=3.1.122>That I would set my lie on any chance,</A><br> +<A NAME=3.1.123>To mend it, or be rid on't.</A><br> +</blockquote> + +<A NAME=speech25><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.124>Both of you</A><br> +<A NAME=3.1.125>Know Banquo was your enemy.</A><br> +</blockquote> + +<A NAME=speech26><b>Both Murderers</b></a> +<blockquote> +<A NAME=3.1.126>True, my lord.</A><br> +</blockquote> + +<A NAME=speech27><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.127>So is he mine; and in such bloody distance,</A><br> +<A NAME=3.1.128>That every minute of his being thrusts</A><br> +<A NAME=3.1.129>Against my near'st of life: and though I could</A><br> +<A NAME=3.1.130>With barefaced power sweep him from my sight</A><br> +<A NAME=3.1.131>And bid my will avouch it, yet I must not,</A><br> +<A NAME=3.1.132>For certain friends that are both his and mine,</A><br> +<A NAME=3.1.133>Whose loves I may not drop, but wail his fall</A><br> +<A NAME=3.1.134>Who I myself struck down; and thence it is,</A><br> +<A NAME=3.1.135>That I to your assistance do make love,</A><br> +<A NAME=3.1.136>Masking the business from the common eye</A><br> +<A NAME=3.1.137>For sundry weighty reasons.</A><br> +</blockquote> + +<A NAME=speech28><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.1.138>We shall, my lord,</A><br> +<A NAME=3.1.139>Perform what you command us.</A><br> +</blockquote> + +<A NAME=speech29><b>First Murderer</b></a> +<blockquote> +<A NAME=3.1.140>Though our lives--</A><br> +</blockquote> + +<A NAME=speech30><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.141>Your spirits shine through you. Within this hour at most</A><br> +<A NAME=3.1.142>I will advise you where to plant yourselves;</A><br> +<A NAME=3.1.143>Acquaint you with the perfect spy o' the time,</A><br> +<A NAME=3.1.144>The moment on't; for't must be done to-night,</A><br> +<A NAME=3.1.145>And something from the palace; always thought</A><br> +<A NAME=3.1.146>That I require a clearness: and with him--</A><br> +<A NAME=3.1.147>To leave no rubs nor botches in the work--</A><br> +<A NAME=3.1.148>Fleance his son, that keeps him company,</A><br> +<A NAME=3.1.149>Whose absence is no less material to me</A><br> +<A NAME=3.1.150>Than is his father's, must embrace the fate</A><br> +<A NAME=3.1.151>Of that dark hour. Resolve yourselves apart:</A><br> +<A NAME=3.1.152>I'll come to you anon.</A><br> +</blockquote> + +<A NAME=speech31><b>Both Murderers</b></a> +<blockquote> +<A NAME=3.1.153>We are resolved, my lord.</A><br> +</blockquote> + +<A NAME=speech32><b>MACBETH</b></a> +<blockquote> +<A NAME=3.1.154>I'll call upon you straight: abide within.</A><br> +<p><i>Exeunt Murderers</i></p> +<A NAME=3.1.155>It is concluded. Banquo, thy soul's flight,</A><br> +<A NAME=3.1.156>If it find heaven, must find it out to-night.</A><br> +<p><i>Exit</i></p> +</blockquote> +<h3>SCENE II. The palace.</h3> +<p><blockquote> +<i>Enter LADY MACBETH and a Servant</i> +</blockquote> + +<A NAME=speech1><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.1>Is Banquo gone from court?</A><br> +</blockquote> + +<A NAME=speech2><b>Servant</b></a> +<blockquote> +<A NAME=3.2.2>Ay, madam, but returns again to-night.</A><br> +</blockquote> + +<A NAME=speech3><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.3>Say to the king, I would attend his leisure</A><br> +<A NAME=3.2.4>For a few words.</A><br> +</blockquote> + +<A NAME=speech4><b>Servant</b></a> +<blockquote> +<A NAME=3.2.5> Madam, I will.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech5><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.6>Nought's had, all's spent,</A><br> +<A NAME=3.2.7>Where our desire is got without content:</A><br> +<A NAME=3.2.8>'Tis safer to be that which we destroy</A><br> +<A NAME=3.2.9>Than by destruction dwell in doubtful joy.</A><br> +<p><i>Enter MACBETH</i></p> +<A NAME=3.2.10>How now, my lord! why do you keep alone,</A><br> +<A NAME=3.2.11>Of sorriest fancies your companions making,</A><br> +<A NAME=3.2.12>Using those thoughts which should indeed have died</A><br> +<A NAME=3.2.13>With them they think on? Things without all remedy</A><br> +<A NAME=3.2.14>Should be without regard: what's done is done.</A><br> +</blockquote> + +<A NAME=speech6><b>MACBETH</b></a> +<blockquote> +<A NAME=3.2.15>We have scotch'd the snake, not kill'd it:</A><br> +<A NAME=3.2.16>She'll close and be herself, whilst our poor malice</A><br> +<A NAME=3.2.17>Remains in danger of her former tooth.</A><br> +<A NAME=3.2.18>But let the frame of things disjoint, both the</A><br> +<A NAME=3.2.19>worlds suffer,</A><br> +<A NAME=3.2.20>Ere we will eat our meal in fear and sleep</A><br> +<A NAME=3.2.21>In the affliction of these terrible dreams</A><br> +<A NAME=3.2.22>That shake us nightly: better be with the dead,</A><br> +<A NAME=3.2.23>Whom we, to gain our peace, have sent to peace,</A><br> +<A NAME=3.2.24>Than on the torture of the mind to lie</A><br> +<A NAME=3.2.25>In restless ecstasy. Duncan is in his grave;</A><br> +<A NAME=3.2.26>After life's fitful fever he sleeps well;</A><br> +<A NAME=3.2.27>Treason has done his worst: nor steel, nor poison,</A><br> +<A NAME=3.2.28>Malice domestic, foreign levy, nothing,</A><br> +<A NAME=3.2.29>Can touch him further.</A><br> +</blockquote> + +<A NAME=speech7><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.30>Come on;</A><br> +<A NAME=3.2.31>Gentle my lord, sleek o'er your rugged looks;</A><br> +<A NAME=3.2.32>Be bright and jovial among your guests to-night.</A><br> +</blockquote> + +<A NAME=speech8><b>MACBETH</b></a> +<blockquote> +<A NAME=3.2.33>So shall I, love; and so, I pray, be you:</A><br> +<A NAME=3.2.34>Let your remembrance apply to Banquo;</A><br> +<A NAME=3.2.35>Present him eminence, both with eye and tongue:</A><br> +<A NAME=3.2.36>Unsafe the while, that we</A><br> +<A NAME=3.2.37>Must lave our honours in these flattering streams,</A><br> +<A NAME=3.2.38>And make our faces vizards to our hearts,</A><br> +<A NAME=3.2.39>Disguising what they are.</A><br> +</blockquote> + +<A NAME=speech9><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.40>You must leave this.</A><br> +</blockquote> + +<A NAME=speech10><b>MACBETH</b></a> +<blockquote> +<A NAME=3.2.41>O, full of scorpions is my mind, dear wife!</A><br> +<A NAME=3.2.42>Thou know'st that Banquo, and his Fleance, lives.</A><br> +</blockquote> + +<A NAME=speech11><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.43>But in them nature's copy's not eterne.</A><br> +</blockquote> + +<A NAME=speech12><b>MACBETH</b></a> +<blockquote> +<A NAME=3.2.44>There's comfort yet; they are assailable;</A><br> +<A NAME=3.2.45>Then be thou jocund: ere the bat hath flown</A><br> +<A NAME=3.2.46>His cloister'd flight, ere to black Hecate's summons</A><br> +<A NAME=3.2.47>The shard-borne beetle with his drowsy hums</A><br> +<A NAME=3.2.48>Hath rung night's yawning peal, there shall be done</A><br> +<A NAME=3.2.49>A deed of dreadful note.</A><br> +</blockquote> + +<A NAME=speech13><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.2.50>What's to be done?</A><br> +</blockquote> + +<A NAME=speech14><b>MACBETH</b></a> +<blockquote> +<A NAME=3.2.51>Be innocent of the knowledge, dearest chuck,</A><br> +<A NAME=3.2.52>Till thou applaud the deed. Come, seeling night,</A><br> +<A NAME=3.2.53>Scarf up the tender eye of pitiful day;</A><br> +<A NAME=3.2.54>And with thy bloody and invisible hand</A><br> +<A NAME=3.2.55>Cancel and tear to pieces that great bond</A><br> +<A NAME=3.2.56>Which keeps me pale! Light thickens; and the crow</A><br> +<A NAME=3.2.57>Makes wing to the rooky wood:</A><br> +<A NAME=3.2.58>Good things of day begin to droop and drowse;</A><br> +<A NAME=3.2.59>While night's black agents to their preys do rouse.</A><br> +<A NAME=3.2.60>Thou marvell'st at my words: but hold thee still;</A><br> +<A NAME=3.2.61>Things bad begun make strong themselves by ill.</A><br> +<A NAME=3.2.62>So, prithee, go with me.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE III. A park near the palace.</h3> +<p><blockquote> +<i>Enter three Murderers</i> +</blockquote> + +<A NAME=speech1><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.1>But who did bid thee join with us?</A><br> +</blockquote> + +<A NAME=speech2><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.2>Macbeth.</A><br> +</blockquote> + +<A NAME=speech3><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.3.3>He needs not our mistrust, since he delivers</A><br> +<A NAME=3.3.4>Our offices and what we have to do</A><br> +<A NAME=3.3.5>To the direction just.</A><br> +</blockquote> + +<A NAME=speech4><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.6>Then stand with us.</A><br> +<A NAME=3.3.7>The west yet glimmers with some streaks of day:</A><br> +<A NAME=3.3.8>Now spurs the lated traveller apace</A><br> +<A NAME=3.3.9>To gain the timely inn; and near approaches</A><br> +<A NAME=3.3.10>The subject of our watch.</A><br> +</blockquote> + +<A NAME=speech5><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.11>Hark! I hear horses.</A><br> +</blockquote> + +<A NAME=speech6><b>BANQUO</b></a> +<blockquote> +<A NAME=3.3.12>[Within] Give us a light there, ho!</A><br> +</blockquote> + +<A NAME=speech7><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.3.13>Then 'tis he: the rest</A><br> +<A NAME=3.3.14>That are within the note of expectation</A><br> +<A NAME=3.3.15>Already are i' the court.</A><br> +</blockquote> + +<A NAME=speech8><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.16>His horses go about.</A><br> +</blockquote> + +<A NAME=speech9><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.17>Almost a mile: but he does usually,</A><br> +<A NAME=3.3.18>So all men do, from hence to the palace gate</A><br> +<A NAME=3.3.19>Make it their walk.</A><br> +</blockquote> + +<A NAME=speech10><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.3.20>A light, a light!</A><br> +<p><i>Enter BANQUO, and FLEANCE with a torch</i></p> +</blockquote> + +<A NAME=speech11><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.21>'Tis he.</A><br> +</blockquote> + +<A NAME=speech12><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.22>Stand to't.</A><br> +</blockquote> + +<A NAME=speech13><b>BANQUO</b></a> +<blockquote> +<A NAME=3.3.23>It will be rain to-night.</A><br> +</blockquote> + +<A NAME=speech14><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.24>Let it come down.</A><br> +<p><i>They set upon BANQUO</i></p> +</blockquote> + +<A NAME=speech15><b>BANQUO</b></a> +<blockquote> +<A NAME=3.3.25>O, treachery! Fly, good Fleance, fly, fly, fly!</A><br> +<A NAME=3.3.26>Thou mayst revenge. O slave!</A><br> +<p><i>Dies. FLEANCE escapes</i></p> +</blockquote> + +<A NAME=speech16><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.27>Who did strike out the light?</A><br> +</blockquote> + +<A NAME=speech17><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.28>Wast not the way?</A><br> +</blockquote> + +<A NAME=speech18><b>Third Murderer</b></a> +<blockquote> +<A NAME=3.3.29>There's but one down; the son is fled.</A><br> +</blockquote> + +<A NAME=speech19><b>Second Murderer</b></a> +<blockquote> +<A NAME=3.3.30>We have lost</A><br> +<A NAME=3.3.31>Best half of our affair.</A><br> +</blockquote> + +<A NAME=speech20><b>First Murderer</b></a> +<blockquote> +<A NAME=3.3.32>Well, let's away, and say how much is done.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE IV. The same. Hall in the palace.</h3> +<p><blockquote> +<i>A banquet prepared. Enter MACBETH, LADY MACBETH, ROSS, LENNOX, Lords, and Attendants</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.1>You know your own degrees; sit down: at first</A><br> +<A NAME=3.4.2>And last the hearty welcome.</A><br> +</blockquote> + +<A NAME=speech2><b>Lords</b></a> +<blockquote> +<A NAME=3.4.3>Thanks to your majesty.</A><br> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.4>Ourself will mingle with society,</A><br> +<A NAME=3.4.5>And play the humble host.</A><br> +<A NAME=3.4.6>Our hostess keeps her state, but in best time</A><br> +<A NAME=3.4.7>We will require her welcome.</A><br> +</blockquote> + +<A NAME=speech4><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.8>Pronounce it for me, sir, to all our friends;</A><br> +<A NAME=3.4.9>For my heart speaks they are welcome.</A><br> +<p><i>First Murderer appears at the door</i></p> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.10>See, they encounter thee with their hearts' thanks.</A><br> +<A NAME=3.4.11>Both sides are even: here I'll sit i' the midst:</A><br> +<A NAME=3.4.12>Be large in mirth; anon we'll drink a measure</A><br> +<A NAME=3.4.13>The table round.</A><br> +<p><i>Approaching the door</i></p> +<A NAME=3.4.14>There's blood on thy face.</A><br> +</blockquote> + +<A NAME=speech6><b>First Murderer</b></a> +<blockquote> +<A NAME=3.4.15>'Tis Banquo's then.</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.16>'Tis better thee without than he within.</A><br> +<A NAME=3.4.17>Is he dispatch'd?</A><br> +</blockquote> + +<A NAME=speech8><b>First Murderer</b></a> +<blockquote> +<A NAME=3.4.18>My lord, his throat is cut; that I did for him.</A><br> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.19>Thou art the best o' the cut-throats: yet he's good</A><br> +<A NAME=3.4.20>That did the like for Fleance: if thou didst it,</A><br> +<A NAME=3.4.21>Thou art the nonpareil.</A><br> +</blockquote> + +<A NAME=speech10><b>First Murderer</b></a> +<blockquote> +<A NAME=3.4.22>Most royal sir,</A><br> +<A NAME=3.4.23>Fleance is 'scaped.</A><br> +</blockquote> + +<A NAME=speech11><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.24>Then comes my fit again: I had else been perfect,</A><br> +<A NAME=3.4.25>Whole as the marble, founded as the rock,</A><br> +<A NAME=3.4.26>As broad and general as the casing air:</A><br> +<A NAME=3.4.27>But now I am cabin'd, cribb'd, confined, bound in</A><br> +<A NAME=3.4.28>To saucy doubts and fears. But Banquo's safe?</A><br> +</blockquote> + +<A NAME=speech12><b>First Murderer</b></a> +<blockquote> +<A NAME=3.4.29>Ay, my good lord: safe in a ditch he bides,</A><br> +<A NAME=3.4.30>With twenty trenched gashes on his head;</A><br> +<A NAME=3.4.31>The least a death to nature.</A><br> +</blockquote> + +<A NAME=speech13><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.32>Thanks for that:</A><br> +<A NAME=3.4.33>There the grown serpent lies; the worm that's fled</A><br> +<A NAME=3.4.34>Hath nature that in time will venom breed,</A><br> +<A NAME=3.4.35>No teeth for the present. Get thee gone: to-morrow</A><br> +<A NAME=3.4.36>We'll hear, ourselves, again.</A><br> +<p><i>Exit Murderer</i></p> +</blockquote> + +<A NAME=speech14><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.37>My royal lord,</A><br> +<A NAME=3.4.38>You do not give the cheer: the feast is sold</A><br> +<A NAME=3.4.39>That is not often vouch'd, while 'tis a-making,</A><br> +<A NAME=3.4.40>'Tis given with welcome: to feed were best at home;</A><br> +<A NAME=3.4.41>From thence the sauce to meat is ceremony;</A><br> +<A NAME=3.4.42>Meeting were bare without it.</A><br> +</blockquote> + +<A NAME=speech15><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.43>Sweet remembrancer!</A><br> +<A NAME=3.4.44>Now, good digestion wait on appetite,</A><br> +<A NAME=3.4.45>And health on both!</A><br> +</blockquote> + +<A NAME=speech16><b>LENNOX</b></a> +<blockquote> +<A NAME=3.4.46>May't please your highness sit.</A><br> +<p><i>The GHOST OF BANQUO enters, and sits in MACBETH's place</i></p> +</blockquote> + +<A NAME=speech17><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.47>Here had we now our country's honour roof'd,</A><br> +<A NAME=3.4.48>Were the graced person of our Banquo present;</A><br> +<A NAME=3.4.49>Who may I rather challenge for unkindness</A><br> +<A NAME=3.4.50>Than pity for mischance!</A><br> +</blockquote> + +<A NAME=speech18><b>ROSS</b></a> +<blockquote> +<A NAME=3.4.51>His absence, sir,</A><br> +<A NAME=3.4.52>Lays blame upon his promise. Please't your highness</A><br> +<A NAME=3.4.53>To grace us with your royal company.</A><br> +</blockquote> + +<A NAME=speech19><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.54>The table's full.</A><br> +</blockquote> + +<A NAME=speech20><b>LENNOX</b></a> +<blockquote> +<A NAME=3.4.55> Here is a place reserved, sir.</A><br> +</blockquote> + +<A NAME=speech21><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.56>Where?</A><br> +</blockquote> + +<A NAME=speech22><b>LENNOX</b></a> +<blockquote> +<A NAME=3.4.57>Here, my good lord. What is't that moves your highness?</A><br> +</blockquote> + +<A NAME=speech23><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.58>Which of you have done this?</A><br> +</blockquote> + +<A NAME=speech24><b>Lords</b></a> +<blockquote> +<A NAME=3.4.59>What, my good lord?</A><br> +</blockquote> + +<A NAME=speech25><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.60>Thou canst not say I did it: never shake</A><br> +<A NAME=3.4.61>Thy gory locks at me.</A><br> +</blockquote> + +<A NAME=speech26><b>ROSS</b></a> +<blockquote> +<A NAME=3.4.62>Gentlemen, rise: his highness is not well.</A><br> +</blockquote> + +<A NAME=speech27><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.63>Sit, worthy friends: my lord is often thus,</A><br> +<A NAME=3.4.64>And hath been from his youth: pray you, keep seat;</A><br> +<A NAME=3.4.65>The fit is momentary; upon a thought</A><br> +<A NAME=3.4.66>He will again be well: if much you note him,</A><br> +<A NAME=3.4.67>You shall offend him and extend his passion:</A><br> +<A NAME=3.4.68>Feed, and regard him not. Are you a man?</A><br> +</blockquote> + +<A NAME=speech28><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.69>Ay, and a bold one, that dare look on that</A><br> +<A NAME=3.4.70>Which might appal the devil.</A><br> +</blockquote> + +<A NAME=speech29><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.71>O proper stuff!</A><br> +<A NAME=3.4.72>This is the very painting of your fear:</A><br> +<A NAME=3.4.73>This is the air-drawn dagger which, you said,</A><br> +<A NAME=3.4.74>Led you to Duncan. O, these flaws and starts,</A><br> +<A NAME=3.4.75>Impostors to true fear, would well become</A><br> +<A NAME=3.4.76>A woman's story at a winter's fire,</A><br> +<A NAME=3.4.77>Authorized by her grandam. Shame itself!</A><br> +<A NAME=3.4.78>Why do you make such faces? When all's done,</A><br> +<A NAME=3.4.79>You look but on a stool.</A><br> +</blockquote> + +<A NAME=speech30><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.80>Prithee, see there! behold! look! lo!</A><br> +<A NAME=3.4.81>how say you?</A><br> +<A NAME=3.4.82>Why, what care I? If thou canst nod, speak too.</A><br> +<A NAME=3.4.83>If charnel-houses and our graves must send</A><br> +<A NAME=3.4.84>Those that we bury back, our monuments</A><br> +<A NAME=3.4.85>Shall be the maws of kites.</A><br> +<p><i>GHOST OF BANQUO vanishes</i></p> +</blockquote> + +<A NAME=speech31><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.86>What, quite unmann'd in folly?</A><br> +</blockquote> + +<A NAME=speech32><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.87>If I stand here, I saw him.</A><br> +</blockquote> + +<A NAME=speech33><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.88>Fie, for shame!</A><br> +</blockquote> + +<A NAME=speech34><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.89>Blood hath been shed ere now, i' the olden time,</A><br> +<A NAME=3.4.90>Ere human statute purged the gentle weal;</A><br> +<A NAME=3.4.91>Ay, and since too, murders have been perform'd</A><br> +<A NAME=3.4.92>Too terrible for the ear: the times have been,</A><br> +<A NAME=3.4.93>That, when the brains were out, the man would die,</A><br> +<A NAME=3.4.94>And there an end; but now they rise again,</A><br> +<A NAME=3.4.95>With twenty mortal murders on their crowns,</A><br> +<A NAME=3.4.96>And push us from our stools: this is more strange</A><br> +<A NAME=3.4.97>Than such a murder is.</A><br> +</blockquote> + +<A NAME=speech35><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.98>My worthy lord,</A><br> +<A NAME=3.4.99>Your noble friends do lack you.</A><br> +</blockquote> + +<A NAME=speech36><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.100>I do forget.</A><br> +<A NAME=3.4.101>Do not muse at me, my most worthy friends,</A><br> +<A NAME=3.4.102>I have a strange infirmity, which is nothing</A><br> +<A NAME=3.4.103>To those that know me. Come, love and health to all;</A><br> +<A NAME=3.4.104>Then I'll sit down. Give me some wine; fill full.</A><br> +<A NAME=3.4.105>I drink to the general joy o' the whole table,</A><br> +<A NAME=3.4.106>And to our dear friend Banquo, whom we miss;</A><br> +<A NAME=3.4.107>Would he were here! to all, and him, we thirst,</A><br> +<A NAME=3.4.108>And all to all.</A><br> +</blockquote> + +<A NAME=speech37><b>Lords</b></a> +<blockquote> +<A NAME=3.4.109> Our duties, and the pledge.</A><br> +<p><i>Re-enter GHOST OF BANQUO</i></p> +</blockquote> + +<A NAME=speech38><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.110>Avaunt! and quit my sight! let the earth hide thee!</A><br> +<A NAME=3.4.111>Thy bones are marrowless, thy blood is cold;</A><br> +<A NAME=3.4.112>Thou hast no speculation in those eyes</A><br> +<A NAME=3.4.113>Which thou dost glare with!</A><br> +</blockquote> + +<A NAME=speech39><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.114>Think of this, good peers,</A><br> +<A NAME=3.4.115>But as a thing of custom: 'tis no other;</A><br> +<A NAME=3.4.116>Only it spoils the pleasure of the time.</A><br> +</blockquote> + +<A NAME=speech40><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.117>What man dare, I dare:</A><br> +<A NAME=3.4.118>Approach thou like the rugged Russian bear,</A><br> +<A NAME=3.4.119>The arm'd rhinoceros, or the Hyrcan tiger;</A><br> +<A NAME=3.4.120>Take any shape but that, and my firm nerves</A><br> +<A NAME=3.4.121>Shall never tremble: or be alive again,</A><br> +<A NAME=3.4.122>And dare me to the desert with thy sword;</A><br> +<A NAME=3.4.123>If trembling I inhabit then, protest me</A><br> +<A NAME=3.4.124>The baby of a girl. Hence, horrible shadow!</A><br> +<A NAME=3.4.125>Unreal mockery, hence!</A><br> +<p><i>GHOST OF BANQUO vanishes</i></p> +<A NAME=3.4.126>Why, so: being gone,</A><br> +<A NAME=3.4.127>I am a man again. Pray you, sit still.</A><br> +</blockquote> + +<A NAME=speech41><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.128>You have displaced the mirth, broke the good meeting,</A><br> +<A NAME=3.4.129>With most admired disorder.</A><br> +</blockquote> + +<A NAME=speech42><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.130>Can such things be,</A><br> +<A NAME=3.4.131>And overcome us like a summer's cloud,</A><br> +<A NAME=3.4.132>Without our special wonder? You make me strange</A><br> +<A NAME=3.4.133>Even to the disposition that I owe,</A><br> +<A NAME=3.4.134>When now I think you can behold such sights,</A><br> +<A NAME=3.4.135>And keep the natural ruby of your cheeks,</A><br> +<A NAME=3.4.136>When mine is blanched with fear.</A><br> +</blockquote> + +<A NAME=speech43><b>ROSS</b></a> +<blockquote> +<A NAME=3.4.137>What sights, my lord?</A><br> +</blockquote> + +<A NAME=speech44><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.138>I pray you, speak not; he grows worse and worse;</A><br> +<A NAME=3.4.139>Question enrages him. At once, good night:</A><br> +<A NAME=3.4.140>Stand not upon the order of your going,</A><br> +<A NAME=3.4.141>But go at once.</A><br> +</blockquote> + +<A NAME=speech45><b>LENNOX</b></a> +<blockquote> +<A NAME=3.4.142> Good night; and better health</A><br> +<A NAME=3.4.143>Attend his majesty!</A><br> +</blockquote> + +<A NAME=speech46><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.144>A kind good night to all!</A><br> +<p><i>Exeunt all but MACBETH and LADY MACBETH</i></p> +</blockquote> + +<A NAME=speech47><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.145>It will have blood; they say, blood will have blood:</A><br> +<A NAME=3.4.146>Stones have been known to move and trees to speak;</A><br> +<A NAME=3.4.147>Augurs and understood relations have</A><br> +<A NAME=3.4.148>By magot-pies and choughs and rooks brought forth</A><br> +<A NAME=3.4.149>The secret'st man of blood. What is the night?</A><br> +</blockquote> + +<A NAME=speech48><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.150>Almost at odds with morning, which is which.</A><br> +</blockquote> + +<A NAME=speech49><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.151>How say'st thou, that Macduff denies his person</A><br> +<A NAME=3.4.152>At our great bidding?</A><br> +</blockquote> + +<A NAME=speech50><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.153>Did you send to him, sir?</A><br> +</blockquote> + +<A NAME=speech51><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.154>I hear it by the way; but I will send:</A><br> +<A NAME=3.4.155>There's not a one of them but in his house</A><br> +<A NAME=3.4.156>I keep a servant fee'd. I will to-morrow,</A><br> +<A NAME=3.4.157>And betimes I will, to the weird sisters:</A><br> +<A NAME=3.4.158>More shall they speak; for now I am bent to know,</A><br> +<A NAME=3.4.159>By the worst means, the worst. For mine own good,</A><br> +<A NAME=3.4.160>All causes shall give way: I am in blood</A><br> +<A NAME=3.4.161>Stepp'd in so far that, should I wade no more,</A><br> +<A NAME=3.4.162>Returning were as tedious as go o'er:</A><br> +<A NAME=3.4.163>Strange things I have in head, that will to hand;</A><br> +<A NAME=3.4.164>Which must be acted ere they may be scann'd.</A><br> +</blockquote> + +<A NAME=speech52><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=3.4.165>You lack the season of all natures, sleep.</A><br> +</blockquote> + +<A NAME=speech53><b>MACBETH</b></a> +<blockquote> +<A NAME=3.4.166>Come, we'll to sleep. My strange and self-abuse</A><br> +<A NAME=3.4.167>Is the initiate fear that wants hard use:</A><br> +<A NAME=3.4.168>We are yet but young in deed.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE V. A Heath.</h3> +<p><blockquote> +<i>Thunder. Enter the three Witches meeting HECATE</i> +</blockquote> + +<A NAME=speech1><b>First Witch</b></a> +<blockquote> +<A NAME=3.5.1>Why, how now, Hecate! you look angerly.</A><br> +</blockquote> + +<A NAME=speech2><b>HECATE</b></a> +<blockquote> +<A NAME=3.5.2>Have I not reason, beldams as you are,</A><br> +<A NAME=3.5.3>Saucy and overbold? How did you dare</A><br> +<A NAME=3.5.4>To trade and traffic with Macbeth</A><br> +<A NAME=3.5.5>In riddles and affairs of death;</A><br> +<A NAME=3.5.6>And I, the mistress of your charms,</A><br> +<A NAME=3.5.7>The close contriver of all harms,</A><br> +<A NAME=3.5.8>Was never call'd to bear my part,</A><br> +<A NAME=3.5.9>Or show the glory of our art?</A><br> +<A NAME=3.5.10>And, which is worse, all you have done</A><br> +<A NAME=3.5.11>Hath been but for a wayward son,</A><br> +<A NAME=3.5.12>Spiteful and wrathful, who, as others do,</A><br> +<A NAME=3.5.13>Loves for his own ends, not for you.</A><br> +<A NAME=3.5.14>But make amends now: get you gone,</A><br> +<A NAME=3.5.15>And at the pit of Acheron</A><br> +<A NAME=3.5.16>Meet me i' the morning: thither he</A><br> +<A NAME=3.5.17>Will come to know his destiny:</A><br> +<A NAME=3.5.18>Your vessels and your spells provide,</A><br> +<A NAME=3.5.19>Your charms and every thing beside.</A><br> +<A NAME=3.5.20>I am for the air; this night I'll spend</A><br> +<A NAME=3.5.21>Unto a dismal and a fatal end:</A><br> +<A NAME=3.5.22>Great business must be wrought ere noon:</A><br> +<A NAME=3.5.23>Upon the corner of the moon</A><br> +<A NAME=3.5.24>There hangs a vaporous drop profound;</A><br> +<A NAME=3.5.25>I'll catch it ere it come to ground:</A><br> +<A NAME=3.5.26>And that distill'd by magic sleights</A><br> +<A NAME=3.5.27>Shall raise such artificial sprites</A><br> +<A NAME=3.5.28>As by the strength of their illusion</A><br> +<A NAME=3.5.29>Shall draw him on to his confusion:</A><br> +<A NAME=3.5.30>He shall spurn fate, scorn death, and bear</A><br> +<A NAME=3.5.31>He hopes 'bove wisdom, grace and fear:</A><br> +<A NAME=3.5.32>And you all know, security</A><br> +<A NAME=3.5.33>Is mortals' chiefest enemy.</A><br> +<p><i>Music and a song within: 'Come away, come away,' & c</i></p> +<A NAME=3.5.34>Hark! I am call'd; my little spirit, see,</A><br> +<A NAME=3.5.35>Sits in a foggy cloud, and stays for me.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech3><b>First Witch</b></a> +<blockquote> +<A NAME=3.5.36>Come, let's make haste; she'll soon be back again.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE VI. Forres. The palace.</h3> +<p><blockquote> +<i>Enter LENNOX and another Lord</i> +</blockquote> + +<A NAME=speech1><b>LENNOX</b></a> +<blockquote> +<A NAME=3.6.1>My former speeches have but hit your thoughts,</A><br> +<A NAME=3.6.2>Which can interpret further: only, I say,</A><br> +<A NAME=3.6.3>Things have been strangely borne. The</A><br> +<A NAME=3.6.4>gracious Duncan</A><br> +<A NAME=3.6.5>Was pitied of Macbeth: marry, he was dead:</A><br> +<A NAME=3.6.6>And the right-valiant Banquo walk'd too late;</A><br> +<A NAME=3.6.7>Whom, you may say, if't please you, Fleance kill'd,</A><br> +<A NAME=3.6.8>For Fleance fled: men must not walk too late.</A><br> +<A NAME=3.6.9>Who cannot want the thought how monstrous</A><br> +<A NAME=3.6.10>It was for Malcolm and for Donalbain</A><br> +<A NAME=3.6.11>To kill their gracious father? damned fact!</A><br> +<A NAME=3.6.12>How it did grieve Macbeth! did he not straight</A><br> +<A NAME=3.6.13>In pious rage the two delinquents tear,</A><br> +<A NAME=3.6.14>That were the slaves of drink and thralls of sleep?</A><br> +<A NAME=3.6.15>Was not that nobly done? Ay, and wisely too;</A><br> +<A NAME=3.6.16>For 'twould have anger'd any heart alive</A><br> +<A NAME=3.6.17>To hear the men deny't. So that, I say,</A><br> +<A NAME=3.6.18>He has borne all things well: and I do think</A><br> +<A NAME=3.6.19>That had he Duncan's sons under his key--</A><br> +<A NAME=3.6.20>As, an't please heaven, he shall not--they</A><br> +<A NAME=3.6.21>should find</A><br> +<A NAME=3.6.22>What 'twere to kill a father; so should Fleance.</A><br> +<A NAME=3.6.23>But, peace! for from broad words and 'cause he fail'd</A><br> +<A NAME=3.6.24>His presence at the tyrant's feast, I hear</A><br> +<A NAME=3.6.25>Macduff lives in disgrace: sir, can you tell</A><br> +<A NAME=3.6.26>Where he bestows himself?</A><br> +</blockquote> + +<A NAME=speech2><b>Lord</b></a> +<blockquote> +<A NAME=3.6.27>The son of Duncan,</A><br> +<A NAME=3.6.28>From whom this tyrant holds the due of birth</A><br> +<A NAME=3.6.29>Lives in the English court, and is received</A><br> +<A NAME=3.6.30>Of the most pious Edward with such grace</A><br> +<A NAME=3.6.31>That the malevolence of fortune nothing</A><br> +<A NAME=3.6.32>Takes from his high respect: thither Macduff</A><br> +<A NAME=3.6.33>Is gone to pray the holy king, upon his aid</A><br> +<A NAME=3.6.34>To wake Northumberland and warlike Siward:</A><br> +<A NAME=3.6.35>That, by the help of these--with Him above</A><br> +<A NAME=3.6.36>To ratify the work--we may again</A><br> +<A NAME=3.6.37>Give to our tables meat, sleep to our nights,</A><br> +<A NAME=3.6.38>Free from our feasts and banquets bloody knives,</A><br> +<A NAME=3.6.39>Do faithful homage and receive free honours:</A><br> +<A NAME=3.6.40>All which we pine for now: and this report</A><br> +<A NAME=3.6.41>Hath so exasperate the king that he</A><br> +<A NAME=3.6.42>Prepares for some attempt of war.</A><br> +</blockquote> + +<A NAME=speech3><b>LENNOX</b></a> +<blockquote> +<A NAME=3.6.43>Sent he to Macduff?</A><br> +</blockquote> + +<A NAME=speech4><b>Lord</b></a> +<blockquote> +<A NAME=3.6.44>He did: and with an absolute 'Sir, not I,'</A><br> +<A NAME=3.6.45>The cloudy messenger turns me his back,</A><br> +<A NAME=3.6.46>And hums, as who should say 'You'll rue the time</A><br> +<A NAME=3.6.47>That clogs me with this answer.'</A><br> +</blockquote> + +<A NAME=speech5><b>LENNOX</b></a> +<blockquote> +<A NAME=3.6.48>And that well might</A><br> +<A NAME=3.6.49>Advise him to a caution, to hold what distance</A><br> +<A NAME=3.6.50>His wisdom can provide. Some holy angel</A><br> +<A NAME=3.6.51>Fly to the court of England and unfold</A><br> +<A NAME=3.6.52>His message ere he come, that a swift blessing</A><br> +<A NAME=3.6.53>May soon return to this our suffering country</A><br> +<A NAME=3.6.54>Under a hand accursed!</A><br> +</blockquote> + +<A NAME=speech6><b>Lord</b></a> +<blockquote> +<A NAME=3.6.55>I'll send my prayers with him.</A><br> +<p><i>Exeunt</i></p> +</blockquote><p> +<H3>ACT IV</h3> +<h3>SCENE I. A cavern. In the middle, a boiling cauldron.</h3> +<p><blockquote> +<i>Thunder. Enter the three Witches</i> +</blockquote> + +<A NAME=speech1><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.1>Thrice the brinded cat hath mew'd.</A><br> +</blockquote> + +<A NAME=speech2><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.2>Thrice and once the hedge-pig whined.</A><br> +</blockquote> + +<A NAME=speech3><b>Third Witch</b></a> +<blockquote> +<A NAME=4.1.3>Harpier cries 'Tis time, 'tis time.</A><br> +</blockquote> + +<A NAME=speech4><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.4>Round about the cauldron go;</A><br> +<A NAME=4.1.5>In the poison'd entrails throw.</A><br> +<A NAME=4.1.6>Toad, that under cold stone</A><br> +<A NAME=4.1.7>Days and nights has thirty-one</A><br> +<A NAME=4.1.8>Swelter'd venom sleeping got,</A><br> +<A NAME=4.1.9>Boil thou first i' the charmed pot.</A><br> +</blockquote> + +<A NAME=speech5><b>ALL</b></a> +<blockquote> +<A NAME=4.1.10>Double, double toil and trouble;</A><br> +<A NAME=4.1.11>Fire burn, and cauldron bubble.</A><br> +</blockquote> + +<A NAME=speech6><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.12>Fillet of a fenny snake,</A><br> +<A NAME=4.1.13>In the cauldron boil and bake;</A><br> +<A NAME=4.1.14>Eye of newt and toe of frog,</A><br> +<A NAME=4.1.15>Wool of bat and tongue of dog,</A><br> +<A NAME=4.1.16>Adder's fork and blind-worm's sting,</A><br> +<A NAME=4.1.17>Lizard's leg and owlet's wing,</A><br> +<A NAME=4.1.18>For a charm of powerful trouble,</A><br> +<A NAME=4.1.19>Like a hell-broth boil and bubble.</A><br> +</blockquote> + +<A NAME=speech7><b>ALL</b></a> +<blockquote> +<A NAME=4.1.20>Double, double toil and trouble;</A><br> +<A NAME=4.1.21>Fire burn and cauldron bubble.</A><br> +</blockquote> + +<A NAME=speech8><b>Third Witch</b></a> +<blockquote> +<A NAME=4.1.22>Scale of dragon, tooth of wolf,</A><br> +<A NAME=4.1.23>Witches' mummy, maw and gulf</A><br> +<A NAME=4.1.24>Of the ravin'd salt-sea shark,</A><br> +<A NAME=4.1.25>Root of hemlock digg'd i' the dark,</A><br> +<A NAME=4.1.26>Liver of blaspheming Jew,</A><br> +<A NAME=4.1.27>Gall of goat, and slips of yew</A><br> +<A NAME=4.1.28>Silver'd in the moon's eclipse,</A><br> +<A NAME=4.1.29>Nose of Turk and Tartar's lips,</A><br> +<A NAME=4.1.30>Finger of birth-strangled babe</A><br> +<A NAME=4.1.31>Ditch-deliver'd by a drab,</A><br> +<A NAME=4.1.32>Make the gruel thick and slab:</A><br> +<A NAME=4.1.33>Add thereto a tiger's chaudron,</A><br> +<A NAME=4.1.34>For the ingredients of our cauldron.</A><br> +</blockquote> + +<A NAME=speech9><b>ALL</b></a> +<blockquote> +<A NAME=4.1.35>Double, double toil and trouble;</A><br> +<A NAME=4.1.36>Fire burn and cauldron bubble.</A><br> +</blockquote> + +<A NAME=speech10><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.37>Cool it with a baboon's blood,</A><br> +<A NAME=4.1.38>Then the charm is firm and good.</A><br> +<p><i>Enter HECATE to the other three Witches</i></p> +</blockquote> + +<A NAME=speech11><b>HECATE</b></a> +<blockquote> +<A NAME=4.1.39>O well done! I commend your pains;</A><br> +<A NAME=4.1.40>And every one shall share i' the gains;</A><br> +<A NAME=4.1.41>And now about the cauldron sing,</A><br> +<A NAME=4.1.42>Live elves and fairies in a ring,</A><br> +<A NAME=4.1.43>Enchanting all that you put in.</A><br> +<p><i>Music and a song: 'Black spirits,' & c</i></p> +<p><i>HECATE retires</i></p> +</blockquote> + +<A NAME=speech12><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.44>By the pricking of my thumbs,</A><br> +<A NAME=4.1.45>Something wicked this way comes.</A><br> +<A NAME=4.1.46>Open, locks,</A><br> +<A NAME=4.1.47>Whoever knocks!</A><br> +<p><i>Enter MACBETH</i></p> +</blockquote> + +<A NAME=speech13><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.48>How now, you secret, black, and midnight hags!</A><br> +<A NAME=4.1.49>What is't you do?</A><br> +</blockquote> + +<A NAME=speech14><b>ALL</b></a> +<blockquote> +<A NAME=4.1.50> A deed without a name.</A><br> +</blockquote> + +<A NAME=speech15><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.51>I conjure you, by that which you profess,</A><br> +<A NAME=4.1.52>Howe'er you come to know it, answer me:</A><br> +<A NAME=4.1.53>Though you untie the winds and let them fight</A><br> +<A NAME=4.1.54>Against the churches; though the yesty waves</A><br> +<A NAME=4.1.55>Confound and swallow navigation up;</A><br> +<A NAME=4.1.56>Though bladed corn be lodged and trees blown down;</A><br> +<A NAME=4.1.57>Though castles topple on their warders' heads;</A><br> +<A NAME=4.1.58>Though palaces and pyramids do slope</A><br> +<A NAME=4.1.59>Their heads to their foundations; though the treasure</A><br> +<A NAME=4.1.60>Of nature's germens tumble all together,</A><br> +<A NAME=4.1.61>Even till destruction sicken; answer me</A><br> +<A NAME=4.1.62>To what I ask you.</A><br> +</blockquote> + +<A NAME=speech16><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.63> Speak.</A><br> +</blockquote> + +<A NAME=speech17><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.64>Demand.</A><br> +</blockquote> + +<A NAME=speech18><b>Third Witch</b></a> +<blockquote> +<A NAME=4.1.65>We'll answer.</A><br> +</blockquote> + +<A NAME=speech19><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.66>Say, if thou'dst rather hear it from our mouths,</A><br> +<A NAME=4.1.67>Or from our masters?</A><br> +</blockquote> + +<A NAME=speech20><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.68>Call 'em; let me see 'em.</A><br> +</blockquote> + +<A NAME=speech21><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.69>Pour in sow's blood, that hath eaten</A><br> +<A NAME=4.1.70>Her nine farrow; grease that's sweaten</A><br> +<A NAME=4.1.71>From the murderer's gibbet throw</A><br> +<A NAME=4.1.72>Into the flame.</A><br> +</blockquote> + +<A NAME=speech22><b>ALL</b></a> +<blockquote> +<A NAME=4.1.73> Come, high or low;</A><br> +<A NAME=4.1.74>Thyself and office deftly show!</A><br> +<p><i>Thunder. First Apparition: an armed Head</i></p> +</blockquote> + +<A NAME=speech23><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.75>Tell me, thou unknown power,--</A><br> +</blockquote> + +<A NAME=speech24><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.76>He knows thy thought:</A><br> +<A NAME=4.1.77>Hear his speech, but say thou nought.</A><br> +</blockquote> + +<A NAME=speech25><b>First Apparition</b></a> +<blockquote> +<A NAME=4.1.78>Macbeth! Macbeth! Macbeth! beware Macduff;</A><br> +<A NAME=4.1.79>Beware the thane of Fife. Dismiss me. Enough.</A><br> +<p><i>Descends</i></p> +</blockquote> + +<A NAME=speech26><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.80>Whate'er thou art, for thy good caution, thanks;</A><br> +<A NAME=4.1.81>Thou hast harp'd my fear aright: but one</A><br> +<A NAME=4.1.82>word more,--</A><br> +</blockquote> + +<A NAME=speech27><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.83>He will not be commanded: here's another,</A><br> +<A NAME=4.1.84>More potent than the first.</A><br> +<p><i>Thunder. Second Apparition: A bloody Child</i></p> +</blockquote> + +<A NAME=speech28><b>Second Apparition</b></a> +<blockquote> +<A NAME=4.1.85>Macbeth! Macbeth! Macbeth!</A><br> +</blockquote> + +<A NAME=speech29><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.86>Had I three ears, I'ld hear thee.</A><br> +</blockquote> + +<A NAME=speech30><b>Second Apparition</b></a> +<blockquote> +<A NAME=4.1.87>Be bloody, bold, and resolute; laugh to scorn</A><br> +<A NAME=4.1.88>The power of man, for none of woman born</A><br> +<A NAME=4.1.89>Shall harm Macbeth.</A><br> +<p><i>Descends</i></p> +</blockquote> + +<A NAME=speech31><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.90>Then live, Macduff: what need I fear of thee?</A><br> +<A NAME=4.1.91>But yet I'll make assurance double sure,</A><br> +<A NAME=4.1.92>And take a bond of fate: thou shalt not live;</A><br> +<A NAME=4.1.93>That I may tell pale-hearted fear it lies,</A><br> +<A NAME=4.1.94>And sleep in spite of thunder.</A><br> +<p><i>Thunder. Third Apparition: a Child crowned, with a tree in his hand</i></p> +<A NAME=4.1.95>What is this</A><br> +<A NAME=4.1.96>That rises like the issue of a king,</A><br> +<A NAME=4.1.97>And wears upon his baby-brow the round</A><br> +<A NAME=4.1.98>And top of sovereignty?</A><br> +</blockquote> + +<A NAME=speech32><b>ALL</b></a> +<blockquote> +<A NAME=4.1.99>Listen, but speak not to't.</A><br> +</blockquote> + +<A NAME=speech33><b>Third Apparition</b></a> +<blockquote> +<A NAME=4.1.100>Be lion-mettled, proud; and take no care</A><br> +<A NAME=4.1.101>Who chafes, who frets, or where conspirers are:</A><br> +<A NAME=4.1.102>Macbeth shall never vanquish'd be until</A><br> +<A NAME=4.1.103>Great Birnam wood to high Dunsinane hill</A><br> +<A NAME=4.1.104>Shall come against him.</A><br> +<p><i>Descends</i></p> +</blockquote> + +<A NAME=speech34><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.105>That will never be</A><br> +<A NAME=4.1.106>Who can impress the forest, bid the tree</A><br> +<A NAME=4.1.107>Unfix his earth-bound root? Sweet bodements! good!</A><br> +<A NAME=4.1.108>Rebellion's head, rise never till the wood</A><br> +<A NAME=4.1.109>Of Birnam rise, and our high-placed Macbeth</A><br> +<A NAME=4.1.110>Shall live the lease of nature, pay his breath</A><br> +<A NAME=4.1.111>To time and mortal custom. Yet my heart</A><br> +<A NAME=4.1.112>Throbs to know one thing: tell me, if your art</A><br> +<A NAME=4.1.113>Can tell so much: shall Banquo's issue ever</A><br> +<A NAME=4.1.114>Reign in this kingdom?</A><br> +</blockquote> + +<A NAME=speech35><b>ALL</b></a> +<blockquote> +<A NAME=4.1.115>Seek to know no more.</A><br> +</blockquote> + +<A NAME=speech36><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.116>I will be satisfied: deny me this,</A><br> +<A NAME=4.1.117>And an eternal curse fall on you! Let me know.</A><br> +<A NAME=4.1.118>Why sinks that cauldron? and what noise is this?</A><br> +<p><i>Hautboys</i></p> +</blockquote> + +<A NAME=speech37><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.119>Show!</A><br> +</blockquote> + +<A NAME=speech38><b>Second Witch</b></a> +<blockquote> +<A NAME=4.1.120>Show!</A><br> +</blockquote> + +<A NAME=speech39><b>Third Witch</b></a> +<blockquote> +<A NAME=4.1.121>Show!</A><br> +</blockquote> + +<A NAME=speech40><b>ALL</b></a> +<blockquote> +<A NAME=4.1.122>Show his eyes, and grieve his heart;</A><br> +<A NAME=4.1.123>Come like shadows, so depart!</A><br> +<p><i>A show of Eight Kings, the last with a glass in his hand; GHOST OF BANQUO following</i></p> +</blockquote> + +<A NAME=speech41><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.124>Thou art too like the spirit of Banquo: down!</A><br> +<A NAME=4.1.125>Thy crown does sear mine eye-balls. And thy hair,</A><br> +<A NAME=4.1.126>Thou other gold-bound brow, is like the first.</A><br> +<A NAME=4.1.127>A third is like the former. Filthy hags!</A><br> +<A NAME=4.1.128>Why do you show me this? A fourth! Start, eyes!</A><br> +<A NAME=4.1.129>What, will the line stretch out to the crack of doom?</A><br> +<A NAME=4.1.130>Another yet! A seventh! I'll see no more:</A><br> +<A NAME=4.1.131>And yet the eighth appears, who bears a glass</A><br> +<A NAME=4.1.132>Which shows me many more; and some I see</A><br> +<A NAME=4.1.133>That two-fold balls and treble scepters carry:</A><br> +<A NAME=4.1.134>Horrible sight! Now, I see, 'tis true;</A><br> +<A NAME=4.1.135>For the blood-bolter'd Banquo smiles upon me,</A><br> +<A NAME=4.1.136>And points at them for his.</A><br> +<p><i>Apparitions vanish</i></p> +<A NAME=4.1.137>What, is this so?</A><br> +</blockquote> + +<A NAME=speech42><b>First Witch</b></a> +<blockquote> +<A NAME=4.1.138>Ay, sir, all this is so: but why</A><br> +<A NAME=4.1.139>Stands Macbeth thus amazedly?</A><br> +<A NAME=4.1.140>Come, sisters, cheer we up his sprites,</A><br> +<A NAME=4.1.141>And show the best of our delights:</A><br> +<A NAME=4.1.142>I'll charm the air to give a sound,</A><br> +<A NAME=4.1.143>While you perform your antic round:</A><br> +<A NAME=4.1.144>That this great king may kindly say,</A><br> +<A NAME=4.1.145>Our duties did his welcome pay.</A><br> +<p><i>Music. The witches dance and then vanish, with HECATE</i></p> +</blockquote> + +<A NAME=speech43><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.146>Where are they? Gone? Let this pernicious hour</A><br> +<A NAME=4.1.147>Stand aye accursed in the calendar!</A><br> +<A NAME=4.1.148>Come in, without there!</A><br> +<p><i>Enter LENNOX</i></p> +</blockquote> + +<A NAME=speech44><b>LENNOX</b></a> +<blockquote> +<A NAME=4.1.149>What's your grace's will?</A><br> +</blockquote> + +<A NAME=speech45><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.150>Saw you the weird sisters?</A><br> +</blockquote> + +<A NAME=speech46><b>LENNOX</b></a> +<blockquote> +<A NAME=4.1.151>No, my lord.</A><br> +</blockquote> + +<A NAME=speech47><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.152>Came they not by you?</A><br> +</blockquote> + +<A NAME=speech48><b>LENNOX</b></a> +<blockquote> +<A NAME=4.1.153>No, indeed, my lord.</A><br> +</blockquote> + +<A NAME=speech49><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.154>Infected be the air whereon they ride;</A><br> +<A NAME=4.1.155>And damn'd all those that trust them! I did hear</A><br> +<A NAME=4.1.156>The galloping of horse: who was't came by?</A><br> +</blockquote> + +<A NAME=speech50><b>LENNOX</b></a> +<blockquote> +<A NAME=4.1.157>'Tis two or three, my lord, that bring you word</A><br> +<A NAME=4.1.158>Macduff is fled to England.</A><br> +</blockquote> + +<A NAME=speech51><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.159>Fled to England!</A><br> +</blockquote> + +<A NAME=speech52><b>LENNOX</b></a> +<blockquote> +<A NAME=4.1.160>Ay, my good lord.</A><br> +</blockquote> + +<A NAME=speech53><b>MACBETH</b></a> +<blockquote> +<A NAME=4.1.161>Time, thou anticipatest my dread exploits:</A><br> +<A NAME=4.1.162>The flighty purpose never is o'ertook</A><br> +<A NAME=4.1.163>Unless the deed go with it; from this moment</A><br> +<A NAME=4.1.164>The very firstlings of my heart shall be</A><br> +<A NAME=4.1.165>The firstlings of my hand. And even now,</A><br> +<A NAME=4.1.166>To crown my thoughts with acts, be it thought and done:</A><br> +<A NAME=4.1.167>The castle of Macduff I will surprise;</A><br> +<A NAME=4.1.168>Seize upon Fife; give to the edge o' the sword</A><br> +<A NAME=4.1.169>His wife, his babes, and all unfortunate souls</A><br> +<A NAME=4.1.170>That trace him in his line. No boasting like a fool;</A><br> +<A NAME=4.1.171>This deed I'll do before this purpose cool.</A><br> +<A NAME=4.1.172>But no more sights!--Where are these gentlemen?</A><br> +<A NAME=4.1.173>Come, bring me where they are.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE II. Fife. Macduff's castle.</h3> +<p><blockquote> +<i>Enter LADY MACDUFF, her Son, and ROSS</i> +</blockquote> + +<A NAME=speech1><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.1>What had he done, to make him fly the land?</A><br> +</blockquote> + +<A NAME=speech2><b>ROSS</b></a> +<blockquote> +<A NAME=4.2.2>You must have patience, madam.</A><br> +</blockquote> + +<A NAME=speech3><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.3>He had none:</A><br> +<A NAME=4.2.4>His flight was madness: when our actions do not,</A><br> +<A NAME=4.2.5>Our fears do make us traitors.</A><br> +</blockquote> + +<A NAME=speech4><b>ROSS</b></a> +<blockquote> +<A NAME=4.2.6>You know not</A><br> +<A NAME=4.2.7>Whether it was his wisdom or his fear.</A><br> +</blockquote> + +<A NAME=speech5><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.8>Wisdom! to leave his wife, to leave his babes,</A><br> +<A NAME=4.2.9>His mansion and his titles in a place</A><br> +<A NAME=4.2.10>From whence himself does fly? He loves us not;</A><br> +<A NAME=4.2.11>He wants the natural touch: for the poor wren,</A><br> +<A NAME=4.2.12>The most diminutive of birds, will fight,</A><br> +<A NAME=4.2.13>Her young ones in her nest, against the owl.</A><br> +<A NAME=4.2.14>All is the fear and nothing is the love;</A><br> +<A NAME=4.2.15>As little is the wisdom, where the flight</A><br> +<A NAME=4.2.16>So runs against all reason.</A><br> +</blockquote> + +<A NAME=speech6><b>ROSS</b></a> +<blockquote> +<A NAME=4.2.17>My dearest coz,</A><br> +<A NAME=4.2.18>I pray you, school yourself: but for your husband,</A><br> +<A NAME=4.2.19>He is noble, wise, judicious, and best knows</A><br> +<A NAME=4.2.20>The fits o' the season. I dare not speak</A><br> +<A NAME=4.2.21>much further;</A><br> +<A NAME=4.2.22>But cruel are the times, when we are traitors</A><br> +<A NAME=4.2.23>And do not know ourselves, when we hold rumour</A><br> +<A NAME=4.2.24>From what we fear, yet know not what we fear,</A><br> +<A NAME=4.2.25>But float upon a wild and violent sea</A><br> +<A NAME=4.2.26>Each way and move. I take my leave of you:</A><br> +<A NAME=4.2.27>Shall not be long but I'll be here again:</A><br> +<A NAME=4.2.28>Things at the worst will cease, or else climb upward</A><br> +<A NAME=4.2.29>To what they were before. My pretty cousin,</A><br> +<A NAME=4.2.30>Blessing upon you!</A><br> +</blockquote> + +<A NAME=speech7><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.31>Father'd he is, and yet he's fatherless.</A><br> +</blockquote> + +<A NAME=speech8><b>ROSS</b></a> +<blockquote> +<A NAME=4.2.32>I am so much a fool, should I stay longer,</A><br> +<A NAME=4.2.33>It would be my disgrace and your discomfort:</A><br> +<A NAME=4.2.34>I take my leave at once.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech9><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.35>Sirrah, your father's dead;</A><br> +<A NAME=4.2.36>And what will you do now? How will you live?</A><br> +</blockquote> + +<A NAME=speech10><b>Son</b></a> +<blockquote> +<A NAME=4.2.37>As birds do, mother.</A><br> +</blockquote> + +<A NAME=speech11><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.38>What, with worms and flies?</A><br> +</blockquote> + +<A NAME=speech12><b>Son</b></a> +<blockquote> +<A NAME=4.2.39>With what I get, I mean; and so do they.</A><br> +</blockquote> + +<A NAME=speech13><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.40>Poor bird! thou'ldst never fear the net nor lime,</A><br> +<A NAME=4.2.41>The pitfall nor the gin.</A><br> +</blockquote> + +<A NAME=speech14><b>Son</b></a> +<blockquote> +<A NAME=4.2.42>Why should I, mother? Poor birds they are not set for.</A><br> +<A NAME=4.2.43>My father is not dead, for all your saying.</A><br> +</blockquote> + +<A NAME=speech15><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.44>Yes, he is dead; how wilt thou do for a father?</A><br> +</blockquote> + +<A NAME=speech16><b>Son</b></a> +<blockquote> +<A NAME=4.2.45>Nay, how will you do for a husband?</A><br> +</blockquote> + +<A NAME=speech17><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.46>Why, I can buy me twenty at any market.</A><br> +</blockquote> + +<A NAME=speech18><b>Son</b></a> +<blockquote> +<A NAME=4.2.47>Then you'll buy 'em to sell again.</A><br> +</blockquote> + +<A NAME=speech19><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.48>Thou speak'st with all thy wit: and yet, i' faith,</A><br> +<A NAME=4.2.49>With wit enough for thee.</A><br> +</blockquote> + +<A NAME=speech20><b>Son</b></a> +<blockquote> +<A NAME=4.2.50>Was my father a traitor, mother?</A><br> +</blockquote> + +<A NAME=speech21><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.51>Ay, that he was.</A><br> +</blockquote> + +<A NAME=speech22><b>Son</b></a> +<blockquote> +<A NAME=4.2.52>What is a traitor?</A><br> +</blockquote> + +<A NAME=speech23><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.53>Why, one that swears and lies.</A><br> +</blockquote> + +<A NAME=speech24><b>Son</b></a> +<blockquote> +<A NAME=4.2.54>And be all traitors that do so?</A><br> +</blockquote> + +<A NAME=speech25><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.55>Every one that does so is a traitor, and must be hanged.</A><br> +</blockquote> + +<A NAME=speech26><b>Son</b></a> +<blockquote> +<A NAME=4.2.56>And must they all be hanged that swear and lie?</A><br> +</blockquote> + +<A NAME=speech27><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.57>Every one.</A><br> +</blockquote> + +<A NAME=speech28><b>Son</b></a> +<blockquote> +<A NAME=4.2.58>Who must hang them?</A><br> +</blockquote> + +<A NAME=speech29><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.59>Why, the honest men.</A><br> +</blockquote> + +<A NAME=speech30><b>Son</b></a> +<blockquote> +<A NAME=4.2.60>Then the liars and swearers are fools,</A><br> +<A NAME=4.2.61>for there are liars and swearers enow to beat</A><br> +<A NAME=4.2.62>the honest men and hang up them.</A><br> +</blockquote> + +<A NAME=speech31><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.63>Now, God help thee, poor monkey!</A><br> +<A NAME=4.2.64>But how wilt thou do for a father?</A><br> +</blockquote> + +<A NAME=speech32><b>Son</b></a> +<blockquote> +<A NAME=4.2.65>If he were dead, you'ld weep for</A><br> +<A NAME=4.2.66>him: if you would not, it were a good sign</A><br> +<A NAME=4.2.67>that I should quickly have a new father.</A><br> +</blockquote> + +<A NAME=speech33><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.68>Poor prattler, how thou talk'st!</A><br> +<p><i>Enter a Messenger</i></p> +</blockquote> + +<A NAME=speech34><b>Messenger</b></a> +<blockquote> +<A NAME=4.2.69>Bless you, fair dame! I am not to you known,</A><br> +<A NAME=4.2.70>Though in your state of honour I am perfect.</A><br> +<A NAME=4.2.71>I doubt some danger does approach you nearly:</A><br> +<A NAME=4.2.72>If you will take a homely man's advice,</A><br> +<A NAME=4.2.73>Be not found here; hence, with your little ones.</A><br> +<A NAME=4.2.74>To fright you thus, methinks, I am too savage;</A><br> +<A NAME=4.2.75>To do worse to you were fell cruelty,</A><br> +<A NAME=4.2.76>Which is too nigh your person. Heaven preserve you!</A><br> +<A NAME=4.2.77>I dare abide no longer.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech35><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.78>Whither should I fly?</A><br> +<A NAME=4.2.79>I have done no harm. But I remember now</A><br> +<A NAME=4.2.80>I am in this earthly world; where to do harm</A><br> +<A NAME=4.2.81>Is often laudable, to do good sometime</A><br> +<A NAME=4.2.82>Accounted dangerous folly: why then, alas,</A><br> +<A NAME=4.2.83>Do I put up that womanly defence,</A><br> +<A NAME=4.2.84>To say I have done no harm?</A><br> +<p><i>Enter Murderers</i></p> +<A NAME=4.2.85>What are these faces?</A><br> +</blockquote> + +<A NAME=speech36><b>First Murderer</b></a> +<blockquote> +<A NAME=4.2.86>Where is your husband?</A><br> +</blockquote> + +<A NAME=speech37><b>LADY MACDUFF</b></a> +<blockquote> +<A NAME=4.2.87>I hope, in no place so unsanctified</A><br> +<A NAME=4.2.88>Where such as thou mayst find him.</A><br> +</blockquote> + +<A NAME=speech38><b>First Murderer</b></a> +<blockquote> +<A NAME=4.2.89>He's a traitor.</A><br> +</blockquote> + +<A NAME=speech39><b>Son</b></a> +<blockquote> +<A NAME=4.2.90>Thou liest, thou shag-hair'd villain!</A><br> +</blockquote> + +<A NAME=speech40><b>First Murderer</b></a> +<blockquote> +<A NAME=4.2.91>What, you egg!</A><br> +<p><i>Stabbing him</i></p> +<A NAME=4.2.92>Young fry of treachery!</A><br> +</blockquote> + +<A NAME=speech41><b>Son</b></a> +<blockquote> +<A NAME=4.2.93>He has kill'd me, mother:</A><br> +<A NAME=4.2.94>Run away, I pray you!</A><br> +<p><i>Dies</i></p> +<p><i>Exit LADY MACDUFF, crying 'Murder!' Exeunt Murderers, following her</i></p> +</blockquote> +<h3>SCENE III. England. Before the King's palace.</h3> +<p><blockquote> +<i>Enter MALCOLM and MACDUFF</i> +</blockquote> + +<A NAME=speech1><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.1>Let us seek out some desolate shade, and there</A><br> +<A NAME=4.3.2>Weep our sad bosoms empty.</A><br> +</blockquote> + +<A NAME=speech2><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.3>Let us rather</A><br> +<A NAME=4.3.4>Hold fast the mortal sword, and like good men</A><br> +<A NAME=4.3.5>Bestride our down-fall'n birthdom: each new morn</A><br> +<A NAME=4.3.6>New widows howl, new orphans cry, new sorrows</A><br> +<A NAME=4.3.7>Strike heaven on the face, that it resounds</A><br> +<A NAME=4.3.8>As if it felt with Scotland and yell'd out</A><br> +<A NAME=4.3.9>Like syllable of dolour.</A><br> +</blockquote> + +<A NAME=speech3><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.10>What I believe I'll wail,</A><br> +<A NAME=4.3.11>What know believe, and what I can redress,</A><br> +<A NAME=4.3.12>As I shall find the time to friend, I will.</A><br> +<A NAME=4.3.13>What you have spoke, it may be so perchance.</A><br> +<A NAME=4.3.14>This tyrant, whose sole name blisters our tongues,</A><br> +<A NAME=4.3.15>Was once thought honest: you have loved him well.</A><br> +<A NAME=4.3.16>He hath not touch'd you yet. I am young;</A><br> +<A NAME=4.3.17>but something</A><br> +<A NAME=4.3.18>You may deserve of him through me, and wisdom</A><br> +<A NAME=4.3.19>To offer up a weak poor innocent lamb</A><br> +<A NAME=4.3.20>To appease an angry god.</A><br> +</blockquote> + +<A NAME=speech4><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.21>I am not treacherous.</A><br> +</blockquote> + +<A NAME=speech5><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.22>But Macbeth is.</A><br> +<A NAME=4.3.23>A good and virtuous nature may recoil</A><br> +<A NAME=4.3.24>In an imperial charge. But I shall crave</A><br> +<A NAME=4.3.25>your pardon;</A><br> +<A NAME=4.3.26>That which you are my thoughts cannot transpose:</A><br> +<A NAME=4.3.27>Angels are bright still, though the brightest fell;</A><br> +<A NAME=4.3.28>Though all things foul would wear the brows of grace,</A><br> +<A NAME=4.3.29>Yet grace must still look so.</A><br> +</blockquote> + +<A NAME=speech6><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.30>I have lost my hopes.</A><br> +</blockquote> + +<A NAME=speech7><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.31>Perchance even there where I did find my doubts.</A><br> +<A NAME=4.3.32>Why in that rawness left you wife and child,</A><br> +<A NAME=4.3.33>Those precious motives, those strong knots of love,</A><br> +<A NAME=4.3.34>Without leave-taking? I pray you,</A><br> +<A NAME=4.3.35>Let not my jealousies be your dishonours,</A><br> +<A NAME=4.3.36>But mine own safeties. You may be rightly just,</A><br> +<A NAME=4.3.37>Whatever I shall think.</A><br> +</blockquote> + +<A NAME=speech8><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.38>Bleed, bleed, poor country!</A><br> +<A NAME=4.3.39>Great tyranny! lay thou thy basis sure,</A><br> +<A NAME=4.3.40>For goodness dare not cheque thee: wear thou</A><br> +<A NAME=4.3.41>thy wrongs;</A><br> +<A NAME=4.3.42>The title is affeer'd! Fare thee well, lord:</A><br> +<A NAME=4.3.43>I would not be the villain that thou think'st</A><br> +<A NAME=4.3.44>For the whole space that's in the tyrant's grasp,</A><br> +<A NAME=4.3.45>And the rich East to boot.</A><br> +</blockquote> + +<A NAME=speech9><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.46>Be not offended:</A><br> +<A NAME=4.3.47>I speak not as in absolute fear of you.</A><br> +<A NAME=4.3.48>I think our country sinks beneath the yoke;</A><br> +<A NAME=4.3.49>It weeps, it bleeds; and each new day a gash</A><br> +<A NAME=4.3.50>Is added to her wounds: I think withal</A><br> +<A NAME=4.3.51>There would be hands uplifted in my right;</A><br> +<A NAME=4.3.52>And here from gracious England have I offer</A><br> +<A NAME=4.3.53>Of goodly thousands: but, for all this,</A><br> +<A NAME=4.3.54>When I shall tread upon the tyrant's head,</A><br> +<A NAME=4.3.55>Or wear it on my sword, yet my poor country</A><br> +<A NAME=4.3.56>Shall have more vices than it had before,</A><br> +<A NAME=4.3.57>More suffer and more sundry ways than ever,</A><br> +<A NAME=4.3.58>By him that shall succeed.</A><br> +</blockquote> + +<A NAME=speech10><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.59>What should he be?</A><br> +</blockquote> + +<A NAME=speech11><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.60>It is myself I mean: in whom I know</A><br> +<A NAME=4.3.61>All the particulars of vice so grafted</A><br> +<A NAME=4.3.62>That, when they shall be open'd, black Macbeth</A><br> +<A NAME=4.3.63>Will seem as pure as snow, and the poor state</A><br> +<A NAME=4.3.64>Esteem him as a lamb, being compared</A><br> +<A NAME=4.3.65>With my confineless harms.</A><br> +</blockquote> + +<A NAME=speech12><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.66>Not in the legions</A><br> +<A NAME=4.3.67>Of horrid hell can come a devil more damn'd</A><br> +<A NAME=4.3.68>In evils to top Macbeth.</A><br> +</blockquote> + +<A NAME=speech13><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.69>I grant him bloody,</A><br> +<A NAME=4.3.70>Luxurious, avaricious, false, deceitful,</A><br> +<A NAME=4.3.71>Sudden, malicious, smacking of every sin</A><br> +<A NAME=4.3.72>That has a name: but there's no bottom, none,</A><br> +<A NAME=4.3.73>In my voluptuousness: your wives, your daughters,</A><br> +<A NAME=4.3.74>Your matrons and your maids, could not fill up</A><br> +<A NAME=4.3.75>The cistern of my lust, and my desire</A><br> +<A NAME=4.3.76>All continent impediments would o'erbear</A><br> +<A NAME=4.3.77>That did oppose my will: better Macbeth</A><br> +<A NAME=4.3.78>Than such an one to reign.</A><br> +</blockquote> + +<A NAME=speech14><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.79>Boundless intemperance</A><br> +<A NAME=4.3.80>In nature is a tyranny; it hath been</A><br> +<A NAME=4.3.81>The untimely emptying of the happy throne</A><br> +<A NAME=4.3.82>And fall of many kings. But fear not yet</A><br> +<A NAME=4.3.83>To take upon you what is yours: you may</A><br> +<A NAME=4.3.84>Convey your pleasures in a spacious plenty,</A><br> +<A NAME=4.3.85>And yet seem cold, the time you may so hoodwink.</A><br> +<A NAME=4.3.86>We have willing dames enough: there cannot be</A><br> +<A NAME=4.3.87>That vulture in you, to devour so many</A><br> +<A NAME=4.3.88>As will to greatness dedicate themselves,</A><br> +<A NAME=4.3.89>Finding it so inclined.</A><br> +</blockquote> + +<A NAME=speech15><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.90>With this there grows</A><br> +<A NAME=4.3.91>In my most ill-composed affection such</A><br> +<A NAME=4.3.92>A stanchless avarice that, were I king,</A><br> +<A NAME=4.3.93>I should cut off the nobles for their lands,</A><br> +<A NAME=4.3.94>Desire his jewels and this other's house:</A><br> +<A NAME=4.3.95>And my more-having would be as a sauce</A><br> +<A NAME=4.3.96>To make me hunger more; that I should forge</A><br> +<A NAME=4.3.97>Quarrels unjust against the good and loyal,</A><br> +<A NAME=4.3.98>Destroying them for wealth.</A><br> +</blockquote> + +<A NAME=speech16><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.99>This avarice</A><br> +<A NAME=4.3.100>Sticks deeper, grows with more pernicious root</A><br> +<A NAME=4.3.101>Than summer-seeming lust, and it hath been</A><br> +<A NAME=4.3.102>The sword of our slain kings: yet do not fear;</A><br> +<A NAME=4.3.103>Scotland hath foisons to fill up your will.</A><br> +<A NAME=4.3.104>Of your mere own: all these are portable,</A><br> +<A NAME=4.3.105>With other graces weigh'd.</A><br> +</blockquote> + +<A NAME=speech17><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.106>But I have none: the king-becoming graces,</A><br> +<A NAME=4.3.107>As justice, verity, temperance, stableness,</A><br> +<A NAME=4.3.108>Bounty, perseverance, mercy, lowliness,</A><br> +<A NAME=4.3.109>Devotion, patience, courage, fortitude,</A><br> +<A NAME=4.3.110>I have no relish of them, but abound</A><br> +<A NAME=4.3.111>In the division of each several crime,</A><br> +<A NAME=4.3.112>Acting it many ways. Nay, had I power, I should</A><br> +<A NAME=4.3.113>Pour the sweet milk of concord into hell,</A><br> +<A NAME=4.3.114>Uproar the universal peace, confound</A><br> +<A NAME=4.3.115>All unity on earth.</A><br> +</blockquote> + +<A NAME=speech18><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.116>O Scotland, Scotland!</A><br> +</blockquote> + +<A NAME=speech19><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.117>If such a one be fit to govern, speak:</A><br> +<A NAME=4.3.118>I am as I have spoken.</A><br> +</blockquote> + +<A NAME=speech20><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.119>Fit to govern!</A><br> +<A NAME=4.3.120>No, not to live. O nation miserable,</A><br> +<A NAME=4.3.121>With an untitled tyrant bloody-scepter'd,</A><br> +<A NAME=4.3.122>When shalt thou see thy wholesome days again,</A><br> +<A NAME=4.3.123>Since that the truest issue of thy throne</A><br> +<A NAME=4.3.124>By his own interdiction stands accursed,</A><br> +<A NAME=4.3.125>And does blaspheme his breed? Thy royal father</A><br> +<A NAME=4.3.126>Was a most sainted king: the queen that bore thee,</A><br> +<A NAME=4.3.127>Oftener upon her knees than on her feet,</A><br> +<A NAME=4.3.128>Died every day she lived. Fare thee well!</A><br> +<A NAME=4.3.129>These evils thou repeat'st upon thyself</A><br> +<A NAME=4.3.130>Have banish'd me from Scotland. O my breast,</A><br> +<A NAME=4.3.131>Thy hope ends here!</A><br> +</blockquote> + +<A NAME=speech21><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.132>Macduff, this noble passion,</A><br> +<A NAME=4.3.133>Child of integrity, hath from my soul</A><br> +<A NAME=4.3.134>Wiped the black scruples, reconciled my thoughts</A><br> +<A NAME=4.3.135>To thy good truth and honour. Devilish Macbeth</A><br> +<A NAME=4.3.136>By many of these trains hath sought to win me</A><br> +<A NAME=4.3.137>Into his power, and modest wisdom plucks me</A><br> +<A NAME=4.3.138>From over-credulous haste: but God above</A><br> +<A NAME=4.3.139>Deal between thee and me! for even now</A><br> +<A NAME=4.3.140>I put myself to thy direction, and</A><br> +<A NAME=4.3.141>Unspeak mine own detraction, here abjure</A><br> +<A NAME=4.3.142>The taints and blames I laid upon myself,</A><br> +<A NAME=4.3.143>For strangers to my nature. I am yet</A><br> +<A NAME=4.3.144>Unknown to woman, never was forsworn,</A><br> +<A NAME=4.3.145>Scarcely have coveted what was mine own,</A><br> +<A NAME=4.3.146>At no time broke my faith, would not betray</A><br> +<A NAME=4.3.147>The devil to his fellow and delight</A><br> +<A NAME=4.3.148>No less in truth than life: my first false speaking</A><br> +<A NAME=4.3.149>Was this upon myself: what I am truly,</A><br> +<A NAME=4.3.150>Is thine and my poor country's to command:</A><br> +<A NAME=4.3.151>Whither indeed, before thy here-approach,</A><br> +<A NAME=4.3.152>Old Siward, with ten thousand warlike men,</A><br> +<A NAME=4.3.153>Already at a point, was setting forth.</A><br> +<A NAME=4.3.154>Now we'll together; and the chance of goodness</A><br> +<A NAME=4.3.155>Be like our warranted quarrel! Why are you silent?</A><br> +</blockquote> + +<A NAME=speech22><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.156>Such welcome and unwelcome things at once</A><br> +<A NAME=4.3.157>'Tis hard to reconcile.</A><br> +<p><i>Enter a Doctor</i></p> +</blockquote> + +<A NAME=speech23><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.158>Well; more anon.--Comes the king forth, I pray you?</A><br> +</blockquote> + +<A NAME=speech24><b>Doctor</b></a> +<blockquote> +<A NAME=4.3.159>Ay, sir; there are a crew of wretched souls</A><br> +<A NAME=4.3.160>That stay his cure: their malady convinces</A><br> +<A NAME=4.3.161>The great assay of art; but at his touch--</A><br> +<A NAME=4.3.162>Such sanctity hath heaven given his hand--</A><br> +<A NAME=4.3.163>They presently amend.</A><br> +</blockquote> + +<A NAME=speech25><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.164>I thank you, doctor.</A><br> +<p><i>Exit Doctor</i></p> +</blockquote> + +<A NAME=speech26><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.165>What's the disease he means?</A><br> +</blockquote> + +<A NAME=speech27><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.166>'Tis call'd the evil:</A><br> +<A NAME=4.3.167>A most miraculous work in this good king;</A><br> +<A NAME=4.3.168>Which often, since my here-remain in England,</A><br> +<A NAME=4.3.169>I have seen him do. How he solicits heaven,</A><br> +<A NAME=4.3.170>Himself best knows: but strangely-visited people,</A><br> +<A NAME=4.3.171>All swoln and ulcerous, pitiful to the eye,</A><br> +<A NAME=4.3.172>The mere despair of surgery, he cures,</A><br> +<A NAME=4.3.173>Hanging a golden stamp about their necks,</A><br> +<A NAME=4.3.174>Put on with holy prayers: and 'tis spoken,</A><br> +<A NAME=4.3.175>To the succeeding royalty he leaves</A><br> +<A NAME=4.3.176>The healing benediction. With this strange virtue,</A><br> +<A NAME=4.3.177>He hath a heavenly gift of prophecy,</A><br> +<A NAME=4.3.178>And sundry blessings hang about his throne,</A><br> +<A NAME=4.3.179>That speak him full of grace.</A><br> +<p><i>Enter ROSS</i></p> +</blockquote> + +<A NAME=speech28><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.180>See, who comes here?</A><br> +</blockquote> + +<A NAME=speech29><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.181>My countryman; but yet I know him not.</A><br> +</blockquote> + +<A NAME=speech30><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.182>My ever-gentle cousin, welcome hither.</A><br> +</blockquote> + +<A NAME=speech31><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.183>I know him now. Good God, betimes remove</A><br> +<A NAME=4.3.184>The means that makes us strangers!</A><br> +</blockquote> + +<A NAME=speech32><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.185>Sir, amen.</A><br> +</blockquote> + +<A NAME=speech33><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.186>Stands Scotland where it did?</A><br> +</blockquote> + +<A NAME=speech34><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.187>Alas, poor country!</A><br> +<A NAME=4.3.188>Almost afraid to know itself. It cannot</A><br> +<A NAME=4.3.189>Be call'd our mother, but our grave; where nothing,</A><br> +<A NAME=4.3.190>But who knows nothing, is once seen to smile;</A><br> +<A NAME=4.3.191>Where sighs and groans and shrieks that rend the air</A><br> +<A NAME=4.3.192>Are made, not mark'd; where violent sorrow seems</A><br> +<A NAME=4.3.193>A modern ecstasy; the dead man's knell</A><br> +<A NAME=4.3.194>Is there scarce ask'd for who; and good men's lives</A><br> +<A NAME=4.3.195>Expire before the flowers in their caps,</A><br> +<A NAME=4.3.196>Dying or ere they sicken.</A><br> +</blockquote> + +<A NAME=speech35><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.197>O, relation</A><br> +<A NAME=4.3.198>Too nice, and yet too true!</A><br> +</blockquote> + +<A NAME=speech36><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.199>What's the newest grief?</A><br> +</blockquote> + +<A NAME=speech37><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.200>That of an hour's age doth hiss the speaker:</A><br> +<A NAME=4.3.201>Each minute teems a new one.</A><br> +</blockquote> + +<A NAME=speech38><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.202>How does my wife?</A><br> +</blockquote> + +<A NAME=speech39><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.203>Why, well.</A><br> +</blockquote> + +<A NAME=speech40><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.204> And all my children?</A><br> +</blockquote> + +<A NAME=speech41><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.205>Well too.</A><br> +</blockquote> + +<A NAME=speech42><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.206>The tyrant has not batter'd at their peace?</A><br> +</blockquote> + +<A NAME=speech43><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.207>No; they were well at peace when I did leave 'em.</A><br> +</blockquote> + +<A NAME=speech44><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.208>But not a niggard of your speech: how goes't?</A><br> +</blockquote> + +<A NAME=speech45><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.209>When I came hither to transport the tidings,</A><br> +<A NAME=4.3.210>Which I have heavily borne, there ran a rumour</A><br> +<A NAME=4.3.211>Of many worthy fellows that were out;</A><br> +<A NAME=4.3.212>Which was to my belief witness'd the rather,</A><br> +<A NAME=4.3.213>For that I saw the tyrant's power a-foot:</A><br> +<A NAME=4.3.214>Now is the time of help; your eye in Scotland</A><br> +<A NAME=4.3.215>Would create soldiers, make our women fight,</A><br> +<A NAME=4.3.216>To doff their dire distresses.</A><br> +</blockquote> + +<A NAME=speech46><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.217>Be't their comfort</A><br> +<A NAME=4.3.218>We are coming thither: gracious England hath</A><br> +<A NAME=4.3.219>Lent us good Siward and ten thousand men;</A><br> +<A NAME=4.3.220>An older and a better soldier none</A><br> +<A NAME=4.3.221>That Christendom gives out.</A><br> +</blockquote> + +<A NAME=speech47><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.222>Would I could answer</A><br> +<A NAME=4.3.223>This comfort with the like! But I have words</A><br> +<A NAME=4.3.224>That would be howl'd out in the desert air,</A><br> +<A NAME=4.3.225>Where hearing should not latch them.</A><br> +</blockquote> + +<A NAME=speech48><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.226>What concern they?</A><br> +<A NAME=4.3.227>The general cause? or is it a fee-grief</A><br> +<A NAME=4.3.228>Due to some single breast?</A><br> +</blockquote> + +<A NAME=speech49><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.229>No mind that's honest</A><br> +<A NAME=4.3.230>But in it shares some woe; though the main part</A><br> +<A NAME=4.3.231>Pertains to you alone.</A><br> +</blockquote> + +<A NAME=speech50><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.232>If it be mine,</A><br> +<A NAME=4.3.233>Keep it not from me, quickly let me have it.</A><br> +</blockquote> + +<A NAME=speech51><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.234>Let not your ears despise my tongue for ever,</A><br> +<A NAME=4.3.235>Which shall possess them with the heaviest sound</A><br> +<A NAME=4.3.236>That ever yet they heard.</A><br> +</blockquote> + +<A NAME=speech52><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.237>Hum! I guess at it.</A><br> +</blockquote> + +<A NAME=speech53><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.238>Your castle is surprised; your wife and babes</A><br> +<A NAME=4.3.239>Savagely slaughter'd: to relate the manner,</A><br> +<A NAME=4.3.240>Were, on the quarry of these murder'd deer,</A><br> +<A NAME=4.3.241>To add the death of you.</A><br> +</blockquote> + +<A NAME=speech54><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.242>Merciful heaven!</A><br> +<A NAME=4.3.243>What, man! ne'er pull your hat upon your brows;</A><br> +<A NAME=4.3.244>Give sorrow words: the grief that does not speak</A><br> +<A NAME=4.3.245>Whispers the o'er-fraught heart and bids it break.</A><br> +</blockquote> + +<A NAME=speech55><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.246>My children too?</A><br> +</blockquote> + +<A NAME=speech56><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.247> Wife, children, servants, all</A><br> +<A NAME=4.3.248>That could be found.</A><br> +</blockquote> + +<A NAME=speech57><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.249>And I must be from thence!</A><br> +<A NAME=4.3.250>My wife kill'd too?</A><br> +</blockquote> + +<A NAME=speech58><b>ROSS</b></a> +<blockquote> +<A NAME=4.3.251>I have said.</A><br> +</blockquote> + +<A NAME=speech59><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.252>Be comforted:</A><br> +<A NAME=4.3.253>Let's make us medicines of our great revenge,</A><br> +<A NAME=4.3.254>To cure this deadly grief.</A><br> +</blockquote> + +<A NAME=speech60><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.255>He has no children. All my pretty ones?</A><br> +<A NAME=4.3.256>Did you say all? O hell-kite! All?</A><br> +<A NAME=4.3.257>What, all my pretty chickens and their dam</A><br> +<A NAME=4.3.258>At one fell swoop?</A><br> +</blockquote> + +<A NAME=speech61><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.259>Dispute it like a man.</A><br> +</blockquote> + +<A NAME=speech62><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.260>I shall do so;</A><br> +<A NAME=4.3.261>But I must also feel it as a man:</A><br> +<A NAME=4.3.262>I cannot but remember such things were,</A><br> +<A NAME=4.3.263>That were most precious to me. Did heaven look on,</A><br> +<A NAME=4.3.264>And would not take their part? Sinful Macduff,</A><br> +<A NAME=4.3.265>They were all struck for thee! naught that I am,</A><br> +<A NAME=4.3.266>Not for their own demerits, but for mine,</A><br> +<A NAME=4.3.267>Fell slaughter on their souls. Heaven rest them now!</A><br> +</blockquote> + +<A NAME=speech63><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.268>Be this the whetstone of your sword: let grief</A><br> +<A NAME=4.3.269>Convert to anger; blunt not the heart, enrage it.</A><br> +</blockquote> + +<A NAME=speech64><b>MACDUFF</b></a> +<blockquote> +<A NAME=4.3.270>O, I could play the woman with mine eyes</A><br> +<A NAME=4.3.271>And braggart with my tongue! But, gentle heavens,</A><br> +<A NAME=4.3.272>Cut short all intermission; front to front</A><br> +<A NAME=4.3.273>Bring thou this fiend of Scotland and myself;</A><br> +<A NAME=4.3.274>Within my sword's length set him; if he 'scape,</A><br> +<A NAME=4.3.275>Heaven forgive him too!</A><br> +</blockquote> + +<A NAME=speech65><b>MALCOLM</b></a> +<blockquote> +<A NAME=4.3.276>This tune goes manly.</A><br> +<A NAME=4.3.277>Come, go we to the king; our power is ready;</A><br> +<A NAME=4.3.278>Our lack is nothing but our leave; Macbeth</A><br> +<A NAME=4.3.279>Is ripe for shaking, and the powers above</A><br> +<A NAME=4.3.280>Put on their instruments. Receive what cheer you may:</A><br> +<A NAME=4.3.281>The night is long that never finds the day.</A><br> +<p><i>Exeunt</i></p> +</blockquote><p> +<H3>ACT V</h3> +<h3>SCENE I. Dunsinane. Ante-room in the castle.</h3> +<p><blockquote> +<i>Enter a Doctor of Physic and a Waiting-Gentlewoman</i> +</blockquote> + +<A NAME=speech1><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.1>I have two nights watched with you, but can perceive</A><br> +<A NAME=5.1.2>no truth in your report. When was it she last walked?</A><br> +</blockquote> + +<A NAME=speech2><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.3>Since his majesty went into the field, I have seen</A><br> +<A NAME=5.1.4>her rise from her bed, throw her night-gown upon</A><br> +<A NAME=5.1.5>her, unlock her closet, take forth paper, fold it,</A><br> +<A NAME=5.1.6>write upon't, read it, afterwards seal it, and again</A><br> +<A NAME=5.1.7>return to bed; yet all this while in a most fast sleep.</A><br> +</blockquote> + +<A NAME=speech3><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.8>A great perturbation in nature, to receive at once</A><br> +<A NAME=5.1.9>the benefit of sleep, and do the effects of</A><br> +<A NAME=5.1.10>watching! In this slumbery agitation, besides her</A><br> +<A NAME=5.1.11>walking and other actual performances, what, at any</A><br> +<A NAME=5.1.12>time, have you heard her say?</A><br> +</blockquote> + +<A NAME=speech4><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.13>That, sir, which I will not report after her.</A><br> +</blockquote> + +<A NAME=speech5><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.14>You may to me: and 'tis most meet you should.</A><br> +</blockquote> + +<A NAME=speech6><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.15>Neither to you nor any one; having no witness to</A><br> +<A NAME=5.1.16>confirm my speech.</A><br> +<p><i>Enter LADY MACBETH, with a taper</i></p> +<A NAME=5.1.17>Lo you, here she comes! This is her very guise;</A><br> +<A NAME=5.1.18>and, upon my life, fast asleep. Observe her; stand close.</A><br> +</blockquote> + +<A NAME=speech7><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.19>How came she by that light?</A><br> +</blockquote> + +<A NAME=speech8><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.20>Why, it stood by her: she has light by her</A><br> +<A NAME=5.1.21>continually; 'tis her command.</A><br> +</blockquote> + +<A NAME=speech9><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.22>You see, her eyes are open.</A><br> +</blockquote> + +<A NAME=speech10><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.23>Ay, but their sense is shut.</A><br> +</blockquote> + +<A NAME=speech11><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.24>What is it she does now? Look, how she rubs her hands.</A><br> +</blockquote> + +<A NAME=speech12><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.25>It is an accustomed action with her, to seem thus</A><br> +<A NAME=5.1.26>washing her hands: I have known her continue in</A><br> +<A NAME=5.1.27>this a quarter of an hour.</A><br> +</blockquote> + +<A NAME=speech13><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.28>Yet here's a spot.</A><br> +</blockquote> + +<A NAME=speech14><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.29>Hark! she speaks: I will set down what comes from</A><br> +<A NAME=5.1.30>her, to satisfy my remembrance the more strongly.</A><br> +</blockquote> + +<A NAME=speech15><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.31>Out, damned spot! out, I say!--One: two: why,</A><br> +<A NAME=5.1.32>then, 'tis time to do't.--Hell is murky!--Fie, my</A><br> +<A NAME=5.1.33>lord, fie! a soldier, and afeard? What need we</A><br> +<A NAME=5.1.34>fear who knows it, when none can call our power to</A><br> +<A NAME=5.1.35>account?--Yet who would have thought the old man</A><br> +<A NAME=5.1.36>to have had so much blood in him.</A><br> +</blockquote> + +<A NAME=speech16><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.37>Do you mark that?</A><br> +</blockquote> + +<A NAME=speech17><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.38>The thane of Fife had a wife: where is she now?--</A><br> +<A NAME=5.1.39>What, will these hands ne'er be clean?--No more o'</A><br> +<A NAME=5.1.40>that, my lord, no more o' that: you mar all with</A><br> +<A NAME=5.1.41>this starting.</A><br> +</blockquote> + +<A NAME=speech18><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.42>Go to, go to; you have known what you should not.</A><br> +</blockquote> + +<A NAME=speech19><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.43>She has spoke what she should not, I am sure of</A><br> +<A NAME=5.1.44>that: heaven knows what she has known.</A><br> +</blockquote> + +<A NAME=speech20><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.45>Here's the smell of the blood still: all the</A><br> +<A NAME=5.1.46>perfumes of Arabia will not sweeten this little</A><br> +<A NAME=5.1.47>hand. Oh, oh, oh!</A><br> +</blockquote> + +<A NAME=speech21><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.48>What a sigh is there! The heart is sorely charged.</A><br> +</blockquote> + +<A NAME=speech22><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.49>I would not have such a heart in my bosom for the</A><br> +<A NAME=5.1.50>dignity of the whole body.</A><br> +</blockquote> + +<A NAME=speech23><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.51>Well, well, well,--</A><br> +</blockquote> + +<A NAME=speech24><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.52>Pray God it be, sir.</A><br> +</blockquote> + +<A NAME=speech25><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.53>This disease is beyond my practise: yet I have known</A><br> +<A NAME=5.1.54>those which have walked in their sleep who have died</A><br> +<A NAME=5.1.55>holily in their beds.</A><br> +</blockquote> + +<A NAME=speech26><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.56>Wash your hands, put on your nightgown; look not so</A><br> +<A NAME=5.1.57>pale.--I tell you yet again, Banquo's buried; he</A><br> +<A NAME=5.1.58>cannot come out on's grave.</A><br> +</blockquote> + +<A NAME=speech27><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.59>Even so?</A><br> +</blockquote> + +<A NAME=speech28><b>LADY MACBETH</b></a> +<blockquote> +<A NAME=5.1.60>To bed, to bed! there's knocking at the gate:</A><br> +<A NAME=5.1.61>come, come, come, come, give me your hand. What's</A><br> +<A NAME=5.1.62>done cannot be undone.--To bed, to bed, to bed!</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech29><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.63>Will she go now to bed?</A><br> +</blockquote> + +<A NAME=speech30><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.64>Directly.</A><br> +</blockquote> + +<A NAME=speech31><b>Doctor</b></a> +<blockquote> +<A NAME=5.1.65>Foul whisperings are abroad: unnatural deeds</A><br> +<A NAME=5.1.66>Do breed unnatural troubles: infected minds</A><br> +<A NAME=5.1.67>To their deaf pillows will discharge their secrets:</A><br> +<A NAME=5.1.68>More needs she the divine than the physician.</A><br> +<A NAME=5.1.69>God, God forgive us all! Look after her;</A><br> +<A NAME=5.1.70>Remove from her the means of all annoyance,</A><br> +<A NAME=5.1.71>And still keep eyes upon her. So, good night:</A><br> +<A NAME=5.1.72>My mind she has mated, and amazed my sight.</A><br> +<A NAME=5.1.73>I think, but dare not speak.</A><br> +</blockquote> + +<A NAME=speech32><b>Gentlewoman</b></a> +<blockquote> +<A NAME=5.1.74>Good night, good doctor.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE II. The country near Dunsinane.</h3> +<p><blockquote> +<i>Drum and colours. Enter MENTEITH, CAITHNESS, ANGUS, LENNOX, and Soldiers</i> +</blockquote> + +<A NAME=speech1><b>MENTEITH</b></a> +<blockquote> +<A NAME=5.2.1>The English power is near, led on by Malcolm,</A><br> +<A NAME=5.2.2>His uncle Siward and the good Macduff:</A><br> +<A NAME=5.2.3>Revenges burn in them; for their dear causes</A><br> +<A NAME=5.2.4>Would to the bleeding and the grim alarm</A><br> +<A NAME=5.2.5>Excite the mortified man.</A><br> +</blockquote> + +<A NAME=speech2><b>ANGUS</b></a> +<blockquote> +<A NAME=5.2.6>Near Birnam wood</A><br> +<A NAME=5.2.7>Shall we well meet them; that way are they coming.</A><br> +</blockquote> + +<A NAME=speech3><b>CAITHNESS</b></a> +<blockquote> +<A NAME=5.2.8>Who knows if Donalbain be with his brother?</A><br> +</blockquote> + +<A NAME=speech4><b>LENNOX</b></a> +<blockquote> +<A NAME=5.2.9>For certain, sir, he is not: I have a file</A><br> +<A NAME=5.2.10>Of all the gentry: there is Siward's son,</A><br> +<A NAME=5.2.11>And many unrough youths that even now</A><br> +<A NAME=5.2.12>Protest their first of manhood.</A><br> +</blockquote> + +<A NAME=speech5><b>MENTEITH</b></a> +<blockquote> +<A NAME=5.2.13>What does the tyrant?</A><br> +</blockquote> + +<A NAME=speech6><b>CAITHNESS</b></a> +<blockquote> +<A NAME=5.2.14>Great Dunsinane he strongly fortifies:</A><br> +<A NAME=5.2.15>Some say he's mad; others that lesser hate him</A><br> +<A NAME=5.2.16>Do call it valiant fury: but, for certain,</A><br> +<A NAME=5.2.17>He cannot buckle his distemper'd cause</A><br> +<A NAME=5.2.18>Within the belt of rule.</A><br> +</blockquote> + +<A NAME=speech7><b>ANGUS</b></a> +<blockquote> +<A NAME=5.2.19>Now does he feel</A><br> +<A NAME=5.2.20>His secret murders sticking on his hands;</A><br> +<A NAME=5.2.21>Now minutely revolts upbraid his faith-breach;</A><br> +<A NAME=5.2.22>Those he commands move only in command,</A><br> +<A NAME=5.2.23>Nothing in love: now does he feel his title</A><br> +<A NAME=5.2.24>Hang loose about him, like a giant's robe</A><br> +<A NAME=5.2.25>Upon a dwarfish thief.</A><br> +</blockquote> + +<A NAME=speech8><b>MENTEITH</b></a> +<blockquote> +<A NAME=5.2.26>Who then shall blame</A><br> +<A NAME=5.2.27>His pester'd senses to recoil and start,</A><br> +<A NAME=5.2.28>When all that is within him does condemn</A><br> +<A NAME=5.2.29>Itself for being there?</A><br> +</blockquote> + +<A NAME=speech9><b>CAITHNESS</b></a> +<blockquote> +<A NAME=5.2.30>Well, march we on,</A><br> +<A NAME=5.2.31>To give obedience where 'tis truly owed:</A><br> +<A NAME=5.2.32>Meet we the medicine of the sickly weal,</A><br> +<A NAME=5.2.33>And with him pour we in our country's purge</A><br> +<A NAME=5.2.34>Each drop of us.</A><br> +</blockquote> + +<A NAME=speech10><b>LENNOX</b></a> +<blockquote> +<A NAME=5.2.35> Or so much as it needs,</A><br> +<A NAME=5.2.36>To dew the sovereign flower and drown the weeds.</A><br> +<A NAME=5.2.37>Make we our march towards Birnam.</A><br> +<p><i>Exeunt, marching</i></p> +</blockquote> +<h3>SCENE III. Dunsinane. A room in the castle.</h3> +<p><blockquote> +<i>Enter MACBETH, Doctor, and Attendants</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.1>Bring me no more reports; let them fly all:</A><br> +<A NAME=5.3.2>Till Birnam wood remove to Dunsinane,</A><br> +<A NAME=5.3.3>I cannot taint with fear. What's the boy Malcolm?</A><br> +<A NAME=5.3.4>Was he not born of woman? The spirits that know</A><br> +<A NAME=5.3.5>All mortal consequences have pronounced me thus:</A><br> +<A NAME=5.3.6>'Fear not, Macbeth; no man that's born of woman</A><br> +<A NAME=5.3.7>Shall e'er have power upon thee.' Then fly,</A><br> +<A NAME=5.3.8>false thanes,</A><br> +<A NAME=5.3.9>And mingle with the English epicures:</A><br> +<A NAME=5.3.10>The mind I sway by and the heart I bear</A><br> +<A NAME=5.3.11>Shall never sag with doubt nor shake with fear.</A><br> +<p><i>Enter a Servant</i></p> +<A NAME=5.3.12>The devil damn thee black, thou cream-faced loon!</A><br> +<A NAME=5.3.13>Where got'st thou that goose look?</A><br> +</blockquote> + +<A NAME=speech2><b>Servant</b></a> +<blockquote> +<A NAME=5.3.14>There is ten thousand--</A><br> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.15>Geese, villain!</A><br> +</blockquote> + +<A NAME=speech4><b>Servant</b></a> +<blockquote> +<A NAME=5.3.16>Soldiers, sir.</A><br> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.17>Go prick thy face, and over-red thy fear,</A><br> +<A NAME=5.3.18>Thou lily-liver'd boy. What soldiers, patch?</A><br> +<A NAME=5.3.19>Death of thy soul! those linen cheeks of thine</A><br> +<A NAME=5.3.20>Are counsellors to fear. What soldiers, whey-face?</A><br> +</blockquote> + +<A NAME=speech6><b>Servant</b></a> +<blockquote> +<A NAME=5.3.21>The English force, so please you.</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.22>Take thy face hence.</A><br> +<p><i>Exit Servant</i></p> +<A NAME=5.3.23>Seyton!--I am sick at heart,</A><br> +<A NAME=5.3.24>When I behold--Seyton, I say!--This push</A><br> +<A NAME=5.3.25>Will cheer me ever, or disseat me now.</A><br> +<A NAME=5.3.26>I have lived long enough: my way of life</A><br> +<A NAME=5.3.27>Is fall'n into the sear, the yellow leaf;</A><br> +<A NAME=5.3.28>And that which should accompany old age,</A><br> +<A NAME=5.3.29>As honour, love, obedience, troops of friends,</A><br> +<A NAME=5.3.30>I must not look to have; but, in their stead,</A><br> +<A NAME=5.3.31>Curses, not loud but deep, mouth-honour, breath,</A><br> +<A NAME=5.3.32>Which the poor heart would fain deny, and dare not. Seyton!</A><br> +<p><i>Enter SEYTON</i></p> +</blockquote> + +<A NAME=speech8><b>SEYTON</b></a> +<blockquote> +<A NAME=5.3.33>What is your gracious pleasure?</A><br> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.34>What news more?</A><br> +</blockquote> + +<A NAME=speech10><b>SEYTON</b></a> +<blockquote> +<A NAME=5.3.35>All is confirm'd, my lord, which was reported.</A><br> +</blockquote> + +<A NAME=speech11><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.36>I'll fight till from my bones my flesh be hack'd.</A><br> +<A NAME=5.3.37>Give me my armour.</A><br> +</blockquote> + +<A NAME=speech12><b>SEYTON</b></a> +<blockquote> +<A NAME=5.3.38>'Tis not needed yet.</A><br> +</blockquote> + +<A NAME=speech13><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.39>I'll put it on.</A><br> +<A NAME=5.3.40>Send out more horses; skirr the country round;</A><br> +<A NAME=5.3.41>Hang those that talk of fear. Give me mine armour.</A><br> +<A NAME=5.3.42>How does your patient, doctor?</A><br> +</blockquote> + +<A NAME=speech14><b>Doctor</b></a> +<blockquote> +<A NAME=5.3.43>Not so sick, my lord,</A><br> +<A NAME=5.3.44>As she is troubled with thick coming fancies,</A><br> +<A NAME=5.3.45>That keep her from her rest.</A><br> +</blockquote> + +<A NAME=speech15><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.46>Cure her of that.</A><br> +<A NAME=5.3.47>Canst thou not minister to a mind diseased,</A><br> +<A NAME=5.3.48>Pluck from the memory a rooted sorrow,</A><br> +<A NAME=5.3.49>Raze out the written troubles of the brain</A><br> +<A NAME=5.3.50>And with some sweet oblivious antidote</A><br> +<A NAME=5.3.51>Cleanse the stuff'd bosom of that perilous stuff</A><br> +<A NAME=5.3.52>Which weighs upon the heart?</A><br> +</blockquote> + +<A NAME=speech16><b>Doctor</b></a> +<blockquote> +<A NAME=5.3.53>Therein the patient</A><br> +<A NAME=5.3.54>Must minister to himself.</A><br> +</blockquote> + +<A NAME=speech17><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.55>Throw physic to the dogs; I'll none of it.</A><br> +<A NAME=5.3.56>Come, put mine armour on; give me my staff.</A><br> +<A NAME=5.3.57>Seyton, send out. Doctor, the thanes fly from me.</A><br> +<A NAME=5.3.58>Come, sir, dispatch. If thou couldst, doctor, cast</A><br> +<A NAME=5.3.59>The water of my land, find her disease,</A><br> +<A NAME=5.3.60>And purge it to a sound and pristine health,</A><br> +<A NAME=5.3.61>I would applaud thee to the very echo,</A><br> +<A NAME=5.3.62>That should applaud again.--Pull't off, I say.--</A><br> +<A NAME=5.3.63>What rhubarb, cyme, or what purgative drug,</A><br> +<A NAME=5.3.64>Would scour these English hence? Hear'st thou of them?</A><br> +</blockquote> + +<A NAME=speech18><b>Doctor</b></a> +<blockquote> +<A NAME=5.3.65>Ay, my good lord; your royal preparation</A><br> +<A NAME=5.3.66>Makes us hear something.</A><br> +</blockquote> + +<A NAME=speech19><b>MACBETH</b></a> +<blockquote> +<A NAME=5.3.67>Bring it after me.</A><br> +<A NAME=5.3.68>I will not be afraid of death and bane,</A><br> +<A NAME=5.3.69>Till Birnam forest come to Dunsinane.</A><br> +</blockquote> + +<A NAME=speech20><b>Doctor</b></a> +<blockquote> +<A NAME=5.3.70>[Aside] Were I from Dunsinane away and clear,</A><br> +<A NAME=5.3.71>Profit again should hardly draw me here.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE IV. Country near Birnam wood.</h3> +<p><blockquote> +<i>Drum and colours. Enter MALCOLM, SIWARD and YOUNG SIWARD, MACDUFF, MENTEITH, CAITHNESS, ANGUS, LENNOX, ROSS, and Soldiers, marching</i> +</blockquote> + +<A NAME=speech1><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.4.1>Cousins, I hope the days are near at hand</A><br> +<A NAME=5.4.2>That chambers will be safe.</A><br> +</blockquote> + +<A NAME=speech2><b>MENTEITH</b></a> +<blockquote> +<A NAME=5.4.3>We doubt it nothing.</A><br> +</blockquote> + +<A NAME=speech3><b>SIWARD</b></a> +<blockquote> +<A NAME=5.4.4>What wood is this before us?</A><br> +</blockquote> + +<A NAME=speech4><b>MENTEITH</b></a> +<blockquote> +<A NAME=5.4.5>The wood of Birnam.</A><br> +</blockquote> + +<A NAME=speech5><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.4.6>Let every soldier hew him down a bough</A><br> +<A NAME=5.4.7>And bear't before him: thereby shall we shadow</A><br> +<A NAME=5.4.8>The numbers of our host and make discovery</A><br> +<A NAME=5.4.9>Err in report of us.</A><br> +</blockquote> + +<A NAME=speech6><b>Soldiers</b></a> +<blockquote> +<A NAME=5.4.10>It shall be done.</A><br> +</blockquote> + +<A NAME=speech7><b>SIWARD</b></a> +<blockquote> +<A NAME=5.4.11>We learn no other but the confident tyrant</A><br> +<A NAME=5.4.12>Keeps still in Dunsinane, and will endure</A><br> +<A NAME=5.4.13>Our setting down before 't.</A><br> +</blockquote> + +<A NAME=speech8><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.4.14>'Tis his main hope:</A><br> +<A NAME=5.4.15>For where there is advantage to be given,</A><br> +<A NAME=5.4.16>Both more and less have given him the revolt,</A><br> +<A NAME=5.4.17>And none serve with him but constrained things</A><br> +<A NAME=5.4.18>Whose hearts are absent too.</A><br> +</blockquote> + +<A NAME=speech9><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.4.19>Let our just censures</A><br> +<A NAME=5.4.20>Attend the true event, and put we on</A><br> +<A NAME=5.4.21>Industrious soldiership.</A><br> +</blockquote> + +<A NAME=speech10><b>SIWARD</b></a> +<blockquote> +<A NAME=5.4.22>The time approaches</A><br> +<A NAME=5.4.23>That will with due decision make us know</A><br> +<A NAME=5.4.24>What we shall say we have and what we owe.</A><br> +<A NAME=5.4.25>Thoughts speculative their unsure hopes relate,</A><br> +<A NAME=5.4.26>But certain issue strokes must arbitrate:</A><br> +<A NAME=5.4.27>Towards which advance the war.</A><br> +<p><i>Exeunt, marching</i></p> +</blockquote> +<h3>SCENE V. Dunsinane. Within the castle.</h3> +<p><blockquote> +<i>Enter MACBETH, SEYTON, and Soldiers, with drum and colours</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.1>Hang out our banners on the outward walls;</A><br> +<A NAME=5.5.2>The cry is still 'They come:' our castle's strength</A><br> +<A NAME=5.5.3>Will laugh a siege to scorn: here let them lie</A><br> +<A NAME=5.5.4>Till famine and the ague eat them up:</A><br> +<A NAME=5.5.5>Were they not forced with those that should be ours,</A><br> +<A NAME=5.5.6>We might have met them dareful, beard to beard,</A><br> +<A NAME=5.5.7>And beat them backward home.</A><br> +<p><i>A cry of women within</i></p> +<A NAME=5.5.8>What is that noise?</A><br> +</blockquote> + +<A NAME=speech2><b>SEYTON</b></a> +<blockquote> +<A NAME=5.5.9>It is the cry of women, my good lord.</A><br> +<p><i>Exit</i></p> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.10>I have almost forgot the taste of fears;</A><br> +<A NAME=5.5.11>The time has been, my senses would have cool'd</A><br> +<A NAME=5.5.12>To hear a night-shriek; and my fell of hair</A><br> +<A NAME=5.5.13>Would at a dismal treatise rouse and stir</A><br> +<A NAME=5.5.14>As life were in't: I have supp'd full with horrors;</A><br> +<A NAME=5.5.15>Direness, familiar to my slaughterous thoughts</A><br> +<A NAME=5.5.16>Cannot once start me.</A><br> +<p><i>Re-enter SEYTON</i></p> +<A NAME=5.5.17>Wherefore was that cry?</A><br> +</blockquote> + +<A NAME=speech4><b>SEYTON</b></a> +<blockquote> +<A NAME=5.5.18>The queen, my lord, is dead.</A><br> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.19>She should have died hereafter;</A><br> +<A NAME=5.5.20>There would have been a time for such a word.</A><br> +<A NAME=5.5.21>To-morrow, and to-morrow, and to-morrow,</A><br> +<A NAME=5.5.22>Creeps in this petty pace from day to day</A><br> +<A NAME=5.5.23>To the last syllable of recorded time,</A><br> +<A NAME=5.5.24>And all our yesterdays have lighted fools</A><br> +<A NAME=5.5.25>The way to dusty death. Out, out, brief candle!</A><br> +<A NAME=5.5.26>Life's but a walking shadow, a poor player</A><br> +<A NAME=5.5.27>That struts and frets his hour upon the stage</A><br> +<A NAME=5.5.28>And then is heard no more: it is a tale</A><br> +<A NAME=5.5.29>Told by an idiot, full of sound and fury,</A><br> +<A NAME=5.5.30>Signifying nothing.</A><br> +<p><i>Enter a Messenger</i></p> +<A NAME=5.5.31>Thou comest to use thy tongue; thy story quickly.</A><br> +</blockquote> + +<A NAME=speech6><b>Messenger</b></a> +<blockquote> +<A NAME=5.5.32>Gracious my lord,</A><br> +<A NAME=5.5.33>I should report that which I say I saw,</A><br> +<A NAME=5.5.34>But know not how to do it.</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.35>Well, say, sir.</A><br> +</blockquote> + +<A NAME=speech8><b>Messenger</b></a> +<blockquote> +<A NAME=5.5.36>As I did stand my watch upon the hill,</A><br> +<A NAME=5.5.37>I look'd toward Birnam, and anon, methought,</A><br> +<A NAME=5.5.38>The wood began to move.</A><br> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.39>Liar and slave!</A><br> +</blockquote> + +<A NAME=speech10><b>Messenger</b></a> +<blockquote> +<A NAME=5.5.40>Let me endure your wrath, if't be not so:</A><br> +<A NAME=5.5.41>Within this three mile may you see it coming;</A><br> +<A NAME=5.5.42>I say, a moving grove.</A><br> +</blockquote> + +<A NAME=speech11><b>MACBETH</b></a> +<blockquote> +<A NAME=5.5.43>If thou speak'st false,</A><br> +<A NAME=5.5.44>Upon the next tree shalt thou hang alive,</A><br> +<A NAME=5.5.45>Till famine cling thee: if thy speech be sooth,</A><br> +<A NAME=5.5.46>I care not if thou dost for me as much.</A><br> +<A NAME=5.5.47>I pull in resolution, and begin</A><br> +<A NAME=5.5.48>To doubt the equivocation of the fiend</A><br> +<A NAME=5.5.49>That lies like truth: 'Fear not, till Birnam wood</A><br> +<A NAME=5.5.50>Do come to Dunsinane:' and now a wood</A><br> +<A NAME=5.5.51>Comes toward Dunsinane. Arm, arm, and out!</A><br> +<A NAME=5.5.52>If this which he avouches does appear,</A><br> +<A NAME=5.5.53>There is nor flying hence nor tarrying here.</A><br> +<A NAME=5.5.54>I gin to be aweary of the sun,</A><br> +<A NAME=5.5.55>And wish the estate o' the world were now undone.</A><br> +<A NAME=5.5.56>Ring the alarum-bell! Blow, wind! come, wrack!</A><br> +<A NAME=5.5.57>At least we'll die with harness on our back.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE VI. Dunsinane. Before the castle.</h3> +<p><blockquote> +<i>Drum and colours. Enter MALCOLM, SIWARD, MACDUFF, and their Army, with boughs</i> +</blockquote> + +<A NAME=speech1><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.6.1>Now near enough: your leafy screens throw down.</A><br> +<A NAME=5.6.2>And show like those you are. You, worthy uncle,</A><br> +<A NAME=5.6.3>Shall, with my cousin, your right-noble son,</A><br> +<A NAME=5.6.4>Lead our first battle: worthy Macduff and we</A><br> +<A NAME=5.6.5>Shall take upon 's what else remains to do,</A><br> +<A NAME=5.6.6>According to our order.</A><br> +</blockquote> + +<A NAME=speech2><b>SIWARD</b></a> +<blockquote> +<A NAME=5.6.7>Fare you well.</A><br> +<A NAME=5.6.8>Do we but find the tyrant's power to-night,</A><br> +<A NAME=5.6.9>Let us be beaten, if we cannot fight.</A><br> +</blockquote> + +<A NAME=speech3><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.6.10>Make all our trumpets speak; give them all breath,</A><br> +<A NAME=5.6.11>Those clamorous harbingers of blood and death.</A><br> +<p><i>Exeunt</i></p> +</blockquote> +<h3>SCENE VII. Another part of the field.</h3> +<p><blockquote> +<i>Alarums. Enter MACBETH</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=5.7.1>They have tied me to a stake; I cannot fly,</A><br> +<A NAME=5.7.2>But, bear-like, I must fight the course. What's he</A><br> +<A NAME=5.7.3>That was not born of woman? Such a one</A><br> +<A NAME=5.7.4>Am I to fear, or none.</A><br> +<p><i>Enter YOUNG SIWARD</i></p> +</blockquote> + +<A NAME=speech2><b>YOUNG SIWARD</b></a> +<blockquote> +<A NAME=5.7.5>What is thy name?</A><br> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=5.7.6> Thou'lt be afraid to hear it.</A><br> +</blockquote> + +<A NAME=speech4><b>YOUNG SIWARD</b></a> +<blockquote> +<A NAME=5.7.7>No; though thou call'st thyself a hotter name</A><br> +<A NAME=5.7.8>Than any is in hell.</A><br> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=5.7.9>My name's Macbeth.</A><br> +</blockquote> + +<A NAME=speech6><b>YOUNG SIWARD</b></a> +<blockquote> +<A NAME=5.7.10>The devil himself could not pronounce a title</A><br> +<A NAME=5.7.11>More hateful to mine ear.</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=5.7.12>No, nor more fearful.</A><br> +</blockquote> + +<A NAME=speech8><b>YOUNG SIWARD</b></a> +<blockquote> +<A NAME=5.7.13>Thou liest, abhorred tyrant; with my sword</A><br> +<A NAME=5.7.14>I'll prove the lie thou speak'st.</A><br> +<p><i>They fight and YOUNG SIWARD is slain</i></p> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=5.7.15>Thou wast born of woman</A><br> +<A NAME=5.7.16>But swords I smile at, weapons laugh to scorn,</A><br> +<A NAME=5.7.17>Brandish'd by man that's of a woman born.</A><br> +<p><i>Exit</i></p> +<p><i>Alarums. Enter MACDUFF</i></p> +</blockquote> + +<A NAME=speech10><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.7.18>That way the noise is. Tyrant, show thy face!</A><br> +<A NAME=5.7.19>If thou be'st slain and with no stroke of mine,</A><br> +<A NAME=5.7.20>My wife and children's ghosts will haunt me still.</A><br> +<A NAME=5.7.21>I cannot strike at wretched kerns, whose arms</A><br> +<A NAME=5.7.22>Are hired to bear their staves: either thou, Macbeth,</A><br> +<A NAME=5.7.23>Or else my sword with an unbatter'd edge</A><br> +<A NAME=5.7.24>I sheathe again undeeded. There thou shouldst be;</A><br> +<A NAME=5.7.25>By this great clatter, one of greatest note</A><br> +<A NAME=5.7.26>Seems bruited. Let me find him, fortune!</A><br> +<A NAME=5.7.27>And more I beg not.</A><br> +<p><i>Exit. Alarums</i></p> +<p><i>Enter MALCOLM and SIWARD</i></p> +</blockquote> + +<A NAME=speech11><b>SIWARD</b></a> +<blockquote> +<A NAME=5.7.28>This way, my lord; the castle's gently render'd:</A><br> +<A NAME=5.7.29>The tyrant's people on both sides do fight;</A><br> +<A NAME=5.7.30>The noble thanes do bravely in the war;</A><br> +<A NAME=5.7.31>The day almost itself professes yours,</A><br> +<A NAME=5.7.32>And little is to do.</A><br> +</blockquote> + +<A NAME=speech12><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.7.33>We have met with foes</A><br> +<A NAME=5.7.34>That strike beside us.</A><br> +</blockquote> + +<A NAME=speech13><b>SIWARD</b></a> +<blockquote> +<A NAME=5.7.35>Enter, sir, the castle.</A><br> +<p><i>Exeunt. Alarums</i></p> +</blockquote> +<h3>SCENE VIII. Another part of the field.</h3> +<p><blockquote> +<i>Enter MACBETH</i> +</blockquote> + +<A NAME=speech1><b>MACBETH</b></a> +<blockquote> +<A NAME=5.8.1>Why should I play the Roman fool, and die</A><br> +<A NAME=5.8.2>On mine own sword? whiles I see lives, the gashes</A><br> +<A NAME=5.8.3>Do better upon them.</A><br> +<p><i>Enter MACDUFF</i></p> +</blockquote> + +<A NAME=speech2><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.8.4>Turn, hell-hound, turn!</A><br> +</blockquote> + +<A NAME=speech3><b>MACBETH</b></a> +<blockquote> +<A NAME=5.8.5>Of all men else I have avoided thee:</A><br> +<A NAME=5.8.6>But get thee back; my soul is too much charged</A><br> +<A NAME=5.8.7>With blood of thine already.</A><br> +</blockquote> + +<A NAME=speech4><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.8.8>I have no words:</A><br> +<A NAME=5.8.9>My voice is in my sword: thou bloodier villain</A><br> +<A NAME=5.8.10>Than terms can give thee out!</A><br> +<p><i>They fight</i></p> +</blockquote> + +<A NAME=speech5><b>MACBETH</b></a> +<blockquote> +<A NAME=5.8.11>Thou losest labour:</A><br> +<A NAME=5.8.12>As easy mayst thou the intrenchant air</A><br> +<A NAME=5.8.13>With thy keen sword impress as make me bleed:</A><br> +<A NAME=5.8.14>Let fall thy blade on vulnerable crests;</A><br> +<A NAME=5.8.15>I bear a charmed life, which must not yield,</A><br> +<A NAME=5.8.16>To one of woman born.</A><br> +</blockquote> + +<A NAME=speech6><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.8.17>Despair thy charm;</A><br> +<A NAME=5.8.18>And let the angel whom thou still hast served</A><br> +<A NAME=5.8.19>Tell thee, Macduff was from his mother's womb</A><br> +<A NAME=5.8.20>Untimely ripp'd.</A><br> +</blockquote> + +<A NAME=speech7><b>MACBETH</b></a> +<blockquote> +<A NAME=5.8.21>Accursed be that tongue that tells me so,</A><br> +<A NAME=5.8.22>For it hath cow'd my better part of man!</A><br> +<A NAME=5.8.23>And be these juggling fiends no more believed,</A><br> +<A NAME=5.8.24>That palter with us in a double sense;</A><br> +<A NAME=5.8.25>That keep the word of promise to our ear,</A><br> +<A NAME=5.8.26>And break it to our hope. I'll not fight with thee.</A><br> +</blockquote> + +<A NAME=speech8><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.8.27>Then yield thee, coward,</A><br> +<A NAME=5.8.28>And live to be the show and gaze o' the time:</A><br> +<A NAME=5.8.29>We'll have thee, as our rarer monsters are,</A><br> +<A NAME=5.8.30>Painted on a pole, and underwrit,</A><br> +<A NAME=5.8.31>'Here may you see the tyrant.'</A><br> +</blockquote> + +<A NAME=speech9><b>MACBETH</b></a> +<blockquote> +<A NAME=5.8.32>I will not yield,</A><br> +<A NAME=5.8.33>To kiss the ground before young Malcolm's feet,</A><br> +<A NAME=5.8.34>And to be baited with the rabble's curse.</A><br> +<A NAME=5.8.35>Though Birnam wood be come to Dunsinane,</A><br> +<A NAME=5.8.36>And thou opposed, being of no woman born,</A><br> +<A NAME=5.8.37>Yet I will try the last. Before my body</A><br> +<A NAME=5.8.38>I throw my warlike shield. Lay on, Macduff,</A><br> +<A NAME=5.8.39>And damn'd be him that first cries, 'Hold, enough!'</A><br> +<p><i>Exeunt, fighting. Alarums</i></p> +<p><i>Retreat. Flourish. Enter, with drum and colours, MALCOLM, SIWARD, ROSS, the other Thanes, and Soldiers</i></p> +</blockquote> + +<A NAME=speech10><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.8.40>I would the friends we miss were safe arrived.</A><br> +</blockquote> + +<A NAME=speech11><b>SIWARD</b></a> +<blockquote> +<A NAME=5.8.41>Some must go off: and yet, by these I see,</A><br> +<A NAME=5.8.42>So great a day as this is cheaply bought.</A><br> +</blockquote> + +<A NAME=speech12><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.8.43>Macduff is missing, and your noble son.</A><br> +</blockquote> + +<A NAME=speech13><b>ROSS</b></a> +<blockquote> +<A NAME=5.8.44>Your son, my lord, has paid a soldier's debt:</A><br> +<A NAME=5.8.45>He only lived but till he was a man;</A><br> +<A NAME=5.8.46>The which no sooner had his prowess confirm'd</A><br> +<A NAME=5.8.47>In the unshrinking station where he fought,</A><br> +<A NAME=5.8.48>But like a man he died.</A><br> +</blockquote> + +<A NAME=speech14><b>SIWARD</b></a> +<blockquote> +<A NAME=5.8.49>Then he is dead?</A><br> +</blockquote> + +<A NAME=speech15><b>ROSS</b></a> +<blockquote> +<A NAME=5.8.50>Ay, and brought off the field: your cause of sorrow</A><br> +<A NAME=5.8.51>Must not be measured by his worth, for then</A><br> +<A NAME=5.8.52>It hath no end.</A><br> +</blockquote> + +<A NAME=speech16><b>SIWARD</b></a> +<blockquote> +<A NAME=5.8.53> Had he his hurts before?</A><br> +</blockquote> + +<A NAME=speech17><b>ROSS</b></a> +<blockquote> +<A NAME=5.8.54>Ay, on the front.</A><br> +</blockquote> + +<A NAME=speech18><b>SIWARD</b></a> +<blockquote> +<A NAME=5.8.55> Why then, God's soldier be he!</A><br> +<A NAME=5.8.56>Had I as many sons as I have hairs,</A><br> +<A NAME=5.8.57>I would not wish them to a fairer death:</A><br> +<A NAME=5.8.58>And so, his knell is knoll'd.</A><br> +</blockquote> + +<A NAME=speech19><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.8.59>He's worth more sorrow,</A><br> +<A NAME=5.8.60>And that I'll spend for him.</A><br> +</blockquote> + +<A NAME=speech20><b>SIWARD</b></a> +<blockquote> +<A NAME=5.8.61>He's worth no more</A><br> +<A NAME=5.8.62>They say he parted well, and paid his score:</A><br> +<A NAME=5.8.63>And so, God be with him! Here comes newer comfort.</A><br> +<p><i>Re-enter MACDUFF, with MACBETH's head</i></p> +</blockquote> + +<A NAME=speech21><b>MACDUFF</b></a> +<blockquote> +<A NAME=5.8.64>Hail, king! for so thou art: behold, where stands</A><br> +<A NAME=5.8.65>The usurper's cursed head: the time is free:</A><br> +<A NAME=5.8.66>I see thee compass'd with thy kingdom's pearl,</A><br> +<A NAME=5.8.67>That speak my salutation in their minds;</A><br> +<A NAME=5.8.68>Whose voices I desire aloud with mine:</A><br> +<A NAME=5.8.69>Hail, King of Scotland!</A><br> +</blockquote> + +<A NAME=speech22><b>ALL</b></a> +<blockquote> +<A NAME=5.8.70>Hail, King of Scotland!</A><br> +<p><i>Flourish</i></p> +</blockquote> + +<A NAME=speech23><b>MALCOLM</b></a> +<blockquote> +<A NAME=5.8.71>We shall not spend a large expense of time</A><br> +<A NAME=5.8.72>Before we reckon with your several loves,</A><br> +<A NAME=5.8.73>And make us even with you. My thanes and kinsmen,</A><br> +<A NAME=5.8.74>Henceforth be earls, the first that ever Scotland</A><br> +<A NAME=5.8.75>In such an honour named. What's more to do,</A><br> +<A NAME=5.8.76>Which would be planted newly with the time,</A><br> +<A NAME=5.8.77>As calling home our exiled friends abroad</A><br> +<A NAME=5.8.78>That fled the snares of watchful tyranny;</A><br> +<A NAME=5.8.79>Producing forth the cruel ministers</A><br> +<A NAME=5.8.80>Of this dead butcher and his fiend-like queen,</A><br> +<A NAME=5.8.81>Who, as 'tis thought, by self and violent hands</A><br> +<A NAME=5.8.82>Took off her life; this, and what needful else</A><br> +<A NAME=5.8.83>That calls upon us, by the grace of Grace,</A><br> +<A NAME=5.8.84>We will perform in measure, time and place:</A><br> +<A NAME=5.8.85>So, thanks to all at once and to each one,</A><br> +<A NAME=5.8.86>Whom we invite to see us crown'd at Scone.</A><br> +<p><i>Flourish. Exeunt</i></p> +</body> +</html> + diff --git a/node_modules/selenium-webdriver/lib/test/data/map.png b/node_modules/selenium-webdriver/lib/test/data/map.png Binary files differnew file mode 100644 index 000000000..763f56279 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/map.png diff --git a/node_modules/selenium-webdriver/lib/test/data/map_visibility.html b/node_modules/selenium-webdriver/lib/test/data/map_visibility.html new file mode 100644 index 000000000..6cf5f763e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/map_visibility.html @@ -0,0 +1,8 @@ +<html> +<head> + <title>Map test page</title> +</head> +<body> +<div style="position: absolute; left: 0px; top: 0px; z-index: 106;"><img style="position: absolute; left: 271px; top: 320px; width: 20px; height: 34px; -moz-user-select: none; border: 0px none; padding: 0px; margin: 0px; z-index: -140270496;" src="markerTransparent.png" class="gmnoprint" usemap="#gmimap0"><map name="gmimap0" id="gmimap0"><area log="miw" coords="9,0,6,1,4,2,2,4,0,8,0,12,1,14,2,16,5,19,7,23,8,26,9,30,9,34,11,34,11,30,12,26,13,24,14,21,16,18,18,16,20,12,20,8,18,4,16,2,15,1,13,0" shape="poly" alt="" href="javascript:void(0)" id="mtgt_unnamed_0" style="position: absolute; left: 159px; top: 342px;"></map></div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/markerTransparent.png b/node_modules/selenium-webdriver/lib/test/data/markerTransparent.png Binary files differnew file mode 100644 index 000000000..ed4e5e7f4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/markerTransparent.png diff --git a/node_modules/selenium-webdriver/lib/test/data/messages.html b/node_modules/selenium-webdriver/lib/test/data/messages.html new file mode 100644 index 000000000..74f1a37f7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/messages.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<script> + var messages = []; + window.addEventListener('message', function(e) { + var message = JSON.stringify(e.data); + messages.push(message); + + var pre = document.createElement('pre'); + pre.style.margin = 0; + pre.style.padding = 0; + pre.textContent = message; + + document.body.appendChild(pre); + }, true); +</script>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/meta-redirect.html b/node_modules/selenium-webdriver/lib/test/data/meta-redirect.html new file mode 100644 index 000000000..9d9c2f0cc --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/meta-redirect.html @@ -0,0 +1,11 @@ +<html> +<head> + <title>Some test page</title> + <meta http-equiv="refresh" content="0;URL=resultPage.html"/> +</head> +<body> +<script type="text/javascript" language="javascript"><!-- +location.replace("resultPage.html"); +//--> </script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/missedJsReference.html b/node_modules/selenium-webdriver/lib/test/data/missedJsReference.html new file mode 100644 index 000000000..616775276 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/missedJsReference.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Example page</title> +</head> +<body> +<p>This page contains a nested iframe. Execute some JS to locate a reference to an element in this + frame and return it. You should need to switch to that frame in order to use that element.</p> +<iframe src="simpleTest.html" name="inner"></iframe> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_1.html b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_1.html new file mode 100644 index 000000000..4eff01acd --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_1.html @@ -0,0 +1,21 @@ +<html> +<head> +<title>First Modal</title> +<script> + function openModal() { + window.showModalDialog("modal_2.html",'dialogWidth:250px;dialogHeight:200px;resizable:yes') + } +</script> +</head> + +<body> +<p>Modal dialog sample</p> + +<input type="button" value="btn2" onclick="openModal();"> + +<a id="lnk2" href="javascript:openModal()">lnk2</a> +<div> + +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_2.html b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_2.html new file mode 100644 index 000000000..cec3f3f14 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_2.html @@ -0,0 +1,21 @@ +<html> +<head> +<title>Second Modal</title> +<script> + function openModal() { + window.showModalDialog("modal_3.html",'dialogWidth:250px;dialogHeight:200px;resizable:yes') + } +</script> +</head> + +<body> +<p>Modal dialog sample</p> + +<input type="button" value="btn3" onclick="openModal();"> + +<a id="lnk3" href="javascript:openModal()">lnk3</a> +<div> + +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_3.html b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_3.html new file mode 100644 index 000000000..6c5eb7231 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modal_3.html @@ -0,0 +1,15 @@ +<html> +<head> +<title>Third Modal</title> + +</head> + +<body> +<p>Modal dialog sample</p> + + +<div> + +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modalindex.html b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modalindex.html new file mode 100644 index 000000000..0a1c4c941 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/modal_dialogs/modalindex.html @@ -0,0 +1,21 @@ +<html> +<head> +<title>Main window</title> +<script> + function openModal() { + window.showModalDialog("modal_1.html",'dialogWidth:250px;dialogHeight:200px;resizable:yes') + } +</script> +</head> + +<body> +<p>Modal dialog sample</p> + +<input type="button" value="btn1" onclick="openModal();"> + +<a id="lnk1" href="javascript:openModal()">lnk1</a> +<div> + +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/mouseOver.html b/node_modules/selenium-webdriver/lib/test/data/mouseOver.html new file mode 100644 index 000000000..d4751bfdf --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/mouseOver.html @@ -0,0 +1,17 @@ +<!DOCTYPE html> +<body style="margin: 0; padding: 0;"> +<div style="position: absolute; overflow: hidden; + left: 0; top: 0; width: 250px; height: 250px; + background: green" + id="greenbox"> + <div style="position: relative; left: 75px; top: 75px; + width: 75px; height: 75px; + background: green" + id="redbox"> + </div> + <script> + var redbox = document.getElementById('redbox'); + redbox.onmouseover = function() { redbox.style.background = 'red'; }; + redbox.onmouseout = function() { redbox.style.background = 'green'; }; + </script> +</div> diff --git a/node_modules/selenium-webdriver/lib/test/data/mousePositionTracker.html b/node_modules/selenium-webdriver/lib/test/data/mousePositionTracker.html new file mode 100644 index 000000000..39a31cda4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/mousePositionTracker.html @@ -0,0 +1,33 @@ +<html> + <head> + <style type="text/css"> + div.solidborder + { + border-style:solid; + border-width:1px; + } + </style> + + <script type="text/javascript" src="js/jquery-1.4.4.min.js"></script> + <script type="text/javascript" src="js/jquery-ui-1.8.10.custom.min.js"></script> + <script type="text/javascript"> + jQuery(document).ready(function(){ + $('#mousetracker').mousemove(function(e){ + xPos = e.pageX - this.offsetLeft; + yPos = e.pageY - this.offsetTop; + $('#status').html(xPos + ', ' + yPos); + }); + }) + +</script> +<body> + <b>Div tracking mouse position.</b> + <br> +<div id="mousetracker" class="solidborder" style="position: absolute; left: 10px; top: 80px; height: 400px; width: 100px; padding: 0px;"> + Move mouse here. +</div> +<h2 id="status"> +0, 0 +</h2> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/nestedElements.html b/node_modules/selenium-webdriver/lib/test/data/nestedElements.html new file mode 100644 index 000000000..cf00083cf --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/nestedElements.html @@ -0,0 +1,155 @@ +<html> + <body> + <p id="test_id">outside</p> + <p id="test_id_out">outside</p> + <div id="test_id_div"> + <p id="test_id">inside</p> + </div> +<form method="get" action="resultPage.html" name="form1" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="1"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<form method="get" action="resultPage.html" name="form2" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<a href="1.html">hello world</a> +<div name="div1"> + <a href="2.html" name="link1">hello world</a> + <a href="2.html" name="link2">hello world</a> +</div> +</body> +</html> +<html> + <body> + +<form method="get" action="resultPage.html" name="form1" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="1"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<form method="get" action="resultPage.html" name="form2" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<a href="1.html">hello world</a> +<div name="div1"> + <a href="2.html">hello world</a> + <a href="2.html">hello world</a> +</div> +</body> +</html> +<html> + <body> + +<form method="get" action="resultPage.html" name="form1" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="1"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<form method="get" action="resultPage.html" name="form2" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<a href="1.html">hello world</a> +<div name="div1"> + <a href="2.html">hello world</a> + <a href="2.html">hello world</a> +</div> +</body> +</html> +<html> + <body> + +<form method="get" action="resultPage.html" name="form1" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="1"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<form method="get" action="resultPage.html" name="form2" style="display: block"> + Here's a checkbox: <input type="checkbox" id="checky" name="checky" value="furrfu"/><br/> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> + <select name="selectomatic" id="2"> + <option selected="selected">One</option> + <option>Two</option> + <option>Four</option> + <option>Still learning how to count, apparently</option> + </select> +</form> + +<a href="1.html">hello world</a> +<div name="div1"> + <a href="2.html">hello world</a> + <a href="2.html">hello world</a> +</div> + +<span class="one">Span with class of one</span> +<div name="classes"> + <span class="one">Find me</span> + <span class="one">Also me</span> + <span class="oneother">But not me</span> +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow-body.html b/node_modules/selenium-webdriver/lib/test/data/overflow-body.html new file mode 100644 index 000000000..2d2264ce6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow-body.html @@ -0,0 +1,15 @@ +<!DOCTYPE html> +<html style="overflow: auto;"> +<head> + <title>The Visibility of Everyday Things</title> +</head> +<body style="overflow: hidden;"> +<!-- When the test is run, the window is resized to less than 700 pixels high --> +<p>This image is copyright Simon Stewart and donated to the Selenium project for use in its test suites. +</p> +<img src="beach.jpg" height="480" width="640" alt="a nice beach"> + +<!-- So this is off screen --> +<iframe width="100%" height="1000" name="resultsFrame" src="xhtmlTest.html"></iframe> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_auto.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_auto.html new file mode 100644 index 000000000..cf8a64719 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_auto.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: auto; + overflow-y: auto; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_hidden.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_hidden.html new file mode 100644 index 000000000..96fd750a6 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_hidden.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: auto; + overflow-y: hidden; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_scroll.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_scroll.html new file mode 100644 index 000000000..6f1d90b6d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_auto_y_scroll.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: auto; + overflow-y: scroll; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_auto.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_auto.html new file mode 100644 index 000000000..24dd19283 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_auto.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: hidden; + overflow-y: auto; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_hidden.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_hidden.html new file mode 100644 index 000000000..cae566578 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_hidden.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: hidden; + overflow-y: hidden; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_scroll.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_scroll.html new file mode 100644 index 000000000..d4ffa3970 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_hidden_y_scroll.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: hidden; + overflow-y: scroll; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_auto.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_auto.html new file mode 100644 index 000000000..d425a2a8a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_auto.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: scroll; + overflow-y: auto; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_hidden.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_hidden.html new file mode 100644 index 000000000..4a6ff595d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_hidden.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: scroll; + overflow-y: hidden; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_scroll.html b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_scroll.html new file mode 100644 index 000000000..efa80742a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/overflow/x_scroll_y_scroll.html @@ -0,0 +1,30 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow</title> + <style> + #over { + width:400px; + height: 300px; + overflow-x: scroll; + overflow-y: scroll; + } + </style> +</head> +<body> + <div id="over"> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="right" onclick="document.getElementById('right-clicked').innerText='ok'">Click right</a></div> + </div> + <div style="height: 5000px; width: 5000px;"> + Right clicked: <span id="right-clicked"></span></br> + Bottom clicked: <span id="bottom-clicked"></span></br> + Bottom-right clicked: <span id="bottom-right-clicked"></span></br> + </div> + <div style="width: 5000px;"> + <div style="width: 100%; text-align: right;" ><a href="#" id="bottom-right" onclick="document.getElementById('bottom-right-clicked').innerText='ok'">Click bottom-right</a></div> + </div> + <a href="#" id="bottom" onclick="document.getElementById('bottom-clicked').innerText='ok'">Click bottom</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/pageWithOnBeforeUnloadMessage.html b/node_modules/selenium-webdriver/lib/test/data/pageWithOnBeforeUnloadMessage.html new file mode 100644 index 000000000..cb59707ed --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/pageWithOnBeforeUnloadMessage.html @@ -0,0 +1,20 @@ +<!DOCTYPE html> +<html> + <head> + <!-- + This page differs from pageWithOnUnload.html in that it returns a string in the + event handler, which causes a different type of alert to appear (the "Stay on + page/Leave current page" alert). + --> + <script type="text/javascript"> + function onBeforeUnloadHandler() { + return "This is for WebDriver with onbeforeunload event handler."; + } + window.onbeforeunload = onBeforeUnloadHandler; + </script> + <title>Page with OnBeforeUnload handler</title> + </head> + <body> + <p>Page with onbeforeunload event handler. <a id="navigate" href="alerts.html">Click here to navigate to another page.</a></p> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/pageWithOnLoad.html b/node_modules/selenium-webdriver/lib/test/data/pageWithOnLoad.html new file mode 100644 index 000000000..2c644ff95 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/pageWithOnLoad.html @@ -0,0 +1,6 @@ +<!DOCTYPE html> +<html> +<body onload="javascript:alert('onload')"> +<p>Page with onload event handler</p> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/pageWithOnUnload.html b/node_modules/selenium-webdriver/lib/test/data/pageWithOnUnload.html new file mode 100644 index 000000000..6070341e2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/pageWithOnUnload.html @@ -0,0 +1,6 @@ +<!DOCTYPE html> +<html> +<body onbeforeunload="alert('onunload')"> +<p>Page with onunload event handler</p> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/page_with_link_to_slow_loading_page.html b/node_modules/selenium-webdriver/lib/test/data/page_with_link_to_slow_loading_page.html new file mode 100644 index 000000000..ea94f8ec1 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/page_with_link_to_slow_loading_page.html @@ -0,0 +1,6 @@ +<!DOCTYPE html> +<html> +<body> +<a id="link-to-slow-loading-page" href="sleep?time=5">load a slow page</a> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/plain.txt b/node_modules/selenium-webdriver/lib/test/data/plain.txt new file mode 100644 index 000000000..8318c86b3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/plain.txt @@ -0,0 +1 @@ +Test
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/proxy/page1.html b/node_modules/selenium-webdriver/lib/test/data/proxy/page1.html new file mode 100644 index 000000000..1810f1cdf --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/proxy/page1.html @@ -0,0 +1,20 @@ +<!DOCTYPE html> +<meta http-equiv="Content-Type" content="text/html;charset=UTF-8"> +<meta http-equiv="X-UA-Compatible" content="IE=edge"> +<title>Page 1</title> +<p>The <code>next</code> query param must be the URL for the next page to +link to. +<script> + var match = document.location.search.match(/next=(.*)/); + if (match && match.length == 2) { + var next = decodeURIComponent(match[1]); + var link = document.createElement('a'); + link.innerText = 'Next!'; + link.textContent = 'Next!'; + link.id = 'next'; + link.href = next + '?next=' + encodeURIComponent( + 'http://' + document.location.host + + document.location.pathname.replace('page1.html', 'page3.html')); + document.body.appendChild(link); + } +</script> diff --git a/node_modules/selenium-webdriver/lib/test/data/proxy/page2.html b/node_modules/selenium-webdriver/lib/test/data/proxy/page2.html new file mode 100644 index 000000000..d826f1742 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/proxy/page2.html @@ -0,0 +1,24 @@ +<!DOCTYPE html> +<meta http-equiv="Content-Type" content="text/html;charset=UTF-8"> +<meta http-equiv="X-UA-Compatible" content="IE=edge"> +<title>Page 2</title> +This page is a middle man for referrer tests. +This page will include a link to a "next" page if the <code>next</code> query +parameter, or the <code>document.referrer</code> is set. +<p><input type="button" id="forward" value="Forward" onclick="history.go(1)"/> +<script> + var match = document.location.search.match(/next=(.*)/); + var next = document.referrer || ''; + if (match && match.length == 2) { + next = decodeURIComponent(match[1]); + } + + if (next) { + var link = document.createElement('a'); + link.innerText = 'Next!'; + link.textContent = 'Next!'; + link.id = 'next'; + link.href = next; + document.body.appendChild(link); + } +</script> diff --git a/node_modules/selenium-webdriver/lib/test/data/proxy/page3.html b/node_modules/selenium-webdriver/lib/test/data/proxy/page3.html new file mode 100644 index 000000000..27048f729 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/proxy/page3.html @@ -0,0 +1,5 @@ +<!DOCTYPE html> +<meta http-equiv="Content-Type" content="text/html;charset=UTF-8"> +<meta http-equiv="X-UA-Compatible" content="IE=edge"> +<title>Page 3</title> +<p><input type="button" id="back" value="Back" onclick="history.go(-1)"/> diff --git a/node_modules/selenium-webdriver/lib/test/data/readOnlyPage.html b/node_modules/selenium-webdriver/lib/test/data/readOnlyPage.html new file mode 100644 index 000000000..8f257fdc7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/readOnlyPage.html @@ -0,0 +1,24 @@ +<html> +<body> +<input id="writableTextInput" type="text" value="Test"/> + +<input id="readOnlyTextInput" type="text" readonly value="Test"/> + +<input id="textInputnotenabled" type="text" disabled="true" value="Test"/> + +<textarea id="writableTextArea" rows="2" cols="20"> +This is a sample text area which is supposed to be cleared +</textarea> + +<textarea id="textAreaReadOnly" readonly rows="5" cols="20"> +text area which is not supposed to be cleared</textarea> + +<textarea rows="5" id="textAreaNotenabled" disabled="true" cols="20"> +text area which is not supposed to be cleared</textarea> + +<div id="content-editable" contentEditable="true"><h1>This</h1><h2>is a</h2><p>contentEditable area</p></div> + +<div id="content-editable-blank" contentEditable="true" style="height:50px;"></div> +</body> +</html> + diff --git a/node_modules/selenium-webdriver/lib/test/data/rectangles.html b/node_modules/selenium-webdriver/lib/test/data/rectangles.html new file mode 100644 index 000000000..8ba233984 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/rectangles.html @@ -0,0 +1,40 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Rectangles</title> + <style type="text/css"> + div { + position: absolute; + margin: 0; + border: 0; + padding: 0; + } + #r1 { + background-color: blue; + left: 10px; + top: 10px; + width: 100px; + height: 50px; + } + #r2 { + background-color: red; + left: 10.9px; + top: 10.1px; + width: 48.666666667px; + height: 49.333333333px; + } + #r3 { + background-color: yellow; + left: 60px; + top: 10px; + width: 50px; + height: 25px; + } + </style> +</head> + <body> + <div id="r1">r1</div> + <div id="r2">r2</div> + <div id="r3">r3</div> + </body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/resultPage.html b/node_modules/selenium-webdriver/lib/test/data/resultPage.html new file mode 100644 index 000000000..94f3e246e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/resultPage.html @@ -0,0 +1,25 @@ +<html> +<head> + <title>We Arrive Here</title> +</head> +<body> + +<p id="greeting">Success!</p> + +<div> + <h1>List of stuff</h1> + <ol> + <li class="items">Item 1</li> + <li>Item 2</li> + </ol> +</div> +<div> + <h1>Almost empty</h1> +</div> + +<script language="Javascript"> + document.write("<p>Window name is: " + window.name + "</p>"); +</script> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/rich_text.html b/node_modules/selenium-webdriver/lib/test/data/rich_text.html new file mode 100644 index 000000000..a42e43aab --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/rich_text.html @@ -0,0 +1,161 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" + "http://www.w3.org/TR/html4/loose.dtd"> +<html> +<head> +<script type="text/javascript"> +function setKeypressHandler (el, keyHandler) { + if (el.addEventListener) { + el.addEventListener('keypress', keyHandler, false); + el.addEventListener('keydown', keyHandler, false); + el.addEventListener('keyup', keyHandler, false); + } else { + el.attachEvent('onkeypress', keyHandler); + el.attachEvent('onkeydown', keyHandler); + el.attachEvent('onkeyup', keyHandler); + } +} + +function output (text) { + var div = document.getElementById('debugOutput'); + div.appendChild(document.createTextNode(text)); + div.appendChild(document.createElement('br')); +} + +window.onload = function () { + // Super dumb browser detection + var isIE = window.navigator.userAgent.search('MSIE') != -1 + || window.navigator.userAgent.search('Trident') != -1; + + var editFrame = document.getElementById('editFrame').contentWindow; + setKeypressHandler(editFrame.document, printEventData); + if (isIE) { + editFrame.document.body.contentEditable = true; + } else { + editFrame.document.designMode = 'On'; + // Attach a name to the containing HTML element + editFrame.document.getElementsByTagName("html")[0].id = "frameHtml"; + } + + var editDiv = document.getElementById('editDiv'); + setKeypressHandler(editDiv, printEventData); + editDiv.contentEditable = true; + + editFrame.document.body.style.margin = 1; + editFrame.document.body.style.padding = 0; + editFrame.document.body.id = 'theBody'; + + editDiv.style.margin = 1; + editDiv.style.padding = 0; + + window.setTimeout(function() { + var pre = document.createElement('pre'); + function write(text) { + pre.appendChild(document.createTextNode(text)); + pre.appendChild(document.createElement('br')); + } + + write('frame.contentWindow.document.designMode: ' + + editFrame.document.designMode); + write('frame.contentWindow.document.body.contentEditable: ' + + editFrame.document.body.contentEditable); + document.getElementById('editFrameInfo').appendChild(pre); + + pre = document.createElement('pre'); + write('div.ownerDocument.designMode: ' + + editDiv.ownerDocument.designMode); + write('div.ownerDocument.body.contentEditable: ' + + editDiv.ownerDocument.body.contentEditable); + write('div.contentEditable: ' + + editDiv.contentEditable); + document.getElementById('editDivInfo').appendChild(pre); + }, 0); +}; + +function isDef(obj, prop) { + return typeof obj[prop] != 'undefined'; +} + +function printEventData(e) { + e = e || window.event; + + function write(id, text, opt_color) { + var el = document.getElementById(id); + el.innerHTML = '[' + text + ']'; + el.style.backgroundColor = opt_color || 'white'; + } + write('type', e.type); + write('tagName', isDef(e, 'target') ? e.target.tagName : e.srcElement.tagName); + write('tagId', isDef(e, 'target') ? e.target.id : e.srcElement.id); + write('keyidentifier', isDef(e, 'keyIdentifier') ? e.keyIdentifier : 'n/a'); + write('keylocation', isDef(e, 'keyLocation') ? e.keyLocation : 'n/a'); + write('keycode', e.keyCode); + write('charcode', e.charCode); + write('which', e.which); + if (isDef(e, 'isTrusted')) { + write('istrusted', e.isTrusted, e.isTrusted ? '#afa' : '#faa'); + } else { + write('istrusted', 'n/a'); + } + write('alt', e.altKey); + write('ctrl', e.ctrlKey); + write('shift', e.shiftKey); + write('meta', e.metaKey); + + var s = ""; + for (var i in e) { + s += i + ": " + e[i] + " "; + } + //alert(s); +} +</script> +</head> +<body> +<div> + <div id="butter" style="background-color: #ffa;"> + </div> + <table width="100%"> + <tr valign="top"> + <td width="50%"> + <div>IFRAME</div> + <iframe id="editFrame" name="editFrame" src="" height="200px" width="300px" frameborder="0" style="border: 1px solid black;"> + </iframe> + <div id="editFrameInfo"> + <pre>frame.contentWindow.document.designMode: on<br>frame.contentWindow.document.body.contentEditable: false<br></pre></div> + </td> + <td> + <div>DIV</div> + <div id="editDiv" style="border-top-width: 1px; border-right-width: 1px; border-bottom-width: 1px; border-left-width: 1px; border-top-style: solid; border-right-style: solid; border-bottom-style: solid; border-left-style: solid; border-top-color: black; border-right-color: black; border-bottom-color: black; border-left-color: black; height: 200px; width: 300px; overflow-x: auto; overflow-y: auto; margin-top: 1px; margin-right: 1px; margin-bottom: 1px; margin-left: 1px; padding-top: 0px; padding-right: 0px; padding-bottom: 0px; padding-left: 0px; " contenteditable="true"> + </div> + <div id="editDivInfo"> + <pre>div.ownerDocument.designMode: off<br>div.ownerDocument.body.contentEditable: false<br>div.contentEditable: true<br></pre></div> + </td> + </tr> + </table> +</div> + +<HR> +<DIV style="margin: 0px;padding:0px;padding-left:10px;font-family:Courier;"> + <TABLE cellpadding="0" cellspacing="0" width="200px" style="font-size:9pt;"> + <TBODY> + <TR><TD width="110px">type:</TD><TD id="type" width="90px">[]</TD></TR> + <TR><TD>tagName:</TD><TD id="tagName">[]</TD></TR> + <TR><TD>id:</TD><TD id="tagId">[]</TD></TR> + <TR><TD>keyIdentifier:</TD><TD id="keyidentifier">[]</TD></TR> + <TR><TD>keyLocation:</TD><TD id="keylocation">[]</TD></TR> + <TR><TD>keyCode:</TD><TD id="keycode">[]</TD></TR> + <TR><TD>charCode:</TD><TD id="charcode">[]</TD></TR> + <TR><TD>which:</TD><TD id="which">[]</TD></TR> + <TR><TD>isTrusted:</TD><TD id="istrusted">[]</TD></TR> + <TR><TD colspan="2">---------------------</TD></TR> + <TR><TD colspan="2">Modifiers</TD></TR> + <TR><TD>alt:</TD><TD id="alt">[]</TD></TR> + <TR><TD>ctrl:</TD><TD id="ctrl">[]</TD></TR> + <TR><TD>shift:</TD><TD id="shift">[]</TD></TR> + <TR><TD>meta:</TD><TD id="meta">[]</TD></TR> + </TBODY> + </TABLE> +</DIV> + + + +</BODY></HTML>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/safari/frames_benchmark.html b/node_modules/selenium-webdriver/lib/test/data/safari/frames_benchmark.html new file mode 100644 index 000000000..8a0592556 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/safari/frames_benchmark.html @@ -0,0 +1,31 @@ +<!DOCTYPE html> +<script> + var start; + var dom; + + function run() { + if (dom) { + dom.parentNode.removeChild(dom); + } + + dom = document.createElement('div'); + var result = document.createElement('div'); + dom.appendChild(result); + document.body.appendChild(dom); + + start = Date.now(); + + for (var i = 0; i < 100; i++) { + var iframe = document.createElement('iframe'); + iframe.style.width = '200px'; + iframe.style.height = '30px'; + dom.appendChild(iframe); + var content = iframe.contentWindow.document.createTextNode('hello, world'); + iframe.contentWindow.document.body.appendChild(content); + iframe.contentWindow.document.body.style.overflow = 'hidden'; + } + + result.innerHTML = 'Done! ' + (Date.now() - start) + ' ms'; + } +</script> +<input type="button" value="Go!" onclick="run()">
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen.css b/node_modules/selenium-webdriver/lib/test/data/screen/screen.css new file mode 100644 index 000000000..815261850 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen.css @@ -0,0 +1,19 @@ +* { + margin: 0; +} +html, body, #output { + width: 100%; + height: 100%; +} +table { + border: 0px; + border-collapse: collapse; + border-spacing: 0px; + display: table; +} +table td { + padding: 0px; +} +.cell { + color: black; +} diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen.html new file mode 100644 index 000000000..166665da3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 100%; + height: 100%; +} +.row { + height: 20px; + width: 100%; +} +.column { + height: 20%; + width: 20px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen.js b/node_modules/selenium-webdriver/lib/test/data/screen/screen.js new file mode 100644 index 000000000..1d1685980 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen.js @@ -0,0 +1,7 @@ +function toColor(num) { + num >>>= 0; + var b = num & 0xFF, + g = (num & 0xFF00) >>> 8, + r = (num & 0xFF0000) >>> 16; + return "rgb(" + [r, g, b].join(",") + ")"; +}
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame1.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame1.html new file mode 100644 index 000000000..35b03ae13 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame1.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen frame1</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body style="width: 100px; height: 100px;"> +<style> +#content { + width: 100%; + height: 100%; +} +.row { + height: 20px; + width: 100%; +} +.column { + height: 20px; + width: 20px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0xDFDFDF; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame2.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame2.html new file mode 100644 index 000000000..e6e17e630 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frame2.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen frame2</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body style="width: 100px; height: 100px;"> +<style> +#content { + width: 100%; + height: 100%; +} +.row { + height: 20px; + width: 100%; +} +.column { + height: 20px; + width: 20px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_frames.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frames.html new file mode 100644 index 000000000..46852dcf5 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_frames.html @@ -0,0 +1,11 @@ +<html> +<head> + <title>screen test</title> +</head> + +<frameset border="0" frameborder="0" framespacing="0" cols="50%, *" rows="*"> + <frame id="frame1" src="screen_frame1.html"/> + <frame id="frame2" src="screen_frame2.html"/> +</frameset> + +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_iframes.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_iframes.html new file mode 100644 index 000000000..ae3ea1e24 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_iframes.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html><head> +<title>Screen test</title> +</head> +<body> +<table><tr><td> +<iframe src="screen_frame1.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" frameborder="0" height="500" scrolling="no" width="500" id="iframe1" name="iframe1-name"></iframe> +</td><td> +<iframe src="screen_frame2.html" marginheight="0" marginwidth="0" topmargin="0" leftmargin="0" allowtransparency="true" frameborder="0" height="500" scrolling="no" width="500" id="iframe2" name="iframe2-name"></iframe> +</td></tr></table> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_too_long.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_too_long.html new file mode 100644 index 000000000..4d00f0270 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_too_long.html @@ -0,0 +1,68 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 70000px; + height: 70000px; +} +.column { + height: 14000px; + width: 14000px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_long.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_long.html new file mode 100644 index 000000000..1a6a1002f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_long.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 3000px; + height: 100%; +} +.row { + height: 20px; + width: 3000px; +} +.column { + height: 20%; + width: 600px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_too_long.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_too_long.html new file mode 100644 index 000000000..3fee005d5 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_x_too_long.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 70000px; + height: 100%; +} +.row { + height: 20px; + width: 70000px; +} +.column { + height: 20%; + width: 14000px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_long.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_long.html new file mode 100644 index 000000000..31733e073 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_long.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 100%; + height: 3000px; +} +.row { + height: 600px; + width: 100%; +} +.column { + height: 20%; + width: 20px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_too_long.html b/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_too_long.html new file mode 100644 index 000000000..dbef9361a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/screen/screen_y_too_long.html @@ -0,0 +1,72 @@ +<!DOCTYPE html> +<html><head> +<title>screen test</title> +<script type="text/javascript" src="screen.js"></script> +<link rel="stylesheet" type="text/css" href="screen.css" /> +</head> +<body> +<style> +#content { + width: 100%; + height: 70000px; +} +.row { + height: 14000px; + width: 100%; +} +.column { + height: 20%; + width: 20px; +} +</style> +<table id="content"> +<tr class="row row1"> +<td class="column column1 cell" id="cell11"> </td> +<td class="column column2 cell" id="cell12"> </td> +<td class="column column3 cell" id="cell13"> </td> +<td class="column column4 cell" id="cell14"> </td> +<td class="column column5 cell" id="cell15"> </td> +</tr> +<tr class="row row2"> +<td class="column column1 cell" id="cell21"> </td> +<td class="column column2 cell" id="cell22"> </td> +<td class="column column3 cell" id="cell23"> </td> +<td class="column column4 cell" id="cell24"> </td> +<td class="column column5 cell" id="cell25"> </td> +</tr> +<tr class="row row3"> +<td class="column column1 cell" id="cell31"> </td> +<td class="column column2 cell" id="cell32"> </td> +<td class="column column3 cell" id="cell33"> </td> +<td class="column column4 cell" id="cell34"> </td> +<td class="column column5 cell" id="cell35"> </td> +</tr> +<tr class="row row4"> +<td class="column column1 cell" id="cell41"> </td> +<td class="column column2 cell" id="cell42"> </td> +<td class="column column3 cell" id="cell43"> </td> +<td class="column column4 cell" id="cell44"> </td> +<td class="column column5 cell" id="cell45"> </td> +</tr> +<tr class="row row5"> +<td class="column column1 cell" id="cell51"> </td> +<td class="column column2 cell" id="cell52"> </td> +<td class="column column3 cell" id="cell53"> </td> +<td class="column column4 cell" id="cell54"> </td> +<td class="column column5 cell" id="cell55"> </td> +</tr> +</table> +<script> +var initialColor = 0x0F0F0F; +var stepColor = 1000; +var cnt = 1; +for (var i = 1; i < 6; i++) { + for (var j = 1; j < 6; j++) { + el = document.getElementById('cell' + i + '' + j); + el.style.backgroundColor = toColor(initialColor + (cnt * stepColor)); + cnt++; + } +} +</script> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/scroll.html b/node_modules/selenium-webdriver/lib/test/data/scroll.html new file mode 100644 index 000000000..cd5214f15 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scroll.html @@ -0,0 +1,27 @@ +<html> +<head> +</head> +<body> +<script> +function dump(event) { + var elt = event.target || event.srcElement; + document.getElementById('clicked').innerHTML = elt.innerHTML; +} +</script> +<div style='height: 150px'></div> +<ul style='overflow: scroll; width: 150px; height: 80px; background-color: yellow' onclick="dump(event)"> +<li id='line1'>line1</li> +<li id='line2'>line2</li> +<li id='line3'>line3</li> +<li id='line4'>line4</li> +<li id='line5'>line5</li> +<li id='line6'>line6</li> +<li id='line7'>line7</li> +<li id='line8'>line8</li> +<li id='line9'>line9</li> +</ul> +<div> +Clicked: <span id='clicked'></span> +</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scroll2.html b/node_modules/selenium-webdriver/lib/test/data/scroll2.html new file mode 100644 index 000000000..0ea66d378 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scroll2.html @@ -0,0 +1,21 @@ +<html> +<head> +</head> +<body> +<ul style='overflow: scroll; height: 100px;'> +<li></li> +<li></li> +<li id="desired">Text</li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +<li></li> +</ul> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scroll3.html b/node_modules/selenium-webdriver/lib/test/data/scroll3.html new file mode 100644 index 000000000..1aa170929 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scroll3.html @@ -0,0 +1,8 @@ +<html> +<body> +<br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /> +<button id="button1">Button1</button> +<br /><br /><br /><br /> + + <button id="button2">Button2</button> +<br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br /><br /></br /><br />
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/scroll4.html b/node_modules/selenium-webdriver/lib/test/data/scroll4.html new file mode 100644 index 000000000..652a778eb --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scroll4.html @@ -0,0 +1,7 @@ +<html> +<body> + <br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /> + <input type="radio" id="radio" /> + <br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /><br /> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scroll5.html b/node_modules/selenium-webdriver/lib/test/data/scroll5.html new file mode 100644 index 000000000..b345a8c3f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scroll5.html @@ -0,0 +1,18 @@ +<html> +<head> +</head> +<body> +<script> +function dump(text) { + document.getElementById('clicked').innerHTML = text; +} +</script> +<div style='overflow: scroll; width: 150px; height: 200px; background-color: yellow' id="outer"> + <div style="width: 150px; height: 5000px; background-color: red;" onclick="dump('clicked')" id="inner"> + </div> +</div> +<div> +Clicked: <span id='clicked'></span> +</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_200.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_200.html new file mode 100644 index 000000000..3eb3bf47d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_200.html @@ -0,0 +1,26 @@ +<!DOCTYPE html> +<html> +<head> + <title>Child frame</title> +</head> +<body> + <h1>This is a scrolling frame test</h1> + <div> + <table> + <tr height="50px"> + <td>First row</td> + </tr> + <tr height="50px"> + <td>Second row</td> + </tr> + <tr height="50px"> + <td>Third row</td> + </tr> + <tr height="50px"> + <td>Fourth row</td> + </tr> + </table> + </div> + <input type='checkbox' name='scroll_checkbox' /> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_2000.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_2000.html new file mode 100644 index 000000000..61ffe85da --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_height_above_2000.html @@ -0,0 +1,26 @@ +<!DOCTYPE html> +<html> +<head> + <title>Child frame</title> +</head> +<body> + <h1>This is a tall frame test</h1> + <div> + <table> + <tr height="500px"> + <td>First row</td> + </tr> + <tr height="500px"> + <td>Second row</td> + </tr> + <tr height="500px"> + <td>Third row</td> + </tr> + <tr height="500px"> + <td>Fourth row</td> + </tr> + </table> + </div> + <input type='checkbox' name='checkbox' /> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame.html new file mode 100644 index 000000000..153013869 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="nested_scrolling_frame" src="frame_with_height_above_200.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame_out_of_view.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame_out_of_view.html new file mode 100644 index 000000000..5781aeb9f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_nested_scrolling_frame_out_of_view.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div style="height: 5000px;">Placeholder</div> + <div> + <iframe name="nested_scrolling_frame" src="frame_with_height_above_200.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_small_height.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_small_height.html new file mode 100644 index 000000000..047de0f18 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/frame_with_small_height.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>Child frame</title> +</head> +<body> + <h1>This is a non-scrolling frame test</h1> + <input type='checkbox' name='checkbox' /> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_double_overflow_auto.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_double_overflow_auto.html new file mode 100644 index 000000000..01b7c3058 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_double_overflow_auto.html @@ -0,0 +1,19 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow: auto</title> + <style type="text/css"> + html, body { + width: 100%; + height: 100%; + overflow: auto; + } + </style> +</head> +<body> + <div style="height: 5000px;">Placeholder</div> + <div> + <a id="link" href="target_page.html">Click me!</a> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_frame_out_of_view.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_frame_out_of_view.html new file mode 100644 index 000000000..c536e41d7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_frame_out_of_view.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div style="height: 5000px;">Placeholder</div> + <div> + <iframe name="frame" src="frame_with_small_height.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames.html new file mode 100644 index 000000000..e5b76022b --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="scrolling_frame" src="frame_with_nested_scrolling_frame.html" width="800" height="150" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames_out_of_view.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames_out_of_view.html new file mode 100644 index 000000000..f79f7c848 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_nested_scrolling_frames_out_of_view.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div style="height: 5000px;">Placeholder</div> + <div> + <iframe name="scrolling_frame" src="frame_with_nested_scrolling_frame_out_of_view.html" width="800" height="150" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_non_scrolling_frame.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_non_scrolling_frame.html new file mode 100644 index 000000000..0a493fa5d --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_non_scrolling_frame.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="scrolling_frame" src="frame_with_height_above_200.html" width="800" height="200" scrolling="no"></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame.html new file mode 100644 index 000000000..cb5d53a44 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="scrolling_frame" src="frame_with_height_above_200.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame_out_of_view.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame_out_of_view.html new file mode 100644 index 000000000..5df1115c2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_scrolling_frame_out_of_view.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div style="height: 5000px;">Placeholder</div> + <div> + <iframe name="scrolling_frame" src="frame_with_height_above_200.html" width="800" height="200" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_tall_frame.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_tall_frame.html new file mode 100644 index 000000000..b7cfaf5a3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_tall_frame.html @@ -0,0 +1,11 @@ +<!DOCTYPE html> +<html> +<head> + <title>Welcome Page</title> +</head> +<body> + <div> + <iframe name="tall_frame" src="frame_with_height_above_2000.html" width="800" height="2500" ></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_y_overflow_auto.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_y_overflow_auto.html new file mode 100644 index 000000000..b5716e731 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/page_with_y_overflow_auto.html @@ -0,0 +1,14 @@ +<!DOCTYPE html> +<html> +<head> + <title>Page with overflow: auto</title> +</head> +<body> + <div style="width:100%; height: 500px; overflow: hidden; overflow-y: auto;"> + <div style="height: 5000px; width: 5000px;">Placeholder</div> + <div> + <a id="link" href="target_page.html">Click me!</a> + </div> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/target_page.html b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/target_page.html new file mode 100644 index 000000000..0457a822f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/scrolling_tests/target_page.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> +<title>Clicked Successfully!</title> +</head> +<body> +<h1>Clicked Successfully!</h1> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/selectPage.html b/node_modules/selenium-webdriver/lib/test/data/selectPage.html new file mode 100644 index 000000000..4028414c1 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/selectPage.html @@ -0,0 +1,58 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" "http://www.w3.org/TR/html4/loose.dtd"> +<html> +<head> +<meta http-equiv="Content-Type" content="text/html; charset=ISO-8859-1"> +<title>Multiple Selection test page</title> +</head> +<body> + <select id="selectWithoutMultiple"> + <option value="one">one</option> + <option value="two" />two</option> + </select> + + <select id="selectWithMultipleEqualsMultiple" multiple="multiple"> + <option selected="selected" label="emmental">Emmental</option> + <option label="roquefort">Roquefort</option> + <option label="parmigiano">Parmigiano</option> + <option label="cheddar">Cheddar</option> + </select> + + <select id="selectWithEmptyStringMultiple" multiple=""> + <option value="one">one</option> + <option value="two">two</option> + </select> + + <select id="selectWithMultipleWithoutValue" multiple> + <option value="one">one</option> + <option value="two">two</option> + </select> + + <select id="selectWithRandomMultipleValue" multiple="somethingElse"> + <option value="one">one</option> + <option value="two">two</option> + </select> + + <select> + <optgroup label="Group"> + <option value="one">one</option> + <option id="two-in-group" value="two">two</option> + </optgroup> + </select> + + <select id="selectWithMultipleLongList" multiple> + <option>one</option> + <option>two</option> + <option>three</option> + <option>four</option> + <option>five</option> + <option>six</option> + </select> + + <select id="narrow" style="width: 50px;"> + <option value="evalon">LaClare Farms Evalon with Cummin</option> + <option value="savourine">Yarra Valley Vintage Savourine</option> + <option value="cheddar">Avonlea Clothbound Cheddar</option> + </select> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/selectableItems.html b/node_modules/selenium-webdriver/lib/test/data/selectableItems.html new file mode 100644 index 000000000..190b2ada7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/selectableItems.html @@ -0,0 +1,65 @@ +<!DOCTYPE html> +<html lang="en"> +<head> + <meta charset="UTF-8" /> + <title>jQuery UI Selectable - Default functionality</title> + <link type="text/css" href="css/ui-lightness/jquery-ui-1.8.1.custom.css" rel="stylesheet" /> + <script type="text/javascript" src="js/jquery-1.4.4.min.js"></script> + <script type="text/javascript" src="js/jquery-ui-1.8.10.custom.min.js"></script> + + <style type="text/css"> + #feedback { font-size: 1.4em; } + #selectable .ui-selecting { background: #FECA40; } + #selectable .ui-selected { background: #F39814; color: white; } + #selectable { list-style-type: none; margin: 0; padding: 0; width: 60%; } + #selectable li { margin: 3px; padding: 0.4em; font-size: 1.4em; height: 18px; } + </style> + <script type="text/javascript"> + $(function() { + $("#selectable").selectable({ + stop: function() { + var infodiv = $("#infodiv").empty(); + $(".ui-selected", this).each(function() { + var that_id = this.id; + infodiv.append(' #' + that_id); + }); + } + }); + $("button").button(); + $("button").click(function() { + var list_disabled = $("#selectable").selectable("option", "disabled"); + $("#infodiv").find('p').html('Disabled: ' + !list_disabled); + $("#selectable").selectable("option", "disabled", !list_disabled); + }); + }); + </script> +</head> +<body> +<div class="demo"> + +<ol id="selectable"> + <li id="item1" class="ui-widget-content">Item 1</li> + <li id="item2" class="ui-widget-content">Item 2</li> + <li id="item3" class="ui-widget-content">Item 3</li> + <li id="item4" class="ui-widget-content">Item 4</li> + <li id="item5" class="ui-widget-content">Item 5</li> + <li id="item6" class="ui-widget-content">Item 6</li> + <li id="item7" class="ui-widget-content">Item 7</li> +</ol> + +</div><!-- End demo --> + +<div class="demo-description"> + + <p>Enable a DOM element (or group of elements) to be selectable. Draw a box with your cursor to select items. Hold down the Ctrl key to make multiple non-adjacent selections. </p> + + <button type="button" id="somebutton">Click to lock</button> + + <div id="infodiv"> + <p>no info</p> + </div> + + +</div><!-- End demo-description --> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/sessionCookie.html b/node_modules/selenium-webdriver/lib/test/data/sessionCookie.html new file mode 100644 index 000000000..0ada24ed3 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/sessionCookie.html @@ -0,0 +1,21 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> + +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title></title> + <script type="text/javascript"> + function setcolor(what){ + document.body.style.backgroundColor=what + document.cookie="bgcolor="+what + } + + function popuponclick() { + my_window = window.open("sessionCookieDest.html", "cookiedestwindow", "status=1,width=350,height=150"); + } + </script> +</head> +<body> + <input id="setcolorbutton" type="button" value="Set Background Color" onclick="setcolor('#80FFFF')"/> + <input id="openwindowbutton" type="button" value="Open New Window" onclick="popuponclick()"/> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/sessionCookieDest.html b/node_modules/selenium-webdriver/lib/test/data/sessionCookieDest.html new file mode 100644 index 000000000..f5e2ef2e4 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/sessionCookieDest.html @@ -0,0 +1,34 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd"> + +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>Session cookie destination</title> + <script type="text/javascript"> + //Get cookie routine by Shelley Powers + function get_cookie(Name) { + var search = Name + "="; + var returnvalue = ""; + if (document.cookie.length > 0) { + offset = document.cookie.indexOf(search); + // if cookie exists + if (offset != -1) { + offset += search.length; + // set index of beginning of value + end = document.cookie.indexOf(";", offset); + // set index of end of cookie value + if (end == -1) end = document.cookie.length; + returnvalue=unescape(document.cookie.substring(offset, end)) + } + } + return returnvalue; + } + + function setcolor(){ + document.body.style.backgroundColor=get_cookie("bgcolor") + } + </script> +</head> +<body onload="setcolor()"> +This is the cookie destination page. +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/simple.xml b/node_modules/selenium-webdriver/lib/test/data/simple.xml new file mode 100644 index 000000000..01f4c87cc --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/simple.xml @@ -0,0 +1,5 @@ +<xml> + <foo> + <bar>baz</bar> + </foo> +</xml>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/simpleTest.html b/node_modules/selenium-webdriver/lib/test/data/simpleTest.html new file mode 100644 index 000000000..38210b9df --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/simpleTest.html @@ -0,0 +1,98 @@ +<html> +<head> + <title>Hello WebDriver</title> +</head> +<body style="" name="body"> +<h1>Heading</h1> + +<p id="oneline">A single line of text</p> +<p id="hiddenline" style="visibility: hidden">A hidden line of text</p> + +<div id="multiline"> + <p>A div containing</p> + More than one line of text<br/> + + <div>and block level elements</div> +</div> + +<span id="span">An inline element</span> + +<p id="lotsofspaces">This line has lots + + of spaces. +</p> + +<p id="nbsp">This line has a non-breaking space</p> + +<p id="nbspandspaces">This line has a non-breaking space and spaces</p> + +<p id="multilinenbsp">These lines  <br />  have leading and trailing NBSPs </p> + +<p id="inline">This <span id="inlinespan"> line has <em>text</em> </span> within elements that are meant to be displayed + <!-- not as a block but --> inline</p> + +<div id="div-with-pre"> +<p>before pre</p> +<pre id="preformatted"> This section has a preformatted + text block + split in four lines + </pre> +<p>after pre</p> +</div> + +<div id="twoblocks"><p>Some text</p><p>Some more text</p></div> + +<div id="nestedblocks">Cheese <div><p>Some text</p><div><p>Some more text</p><p>and also</p></div></div>Brie</div> + +<div id="collapsingtext"><span></span><div>Hello, world</div><span></span></div> + +<div id="withDocumentWrite"> +<script> +document.write("with document.write"); +document.write(" and with document.write again"); +</script> +</div> + +<form action="resultPage.html"> + <p> + <input type="checkbox" id="checkbox1"> + <label id="label1" for="checkbox1">foo<br />bar</label> + </p> +</form> + +<div id="links"> +<a href=""> link with leading space</a> +<a href="" id="linkWithTrailingSpace">link with trailing space +</a> +<a href=""><b>link with formatting tags</b></a> +<a href="" id="quote">link with " (double quote)</a> +<a href="" id="squote">link with ' (single quote)</a> +<a href="" id="backslash">link with \ (backslash)</a> +</div> + +<div style="text-indent:80%"><a href="resultPage.html" id="multilinelink">this link should break<br />on multiple lines</a></div> + +<div name="someDiv">Top level</div> +<div id="containsSomeDiv"> + <div name="someDiv">Nested</div> +</div> + +<table id="wrappingtext"> + <tbody> + <tr><td style="width: 10px;"><span>beforeSpace</span><span> </span><span>afterSpace</span></td></tr> + </tbody> +</table> + +<!-- Here comes an invalid <img> tag which has no src attribute ... --> +<img id="invalidImgTag" /> + +<img id="validImgTag" src="icon.gif" /> +<a id="validAnchorTag" href="icon.gif">a link to an icon</a> + +<span id="simpleJsonText">{a="b", c=1, d=true}</span> +<span id="complexJsonText">{a="\\b\\\"'\'"}</span> + +<span id="trimmedSpace"> test </span> + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/slowLoadingAlert.html b/node_modules/selenium-webdriver/lib/test/data/slowLoadingAlert.html new file mode 100644 index 000000000..a6216e375 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/slowLoadingAlert.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> +<title>slowLoadingAlert</title> +</head> + +<body onload="window.setTimeout(function() { window.alert('Look, an alert!'); }, 200);"> +</body> + +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/slowLoadingResourcePage.html b/node_modules/selenium-webdriver/lib/test/data/slowLoadingResourcePage.html new file mode 100644 index 000000000..02796c34a --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/slowLoadingResourcePage.html @@ -0,0 +1,12 @@ +<html> +<head> + <title>This page loads something slowly</title> +</head> +<body> + <p id="peas">Simulate the situation where a web-bug or analytics script takes waaay + too long to respond. Normally these things are loaded in an iframe, which is + what we're doing here.</p> + + <img src="sleep?time=7"></img> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/slow_loading_iframes.html b/node_modules/selenium-webdriver/lib/test/data/slow_loading_iframes.html new file mode 100644 index 000000000..d007248e2 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/slow_loading_iframes.html @@ -0,0 +1,14 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" + "http://www.w3.org/TR/html4/loose.dtd"> +<html> + <head> + <title>Page with slow loading iFrames</title> + </head> + <body> + <!-- Takes 3 seconds to load --> + <iframe src="/common/sleep?time=3"></iframe> + + <!-- Important: do not add a src attribute! --> + <iframe id="noSrc"></iframe> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/styledPage.html b/node_modules/selenium-webdriver/lib/test/data/styledPage.html new file mode 100644 index 000000000..30810f091 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/styledPage.html @@ -0,0 +1,28 @@ +<!DOCTYPE html> +<html> +<head> + <title>Styled Page</title> + <script> + function log(message) { + document.getElementById('log').innerHTML = "<p>" + message + "</p>" + } + </script> + +</head> +<body> +<div style="height: 200px"></div> + +<form action="#" method="get" onsubmit="return false;"> + <input name="searchBox"> + <input type="submit" name="btn" style="padding-top: 4px; padding-bottom: 4px" value="Search" onclick="log('click');"> +</form> + +<div id="log"></div> + +<div style="height: 4000px">Content</div> +</body> +</html> + + + + diff --git a/node_modules/selenium-webdriver/lib/test/data/svgPiechart.xhtml b/node_modules/selenium-webdriver/lib/test/data/svgPiechart.xhtml new file mode 100644 index 000000000..bf060fded --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/svgPiechart.xhtml @@ -0,0 +1,81 @@ +<?xml version="1.0" encoding="UTF-8"?> +<!DOCTYPE html + PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" + "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml" + xmlns:svg="http://www.w3.org/2000/svg" + xmlns:xlink="http://www.w3.org/1999/xlink"> +<head> + <title>Pie Chart Test</title> +</head> +<body> +<script type="text/javascript"> + function markClick(input) { + var element = document.getElementById('result'); + element.innerHTML = input; + } +</script> + <div id="someText"> + Some text for the chart. + </div> + <div id="result">Nothing.</div> + <div id="chart_container" style="width: 400px; height: 220px; border: 1px solid #808080;"> +<svg:svg id="chart_container" height="220" width="400"> + <svg:defs id="defs"></svg:defs> + <svg:g> + <svg:rect fill="white" height="220" width="400" y="0" x="0"></svg:rect> + <svg:text fill="black" font-weight="bold" font-size="10" font-family="Arial" y="16" x="200" text-anchor="middle">Test Chart</svg:text> + <svg:rect fill="white" height="83" width="97" y="77" x="296"></svg:rect> + <svg:rect fill="red" stroke="none" height="12" width="12" y="84" x="303"></svg:rect> + <svg:text fill="black" font-size="12" font-family="Arial" y="94" x="318" onclick="markClick('text_apple')">Apple</svg:text> + <svg:rect fill="green" stroke="none" height="12" width="12" y="103" x="303"></svg:rect> + <svg:text fill="black" font-size="12" font-family="Arial" y="113" x="318">Orange</svg:text> + <svg:rect fill="#808080" stroke="none" height="12" width="12" y="122" x="303"></svg:rect> + <svg:text fill="black" font-size="12" font-family="Arial" y="132" x="318">Banana</svg:text> + <svg:rect fill="green" stroke="none" height="12" width="12" y="141" x="303"></svg:rect> + <svg:text fill="black" font-size="12" font-family="Arial" y="151" x="318">Orange</svg:text> + <svg:g onclick="markClick('slice_red')"><svg:path fill="red" stroke="none" d="M148,119L148,43A76,76,0,0,1,198,61.77Z"></svg:path></svg:g> + <svg:g onclick="markClick('slice_green')"><svg:path fill="green" stroke="none" d="M148,119L198,61.77A76,76,0,0,1,202.93,171.52Z"></svg:path></svg:g> + <svg:g><svg:path fill="#808080" stroke="none" d="M148,119L202.93,171.52A76,76,0,0,1,72.08,122.41Z"></svg:path></svg:g> + <svg:g><svg:path fill="green" stroke="none" d="M148,119L72.08,122.41A76,76,0,0,1,148,43Z"></svg:path></svg:g> + </svg:g> +</svg:svg> +<svg:svg width="400px" height="120px"> + <svg:desc>Example RotateScale - Rotate and scale transforms</svg:desc> + <svg:g fill="none" stroke="black" stroke-width="3" > + <!-- Draw the axes of the original coordinate system --> + <svg:line x1="0" y1="1.5" x2="400" y2="1.5" /> + <svg:line x1="1.5" y1="0" x2="1.5" y2="120" /> + </svg:g> + <!-- Establish a new coordinate system whose origin is at (50,30) + in the initial coord. system and which is rotated by 30 degrees. --> + <svg:g transform="translate(50,30)"> + <svg:g transform="rotate(30)" id="rotate"> + <svg:g fill="none" stroke="red" stroke-width="3" > + <svg:line x1="0" y1="0" x2="50" y2="0" /> + <svg:line x1="0" y1="0" x2="0" y2="50" /> + </svg:g> + <svg:text x="0" y="0" font-size="20" font-family="Verdana" fill="blue" > + ABC (rotate) + </svg:text> + </svg:g> + </svg:g> + <!-- Establish a new coordinate system whose origin is at (200,40) + in the initial coord. system and which is scaled by 1.5. --> + <svg:g transform="translate(200,40)"> + <svg:g transform="scale(1.5)"> + <svg:g fill="none" stroke="red" stroke-width="3" > + <svg:line x1="0" y1="0" x2="50" y2="0" /> + <svg:line x1="0" y1="0" x2="0" y2="50" /> + </svg:g> + <svg:text x="0" y="0" font-size="20" font-family="Verdana" fill="blue" > + ABC (scale) + </svg:text> + </svg:g> + </svg:g> +</svg:svg> + <div style="position: absolute; white-space: nowrap; top: 230px; left: 410px; font-family: Arial; font-size: 12px; display: none; ">WOrange</div> + </div> + <div style="display: none; position: absolute; top: 230px; left: 410px; white-space: nowrap; font-family: Arial; font-size: 12px;">WOrange</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/svgTest.svg b/node_modules/selenium-webdriver/lib/test/data/svgTest.svg new file mode 100644 index 000000000..c6cc28390 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/svgTest.svg @@ -0,0 +1,4 @@ +<?xml version="1.0" encoding="utf-8"?> +<svg xmlns="http://www.w3.org/2000/svg" version="1.1" baseProfile="full" width="100px" height="100px" viewBox="0 0 100 100"> + <rect id="rect" width="50" height="50" fill="blue" onclick="document.getElementById('rect').setAttribute('fill', 'green')" /> +</svg> diff --git a/node_modules/selenium-webdriver/lib/test/data/tables.html b/node_modules/selenium-webdriver/lib/test/data/tables.html new file mode 100644 index 000000000..a2bc957b8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/tables.html @@ -0,0 +1,36 @@ +<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN" + "http://www.w3.org/TR/html4/loose.dtd"> +<html> +<head> + <title>Here be tables</title> +</head> +<body> + +<table id="base"> + <tr> + <td>Hello</td> + <td>World</td> + <td>(Cheese!)</td> + </tr> +</table> + +<table> + <tr id="hidden_text"> + <td>some text + <div style="display: none;">some more text</div> + </td> + </tr> +</table> + +<table> + <tr> + <th colspan="3" id="th1">Heading</th> + </tr> + <tr> + <td id="td1">Data 1</td> + <td colspan="2" id="td2">Data 2</td> + </tr> +</table> + +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/tinymce.html b/node_modules/selenium-webdriver/lib/test/data/tinymce.html new file mode 100644 index 000000000..067b66cd8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/tinymce.html @@ -0,0 +1,10 @@ +<!DOCTYPE html> +<html> +<head> + <title>TinyMCE</title> + <script src="js/tinymce.min.js"></script> +</head> +<body onload="tinymce.init({selector:'textarea'})"> +<textarea>Initial content</textarea> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/transformable.xml b/node_modules/selenium-webdriver/lib/test/data/transformable.xml new file mode 100644 index 000000000..0b7e7fd58 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/transformable.xml @@ -0,0 +1,11 @@ +<?xml version="1.0" encoding="UTF-8"?> +<?xml-stylesheet type="text/xsl" href="transformable.xsl"?> +<!DOCTYPE html [ <!ENTITY nbsp " "> ]> +<html xmlns="http://www.w3.org/1999/xhtml" xmlns:html="http://www.w3.org/1999/xhtml" xmlns:ui="http://dummy.com/mynamespace"> + <body id='body'> + <p>Click the button.</p> + <ui:app url="xhtmlTest.html"> + <ui:someButton id="x" name="y">Go to another page</ui:someButton> + </ui:app> + </body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/transformable.xsl b/node_modules/selenium-webdriver/lib/test/data/transformable.xsl new file mode 100644 index 000000000..53db9fded --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/transformable.xsl @@ -0,0 +1,37 @@ +<?xml version="1.0"?> + +<xsl:stylesheet + xmlns:xsl="http://www.w3.org/1999/XSL/Transform" + xmlns:ui="http://dummy.com/mynamespace" + xmlns="http://www.w3.org/1999/xhtml" + xmlns:html="http://www.w3.org/1999/xhtml" + version="1.0"> + + <xsl:output method="html" + doctype-system="http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd" + doctype-public="-//W3C//DTD XHTML 1.0 Strict//EN" indent="yes"/> + + <xsl:template match="ui:app"> + <form> + <xsl:attribute name="action"> + <xsl:value-of select="@url" /> + </xsl:attribute> + <xsl:apply-templates select="./*" /> + </form> + </xsl:template> + + <xsl:template match="ui:someButton"> + <input type="submit"> + <xsl:attribute name="id"> + <xsl:value-of select="@id" /> + </xsl:attribute> + <xsl:attribute name="name"> + <xsl:value-of select="@name" /> + </xsl:attribute> + <xsl:attribute name="value"> + <xsl:value-of select="normalize-space(.)"/> + </xsl:attribute> + </input> + </xsl:template> + +</xsl:stylesheet>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/transparentUpload.html b/node_modules/selenium-webdriver/lib/test/data/transparentUpload.html new file mode 100644 index 000000000..87b02bfbc --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/transparentUpload.html @@ -0,0 +1,70 @@ +<!DOCTYPE html> +<html> +<head> + <title>Upload Form</title> + <style> + .fileUpload { + position: relative; + overflow: hidden; + margin: 10px; + background-color: #FFFFFF; + width: 50px; + text-align: center; + } + .fileUpload input.upload { + position: absolute; + top: 0; + right: 0; + margin: 0; + padding: 0; + font-size: 20px; + cursor: pointer; + opacity: 0; + filter: alpha(opacity=0); + height: 100%; + text-align: center; + } + </style> + <script> + var intervalId; + function onTick() { + var label = document.getElementById('upload_label'); + label.innerHTML += '.'; + } + + function onUploadSubmit() { + document.getElementById('upload_target').contentWindow.document.body. + innerHTML = ''; + var label = document.getElementById('upload_label'); + label.innerHTML = 'Uploading "' + document.forms[0].upload.value + '"'; + label.style.display = ''; + intervalId = window.setInterval(onTick, 500); + return true; + } + + function onUploadDone() { + var label = document.getElementById('upload_label'); + label.style.display = 'none'; + window.clearInterval(intervalId); + return true; + } + </script> +</head> +<body> +<form action="/common/upload" method="post" name="upload_form" + target="upload_target" enctype="multipart/form-data" + onsubmit="onUploadSubmit();"> + <div> + <div class="fileUpload"> + <span>Upload</span> + <input id="upload" name="upload" type="file" class="upload" /> + </div> + <div><input id="go" type="submit" value="Go!"/></div> + </div> + <div id="upload_label" style="display:none"></div> + <iframe src="" id="upload_target" name="upload_target" + style="width:300px;height:200px"> + </iframe> +</form> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/underscore.html b/node_modules/selenium-webdriver/lib/test/data/underscore.html new file mode 100644 index 000000000..904a4441f --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/underscore.html @@ -0,0 +1,9 @@ +<html> +<head> +<script type="text/javascript"> +_ = [1, 2, 3]; +</script> +</head> +<body> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/unicode_ltr.html b/node_modules/selenium-webdriver/lib/test/data/unicode_ltr.html new file mode 100644 index 000000000..245acc74e --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/unicode_ltr.html @@ -0,0 +1,8 @@ +<!DOCTYPE html> +<html> + <head> + </head> + <body dir="ltr" class="Dw"> + <div id="EH"><nobr class="">Some notes</nobr></div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/upload.html b/node_modules/selenium-webdriver/lib/test/data/upload.html new file mode 100644 index 000000000..aca398ab7 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/upload.html @@ -0,0 +1,45 @@ +<!DOCTYPE html> +<html> +<head> + <title>Upload Form</title> + <script> + var intervalId; + function onTick() { + var label = document.getElementById('upload_label'); + label.innerHTML += '.'; + } + + function onUploadSubmit() { + document.getElementById('upload_target').contentWindow.document.body. + innerHTML = ''; + var label = document.getElementById('upload_label'); + label.innerHTML = 'Uploading "' + document.forms[0].upload.value + '"'; + label.style.display = ''; + intervalId = window.setInterval(onTick, 500); + return true; + } + + function onUploadDone() { + var label = document.getElementById('upload_label'); + label.style.display = 'none'; + window.clearInterval(intervalId); + return true; + } + </script> +</head> +<body> +<form action="/common/upload" method="post" name="upload_form" + target="upload_target" enctype="multipart/form-data" + onsubmit="onUploadSubmit();"> + <div> + Enter a file to upload: + <div><input id="upload" name="upload" type="file"/></div> + <div><input id="go" type="submit" value="Go!"/></div> + </div> + <div id="upload_label" style="display:none"></div> + <iframe src="" id="upload_target" name="upload_target" + style="width:300px;height:200px"> + </iframe> +</form> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/userDefinedProperty.html b/node_modules/selenium-webdriver/lib/test/data/userDefinedProperty.html new file mode 100644 index 000000000..2453e6921 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/userDefinedProperty.html @@ -0,0 +1,8 @@ +<html> +<body> +<div id="d"></div> +<script> +document.getElementById("d").dynamicProperty = 'sampleValue'; +</script> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/veryLargeCanvas.html b/node_modules/selenium-webdriver/lib/test/data/veryLargeCanvas.html new file mode 100644 index 000000000..54a2aba46 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/veryLargeCanvas.html @@ -0,0 +1,81 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>Rectangles</title> + <script type="text/javascript"> + function appendMessage(message) { + document.getElementById('result').innerHTML += message + + " "; + } + </script> + <style type="text/css"> + #r1 { + position: absolute; + background-color: lightblue; + left: 100px; + top: 100px; + width: 100px; + height: 50px; + } + #r2 { + position: absolute; + background-color: red; + left: 2500px; + top: 50px; + width: 80px; + height: 50px; + } + #r3 { + position: absolute; + background-color: yellow; + left: 60px; + top: 1500px; + width: 80px; + height: 50px; + } + #r4 { + position: absolute; + background-color: cyan; + left: 220px; + top: 180px; + width: 100px; + height: 50px; + } + #r5 { + position: absolute; + background-color: blue; + left: 60px; + top: 1600px; + width: 80px; + height: 50px; + } + #r6 { + position: absolute; + background-color: green; + left: 2581px; + top: 50px; + width: 80px; + height: 50px; + } + #result { + border: 10; + padding: 5; + background-color: grey; + position: absolute; + left: 20px; + top: 30px; + width: 400px; + height: 20px; + } + </style> +</head> +<body> + <div id="result"></div> + <div id="r1" onclick="appendMessage('First')">First Target</div> + <div id="r2" onclick="appendMessage('Second')">Second Target</div> + <div id="r3" onclick="appendMessage('Third')">Third Target</div> + <div id="r4" onclick="appendMessage('Fourth')">Fourth Target</div> + <div id="r5" onclick="appendMessage('OOPS2')">Not a Target</div> + <div id="r6" onclick="appendMessage('OOPS')">Not a Target</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/visibility-css.html b/node_modules/selenium-webdriver/lib/test/data/visibility-css.html new file mode 100644 index 000000000..80cc649ce --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/visibility-css.html @@ -0,0 +1,21 @@ +<!DOCTYPE html> +<html> +<head> +<meta content="text/html; charset=UTF-8" http-equiv="content-type" /> +<title>Visibility test via CSS</title> +<style> + +.box-popup { + border : 1px; + min-width : 150px; +} +body { + overflow : hidden; +} +</style></head><body> +<div style="left: 30px; top: 10px; visibility: visible; position: absolute; overflow: visible;" + class="box-popup" id="suggest"> + <p>Hello world. I like cheese.</p> +</div> +</body> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/win32frameset.html b/node_modules/selenium-webdriver/lib/test/data/win32frameset.html new file mode 100644 index 000000000..108b80f8c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/win32frameset.html @@ -0,0 +1,8 @@ +<html> +<head></head> +<frameset cols="*, *, *"> + <frame name="first" src="page/1"/> + <frame name="second" src="page/2?title=Fish"/> + <frame name="third" src="formPage.html"/> +</frameset> +</html>
\ No newline at end of file diff --git a/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/page_with_frame.html b/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/page_with_frame.html new file mode 100644 index 000000000..b94733b5c --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/page_with_frame.html @@ -0,0 +1,12 @@ +<!DOCTYPE html> +<html> +<head> + <title>Test page for WindowSwitchingTest.testShouldFocusOnTheTopMostFrameAfterSwitchingToAWindow</title> +</head> +<body> + <p><a id="a-link-that-opens-a-new-window" target="newWindow" href="simple_page.html">Open new window</a></p> + <div> + <iframe name="myframe" src="simple_page.html" width="400" height="200"></iframe> + </div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/simple_page.html b/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/simple_page.html new file mode 100644 index 000000000..52c163cbf --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/window_switching_tests/simple_page.html @@ -0,0 +1,9 @@ +<!DOCTYPE html> +<html> +<head> + <title>Simple Page</title> +</head> +<body> + <div>Simple page with simple test.</div> +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/xhtmlFormPage.xhtml b/node_modules/selenium-webdriver/lib/test/data/xhtmlFormPage.xhtml new file mode 100644 index 000000000..aca53d343 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/xhtmlFormPage.xhtml @@ -0,0 +1,17 @@ +<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Strict//EN" + "http://www.w3.org/TR/xhtml1/DTD/xhtml1-strict.dtd"> +<html xmlns="http://www.w3.org/1999/xhtml"> +<head> + <title>XHTML</title> +</head> +<body> + + <form method="POST" enctype="multipart/form-data"> + <input name="file" id="file" type="file" /> + <input name="submit" id="submit" type="submit" /> + </form> + +<p id="self-closed" />Here is some content that should not be in the previous p tag + +</body> +</html> diff --git a/node_modules/selenium-webdriver/lib/test/data/xhtmlTest.html b/node_modules/selenium-webdriver/lib/test/data/xhtmlTest.html new file mode 100644 index 000000000..d2f3a5da8 --- /dev/null +++ b/node_modules/selenium-webdriver/lib/test/data/xhtmlTest.html @@ -0,0 +1,76 @@ +<?xml version="1.0"?> +<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en"> +<head> + <title>XHTML Test Page</title> +</head> +<body> +<div class="navigation"> + <p><a href="resultPage.html" target="result" name="windowOne">Open new window</a></p> + <p><a href="iframes.html" target="_blank" name="windowTwo">Create a new anonymous window</a></p> + <p><a href="iframes.html" name="sameWindow">Open page with iframes in same window</a></p> + <p><a href="javascriptPage.html" target="result" name="windowThree">Open a window with a close button</a></p> +</div> + +<a name="notext"><b></b></a> + +<div class="content"> + <h1 class="header">XHTML Might Be The Future</h1> + + <p>If you'd like to go elsewhere then <a href="resultPage.html">click me</a>.</p> + + <p>Alternatively, <a href="resultPage.html" id="linkId">this goes to the same place</a>.</p> + + <form name="someForm"> + <input id="username" type="text" value="change"/> + </form> + + This link has the same text as another link: <a href="resultPage.html">click me</a>. +</div> + +<div class="extraDiv">Another div starts here.<p/> + <h2 class="nameA nameBnoise nameC">An H2 title</h2> + <p class="nameC">Some more text</p> +</div> + +<div> + <a id="id1" href="#">Foo</a> + <ul id="id2" /> + <span id="id3"/> +</div> + +<div> + <table id="table" ></table> +</div> + +<span id="amazing"> +<div> + <div> + <div> + <span/> + <a>I have width</a> + </div> + </div> +</div> +</span> + +<a name="text" /> +<p id="spaces"> </p> +<p id="empty"></p> +<a href="foo" id="linkWithEqualsSign">Link=equalssign</a> + +<p class=" spaceAround ">Spaced out</p> + +<span id="my_span"> + <div>first_div</div> + <div>second_div</div> + <span>first_span</span> + <span>second_span</span> +</span> + +<div id="parent">I'm a parent + <div id="child">I'm a child</div> +</div> + +<div id="only-exists-on-xhtmltest">Woo woo</div> +</body> +</html> |
