diff options
| author | Florian Dold <florian.dold@gmail.com> | 2018-02-20 17:16:29 +0100 |
|---|---|---|
| committer | Florian Dold <florian.dold@gmail.com> | 2018-02-20 17:16:29 +0100 |
| commit | 0ad2935a1f6436d62251f30e826c9c78bfd49525 (patch) | |
| tree | e9852ed84b8e6520361dbe514c98e13d69672be7 /node_modules/ava | |
| parent | 23f4998dfec5edc8f0ce134d848c996d434181ba (diff) | |
node_modules
Diffstat (limited to 'node_modules/ava')
61 files changed, 14522 insertions, 0 deletions
diff --git a/node_modules/ava/node_modules/.bin/semver b/node_modules/ava/node_modules/.bin/semver new file mode 120000 index 000000000..b3ca6032f --- /dev/null +++ b/node_modules/ava/node_modules/.bin/semver @@ -0,0 +1 @@ +../../../semver/bin/semver
\ No newline at end of file diff --git a/node_modules/ava/node_modules/chalk/node_modules/supports-color/browser.js b/node_modules/ava/node_modules/chalk/node_modules/supports-color/browser.js new file mode 100644 index 000000000..ae7c87b17 --- /dev/null +++ b/node_modules/ava/node_modules/chalk/node_modules/supports-color/browser.js @@ -0,0 +1,2 @@ +'use strict'; +module.exports = false; diff --git a/node_modules/ava/node_modules/chalk/node_modules/supports-color/index.js b/node_modules/ava/node_modules/chalk/node_modules/supports-color/index.js new file mode 100644 index 000000000..20a29230e --- /dev/null +++ b/node_modules/ava/node_modules/chalk/node_modules/supports-color/index.js @@ -0,0 +1,115 @@ +'use strict'; +const os = require('os'); +const hasFlag = require('has-flag'); + +const env = process.env; + +const support = level => { + if (level === 0) { + return false; + } + + return { + level, + hasBasic: true, + has256: level >= 2, + has16m: level >= 3 + }; +}; + +let supportLevel = (() => { + if (hasFlag('no-color') || + hasFlag('no-colors') || + hasFlag('color=false')) { + return 0; + } + + if (hasFlag('color=16m') || + hasFlag('color=full') || + hasFlag('color=truecolor')) { + return 3; + } + + if (hasFlag('color=256')) { + return 2; + } + + if (hasFlag('color') || + hasFlag('colors') || + hasFlag('color=true') || + hasFlag('color=always')) { + return 1; + } + + if (process.stdout && !process.stdout.isTTY) { + return 0; + } + + if (process.platform === 'win32') { + // Node.js 7.5.0 is the first version of Node.js to include a patch to + // libuv that enables 256 color output on Windows. Anything earlier and it + // won't work. However, here we target Node.js 8 at minimum as it is an LTS + // release, and Node.js 7 is not. Windows 10 build 10586 is the first Windows + // release that supports 256 colors. + const osRelease = os.release().split('.'); + if ( + Number(process.versions.node.split('.')[0]) >= 8 && + Number(osRelease[0]) >= 10 && + Number(osRelease[2]) >= 10586 + ) { + return 2; + } + + return 1; + } + + if ('CI' in env) { + if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI'].some(sign => sign in env) || env.CI_NAME === 'codeship') { + return 1; + } + + return 0; + } + + if ('TEAMCITY_VERSION' in env) { + return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0; + } + + if ('TERM_PROGRAM' in env) { + const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10); + + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + return version >= 3 ? 3 : 2; + case 'Hyper': + return 3; + case 'Apple_Terminal': + return 2; + // No default + } + } + + if (/-256(color)?$/i.test(env.TERM)) { + return 2; + } + + if (/^screen|^xterm|^vt100|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) { + return 1; + } + + if ('COLORTERM' in env) { + return 1; + } + + if (env.TERM === 'dumb') { + return 0; + } + + return 0; +})(); + +if ('FORCE_COLOR' in env) { + supportLevel = parseInt(env.FORCE_COLOR, 10) === 0 ? 0 : (supportLevel || 1); +} + +module.exports = process && support(supportLevel); diff --git a/node_modules/ava/node_modules/chalk/node_modules/supports-color/license b/node_modules/ava/node_modules/chalk/node_modules/supports-color/license new file mode 100644 index 000000000..e7af2f771 --- /dev/null +++ b/node_modules/ava/node_modules/chalk/node_modules/supports-color/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ava/node_modules/chalk/node_modules/supports-color/package.json b/node_modules/ava/node_modules/chalk/node_modules/supports-color/package.json new file mode 100644 index 000000000..b665bab8b --- /dev/null +++ b/node_modules/ava/node_modules/chalk/node_modules/supports-color/package.json @@ -0,0 +1,53 @@ +{ + "name": "supports-color", + "version": "4.5.0", + "description": "Detect whether a terminal supports color", + "license": "MIT", + "repository": "chalk/supports-color", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "engines": { + "node": ">=4" + }, + "scripts": { + "test": "xo && ava" + }, + "files": [ + "index.js", + "browser.js" + ], + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "ansi", + "styles", + "tty", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "support", + "supports", + "capability", + "detect", + "truecolor", + "16m" + ], + "dependencies": { + "has-flag": "^2.0.0" + }, + "devDependencies": { + "ava": "*", + "import-fresh": "^2.0.0", + "xo": "*" + }, + "browser": "browser.js" +} diff --git a/node_modules/ava/node_modules/chalk/node_modules/supports-color/readme.md b/node_modules/ava/node_modules/chalk/node_modules/supports-color/readme.md new file mode 100644 index 000000000..3bef57db0 --- /dev/null +++ b/node_modules/ava/node_modules/chalk/node_modules/supports-color/readme.md @@ -0,0 +1,66 @@ +# supports-color [](https://travis-ci.org/chalk/supports-color) + +> Detect whether a terminal supports color + + +## Install + +``` +$ npm install supports-color +``` + + +## Usage + +```js +const supportsColor = require('supports-color'); + +if (supportsColor) { + console.log('Terminal supports color'); +} + +if (supportsColor.has256) { + console.log('Terminal supports 256 colors'); +} + +if (supportsColor.has16m) { + console.log('Terminal supports 16 million colors (truecolor)'); +} +``` + + +## API + +Returns an `Object`, or `false` if color is not supported. + +The returned object specifies a level of support for color through a `.level` property and a corresponding flag: + +- `.level = 1` and `.hasBasic = true`: Basic color support (16 colors) +- `.level = 2` and `.has256 = true`: 256 color support +- `.level = 3` and `.has16m = true`: Truecolor support (16 million colors) + + +## Info + +It obeys the `--color` and `--no-color` CLI flags. + +Can be overridden by the user with the flags `--color` and `--no-color`. For situations where using `--color` is not possible, add the environment variable `FORCE_COLOR=1` to forcefully enable color or `FORCE_COLOR=0` to forcefully disable. The use of `FORCE_COLOR` overrides all other color support checks. + +Explicit 256/Truecolor mode can be enabled using the `--color=256` and `--color=16m` flags, respectively. + + +## Related + +- [supports-color-cli](https://github.com/chalk/supports-color-cli) - CLI for this module +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT diff --git a/node_modules/ava/node_modules/chalk/types/index.d.ts b/node_modules/ava/node_modules/chalk/types/index.d.ts new file mode 100644 index 000000000..b4e4dc57e --- /dev/null +++ b/node_modules/ava/node_modules/chalk/types/index.d.ts @@ -0,0 +1,97 @@ +// Type definitions for Chalk +// Definitions by: Thomas Sauer <https://github.com/t-sauer> + +export const enum Level { + None = 0, + Basic = 1, + Ansi256 = 2, + TrueColor = 3 +} + +export interface ChalkOptions { + enabled?: boolean; + level?: Level; +} + +export interface ChalkConstructor { + new (options?: ChalkOptions): Chalk; + (options?: ChalkOptions): Chalk; +} + +export interface ColorSupport { + level: Level; + hasBasic: boolean; + has256: boolean; + has16m: boolean; +} + +export interface Chalk { + (...text: string[]): string; + (text: TemplateStringsArray, ...placeholders: string[]): string; + constructor: ChalkConstructor; + enabled: boolean; + level: Level; + rgb(r: number, g: number, b: number): this; + hsl(h: number, s: number, l: number): this; + hsv(h: number, s: number, v: number): this; + hwb(h: number, w: number, b: number): this; + bgHex(color: string): this; + bgKeyword(color: string): this; + bgRgb(r: number, g: number, b: number): this; + bgHsl(h: number, s: number, l: number): this; + bgHsv(h: number, s: number, v: number): this; + bgHwb(h: number, w: number, b: number): this; + hex(color: string): this; + keyword(color: string): this; + + readonly reset: this; + readonly bold: this; + readonly dim: this; + readonly italic: this; + readonly underline: this; + readonly inverse: this; + readonly hidden: this; + readonly strikethrough: this; + + readonly visible: this; + + readonly black: this; + readonly red: this; + readonly green: this; + readonly yellow: this; + readonly blue: this; + readonly magenta: this; + readonly cyan: this; + readonly white: this; + readonly gray: this; + readonly grey: this; + readonly blackBright: this; + readonly redBright: this; + readonly greenBright: this; + readonly yellowBright: this; + readonly blueBright: this; + readonly magentaBright: this; + readonly cyanBright: this; + readonly whiteBright: this; + + readonly bgBlack: this; + readonly bgRed: this; + readonly bgGreen: this; + readonly bgYellow: this; + readonly bgBlue: this; + readonly bgMagenta: this; + readonly bgCyan: this; + readonly bgWhite: this; + readonly bgBlackBright: this; + readonly bgRedBright: this; + readonly bgGreenBright: this; + readonly bgYellowBright: this; + readonly bgBlueBright: this; + readonly bgMagentaBright: this; + readonly bgCyanBright: this; + readonly bgWhiteBright: this; +} + +declare const chalk: Chalk & { supportsColor: ColorSupport }; + +export default chalk diff --git a/node_modules/ava/node_modules/debug/.coveralls.yml b/node_modules/ava/node_modules/debug/.coveralls.yml new file mode 100644 index 000000000..20a706858 --- /dev/null +++ b/node_modules/ava/node_modules/debug/.coveralls.yml @@ -0,0 +1 @@ +repo_token: SIAeZjKYlHK74rbcFvNHMUzjRiMpflxve diff --git a/node_modules/ava/node_modules/debug/.eslintrc b/node_modules/ava/node_modules/debug/.eslintrc new file mode 100644 index 000000000..146371edb --- /dev/null +++ b/node_modules/ava/node_modules/debug/.eslintrc @@ -0,0 +1,14 @@ +{ + "env": { + "browser": true, + "node": true + }, + "globals": { + "chrome": true + }, + "rules": { + "no-console": 0, + "no-empty": [1, { "allowEmptyCatch": true }] + }, + "extends": "eslint:recommended" +} diff --git a/node_modules/ava/node_modules/debug/.npmignore b/node_modules/ava/node_modules/debug/.npmignore new file mode 100644 index 000000000..5f60eecc8 --- /dev/null +++ b/node_modules/ava/node_modules/debug/.npmignore @@ -0,0 +1,9 @@ +support +test +examples +example +*.sock +dist +yarn.lock +coverage +bower.json diff --git a/node_modules/ava/node_modules/debug/.travis.yml b/node_modules/ava/node_modules/debug/.travis.yml new file mode 100644 index 000000000..a76430037 --- /dev/null +++ b/node_modules/ava/node_modules/debug/.travis.yml @@ -0,0 +1,20 @@ +sudo: false + +language: node_js + +node_js: + - "4" + - "6" + - "8" + +install: + - make install + +script: + - make lint + - make test + +matrix: + include: + - node_js: '8' + env: BROWSER=1 diff --git a/node_modules/ava/node_modules/debug/CHANGELOG.md b/node_modules/ava/node_modules/debug/CHANGELOG.md new file mode 100644 index 000000000..820d21e33 --- /dev/null +++ b/node_modules/ava/node_modules/debug/CHANGELOG.md @@ -0,0 +1,395 @@ + +3.1.0 / 2017-09-26 +================== + + * Add `DEBUG_HIDE_DATE` env var (#486) + * Remove ReDoS regexp in %o formatter (#504) + * Remove "component" from package.json + * Remove `component.json` + * Ignore package-lock.json + * Examples: fix colors printout + * Fix: browser detection + * Fix: spelling mistake (#496, @EdwardBetts) + +3.0.1 / 2017-08-24 +================== + + * Fix: Disable colors in Edge and Internet Explorer (#489) + +3.0.0 / 2017-08-08 +================== + + * Breaking: Remove DEBUG_FD (#406) + * Breaking: Use `Date#toISOString()` instead to `Date#toUTCString()` when output is not a TTY (#418) + * Breaking: Make millisecond timer namespace specific and allow 'always enabled' output (#408) + * Addition: document `enabled` flag (#465) + * Addition: add 256 colors mode (#481) + * Addition: `enabled()` updates existing debug instances, add `destroy()` function (#440) + * Update: component: update "ms" to v2.0.0 + * Update: separate the Node and Browser tests in Travis-CI + * Update: refactor Readme, fixed documentation, added "Namespace Colors" section, redid screenshots + * Update: separate Node.js and web browser examples for organization + * Update: update "browserify" to v14.4.0 + * Fix: fix Readme typo (#473) + +2.6.9 / 2017-09-22 +================== + + * remove ReDoS regexp in %o formatter (#504) + +2.6.8 / 2017-05-18 +================== + + * Fix: Check for undefined on browser globals (#462, @marbemac) + +2.6.7 / 2017-05-16 +================== + + * Fix: Update ms to 2.0.0 to fix regular expression denial of service vulnerability (#458, @hubdotcom) + * Fix: Inline extend function in node implementation (#452, @dougwilson) + * Docs: Fix typo (#455, @msasad) + +2.6.5 / 2017-04-27 +================== + + * Fix: null reference check on window.documentElement.style.WebkitAppearance (#447, @thebigredgeek) + * Misc: clean up browser reference checks (#447, @thebigredgeek) + * Misc: add npm-debug.log to .gitignore (@thebigredgeek) + + +2.6.4 / 2017-04-20 +================== + + * Fix: bug that would occur if process.env.DEBUG is a non-string value. (#444, @LucianBuzzo) + * Chore: ignore bower.json in npm installations. (#437, @joaovieira) + * Misc: update "ms" to v0.7.3 (@tootallnate) + +2.6.3 / 2017-03-13 +================== + + * Fix: Electron reference to `process.env.DEBUG` (#431, @paulcbetts) + * Docs: Changelog fix (@thebigredgeek) + +2.6.2 / 2017-03-10 +================== + + * Fix: DEBUG_MAX_ARRAY_LENGTH (#420, @slavaGanzin) + * Docs: Add backers and sponsors from Open Collective (#422, @piamancini) + * Docs: Add Slackin invite badge (@tootallnate) + +2.6.1 / 2017-02-10 +================== + + * Fix: Module's `export default` syntax fix for IE8 `Expected identifier` error + * Fix: Whitelist DEBUG_FD for values 1 and 2 only (#415, @pi0) + * Fix: IE8 "Expected identifier" error (#414, @vgoma) + * Fix: Namespaces would not disable once enabled (#409, @musikov) + +2.6.0 / 2016-12-28 +================== + + * Fix: added better null pointer checks for browser useColors (@thebigredgeek) + * Improvement: removed explicit `window.debug` export (#404, @tootallnate) + * Improvement: deprecated `DEBUG_FD` environment variable (#405, @tootallnate) + +2.5.2 / 2016-12-25 +================== + + * Fix: reference error on window within webworkers (#393, @KlausTrainer) + * Docs: fixed README typo (#391, @lurch) + * Docs: added notice about v3 api discussion (@thebigredgeek) + +2.5.1 / 2016-12-20 +================== + + * Fix: babel-core compatibility + +2.5.0 / 2016-12-20 +================== + + * Fix: wrong reference in bower file (@thebigredgeek) + * Fix: webworker compatibility (@thebigredgeek) + * Fix: output formatting issue (#388, @kribblo) + * Fix: babel-loader compatibility (#383, @escwald) + * Misc: removed built asset from repo and publications (@thebigredgeek) + * Misc: moved source files to /src (#378, @yamikuronue) + * Test: added karma integration and replaced babel with browserify for browser tests (#378, @yamikuronue) + * Test: coveralls integration (#378, @yamikuronue) + * Docs: simplified language in the opening paragraph (#373, @yamikuronue) + +2.4.5 / 2016-12-17 +================== + + * Fix: `navigator` undefined in Rhino (#376, @jochenberger) + * Fix: custom log function (#379, @hsiliev) + * Improvement: bit of cleanup + linting fixes (@thebigredgeek) + * Improvement: rm non-maintainted `dist/` dir (#375, @freewil) + * Docs: simplified language in the opening paragraph. (#373, @yamikuronue) + +2.4.4 / 2016-12-14 +================== + + * Fix: work around debug being loaded in preload scripts for electron (#368, @paulcbetts) + +2.4.3 / 2016-12-14 +================== + + * Fix: navigation.userAgent error for react native (#364, @escwald) + +2.4.2 / 2016-12-14 +================== + + * Fix: browser colors (#367, @tootallnate) + * Misc: travis ci integration (@thebigredgeek) + * Misc: added linting and testing boilerplate with sanity check (@thebigredgeek) + +2.4.1 / 2016-12-13 +================== + + * Fix: typo that broke the package (#356) + +2.4.0 / 2016-12-13 +================== + + * Fix: bower.json references unbuilt src entry point (#342, @justmatt) + * Fix: revert "handle regex special characters" (@tootallnate) + * Feature: configurable util.inspect()`options for NodeJS (#327, @tootallnate) + * Feature: %O`(big O) pretty-prints objects (#322, @tootallnate) + * Improvement: allow colors in workers (#335, @botverse) + * Improvement: use same color for same namespace. (#338, @lchenay) + +2.3.3 / 2016-11-09 +================== + + * Fix: Catch `JSON.stringify()` errors (#195, Jovan Alleyne) + * Fix: Returning `localStorage` saved values (#331, Levi Thomason) + * Improvement: Don't create an empty object when no `process` (Nathan Rajlich) + +2.3.2 / 2016-11-09 +================== + + * Fix: be super-safe in index.js as well (@TooTallNate) + * Fix: should check whether process exists (Tom Newby) + +2.3.1 / 2016-11-09 +================== + + * Fix: Added electron compatibility (#324, @paulcbetts) + * Improvement: Added performance optimizations (@tootallnate) + * Readme: Corrected PowerShell environment variable example (#252, @gimre) + * Misc: Removed yarn lock file from source control (#321, @fengmk2) + +2.3.0 / 2016-11-07 +================== + + * Fix: Consistent placement of ms diff at end of output (#215, @gorangajic) + * Fix: Escaping of regex special characters in namespace strings (#250, @zacronos) + * Fix: Fixed bug causing crash on react-native (#282, @vkarpov15) + * Feature: Enabled ES6+ compatible import via default export (#212 @bucaran) + * Feature: Added %O formatter to reflect Chrome's console.log capability (#279, @oncletom) + * Package: Update "ms" to 0.7.2 (#315, @DevSide) + * Package: removed superfluous version property from bower.json (#207 @kkirsche) + * Readme: fix USE_COLORS to DEBUG_COLORS + * Readme: Doc fixes for format string sugar (#269, @mlucool) + * Readme: Updated docs for DEBUG_FD and DEBUG_COLORS environment variables (#232, @mattlyons0) + * Readme: doc fixes for PowerShell (#271 #243, @exoticknight @unreadable) + * Readme: better docs for browser support (#224, @matthewmueller) + * Tooling: Added yarn integration for development (#317, @thebigredgeek) + * Misc: Renamed History.md to CHANGELOG.md (@thebigredgeek) + * Misc: Added license file (#226 #274, @CantemoInternal @sdaitzman) + * Misc: Updated contributors (@thebigredgeek) + +2.2.0 / 2015-05-09 +================== + + * package: update "ms" to v0.7.1 (#202, @dougwilson) + * README: add logging to file example (#193, @DanielOchoa) + * README: fixed a typo (#191, @amir-s) + * browser: expose `storage` (#190, @stephenmathieson) + * Makefile: add a `distclean` target (#189, @stephenmathieson) + +2.1.3 / 2015-03-13 +================== + + * Updated stdout/stderr example (#186) + * Updated example/stdout.js to match debug current behaviour + * Renamed example/stderr.js to stdout.js + * Update Readme.md (#184) + * replace high intensity foreground color for bold (#182, #183) + +2.1.2 / 2015-03-01 +================== + + * dist: recompile + * update "ms" to v0.7.0 + * package: update "browserify" to v9.0.3 + * component: fix "ms.js" repo location + * changed bower package name + * updated documentation about using debug in a browser + * fix: security error on safari (#167, #168, @yields) + +2.1.1 / 2014-12-29 +================== + + * browser: use `typeof` to check for `console` existence + * browser: check for `console.log` truthiness (fix IE 8/9) + * browser: add support for Chrome apps + * Readme: added Windows usage remarks + * Add `bower.json` to properly support bower install + +2.1.0 / 2014-10-15 +================== + + * node: implement `DEBUG_FD` env variable support + * package: update "browserify" to v6.1.0 + * package: add "license" field to package.json (#135, @panuhorsmalahti) + +2.0.0 / 2014-09-01 +================== + + * package: update "browserify" to v5.11.0 + * node: use stderr rather than stdout for logging (#29, @stephenmathieson) + +1.0.4 / 2014-07-15 +================== + + * dist: recompile + * example: remove `console.info()` log usage + * example: add "Content-Type" UTF-8 header to browser example + * browser: place %c marker after the space character + * browser: reset the "content" color via `color: inherit` + * browser: add colors support for Firefox >= v31 + * debug: prefer an instance `log()` function over the global one (#119) + * Readme: update documentation about styled console logs for FF v31 (#116, @wryk) + +1.0.3 / 2014-07-09 +================== + + * Add support for multiple wildcards in namespaces (#122, @seegno) + * browser: fix lint + +1.0.2 / 2014-06-10 +================== + + * browser: update color palette (#113, @gscottolson) + * common: make console logging function configurable (#108, @timoxley) + * node: fix %o colors on old node <= 0.8.x + * Makefile: find node path using shell/which (#109, @timoxley) + +1.0.1 / 2014-06-06 +================== + + * browser: use `removeItem()` to clear localStorage + * browser, node: don't set DEBUG if namespaces is undefined (#107, @leedm777) + * package: add "contributors" section + * node: fix comment typo + * README: list authors + +1.0.0 / 2014-06-04 +================== + + * make ms diff be global, not be scope + * debug: ignore empty strings in enable() + * node: make DEBUG_COLORS able to disable coloring + * *: export the `colors` array + * npmignore: don't publish the `dist` dir + * Makefile: refactor to use browserify + * package: add "browserify" as a dev dependency + * Readme: add Web Inspector Colors section + * node: reset terminal color for the debug content + * node: map "%o" to `util.inspect()` + * browser: map "%j" to `JSON.stringify()` + * debug: add custom "formatters" + * debug: use "ms" module for humanizing the diff + * Readme: add "bash" syntax highlighting + * browser: add Firebug color support + * browser: add colors for WebKit browsers + * node: apply log to `console` + * rewrite: abstract common logic for Node & browsers + * add .jshintrc file + +0.8.1 / 2014-04-14 +================== + + * package: re-add the "component" section + +0.8.0 / 2014-03-30 +================== + + * add `enable()` method for nodejs. Closes #27 + * change from stderr to stdout + * remove unnecessary index.js file + +0.7.4 / 2013-11-13 +================== + + * remove "browserify" key from package.json (fixes something in browserify) + +0.7.3 / 2013-10-30 +================== + + * fix: catch localStorage security error when cookies are blocked (Chrome) + * add debug(err) support. Closes #46 + * add .browser prop to package.json. Closes #42 + +0.7.2 / 2013-02-06 +================== + + * fix package.json + * fix: Mobile Safari (private mode) is broken with debug + * fix: Use unicode to send escape character to shell instead of octal to work with strict mode javascript + +0.7.1 / 2013-02-05 +================== + + * add repository URL to package.json + * add DEBUG_COLORED to force colored output + * add browserify support + * fix component. Closes #24 + +0.7.0 / 2012-05-04 +================== + + * Added .component to package.json + * Added debug.component.js build + +0.6.0 / 2012-03-16 +================== + + * Added support for "-" prefix in DEBUG [Vinay Pulim] + * Added `.enabled` flag to the node version [TooTallNate] + +0.5.0 / 2012-02-02 +================== + + * Added: humanize diffs. Closes #8 + * Added `debug.disable()` to the CS variant + * Removed padding. Closes #10 + * Fixed: persist client-side variant again. Closes #9 + +0.4.0 / 2012-02-01 +================== + + * Added browser variant support for older browsers [TooTallNate] + * Added `debug.enable('project:*')` to browser variant [TooTallNate] + * Added padding to diff (moved it to the right) + +0.3.0 / 2012-01-26 +================== + + * Added millisecond diff when isatty, otherwise UTC string + +0.2.0 / 2012-01-22 +================== + + * Added wildcard support + +0.1.0 / 2011-12-02 +================== + + * Added: remove colors unless stderr isatty [TooTallNate] + +0.0.1 / 2010-01-03 +================== + + * Initial release diff --git a/node_modules/ava/node_modules/debug/LICENSE b/node_modules/ava/node_modules/debug/LICENSE new file mode 100644 index 000000000..658c933d2 --- /dev/null +++ b/node_modules/ava/node_modules/debug/LICENSE @@ -0,0 +1,19 @@ +(The MIT License) + +Copyright (c) 2014 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software +and associated documentation files (the 'Software'), to deal in the Software without restriction, +including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, +and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, +subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial +portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT +LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, +WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. + diff --git a/node_modules/ava/node_modules/debug/Makefile b/node_modules/ava/node_modules/debug/Makefile new file mode 100644 index 000000000..3ddd1360e --- /dev/null +++ b/node_modules/ava/node_modules/debug/Makefile @@ -0,0 +1,58 @@ +# get Makefile directory name: http://stackoverflow.com/a/5982798/376773 +THIS_MAKEFILE_PATH:=$(word $(words $(MAKEFILE_LIST)),$(MAKEFILE_LIST)) +THIS_DIR:=$(shell cd $(dir $(THIS_MAKEFILE_PATH));pwd) + +# BIN directory +BIN := $(THIS_DIR)/node_modules/.bin + +# Path +PATH := node_modules/.bin:$(PATH) +SHELL := /bin/bash + +# applications +NODE ?= $(shell which node) +YARN ?= $(shell which yarn) +PKG ?= $(if $(YARN),$(YARN),$(NODE) $(shell which npm)) +BROWSERIFY ?= $(NODE) $(BIN)/browserify + +install: node_modules + +browser: dist/debug.js + +node_modules: package.json + @NODE_ENV= $(PKG) install + @touch node_modules + +dist/debug.js: src/*.js node_modules + @mkdir -p dist + @$(BROWSERIFY) \ + --standalone debug \ + . > dist/debug.js + +lint: + @eslint *.js src/*.js + +test-node: + @istanbul cover node_modules/mocha/bin/_mocha -- test/**.js + @cat ./coverage/lcov.info | ./node_modules/coveralls/bin/coveralls.js + +test-browser: + @$(MAKE) browser + @karma start --single-run + +test-all: + @concurrently \ + "make test-node" \ + "make test-browser" + +test: + @if [ "x$(BROWSER)" = "x" ]; then \ + $(MAKE) test-node; \ + else \ + $(MAKE) test-browser; \ + fi + +clean: + rimraf dist coverage + +.PHONY: browser install clean lint test test-all test-node test-browser diff --git a/node_modules/ava/node_modules/debug/README.md b/node_modules/ava/node_modules/debug/README.md new file mode 100644 index 000000000..8e754d17b --- /dev/null +++ b/node_modules/ava/node_modules/debug/README.md @@ -0,0 +1,368 @@ +# debug +[](https://travis-ci.org/visionmedia/debug) [](https://coveralls.io/github/visionmedia/debug?branch=master) [](https://visionmedia-community-slackin.now.sh/) [](#backers) +[](#sponsors) + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> + +A tiny JavaScript debugging utility modelled after Node.js core's debugging +technique. Works in Node.js and web browsers. + +## Installation + +```bash +$ npm install debug +``` + +## Usage + +`debug` exposes a function; simply pass this function the name of your module, and it will return a decorated version of `console.error` for you to pass debug statements to. This will allow you to toggle the debug output for different parts of your module as well as the module as a whole. + +Example [_app.js_](./examples/node/app.js): + +```js +var debug = require('debug')('http') + , http = require('http') + , name = 'My App'; + +// fake app + +debug('booting %o', name); + +http.createServer(function(req, res){ + debug(req.method + ' ' + req.url); + res.end('hello\n'); +}).listen(3000, function(){ + debug('listening'); +}); + +// fake worker of some kind + +require('./worker'); +``` + +Example [_worker.js_](./examples/node/worker.js): + +```js +var a = require('debug')('worker:a') + , b = require('debug')('worker:b'); + +function work() { + a('doing lots of uninteresting work'); + setTimeout(work, Math.random() * 1000); +} + +work(); + +function workb() { + b('doing some work'); + setTimeout(workb, Math.random() * 2000); +} + +workb(); +``` + +The `DEBUG` environment variable is then used to enable these based on space or +comma-delimited names. + +Here are some examples: + +<img width="647" alt="screen shot 2017-08-08 at 12 53 04 pm" src="https://user-images.githubusercontent.com/71256/29091703-a6302cdc-7c38-11e7-8304-7c0b3bc600cd.png"> +<img width="647" alt="screen shot 2017-08-08 at 12 53 38 pm" src="https://user-images.githubusercontent.com/71256/29091700-a62a6888-7c38-11e7-800b-db911291ca2b.png"> +<img width="647" alt="screen shot 2017-08-08 at 12 53 25 pm" src="https://user-images.githubusercontent.com/71256/29091701-a62ea114-7c38-11e7-826a-2692bedca740.png"> + +#### Windows note + +On Windows the environment variable is set using the `set` command. + +```cmd +set DEBUG=*,-not_this +``` + +Note that PowerShell uses different syntax to set environment variables. + +```cmd +$env:DEBUG = "*,-not_this" +``` + +Then, run the program to be debugged as usual. + + +## Namespace Colors + +Every debug instance has a color generated for it based on its namespace name. +This helps when visually parsing the debug output to identify which debug instance +a debug line belongs to. + +#### Node.js + +In Node.js, colors are enabled when stderr is a TTY. You also _should_ install +the [`supports-color`](https://npmjs.org/supports-color) module alongside debug, +otherwise debug will only use a small handful of basic colors. + +<img width="521" src="https://user-images.githubusercontent.com/71256/29092181-47f6a9e6-7c3a-11e7-9a14-1928d8a711cd.png"> + +#### Web Browser + +Colors are also enabled on "Web Inspectors" that understand the `%c` formatting +option. These are WebKit web inspectors, Firefox ([since version +31](https://hacks.mozilla.org/2014/05/editable-box-model-multiple-selection-sublime-text-keys-much-more-firefox-developer-tools-episode-31/)) +and the Firebug plugin for Firefox (any version). + +<img width="524" src="https://user-images.githubusercontent.com/71256/29092033-b65f9f2e-7c39-11e7-8e32-f6f0d8e865c1.png"> + + +## Millisecond diff + +When actively developing an application it can be useful to see when the time spent between one `debug()` call and the next. Suppose for example you invoke `debug()` before requesting a resource, and after as well, the "+NNNms" will show you how much time was spent between calls. + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091486-fa38524c-7c37-11e7-895f-e7ec8e1039b6.png"> + +When stdout is not a TTY, `Date#toISOString()` is used, making it more useful for logging the debug information as shown below: + +<img width="647" src="https://user-images.githubusercontent.com/71256/29091956-6bd78372-7c39-11e7-8c55-c948396d6edd.png"> + + +## Conventions + +If you're using this in one or more of your libraries, you _should_ use the name of your library so that developers may toggle debugging as desired without guessing names. If you have more than one debuggers you _should_ prefix them with your library name and use ":" to separate features. For example "bodyParser" from Connect would then be "connect:bodyParser". If you append a "*" to the end of your name, it will always be enabled regardless of the setting of the DEBUG environment variable. You can then use it for normal output as well as debug output. + +## Wildcards + +The `*` character may be used as a wildcard. Suppose for example your library has +debuggers named "connect:bodyParser", "connect:compress", "connect:session", +instead of listing all three with +`DEBUG=connect:bodyParser,connect:compress,connect:session`, you may simply do +`DEBUG=connect:*`, or to run everything using this module simply use `DEBUG=*`. + +You can also exclude specific debuggers by prefixing them with a "-" character. +For example, `DEBUG=*,-connect:*` would include all debuggers except those +starting with "connect:". + +## Environment Variables + +When running through Node.js, you can set a few environment variables that will +change the behavior of the debug logging: + +| Name | Purpose | +|-----------|-------------------------------------------------| +| `DEBUG` | Enables/disables specific debugging namespaces. | +| `DEBUG_HIDE_DATE` | Hide date from debug output (non-TTY). | +| `DEBUG_COLORS`| Whether or not to use colors in the debug output. | +| `DEBUG_DEPTH` | Object inspection depth. | +| `DEBUG_SHOW_HIDDEN` | Shows hidden properties on inspected objects. | + + +__Note:__ The environment variables beginning with `DEBUG_` end up being +converted into an Options object that gets used with `%o`/`%O` formatters. +See the Node.js documentation for +[`util.inspect()`](https://nodejs.org/api/util.html#util_util_inspect_object_options) +for the complete list. + +## Formatters + +Debug uses [printf-style](https://wikipedia.org/wiki/Printf_format_string) formatting. +Below are the officially supported formatters: + +| Formatter | Representation | +|-----------|----------------| +| `%O` | Pretty-print an Object on multiple lines. | +| `%o` | Pretty-print an Object all on a single line. | +| `%s` | String. | +| `%d` | Number (both integer and float). | +| `%j` | JSON. Replaced with the string '[Circular]' if the argument contains circular references. | +| `%%` | Single percent sign ('%'). This does not consume an argument. | + + +### Custom formatters + +You can add custom formatters by extending the `debug.formatters` object. +For example, if you wanted to add support for rendering a Buffer as hex with +`%h`, you could do something like: + +```js +const createDebug = require('debug') +createDebug.formatters.h = (v) => { + return v.toString('hex') +} + +// …elsewhere +const debug = createDebug('foo') +debug('this is hex: %h', new Buffer('hello world')) +// foo this is hex: 68656c6c6f20776f726c6421 +0ms +``` + + +## Browser Support + +You can build a browser-ready script using [browserify](https://github.com/substack/node-browserify), +or just use the [browserify-as-a-service](https://wzrd.in/) [build](https://wzrd.in/standalone/debug@latest), +if you don't want to build it yourself. + +Debug's enable state is currently persisted by `localStorage`. +Consider the situation shown below where you have `worker:a` and `worker:b`, +and wish to debug both. You can enable this using `localStorage.debug`: + +```js +localStorage.debug = 'worker:*' +``` + +And then refresh the page. + +```js +a = debug('worker:a'); +b = debug('worker:b'); + +setInterval(function(){ + a('doing some work'); +}, 1000); + +setInterval(function(){ + b('doing some work'); +}, 1200); +``` + + +## Output streams + + By default `debug` will log to stderr, however this can be configured per-namespace by overriding the `log` method: + +Example [_stdout.js_](./examples/node/stdout.js): + +```js +var debug = require('debug'); +var error = debug('app:error'); + +// by default stderr is used +error('goes to stderr!'); + +var log = debug('app:log'); +// set this namespace to log via console.log +log.log = console.log.bind(console); // don't forget to bind to console! +log('goes to stdout'); +error('still goes to stderr!'); + +// set all output to go via console.info +// overrides all per-namespace log settings +debug.log = console.info.bind(console); +error('now goes to stdout via console.info'); +log('still goes to stdout, but via console.info now'); +``` + +## Checking whether a debug target is enabled + +After you've created a debug instance, you can determine whether or not it is +enabled by checking the `enabled` property: + +```javascript +const debug = require('debug')('http'); + +if (debug.enabled) { + // do stuff... +} +``` + +You can also manually toggle this property to force the debug instance to be +enabled or disabled. + + +## Authors + + - TJ Holowaychuk + - Nathan Rajlich + - Andrew Rhyne + +## Backers + +Support us with a monthly donation and help us continue our activities. [[Become a backer](https://opencollective.com/debug#backer)] + +<a href="https://opencollective.com/debug/backer/0/website" target="_blank"><img src="https://opencollective.com/debug/backer/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/1/website" target="_blank"><img src="https://opencollective.com/debug/backer/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/2/website" target="_blank"><img src="https://opencollective.com/debug/backer/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/3/website" target="_blank"><img src="https://opencollective.com/debug/backer/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/4/website" target="_blank"><img src="https://opencollective.com/debug/backer/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/5/website" target="_blank"><img src="https://opencollective.com/debug/backer/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/6/website" target="_blank"><img src="https://opencollective.com/debug/backer/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/7/website" target="_blank"><img src="https://opencollective.com/debug/backer/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/8/website" target="_blank"><img src="https://opencollective.com/debug/backer/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/9/website" target="_blank"><img src="https://opencollective.com/debug/backer/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/10/website" target="_blank"><img src="https://opencollective.com/debug/backer/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/11/website" target="_blank"><img src="https://opencollective.com/debug/backer/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/12/website" target="_blank"><img src="https://opencollective.com/debug/backer/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/13/website" target="_blank"><img src="https://opencollective.com/debug/backer/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/14/website" target="_blank"><img src="https://opencollective.com/debug/backer/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/15/website" target="_blank"><img src="https://opencollective.com/debug/backer/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/16/website" target="_blank"><img src="https://opencollective.com/debug/backer/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/17/website" target="_blank"><img src="https://opencollective.com/debug/backer/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/18/website" target="_blank"><img src="https://opencollective.com/debug/backer/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/19/website" target="_blank"><img src="https://opencollective.com/debug/backer/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/20/website" target="_blank"><img src="https://opencollective.com/debug/backer/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/21/website" target="_blank"><img src="https://opencollective.com/debug/backer/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/22/website" target="_blank"><img src="https://opencollective.com/debug/backer/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/23/website" target="_blank"><img src="https://opencollective.com/debug/backer/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/24/website" target="_blank"><img src="https://opencollective.com/debug/backer/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/25/website" target="_blank"><img src="https://opencollective.com/debug/backer/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/26/website" target="_blank"><img src="https://opencollective.com/debug/backer/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/27/website" target="_blank"><img src="https://opencollective.com/debug/backer/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/28/website" target="_blank"><img src="https://opencollective.com/debug/backer/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/backer/29/website" target="_blank"><img src="https://opencollective.com/debug/backer/29/avatar.svg"></a> + + +## Sponsors + +Become a sponsor and get your logo on our README on Github with a link to your site. [[Become a sponsor](https://opencollective.com/debug#sponsor)] + +<a href="https://opencollective.com/debug/sponsor/0/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/0/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/1/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/1/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/2/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/2/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/3/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/3/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/4/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/4/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/5/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/5/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/6/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/6/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/7/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/7/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/8/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/8/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/9/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/9/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/10/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/10/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/11/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/11/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/12/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/12/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/13/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/13/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/14/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/14/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/15/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/15/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/16/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/16/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/17/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/17/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/18/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/18/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/19/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/19/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/20/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/20/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/21/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/21/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/22/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/22/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/23/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/23/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/24/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/24/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/25/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/25/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/26/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/26/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/27/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/27/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/28/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/28/avatar.svg"></a> +<a href="https://opencollective.com/debug/sponsor/29/website" target="_blank"><img src="https://opencollective.com/debug/sponsor/29/avatar.svg"></a> + +## License + +(The MIT License) + +Copyright (c) 2014-2017 TJ Holowaychuk <tj@vision-media.ca> + +Permission is hereby granted, free of charge, to any person obtaining +a copy of this software and associated documentation files (the +'Software'), to deal in the Software without restriction, including +without limitation the rights to use, copy, modify, merge, publish, +distribute, sublicense, and/or sell copies of the Software, and to +permit persons to whom the Software is furnished to do so, subject to +the following conditions: + +The above copyright notice and this permission notice shall be +included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED 'AS IS', WITHOUT WARRANTY OF ANY KIND, +EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF +MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. +IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY +CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, +TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE +SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ava/node_modules/debug/karma.conf.js b/node_modules/ava/node_modules/debug/karma.conf.js new file mode 100644 index 000000000..103a82d15 --- /dev/null +++ b/node_modules/ava/node_modules/debug/karma.conf.js @@ -0,0 +1,70 @@ +// Karma configuration +// Generated on Fri Dec 16 2016 13:09:51 GMT+0000 (UTC) + +module.exports = function(config) { + config.set({ + + // base path that will be used to resolve all patterns (eg. files, exclude) + basePath: '', + + + // frameworks to use + // available frameworks: https://npmjs.org/browse/keyword/karma-adapter + frameworks: ['mocha', 'chai', 'sinon'], + + + // list of files / patterns to load in the browser + files: [ + 'dist/debug.js', + 'test/*spec.js' + ], + + + // list of files to exclude + exclude: [ + 'src/node.js' + ], + + + // preprocess matching files before serving them to the browser + // available preprocessors: https://npmjs.org/browse/keyword/karma-preprocessor + preprocessors: { + }, + + // test results reporter to use + // possible values: 'dots', 'progress' + // available reporters: https://npmjs.org/browse/keyword/karma-reporter + reporters: ['progress'], + + + // web server port + port: 9876, + + + // enable / disable colors in the output (reporters and logs) + colors: true, + + + // level of logging + // possible values: config.LOG_DISABLE || config.LOG_ERROR || config.LOG_WARN || config.LOG_INFO || config.LOG_DEBUG + logLevel: config.LOG_INFO, + + + // enable / disable watching file and executing tests whenever any file changes + autoWatch: true, + + + // start these browsers + // available browser launchers: https://npmjs.org/browse/keyword/karma-launcher + browsers: ['PhantomJS'], + + + // Continuous Integration mode + // if true, Karma captures browsers, runs the tests and exits + singleRun: false, + + // Concurrency level + // how many browser should be started simultaneous + concurrency: Infinity + }) +} diff --git a/node_modules/ava/node_modules/debug/node.js b/node_modules/ava/node_modules/debug/node.js new file mode 100644 index 000000000..7fc36fe6d --- /dev/null +++ b/node_modules/ava/node_modules/debug/node.js @@ -0,0 +1 @@ +module.exports = require('./src/node'); diff --git a/node_modules/ava/node_modules/debug/node_modules/ms/index.js b/node_modules/ava/node_modules/debug/node_modules/ms/index.js new file mode 100644 index 000000000..6a522b16b --- /dev/null +++ b/node_modules/ava/node_modules/debug/node_modules/ms/index.js @@ -0,0 +1,152 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + if (ms >= d) { + return Math.round(ms / d) + 'd'; + } + if (ms >= h) { + return Math.round(ms / h) + 'h'; + } + if (ms >= m) { + return Math.round(ms / m) + 'm'; + } + if (ms >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + return plural(ms, d, 'day') || + plural(ms, h, 'hour') || + plural(ms, m, 'minute') || + plural(ms, s, 'second') || + ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, n, name) { + if (ms < n) { + return; + } + if (ms < n * 1.5) { + return Math.floor(ms / n) + ' ' + name; + } + return Math.ceil(ms / n) + ' ' + name + 's'; +} diff --git a/node_modules/ava/node_modules/debug/node_modules/ms/license.md b/node_modules/ava/node_modules/debug/node_modules/ms/license.md new file mode 100644 index 000000000..69b61253a --- /dev/null +++ b/node_modules/ava/node_modules/debug/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ava/node_modules/debug/node_modules/ms/package.json b/node_modules/ava/node_modules/debug/node_modules/ms/package.json new file mode 100644 index 000000000..6a31c81fa --- /dev/null +++ b/node_modules/ava/node_modules/debug/node_modules/ms/package.json @@ -0,0 +1,37 @@ +{ + "name": "ms", + "version": "2.0.0", + "description": "Tiny milisecond conversion utility", + "repository": "zeit/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "3.19.0", + "expect.js": "0.3.1", + "husky": "0.13.3", + "lint-staged": "3.4.1", + "mocha": "3.4.1" + } +} diff --git a/node_modules/ava/node_modules/debug/node_modules/ms/readme.md b/node_modules/ava/node_modules/debug/node_modules/ms/readme.md new file mode 100644 index 000000000..84a9974cc --- /dev/null +++ b/node_modules/ava/node_modules/debug/node_modules/ms/readme.md @@ -0,0 +1,51 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +``` + +### Convert from milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(ms('10 hours')) // "10h" +``` + +### Time format written-out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [node](https://nodejs.org) and in the browser. +- If a number is supplied to `ms`, a string with a unit is returned. +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`). +- If you pass a string with a number and a valid unit, the number of equivalent ms is returned. + +## Caught a bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, node will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/ava/node_modules/debug/package.json b/node_modules/ava/node_modules/debug/package.json new file mode 100644 index 000000000..ada43cfe9 --- /dev/null +++ b/node_modules/ava/node_modules/debug/package.json @@ -0,0 +1,43 @@ +{ + "name": "debug", + "version": "3.1.0", + "repository": { + "type": "git", + "url": "git://github.com/visionmedia/debug.git" + }, + "description": "small debugging utility", + "keywords": [ + "debug", + "log", + "debugger" + ], + "author": "TJ Holowaychuk <tj@vision-media.ca>", + "contributors": [ + "Nathan Rajlich <nathan@tootallnate.net> (http://n8.io)", + "Andrew Rhyne <rhyneandrew@gmail.com>" + ], + "license": "MIT", + "dependencies": { + "ms": "2.0.0" + }, + "devDependencies": { + "browserify": "14.4.0", + "chai": "^3.5.0", + "concurrently": "^3.1.0", + "coveralls": "^2.11.15", + "eslint": "^3.12.1", + "istanbul": "^0.4.5", + "karma": "^1.3.0", + "karma-chai": "^0.1.0", + "karma-mocha": "^1.3.0", + "karma-phantomjs-launcher": "^1.0.2", + "karma-sinon": "^1.0.5", + "mocha": "^3.2.0", + "mocha-lcov-reporter": "^1.2.0", + "rimraf": "^2.5.4", + "sinon": "^1.17.6", + "sinon-chai": "^2.8.0" + }, + "main": "./src/index.js", + "browser": "./src/browser.js" +} diff --git a/node_modules/ava/node_modules/debug/src/browser.js b/node_modules/ava/node_modules/debug/src/browser.js new file mode 100644 index 000000000..f5149ff52 --- /dev/null +++ b/node_modules/ava/node_modules/debug/src/browser.js @@ -0,0 +1,195 @@ +/** + * This is the web browser implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; +exports.storage = 'undefined' != typeof chrome + && 'undefined' != typeof chrome.storage + ? chrome.storage.local + : localstorage(); + +/** + * Colors. + */ + +exports.colors = [ + '#0000CC', '#0000FF', '#0033CC', '#0033FF', '#0066CC', '#0066FF', '#0099CC', + '#0099FF', '#00CC00', '#00CC33', '#00CC66', '#00CC99', '#00CCCC', '#00CCFF', + '#3300CC', '#3300FF', '#3333CC', '#3333FF', '#3366CC', '#3366FF', '#3399CC', + '#3399FF', '#33CC00', '#33CC33', '#33CC66', '#33CC99', '#33CCCC', '#33CCFF', + '#6600CC', '#6600FF', '#6633CC', '#6633FF', '#66CC00', '#66CC33', '#9900CC', + '#9900FF', '#9933CC', '#9933FF', '#99CC00', '#99CC33', '#CC0000', '#CC0033', + '#CC0066', '#CC0099', '#CC00CC', '#CC00FF', '#CC3300', '#CC3333', '#CC3366', + '#CC3399', '#CC33CC', '#CC33FF', '#CC6600', '#CC6633', '#CC9900', '#CC9933', + '#CCCC00', '#CCCC33', '#FF0000', '#FF0033', '#FF0066', '#FF0099', '#FF00CC', + '#FF00FF', '#FF3300', '#FF3333', '#FF3366', '#FF3399', '#FF33CC', '#FF33FF', + '#FF6600', '#FF6633', '#FF9900', '#FF9933', '#FFCC00', '#FFCC33' +]; + +/** + * Currently only WebKit-based Web Inspectors, Firefox >= v31, + * and the Firebug extension (any Firefox version) are known + * to support "%c" CSS customizations. + * + * TODO: add a `localStorage` variable to explicitly enable/disable colors + */ + +function useColors() { + // NB: In an Electron preload script, document will be defined but not fully + // initialized. Since we know we're in Chrome, we'll just detect this case + // explicitly + if (typeof window !== 'undefined' && window.process && window.process.type === 'renderer') { + return true; + } + + // Internet Explorer and Edge do not support colors. + if (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/(edge|trident)\/(\d+)/)) { + return false; + } + + // is webkit? http://stackoverflow.com/a/16459606/376773 + // document is undefined in react-native: https://github.com/facebook/react-native/pull/1632 + return (typeof document !== 'undefined' && document.documentElement && document.documentElement.style && document.documentElement.style.WebkitAppearance) || + // is firebug? http://stackoverflow.com/a/398120/376773 + (typeof window !== 'undefined' && window.console && (window.console.firebug || (window.console.exception && window.console.table))) || + // is firefox >= v31? + // https://developer.mozilla.org/en-US/docs/Tools/Web_Console#Styling_messages + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/firefox\/(\d+)/) && parseInt(RegExp.$1, 10) >= 31) || + // double check webkit in userAgent just in case we are in a worker + (typeof navigator !== 'undefined' && navigator.userAgent && navigator.userAgent.toLowerCase().match(/applewebkit\/(\d+)/)); +} + +/** + * Map %j to `JSON.stringify()`, since no Web Inspectors do that by default. + */ + +exports.formatters.j = function(v) { + try { + return JSON.stringify(v); + } catch (err) { + return '[UnexpectedJSONParseError]: ' + err.message; + } +}; + + +/** + * Colorize log arguments if enabled. + * + * @api public + */ + +function formatArgs(args) { + var useColors = this.useColors; + + args[0] = (useColors ? '%c' : '') + + this.namespace + + (useColors ? ' %c' : ' ') + + args[0] + + (useColors ? '%c ' : ' ') + + '+' + exports.humanize(this.diff); + + if (!useColors) return; + + var c = 'color: ' + this.color; + args.splice(1, 0, c, 'color: inherit') + + // the final "%c" is somewhat tricky, because there could be other + // arguments passed either before or after the %c, so we need to + // figure out the correct index to insert the CSS into + var index = 0; + var lastC = 0; + args[0].replace(/%[a-zA-Z%]/g, function(match) { + if ('%%' === match) return; + index++; + if ('%c' === match) { + // we only are interested in the *last* %c + // (the user may have provided their own) + lastC = index; + } + }); + + args.splice(lastC, 0, c); +} + +/** + * Invokes `console.log()` when available. + * No-op when `console.log` is not a "function". + * + * @api public + */ + +function log() { + // this hackery is required for IE8/9, where + // the `console.log` function doesn't have 'apply' + return 'object' === typeof console + && console.log + && Function.prototype.apply.call(console.log, console, arguments); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + try { + if (null == namespaces) { + exports.storage.removeItem('debug'); + } else { + exports.storage.debug = namespaces; + } + } catch(e) {} +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + var r; + try { + r = exports.storage.debug; + } catch(e) {} + + // If debug isn't set in LS, and we're in Electron, try to load $DEBUG + if (!r && typeof process !== 'undefined' && 'env' in process) { + r = process.env.DEBUG; + } + + return r; +} + +/** + * Enable namespaces listed in `localStorage.debug` initially. + */ + +exports.enable(load()); + +/** + * Localstorage attempts to return the localstorage. + * + * This is necessary because safari throws + * when a user disables cookies/localstorage + * and you attempt to access it. + * + * @return {LocalStorage} + * @api private + */ + +function localstorage() { + try { + return window.localStorage; + } catch (e) {} +} diff --git a/node_modules/ava/node_modules/debug/src/debug.js b/node_modules/ava/node_modules/debug/src/debug.js new file mode 100644 index 000000000..77e6384a3 --- /dev/null +++ b/node_modules/ava/node_modules/debug/src/debug.js @@ -0,0 +1,225 @@ + +/** + * This is the common logic for both the Node.js and web browser + * implementations of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = createDebug.debug = createDebug['default'] = createDebug; +exports.coerce = coerce; +exports.disable = disable; +exports.enable = enable; +exports.enabled = enabled; +exports.humanize = require('ms'); + +/** + * Active `debug` instances. + */ +exports.instances = []; + +/** + * The currently active debug mode names, and names to skip. + */ + +exports.names = []; +exports.skips = []; + +/** + * Map of special "%n" handling functions, for the debug "format" argument. + * + * Valid key names are a single, lower or upper-case letter, i.e. "n" and "N". + */ + +exports.formatters = {}; + +/** + * Select a color. + * @param {String} namespace + * @return {Number} + * @api private + */ + +function selectColor(namespace) { + var hash = 0, i; + + for (i in namespace) { + hash = ((hash << 5) - hash) + namespace.charCodeAt(i); + hash |= 0; // Convert to 32bit integer + } + + return exports.colors[Math.abs(hash) % exports.colors.length]; +} + +/** + * Create a debugger with the given `namespace`. + * + * @param {String} namespace + * @return {Function} + * @api public + */ + +function createDebug(namespace) { + + var prevTime; + + function debug() { + // disabled? + if (!debug.enabled) return; + + var self = debug; + + // set `diff` timestamp + var curr = +new Date(); + var ms = curr - (prevTime || curr); + self.diff = ms; + self.prev = prevTime; + self.curr = curr; + prevTime = curr; + + // turn the `arguments` into a proper Array + var args = new Array(arguments.length); + for (var i = 0; i < args.length; i++) { + args[i] = arguments[i]; + } + + args[0] = exports.coerce(args[0]); + + if ('string' !== typeof args[0]) { + // anything else let's inspect with %O + args.unshift('%O'); + } + + // apply any `formatters` transformations + var index = 0; + args[0] = args[0].replace(/%([a-zA-Z%])/g, function(match, format) { + // if we encounter an escaped % then don't increase the array index + if (match === '%%') return match; + index++; + var formatter = exports.formatters[format]; + if ('function' === typeof formatter) { + var val = args[index]; + match = formatter.call(self, val); + + // now we need to remove `args[index]` since it's inlined in the `format` + args.splice(index, 1); + index--; + } + return match; + }); + + // apply env-specific formatting (colors, etc.) + exports.formatArgs.call(self, args); + + var logFn = debug.log || exports.log || console.log.bind(console); + logFn.apply(self, args); + } + + debug.namespace = namespace; + debug.enabled = exports.enabled(namespace); + debug.useColors = exports.useColors(); + debug.color = selectColor(namespace); + debug.destroy = destroy; + + // env-specific initialization logic for debug instances + if ('function' === typeof exports.init) { + exports.init(debug); + } + + exports.instances.push(debug); + + return debug; +} + +function destroy () { + var index = exports.instances.indexOf(this); + if (index !== -1) { + exports.instances.splice(index, 1); + return true; + } else { + return false; + } +} + +/** + * Enables a debug mode by namespaces. This can include modes + * separated by a colon and wildcards. + * + * @param {String} namespaces + * @api public + */ + +function enable(namespaces) { + exports.save(namespaces); + + exports.names = []; + exports.skips = []; + + var i; + var split = (typeof namespaces === 'string' ? namespaces : '').split(/[\s,]+/); + var len = split.length; + + for (i = 0; i < len; i++) { + if (!split[i]) continue; // ignore empty strings + namespaces = split[i].replace(/\*/g, '.*?'); + if (namespaces[0] === '-') { + exports.skips.push(new RegExp('^' + namespaces.substr(1) + '$')); + } else { + exports.names.push(new RegExp('^' + namespaces + '$')); + } + } + + for (i = 0; i < exports.instances.length; i++) { + var instance = exports.instances[i]; + instance.enabled = exports.enabled(instance.namespace); + } +} + +/** + * Disable debug output. + * + * @api public + */ + +function disable() { + exports.enable(''); +} + +/** + * Returns true if the given mode name is enabled, false otherwise. + * + * @param {String} name + * @return {Boolean} + * @api public + */ + +function enabled(name) { + if (name[name.length - 1] === '*') { + return true; + } + var i, len; + for (i = 0, len = exports.skips.length; i < len; i++) { + if (exports.skips[i].test(name)) { + return false; + } + } + for (i = 0, len = exports.names.length; i < len; i++) { + if (exports.names[i].test(name)) { + return true; + } + } + return false; +} + +/** + * Coerce `val`. + * + * @param {Mixed} val + * @return {Mixed} + * @api private + */ + +function coerce(val) { + if (val instanceof Error) return val.stack || val.message; + return val; +} diff --git a/node_modules/ava/node_modules/debug/src/index.js b/node_modules/ava/node_modules/debug/src/index.js new file mode 100644 index 000000000..cabcbcda1 --- /dev/null +++ b/node_modules/ava/node_modules/debug/src/index.js @@ -0,0 +1,10 @@ +/** + * Detect Electron renderer process, which is node, but we should + * treat as a browser. + */ + +if (typeof process === 'undefined' || process.type === 'renderer') { + module.exports = require('./browser.js'); +} else { + module.exports = require('./node.js'); +} diff --git a/node_modules/ava/node_modules/debug/src/node.js b/node_modules/ava/node_modules/debug/src/node.js new file mode 100644 index 000000000..d666fb9c0 --- /dev/null +++ b/node_modules/ava/node_modules/debug/src/node.js @@ -0,0 +1,186 @@ +/** + * Module dependencies. + */ + +var tty = require('tty'); +var util = require('util'); + +/** + * This is the Node.js implementation of `debug()`. + * + * Expose `debug()` as the module. + */ + +exports = module.exports = require('./debug'); +exports.init = init; +exports.log = log; +exports.formatArgs = formatArgs; +exports.save = save; +exports.load = load; +exports.useColors = useColors; + +/** + * Colors. + */ + +exports.colors = [ 6, 2, 3, 4, 5, 1 ]; + +try { + var supportsColor = require('supports-color'); + if (supportsColor && supportsColor.level >= 2) { + exports.colors = [ + 20, 21, 26, 27, 32, 33, 38, 39, 40, 41, 42, 43, 44, 45, 56, 57, 62, 63, 68, + 69, 74, 75, 76, 77, 78, 79, 80, 81, 92, 93, 98, 99, 112, 113, 128, 129, 134, + 135, 148, 149, 160, 161, 162, 163, 164, 165, 166, 167, 168, 169, 170, 171, + 172, 173, 178, 179, 184, 185, 196, 197, 198, 199, 200, 201, 202, 203, 204, + 205, 206, 207, 208, 209, 214, 215, 220, 221 + ]; + } +} catch (err) { + // swallow - we only care if `supports-color` is available; it doesn't have to be. +} + +/** + * Build up the default `inspectOpts` object from the environment variables. + * + * $ DEBUG_COLORS=no DEBUG_DEPTH=10 DEBUG_SHOW_HIDDEN=enabled node script.js + */ + +exports.inspectOpts = Object.keys(process.env).filter(function (key) { + return /^debug_/i.test(key); +}).reduce(function (obj, key) { + // camel-case + var prop = key + .substring(6) + .toLowerCase() + .replace(/_([a-z])/g, function (_, k) { return k.toUpperCase() }); + + // coerce string value into JS value + var val = process.env[key]; + if (/^(yes|on|true|enabled)$/i.test(val)) val = true; + else if (/^(no|off|false|disabled)$/i.test(val)) val = false; + else if (val === 'null') val = null; + else val = Number(val); + + obj[prop] = val; + return obj; +}, {}); + +/** + * Is stdout a TTY? Colored output is enabled when `true`. + */ + +function useColors() { + return 'colors' in exports.inspectOpts + ? Boolean(exports.inspectOpts.colors) + : tty.isatty(process.stderr.fd); +} + +/** + * Map %o to `util.inspect()`, all on a single line. + */ + +exports.formatters.o = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts) + .split('\n').map(function(str) { + return str.trim() + }).join(' '); +}; + +/** + * Map %o to `util.inspect()`, allowing multiple lines if needed. + */ + +exports.formatters.O = function(v) { + this.inspectOpts.colors = this.useColors; + return util.inspect(v, this.inspectOpts); +}; + +/** + * Adds ANSI color escape codes if enabled. + * + * @api public + */ + +function formatArgs(args) { + var name = this.namespace; + var useColors = this.useColors; + + if (useColors) { + var c = this.color; + var colorCode = '\u001b[3' + (c < 8 ? c : '8;5;' + c); + var prefix = ' ' + colorCode + ';1m' + name + ' ' + '\u001b[0m'; + + args[0] = prefix + args[0].split('\n').join('\n' + prefix); + args.push(colorCode + 'm+' + exports.humanize(this.diff) + '\u001b[0m'); + } else { + args[0] = getDate() + name + ' ' + args[0]; + } +} + +function getDate() { + if (exports.inspectOpts.hideDate) { + return ''; + } else { + return new Date().toISOString() + ' '; + } +} + +/** + * Invokes `util.format()` with the specified arguments and writes to stderr. + */ + +function log() { + return process.stderr.write(util.format.apply(util, arguments) + '\n'); +} + +/** + * Save `namespaces`. + * + * @param {String} namespaces + * @api private + */ + +function save(namespaces) { + if (null == namespaces) { + // If you set a process.env field to null or undefined, it gets cast to the + // string 'null' or 'undefined'. Just delete instead. + delete process.env.DEBUG; + } else { + process.env.DEBUG = namespaces; + } +} + +/** + * Load `namespaces`. + * + * @return {String} returns the previously persisted debug modes + * @api private + */ + +function load() { + return process.env.DEBUG; +} + +/** + * Init logic for `debug` instances. + * + * Create a new `inspectOpts` object in case `useColors` is set + * differently for a particular `debug` instance. + */ + +function init (debug) { + debug.inspectOpts = {}; + + var keys = Object.keys(exports.inspectOpts); + for (var i = 0; i < keys.length; i++) { + debug.inspectOpts[keys[i]] = exports.inspectOpts[keys[i]]; + } +} + +/** + * Enable namespaces listed in `process.env.DEBUG` initially. + */ + +exports.enable(load()); diff --git a/node_modules/ava/node_modules/ms/index.js b/node_modules/ava/node_modules/ms/index.js new file mode 100644 index 000000000..72297501f --- /dev/null +++ b/node_modules/ava/node_modules/ms/index.js @@ -0,0 +1,162 @@ +/** + * Helpers. + */ + +var s = 1000; +var m = s * 60; +var h = m * 60; +var d = h * 24; +var w = d * 7; +var y = d * 365.25; + +/** + * Parse or format the given `val`. + * + * Options: + * + * - `long` verbose formatting [false] + * + * @param {String|Number} val + * @param {Object} [options] + * @throws {Error} throw an error if val is not a non-empty string or a number + * @return {String|Number} + * @api public + */ + +module.exports = function(val, options) { + options = options || {}; + var type = typeof val; + if (type === 'string' && val.length > 0) { + return parse(val); + } else if (type === 'number' && isNaN(val) === false) { + return options.long ? fmtLong(val) : fmtShort(val); + } + throw new Error( + 'val is not a non-empty string or a valid number. val=' + + JSON.stringify(val) + ); +}; + +/** + * Parse the given `str` and return milliseconds. + * + * @param {String} str + * @return {Number} + * @api private + */ + +function parse(str) { + str = String(str); + if (str.length > 100) { + return; + } + var match = /^((?:\d+)?\-?\d?\.?\d+) *(milliseconds?|msecs?|ms|seconds?|secs?|s|minutes?|mins?|m|hours?|hrs?|h|days?|d|weeks?|w|years?|yrs?|y)?$/i.exec( + str + ); + if (!match) { + return; + } + var n = parseFloat(match[1]); + var type = (match[2] || 'ms').toLowerCase(); + switch (type) { + case 'years': + case 'year': + case 'yrs': + case 'yr': + case 'y': + return n * y; + case 'weeks': + case 'week': + case 'w': + return n * w; + case 'days': + case 'day': + case 'd': + return n * d; + case 'hours': + case 'hour': + case 'hrs': + case 'hr': + case 'h': + return n * h; + case 'minutes': + case 'minute': + case 'mins': + case 'min': + case 'm': + return n * m; + case 'seconds': + case 'second': + case 'secs': + case 'sec': + case 's': + return n * s; + case 'milliseconds': + case 'millisecond': + case 'msecs': + case 'msec': + case 'ms': + return n; + default: + return undefined; + } +} + +/** + * Short format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtShort(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return Math.round(ms / d) + 'd'; + } + if (msAbs >= h) { + return Math.round(ms / h) + 'h'; + } + if (msAbs >= m) { + return Math.round(ms / m) + 'm'; + } + if (msAbs >= s) { + return Math.round(ms / s) + 's'; + } + return ms + 'ms'; +} + +/** + * Long format for `ms`. + * + * @param {Number} ms + * @return {String} + * @api private + */ + +function fmtLong(ms) { + var msAbs = Math.abs(ms); + if (msAbs >= d) { + return plural(ms, msAbs, d, 'day'); + } + if (msAbs >= h) { + return plural(ms, msAbs, h, 'hour'); + } + if (msAbs >= m) { + return plural(ms, msAbs, m, 'minute'); + } + if (msAbs >= s) { + return plural(ms, msAbs, s, 'second'); + } + return ms + ' ms'; +} + +/** + * Pluralization helper. + */ + +function plural(ms, msAbs, n, name) { + var isPlural = msAbs >= n * 1.5; + return Math.round(ms / n) + ' ' + name + (isPlural ? 's' : ''); +} diff --git a/node_modules/ava/node_modules/ms/license.md b/node_modules/ava/node_modules/ms/license.md new file mode 100644 index 000000000..69b61253a --- /dev/null +++ b/node_modules/ava/node_modules/ms/license.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2016 Zeit, Inc. + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ava/node_modules/ms/package.json b/node_modules/ava/node_modules/ms/package.json new file mode 100644 index 000000000..fc28cb39d --- /dev/null +++ b/node_modules/ava/node_modules/ms/package.json @@ -0,0 +1,37 @@ +{ + "name": "ms", + "version": "2.1.1", + "description": "Tiny millisecond conversion utility", + "repository": "zeit/ms", + "main": "./index", + "files": [ + "index.js" + ], + "scripts": { + "precommit": "lint-staged", + "lint": "eslint lib/* bin/*", + "test": "mocha tests.js" + }, + "eslintConfig": { + "extends": "eslint:recommended", + "env": { + "node": true, + "es6": true + } + }, + "lint-staged": { + "*.js": [ + "npm run lint", + "prettier --single-quote --write", + "git add" + ] + }, + "license": "MIT", + "devDependencies": { + "eslint": "4.12.1", + "expect.js": "0.3.1", + "husky": "0.14.3", + "lint-staged": "5.0.0", + "mocha": "4.0.1" + } +} diff --git a/node_modules/ava/node_modules/ms/readme.md b/node_modules/ava/node_modules/ms/readme.md new file mode 100644 index 000000000..bb767293a --- /dev/null +++ b/node_modules/ava/node_modules/ms/readme.md @@ -0,0 +1,60 @@ +# ms + +[](https://travis-ci.org/zeit/ms) +[](https://zeit.chat/) + +Use this package to easily convert various time formats to milliseconds. + +## Examples + +```js +ms('2 days') // 172800000 +ms('1d') // 86400000 +ms('10h') // 36000000 +ms('2.5 hrs') // 9000000 +ms('2h') // 7200000 +ms('1m') // 60000 +ms('5s') // 5000 +ms('1y') // 31557600000 +ms('100') // 100 +ms('-3 days') // -259200000 +ms('-1h') // -3600000 +ms('-200') // -200 +``` + +### Convert from Milliseconds + +```js +ms(60000) // "1m" +ms(2 * 60000) // "2m" +ms(-3 * 60000) // "-3m" +ms(ms('10 hours')) // "10h" +``` + +### Time Format Written-Out + +```js +ms(60000, { long: true }) // "1 minute" +ms(2 * 60000, { long: true }) // "2 minutes" +ms(-3 * 60000, { long: true }) // "-3 minutes" +ms(ms('10 hours'), { long: true }) // "10 hours" +``` + +## Features + +- Works both in [Node.js](https://nodejs.org) and in the browser +- If a number is supplied to `ms`, a string with a unit is returned +- If a string that contains the number is supplied, it returns it as a number (e.g.: it returns `100` for `'100'`) +- If you pass a string with a number and a valid unit, the number of equivalent milliseconds is returned + +## Related Packages + +- [ms.macro](https://github.com/knpwrs/ms.macro) - Run `ms` as a macro at build-time. + +## Caught a Bug? + +1. [Fork](https://help.github.com/articles/fork-a-repo/) this repository to your own GitHub account and then [clone](https://help.github.com/articles/cloning-a-repository/) it to your local device +2. Link the package to the global module directory: `npm link` +3. Within the module you want to test your local development instance of ms, just link it to the dependencies: `npm link ms`. Instead of the default one from npm, Node.js will now use your clone of ms! + +As always, you can run the tests using: `npm test` diff --git a/node_modules/ava/node_modules/source-map-support/LICENSE.md b/node_modules/ava/node_modules/source-map-support/LICENSE.md new file mode 100644 index 000000000..6247ca912 --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/LICENSE.md @@ -0,0 +1,21 @@ +The MIT License (MIT) + +Copyright (c) 2014 Evan Wallace + +Permission is hereby granted, free of charge, to any person obtaining a copy +of this software and associated documentation files (the "Software"), to deal +in the Software without restriction, including without limitation the rights +to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +copies of the Software, and to permit persons to whom the Software is +furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all +copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE +SOFTWARE. diff --git a/node_modules/ava/node_modules/source-map-support/README.md b/node_modules/ava/node_modules/source-map-support/README.md new file mode 100644 index 000000000..0144e1caa --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/README.md @@ -0,0 +1,251 @@ +# Source Map Support +[](https://travis-ci.org/evanw/node-source-map-support) + +This module provides source map support for stack traces in node via the [V8 stack trace API](https://github.com/v8/v8/wiki/Stack-Trace-API). It uses the [source-map](https://github.com/mozilla/source-map) module to replace the paths and line numbers of source-mapped files with their original paths and line numbers. The output mimics node's stack trace format with the goal of making every compile-to-JS language more of a first-class citizen. Source maps are completely general (not specific to any one language) so you can use source maps with multiple compile-to-JS languages in the same node process. + +## Installation and Usage + +#### Node support + +``` +$ npm install source-map-support +``` + +Source maps can be generated using libraries such as [source-map-index-generator](https://github.com/twolfson/source-map-index-generator). Once you have a valid source map, insert the following line at the top of your compiled code: + +```js +require('source-map-support').install(); +``` + +And place a source mapping comment somewhere in the file (usually done automatically or with an option by your transpiler): + +``` +//# sourceMappingURL=path/to/source.map +``` + +If multiple sourceMappingURL comments exist in one file, the last sourceMappingURL comment will be +respected (e.g. if a file mentions the comment in code, or went through multiple transpilers). +The path should either be absolute or relative to the compiled file. + +It is also possible to install the source map support directly by +requiring the `register` module which can be handy with ES6: + +```js +import 'source-map-support/register' + +// Instead of: +import sourceMapSupport from 'source-map-support' +sourceMapSupport.install() +``` +Note: if you're using babel-register, it includes source-map-support already. + +It is also very useful with Mocha: + +``` +$ mocha --require source-map-support/register tests/ +``` + +#### Browser support + +This library also works in Chrome. While the DevTools console already supports source maps, the V8 engine doesn't and `Error.prototype.stack` will be incorrect without this library. Everything will just work if you deploy your source files using [browserify](http://browserify.org/). Just make sure to pass the `--debug` flag to the browserify command so your source maps are included in the bundled code. + +This library also works if you use another build process or just include the source files directly. In this case, include the file `browser-source-map-support.js` in your page and call `sourceMapSupport.install()`. It contains the whole library already bundled for the browser using browserify. + +```html +<script src="browser-source-map-support.js"></script> +<script>sourceMapSupport.install();</script> +``` + +This library also works if you use AMD (Asynchronous Module Definition), which is used in tools like [RequireJS](http://requirejs.org/). Just list `browser-source-map-support` as a dependency: + +```html +<script> + define(['browser-source-map-support'], function(sourceMapSupport) { + sourceMapSupport.install(); + }); +</script> +``` + +## Options + +This module installs two things: a change to the `stack` property on `Error` objects and a handler for uncaught exceptions that mimics node's default exception handler (the handler can be seen in the demos below). You may want to disable the handler if you have your own uncaught exception handler. This can be done by passing an argument to the installer: + +```js +require('source-map-support').install({ + handleUncaughtExceptions: false +}); +``` + +This module loads source maps from the filesystem by default. You can provide alternate loading behavior through a callback as shown below. For example, [Meteor](https://github.com/meteor) keeps all source maps cached in memory to avoid disk access. + +```js +require('source-map-support').install({ + retrieveSourceMap: function(source) { + if (source === 'compiled.js') { + return { + url: 'original.js', + map: fs.readFileSync('compiled.js.map', 'utf8') + }; + } + return null; + } +}); +``` + +The module will by default assume a browser environment if XMLHttpRequest and window are defined. If either of these do not exist it will instead assume a node environment. +In some rare cases, e.g. when running a browser emulation and where both variables are also set, you can explictly specify the environment to be either 'browser' or 'node'. + +```js +require('source-map-support').install({ + environment: 'node' +}); +``` + +To support files with inline source maps, the `hookRequire` options can be specified, which will monitor all source files for inline source maps. + + +```js +require('source-map-support').install({ + hookRequire: true +}); +``` + +This monkey patches the `require` module loading chain, so is not enabled by default and is not recommended for any sort of production usage. + +## Demos + +#### Basic Demo + +original.js: + +```js +throw new Error('test'); // This is the original code +``` + +compiled.js: + +```js +require('source-map-support').install(); + +throw new Error('test'); // This is the compiled code +// The next line defines the sourceMapping. +//# sourceMappingURL=compiled.js.map +``` + +compiled.js.map: + +```json +{ + "version": 3, + "file": "compiled.js", + "sources": ["original.js"], + "names": [], + "mappings": ";;AAAA,MAAM,IAAI" +} +``` + +Run compiled.js using node (notice how the stack trace uses original.js instead of compiled.js): + +``` +$ node compiled.js + +original.js:1 +throw new Error('test'); // This is the original code + ^ +Error: test + at Object.<anonymous> (original.js:1:7) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) + at node.js:901:3 +``` + +#### TypeScript Demo + +demo.ts: + +```typescript +declare function require(name: string); +require('source-map-support').install(); +class Foo { + constructor() { this.bar(); } + bar() { throw new Error('this is a demo'); } +} +new Foo(); +``` + +Compile and run the file using the TypeScript compiler from the terminal: + +``` +$ npm install source-map-support typescript +$ node_modules/typescript/bin/tsc -sourcemap demo.ts +$ node demo.js + +demo.ts:5 + bar() { throw new Error('this is a demo'); } + ^ +Error: this is a demo + at Foo.bar (demo.ts:5:17) + at new Foo (demo.ts:4:24) + at Object.<anonymous> (demo.ts:7:1) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) + at node.js:901:3 +``` + +#### CoffeeScript Demo + +demo.coffee: + +```coffee +require('source-map-support').install() +foo = -> + bar = -> throw new Error 'this is a demo' + bar() +foo() +``` + +Compile and run the file using the CoffeeScript compiler from the terminal: + +```sh +$ npm install source-map-support coffee-script +$ node_modules/coffee-script/bin/coffee --map --compile demo.coffee +$ node demo.js + +demo.coffee:3 + bar = -> throw new Error 'this is a demo' + ^ +Error: this is a demo + at bar (demo.coffee:3:22) + at foo (demo.coffee:4:3) + at Object.<anonymous> (demo.coffee:5:1) + at Object.<anonymous> (demo.coffee:1:1) + at Module._compile (module.js:456:26) + at Object.Module._extensions..js (module.js:474:10) + at Module.load (module.js:356:32) + at Function.Module._load (module.js:312:12) + at Function.Module.runMain (module.js:497:10) + at startup (node.js:119:16) +``` + +## Tests + +This repo contains both automated tests for node and manual tests for the browser. The automated tests can be run using mocha (type `mocha` in the root directory). To run the manual tests: + +* Build the tests using `build.js` +* Launch the HTTP server (`npm run serve-tests`) and visit + * http://127.0.0.1:1336/amd-test + * http://127.0.0.1:1336/browser-test + * http://127.0.0.1:1336/browserify-test - **Currently not working** due to a bug with browserify (see [pull request #66](https://github.com/evanw/node-source-map-support/pull/66) for details). +* For `header-test`, run `server.js` inside that directory and visit http://127.0.0.1:1337/ + +## License + +This code is available under the [MIT license](http://opensource.org/licenses/MIT). diff --git a/node_modules/ava/node_modules/source-map-support/browser-source-map-support.js b/node_modules/ava/node_modules/source-map-support/browser-source-map-support.js new file mode 100644 index 000000000..ba78fe3fd --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/browser-source-map-support.js @@ -0,0 +1,112 @@ +/* + * Support for source maps in V8 stack traces + * https://github.com/evanw/node-source-map-support + */ +/* + The buffer module from node.js, for the browser. + + @author Feross Aboukhadijeh <feross@feross.org> <http://feross.org> + license MIT +*/ +(this.define||function(N,O){this.sourceMapSupport=O()})("browser-source-map-support",function(N){(function b(q,v,h){function e(d,a){if(!v[d]){if(!q[d]){var l="function"==typeof require&&require;if(!a&&l)return l(d,!0);if(k)return k(d,!0);throw Error("Cannot find module '"+d+"'");}l=v[d]={exports:{}};q[d][0].call(l.exports,function(a){var b=q[d][1][a];return e(b?b:a)},l,l.exports,b,q,v,h)}return v[d].exports}for(var k="function"==typeof require&&require,n=0;n<h.length;n++)e(h[n]);return e})({1:[function(q, +v,h){N=q("./source-map-support")},{"./source-map-support":19}],2:[function(q,v,h){(function(b){function e(b){b=b.charCodeAt(0);if(43===b||45===b)return 62;if(47===b||95===b)return 63;if(48>b)return-1;if(58>b)return b-48+52;if(91>b)return b-65;if(123>b)return b-97+26}var k="undefined"!==typeof Uint8Array?Uint8Array:Array;b.toByteArray=function(b){function d(a){u[t++]=a}if(0<b.length%4)throw Error("Invalid string. Length must be a multiple of 4");var a=b.length;var l="="===b.charAt(a-2)?2:"="===b.charAt(a- +1)?1:0;var u=new k(3*b.length/4-l);var r=0<l?b.length-4:b.length;var t=0;for(a=0;a<r;a+=4){var z=e(b.charAt(a))<<18|e(b.charAt(a+1))<<12|e(b.charAt(a+2))<<6|e(b.charAt(a+3));d((z&16711680)>>16);d((z&65280)>>8);d(z&255)}2===l?(z=e(b.charAt(a))<<2|e(b.charAt(a+1))>>4,d(z&255)):1===l&&(z=e(b.charAt(a))<<10|e(b.charAt(a+1))<<4|e(b.charAt(a+2))>>2,d(z>>8&255),d(z&255));return u};b.fromByteArray=function(b){var d=b.length%3,a="",l;var e=0;for(l=b.length-d;e<l;e+=3){var r=(b[e]<<16)+(b[e+1]<<8)+b[e+2];r= +"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>18&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>12&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>6&63)+"ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r&63);a+=r}switch(d){case 1:r=b[b.length-1];a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>2);a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r<< +4&63);a+="==";break;case 2:r=(b[b.length-2]<<8)+b[b.length-1],a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>10),a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r>>4&63),a+="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".charAt(r<<2&63),a+="="}return a}})("undefined"===typeof h?this.base64js={}:h)},{}],3:[function(q,v,h){},{}],4:[function(q,v,h){function b(f,g,x){if(!(this instanceof b))return new b(f,g,x);var a=typeof f; +if("base64"===g&&"string"===a)for(f=f.trim?f.trim():f.replace(/^\s+|\s+$/g,"");0!==f.length%4;)f+="=";if("number"===a)var c=D(f);else if("string"===a)c=b.byteLength(f,g);else if("object"===a)c=D(f.length);else throw Error("First argument needs to be a number, array or string.");if(b._useTypedArrays)var d=b._augment(new Uint8Array(c));else d=this,d.length=c,d._isBuffer=!0;if(b._useTypedArrays&&"number"===typeof f.byteLength)d._set(f);else{var m=f;if(M(m)||b.isBuffer(m)||m&&"object"===typeof m&&"number"=== +typeof m.length)for(g=0;g<c;g++)b.isBuffer(f)?d[g]=f.readUInt8(g):d[g]=f[g];else if("string"===a)d.write(f,0,g);else if("number"===a&&!b._useTypedArrays&&!x)for(g=0;g<c;g++)d[g]=0}return d}function e(f,g,x){var a="";for(x=Math.min(f.length,x);g<x;g++)a+=String.fromCharCode(f[g]);return a}function k(f,g,x,a){a||(p("boolean"===typeof x,"missing or invalid endian"),p(void 0!==g&&null!==g,"missing offset"),p(g+1<f.length,"Trying to read beyond buffer length"));a=f.length;if(!(g>=a))return x?(x=f[g],g+ +1<a&&(x|=f[g+1]<<8)):(x=f[g]<<8,g+1<a&&(x|=f[g+1])),x}function n(f,g,a,c){c||(p("boolean"===typeof a,"missing or invalid endian"),p(void 0!==g&&null!==g,"missing offset"),p(g+3<f.length,"Trying to read beyond buffer length"));c=f.length;if(!(g>=c)){var x;a?(g+2<c&&(x=f[g+2]<<16),g+1<c&&(x|=f[g+1]<<8),x|=f[g],g+3<c&&(x+=f[g+3]<<24>>>0)):(g+1<c&&(x=f[g+1]<<16),g+2<c&&(x|=f[g+2]<<8),g+3<c&&(x|=f[g+3]),x+=f[g]<<24>>>0);return x}}function d(f,g,a,c){c||(p("boolean"===typeof a,"missing or invalid endian"), +p(void 0!==g&&null!==g,"missing offset"),p(g+1<f.length,"Trying to read beyond buffer length"));if(!(g>=f.length))return f=k(f,g,a,!0),f&32768?-1*(65535-f+1):f}function a(f,g,a,c){c||(p("boolean"===typeof a,"missing or invalid endian"),p(void 0!==g&&null!==g,"missing offset"),p(g+3<f.length,"Trying to read beyond buffer length"));if(!(g>=f.length))return f=n(f,g,a,!0),f&2147483648?-1*(4294967295-f+1):f}function l(f,g,a,c){c||(p("boolean"===typeof a,"missing or invalid endian"),p(g+3<f.length,"Trying to read beyond buffer length")); +return I.read(f,g,a,23,4)}function u(f,g,a,c){c||(p("boolean"===typeof a,"missing or invalid endian"),p(g+7<f.length,"Trying to read beyond buffer length"));return I.read(f,g,a,52,8)}function r(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c,"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+1<f.length,"trying to write beyond buffer length"),H(g,65535));var x=f.length;if(!(a>=x))for(b=0,x=Math.min(x-a,2);b<x;b++)f[a+b]=(g&255<<8*(c?b:1-b))>>>8* +(c?b:1-b)}function t(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c,"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+3<f.length,"trying to write beyond buffer length"),H(g,4294967295));var x=f.length;if(!(a>=x))for(b=0,x=Math.min(x-a,4);b<x;b++)f[a+b]=g>>>8*(c?b:3-b)&255}function z(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c,"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+1<f.length, +"Trying to write beyond buffer length"),A(g,32767,-32768));a>=f.length||(0<=g?r(f,g,a,c,b):r(f,65535+g+1,a,c,b))}function c(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c,"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+3<f.length,"Trying to write beyond buffer length"),A(g,2147483647,-2147483648));a>=f.length||(0<=g?t(f,g,a,c,b):t(f,4294967295+g+1,a,c,b))}function m(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c, +"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+3<f.length,"Trying to write beyond buffer length"),F(g,3.4028234663852886E38,-3.4028234663852886E38));a>=f.length||I.write(f,g,a,c,23,4)}function y(f,g,a,c,b){b||(p(void 0!==g&&null!==g,"missing value"),p("boolean"===typeof c,"missing or invalid endian"),p(void 0!==a&&null!==a,"missing offset"),p(a+7<f.length,"Trying to write beyond buffer length"),F(g,1.7976931348623157E308,-1.7976931348623157E308));a>=f.length||I.write(f, +g,a,c,52,8)}function C(f,g,a){if("number"!==typeof f)return a;f=~~f;if(f>=g)return g;if(0<=f)return f;f+=g;return 0<=f?f:0}function D(f){f=~~Math.ceil(+f);return 0>f?0:f}function M(f){return(Array.isArray||function(f){return"[object Array]"===Object.prototype.toString.call(f)})(f)}function K(f){return 16>f?"0"+f.toString(16):f.toString(16)}function L(f){for(var a=[],c=0;c<f.length;c++){var b=f.charCodeAt(c);if(127>=b)a.push(f.charCodeAt(c));else{var d=c;55296<=b&&57343>=b&&c++;b=encodeURIComponent(f.slice(d, +c+1)).substr(1).split("%");for(d=0;d<b.length;d++)a.push(parseInt(b[d],16))}}return a}function J(f){for(var a=[],c=0;c<f.length;c++)a.push(f.charCodeAt(c)&255);return a}function B(f,a,c,b){for(var g=0;g<b&&!(g+c>=a.length||g>=f.length);g++)a[g+c]=f[g];return g}function G(f){try{return decodeURIComponent(f)}catch(g){return String.fromCharCode(65533)}}function H(f,a){p("number"===typeof f,"cannot write a non-number as a number");p(0<=f,"specified a negative value for writing an unsigned value");p(f<= +a,"value is larger than maximum value for type");p(Math.floor(f)===f,"value has a fractional component")}function A(f,a,c){p("number"===typeof f,"cannot write a non-number as a number");p(f<=a,"value larger than maximum allowed value");p(f>=c,"value smaller than minimum allowed value");p(Math.floor(f)===f,"value has a fractional component")}function F(f,a,c){p("number"===typeof f,"cannot write a non-number as a number");p(f<=a,"value larger than maximum allowed value");p(f>=c,"value smaller than minimum allowed value")} +function p(f,a){if(!f)throw Error(a||"Failed assertion");}var E=q("base64-js"),I=q("ieee754");h.Buffer=b;h.SlowBuffer=b;h.INSPECT_MAX_BYTES=50;b.poolSize=8192;b._useTypedArrays=function(){try{var f=new ArrayBuffer(0),a=new Uint8Array(f);a.foo=function(){return 42};return 42===a.foo()&&"function"===typeof a.subarray}catch(x){return!1}}();b.isEncoding=function(f){switch(String(f).toLowerCase()){case "hex":case "utf8":case "utf-8":case "ascii":case "binary":case "base64":case "raw":case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":return!0; +default:return!1}};b.isBuffer=function(f){return!(null===f||void 0===f||!f._isBuffer)};b.byteLength=function(f,a){f+="";switch(a||"utf8"){case "hex":var c=f.length/2;break;case "utf8":case "utf-8":c=L(f).length;break;case "ascii":case "binary":case "raw":c=f.length;break;case "base64":c=E.toByteArray(f).length;break;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":c=2*f.length;break;default:throw Error("Unknown encoding");}return c};b.concat=function(f,a){p(M(f),"Usage: Buffer.concat(list, [totalLength])\nlist should be an Array."); +if(0===f.length)return new b(0);if(1===f.length)return f[0];var c;if("number"!==typeof a)for(c=a=0;c<f.length;c++)a+=f[c].length;var g=new b(a),d=0;for(c=0;c<f.length;c++){var m=f[c];m.copy(g,d);d+=m.length}return g};b.prototype.write=function(f,a,c,d){if(isFinite(a))isFinite(c)||(d=c,c=void 0);else{var g=d;d=a;a=c;c=g}a=Number(a)||0;g=this.length-a;c?(c=Number(c),c>g&&(c=g)):c=g;d=String(d||"utf8").toLowerCase();switch(d){case "hex":a=Number(a)||0;d=this.length-a;c?(c=Number(c),c>d&&(c=d)):c=d;d= +f.length;p(0===d%2,"Invalid hex string");c>d/2&&(c=d/2);for(d=0;d<c;d++)g=parseInt(f.substr(2*d,2),16),p(!isNaN(g),"Invalid hex string"),this[a+d]=g;b._charsWritten=2*d;f=d;break;case "utf8":case "utf-8":f=b._charsWritten=B(L(f),this,a,c);break;case "ascii":f=b._charsWritten=B(J(f),this,a,c);break;case "binary":f=b._charsWritten=B(J(f),this,a,c);break;case "base64":f=b._charsWritten=B(E.toByteArray(f),this,a,c);break;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":g=[];for(var m=0;m<f.length;m++){var t= +f.charCodeAt(m);d=t>>8;t%=256;g.push(t);g.push(d)}f=b._charsWritten=B(g,this,a,c);break;default:throw Error("Unknown encoding");}return f};b.prototype.toString=function(f,a,c){f=String(f||"utf8").toLowerCase();a=Number(a)||0;c=void 0!==c?Number(c):c=this.length;if(c===a)return"";switch(f){case "hex":f=this.length;if(!a||0>a)a=0;if(!c||0>c||c>f)c=f;for(f="";a<c;a++)f+=K(this[a]);c=f;break;case "utf8":case "utf-8":var g=f="";for(c=Math.min(this.length,c);a<c;a++)127>=this[a]?(f+=G(g)+String.fromCharCode(this[a]), +g=""):g+="%"+this[a].toString(16);c=f+G(g);break;case "ascii":c=e(this,a,c);break;case "binary":c=e(this,a,c);break;case "base64":c=0===a&&c===this.length?E.fromByteArray(this):E.fromByteArray(this.slice(a,c));break;case "ucs2":case "ucs-2":case "utf16le":case "utf-16le":c=this.slice(a,c);a="";for(f=0;f<c.length;f+=2)a+=String.fromCharCode(c[f]+256*c[f+1]);c=a;break;default:throw Error("Unknown encoding");}return c};b.prototype.toJSON=function(){return{type:"Buffer",data:Array.prototype.slice.call(this._arr|| +this,0)}};b.prototype.copy=function(f,a,c,d){c||(c=0);d||0===d||(d=this.length);a||(a=0);if(d!==c&&0!==f.length&&0!==this.length)if(p(d>=c,"sourceEnd < sourceStart"),p(0<=a&&a<f.length,"targetStart out of bounds"),p(0<=c&&c<this.length,"sourceStart out of bounds"),p(0<=d&&d<=this.length,"sourceEnd out of bounds"),d>this.length&&(d=this.length),f.length-a<d-c&&(d=f.length-a+c),d-=c,100>d||!b._useTypedArrays)for(var g=0;g<d;g++)f[g+a]=this[g+c];else f._set(this.subarray(c,c+d),a)};b.prototype.slice= +function(f,a){var c=this.length;f=C(f,c,0);a=C(a,c,c);if(b._useTypedArrays)return b._augment(this.subarray(f,a));c=a-f;for(var g=new b(c,void 0,!0),d=0;d<c;d++)g[d]=this[d+f];return g};b.prototype.get=function(f){console.log(".get() is deprecated. Access using array indexes instead.");return this.readUInt8(f)};b.prototype.set=function(f,a){console.log(".set() is deprecated. Access using array indexes instead.");return this.writeUInt8(f,a)};b.prototype.readUInt8=function(f,a){a||(p(void 0!==f&&null!== +f,"missing offset"),p(f<this.length,"Trying to read beyond buffer length"));if(!(f>=this.length))return this[f]};b.prototype.readUInt16LE=function(f,a){return k(this,f,!0,a)};b.prototype.readUInt16BE=function(a,c){return k(this,a,!1,c)};b.prototype.readUInt32LE=function(a,c){return n(this,a,!0,c)};b.prototype.readUInt32BE=function(a,c){return n(this,a,!1,c)};b.prototype.readInt8=function(a,c){c||(p(void 0!==a&&null!==a,"missing offset"),p(a<this.length,"Trying to read beyond buffer length"));if(!(a>= +this.length))return this[a]&128?-1*(255-this[a]+1):this[a]};b.prototype.readInt16LE=function(a,c){return d(this,a,!0,c)};b.prototype.readInt16BE=function(a,c){return d(this,a,!1,c)};b.prototype.readInt32LE=function(c,b){return a(this,c,!0,b)};b.prototype.readInt32BE=function(c,b){return a(this,c,!1,b)};b.prototype.readFloatLE=function(a,c){return l(this,a,!0,c)};b.prototype.readFloatBE=function(a,c){return l(this,a,!1,c)};b.prototype.readDoubleLE=function(a,c){return u(this,a,!0,c)};b.prototype.readDoubleBE= +function(a,c){return u(this,a,!1,c)};b.prototype.writeUInt8=function(a,c,b){b||(p(void 0!==a&&null!==a,"missing value"),p(void 0!==c&&null!==c,"missing offset"),p(c<this.length,"trying to write beyond buffer length"),H(a,255));c>=this.length||(this[c]=a)};b.prototype.writeUInt16LE=function(a,c,b){r(this,a,c,!0,b)};b.prototype.writeUInt16BE=function(a,c,b){r(this,a,c,!1,b)};b.prototype.writeUInt32LE=function(a,c,b){t(this,a,c,!0,b)};b.prototype.writeUInt32BE=function(a,c,b){t(this,a,c,!1,b)};b.prototype.writeInt8= +function(a,c,b){b||(p(void 0!==a&&null!==a,"missing value"),p(void 0!==c&&null!==c,"missing offset"),p(c<this.length,"Trying to write beyond buffer length"),A(a,127,-128));c>=this.length||(0<=a?this.writeUInt8(a,c,b):this.writeUInt8(255+a+1,c,b))};b.prototype.writeInt16LE=function(a,c,b){z(this,a,c,!0,b)};b.prototype.writeInt16BE=function(a,c,b){z(this,a,c,!1,b)};b.prototype.writeInt32LE=function(a,b,d){c(this,a,b,!0,d)};b.prototype.writeInt32BE=function(a,b,d){c(this,a,b,!1,d)};b.prototype.writeFloatLE= +function(a,c,b){m(this,a,c,!0,b)};b.prototype.writeFloatBE=function(a,c,b){m(this,a,c,!1,b)};b.prototype.writeDoubleLE=function(a,c,b){y(this,a,c,!0,b)};b.prototype.writeDoubleBE=function(a,c,b){y(this,a,c,!1,b)};b.prototype.fill=function(a,c,b){a||(a=0);c||(c=0);b||(b=this.length);"string"===typeof a&&(a=a.charCodeAt(0));p("number"===typeof a&&!isNaN(a),"value is not a number");p(b>=c,"end < start");if(b!==c&&0!==this.length)for(p(0<=c&&c<this.length,"start out of bounds"),p(0<=b&&b<=this.length, +"end out of bounds");c<b;c++)this[c]=a};b.prototype.inspect=function(){for(var a=[],c=this.length,b=0;b<c;b++)if(a[b]=K(this[b]),b===h.INSPECT_MAX_BYTES){a[b+1]="...";break}return"<Buffer "+a.join(" ")+">"};b.prototype.toArrayBuffer=function(){if("undefined"!==typeof Uint8Array){if(b._useTypedArrays)return(new b(this)).buffer;for(var a=new Uint8Array(this.length),c=0,d=a.length;c<d;c+=1)a[c]=this[c];return a.buffer}throw Error("Buffer.toArrayBuffer not supported in this browser");};var w=b.prototype; +b._augment=function(a){a._isBuffer=!0;a._get=a.get;a._set=a.set;a.get=w.get;a.set=w.set;a.write=w.write;a.toString=w.toString;a.toLocaleString=w.toString;a.toJSON=w.toJSON;a.copy=w.copy;a.slice=w.slice;a.readUInt8=w.readUInt8;a.readUInt16LE=w.readUInt16LE;a.readUInt16BE=w.readUInt16BE;a.readUInt32LE=w.readUInt32LE;a.readUInt32BE=w.readUInt32BE;a.readInt8=w.readInt8;a.readInt16LE=w.readInt16LE;a.readInt16BE=w.readInt16BE;a.readInt32LE=w.readInt32LE;a.readInt32BE=w.readInt32BE;a.readFloatLE=w.readFloatLE; +a.readFloatBE=w.readFloatBE;a.readDoubleLE=w.readDoubleLE;a.readDoubleBE=w.readDoubleBE;a.writeUInt8=w.writeUInt8;a.writeUInt16LE=w.writeUInt16LE;a.writeUInt16BE=w.writeUInt16BE;a.writeUInt32LE=w.writeUInt32LE;a.writeUInt32BE=w.writeUInt32BE;a.writeInt8=w.writeInt8;a.writeInt16LE=w.writeInt16LE;a.writeInt16BE=w.writeInt16BE;a.writeInt32LE=w.writeInt32LE;a.writeInt32BE=w.writeInt32BE;a.writeFloatLE=w.writeFloatLE;a.writeFloatBE=w.writeFloatBE;a.writeDoubleLE=w.writeDoubleLE;a.writeDoubleBE=w.writeDoubleBE; +a.fill=w.fill;a.inspect=w.inspect;a.toArrayBuffer=w.toArrayBuffer;return a}},{"base64-js":2,ieee754:5}],5:[function(q,v,h){h.read=function(b,e,k,n,d){var a=8*d-n-1;var l=(1<<a)-1,u=l>>1,r=-7;d=k?d-1:0;var t=k?-1:1,z=b[e+d];d+=t;k=z&(1<<-r)-1;z>>=-r;for(r+=a;0<r;k=256*k+b[e+d],d+=t,r-=8);a=k&(1<<-r)-1;k>>=-r;for(r+=n;0<r;a=256*a+b[e+d],d+=t,r-=8);if(0===k)k=1-u;else{if(k===l)return a?NaN:Infinity*(z?-1:1);a+=Math.pow(2,n);k-=u}return(z?-1:1)*a*Math.pow(2,k-n)};h.write=function(b,e,k,n,d,a){var l,u= +8*a-d-1,r=(1<<u)-1,t=r>>1,z=23===d?Math.pow(2,-24)-Math.pow(2,-77):0;a=n?0:a-1;var c=n?1:-1,m=0>e||0===e&&0>1/e?1:0;e=Math.abs(e);isNaN(e)||Infinity===e?(e=isNaN(e)?1:0,n=r):(n=Math.floor(Math.log(e)/Math.LN2),1>e*(l=Math.pow(2,-n))&&(n--,l*=2),e=1<=n+t?e+z/l:e+z*Math.pow(2,1-t),2<=e*l&&(n++,l/=2),n+t>=r?(e=0,n=r):1<=n+t?(e=(e*l-1)*Math.pow(2,d),n+=t):(e=e*Math.pow(2,t-1)*Math.pow(2,d),n=0));for(;8<=d;b[k+a]=e&255,a+=c,e/=256,d-=8);n=n<<d|e;for(u+=d;0<u;b[k+a]=n&255,a+=c,n/=256,u-=8);b[k+a-c]|=128* +m}},{}],6:[function(q,v,h){(function(b){function e(a,b){for(var d=0,l=a.length-1;0<=l;l--){var t=a[l];"."===t?a.splice(l,1):".."===t?(a.splice(l,1),d++):d&&(a.splice(l,1),d--)}if(b)for(;d--;d)a.unshift("..");return a}function k(a,b){if(a.filter)return a.filter(b);for(var d=[],l=0;l<a.length;l++)b(a[l],l,a)&&d.push(a[l]);return d}var n=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;h.resolve=function(){for(var a="",d=!1,u=arguments.length-1;-1<=u&&!d;u--){var r=0<=u?arguments[u]:b.cwd(); +if("string"!==typeof r)throw new TypeError("Arguments to path.resolve must be strings");r&&(a=r+"/"+a,d="/"===r.charAt(0))}a=e(k(a.split("/"),function(a){return!!a}),!d).join("/");return(d?"/":"")+a||"."};h.normalize=function(a){var b=h.isAbsolute(a),u="/"===d(a,-1);(a=e(k(a.split("/"),function(a){return!!a}),!b).join("/"))||b||(a=".");a&&u&&(a+="/");return(b?"/":"")+a};h.isAbsolute=function(a){return"/"===a.charAt(0)};h.join=function(){var a=Array.prototype.slice.call(arguments,0);return h.normalize(k(a, +function(a,b){if("string"!==typeof a)throw new TypeError("Arguments to path.join must be strings");return a}).join("/"))};h.relative=function(a,b){function d(a){for(var c=0;c<a.length&&""===a[c];c++);for(var b=a.length-1;0<=b&&""===a[b];b--);return c>b?[]:a.slice(c,b-c+1)}a=h.resolve(a).substr(1);b=h.resolve(b).substr(1);for(var l=d(a.split("/")),t=d(b.split("/")),e=Math.min(l.length,t.length),c=e,m=0;m<e;m++)if(l[m]!==t[m]){c=m;break}e=[];for(m=c;m<l.length;m++)e.push("..");e=e.concat(t.slice(c)); +return e.join("/")};h.sep="/";h.delimiter=":";h.dirname=function(a){var b=n.exec(a).slice(1);a=b[0];b=b[1];if(!a&&!b)return".";b&&(b=b.substr(0,b.length-1));return a+b};h.basename=function(a,b){var d=n.exec(a).slice(1)[2];b&&d.substr(-1*b.length)===b&&(d=d.substr(0,d.length-b.length));return d};h.extname=function(a){return n.exec(a).slice(1)[3]};var d="b"==="ab".substr(-1)?function(a,b,d){return a.substr(b,d)}:function(a,b,d){0>b&&(b=a.length+b);return a.substr(b,d)}}).call(this,q("node_modules/process/browser.js"))}, +{"node_modules/process/browser.js":7}],7:[function(q,v,h){function b(){}q=v.exports={};q.nextTick=function(){if("undefined"!==typeof window&&window.setImmediate)return function(b){return window.setImmediate(b)};if("undefined"!==typeof window&&window.postMessage&&window.addEventListener){var b=[];window.addEventListener("message",function(e){var k=e.source;k!==window&&null!==k||"process-tick"!==e.data||(e.stopPropagation(),0<b.length&&b.shift()())},!0);return function(e){b.push(e);window.postMessage("process-tick", +"*")}}return function(b){setTimeout(b,0)}}();q.title="browser";q.browser=!0;q.env={};q.argv=[];q.on=b;q.once=b;q.off=b;q.emit=b;q.binding=function(b){throw Error("process.binding is not supported");};q.cwd=function(){return"/"};q.chdir=function(b){throw Error("process.chdir is not supported");}},{}],8:[function(q,v,h){function b(){this._array=[];this._set=n?new Map:Object.create(null)}var e=q("./util"),k=Object.prototype.hasOwnProperty,n="undefined"!==typeof Map;b.fromArray=function(d,a){for(var e= +new b,k=0,r=d.length;k<r;k++)e.add(d[k],a);return e};b.prototype.size=function(){return n?this._set.size:Object.getOwnPropertyNames(this._set).length};b.prototype.add=function(b,a){var d=n?b:e.toSetString(b),u=n?this.has(b):k.call(this._set,d),r=this._array.length;u&&!a||this._array.push(b);u||(n?this._set.set(b,r):this._set[d]=r)};b.prototype.has=function(b){if(n)return this._set.has(b);b=e.toSetString(b);return k.call(this._set,b)};b.prototype.indexOf=function(b){if(n){var a=this._set.get(b);if(0<= +a)return a}else if(a=e.toSetString(b),k.call(this._set,a))return this._set[a];throw Error('"'+b+'" is not in the set.');};b.prototype.at=function(b){if(0<=b&&b<this._array.length)return this._array[b];throw Error("No element indexed by "+b);};b.prototype.toArray=function(){return this._array.slice()};h.ArraySet=b},{"./util":17}],9:[function(q,v,h){var b=q("./base64");h.encode=function(e){var k="",n=0>e?(-e<<1)+1:(e<<1)+0;do e=n&31,n>>>=5,0<n&&(e|=32),k+=b.encode(e);while(0<n);return k};h.decode=function(e, +k,n){var d=e.length,a=0,l=0;do{if(k>=d)throw Error("Expected more digits in base 64 VLQ value.");var u=b.decode(e.charCodeAt(k++));if(-1===u)throw Error("Invalid base64 digit: "+e.charAt(k-1));var r=!!(u&32);u&=31;a+=u<<l;l+=5}while(r);e=a>>1;n.value=1===(a&1)?-e:e;n.rest=k}},{"./base64":10}],10:[function(q,v,h){var b="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");h.encode=function(e){if(0<=e&&e<b.length)return b[e];throw new TypeError("Must be between 0 and 63: "+e); +};h.decode=function(b){return 65<=b&&90>=b?b-65:97<=b&&122>=b?b-97+26:48<=b&&57>=b?b-48+52:43==b?62:47==b?63:-1}},{}],11:[function(q,v,h){function b(e,k,n,d,a,l){var u=Math.floor((k-e)/2)+e,r=a(n,d[u],!0);return 0===r?u:0<r?1<k-u?b(u,k,n,d,a,l):l==h.LEAST_UPPER_BOUND?k<d.length?k:-1:u:1<u-e?b(e,u,n,d,a,l):l==h.LEAST_UPPER_BOUND?u:0>e?-1:e}h.GREATEST_LOWER_BOUND=1;h.LEAST_UPPER_BOUND=2;h.search=function(e,k,n,d){if(0===k.length)return-1;e=b(-1,k.length,e,k,n,d||h.GREATEST_LOWER_BOUND);if(0>e)return-1; +for(;0<=e-1&&0===n(k[e],k[e-1],!0);)--e;return e}},{}],12:[function(q,v,h){function b(){this._array=[];this._sorted=!0;this._last={generatedLine:-1,generatedColumn:0}}var e=q("./util");b.prototype.unsortedForEach=function(b,e){this._array.forEach(b,e)};b.prototype.add=function(b){var k=this._last,d=k.generatedLine,a=b.generatedLine,l=k.generatedColumn,u=b.generatedColumn;a>d||a==d&&u>=l||0>=e.compareByGeneratedPositionsInflated(k,b)?this._last=b:this._sorted=!1;this._array.push(b)};b.prototype.toArray= +function(){this._sorted||(this._array.sort(e.compareByGeneratedPositionsInflated),this._sorted=!0);return this._array};h.MappingList=b},{"./util":17}],13:[function(q,v,h){function b(b,e,d){var a=b[e];b[e]=b[d];b[d]=a}function e(k,n,d,a){if(d<a){var l=d-1;b(k,Math.round(d+Math.random()*(a-d)),a);for(var u=k[a],r=d;r<a;r++)0>=n(k[r],u)&&(l+=1,b(k,l,r));b(k,l+1,r);l+=1;e(k,n,d,l-1);e(k,n,l+1,a)}}h.quickSort=function(b,n){e(b,n,0,b.length-1)}},{}],14:[function(q,v,h){function b(a,b){var c=a;"string"=== +typeof a&&(c=d.parseSourceMapInput(a));return null!=c.sections?new n(c,b):new e(c,b)}function e(a,b){var c=a;"string"===typeof a&&(c=d.parseSourceMapInput(a));var m=d.getArg(c,"version"),t=d.getArg(c,"sources"),e=d.getArg(c,"names",[]),r=d.getArg(c,"sourceRoot",null),k=d.getArg(c,"sourcesContent",null),u=d.getArg(c,"mappings");c=d.getArg(c,"file",null);if(m!=this._version)throw Error("Unsupported version: "+m);r&&(r=d.normalize(r));t=t.map(String).map(d.normalize).map(function(a){return r&&d.isAbsolute(r)&& +d.isAbsolute(a)?d.relative(r,a):a});this._names=l.fromArray(e.map(String),!0);this._sources=l.fromArray(t,!0);this.sourceRoot=r;this.sourcesContent=k;this._mappings=u;this._sourceMapURL=b;this.file=c}function k(){this.generatedColumn=this.generatedLine=0;this.name=this.originalColumn=this.originalLine=this.source=null}function n(a,e){var c=a;"string"===typeof a&&(c=d.parseSourceMapInput(a));var m=d.getArg(c,"version");c=d.getArg(c,"sections");if(m!=this._version)throw Error("Unsupported version: "+ +m);this._sources=new l;this._names=new l;var t={line:-1,column:0};this._sections=c.map(function(a){if(a.url)throw Error("Support for url field in sections not implemented.");var c=d.getArg(a,"offset"),m=d.getArg(c,"line"),l=d.getArg(c,"column");if(m<t.line||m===t.line&&l<t.column)throw Error("Section offsets must be ordered and non-overlapping.");t=c;return{generatedOffset:{generatedLine:m+1,generatedColumn:l+1},consumer:new b(d.getArg(a,"map"),e)}})}var d=q("./util"),a=q("./binary-search"),l=q("./array-set").ArraySet, +u=q("./base64-vlq"),r=q("./quick-sort").quickSort;b.fromSourceMap=function(a){return e.fromSourceMap(a)};b.prototype._version=3;b.prototype.__generatedMappings=null;Object.defineProperty(b.prototype,"_generatedMappings",{configurable:!0,enumerable:!0,get:function(){this.__generatedMappings||this._parseMappings(this._mappings,this.sourceRoot);return this.__generatedMappings}});b.prototype.__originalMappings=null;Object.defineProperty(b.prototype,"_originalMappings",{configurable:!0,enumerable:!0,get:function(){this.__originalMappings|| +this._parseMappings(this._mappings,this.sourceRoot);return this.__originalMappings}});b.prototype._charIsMappingSeparator=function(a,b){var c=a.charAt(b);return";"===c||","===c};b.prototype._parseMappings=function(a,b){throw Error("Subclasses must implement _parseMappings");};b.GENERATED_ORDER=1;b.ORIGINAL_ORDER=2;b.GREATEST_LOWER_BOUND=1;b.LEAST_UPPER_BOUND=2;b.prototype.eachMapping=function(a,e,c){e=e||null;switch(c||b.GENERATED_ORDER){case b.GENERATED_ORDER:c=this._generatedMappings;break;case b.ORIGINAL_ORDER:c= +this._originalMappings;break;default:throw Error("Unknown order of iteration.");}var m=this.sourceRoot;c.map(function(a){var c=null===a.source?null:this._sources.at(a.source);c=d.computeSourceURL(m,c,this._sourceMapURL);return{source:c,generatedLine:a.generatedLine,generatedColumn:a.generatedColumn,originalLine:a.originalLine,originalColumn:a.originalColumn,name:null===a.name?null:this._names.at(a.name)}},this).forEach(a,e)};b.prototype.allGeneratedPositionsFor=function(b){var e=d.getArg(b,"line"), +c={source:d.getArg(b,"source"),originalLine:e,originalColumn:d.getArg(b,"column",0)};null!=this.sourceRoot&&(c.source=d.relative(this.sourceRoot,c.source));if(!this._sources.has(c.source))return[];c.source=this._sources.indexOf(c.source);var m=[];c=this._findMapping(c,this._originalMappings,"originalLine","originalColumn",d.compareByOriginalPositions,a.LEAST_UPPER_BOUND);if(0<=c){var t=this._originalMappings[c];if(void 0===b.column)for(e=t.originalLine;t&&t.originalLine===e;)m.push({line:d.getArg(t, +"generatedLine",null),column:d.getArg(t,"generatedColumn",null),lastColumn:d.getArg(t,"lastGeneratedColumn",null)}),t=this._originalMappings[++c];else for(b=t.originalColumn;t&&t.originalLine===e&&t.originalColumn==b;)m.push({line:d.getArg(t,"generatedLine",null),column:d.getArg(t,"generatedColumn",null),lastColumn:d.getArg(t,"lastGeneratedColumn",null)}),t=this._originalMappings[++c]}return m};h.SourceMapConsumer=b;e.prototype=Object.create(b.prototype);e.prototype.consumer=b;e.fromSourceMap=function(a, +b){var c=Object.create(e.prototype),m=c._names=l.fromArray(a._names.toArray(),!0),t=c._sources=l.fromArray(a._sources.toArray(),!0);c.sourceRoot=a._sourceRoot;c.sourcesContent=a._generateSourcesContent(c._sources.toArray(),c.sourceRoot);c.file=a._file;c._sourceMapURL=b;for(var u=a._mappings.toArray().slice(),z=c.__generatedMappings=[],n=c.__originalMappings=[],h=0,q=u.length;h<q;h++){var v=u[h],B=new k;B.generatedLine=v.generatedLine;B.generatedColumn=v.generatedColumn;v.source&&(B.source=t.indexOf(v.source), +B.originalLine=v.originalLine,B.originalColumn=v.originalColumn,v.name&&(B.name=m.indexOf(v.name)),n.push(B));z.push(B)}r(c.__originalMappings,d.compareByOriginalPositions);return c};e.prototype._version=3;Object.defineProperty(e.prototype,"sources",{get:function(){return this._sources.toArray().map(function(a){return d.computeSourceURL(this.sourceRoot,a,this._sourceMapURL)},this)}});e.prototype._parseMappings=function(a,b){for(var c=1,m=0,e=0,t=0,l=0,z=0,n=a.length,h=0,q={},v={},G=[],H=[],A,F,p, +E,I;h<n;)if(";"===a.charAt(h))c++,h++,m=0;else if(","===a.charAt(h))h++;else{A=new k;A.generatedLine=c;for(E=h;E<n&&!this._charIsMappingSeparator(a,E);E++);F=a.slice(h,E);if(p=q[F])h+=F.length;else{for(p=[];h<E;)u.decode(a,h,v),I=v.value,h=v.rest,p.push(I);if(2===p.length)throw Error("Found a source, but no line and column");if(3===p.length)throw Error("Found a source and line, but no column");q[F]=p}A.generatedColumn=m+p[0];m=A.generatedColumn;1<p.length&&(A.source=l+p[1],l+=p[1],A.originalLine= +e+p[2],e=A.originalLine,A.originalLine+=1,A.originalColumn=t+p[3],t=A.originalColumn,4<p.length&&(A.name=z+p[4],z+=p[4]));H.push(A);"number"===typeof A.originalLine&&G.push(A)}r(H,d.compareByGeneratedPositionsDeflated);this.__generatedMappings=H;r(G,d.compareByOriginalPositions);this.__originalMappings=G};e.prototype._findMapping=function(b,d,c,m,e,l){if(0>=b[c])throw new TypeError("Line must be greater than or equal to 1, got "+b[c]);if(0>b[m])throw new TypeError("Column must be greater than or equal to 0, got "+ +b[m]);return a.search(b,d,e,l)};e.prototype.computeColumnSpans=function(){for(var a=0;a<this._generatedMappings.length;++a){var b=this._generatedMappings[a];if(a+1<this._generatedMappings.length){var c=this._generatedMappings[a+1];if(b.generatedLine===c.generatedLine){b.lastGeneratedColumn=c.generatedColumn-1;continue}}b.lastGeneratedColumn=Infinity}};e.prototype.originalPositionFor=function(a){var e={generatedLine:d.getArg(a,"line"),generatedColumn:d.getArg(a,"column")};a=this._findMapping(e,this._generatedMappings, +"generatedLine","generatedColumn",d.compareByGeneratedPositionsDeflated,d.getArg(a,"bias",b.GREATEST_LOWER_BOUND));if(0<=a&&(a=this._generatedMappings[a],a.generatedLine===e.generatedLine)){e=d.getArg(a,"source",null);null!==e&&(e=this._sources.at(e),e=d.computeSourceURL(this.sourceRoot,e,this._sourceMapURL));var c=d.getArg(a,"name",null);null!==c&&(c=this._names.at(c));return{source:e,line:d.getArg(a,"originalLine",null),column:d.getArg(a,"originalColumn",null),name:c}}return{source:null,line:null, +column:null,name:null}};e.prototype.hasContentsOfAllSources=function(){return this.sourcesContent?this.sourcesContent.length>=this._sources.size()&&!this.sourcesContent.some(function(a){return null==a}):!1};e.prototype.sourceContentFor=function(a,b){if(!this.sourcesContent)return null;var c=a;null!=this.sourceRoot&&(c=d.relative(this.sourceRoot,c));if(this._sources.has(c))return this.sourcesContent[this._sources.indexOf(c)];var m=this.sources,e;for(e=0;e<m.length;++e)if(m[e]==a)return this.sourcesContent[e]; +var l;if(null!=this.sourceRoot&&(l=d.urlParse(this.sourceRoot))){m=c.replace(/^file:\/\//,"");if("file"==l.scheme&&this._sources.has(m))return this.sourcesContent[this._sources.indexOf(m)];if((!l.path||"/"==l.path)&&this._sources.has("/"+c))return this.sourcesContent[this._sources.indexOf("/"+c)]}if(b)return null;throw Error('"'+c+'" is not in the SourceMap.');};e.prototype.generatedPositionFor=function(a){var e=d.getArg(a,"source");null!=this.sourceRoot&&(e=d.relative(this.sourceRoot,e));if(!this._sources.has(e))return{line:null, +column:null,lastColumn:null};e=this._sources.indexOf(e);e={source:e,originalLine:d.getArg(a,"line"),originalColumn:d.getArg(a,"column")};a=this._findMapping(e,this._originalMappings,"originalLine","originalColumn",d.compareByOriginalPositions,d.getArg(a,"bias",b.GREATEST_LOWER_BOUND));return 0<=a&&(a=this._originalMappings[a],a.source===e.source)?{line:d.getArg(a,"generatedLine",null),column:d.getArg(a,"generatedColumn",null),lastColumn:d.getArg(a,"lastGeneratedColumn",null)}:{line:null,column:null, +lastColumn:null}};h.BasicSourceMapConsumer=e;n.prototype=Object.create(b.prototype);n.prototype.constructor=b;n.prototype._version=3;Object.defineProperty(n.prototype,"sources",{get:function(){for(var a=[],b=0;b<this._sections.length;b++)for(var c=0;c<this._sections[b].consumer.sources.length;c++)a.push(this._sections[b].consumer.sources[c]);return a}});n.prototype.originalPositionFor=function(b){var e={generatedLine:d.getArg(b,"line"),generatedColumn:d.getArg(b,"column")},c=a.search(e,this._sections, +function(a,c){var b=a.generatedLine-c.generatedOffset.generatedLine;return b?b:a.generatedColumn-c.generatedOffset.generatedColumn});return(c=this._sections[c])?c.consumer.originalPositionFor({line:e.generatedLine-(c.generatedOffset.generatedLine-1),column:e.generatedColumn-(c.generatedOffset.generatedLine===e.generatedLine?c.generatedOffset.generatedColumn-1:0),bias:b.bias}):{source:null,line:null,column:null,name:null}};n.prototype.hasContentsOfAllSources=function(){return this._sections.every(function(a){return a.consumer.hasContentsOfAllSources()})}; +n.prototype.sourceContentFor=function(a,b){for(var c=0;c<this._sections.length;c++){var d=this._sections[c].consumer.sourceContentFor(a,!0);if(d)return d}if(b)return null;throw Error('"'+a+'" is not in the SourceMap.');};n.prototype.generatedPositionFor=function(a){for(var b=0;b<this._sections.length;b++){var c=this._sections[b];if(-1!==c.consumer.sources.indexOf(d.getArg(a,"source"))){var m=c.consumer.generatedPositionFor(a);if(m)return{line:m.line+(c.generatedOffset.generatedLine-1),column:m.column+ +(c.generatedOffset.generatedLine===m.line?c.generatedOffset.generatedColumn-1:0)}}}return{line:null,column:null}};n.prototype._parseMappings=function(a,b){this.__generatedMappings=[];this.__originalMappings=[];for(var c=0;c<this._sections.length;c++)for(var m=this._sections[c],e=m.consumer._generatedMappings,l=0;l<e.length;l++){var u=e[l],k=m.consumer._sources.at(u.source);k=d.computeSourceURL(m.consumer.sourceRoot,k,this._sourceMapURL);this._sources.add(k);k=this._sources.indexOf(k);var t=null;u.name&& +(t=m.consumer._names.at(u.name),this._names.add(t),t=this._names.indexOf(t));u={source:k,generatedLine:u.generatedLine+(m.generatedOffset.generatedLine-1),generatedColumn:u.generatedColumn+(m.generatedOffset.generatedLine===u.generatedLine?m.generatedOffset.generatedColumn-1:0),originalLine:u.originalLine,originalColumn:u.originalColumn,name:t};this.__generatedMappings.push(u);"number"===typeof u.originalLine&&this.__originalMappings.push(u)}r(this.__generatedMappings,d.compareByGeneratedPositionsDeflated); +r(this.__originalMappings,d.compareByOriginalPositions)};h.IndexedSourceMapConsumer=n},{"./array-set":8,"./base64-vlq":9,"./binary-search":11,"./quick-sort":13,"./util":17}],15:[function(q,v,h){function b(a){a||(a={});this._file=k.getArg(a,"file",null);this._sourceRoot=k.getArg(a,"sourceRoot",null);this._skipValidation=k.getArg(a,"skipValidation",!1);this._sources=new n;this._names=new n;this._mappings=new d;this._sourcesContents=null}var e=q("./base64-vlq"),k=q("./util"),n=q("./array-set").ArraySet, +d=q("./mapping-list").MappingList;b.prototype._version=3;b.fromSourceMap=function(a){var d=a.sourceRoot,e=new b({file:a.file,sourceRoot:d});a.eachMapping(function(a){var b={generated:{line:a.generatedLine,column:a.generatedColumn}};null!=a.source&&(b.source=a.source,null!=d&&(b.source=k.relative(d,b.source)),b.original={line:a.originalLine,column:a.originalColumn},null!=a.name&&(b.name=a.name));e.addMapping(b)});a.sources.forEach(function(b){var l=b;null!==d&&(l=k.relative(d,b));e._sources.has(l)|| +e._sources.add(l);l=a.sourceContentFor(b);null!=l&&e.setSourceContent(b,l)});return e};b.prototype.addMapping=function(a){var b=k.getArg(a,"generated"),d=k.getArg(a,"original",null),e=k.getArg(a,"source",null);a=k.getArg(a,"name",null);this._skipValidation||this._validateMapping(b,d,e,a);null!=e&&(e=String(e),this._sources.has(e)||this._sources.add(e));null!=a&&(a=String(a),this._names.has(a)||this._names.add(a));this._mappings.add({generatedLine:b.line,generatedColumn:b.column,originalLine:null!= +d&&d.line,originalColumn:null!=d&&d.column,source:e,name:a})};b.prototype.setSourceContent=function(a,b){var d=a;null!=this._sourceRoot&&(d=k.relative(this._sourceRoot,d));null!=b?(this._sourcesContents||(this._sourcesContents=Object.create(null)),this._sourcesContents[k.toSetString(d)]=b):this._sourcesContents&&(delete this._sourcesContents[k.toSetString(d)],0===Object.keys(this._sourcesContents).length&&(this._sourcesContents=null))};b.prototype.applySourceMap=function(a,b,d){var e=b;if(null==b){if(null== +a.file)throw Error('SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, or the source map\'s "file" property. Both were omitted.');e=a.file}var l=this._sourceRoot;null!=l&&(e=k.relative(l,e));var u=new n,c=new n;this._mappings.unsortedForEach(function(b){if(b.source===e&&null!=b.originalLine){var m=a.originalPositionFor({line:b.originalLine,column:b.originalColumn});null!=m.source&&(b.source=m.source,null!=d&&(b.source=k.join(d,b.source)),null!=l&&(b.source=k.relative(l, +b.source)),b.originalLine=m.line,b.originalColumn=m.column,null!=m.name&&(b.name=m.name))}m=b.source;null==m||u.has(m)||u.add(m);b=b.name;null==b||c.has(b)||c.add(b)},this);this._sources=u;this._names=c;a.sources.forEach(function(b){var c=a.sourceContentFor(b);null!=c&&(null!=d&&(b=k.join(d,b)),null!=l&&(b=k.relative(l,b)),this.setSourceContent(b,c))},this)};b.prototype._validateMapping=function(a,b,d,e){if(b&&"number"!==typeof b.line&&"number"!==typeof b.column)throw Error("original.line and original.column are not numbers -- you probably meant to omit the original mapping entirely and only map the generated position. If so, pass null for the original mapping instead of an object with empty or null values."); +if(!(a&&"line"in a&&"column"in a&&0<a.line&&0<=a.column&&!b&&!d&&!e||a&&"line"in a&&"column"in a&&b&&"line"in b&&"column"in b&&0<a.line&&0<=a.column&&0<b.line&&0<=b.column&&d))throw Error("Invalid mapping: "+JSON.stringify({generated:a,source:d,original:b,name:e}));};b.prototype._serializeMappings=function(){for(var a=0,b=1,d=0,h=0,n=0,q=0,c="",m,y,C,D=this._mappings.toArray(),v=0,K=D.length;v<K;v++){y=D[v];m="";if(y.generatedLine!==b)for(a=0;y.generatedLine!==b;)m+=";",b++;else if(0<v){if(!k.compareByGeneratedPositionsInflated(y, +D[v-1]))continue;m+=","}m+=e.encode(y.generatedColumn-a);a=y.generatedColumn;null!=y.source&&(C=this._sources.indexOf(y.source),m+=e.encode(C-q),q=C,m+=e.encode(y.originalLine-1-h),h=y.originalLine-1,m+=e.encode(y.originalColumn-d),d=y.originalColumn,null!=y.name&&(y=this._names.indexOf(y.name),m+=e.encode(y-n),n=y));c+=m}return c};b.prototype._generateSourcesContent=function(a,b){return a.map(function(a){if(!this._sourcesContents)return null;null!=b&&(a=k.relative(b,a));a=k.toSetString(a);return Object.prototype.hasOwnProperty.call(this._sourcesContents, +a)?this._sourcesContents[a]:null},this)};b.prototype.toJSON=function(){var a={version:this._version,sources:this._sources.toArray(),names:this._names.toArray(),mappings:this._serializeMappings()};null!=this._file&&(a.file=this._file);null!=this._sourceRoot&&(a.sourceRoot=this._sourceRoot);this._sourcesContents&&(a.sourcesContent=this._generateSourcesContent(a.sources,a.sourceRoot));return a};b.prototype.toString=function(){return JSON.stringify(this.toJSON())};h.SourceMapGenerator=b},{"./array-set":8, +"./base64-vlq":9,"./mapping-list":12,"./util":17}],16:[function(q,v,h){function b(b,a,e,k,h){this.children=[];this.sourceContents={};this.line=null==b?null:b;this.column=null==a?null:a;this.source=null==e?null:e;this.name=null==h?null:h;this.$$$isSourceNode$$$=!0;null!=k&&this.add(k)}var e=q("./source-map-generator").SourceMapGenerator,k=q("./util"),n=/(\r?\n)/;b.fromStringWithSourceMap=function(d,a,e){function l(a,c){if(null===a||void 0===a.source)h.add(c);else{var d=e?k.join(e,a.source):a.source; +h.add(new b(a.originalLine,a.originalColumn,d,c,a.name))}}var h=new b,t=d.split(n),q=0,c=function(){var a=q<t.length?t[q++]:void 0,b=(q<t.length?t[q++]:void 0)||"";return a+b},m=1,y=0,C=null;a.eachMapping(function(a){if(null!==C)if(m<a.generatedLine)l(C,c()),m++,y=0;else{var b=t[q]||"",d=b.substr(0,a.generatedColumn-y);t[q]=b.substr(a.generatedColumn-y);y=a.generatedColumn;l(C,d);C=a;return}for(;m<a.generatedLine;)h.add(c()),m++;y<a.generatedColumn&&(b=t[q]||"",h.add(b.substr(0,a.generatedColumn)), +t[q]=b.substr(a.generatedColumn),y=a.generatedColumn);C=a},this);q<t.length&&(C&&l(C,c()),h.add(t.splice(q).join("")));a.sources.forEach(function(b){var c=a.sourceContentFor(b);null!=c&&(null!=e&&(b=k.join(e,b)),h.setSourceContent(b,c))});return h};b.prototype.add=function(b){if(Array.isArray(b))b.forEach(function(a){this.add(a)},this);else if(b.$$$isSourceNode$$$||"string"===typeof b)b&&this.children.push(b);else throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+ +b);return this};b.prototype.prepend=function(b){if(Array.isArray(b))for(var a=b.length-1;0<=a;a--)this.prepend(b[a]);else if(b.$$$isSourceNode$$$||"string"===typeof b)this.children.unshift(b);else throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+b);return this};b.prototype.walk=function(b){for(var a,d=0,e=this.children.length;d<e;d++)a=this.children[d],a.$$$isSourceNode$$$?a.walk(b):""!==a&&b(a,{source:this.source,line:this.line,column:this.column, +name:this.name})};b.prototype.join=function(b){var a,d=this.children.length;if(0<d){var e=[];for(a=0;a<d-1;a++)e.push(this.children[a]),e.push(b);e.push(this.children[a]);this.children=e}return this};b.prototype.replaceRight=function(b,a){var d=this.children[this.children.length-1];d.$$$isSourceNode$$$?d.replaceRight(b,a):"string"===typeof d?this.children[this.children.length-1]=d.replace(b,a):this.children.push("".replace(b,a));return this};b.prototype.setSourceContent=function(b,a){this.sourceContents[k.toSetString(b)]= +a};b.prototype.walkSourceContents=function(b){for(var a=0,d=this.children.length;a<d;a++)this.children[a].$$$isSourceNode$$$&&this.children[a].walkSourceContents(b);var e=Object.keys(this.sourceContents);a=0;for(d=e.length;a<d;a++)b(k.fromSetString(e[a]),this.sourceContents[e[a]])};b.prototype.toString=function(){var b="";this.walk(function(a){b+=a});return b};b.prototype.toStringWithSourceMap=function(b){var a="",d=1,k=0,h=new e(b),n=!1,q=null,c=null,m=null,y=null;this.walk(function(b,e){a+=b;null!== +e.source&&null!==e.line&&null!==e.column?(q===e.source&&c===e.line&&m===e.column&&y===e.name||h.addMapping({source:e.source,original:{line:e.line,column:e.column},generated:{line:d,column:k},name:e.name}),q=e.source,c=e.line,m=e.column,y=e.name,n=!0):n&&(h.addMapping({generated:{line:d,column:k}}),q=null,n=!1);for(var l=0,r=b.length;l<r;l++)10===b.charCodeAt(l)?(d++,k=0,l+1===r?(q=null,n=!1):n&&h.addMapping({source:e.source,original:{line:e.line,column:e.column},generated:{line:d,column:k},name:e.name})): +k++});this.walkSourceContents(function(a,b){h.setSourceContent(a,b)});return{code:a,map:h}};h.SourceNode=b},{"./source-map-generator":15,"./util":17}],17:[function(q,v,h){function b(a){return(a=a.match(t))?{scheme:a[1],auth:a[2],host:a[3],port:a[4],path:a[5]}:null}function e(a){var b="";a.scheme&&(b+=a.scheme+":");b+="//";a.auth&&(b+=a.auth+"@");a.host&&(b+=a.host);a.port&&(b+=":"+a.port);a.path&&(b+=a.path);return b}function k(a){var c=a,d=b(a);if(d){if(!d.path)return a;c=d.path}a=h.isAbsolute(c); +c=c.split(/\/+/);for(var k,l=0,n=c.length-1;0<=n;n--)k=c[n],"."===k?c.splice(n,1):".."===k?l++:0<l&&(""===k?(c.splice(n+1,l),l=0):(c.splice(n,2),l--));c=c.join("/");""===c&&(c=a?"/":".");return d?(d.path=c,e(d)):c}function n(a,d){""===a&&(a=".");""===d&&(d=".");var c=b(d),m=b(a);m&&(a=m.path||"/");if(c&&!c.scheme)return m&&(c.scheme=m.scheme),e(c);if(c||d.match(z))return d;if(m&&!m.host&&!m.path)return m.host=d,e(m);c="/"===d.charAt(0)?d:k(a.replace(/\/+$/,"")+"/"+d);return m?(m.path=c,e(m)):c}function d(a){return a} +function a(a){return u(a)?"$"+a:a}function l(a){return u(a)?a.slice(1):a}function u(a){if(!a)return!1;var b=a.length;if(9>b||95!==a.charCodeAt(b-1)||95!==a.charCodeAt(b-2)||111!==a.charCodeAt(b-3)||116!==a.charCodeAt(b-4)||111!==a.charCodeAt(b-5)||114!==a.charCodeAt(b-6)||112!==a.charCodeAt(b-7)||95!==a.charCodeAt(b-8)||95!==a.charCodeAt(b-9))return!1;for(b-=10;0<=b;b--)if(36!==a.charCodeAt(b))return!1;return!0}function r(a,b){return a===b?0:null===a?1:null===b?-1:a>b?1:-1}h.getArg=function(a,b,d){if(b in +a)return a[b];if(3===arguments.length)return d;throw Error('"'+b+'" is a required argument.');};var t=/^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/,z=/^data:.+\,.+$/;h.urlParse=b;h.urlGenerate=e;h.normalize=k;h.join=n;h.isAbsolute=function(a){return"/"===a.charAt(0)||t.test(a)};h.relative=function(a,b){""===a&&(a=".");a=a.replace(/\/$/,"");for(var c=0;0!==b.indexOf(a+"/");){var d=a.lastIndexOf("/");if(0>d)return b;a=a.slice(0,d);if(a.match(/^([^\/]+:\/)?\/*$/))return b;++c}return Array(c+ +1).join("../")+b.substr(a.length+1)};q=!("__proto__"in Object.create(null));h.toSetString=q?d:a;h.fromSetString=q?d:l;h.compareByOriginalPositions=function(a,b,d){var c=r(a.source,b.source);if(0!==c)return c;c=a.originalLine-b.originalLine;if(0!==c)return c;c=a.originalColumn-b.originalColumn;if(0!==c||d)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c)return c;c=a.generatedLine-b.generatedLine;return 0!==c?c:r(a.name,b.name)};h.compareByGeneratedPositionsDeflated=function(a,b,d){var c=a.generatedLine- +b.generatedLine;if(0!==c)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c||d)return c;c=r(a.source,b.source);if(0!==c)return c;c=a.originalLine-b.originalLine;if(0!==c)return c;c=a.originalColumn-b.originalColumn;return 0!==c?c:r(a.name,b.name)};h.compareByGeneratedPositionsInflated=function(a,b){var c=a.generatedLine-b.generatedLine;if(0!==c)return c;c=a.generatedColumn-b.generatedColumn;if(0!==c)return c;c=r(a.source,b.source);if(0!==c)return c;c=a.originalLine-b.originalLine;if(0!==c)return c; +c=a.originalColumn-b.originalColumn;return 0!==c?c:r(a.name,b.name)};h.parseSourceMapInput=function(a){return JSON.parse(a.replace(/^\)]}'[^\n]*\n/,""))};h.computeSourceURL=function(a,d,h){d=d||"";a&&("/"!==a[a.length-1]&&"/"!==d[0]&&(a+="/"),d=a+d);if(h){a=b(h);if(!a)throw Error("sourceMapURL could not be parsed");a.path&&(h=a.path.lastIndexOf("/"),0<=h&&(a.path=a.path.substring(0,h+1)));d=n(e(a),d)}return k(d)}},{}],18:[function(q,v,h){h.SourceMapGenerator=q("./lib/source-map-generator").SourceMapGenerator; +h.SourceMapConsumer=q("./lib/source-map-consumer").SourceMapConsumer;h.SourceNode=q("./lib/source-node").SourceNode},{"./lib/source-map-consumer":14,"./lib/source-map-generator":15,"./lib/source-node":16}],19:[function(q,v,h){(function(b,e){function k(){return"browser"===J?!0:"node"===J?!1:"undefined"!==typeof window&&"function"===typeof XMLHttpRequest&&!(window.require&&window.module&&window.process&&"renderer"===window.process.type)}function n(a){return function(b){for(var c=0;c<a.length;c++){var d= +a[c](b);if(d)return d}return null}}function d(a,b){if(!a)return b;var c=C.dirname(a),d=/^\w+:\/\/[^\/]*/.exec(c);d=d?d[0]:"";return d+C.resolve(c.slice(d.length),b)}function a(a){var b=G[a.source];if(!b){var c=E(a.source);c?(b=G[a.source]={url:c.url,map:new y(c.map)},b.map.sourcesContent&&b.map.sources.forEach(function(a,c){var e=b.map.sourcesContent[c];if(e){var f=d(b.url,a);B[f]=e}})):b=G[a.source]={url:null,map:null}}return b&&b.map&&(c=b.map.originalPositionFor(a),null!==c.source)?(c.source=d(b.url, +c.source),c):a}function l(b){var c=/^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(b);return c?(b=a({source:c[2],line:+c[3],column:c[4]-1}),"eval at "+c[1]+" ("+b.source+":"+b.line+":"+(b.column+1)+")"):(c=/^eval at ([^(]+) \((.+)\)$/.exec(b))?"eval at "+c[1]+" ("+l(c[2])+")":b}function u(){var a="";if(this.isNative())a="native";else{var b=this.getScriptNameOrSourceURL();!b&&this.isEval()&&(a=this.getEvalOrigin(),a+=", ");a=b?a+b:a+"<anonymous>";b=this.getLineNumber();null!=b&&(a+=":"+b,(b=this.getColumnNumber())&& +(a+=":"+b))}b="";var c=this.getFunctionName(),d=!0,e=this.isConstructor();if(this.isToplevel()||e)e?b+="new "+(c||"<anonymous>"):c?b+=c:(b+=a,d=!1);else{e=this.getTypeName();"[object Object]"===e&&(e="null");var k=this.getMethodName();c?(e&&0!=c.indexOf(e)&&(b+=e+"."),b+=c,k&&c.indexOf("."+k)!=c.length-k.length-1&&(b+=" [as "+k+"]")):b+=e+"."+(k||"<anonymous>")}d&&(b+=" ("+a+")");return b}function r(a){var b={};Object.getOwnPropertyNames(Object.getPrototypeOf(a)).forEach(function(c){b[c]=/^(?:is|get)/.test(c)? +function(){return a[c].call(a)}:a[c]});b.toString=u;return b}function t(b){if(b.isNative())return b;var c=b.getFileName()||b.getScriptNameOrSourceURL();if(c){var d=b.getLineNumber(),e=b.getColumnNumber()-1;1===d&&62<e&&!k()&&!b.isEval()&&(e-=62);var h=a({source:c,line:d,column:e});b=r(b);b.getFileName=function(){return h.source};b.getLineNumber=function(){return h.line};b.getColumnNumber=function(){return h.column+1};b.getScriptNameOrSourceURL=function(){return h.source};return b}var m=b.isEval()&& +b.getEvalOrigin();m&&(m=l(m),b=r(b),b.getEvalOrigin=function(){return m});return b}function v(a,b){L&&(B={},G={});return a+b.map(function(a){return"\n at "+t(a)}).join("")}function c(a){var b=/\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(a.stack);if(b){a=b[1];var c=+b[2];b=+b[3];var d=B[a];if(!d&&D&&D.existsSync(a))try{d=D.readFileSync(a,"utf8")}catch(x){d=""}if(d&&(d=d.split(/(?:\r\n|\r|\n)/)[c-1]))return a+":"+c+"\n"+d+"\n"+Array(b).join(" ")+"^"}return null}function m(){var a=b.emit;b.emit=function(d){if("uncaughtException"=== +d){var e=arguments[1]&&arguments[1].stack,g=0<this.listeners(d).length;if(e&&!g){e=arguments[1];if(g=c(e))console.error(),console.error(g);console.error(e.stack);b.exit(1);return}}return a.apply(this,arguments)}}var y=q("source-map").SourceMapConsumer,C=q("path");try{var D=q("fs");D.existsSync&&D.readFileSync||(D=null)}catch(I){}var M=!1,K=!1,L=!1,J="auto",B={},G={},H=/^data:application\/json[^,]+base64,/,A=[],F=[],p=n(A);A.push(function(a){a=a.trim();if(a in B)return B[a];var b=null;if(!D){var c= +new XMLHttpRequest;c.open("GET",a,!1);c.send(null);b=null;4===c.readyState&&200===c.status&&(b=c.responseText)}else if(D.existsSync(a))try{b=D.readFileSync(a,"utf8")}catch(g){b=""}return B[a]=b});var E=n(F);F.push(function(a){a:{if(k())try{var b=new XMLHttpRequest;b.open("GET",a,!1);b.send(null);var c=b.getResponseHeader("SourceMap")||b.getResponseHeader("X-SourceMap");if(c){var g=c;break a}}catch(P){}g=p(a);b=/(?:\/\/[@#][ \t]+sourceMappingURL=([^\s'"]+?)[ \t]*$)|(?:\/\*[@#][ \t]+sourceMappingURL=([^\*]+?)[ \t]*(?:\*\/)[ \t]*$)/mg; +for(var h;c=b.exec(g);)h=c;g=h?h[1]:null}if(!g)return null;H.test(g)?(h=g.slice(g.indexOf(",")+1),h=(new e(h,"base64")).toString(),g=a):(g=d(a,g),h=p(g));return h?{url:g,map:h}:null});h.wrapCallSite=t;h.getErrorSource=c;h.mapSourcePosition=a;h.retrieveSourceMap=E;h.install=function(a){a=a||{};if(a.environment&&(J=a.environment,-1===["node","browser","auto"].indexOf(J)))throw Error("environment "+J+" was unknown. Available options are {auto, browser, node}");a.retrieveFile&&(a.overrideRetrieveFile&& +(A.length=0),A.unshift(a.retrieveFile));a.retrieveSourceMap&&(a.overrideRetrieveSourceMap&&(F.length=0),F.unshift(a.retrieveSourceMap));if(a.hookRequire&&!k()){try{var c=q("module")}catch(g){}var d=c.prototype._compile;d.__sourceMapSupport||(c.prototype._compile=function(a,b){B[b]=a;G[b]=void 0;return d.call(this,a,b)},c.prototype._compile.__sourceMapSupport=!0)}L||(L="emptyCacheBetweenOperations"in a?a.emptyCacheBetweenOperations:!1);M||(M=!0,Error.prepareStackTrace=v);!K&&("handleUncaughtExceptions"in +a?a.handleUncaughtExceptions:1)&&"object"===typeof b&&null!==b&&"function"===typeof b.on&&(K=!0,m())}}).call(this,q("node_modules/process/browser.js"),q("buffer").Buffer)},{"node_modules/process/browser.js":7,buffer:4,fs:3,module:3,path:6,"source-map":18}]},{},[1]);return N}); diff --git a/node_modules/ava/node_modules/source-map-support/package.json b/node_modules/ava/node_modules/source-map-support/package.json new file mode 100644 index 000000000..b99630661 --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/package.json @@ -0,0 +1,30 @@ +{ + "name": "source-map-support", + "description": "Fixes stack traces for files with source maps", + "version": "0.5.0", + "main": "./source-map-support.js", + "scripts": { + "build": "node build.js", + "serve-tests": "http-server -p 1336", + "prepublish": "npm run build", + "test": "mocha" + }, + "dependencies": { + "source-map": "^0.6.0" + }, + "devDependencies": { + "browserify": "3.44.2", + "coffee-script": "1.7.1", + "http-server": "^0.8.5", + "mocha": "1.18.2", + "webpack": "^1.13.3" + }, + "repository": { + "type": "git", + "url": "https://github.com/evanw/node-source-map-support" + }, + "bugs": { + "url": "https://github.com/evanw/node-source-map-support/issues" + }, + "license": "MIT" +} diff --git a/node_modules/ava/node_modules/source-map-support/register.js b/node_modules/ava/node_modules/source-map-support/register.js new file mode 100644 index 000000000..4f68e67d0 --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/register.js @@ -0,0 +1 @@ +require('./').install(); diff --git a/node_modules/ava/node_modules/source-map-support/source-map-support.js b/node_modules/ava/node_modules/source-map-support/source-map-support.js new file mode 100644 index 000000000..abd888604 --- /dev/null +++ b/node_modules/ava/node_modules/source-map-support/source-map-support.js @@ -0,0 +1,527 @@ +var SourceMapConsumer = require('source-map').SourceMapConsumer; +var path = require('path'); + +var fs; +try { + fs = require('fs'); + if (!fs.existsSync || !fs.readFileSync) { + // fs doesn't have all methods we need + fs = null; + } +} catch (err) { + /* nop */ +} + +// Only install once if called multiple times +var errorFormatterInstalled = false; +var uncaughtShimInstalled = false; + +// If true, the caches are reset before a stack trace formatting operation +var emptyCacheBetweenOperations = false; + +// Supports {browser, node, auto} +var environment = "auto"; + +// Maps a file path to a string containing the file contents +var fileContentsCache = {}; + +// Maps a file path to a source map for that file +var sourceMapCache = {}; + +// Regex for detecting source maps +var reSourceMap = /^data:application\/json[^,]+base64,/; + +// Priority list of retrieve handlers +var retrieveFileHandlers = []; +var retrieveMapHandlers = []; + +function isInBrowser() { + if (environment === "browser") + return true; + if (environment === "node") + return false; + return ((typeof window !== 'undefined') && (typeof XMLHttpRequest === 'function') && !(window.require && window.module && window.process && window.process.type === "renderer")); +} + +function hasGlobalProcessEventEmitter() { + return ((typeof process === 'object') && (process !== null) && (typeof process.on === 'function')); +} + +function handlerExec(list) { + return function(arg) { + for (var i = 0; i < list.length; i++) { + var ret = list[i](arg); + if (ret) { + return ret; + } + } + return null; + }; +} + +var retrieveFile = handlerExec(retrieveFileHandlers); + +retrieveFileHandlers.push(function(path) { + // Trim the path to make sure there is no extra whitespace. + path = path.trim(); + if (path in fileContentsCache) { + return fileContentsCache[path]; + } + + var contents = null; + if (!fs) { + // Use SJAX if we are in the browser + var xhr = new XMLHttpRequest(); + xhr.open('GET', path, false); + xhr.send(null); + var contents = null + if (xhr.readyState === 4 && xhr.status === 200) { + contents = xhr.responseText + } + } else if (fs.existsSync(path)) { + // Otherwise, use the filesystem + try { + contents = fs.readFileSync(path, 'utf8'); + } catch (er) { + contents = ''; + } + } + + return fileContentsCache[path] = contents; +}); + +// Support URLs relative to a directory, but be careful about a protocol prefix +// in case we are in the browser (i.e. directories may start with "http://") +function supportRelativeURL(file, url) { + if (!file) return url; + var dir = path.dirname(file); + var match = /^\w+:\/\/[^\/]*/.exec(dir); + var protocol = match ? match[0] : ''; + return protocol + path.resolve(dir.slice(protocol.length), url); +} + +function retrieveSourceMapURL(source) { + var fileData; + + if (isInBrowser()) { + try { + var xhr = new XMLHttpRequest(); + xhr.open('GET', source, false); + xhr.send(null); + fileData = xhr.readyState === 4 ? xhr.responseText : null; + + // Support providing a sourceMappingURL via the SourceMap header + var sourceMapHeader = xhr.getResponseHeader("SourceMap") || + xhr.getResponseHeader("X-SourceMap"); + if (sourceMapHeader) { + return sourceMapHeader; + } + } catch (e) { + } + } + + // Get the URL of the source map + fileData = retrieveFile(source); + var re = /(?:\/\/[@#][ \t]+sourceMappingURL=([^\s'"]+?)[ \t]*$)|(?:\/\*[@#][ \t]+sourceMappingURL=([^\*]+?)[ \t]*(?:\*\/)[ \t]*$)/mg; + // Keep executing the search to find the *last* sourceMappingURL to avoid + // picking up sourceMappingURLs from comments, strings, etc. + var lastMatch, match; + while (match = re.exec(fileData)) lastMatch = match; + if (!lastMatch) return null; + return lastMatch[1]; +}; + +// Can be overridden by the retrieveSourceMap option to install. Takes a +// generated source filename; returns a {map, optional url} object, or null if +// there is no source map. The map field may be either a string or the parsed +// JSON object (ie, it must be a valid argument to the SourceMapConsumer +// constructor). +var retrieveSourceMap = handlerExec(retrieveMapHandlers); +retrieveMapHandlers.push(function(source) { + var sourceMappingURL = retrieveSourceMapURL(source); + if (!sourceMappingURL) return null; + + // Read the contents of the source map + var sourceMapData; + if (reSourceMap.test(sourceMappingURL)) { + // Support source map URL as a data url + var rawData = sourceMappingURL.slice(sourceMappingURL.indexOf(',') + 1); + sourceMapData = new Buffer(rawData, "base64").toString(); + sourceMappingURL = source; + } else { + // Support source map URLs relative to the source URL + sourceMappingURL = supportRelativeURL(source, sourceMappingURL); + sourceMapData = retrieveFile(sourceMappingURL); + } + + if (!sourceMapData) { + return null; + } + + return { + url: sourceMappingURL, + map: sourceMapData + }; +}); + +function mapSourcePosition(position) { + var sourceMap = sourceMapCache[position.source]; + if (!sourceMap) { + // Call the (overrideable) retrieveSourceMap function to get the source map. + var urlAndMap = retrieveSourceMap(position.source); + if (urlAndMap) { + sourceMap = sourceMapCache[position.source] = { + url: urlAndMap.url, + map: new SourceMapConsumer(urlAndMap.map) + }; + + // Load all sources stored inline with the source map into the file cache + // to pretend like they are already loaded. They may not exist on disk. + if (sourceMap.map.sourcesContent) { + sourceMap.map.sources.forEach(function(source, i) { + var contents = sourceMap.map.sourcesContent[i]; + if (contents) { + var url = supportRelativeURL(sourceMap.url, source); + fileContentsCache[url] = contents; + } + }); + } + } else { + sourceMap = sourceMapCache[position.source] = { + url: null, + map: null + }; + } + } + + // Resolve the source URL relative to the URL of the source map + if (sourceMap && sourceMap.map) { + var originalPosition = sourceMap.map.originalPositionFor(position); + + // Only return the original position if a matching line was found. If no + // matching line is found then we return position instead, which will cause + // the stack trace to print the path and line for the compiled file. It is + // better to give a precise location in the compiled file than a vague + // location in the original file. + if (originalPosition.source !== null) { + originalPosition.source = supportRelativeURL( + sourceMap.url, originalPosition.source); + return originalPosition; + } + } + + return position; +} + +// Parses code generated by FormatEvalOrigin(), a function inside V8: +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js +function mapEvalOrigin(origin) { + // Most eval() calls are in this format + var match = /^eval at ([^(]+) \((.+):(\d+):(\d+)\)$/.exec(origin); + if (match) { + var position = mapSourcePosition({ + source: match[2], + line: +match[3], + column: match[4] - 1 + }); + return 'eval at ' + match[1] + ' (' + position.source + ':' + + position.line + ':' + (position.column + 1) + ')'; + } + + // Parse nested eval() calls using recursion + match = /^eval at ([^(]+) \((.+)\)$/.exec(origin); + if (match) { + return 'eval at ' + match[1] + ' (' + mapEvalOrigin(match[2]) + ')'; + } + + // Make sure we still return useful information if we didn't find anything + return origin; +} + +// This is copied almost verbatim from the V8 source code at +// https://code.google.com/p/v8/source/browse/trunk/src/messages.js. The +// implementation of wrapCallSite() used to just forward to the actual source +// code of CallSite.prototype.toString but unfortunately a new release of V8 +// did something to the prototype chain and broke the shim. The only fix I +// could find was copy/paste. +function CallSiteToString() { + var fileName; + var fileLocation = ""; + if (this.isNative()) { + fileLocation = "native"; + } else { + fileName = this.getScriptNameOrSourceURL(); + if (!fileName && this.isEval()) { + fileLocation = this.getEvalOrigin(); + fileLocation += ", "; // Expecting source position to follow. + } + + if (fileName) { + fileLocation += fileName; + } else { + // Source code does not originate from a file and is not native, but we + // can still get the source position inside the source string, e.g. in + // an eval string. + fileLocation += "<anonymous>"; + } + var lineNumber = this.getLineNumber(); + if (lineNumber != null) { + fileLocation += ":" + lineNumber; + var columnNumber = this.getColumnNumber(); + if (columnNumber) { + fileLocation += ":" + columnNumber; + } + } + } + + var line = ""; + var functionName = this.getFunctionName(); + var addSuffix = true; + var isConstructor = this.isConstructor(); + var isMethodCall = !(this.isToplevel() || isConstructor); + if (isMethodCall) { + var typeName = this.getTypeName(); + // Fixes shim to be backward compatable with Node v0 to v4 + if (typeName === "[object Object]") { + typeName = "null"; + } + var methodName = this.getMethodName(); + if (functionName) { + if (typeName && functionName.indexOf(typeName) != 0) { + line += typeName + "."; + } + line += functionName; + if (methodName && functionName.indexOf("." + methodName) != functionName.length - methodName.length - 1) { + line += " [as " + methodName + "]"; + } + } else { + line += typeName + "." + (methodName || "<anonymous>"); + } + } else if (isConstructor) { + line += "new " + (functionName || "<anonymous>"); + } else if (functionName) { + line += functionName; + } else { + line += fileLocation; + addSuffix = false; + } + if (addSuffix) { + line += " (" + fileLocation + ")"; + } + return line; +} + +function cloneCallSite(frame) { + var object = {}; + Object.getOwnPropertyNames(Object.getPrototypeOf(frame)).forEach(function(name) { + object[name] = /^(?:is|get)/.test(name) ? function() { return frame[name].call(frame); } : frame[name]; + }); + object.toString = CallSiteToString; + return object; +} + +function wrapCallSite(frame) { + if(frame.isNative()) { + return frame; + } + + // Most call sites will return the source file from getFileName(), but code + // passed to eval() ending in "//# sourceURL=..." will return the source file + // from getScriptNameOrSourceURL() instead + var source = frame.getFileName() || frame.getScriptNameOrSourceURL(); + if (source) { + var line = frame.getLineNumber(); + var column = frame.getColumnNumber() - 1; + + // Fix position in Node where some (internal) code is prepended. + // See https://github.com/evanw/node-source-map-support/issues/36 + var headerLength = 62; + if (line === 1 && column > headerLength && !isInBrowser() && !frame.isEval()) { + column -= headerLength; + } + + var position = mapSourcePosition({ + source: source, + line: line, + column: column + }); + frame = cloneCallSite(frame); + frame.getFileName = function() { return position.source; }; + frame.getLineNumber = function() { return position.line; }; + frame.getColumnNumber = function() { return position.column + 1; }; + frame.getScriptNameOrSourceURL = function() { return position.source; }; + return frame; + } + + // Code called using eval() needs special handling + var origin = frame.isEval() && frame.getEvalOrigin(); + if (origin) { + origin = mapEvalOrigin(origin); + frame = cloneCallSite(frame); + frame.getEvalOrigin = function() { return origin; }; + return frame; + } + + // If we get here then we were unable to change the source position + return frame; +} + +// This function is part of the V8 stack trace API, for more info see: +// http://code.google.com/p/v8/wiki/JavaScriptStackTraceApi +function prepareStackTrace(error, stack) { + if (emptyCacheBetweenOperations) { + fileContentsCache = {}; + sourceMapCache = {}; + } + + return error + stack.map(function(frame) { + return '\n at ' + wrapCallSite(frame); + }).join(''); +} + +// Generate position and snippet of original source with pointer +function getErrorSource(error) { + var match = /\n at [^(]+ \((.*):(\d+):(\d+)\)/.exec(error.stack); + if (match) { + var source = match[1]; + var line = +match[2]; + var column = +match[3]; + + // Support the inline sourceContents inside the source map + var contents = fileContentsCache[source]; + + // Support files on disk + if (!contents && fs && fs.existsSync(source)) { + try { + contents = fs.readFileSync(source, 'utf8'); + } catch (er) { + contents = ''; + } + } + + // Format the line from the original source code like node does + if (contents) { + var code = contents.split(/(?:\r\n|\r|\n)/)[line - 1]; + if (code) { + return source + ':' + line + '\n' + code + '\n' + + new Array(column).join(' ') + '^'; + } + } + } + return null; +} + +function printErrorAndExit (error) { + var source = getErrorSource(error); + + if (source) { + console.error(); + console.error(source); + } + + console.error(error.stack); + process.exit(1); +} + +function shimEmitUncaughtException () { + var origEmit = process.emit; + + process.emit = function (type) { + if (type === 'uncaughtException') { + var hasStack = (arguments[1] && arguments[1].stack); + var hasListeners = (this.listeners(type).length > 0); + + if (hasStack && !hasListeners) { + return printErrorAndExit(arguments[1]); + } + } + + return origEmit.apply(this, arguments); + }; +} + +exports.wrapCallSite = wrapCallSite; +exports.getErrorSource = getErrorSource; +exports.mapSourcePosition = mapSourcePosition; +exports.retrieveSourceMap = retrieveSourceMap; + +exports.install = function(options) { + options = options || {}; + + if (options.environment) { + environment = options.environment; + if (["node", "browser", "auto"].indexOf(environment) === -1) { + throw new Error("environment " + environment + " was unknown. Available options are {auto, browser, node}") + } + } + + // Allow sources to be found by methods other than reading the files + // directly from disk. + if (options.retrieveFile) { + if (options.overrideRetrieveFile) { + retrieveFileHandlers.length = 0; + } + + retrieveFileHandlers.unshift(options.retrieveFile); + } + + // Allow source maps to be found by methods other than reading the files + // directly from disk. + if (options.retrieveSourceMap) { + if (options.overrideRetrieveSourceMap) { + retrieveMapHandlers.length = 0; + } + + retrieveMapHandlers.unshift(options.retrieveSourceMap); + } + + // Support runtime transpilers that include inline source maps + if (options.hookRequire && !isInBrowser()) { + var Module; + try { + Module = require('module'); + } catch (err) { + // NOP: Loading in catch block to convert webpack error to warning. + } + var $compile = Module.prototype._compile; + + if (!$compile.__sourceMapSupport) { + Module.prototype._compile = function(content, filename) { + fileContentsCache[filename] = content; + sourceMapCache[filename] = undefined; + return $compile.call(this, content, filename); + }; + + Module.prototype._compile.__sourceMapSupport = true; + } + } + + // Configure options + if (!emptyCacheBetweenOperations) { + emptyCacheBetweenOperations = 'emptyCacheBetweenOperations' in options ? + options.emptyCacheBetweenOperations : false; + } + + // Install the error reformatter + if (!errorFormatterInstalled) { + errorFormatterInstalled = true; + Error.prepareStackTrace = prepareStackTrace; + } + + if (!uncaughtShimInstalled) { + var installHandler = 'handleUncaughtExceptions' in options ? + options.handleUncaughtExceptions : true; + + // Provide the option to not install the uncaught exception handler. This is + // to support other uncaught exception handlers (in test frameworks, for + // example). If this handler is not installed and there are no other uncaught + // exception handlers, uncaught exceptions will be caught by node's built-in + // exception handler and the process will still be terminated. However, the + // generated JavaScript code will be shown above the stack trace instead of + // the original source code. + if (installHandler && hasGlobalProcessEventEmitter()) { + uncaughtShimInstalled = true; + shimEmitUncaughtException(); + } + } +}; diff --git a/node_modules/ava/node_modules/source-map/CHANGELOG.md b/node_modules/ava/node_modules/source-map/CHANGELOG.md new file mode 100644 index 000000000..3a8c066c6 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/CHANGELOG.md @@ -0,0 +1,301 @@ +# Change Log + +## 0.5.6 + +* Fix for regression when people were using numbers as names in source maps. See + #236. + +## 0.5.5 + +* Fix "regression" of unsupported, implementation behavior that half the world + happens to have come to depend on. See #235. + +* Fix regression involving function hoisting in SpiderMonkey. See #233. + +## 0.5.4 + +* Large performance improvements to source-map serialization. See #228 and #229. + +## 0.5.3 + +* Do not include unnecessary distribution files. See + commit ef7006f8d1647e0a83fdc60f04f5a7ca54886f86. + +## 0.5.2 + +* Include browser distributions of the library in package.json's `files`. See + issue #212. + +## 0.5.1 + +* Fix latent bugs in IndexedSourceMapConsumer.prototype._parseMappings. See + ff05274becc9e6e1295ed60f3ea090d31d843379. + +## 0.5.0 + +* Node 0.8 is no longer supported. + +* Use webpack instead of dryice for bundling. + +* Big speedups serializing source maps. See pull request #203. + +* Fix a bug with `SourceMapConsumer.prototype.sourceContentFor` and sources that + explicitly start with the source root. See issue #199. + +## 0.4.4 + +* Fix an issue where using a `SourceMapGenerator` after having created a + `SourceMapConsumer` from it via `SourceMapConsumer.fromSourceMap` failed. See + issue #191. + +* Fix an issue with where `SourceMapGenerator` would mistakenly consider + different mappings as duplicates of each other and avoid generating them. See + issue #192. + +## 0.4.3 + +* A very large number of performance improvements, particularly when parsing + source maps. Collectively about 75% of time shaved off of the source map + parsing benchmark! + +* Fix a bug in `SourceMapConsumer.prototype.allGeneratedPositionsFor` and fuzzy + searching in the presence of a column option. See issue #177. + +* Fix a bug with joining a source and its source root when the source is above + the root. See issue #182. + +* Add the `SourceMapConsumer.prototype.hasContentsOfAllSources` method to + determine when all sources' contents are inlined into the source map. See + issue #190. + +## 0.4.2 + +* Add an `.npmignore` file so that the benchmarks aren't pulled down by + dependent projects. Issue #169. + +* Add an optional `column` argument to + `SourceMapConsumer.prototype.allGeneratedPositionsFor` and better handle lines + with no mappings. Issues #172 and #173. + +## 0.4.1 + +* Fix accidentally defining a global variable. #170. + +## 0.4.0 + +* The default direction for fuzzy searching was changed back to its original + direction. See #164. + +* There is now a `bias` option you can supply to `SourceMapConsumer` to control + the fuzzy searching direction. See #167. + +* About an 8% speed up in parsing source maps. See #159. + +* Added a benchmark for parsing and generating source maps. + +## 0.3.0 + +* Change the default direction that searching for positions fuzzes when there is + not an exact match. See #154. + +* Support for environments using json2.js for JSON serialization. See #156. + +## 0.2.0 + +* Support for consuming "indexed" source maps which do not have any remote + sections. See pull request #127. This introduces a minor backwards + incompatibility if you are monkey patching `SourceMapConsumer.prototype` + methods. + +## 0.1.43 + +* Performance improvements for `SourceMapGenerator` and `SourceNode`. See issue + #148 for some discussion and issues #150, #151, and #152 for implementations. + +## 0.1.42 + +* Fix an issue where `SourceNode`s from different versions of the source-map + library couldn't be used in conjunction with each other. See issue #142. + +## 0.1.41 + +* Fix a bug with getting the source content of relative sources with a "./" + prefix. See issue #145 and [Bug 1090768](bugzil.la/1090768). + +* Add the `SourceMapConsumer.prototype.computeColumnSpans` method to compute the + column span of each mapping. + +* Add the `SourceMapConsumer.prototype.allGeneratedPositionsFor` method to find + all generated positions associated with a given original source and line. + +## 0.1.40 + +* Performance improvements for parsing source maps in SourceMapConsumer. + +## 0.1.39 + +* Fix a bug where setting a source's contents to null before any source content + had been set before threw a TypeError. See issue #131. + +## 0.1.38 + +* Fix a bug where finding relative paths from an empty path were creating + absolute paths. See issue #129. + +## 0.1.37 + +* Fix a bug where if the source root was an empty string, relative source paths + would turn into absolute source paths. Issue #124. + +## 0.1.36 + +* Allow the `names` mapping property to be an empty string. Issue #121. + +## 0.1.35 + +* A third optional parameter was added to `SourceNode.fromStringWithSourceMap` + to specify a path that relative sources in the second parameter should be + relative to. Issue #105. + +* If no file property is given to a `SourceMapGenerator`, then the resulting + source map will no longer have a `null` file property. The property will + simply not exist. Issue #104. + +* Fixed a bug where consecutive newlines were ignored in `SourceNode`s. + Issue #116. + +## 0.1.34 + +* Make `SourceNode` work with windows style ("\r\n") newlines. Issue #103. + +* Fix bug involving source contents and the + `SourceMapGenerator.prototype.applySourceMap`. Issue #100. + +## 0.1.33 + +* Fix some edge cases surrounding path joining and URL resolution. + +* Add a third parameter for relative path to + `SourceMapGenerator.prototype.applySourceMap`. + +* Fix issues with mappings and EOLs. + +## 0.1.32 + +* Fixed a bug where SourceMapConsumer couldn't handle negative relative columns + (issue 92). + +* Fixed test runner to actually report number of failed tests as its process + exit code. + +* Fixed a typo when reporting bad mappings (issue 87). + +## 0.1.31 + +* Delay parsing the mappings in SourceMapConsumer until queried for a source + location. + +* Support Sass source maps (which at the time of writing deviate from the spec + in small ways) in SourceMapConsumer. + +## 0.1.30 + +* Do not join source root with a source, when the source is a data URI. + +* Extend the test runner to allow running single specific test files at a time. + +* Performance improvements in `SourceNode.prototype.walk` and + `SourceMapConsumer.prototype.eachMapping`. + +* Source map browser builds will now work inside Workers. + +* Better error messages when attempting to add an invalid mapping to a + `SourceMapGenerator`. + +## 0.1.29 + +* Allow duplicate entries in the `names` and `sources` arrays of source maps + (usually from TypeScript) we are parsing. Fixes github issue 72. + +## 0.1.28 + +* Skip duplicate mappings when creating source maps from SourceNode; github + issue 75. + +## 0.1.27 + +* Don't throw an error when the `file` property is missing in SourceMapConsumer, + we don't use it anyway. + +## 0.1.26 + +* Fix SourceNode.fromStringWithSourceMap for empty maps. Fixes github issue 70. + +## 0.1.25 + +* Make compatible with browserify + +## 0.1.24 + +* Fix issue with absolute paths and `file://` URIs. See + https://bugzilla.mozilla.org/show_bug.cgi?id=885597 + +## 0.1.23 + +* Fix issue with absolute paths and sourcesContent, github issue 64. + +## 0.1.22 + +* Ignore duplicate mappings in SourceMapGenerator. Fixes github issue 21. + +## 0.1.21 + +* Fixed handling of sources that start with a slash so that they are relative to + the source root's host. + +## 0.1.20 + +* Fixed github issue #43: absolute URLs aren't joined with the source root + anymore. + +## 0.1.19 + +* Using Travis CI to run tests. + +## 0.1.18 + +* Fixed a bug in the handling of sourceRoot. + +## 0.1.17 + +* Added SourceNode.fromStringWithSourceMap. + +## 0.1.16 + +* Added missing documentation. + +* Fixed the generating of empty mappings in SourceNode. + +## 0.1.15 + +* Added SourceMapGenerator.applySourceMap. + +## 0.1.14 + +* The sourceRoot is now handled consistently. + +## 0.1.13 + +* Added SourceMapGenerator.fromSourceMap. + +## 0.1.12 + +* SourceNode now generates empty mappings too. + +## 0.1.11 + +* Added name support to SourceNode. + +## 0.1.10 + +* Added sourcesContent support to the customer and generator. diff --git a/node_modules/ava/node_modules/source-map/LICENSE b/node_modules/ava/node_modules/source-map/LICENSE new file mode 100644 index 000000000..ed1b7cf27 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/LICENSE @@ -0,0 +1,28 @@ + +Copyright (c) 2009-2011, Mozilla Foundation and contributors +All rights reserved. + +Redistribution and use in source and binary forms, with or without +modification, are permitted provided that the following conditions are met: + +* Redistributions of source code must retain the above copyright notice, this + list of conditions and the following disclaimer. + +* Redistributions in binary form must reproduce the above copyright notice, + this list of conditions and the following disclaimer in the documentation + and/or other materials provided with the distribution. + +* Neither the names of the Mozilla Foundation nor the names of project + contributors may be used to endorse or promote products derived from this + software without specific prior written permission. + +THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS "AS IS" AND +ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE IMPLIED +WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR PURPOSE ARE +DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT HOLDER OR CONTRIBUTORS BE LIABLE +FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL, EXEMPLARY, OR CONSEQUENTIAL +DAMAGES (INCLUDING, BUT NOT LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR +SERVICES; LOSS OF USE, DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER +CAUSED AND ON ANY THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, +OR TORT (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE +OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. diff --git a/node_modules/ava/node_modules/source-map/README.md b/node_modules/ava/node_modules/source-map/README.md new file mode 100644 index 000000000..fea4beb19 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/README.md @@ -0,0 +1,742 @@ +# Source Map + +[](https://travis-ci.org/mozilla/source-map) + +[](https://www.npmjs.com/package/source-map) + +This is a library to generate and consume the source map format +[described here][format]. + +[format]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit + +## Use with Node + + $ npm install source-map + +## Use on the Web + + <script src="https://raw.githubusercontent.com/mozilla/source-map/master/dist/source-map.min.js" defer></script> + +-------------------------------------------------------------------------------- + +<!-- `npm run toc` to regenerate the Table of Contents --> + +<!-- START doctoc generated TOC please keep comment here to allow auto update --> +<!-- DON'T EDIT THIS SECTION, INSTEAD RE-RUN doctoc TO UPDATE --> +## Table of Contents + +- [Examples](#examples) + - [Consuming a source map](#consuming-a-source-map) + - [Generating a source map](#generating-a-source-map) + - [With SourceNode (high level API)](#with-sourcenode-high-level-api) + - [With SourceMapGenerator (low level API)](#with-sourcemapgenerator-low-level-api) +- [API](#api) + - [SourceMapConsumer](#sourcemapconsumer) + - [new SourceMapConsumer(rawSourceMap)](#new-sourcemapconsumerrawsourcemap) + - [SourceMapConsumer.prototype.computeColumnSpans()](#sourcemapconsumerprototypecomputecolumnspans) + - [SourceMapConsumer.prototype.originalPositionFor(generatedPosition)](#sourcemapconsumerprototypeoriginalpositionforgeneratedposition) + - [SourceMapConsumer.prototype.generatedPositionFor(originalPosition)](#sourcemapconsumerprototypegeneratedpositionfororiginalposition) + - [SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition)](#sourcemapconsumerprototypeallgeneratedpositionsfororiginalposition) + - [SourceMapConsumer.prototype.hasContentsOfAllSources()](#sourcemapconsumerprototypehascontentsofallsources) + - [SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing])](#sourcemapconsumerprototypesourcecontentforsource-returnnullonmissing) + - [SourceMapConsumer.prototype.eachMapping(callback, context, order)](#sourcemapconsumerprototypeeachmappingcallback-context-order) + - [SourceMapGenerator](#sourcemapgenerator) + - [new SourceMapGenerator([startOfSourceMap])](#new-sourcemapgeneratorstartofsourcemap) + - [SourceMapGenerator.fromSourceMap(sourceMapConsumer)](#sourcemapgeneratorfromsourcemapsourcemapconsumer) + - [SourceMapGenerator.prototype.addMapping(mapping)](#sourcemapgeneratorprototypeaddmappingmapping) + - [SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent)](#sourcemapgeneratorprototypesetsourcecontentsourcefile-sourcecontent) + - [SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]])](#sourcemapgeneratorprototypeapplysourcemapsourcemapconsumer-sourcefile-sourcemappath) + - [SourceMapGenerator.prototype.toString()](#sourcemapgeneratorprototypetostring) + - [SourceNode](#sourcenode) + - [new SourceNode([line, column, source[, chunk[, name]]])](#new-sourcenodeline-column-source-chunk-name) + - [SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath])](#sourcenodefromstringwithsourcemapcode-sourcemapconsumer-relativepath) + - [SourceNode.prototype.add(chunk)](#sourcenodeprototypeaddchunk) + - [SourceNode.prototype.prepend(chunk)](#sourcenodeprototypeprependchunk) + - [SourceNode.prototype.setSourceContent(sourceFile, sourceContent)](#sourcenodeprototypesetsourcecontentsourcefile-sourcecontent) + - [SourceNode.prototype.walk(fn)](#sourcenodeprototypewalkfn) + - [SourceNode.prototype.walkSourceContents(fn)](#sourcenodeprototypewalksourcecontentsfn) + - [SourceNode.prototype.join(sep)](#sourcenodeprototypejoinsep) + - [SourceNode.prototype.replaceRight(pattern, replacement)](#sourcenodeprototypereplacerightpattern-replacement) + - [SourceNode.prototype.toString()](#sourcenodeprototypetostring) + - [SourceNode.prototype.toStringWithSourceMap([startOfSourceMap])](#sourcenodeprototypetostringwithsourcemapstartofsourcemap) + +<!-- END doctoc generated TOC please keep comment here to allow auto update --> + +## Examples + +### Consuming a source map + +```js +var rawSourceMap = { + version: 3, + file: 'min.js', + names: ['bar', 'baz', 'n'], + sources: ['one.js', 'two.js'], + sourceRoot: 'http://example.com/www/js/', + mappings: 'CAAC,IAAI,IAAM,SAAUA,GAClB,OAAOC,IAAID;CCDb,IAAI,IAAM,SAAUE,GAClB,OAAOA' +}; + +var smc = new SourceMapConsumer(rawSourceMap); + +console.log(smc.sources); +// [ 'http://example.com/www/js/one.js', +// 'http://example.com/www/js/two.js' ] + +console.log(smc.originalPositionFor({ + line: 2, + column: 28 +})); +// { source: 'http://example.com/www/js/two.js', +// line: 2, +// column: 10, +// name: 'n' } + +console.log(smc.generatedPositionFor({ + source: 'http://example.com/www/js/two.js', + line: 2, + column: 10 +})); +// { line: 2, column: 28 } + +smc.eachMapping(function (m) { + // ... +}); +``` + +### Generating a source map + +In depth guide: +[**Compiling to JavaScript, and Debugging with Source Maps**](https://hacks.mozilla.org/2013/05/compiling-to-javascript-and-debugging-with-source-maps/) + +#### With SourceNode (high level API) + +```js +function compile(ast) { + switch (ast.type) { + case 'BinaryExpression': + return new SourceNode( + ast.location.line, + ast.location.column, + ast.location.source, + [compile(ast.left), " + ", compile(ast.right)] + ); + case 'Literal': + return new SourceNode( + ast.location.line, + ast.location.column, + ast.location.source, + String(ast.value) + ); + // ... + default: + throw new Error("Bad AST"); + } +} + +var ast = parse("40 + 2", "add.js"); +console.log(compile(ast).toStringWithSourceMap({ + file: 'add.js' +})); +// { code: '40 + 2', +// map: [object SourceMapGenerator] } +``` + +#### With SourceMapGenerator (low level API) + +```js +var map = new SourceMapGenerator({ + file: "source-mapped.js" +}); + +map.addMapping({ + generated: { + line: 10, + column: 35 + }, + source: "foo.js", + original: { + line: 33, + column: 2 + }, + name: "christopher" +}); + +console.log(map.toString()); +// '{"version":3,"file":"source-mapped.js","sources":["foo.js"],"names":["christopher"],"mappings":";;;;;;;;;mCAgCEA"}' +``` + +## API + +Get a reference to the module: + +```js +// Node.js +var sourceMap = require('source-map'); + +// Browser builds +var sourceMap = window.sourceMap; + +// Inside Firefox +const sourceMap = require("devtools/toolkit/sourcemap/source-map.js"); +``` + +### SourceMapConsumer + +A SourceMapConsumer instance represents a parsed source map which we can query +for information about the original file positions by giving it a file position +in the generated source. + +#### new SourceMapConsumer(rawSourceMap) + +The only parameter is the raw source map (either as a string which can be +`JSON.parse`'d, or an object). According to the spec, source maps have the +following attributes: + +* `version`: Which version of the source map spec this map is following. + +* `sources`: An array of URLs to the original source files. + +* `names`: An array of identifiers which can be referenced by individual + mappings. + +* `sourceRoot`: Optional. The URL root from which all sources are relative. + +* `sourcesContent`: Optional. An array of contents of the original source files. + +* `mappings`: A string of base64 VLQs which contain the actual mappings. + +* `file`: Optional. The generated filename this source map is associated with. + +```js +var consumer = new sourceMap.SourceMapConsumer(rawSourceMapJsonData); +``` + +#### SourceMapConsumer.prototype.computeColumnSpans() + +Compute the last column for each generated mapping. The last column is +inclusive. + +```js +// Before: +consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1 }, +// { line: 2, +// column: 10 }, +// { line: 2, +// column: 20 } ] + +consumer.computeColumnSpans(); + +// After: +consumer.allGeneratedPositionsFor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1, +// lastColumn: 9 }, +// { line: 2, +// column: 10, +// lastColumn: 19 }, +// { line: 2, +// column: 20, +// lastColumn: Infinity } ] + +``` + +#### SourceMapConsumer.prototype.originalPositionFor(generatedPosition) + +Returns the original source, line, and column information for the generated +source's line and column positions provided. The only argument is an object with +the following properties: + +* `line`: The line number in the generated source. Line numbers in + this library are 1-based (note that the underlying source map + specification uses 0-based line numbers -- this library handles the + translation). + +* `column`: The column number in the generated source. Column numbers + in this library are 0-based. + +* `bias`: Either `SourceMapConsumer.GREATEST_LOWER_BOUND` or + `SourceMapConsumer.LEAST_UPPER_BOUND`. Specifies whether to return the closest + element that is smaller than or greater than the one we are searching for, + respectively, if the exact element cannot be found. Defaults to + `SourceMapConsumer.GREATEST_LOWER_BOUND`. + +and an object is returned with the following properties: + +* `source`: The original source file, or null if this information is not + available. + +* `line`: The line number in the original source, or null if this information is + not available. The line number is 1-based. + +* `column`: The column number in the original source, or null if this + information is not available. The column number is 0-based. + +* `name`: The original identifier, or null if this information is not available. + +```js +consumer.originalPositionFor({ line: 2, column: 10 }) +// { source: 'foo.coffee', +// line: 2, +// column: 2, +// name: null } + +consumer.originalPositionFor({ line: 99999999999999999, column: 999999999999999 }) +// { source: null, +// line: null, +// column: null, +// name: null } +``` + +#### SourceMapConsumer.prototype.generatedPositionFor(originalPosition) + +Returns the generated line and column information for the original source, +line, and column positions provided. The only argument is an object with +the following properties: + +* `source`: The filename of the original source. + +* `line`: The line number in the original source. The line number is + 1-based. + +* `column`: The column number in the original source. The column + number is 0-based. + +and an object is returned with the following properties: + +* `line`: The line number in the generated source, or null. The line + number is 1-based. + +* `column`: The column number in the generated source, or null. The + column number is 0-based. + +```js +consumer.generatedPositionFor({ source: "example.js", line: 2, column: 10 }) +// { line: 1, +// column: 56 } +``` + +#### SourceMapConsumer.prototype.allGeneratedPositionsFor(originalPosition) + +Returns all generated line and column information for the original source, line, +and column provided. If no column is provided, returns all mappings +corresponding to a either the line we are searching for or the next closest line +that has any mappings. Otherwise, returns all mappings corresponding to the +given line and either the column we are searching for or the next closest column +that has any offsets. + +The only argument is an object with the following properties: + +* `source`: The filename of the original source. + +* `line`: The line number in the original source. The line number is + 1-based. + +* `column`: Optional. The column number in the original source. The + column number is 0-based. + +and an array of objects is returned, each with the following properties: + +* `line`: The line number in the generated source, or null. The line + number is 1-based. + +* `column`: The column number in the generated source, or null. The + column number is 0-based. + +```js +consumer.allGeneratedpositionsfor({ line: 2, source: "foo.coffee" }) +// [ { line: 2, +// column: 1 }, +// { line: 2, +// column: 10 }, +// { line: 2, +// column: 20 } ] +``` + +#### SourceMapConsumer.prototype.hasContentsOfAllSources() + +Return true if we have the embedded source content for every source listed in +the source map, false otherwise. + +In other words, if this method returns `true`, then +`consumer.sourceContentFor(s)` will succeed for every source `s` in +`consumer.sources`. + +```js +// ... +if (consumer.hasContentsOfAllSources()) { + consumerReadyCallback(consumer); +} else { + fetchSources(consumer, consumerReadyCallback); +} +// ... +``` + +#### SourceMapConsumer.prototype.sourceContentFor(source[, returnNullOnMissing]) + +Returns the original source content for the source provided. The only +argument is the URL of the original source file. + +If the source content for the given source is not found, then an error is +thrown. Optionally, pass `true` as the second param to have `null` returned +instead. + +```js +consumer.sources +// [ "my-cool-lib.clj" ] + +consumer.sourceContentFor("my-cool-lib.clj") +// "..." + +consumer.sourceContentFor("this is not in the source map"); +// Error: "this is not in the source map" is not in the source map + +consumer.sourceContentFor("this is not in the source map", true); +// null +``` + +#### SourceMapConsumer.prototype.eachMapping(callback, context, order) + +Iterate over each mapping between an original source/line/column and a +generated line/column in this source map. + +* `callback`: The function that is called with each mapping. Mappings have the + form `{ source, generatedLine, generatedColumn, originalLine, originalColumn, + name }` + +* `context`: Optional. If specified, this object will be the value of `this` + every time that `callback` is called. + +* `order`: Either `SourceMapConsumer.GENERATED_ORDER` or + `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to iterate over + the mappings sorted by the generated file's line/column order or the + original's source/line/column order, respectively. Defaults to + `SourceMapConsumer.GENERATED_ORDER`. + +```js +consumer.eachMapping(function (m) { console.log(m); }) +// ... +// { source: 'illmatic.js', +// generatedLine: 1, +// generatedColumn: 0, +// originalLine: 1, +// originalColumn: 0, +// name: null } +// { source: 'illmatic.js', +// generatedLine: 2, +// generatedColumn: 0, +// originalLine: 2, +// originalColumn: 0, +// name: null } +// ... +``` +### SourceMapGenerator + +An instance of the SourceMapGenerator represents a source map which is being +built incrementally. + +#### new SourceMapGenerator([startOfSourceMap]) + +You may pass an object with the following properties: + +* `file`: The filename of the generated source that this source map is + associated with. + +* `sourceRoot`: A root for all relative URLs in this source map. + +* `skipValidation`: Optional. When `true`, disables validation of mappings as + they are added. This can improve performance but should be used with + discretion, as a last resort. Even then, one should avoid using this flag when + running tests, if possible. + +```js +var generator = new sourceMap.SourceMapGenerator({ + file: "my-generated-javascript-file.js", + sourceRoot: "http://example.com/app/js/" +}); +``` + +#### SourceMapGenerator.fromSourceMap(sourceMapConsumer) + +Creates a new `SourceMapGenerator` from an existing `SourceMapConsumer` instance. + +* `sourceMapConsumer` The SourceMap. + +```js +var generator = sourceMap.SourceMapGenerator.fromSourceMap(consumer); +``` + +#### SourceMapGenerator.prototype.addMapping(mapping) + +Add a single mapping from original source line and column to the generated +source's line and column for this source map being created. The mapping object +should have the following properties: + +* `generated`: An object with the generated line and column positions. + +* `original`: An object with the original line and column positions. + +* `source`: The original source file (relative to the sourceRoot). + +* `name`: An optional original token name for this mapping. + +```js +generator.addMapping({ + source: "module-one.scm", + original: { line: 128, column: 0 }, + generated: { line: 3, column: 456 } +}) +``` + +#### SourceMapGenerator.prototype.setSourceContent(sourceFile, sourceContent) + +Set the source content for an original source file. + +* `sourceFile` the URL of the original source file. + +* `sourceContent` the content of the source file. + +```js +generator.setSourceContent("module-one.scm", + fs.readFileSync("path/to/module-one.scm")) +``` + +#### SourceMapGenerator.prototype.applySourceMap(sourceMapConsumer[, sourceFile[, sourceMapPath]]) + +Applies a SourceMap for a source file to the SourceMap. +Each mapping to the supplied source file is rewritten using the +supplied SourceMap. Note: The resolution for the resulting mappings +is the minimum of this map and the supplied map. + +* `sourceMapConsumer`: The SourceMap to be applied. + +* `sourceFile`: Optional. The filename of the source file. + If omitted, sourceMapConsumer.file will be used, if it exists. + Otherwise an error will be thrown. + +* `sourceMapPath`: Optional. The dirname of the path to the SourceMap + to be applied. If relative, it is relative to the SourceMap. + + This parameter is needed when the two SourceMaps aren't in the same + directory, and the SourceMap to be applied contains relative source + paths. If so, those relative source paths need to be rewritten + relative to the SourceMap. + + If omitted, it is assumed that both SourceMaps are in the same directory, + thus not needing any rewriting. (Supplying `'.'` has the same effect.) + +#### SourceMapGenerator.prototype.toString() + +Renders the source map being generated to a string. + +```js +generator.toString() +// '{"version":3,"sources":["module-one.scm"],"names":[],"mappings":"...snip...","file":"my-generated-javascript-file.js","sourceRoot":"http://example.com/app/js/"}' +``` + +### SourceNode + +SourceNodes provide a way to abstract over interpolating and/or concatenating +snippets of generated JavaScript source code, while maintaining the line and +column information associated between those snippets and the original source +code. This is useful as the final intermediate representation a compiler might +use before outputting the generated JS and source map. + +#### new SourceNode([line, column, source[, chunk[, name]]]) + +* `line`: The original line number associated with this source node, or null if + it isn't associated with an original line. The line number is 1-based. + +* `column`: The original column number associated with this source node, or null + if it isn't associated with an original column. The column number + is 0-based. + +* `source`: The original source's filename; null if no filename is provided. + +* `chunk`: Optional. Is immediately passed to `SourceNode.prototype.add`, see + below. + +* `name`: Optional. The original identifier. + +```js +var node = new SourceNode(1, 2, "a.cpp", [ + new SourceNode(3, 4, "b.cpp", "extern int status;\n"), + new SourceNode(5, 6, "c.cpp", "std::string* make_string(size_t n);\n"), + new SourceNode(7, 8, "d.cpp", "int main(int argc, char** argv) {}\n"), +]); +``` + +#### SourceNode.fromStringWithSourceMap(code, sourceMapConsumer[, relativePath]) + +Creates a SourceNode from generated code and a SourceMapConsumer. + +* `code`: The generated code + +* `sourceMapConsumer` The SourceMap for the generated code + +* `relativePath` The optional path that relative sources in `sourceMapConsumer` + should be relative to. + +```js +var consumer = new SourceMapConsumer(fs.readFileSync("path/to/my-file.js.map", "utf8")); +var node = SourceNode.fromStringWithSourceMap(fs.readFileSync("path/to/my-file.js"), + consumer); +``` + +#### SourceNode.prototype.add(chunk) + +Add a chunk of generated JS to this source node. + +* `chunk`: A string snippet of generated JS code, another instance of + `SourceNode`, or an array where each member is one of those things. + +```js +node.add(" + "); +node.add(otherNode); +node.add([leftHandOperandNode, " + ", rightHandOperandNode]); +``` + +#### SourceNode.prototype.prepend(chunk) + +Prepend a chunk of generated JS to this source node. + +* `chunk`: A string snippet of generated JS code, another instance of + `SourceNode`, or an array where each member is one of those things. + +```js +node.prepend("/** Build Id: f783haef86324gf **/\n\n"); +``` + +#### SourceNode.prototype.setSourceContent(sourceFile, sourceContent) + +Set the source content for a source file. This will be added to the +`SourceMap` in the `sourcesContent` field. + +* `sourceFile`: The filename of the source file + +* `sourceContent`: The content of the source file + +```js +node.setSourceContent("module-one.scm", + fs.readFileSync("path/to/module-one.scm")) +``` + +#### SourceNode.prototype.walk(fn) + +Walk over the tree of JS snippets in this node and its children. The walking +function is called once for each snippet of JS and is passed that snippet and +the its original associated source's line/column location. + +* `fn`: The traversal function. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.walk(function (code, loc) { console.log("WALK:", code, loc); }) +// WALK: uno { source: 'b.js', line: 3, column: 4, name: null } +// WALK: dos { source: 'a.js', line: 1, column: 2, name: null } +// WALK: tres { source: 'a.js', line: 1, column: 2, name: null } +// WALK: quatro { source: 'c.js', line: 5, column: 6, name: null } +``` + +#### SourceNode.prototype.walkSourceContents(fn) + +Walk over the tree of SourceNodes. The walking function is called for each +source file content and is passed the filename and source content. + +* `fn`: The traversal function. + +```js +var a = new SourceNode(1, 2, "a.js", "generated from a"); +a.setSourceContent("a.js", "original a"); +var b = new SourceNode(1, 2, "b.js", "generated from b"); +b.setSourceContent("b.js", "original b"); +var c = new SourceNode(1, 2, "c.js", "generated from c"); +c.setSourceContent("c.js", "original c"); + +var node = new SourceNode(null, null, null, [a, b, c]); +node.walkSourceContents(function (source, contents) { console.log("WALK:", source, ":", contents); }) +// WALK: a.js : original a +// WALK: b.js : original b +// WALK: c.js : original c +``` + +#### SourceNode.prototype.join(sep) + +Like `Array.prototype.join` except for SourceNodes. Inserts the separator +between each of this source node's children. + +* `sep`: The separator. + +```js +var lhs = new SourceNode(1, 2, "a.rs", "my_copy"); +var operand = new SourceNode(3, 4, "a.rs", "="); +var rhs = new SourceNode(5, 6, "a.rs", "orig.clone()"); + +var node = new SourceNode(null, null, null, [ lhs, operand, rhs ]); +var joinedNode = node.join(" "); +``` + +#### SourceNode.prototype.replaceRight(pattern, replacement) + +Call `String.prototype.replace` on the very right-most source snippet. Useful +for trimming white space from the end of a source node, etc. + +* `pattern`: The pattern to replace. + +* `replacement`: The thing to replace the pattern with. + +```js +// Trim trailing white space. +node.replaceRight(/\s*$/, ""); +``` + +#### SourceNode.prototype.toString() + +Return the string representation of this source node. Walks over the tree and +concatenates all the various snippets together to one string. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.toString() +// 'unodostresquatro' +``` + +#### SourceNode.prototype.toStringWithSourceMap([startOfSourceMap]) + +Returns the string representation of this tree of source nodes, plus a +SourceMapGenerator which contains all the mappings between the generated and +original sources. + +The arguments are the same as those to `new SourceMapGenerator`. + +```js +var node = new SourceNode(1, 2, "a.js", [ + new SourceNode(3, 4, "b.js", "uno"), + "dos", + [ + "tres", + new SourceNode(5, 6, "c.js", "quatro") + ] +]); + +node.toStringWithSourceMap({ file: "my-output-file.js" }) +// { code: 'unodostresquatro', +// map: [object SourceMapGenerator] } +``` diff --git a/node_modules/ava/node_modules/source-map/dist/source-map.debug.js b/node_modules/ava/node_modules/source-map/dist/source-map.debug.js new file mode 100644 index 000000000..aad0620d7 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/dist/source-map.debug.js @@ -0,0 +1,3234 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["sourceMap"] = factory(); + else + root["sourceMap"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; +/******/ +/******/ // The require function +/******/ function __webpack_require__(moduleId) { +/******/ +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; +/******/ +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; +/******/ +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); +/******/ +/******/ // Flag the module as loaded +/******/ module.loaded = true; +/******/ +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } +/******/ +/******/ +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; +/******/ +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; +/******/ +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; +/******/ +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + /* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ + exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer; + exports.SourceNode = __webpack_require__(10).SourceNode; + + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var base64VLQ = __webpack_require__(2); + var util = __webpack_require__(4); + var ArraySet = __webpack_require__(5).ArraySet; + var MappingList = __webpack_require__(6).MappingList; + + /** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ + function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; + } + + SourceMapGenerator.prototype._version = 3; + + /** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ + SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + + /** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ + SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + + /** + * Set the source content for a source file. + */ + SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + + /** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ + SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + + /** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ + SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + + /** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ + SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + + SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + + /** + * Externalize the source map. + */ + SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + + /** + * Render the source map being generated to a string. + */ + SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + + exports.SourceMapGenerator = SourceMapGenerator; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + + var base64 = __webpack_require__(3); + + // A single base 64 digit can contain 6 bits of data. For the base 64 variable + // length quantities we use in the source map spec, the first bit is the sign, + // the next four bits are the actual value, and the 6th bit is the + // continuation bit. The continuation bit tells us whether there are more + // digits in this value following this digit. + // + // Continuation + // | Sign + // | | + // V V + // 101011 + + var VLQ_BASE_SHIFT = 5; + + // binary: 100000 + var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + + // binary: 011111 + var VLQ_BASE_MASK = VLQ_BASE - 1; + + // binary: 100000 + var VLQ_CONTINUATION_BIT = VLQ_BASE; + + /** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ + function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; + } + + /** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ + function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; + } + + /** + * Returns the base 64 VLQ encoded value. + */ + exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; + }; + + /** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ + exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + + /** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ + exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); + }; + + /** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ + exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + /** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ + function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } + } + exports.getArg = getArg; + + var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; + var dataUrlRegexp = /^data:.+\,.+$/; + + function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; + } + exports.urlParse = urlParse; + + function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; + } + exports.urlGenerate = urlGenerate; + + /** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ + function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; + } + exports.normalize = normalize; + + /** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ + function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; + } + exports.join = join; + + exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); + }; + + /** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ + function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); + } + exports.relative = relative; + + var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); + }()); + + function identity (s) { + return s; + } + + /** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ + function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; + } + exports.toSetString = supportsNullProto ? identity : toSetString; + + function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; + } + exports.fromSetString = supportsNullProto ? identity : fromSetString; + + function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; + } + + /** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ + function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByOriginalPositions = compareByOriginalPositions; + + /** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ + function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + + function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; + } + + /** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ + function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + + /** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ + function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); + } + exports.parseSourceMapInput = parseSourceMapInput; + + /** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ + function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); + } + exports.computeSourceURL = computeSourceURL; + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var has = Object.prototype.hasOwnProperty; + var hasNativeMap = typeof Map !== "undefined"; + + /** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ + function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); + } + + /** + * Static method for creating ArraySet instances from an existing array. + */ + ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; + }; + + /** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ + ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; + }; + + /** + * Add the given string to this set. + * + * @param String aStr + */ + ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } + }; + + /** + * Is the given string a member of this set? + * + * @param String aStr + */ + ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } + }; + + /** + * What is the index of the given string in the array? + * + * @param String aStr + */ + ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); + }; + + /** + * What is the element at the given index? + * + * @param Number aIdx + */ + ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); + }; + + /** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ + ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); + }; + + exports.ArraySet = ArraySet; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + + /** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ + function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; + } + + /** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ + function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; + } + + /** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ + MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + + /** + * Add the given source mapping. + * + * @param Object aMapping + */ + MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } + }; + + /** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ + MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; + }; + + exports.MappingList = MappingList; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var binarySearch = __webpack_require__(8); + var ArraySet = __webpack_require__(5).ArraySet; + var base64VLQ = __webpack_require__(2); + var quickSort = __webpack_require__(9).quickSort; + + function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); + } + + SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); + } + + /** + * The version of the source mapping spec that we are consuming. + */ + SourceMapConsumer.prototype._version = 3; + + // `__generatedMappings` and `__originalMappings` are arrays that hold the + // parsed mapping coordinates from the source map's "mappings" attribute. They + // are lazily instantiated, accessed via the `_generatedMappings` and + // `_originalMappings` getters respectively, and we only parse the mappings + // and create these arrays once queried for a source location. We jump through + // these hoops because there can be many thousands of mappings, and parsing + // them is expensive, so we only want to do it if we must. + // + // Each object in the arrays is of the form: + // + // { + // generatedLine: The line number in the generated code, + // generatedColumn: The column number in the generated code, + // source: The path to the original source file that generated this + // chunk of code, + // originalLine: The line number in the original source that + // corresponds to this chunk of generated code, + // originalColumn: The column number in the original source that + // corresponds to this chunk of generated code, + // name: The name of the original symbol which generated this chunk of + // code. + // } + // + // All properties except for `generatedLine` and `generatedColumn` can be + // `null`. + // + // `_generatedMappings` is ordered by the generated positions. + // + // `_originalMappings` is ordered by the original positions. + + SourceMapConsumer.prototype.__generatedMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } + }); + + SourceMapConsumer.prototype.__originalMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } + }); + + SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + + SourceMapConsumer.GENERATED_ORDER = 1; + SourceMapConsumer.ORIGINAL_ORDER = 2; + + SourceMapConsumer.GREATEST_LOWER_BOUND = 1; + SourceMapConsumer.LEAST_UPPER_BOUND = 2; + + /** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ + SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + + /** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + + exports.SourceMapConsumer = SourceMapConsumer; + + /** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ + function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; + } + + BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + + /** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ + BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; + }; + + /** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ + BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + + /** + * The version of the source mapping spec that we are consuming. + */ + BasicSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } + }); + + /** + * Provide the JIT with a nice shape / hidden class. + */ + function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; + } + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + + /** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ + BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + + /** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ + BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + + exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + + /** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ + function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); + } + + IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + + /** + * The version of the source mapping spec that we are consuming. + */ + IndexedSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } + }); + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + + exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + exports.GREATEST_LOWER_BOUND = 1; + exports.LEAST_UPPER_BOUND = 2; + + /** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ + function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } + } + + /** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ + exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + // It turns out that some (most?) JavaScript engines don't self-host + // `Array.prototype.sort`. This makes sense because C++ will likely remain + // faster than JS when doing raw CPU-intensive sorting. However, when using a + // custom comparator function, calling back and forth between the VM's C++ and + // JIT'd JS is rather slow *and* loses JIT type information, resulting in + // worse generated code for the comparator function than would be optimal. In + // fact, when sorting with a comparator, these costs outweigh the benefits of + // sorting in C++. By using our own JS-implemented Quick Sort (below), we get + // a ~3500ms mean speed-up in `bench/bench.html`. + + /** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ + function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; + } + + /** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ + function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); + } + + /** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ + function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } + } + + /** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ + exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + var util = __webpack_require__(4); + + // Matches a Windows-style `\r\n` newline or a `\n` newline used by all other + // operating systems these days (capturing the result). + var REGEX_NEWLINE = /(\r?\n)/; + + // Newline character code for charCodeAt() comparisons + var NEWLINE_CODE = 10; + + // Private symbol for identifying `SourceNode`s when multiple versions of + // the source-map library are loaded. This MUST NOT CHANGE across + // versions! + var isSourceNode = "$$$isSourceNode$$$"; + + /** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ + function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); + } + + /** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ + SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + + /** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } + }; + + /** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ + SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; + }; + + /** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ + SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; + }; + + /** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ + SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + + /** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + + /** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ + SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; + }; + + /** + * Returns the string representation of this source node along with a source + * map. + */ + SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; + }; + + exports.SourceNode = SourceNode; + + +/***/ }) +/******/ ]) +}); +; +//# sourceMappingURL=data:application/json;charset=utf-8;base64,eyJ2ZXJzaW9uIjozLCJzb3VyY2VzIjpbIndlYnBhY2s6Ly8vd2VicGFjay91bml2ZXJzYWxNb2R1bGVEZWZpbml0aW9uIiwid2VicGFjazovLy93ZWJwYWNrL2Jvb3RzdHJhcCAxNjI0YzcyOTliODg3ZjdiZGY2NCIsIndlYnBhY2s6Ly8vLi9zb3VyY2UtbWFwLmpzIiwid2VicGFjazovLy8uL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LXZscS5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmFzZTY0LmpzIiwid2VicGFjazovLy8uL2xpYi91dGlsLmpzIiwid2VicGFjazovLy8uL2xpYi9hcnJheS1zZXQuanMiLCJ3ZWJwYWNrOi8vLy4vbGliL21hcHBpbmctbGlzdC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qcyIsIndlYnBhY2s6Ly8vLi9saWIvYmluYXJ5LXNlYXJjaC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvcXVpY2stc29ydC5qcyIsIndlYnBhY2s6Ly8vLi9saWIvc291cmNlLW5vZGUuanMiXSwibmFtZXMiOltdLCJtYXBwaW5ncyI6IkFBQUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsQ0FBQztBQUNELE87QUNWQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSx1QkFBZTtBQUNmO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7QUFHQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOzs7Ozs7O0FDdENBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNQQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsVUFBUztBQUNUO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBLE1BQUs7QUFDTDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsUUFBTztBQUNQO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLDJDQUEwQyxTQUFTO0FBQ25EO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQ3hhQSxpQkFBZ0Isb0JBQW9CO0FBQ3BDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSw0REFBMkQ7QUFDM0QscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRzs7QUFFSDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7O0FBRUg7QUFDQTtBQUNBOzs7Ozs7O0FDM0lBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGlCQUFnQjtBQUNoQixpQkFBZ0I7O0FBRWhCLG9CQUFtQjtBQUNuQixxQkFBb0I7O0FBRXBCLGlCQUFnQjtBQUNoQixpQkFBZ0I7O0FBRWhCLGlCQUFnQjtBQUNoQixrQkFBaUI7O0FBRWpCO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7Ozs7O0FDbEVBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBLElBQUc7QUFDSDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLCtDQUE4QyxRQUFRO0FBQ3REO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsRUFBQzs7QUFFRDtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQSw0QkFBMkIsUUFBUTtBQUNuQztBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBLGNBQWE7QUFDYjs7QUFFQTtBQUNBLGVBQWM7QUFDZDs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLHVDQUFzQztBQUN0QztBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOzs7Ozs7O0FDdmVBLGlCQUFnQixvQkFBb0I7QUFDcEM7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLHVDQUFzQyxTQUFTO0FBQy9DO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLO0FBQ0w7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7Ozs7Ozs7QUN4SEEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGlCQUFnQjtBQUNoQjs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7Ozs7Ozs7QUM5RUEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQSxFQUFDOztBQUVEO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CO0FBQ25COztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFlBQVc7O0FBRVg7QUFDQTtBQUNBLFFBQU87QUFDUDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsWUFBVzs7QUFFWDtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsNEJBQTJCLE1BQU07QUFDakM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxNQUFLOztBQUVMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsSUFBRzs7QUFFSDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLGNBQWEsa0NBQWtDO0FBQy9DO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7O0FBRUw7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBLHVEQUFzRCxZQUFZO0FBQ2xFO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0Esb0NBQW1DO0FBQ25DO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSwwQkFBeUIsY0FBYztBQUN2QztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBLFVBQVM7QUFDVDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esd0JBQXVCLHdDQUF3QztBQUMvRDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGdEQUErQyxtQkFBbUIsRUFBRTtBQUNwRTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxrQkFBaUIsb0JBQW9CO0FBQ3JDO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSw4QkFBNkIsTUFBTTtBQUNuQztBQUNBLFFBQU87QUFDUDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsUUFBTztBQUNQO0FBQ0E7QUFDQSxJQUFHO0FBQ0g7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxvQkFBbUIsMkJBQTJCO0FBQzlDLHNCQUFxQiwrQ0FBK0M7QUFDcEU7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLEVBQUM7O0FBRUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0EsUUFBTztBQUNQOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CLDJCQUEyQjtBQUM5Qzs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLG9CQUFtQiwyQkFBMkI7QUFDOUM7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esb0JBQW1CLDJCQUEyQjtBQUM5QztBQUNBO0FBQ0Esc0JBQXFCLDRCQUE0QjtBQUNqRDs7QUFFQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTs7QUFFQTs7Ozs7OztBQ3huQ0EsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7Ozs7Ozs7QUM5R0EsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxZQUFXLE1BQU07QUFDakI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQSxZQUFXLE9BQU87QUFDbEI7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxNQUFNO0FBQ2pCO0FBQ0EsWUFBVyxTQUFTO0FBQ3BCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0EsWUFBVyxPQUFPO0FBQ2xCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxvQkFBbUIsT0FBTztBQUMxQjtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0EsWUFBVyxNQUFNO0FBQ2pCO0FBQ0EsWUFBVyxTQUFTO0FBQ3BCO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7Ozs7Ozs7QUNqSEEsaUJBQWdCLG9CQUFvQjtBQUNwQztBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSzs7QUFFTDs7QUFFQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLE1BQUs7QUFDTDtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0Esa0NBQWlDLFFBQVE7QUFDekM7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsOENBQTZDLFNBQVM7QUFDdEQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EscUJBQW9CO0FBQ3BCO0FBQ0E7QUFDQSx1Q0FBc0M7QUFDdEM7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsZ0JBQWUsV0FBVztBQUMxQjtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTs7QUFFQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsZ0RBQStDLFNBQVM7QUFDeEQ7QUFDQTtBQUNBO0FBQ0E7O0FBRUE7QUFDQSwwQ0FBeUMsU0FBUztBQUNsRDtBQUNBO0FBQ0E7O0FBRUE7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLElBQUc7QUFDSDtBQUNBOztBQUVBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLFlBQVc7QUFDWDtBQUNBO0FBQ0E7QUFDQSxZQUFXO0FBQ1g7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0EsTUFBSztBQUNMO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0EsNkNBQTRDLGNBQWM7QUFDMUQ7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBO0FBQ0E7QUFDQSxVQUFTO0FBQ1Q7QUFDQTtBQUNBO0FBQ0E7QUFDQTtBQUNBLGNBQWE7QUFDYjtBQUNBO0FBQ0E7QUFDQSxjQUFhO0FBQ2I7QUFDQSxZQUFXO0FBQ1g7QUFDQSxRQUFPO0FBQ1A7QUFDQTtBQUNBO0FBQ0EsSUFBRztBQUNIO0FBQ0E7QUFDQSxJQUFHOztBQUVILFdBQVU7QUFDVjs7QUFFQSIsImZpbGUiOiJzb3VyY2UtbWFwLmRlYnVnLmpzIiwic291cmNlc0NvbnRlbnQiOlsiKGZ1bmN0aW9uIHdlYnBhY2tVbml2ZXJzYWxNb2R1bGVEZWZpbml0aW9uKHJvb3QsIGZhY3RvcnkpIHtcblx0aWYodHlwZW9mIGV4cG9ydHMgPT09ICdvYmplY3QnICYmIHR5cGVvZiBtb2R1bGUgPT09ICdvYmplY3QnKVxuXHRcdG1vZHVsZS5leHBvcnRzID0gZmFjdG9yeSgpO1xuXHRlbHNlIGlmKHR5cGVvZiBkZWZpbmUgPT09ICdmdW5jdGlvbicgJiYgZGVmaW5lLmFtZClcblx0XHRkZWZpbmUoW10sIGZhY3RvcnkpO1xuXHRlbHNlIGlmKHR5cGVvZiBleHBvcnRzID09PSAnb2JqZWN0Jylcblx0XHRleHBvcnRzW1wic291cmNlTWFwXCJdID0gZmFjdG9yeSgpO1xuXHRlbHNlXG5cdFx0cm9vdFtcInNvdXJjZU1hcFwiXSA9IGZhY3RvcnkoKTtcbn0pKHRoaXMsIGZ1bmN0aW9uKCkge1xucmV0dXJuIFxuXG5cbi8vIFdFQlBBQ0sgRk9PVEVSIC8vXG4vLyB3ZWJwYWNrL3VuaXZlcnNhbE1vZHVsZURlZmluaXRpb24iLCIgXHQvLyBUaGUgbW9kdWxlIGNhY2hlXG4gXHR2YXIgaW5zdGFsbGVkTW9kdWxlcyA9IHt9O1xuXG4gXHQvLyBUaGUgcmVxdWlyZSBmdW5jdGlvblxuIFx0ZnVuY3Rpb24gX193ZWJwYWNrX3JlcXVpcmVfXyhtb2R1bGVJZCkge1xuXG4gXHRcdC8vIENoZWNrIGlmIG1vZHVsZSBpcyBpbiBjYWNoZVxuIFx0XHRpZihpbnN0YWxsZWRNb2R1bGVzW21vZHVsZUlkXSlcbiBcdFx0XHRyZXR1cm4gaW5zdGFsbGVkTW9kdWxlc1ttb2R1bGVJZF0uZXhwb3J0cztcblxuIFx0XHQvLyBDcmVhdGUgYSBuZXcgbW9kdWxlIChhbmQgcHV0IGl0IGludG8gdGhlIGNhY2hlKVxuIFx0XHR2YXIgbW9kdWxlID0gaW5zdGFsbGVkTW9kdWxlc1ttb2R1bGVJZF0gPSB7XG4gXHRcdFx0ZXhwb3J0czoge30sXG4gXHRcdFx0aWQ6IG1vZHVsZUlkLFxuIFx0XHRcdGxvYWRlZDogZmFsc2VcbiBcdFx0fTtcblxuIFx0XHQvLyBFeGVjdXRlIHRoZSBtb2R1bGUgZnVuY3Rpb25cbiBcdFx0bW9kdWxlc1ttb2R1bGVJZF0uY2FsbChtb2R1bGUuZXhwb3J0cywgbW9kdWxlLCBtb2R1bGUuZXhwb3J0cywgX193ZWJwYWNrX3JlcXVpcmVfXyk7XG5cbiBcdFx0Ly8gRmxhZyB0aGUgbW9kdWxlIGFzIGxvYWRlZFxuIFx0XHRtb2R1bGUubG9hZGVkID0gdHJ1ZTtcblxuIFx0XHQvLyBSZXR1cm4gdGhlIGV4cG9ydHMgb2YgdGhlIG1vZHVsZVxuIFx0XHRyZXR1cm4gbW9kdWxlLmV4cG9ydHM7XG4gXHR9XG5cblxuIFx0Ly8gZXhwb3NlIHRoZSBtb2R1bGVzIG9iamVjdCAoX193ZWJwYWNrX21vZHVsZXNfXylcbiBcdF9fd2VicGFja19yZXF1aXJlX18ubSA9IG1vZHVsZXM7XG5cbiBcdC8vIGV4cG9zZSB0aGUgbW9kdWxlIGNhY2hlXG4gXHRfX3dlYnBhY2tfcmVxdWlyZV9fLmMgPSBpbnN0YWxsZWRNb2R1bGVzO1xuXG4gXHQvLyBfX3dlYnBhY2tfcHVibGljX3BhdGhfX1xuIFx0X193ZWJwYWNrX3JlcXVpcmVfXy5wID0gXCJcIjtcblxuIFx0Ly8gTG9hZCBlbnRyeSBtb2R1bGUgYW5kIHJldHVybiBleHBvcnRzXG4gXHRyZXR1cm4gX193ZWJwYWNrX3JlcXVpcmVfXygwKTtcblxuXG5cbi8vIFdFQlBBQ0sgRk9PVEVSIC8vXG4vLyB3ZWJwYWNrL2Jvb3RzdHJhcCAxNjI0YzcyOTliODg3ZjdiZGY2NCIsIi8qXG4gKiBDb3B5cmlnaHQgMjAwOS0yMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRS50eHQgb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKi9cbmV4cG9ydHMuU291cmNlTWFwR2VuZXJhdG9yID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW1hcC1nZW5lcmF0b3InKS5Tb3VyY2VNYXBHZW5lcmF0b3I7XG5leHBvcnRzLlNvdXJjZU1hcENvbnN1bWVyID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW1hcC1jb25zdW1lcicpLlNvdXJjZU1hcENvbnN1bWVyO1xuZXhwb3J0cy5Tb3VyY2VOb2RlID0gcmVxdWlyZSgnLi9saWIvc291cmNlLW5vZGUnKS5Tb3VyY2VOb2RlO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9zb3VyY2UtbWFwLmpzXG4vLyBtb2R1bGUgaWQgPSAwXG4vLyBtb2R1bGUgY2h1bmtzID0gMCIsIi8qIC0qLSBNb2RlOiBqczsganMtaW5kZW50LWxldmVsOiAyOyAtKi0gKi9cbi8qXG4gKiBDb3B5cmlnaHQgMjAxMSBNb3ppbGxhIEZvdW5kYXRpb24gYW5kIGNvbnRyaWJ1dG9yc1xuICogTGljZW5zZWQgdW5kZXIgdGhlIE5ldyBCU0QgbGljZW5zZS4gU2VlIExJQ0VOU0Ugb3I6XG4gKiBodHRwOi8vb3BlbnNvdXJjZS5vcmcvbGljZW5zZXMvQlNELTMtQ2xhdXNlXG4gKi9cblxudmFyIGJhc2U2NFZMUSA9IHJlcXVpcmUoJy4vYmFzZTY0LXZscScpO1xudmFyIHV0aWwgPSByZXF1aXJlKCcuL3V0aWwnKTtcbnZhciBBcnJheVNldCA9IHJlcXVpcmUoJy4vYXJyYXktc2V0JykuQXJyYXlTZXQ7XG52YXIgTWFwcGluZ0xpc3QgPSByZXF1aXJlKCcuL21hcHBpbmctbGlzdCcpLk1hcHBpbmdMaXN0O1xuXG4vKipcbiAqIEFuIGluc3RhbmNlIG9mIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3IgcmVwcmVzZW50cyBhIHNvdXJjZSBtYXAgd2hpY2ggaXNcbiAqIGJlaW5nIGJ1aWx0IGluY3JlbWVudGFsbHkuIFlvdSBtYXkgcGFzcyBhbiBvYmplY3Qgd2l0aCB0aGUgZm9sbG93aW5nXG4gKiBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBmaWxlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIGdlbmVyYXRlZCBzb3VyY2UuXG4gKiAgIC0gc291cmNlUm9vdDogQSByb290IGZvciBhbGwgcmVsYXRpdmUgVVJMcyBpbiB0aGlzIHNvdXJjZSBtYXAuXG4gKi9cbmZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcihhQXJncykge1xuICBpZiAoIWFBcmdzKSB7XG4gICAgYUFyZ3MgPSB7fTtcbiAgfVxuICB0aGlzLl9maWxlID0gdXRpbC5nZXRBcmcoYUFyZ3MsICdmaWxlJywgbnVsbCk7XG4gIHRoaXMuX3NvdXJjZVJvb3QgPSB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZVJvb3QnLCBudWxsKTtcbiAgdGhpcy5fc2tpcFZhbGlkYXRpb24gPSB1dGlsLmdldEFyZyhhQXJncywgJ3NraXBWYWxpZGF0aW9uJywgZmFsc2UpO1xuICB0aGlzLl9zb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX25hbWVzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX21hcHBpbmdzID0gbmV3IE1hcHBpbmdMaXN0KCk7XG4gIHRoaXMuX3NvdXJjZXNDb250ZW50cyA9IG51bGw7XG59XG5cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX3ZlcnNpb24gPSAzO1xuXG4vKipcbiAqIENyZWF0ZXMgYSBuZXcgU291cmNlTWFwR2VuZXJhdG9yIGJhc2VkIG9uIGEgU291cmNlTWFwQ29uc3VtZXJcbiAqXG4gKiBAcGFyYW0gYVNvdXJjZU1hcENvbnN1bWVyIFRoZSBTb3VyY2VNYXAuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5mcm9tU291cmNlTWFwID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX2Zyb21Tb3VyY2VNYXAoYVNvdXJjZU1hcENvbnN1bWVyKSB7XG4gICAgdmFyIHNvdXJjZVJvb3QgPSBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlUm9vdDtcbiAgICB2YXIgZ2VuZXJhdG9yID0gbmV3IFNvdXJjZU1hcEdlbmVyYXRvcih7XG4gICAgICBmaWxlOiBhU291cmNlTWFwQ29uc3VtZXIuZmlsZSxcbiAgICAgIHNvdXJjZVJvb3Q6IHNvdXJjZVJvb3RcbiAgICB9KTtcbiAgICBhU291cmNlTWFwQ29uc3VtZXIuZWFjaE1hcHBpbmcoZnVuY3Rpb24gKG1hcHBpbmcpIHtcbiAgICAgIHZhciBuZXdNYXBwaW5nID0ge1xuICAgICAgICBnZW5lcmF0ZWQ6IHtcbiAgICAgICAgICBsaW5lOiBtYXBwaW5nLmdlbmVyYXRlZExpbmUsXG4gICAgICAgICAgY29sdW1uOiBtYXBwaW5nLmdlbmVyYXRlZENvbHVtblxuICAgICAgICB9XG4gICAgICB9O1xuXG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgIT0gbnVsbCkge1xuICAgICAgICBuZXdNYXBwaW5nLnNvdXJjZSA9IG1hcHBpbmcuc291cmNlO1xuICAgICAgICBpZiAoc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICAgICAgbmV3TWFwcGluZy5zb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIG5ld01hcHBpbmcuc291cmNlKTtcbiAgICAgICAgfVxuXG4gICAgICAgIG5ld01hcHBpbmcub3JpZ2luYWwgPSB7XG4gICAgICAgICAgbGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgICAgY29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uXG4gICAgICAgIH07XG5cbiAgICAgICAgaWYgKG1hcHBpbmcubmFtZSAhPSBudWxsKSB7XG4gICAgICAgICAgbmV3TWFwcGluZy5uYW1lID0gbWFwcGluZy5uYW1lO1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIGdlbmVyYXRvci5hZGRNYXBwaW5nKG5ld01hcHBpbmcpO1xuICAgIH0pO1xuICAgIGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VzLmZvckVhY2goZnVuY3Rpb24gKHNvdXJjZUZpbGUpIHtcbiAgICAgIHZhciBzb3VyY2VSZWxhdGl2ZSA9IHNvdXJjZUZpbGU7XG4gICAgICBpZiAoc291cmNlUm9vdCAhPT0gbnVsbCkge1xuICAgICAgICBzb3VyY2VSZWxhdGl2ZSA9IHV0aWwucmVsYXRpdmUoc291cmNlUm9vdCwgc291cmNlRmlsZSk7XG4gICAgICB9XG5cbiAgICAgIGlmICghZ2VuZXJhdG9yLl9zb3VyY2VzLmhhcyhzb3VyY2VSZWxhdGl2ZSkpIHtcbiAgICAgICAgZ2VuZXJhdG9yLl9zb3VyY2VzLmFkZChzb3VyY2VSZWxhdGl2ZSk7XG4gICAgICB9XG5cbiAgICAgIHZhciBjb250ZW50ID0gYVNvdXJjZU1hcENvbnN1bWVyLnNvdXJjZUNvbnRlbnRGb3Ioc291cmNlRmlsZSk7XG4gICAgICBpZiAoY29udGVudCAhPSBudWxsKSB7XG4gICAgICAgIGdlbmVyYXRvci5zZXRTb3VyY2VDb250ZW50KHNvdXJjZUZpbGUsIGNvbnRlbnQpO1xuICAgICAgfVxuICAgIH0pO1xuICAgIHJldHVybiBnZW5lcmF0b3I7XG4gIH07XG5cbi8qKlxuICogQWRkIGEgc2luZ2xlIG1hcHBpbmcgZnJvbSBvcmlnaW5hbCBzb3VyY2UgbGluZSBhbmQgY29sdW1uIHRvIHRoZSBnZW5lcmF0ZWRcbiAqIHNvdXJjZSdzIGxpbmUgYW5kIGNvbHVtbiBmb3IgdGhpcyBzb3VyY2UgbWFwIGJlaW5nIGNyZWF0ZWQuIFRoZSBtYXBwaW5nXG4gKiBvYmplY3Qgc2hvdWxkIGhhdmUgdGhlIGZvbGxvd2luZyBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBnZW5lcmF0ZWQ6IEFuIG9iamVjdCB3aXRoIHRoZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucy5cbiAqICAgLSBvcmlnaW5hbDogQW4gb2JqZWN0IHdpdGggdGhlIG9yaWdpbmFsIGxpbmUgYW5kIGNvbHVtbiBwb3NpdGlvbnMuXG4gKiAgIC0gc291cmNlOiBUaGUgb3JpZ2luYWwgc291cmNlIGZpbGUgKHJlbGF0aXZlIHRvIHRoZSBzb3VyY2VSb290KS5cbiAqICAgLSBuYW1lOiBBbiBvcHRpb25hbCBvcmlnaW5hbCB0b2tlbiBuYW1lIGZvciB0aGlzIG1hcHBpbmcuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuYWRkTWFwcGluZyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9hZGRNYXBwaW5nKGFBcmdzKSB7XG4gICAgdmFyIGdlbmVyYXRlZCA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnZ2VuZXJhdGVkJyk7XG4gICAgdmFyIG9yaWdpbmFsID0gdXRpbC5nZXRBcmcoYUFyZ3MsICdvcmlnaW5hbCcsIG51bGwpO1xuICAgIHZhciBzb3VyY2UgPSB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZScsIG51bGwpO1xuICAgIHZhciBuYW1lID0gdXRpbC5nZXRBcmcoYUFyZ3MsICduYW1lJywgbnVsbCk7XG5cbiAgICBpZiAoIXRoaXMuX3NraXBWYWxpZGF0aW9uKSB7XG4gICAgICB0aGlzLl92YWxpZGF0ZU1hcHBpbmcoZ2VuZXJhdGVkLCBvcmlnaW5hbCwgc291cmNlLCBuYW1lKTtcbiAgICB9XG5cbiAgICBpZiAoc291cmNlICE9IG51bGwpIHtcbiAgICAgIHNvdXJjZSA9IFN0cmluZyhzb3VyY2UpO1xuICAgICAgaWYgKCF0aGlzLl9zb3VyY2VzLmhhcyhzb3VyY2UpKSB7XG4gICAgICAgIHRoaXMuX3NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICB9XG4gICAgfVxuXG4gICAgaWYgKG5hbWUgIT0gbnVsbCkge1xuICAgICAgbmFtZSA9IFN0cmluZyhuYW1lKTtcbiAgICAgIGlmICghdGhpcy5fbmFtZXMuaGFzKG5hbWUpKSB7XG4gICAgICAgIHRoaXMuX25hbWVzLmFkZChuYW1lKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICB0aGlzLl9tYXBwaW5ncy5hZGQoe1xuICAgICAgZ2VuZXJhdGVkTGluZTogZ2VuZXJhdGVkLmxpbmUsXG4gICAgICBnZW5lcmF0ZWRDb2x1bW46IGdlbmVyYXRlZC5jb2x1bW4sXG4gICAgICBvcmlnaW5hbExpbmU6IG9yaWdpbmFsICE9IG51bGwgJiYgb3JpZ2luYWwubGluZSxcbiAgICAgIG9yaWdpbmFsQ29sdW1uOiBvcmlnaW5hbCAhPSBudWxsICYmIG9yaWdpbmFsLmNvbHVtbixcbiAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgbmFtZTogbmFtZVxuICAgIH0pO1xuICB9O1xuXG4vKipcbiAqIFNldCB0aGUgc291cmNlIGNvbnRlbnQgZm9yIGEgc291cmNlIGZpbGUuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuc2V0U291cmNlQ29udGVudCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl9zZXRTb3VyY2VDb250ZW50KGFTb3VyY2VGaWxlLCBhU291cmNlQ29udGVudCkge1xuICAgIHZhciBzb3VyY2UgPSBhU291cmNlRmlsZTtcbiAgICBpZiAodGhpcy5fc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICBzb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHRoaXMuX3NvdXJjZVJvb3QsIHNvdXJjZSk7XG4gICAgfVxuXG4gICAgaWYgKGFTb3VyY2VDb250ZW50ICE9IG51bGwpIHtcbiAgICAgIC8vIEFkZCB0aGUgc291cmNlIGNvbnRlbnQgdG8gdGhlIF9zb3VyY2VzQ29udGVudHMgbWFwLlxuICAgICAgLy8gQ3JlYXRlIGEgbmV3IF9zb3VyY2VzQ29udGVudHMgbWFwIGlmIHRoZSBwcm9wZXJ0eSBpcyBudWxsLlxuICAgICAgaWYgKCF0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgICAgdGhpcy5fc291cmNlc0NvbnRlbnRzID0gT2JqZWN0LmNyZWF0ZShudWxsKTtcbiAgICAgIH1cbiAgICAgIHRoaXMuX3NvdXJjZXNDb250ZW50c1t1dGlsLnRvU2V0U3RyaW5nKHNvdXJjZSldID0gYVNvdXJjZUNvbnRlbnQ7XG4gICAgfSBlbHNlIGlmICh0aGlzLl9zb3VyY2VzQ29udGVudHMpIHtcbiAgICAgIC8vIFJlbW92ZSB0aGUgc291cmNlIGZpbGUgZnJvbSB0aGUgX3NvdXJjZXNDb250ZW50cyBtYXAuXG4gICAgICAvLyBJZiB0aGUgX3NvdXJjZXNDb250ZW50cyBtYXAgaXMgZW1wdHksIHNldCB0aGUgcHJvcGVydHkgdG8gbnVsbC5cbiAgICAgIGRlbGV0ZSB0aGlzLl9zb3VyY2VzQ29udGVudHNbdXRpbC50b1NldFN0cmluZyhzb3VyY2UpXTtcbiAgICAgIGlmIChPYmplY3Qua2V5cyh0aGlzLl9zb3VyY2VzQ29udGVudHMpLmxlbmd0aCA9PT0gMCkge1xuICAgICAgICB0aGlzLl9zb3VyY2VzQ29udGVudHMgPSBudWxsO1xuICAgICAgfVxuICAgIH1cbiAgfTtcblxuLyoqXG4gKiBBcHBsaWVzIHRoZSBtYXBwaW5ncyBvZiBhIHN1Yi1zb3VyY2UtbWFwIGZvciBhIHNwZWNpZmljIHNvdXJjZSBmaWxlIHRvIHRoZVxuICogc291cmNlIG1hcCBiZWluZyBnZW5lcmF0ZWQuIEVhY2ggbWFwcGluZyB0byB0aGUgc3VwcGxpZWQgc291cmNlIGZpbGUgaXNcbiAqIHJld3JpdHRlbiB1c2luZyB0aGUgc3VwcGxpZWQgc291cmNlIG1hcC4gTm90ZTogVGhlIHJlc29sdXRpb24gZm9yIHRoZVxuICogcmVzdWx0aW5nIG1hcHBpbmdzIGlzIHRoZSBtaW5pbWl1bSBvZiB0aGlzIG1hcCBhbmQgdGhlIHN1cHBsaWVkIG1hcC5cbiAqXG4gKiBAcGFyYW0gYVNvdXJjZU1hcENvbnN1bWVyIFRoZSBzb3VyY2UgbWFwIHRvIGJlIGFwcGxpZWQuXG4gKiBAcGFyYW0gYVNvdXJjZUZpbGUgT3B0aW9uYWwuIFRoZSBmaWxlbmFtZSBvZiB0aGUgc291cmNlIGZpbGUuXG4gKiAgICAgICAgSWYgb21pdHRlZCwgU291cmNlTWFwQ29uc3VtZXIncyBmaWxlIHByb3BlcnR5IHdpbGwgYmUgdXNlZC5cbiAqIEBwYXJhbSBhU291cmNlTWFwUGF0aCBPcHRpb25hbC4gVGhlIGRpcm5hbWUgb2YgdGhlIHBhdGggdG8gdGhlIHNvdXJjZSBtYXBcbiAqICAgICAgICB0byBiZSBhcHBsaWVkLiBJZiByZWxhdGl2ZSwgaXQgaXMgcmVsYXRpdmUgdG8gdGhlIFNvdXJjZU1hcENvbnN1bWVyLlxuICogICAgICAgIFRoaXMgcGFyYW1ldGVyIGlzIG5lZWRlZCB3aGVuIHRoZSB0d28gc291cmNlIG1hcHMgYXJlbid0IGluIHRoZSBzYW1lXG4gKiAgICAgICAgZGlyZWN0b3J5LCBhbmQgdGhlIHNvdXJjZSBtYXAgdG8gYmUgYXBwbGllZCBjb250YWlucyByZWxhdGl2ZSBzb3VyY2VcbiAqICAgICAgICBwYXRocy4gSWYgc28sIHRob3NlIHJlbGF0aXZlIHNvdXJjZSBwYXRocyBuZWVkIHRvIGJlIHJld3JpdHRlblxuICogICAgICAgIHJlbGF0aXZlIHRvIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3IuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuYXBwbHlTb3VyY2VNYXAgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfYXBwbHlTb3VyY2VNYXAoYVNvdXJjZU1hcENvbnN1bWVyLCBhU291cmNlRmlsZSwgYVNvdXJjZU1hcFBhdGgpIHtcbiAgICB2YXIgc291cmNlRmlsZSA9IGFTb3VyY2VGaWxlO1xuICAgIC8vIElmIGFTb3VyY2VGaWxlIGlzIG9taXR0ZWQsIHdlIHdpbGwgdXNlIHRoZSBmaWxlIHByb3BlcnR5IG9mIHRoZSBTb3VyY2VNYXBcbiAgICBpZiAoYVNvdXJjZUZpbGUgPT0gbnVsbCkge1xuICAgICAgaWYgKGFTb3VyY2VNYXBDb25zdW1lci5maWxlID09IG51bGwpIHtcbiAgICAgICAgdGhyb3cgbmV3IEVycm9yKFxuICAgICAgICAgICdTb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLmFwcGx5U291cmNlTWFwIHJlcXVpcmVzIGVpdGhlciBhbiBleHBsaWNpdCBzb3VyY2UgZmlsZSwgJyArXG4gICAgICAgICAgJ29yIHRoZSBzb3VyY2UgbWFwXFwncyBcImZpbGVcIiBwcm9wZXJ0eS4gQm90aCB3ZXJlIG9taXR0ZWQuJ1xuICAgICAgICApO1xuICAgICAgfVxuICAgICAgc291cmNlRmlsZSA9IGFTb3VyY2VNYXBDb25zdW1lci5maWxlO1xuICAgIH1cbiAgICB2YXIgc291cmNlUm9vdCA9IHRoaXMuX3NvdXJjZVJvb3Q7XG4gICAgLy8gTWFrZSBcInNvdXJjZUZpbGVcIiByZWxhdGl2ZSBpZiBhbiBhYnNvbHV0ZSBVcmwgaXMgcGFzc2VkLlxuICAgIGlmIChzb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgIHNvdXJjZUZpbGUgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIHNvdXJjZUZpbGUpO1xuICAgIH1cbiAgICAvLyBBcHBseWluZyB0aGUgU291cmNlTWFwIGNhbiBhZGQgYW5kIHJlbW92ZSBpdGVtcyBmcm9tIHRoZSBzb3VyY2VzIGFuZFxuICAgIC8vIHRoZSBuYW1lcyBhcnJheS5cbiAgICB2YXIgbmV3U291cmNlcyA9IG5ldyBBcnJheVNldCgpO1xuICAgIHZhciBuZXdOYW1lcyA9IG5ldyBBcnJheVNldCgpO1xuXG4gICAgLy8gRmluZCBtYXBwaW5ncyBmb3IgdGhlIFwic291cmNlRmlsZVwiXG4gICAgdGhpcy5fbWFwcGluZ3MudW5zb3J0ZWRGb3JFYWNoKGZ1bmN0aW9uIChtYXBwaW5nKSB7XG4gICAgICBpZiAobWFwcGluZy5zb3VyY2UgPT09IHNvdXJjZUZpbGUgJiYgbWFwcGluZy5vcmlnaW5hbExpbmUgIT0gbnVsbCkge1xuICAgICAgICAvLyBDaGVjayBpZiBpdCBjYW4gYmUgbWFwcGVkIGJ5IHRoZSBzb3VyY2UgbWFwLCB0aGVuIHVwZGF0ZSB0aGUgbWFwcGluZy5cbiAgICAgICAgdmFyIG9yaWdpbmFsID0gYVNvdXJjZU1hcENvbnN1bWVyLm9yaWdpbmFsUG9zaXRpb25Gb3Ioe1xuICAgICAgICAgIGxpbmU6IG1hcHBpbmcub3JpZ2luYWxMaW5lLFxuICAgICAgICAgIGNvbHVtbjogbWFwcGluZy5vcmlnaW5hbENvbHVtblxuICAgICAgICB9KTtcbiAgICAgICAgaWYgKG9yaWdpbmFsLnNvdXJjZSAhPSBudWxsKSB7XG4gICAgICAgICAgLy8gQ29weSBtYXBwaW5nXG4gICAgICAgICAgbWFwcGluZy5zb3VyY2UgPSBvcmlnaW5hbC5zb3VyY2U7XG4gICAgICAgICAgaWYgKGFTb3VyY2VNYXBQYXRoICE9IG51bGwpIHtcbiAgICAgICAgICAgIG1hcHBpbmcuc291cmNlID0gdXRpbC5qb2luKGFTb3VyY2VNYXBQYXRoLCBtYXBwaW5nLnNvdXJjZSlcbiAgICAgICAgICB9XG4gICAgICAgICAgaWYgKHNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgICAgICAgbWFwcGluZy5zb3VyY2UgPSB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIG1hcHBpbmcuc291cmNlKTtcbiAgICAgICAgICB9XG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgPSBvcmlnaW5hbC5saW5lO1xuICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxDb2x1bW4gPSBvcmlnaW5hbC5jb2x1bW47XG4gICAgICAgICAgaWYgKG9yaWdpbmFsLm5hbWUgIT0gbnVsbCkge1xuICAgICAgICAgICAgbWFwcGluZy5uYW1lID0gb3JpZ2luYWwubmFtZTtcbiAgICAgICAgICB9XG4gICAgICAgIH1cbiAgICAgIH1cblxuICAgICAgdmFyIHNvdXJjZSA9IG1hcHBpbmcuc291cmNlO1xuICAgICAgaWYgKHNvdXJjZSAhPSBudWxsICYmICFuZXdTb3VyY2VzLmhhcyhzb3VyY2UpKSB7XG4gICAgICAgIG5ld1NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICB9XG5cbiAgICAgIHZhciBuYW1lID0gbWFwcGluZy5uYW1lO1xuICAgICAgaWYgKG5hbWUgIT0gbnVsbCAmJiAhbmV3TmFtZXMuaGFzKG5hbWUpKSB7XG4gICAgICAgIG5ld05hbWVzLmFkZChuYW1lKTtcbiAgICAgIH1cblxuICAgIH0sIHRoaXMpO1xuICAgIHRoaXMuX3NvdXJjZXMgPSBuZXdTb3VyY2VzO1xuICAgIHRoaXMuX25hbWVzID0gbmV3TmFtZXM7XG5cbiAgICAvLyBDb3B5IHNvdXJjZXNDb250ZW50cyBvZiBhcHBsaWVkIG1hcC5cbiAgICBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlcy5mb3JFYWNoKGZ1bmN0aW9uIChzb3VyY2VGaWxlKSB7XG4gICAgICB2YXIgY29udGVudCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKHNvdXJjZUZpbGUpO1xuICAgICAgaWYgKGNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgICBpZiAoYVNvdXJjZU1hcFBhdGggIT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZUZpbGUgPSB1dGlsLmpvaW4oYVNvdXJjZU1hcFBhdGgsIHNvdXJjZUZpbGUpO1xuICAgICAgICB9XG4gICAgICAgIGlmIChzb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgICAgICBzb3VyY2VGaWxlID0gdXRpbC5yZWxhdGl2ZShzb3VyY2VSb290LCBzb3VyY2VGaWxlKTtcbiAgICAgICAgfVxuICAgICAgICB0aGlzLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSwgdGhpcyk7XG4gIH07XG5cbi8qKlxuICogQSBtYXBwaW5nIGNhbiBoYXZlIG9uZSBvZiB0aGUgdGhyZWUgbGV2ZWxzIG9mIGRhdGE6XG4gKlxuICogICAxLiBKdXN0IHRoZSBnZW5lcmF0ZWQgcG9zaXRpb24uXG4gKiAgIDIuIFRoZSBHZW5lcmF0ZWQgcG9zaXRpb24sIG9yaWdpbmFsIHBvc2l0aW9uLCBhbmQgb3JpZ2luYWwgc291cmNlLlxuICogICAzLiBHZW5lcmF0ZWQgYW5kIG9yaWdpbmFsIHBvc2l0aW9uLCBvcmlnaW5hbCBzb3VyY2UsIGFzIHdlbGwgYXMgYSBuYW1lXG4gKiAgICAgIHRva2VuLlxuICpcbiAqIFRvIG1haW50YWluIGNvbnNpc3RlbmN5LCB3ZSB2YWxpZGF0ZSB0aGF0IGFueSBuZXcgbWFwcGluZyBiZWluZyBhZGRlZCBmYWxsc1xuICogaW4gdG8gb25lIG9mIHRoZXNlIGNhdGVnb3JpZXMuXG4gKi9cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX3ZhbGlkYXRlTWFwcGluZyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcEdlbmVyYXRvcl92YWxpZGF0ZU1hcHBpbmcoYUdlbmVyYXRlZCwgYU9yaWdpbmFsLCBhU291cmNlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGFOYW1lKSB7XG4gICAgLy8gV2hlbiBhT3JpZ2luYWwgaXMgdHJ1dGh5IGJ1dCBoYXMgZW1wdHkgdmFsdWVzIGZvciAubGluZSBhbmQgLmNvbHVtbixcbiAgICAvLyBpdCBpcyBtb3N0IGxpa2VseSBhIHByb2dyYW1tZXIgZXJyb3IuIEluIHRoaXMgY2FzZSB3ZSB0aHJvdyBhIHZlcnlcbiAgICAvLyBzcGVjaWZpYyBlcnJvciBtZXNzYWdlIHRvIHRyeSB0byBndWlkZSB0aGVtIHRoZSByaWdodCB3YXkuXG4gICAgLy8gRm9yIGV4YW1wbGU6IGh0dHBzOi8vZ2l0aHViLmNvbS9Qb2x5bWVyL3BvbHltZXItYnVuZGxlci9wdWxsLzUxOVxuICAgIGlmIChhT3JpZ2luYWwgJiYgdHlwZW9mIGFPcmlnaW5hbC5saW5lICE9PSAnbnVtYmVyJyAmJiB0eXBlb2YgYU9yaWdpbmFsLmNvbHVtbiAhPT0gJ251bWJlcicpIHtcbiAgICAgICAgdGhyb3cgbmV3IEVycm9yKFxuICAgICAgICAgICAgJ29yaWdpbmFsLmxpbmUgYW5kIG9yaWdpbmFsLmNvbHVtbiBhcmUgbm90IG51bWJlcnMgLS0geW91IHByb2JhYmx5IG1lYW50IHRvIG9taXQgJyArXG4gICAgICAgICAgICAndGhlIG9yaWdpbmFsIG1hcHBpbmcgZW50aXJlbHkgYW5kIG9ubHkgbWFwIHRoZSBnZW5lcmF0ZWQgcG9zaXRpb24uIElmIHNvLCBwYXNzICcgK1xuICAgICAgICAgICAgJ251bGwgZm9yIHRoZSBvcmlnaW5hbCBtYXBwaW5nIGluc3RlYWQgb2YgYW4gb2JqZWN0IHdpdGggZW1wdHkgb3IgbnVsbCB2YWx1ZXMuJ1xuICAgICAgICApO1xuICAgIH1cblxuICAgIGlmIChhR2VuZXJhdGVkICYmICdsaW5lJyBpbiBhR2VuZXJhdGVkICYmICdjb2x1bW4nIGluIGFHZW5lcmF0ZWRcbiAgICAgICAgJiYgYUdlbmVyYXRlZC5saW5lID4gMCAmJiBhR2VuZXJhdGVkLmNvbHVtbiA+PSAwXG4gICAgICAgICYmICFhT3JpZ2luYWwgJiYgIWFTb3VyY2UgJiYgIWFOYW1lKSB7XG4gICAgICAvLyBDYXNlIDEuXG4gICAgICByZXR1cm47XG4gICAgfVxuICAgIGVsc2UgaWYgKGFHZW5lcmF0ZWQgJiYgJ2xpbmUnIGluIGFHZW5lcmF0ZWQgJiYgJ2NvbHVtbicgaW4gYUdlbmVyYXRlZFxuICAgICAgICAgICAgICYmIGFPcmlnaW5hbCAmJiAnbGluZScgaW4gYU9yaWdpbmFsICYmICdjb2x1bW4nIGluIGFPcmlnaW5hbFxuICAgICAgICAgICAgICYmIGFHZW5lcmF0ZWQubGluZSA+IDAgJiYgYUdlbmVyYXRlZC5jb2x1bW4gPj0gMFxuICAgICAgICAgICAgICYmIGFPcmlnaW5hbC5saW5lID4gMCAmJiBhT3JpZ2luYWwuY29sdW1uID49IDBcbiAgICAgICAgICAgICAmJiBhU291cmNlKSB7XG4gICAgICAvLyBDYXNlcyAyIGFuZCAzLlxuICAgICAgcmV0dXJuO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignSW52YWxpZCBtYXBwaW5nOiAnICsgSlNPTi5zdHJpbmdpZnkoe1xuICAgICAgICBnZW5lcmF0ZWQ6IGFHZW5lcmF0ZWQsXG4gICAgICAgIHNvdXJjZTogYVNvdXJjZSxcbiAgICAgICAgb3JpZ2luYWw6IGFPcmlnaW5hbCxcbiAgICAgICAgbmFtZTogYU5hbWVcbiAgICAgIH0pKTtcbiAgICB9XG4gIH07XG5cbi8qKlxuICogU2VyaWFsaXplIHRoZSBhY2N1bXVsYXRlZCBtYXBwaW5ncyBpbiB0byB0aGUgc3RyZWFtIG9mIGJhc2UgNjQgVkxRc1xuICogc3BlY2lmaWVkIGJ5IHRoZSBzb3VyY2UgbWFwIGZvcm1hdC5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS5fc2VyaWFsaXplTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3Jfc2VyaWFsaXplTWFwcGluZ3MoKSB7XG4gICAgdmFyIHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgICB2YXIgcHJldmlvdXNHZW5lcmF0ZWRMaW5lID0gMTtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gMDtcbiAgICB2YXIgcHJldmlvdXNOYW1lID0gMDtcbiAgICB2YXIgcHJldmlvdXNTb3VyY2UgPSAwO1xuICAgIHZhciByZXN1bHQgPSAnJztcbiAgICB2YXIgbmV4dDtcbiAgICB2YXIgbWFwcGluZztcbiAgICB2YXIgbmFtZUlkeDtcbiAgICB2YXIgc291cmNlSWR4O1xuXG4gICAgdmFyIG1hcHBpbmdzID0gdGhpcy5fbWFwcGluZ3MudG9BcnJheSgpO1xuICAgIGZvciAodmFyIGkgPSAwLCBsZW4gPSBtYXBwaW5ncy5sZW5ndGg7IGkgPCBsZW47IGkrKykge1xuICAgICAgbWFwcGluZyA9IG1hcHBpbmdzW2ldO1xuICAgICAgbmV4dCA9ICcnXG5cbiAgICAgIGlmIChtYXBwaW5nLmdlbmVyYXRlZExpbmUgIT09IHByZXZpb3VzR2VuZXJhdGVkTGluZSkge1xuICAgICAgICBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgICAgIHdoaWxlIChtYXBwaW5nLmdlbmVyYXRlZExpbmUgIT09IHByZXZpb3VzR2VuZXJhdGVkTGluZSkge1xuICAgICAgICAgIG5leHQgKz0gJzsnO1xuICAgICAgICAgIHByZXZpb3VzR2VuZXJhdGVkTGluZSsrO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgICBlbHNlIHtcbiAgICAgICAgaWYgKGkgPiAwKSB7XG4gICAgICAgICAgaWYgKCF1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0luZmxhdGVkKG1hcHBpbmcsIG1hcHBpbmdzW2kgLSAxXSkpIHtcbiAgICAgICAgICAgIGNvbnRpbnVlO1xuICAgICAgICAgIH1cbiAgICAgICAgICBuZXh0ICs9ICcsJztcbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5nZW5lcmF0ZWRDb2x1bW5cbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIC0gcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgaWYgKG1hcHBpbmcuc291cmNlICE9IG51bGwpIHtcbiAgICAgICAgc291cmNlSWR4ID0gdGhpcy5fc291cmNlcy5pbmRleE9mKG1hcHBpbmcuc291cmNlKTtcbiAgICAgICAgbmV4dCArPSBiYXNlNjRWTFEuZW5jb2RlKHNvdXJjZUlkeCAtIHByZXZpb3VzU291cmNlKTtcbiAgICAgICAgcHJldmlvdXNTb3VyY2UgPSBzb3VyY2VJZHg7XG5cbiAgICAgICAgLy8gbGluZXMgYXJlIHN0b3JlZCAwLWJhc2VkIGluIFNvdXJjZU1hcCBzcGVjIHZlcnNpb24gM1xuICAgICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5vcmlnaW5hbExpbmUgLSAxXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIC0gcHJldmlvdXNPcmlnaW5hbExpbmUpO1xuICAgICAgICBwcmV2aW91c09yaWdpbmFsTGluZSA9IG1hcHBpbmcub3JpZ2luYWxMaW5lIC0gMTtcblxuICAgICAgICBuZXh0ICs9IGJhc2U2NFZMUS5lbmNvZGUobWFwcGluZy5vcmlnaW5hbENvbHVtblxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAtIHByZXZpb3VzT3JpZ2luYWxDb2x1bW4pO1xuICAgICAgICBwcmV2aW91c09yaWdpbmFsQ29sdW1uID0gbWFwcGluZy5vcmlnaW5hbENvbHVtbjtcblxuICAgICAgICBpZiAobWFwcGluZy5uYW1lICE9IG51bGwpIHtcbiAgICAgICAgICBuYW1lSWR4ID0gdGhpcy5fbmFtZXMuaW5kZXhPZihtYXBwaW5nLm5hbWUpO1xuICAgICAgICAgIG5leHQgKz0gYmFzZTY0VkxRLmVuY29kZShuYW1lSWR4IC0gcHJldmlvdXNOYW1lKTtcbiAgICAgICAgICBwcmV2aW91c05hbWUgPSBuYW1lSWR4O1xuICAgICAgICB9XG4gICAgICB9XG5cbiAgICAgIHJlc3VsdCArPSBuZXh0O1xuICAgIH1cblxuICAgIHJldHVybiByZXN1bHQ7XG4gIH07XG5cblNvdXJjZU1hcEdlbmVyYXRvci5wcm90b3R5cGUuX2dlbmVyYXRlU291cmNlc0NvbnRlbnQgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfZ2VuZXJhdGVTb3VyY2VzQ29udGVudChhU291cmNlcywgYVNvdXJjZVJvb3QpIHtcbiAgICByZXR1cm4gYVNvdXJjZXMubWFwKGZ1bmN0aW9uIChzb3VyY2UpIHtcbiAgICAgIGlmICghdGhpcy5fc291cmNlc0NvbnRlbnRzKSB7XG4gICAgICAgIHJldHVybiBudWxsO1xuICAgICAgfVxuICAgICAgaWYgKGFTb3VyY2VSb290ICE9IG51bGwpIHtcbiAgICAgICAgc291cmNlID0gdXRpbC5yZWxhdGl2ZShhU291cmNlUm9vdCwgc291cmNlKTtcbiAgICAgIH1cbiAgICAgIHZhciBrZXkgPSB1dGlsLnRvU2V0U3RyaW5nKHNvdXJjZSk7XG4gICAgICByZXR1cm4gT2JqZWN0LnByb3RvdHlwZS5oYXNPd25Qcm9wZXJ0eS5jYWxsKHRoaXMuX3NvdXJjZXNDb250ZW50cywga2V5KVxuICAgICAgICA/IHRoaXMuX3NvdXJjZXNDb250ZW50c1trZXldXG4gICAgICAgIDogbnVsbDtcbiAgICB9LCB0aGlzKTtcbiAgfTtcblxuLyoqXG4gKiBFeHRlcm5hbGl6ZSB0aGUgc291cmNlIG1hcC5cbiAqL1xuU291cmNlTWFwR2VuZXJhdG9yLnByb3RvdHlwZS50b0pTT04gPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBHZW5lcmF0b3JfdG9KU09OKCkge1xuICAgIHZhciBtYXAgPSB7XG4gICAgICB2ZXJzaW9uOiB0aGlzLl92ZXJzaW9uLFxuICAgICAgc291cmNlczogdGhpcy5fc291cmNlcy50b0FycmF5KCksXG4gICAgICBuYW1lczogdGhpcy5fbmFtZXMudG9BcnJheSgpLFxuICAgICAgbWFwcGluZ3M6IHRoaXMuX3NlcmlhbGl6ZU1hcHBpbmdzKClcbiAgICB9O1xuICAgIGlmICh0aGlzLl9maWxlICE9IG51bGwpIHtcbiAgICAgIG1hcC5maWxlID0gdGhpcy5fZmlsZTtcbiAgICB9XG4gICAgaWYgKHRoaXMuX3NvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgICAgbWFwLnNvdXJjZVJvb3QgPSB0aGlzLl9zb3VyY2VSb290O1xuICAgIH1cbiAgICBpZiAodGhpcy5fc291cmNlc0NvbnRlbnRzKSB7XG4gICAgICBtYXAuc291cmNlc0NvbnRlbnQgPSB0aGlzLl9nZW5lcmF0ZVNvdXJjZXNDb250ZW50KG1hcC5zb3VyY2VzLCBtYXAuc291cmNlUm9vdCk7XG4gICAgfVxuXG4gICAgcmV0dXJuIG1hcDtcbiAgfTtcblxuLyoqXG4gKiBSZW5kZXIgdGhlIHNvdXJjZSBtYXAgYmVpbmcgZ2VuZXJhdGVkIHRvIGEgc3RyaW5nLlxuICovXG5Tb3VyY2VNYXBHZW5lcmF0b3IucHJvdG90eXBlLnRvU3RyaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwR2VuZXJhdG9yX3RvU3RyaW5nKCkge1xuICAgIHJldHVybiBKU09OLnN0cmluZ2lmeSh0aGlzLnRvSlNPTigpKTtcbiAgfTtcblxuZXhwb3J0cy5Tb3VyY2VNYXBHZW5lcmF0b3IgPSBTb3VyY2VNYXBHZW5lcmF0b3I7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL2xpYi9zb3VyY2UtbWFwLWdlbmVyYXRvci5qc1xuLy8gbW9kdWxlIGlkID0gMVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICpcbiAqIEJhc2VkIG9uIHRoZSBCYXNlIDY0IFZMUSBpbXBsZW1lbnRhdGlvbiBpbiBDbG9zdXJlIENvbXBpbGVyOlxuICogaHR0cHM6Ly9jb2RlLmdvb2dsZS5jb20vcC9jbG9zdXJlLWNvbXBpbGVyL3NvdXJjZS9icm93c2UvdHJ1bmsvc3JjL2NvbS9nb29nbGUvZGVidWdnaW5nL3NvdXJjZW1hcC9CYXNlNjRWTFEuamF2YVxuICpcbiAqIENvcHlyaWdodCAyMDExIFRoZSBDbG9zdXJlIENvbXBpbGVyIEF1dGhvcnMuIEFsbCByaWdodHMgcmVzZXJ2ZWQuXG4gKiBSZWRpc3RyaWJ1dGlvbiBhbmQgdXNlIGluIHNvdXJjZSBhbmQgYmluYXJ5IGZvcm1zLCB3aXRoIG9yIHdpdGhvdXRcbiAqIG1vZGlmaWNhdGlvbiwgYXJlIHBlcm1pdHRlZCBwcm92aWRlZCB0aGF0IHRoZSBmb2xsb3dpbmcgY29uZGl0aW9ucyBhcmVcbiAqIG1ldDpcbiAqXG4gKiAgKiBSZWRpc3RyaWJ1dGlvbnMgb2Ygc291cmNlIGNvZGUgbXVzdCByZXRhaW4gdGhlIGFib3ZlIGNvcHlyaWdodFxuICogICAgbm90aWNlLCB0aGlzIGxpc3Qgb2YgY29uZGl0aW9ucyBhbmQgdGhlIGZvbGxvd2luZyBkaXNjbGFpbWVyLlxuICogICogUmVkaXN0cmlidXRpb25zIGluIGJpbmFyeSBmb3JtIG11c3QgcmVwcm9kdWNlIHRoZSBhYm92ZVxuICogICAgY29weXJpZ2h0IG5vdGljZSwgdGhpcyBsaXN0IG9mIGNvbmRpdGlvbnMgYW5kIHRoZSBmb2xsb3dpbmdcbiAqICAgIGRpc2NsYWltZXIgaW4gdGhlIGRvY3VtZW50YXRpb24gYW5kL29yIG90aGVyIG1hdGVyaWFscyBwcm92aWRlZFxuICogICAgd2l0aCB0aGUgZGlzdHJpYnV0aW9uLlxuICogICogTmVpdGhlciB0aGUgbmFtZSBvZiBHb29nbGUgSW5jLiBub3IgdGhlIG5hbWVzIG9mIGl0c1xuICogICAgY29udHJpYnV0b3JzIG1heSBiZSB1c2VkIHRvIGVuZG9yc2Ugb3IgcHJvbW90ZSBwcm9kdWN0cyBkZXJpdmVkXG4gKiAgICBmcm9tIHRoaXMgc29mdHdhcmUgd2l0aG91dCBzcGVjaWZpYyBwcmlvciB3cml0dGVuIHBlcm1pc3Npb24uXG4gKlxuICogVEhJUyBTT0ZUV0FSRSBJUyBQUk9WSURFRCBCWSBUSEUgQ09QWVJJR0hUIEhPTERFUlMgQU5EIENPTlRSSUJVVE9SU1xuICogXCJBUyBJU1wiIEFORCBBTlkgRVhQUkVTUyBPUiBJTVBMSUVEIFdBUlJBTlRJRVMsIElOQ0xVRElORywgQlVUIE5PVFxuICogTElNSVRFRCBUTywgVEhFIElNUExJRUQgV0FSUkFOVElFUyBPRiBNRVJDSEFOVEFCSUxJVFkgQU5EIEZJVE5FU1MgRk9SXG4gKiBBIFBBUlRJQ1VMQVIgUFVSUE9TRSBBUkUgRElTQ0xBSU1FRC4gSU4gTk8gRVZFTlQgU0hBTEwgVEhFIENPUFlSSUdIVFxuICogT1dORVIgT1IgQ09OVFJJQlVUT1JTIEJFIExJQUJMRSBGT1IgQU5ZIERJUkVDVCwgSU5ESVJFQ1QsIElOQ0lERU5UQUwsXG4gKiBTUEVDSUFMLCBFWEVNUExBUlksIE9SIENPTlNFUVVFTlRJQUwgREFNQUdFUyAoSU5DTFVESU5HLCBCVVQgTk9UXG4gKiBMSU1JVEVEIFRPLCBQUk9DVVJFTUVOVCBPRiBTVUJTVElUVVRFIEdPT0RTIE9SIFNFUlZJQ0VTOyBMT1NTIE9GIFVTRSxcbiAqIERBVEEsIE9SIFBST0ZJVFM7IE9SIEJVU0lORVNTIElOVEVSUlVQVElPTikgSE9XRVZFUiBDQVVTRUQgQU5EIE9OIEFOWVxuICogVEhFT1JZIE9GIExJQUJJTElUWSwgV0hFVEhFUiBJTiBDT05UUkFDVCwgU1RSSUNUIExJQUJJTElUWSwgT1IgVE9SVFxuICogKElOQ0xVRElORyBORUdMSUdFTkNFIE9SIE9USEVSV0lTRSkgQVJJU0lORyBJTiBBTlkgV0FZIE9VVCBPRiBUSEUgVVNFXG4gKiBPRiBUSElTIFNPRlRXQVJFLCBFVkVOIElGIEFEVklTRUQgT0YgVEhFIFBPU1NJQklMSVRZIE9GIFNVQ0ggREFNQUdFLlxuICovXG5cbnZhciBiYXNlNjQgPSByZXF1aXJlKCcuL2Jhc2U2NCcpO1xuXG4vLyBBIHNpbmdsZSBiYXNlIDY0IGRpZ2l0IGNhbiBjb250YWluIDYgYml0cyBvZiBkYXRhLiBGb3IgdGhlIGJhc2UgNjQgdmFyaWFibGVcbi8vIGxlbmd0aCBxdWFudGl0aWVzIHdlIHVzZSBpbiB0aGUgc291cmNlIG1hcCBzcGVjLCB0aGUgZmlyc3QgYml0IGlzIHRoZSBzaWduLFxuLy8gdGhlIG5leHQgZm91ciBiaXRzIGFyZSB0aGUgYWN0dWFsIHZhbHVlLCBhbmQgdGhlIDZ0aCBiaXQgaXMgdGhlXG4vLyBjb250aW51YXRpb24gYml0LiBUaGUgY29udGludWF0aW9uIGJpdCB0ZWxscyB1cyB3aGV0aGVyIHRoZXJlIGFyZSBtb3JlXG4vLyBkaWdpdHMgaW4gdGhpcyB2YWx1ZSBmb2xsb3dpbmcgdGhpcyBkaWdpdC5cbi8vXG4vLyAgIENvbnRpbnVhdGlvblxuLy8gICB8ICAgIFNpZ25cbi8vICAgfCAgICB8XG4vLyAgIFYgICAgVlxuLy8gICAxMDEwMTFcblxudmFyIFZMUV9CQVNFX1NISUZUID0gNTtcblxuLy8gYmluYXJ5OiAxMDAwMDBcbnZhciBWTFFfQkFTRSA9IDEgPDwgVkxRX0JBU0VfU0hJRlQ7XG5cbi8vIGJpbmFyeTogMDExMTExXG52YXIgVkxRX0JBU0VfTUFTSyA9IFZMUV9CQVNFIC0gMTtcblxuLy8gYmluYXJ5OiAxMDAwMDBcbnZhciBWTFFfQ09OVElOVUFUSU9OX0JJVCA9IFZMUV9CQVNFO1xuXG4vKipcbiAqIENvbnZlcnRzIGZyb20gYSB0d28tY29tcGxlbWVudCB2YWx1ZSB0byBhIHZhbHVlIHdoZXJlIHRoZSBzaWduIGJpdCBpc1xuICogcGxhY2VkIGluIHRoZSBsZWFzdCBzaWduaWZpY2FudCBiaXQuICBGb3IgZXhhbXBsZSwgYXMgZGVjaW1hbHM6XG4gKiAgIDEgYmVjb21lcyAyICgxMCBiaW5hcnkpLCAtMSBiZWNvbWVzIDMgKDExIGJpbmFyeSlcbiAqICAgMiBiZWNvbWVzIDQgKDEwMCBiaW5hcnkpLCAtMiBiZWNvbWVzIDUgKDEwMSBiaW5hcnkpXG4gKi9cbmZ1bmN0aW9uIHRvVkxRU2lnbmVkKGFWYWx1ZSkge1xuICByZXR1cm4gYVZhbHVlIDwgMFxuICAgID8gKCgtYVZhbHVlKSA8PCAxKSArIDFcbiAgICA6IChhVmFsdWUgPDwgMSkgKyAwO1xufVxuXG4vKipcbiAqIENvbnZlcnRzIHRvIGEgdHdvLWNvbXBsZW1lbnQgdmFsdWUgZnJvbSBhIHZhbHVlIHdoZXJlIHRoZSBzaWduIGJpdCBpc1xuICogcGxhY2VkIGluIHRoZSBsZWFzdCBzaWduaWZpY2FudCBiaXQuICBGb3IgZXhhbXBsZSwgYXMgZGVjaW1hbHM6XG4gKiAgIDIgKDEwIGJpbmFyeSkgYmVjb21lcyAxLCAzICgxMSBiaW5hcnkpIGJlY29tZXMgLTFcbiAqICAgNCAoMTAwIGJpbmFyeSkgYmVjb21lcyAyLCA1ICgxMDEgYmluYXJ5KSBiZWNvbWVzIC0yXG4gKi9cbmZ1bmN0aW9uIGZyb21WTFFTaWduZWQoYVZhbHVlKSB7XG4gIHZhciBpc05lZ2F0aXZlID0gKGFWYWx1ZSAmIDEpID09PSAxO1xuICB2YXIgc2hpZnRlZCA9IGFWYWx1ZSA+PiAxO1xuICByZXR1cm4gaXNOZWdhdGl2ZVxuICAgID8gLXNoaWZ0ZWRcbiAgICA6IHNoaWZ0ZWQ7XG59XG5cbi8qKlxuICogUmV0dXJucyB0aGUgYmFzZSA2NCBWTFEgZW5jb2RlZCB2YWx1ZS5cbiAqL1xuZXhwb3J0cy5lbmNvZGUgPSBmdW5jdGlvbiBiYXNlNjRWTFFfZW5jb2RlKGFWYWx1ZSkge1xuICB2YXIgZW5jb2RlZCA9IFwiXCI7XG4gIHZhciBkaWdpdDtcblxuICB2YXIgdmxxID0gdG9WTFFTaWduZWQoYVZhbHVlKTtcblxuICBkbyB7XG4gICAgZGlnaXQgPSB2bHEgJiBWTFFfQkFTRV9NQVNLO1xuICAgIHZscSA+Pj49IFZMUV9CQVNFX1NISUZUO1xuICAgIGlmICh2bHEgPiAwKSB7XG4gICAgICAvLyBUaGVyZSBhcmUgc3RpbGwgbW9yZSBkaWdpdHMgaW4gdGhpcyB2YWx1ZSwgc28gd2UgbXVzdCBtYWtlIHN1cmUgdGhlXG4gICAgICAvLyBjb250aW51YXRpb24gYml0IGlzIG1hcmtlZC5cbiAgICAgIGRpZ2l0IHw9IFZMUV9DT05USU5VQVRJT05fQklUO1xuICAgIH1cbiAgICBlbmNvZGVkICs9IGJhc2U2NC5lbmNvZGUoZGlnaXQpO1xuICB9IHdoaWxlICh2bHEgPiAwKTtcblxuICByZXR1cm4gZW5jb2RlZDtcbn07XG5cbi8qKlxuICogRGVjb2RlcyB0aGUgbmV4dCBiYXNlIDY0IFZMUSB2YWx1ZSBmcm9tIHRoZSBnaXZlbiBzdHJpbmcgYW5kIHJldHVybnMgdGhlXG4gKiB2YWx1ZSBhbmQgdGhlIHJlc3Qgb2YgdGhlIHN0cmluZyB2aWEgdGhlIG91dCBwYXJhbWV0ZXIuXG4gKi9cbmV4cG9ydHMuZGVjb2RlID0gZnVuY3Rpb24gYmFzZTY0VkxRX2RlY29kZShhU3RyLCBhSW5kZXgsIGFPdXRQYXJhbSkge1xuICB2YXIgc3RyTGVuID0gYVN0ci5sZW5ndGg7XG4gIHZhciByZXN1bHQgPSAwO1xuICB2YXIgc2hpZnQgPSAwO1xuICB2YXIgY29udGludWF0aW9uLCBkaWdpdDtcblxuICBkbyB7XG4gICAgaWYgKGFJbmRleCA+PSBzdHJMZW4pIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcihcIkV4cGVjdGVkIG1vcmUgZGlnaXRzIGluIGJhc2UgNjQgVkxRIHZhbHVlLlwiKTtcbiAgICB9XG5cbiAgICBkaWdpdCA9IGJhc2U2NC5kZWNvZGUoYVN0ci5jaGFyQ29kZUF0KGFJbmRleCsrKSk7XG4gICAgaWYgKGRpZ2l0ID09PSAtMSkge1xuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiSW52YWxpZCBiYXNlNjQgZGlnaXQ6IFwiICsgYVN0ci5jaGFyQXQoYUluZGV4IC0gMSkpO1xuICAgIH1cblxuICAgIGNvbnRpbnVhdGlvbiA9ICEhKGRpZ2l0ICYgVkxRX0NPTlRJTlVBVElPTl9CSVQpO1xuICAgIGRpZ2l0ICY9IFZMUV9CQVNFX01BU0s7XG4gICAgcmVzdWx0ID0gcmVzdWx0ICsgKGRpZ2l0IDw8IHNoaWZ0KTtcbiAgICBzaGlmdCArPSBWTFFfQkFTRV9TSElGVDtcbiAgfSB3aGlsZSAoY29udGludWF0aW9uKTtcblxuICBhT3V0UGFyYW0udmFsdWUgPSBmcm9tVkxRU2lnbmVkKHJlc3VsdCk7XG4gIGFPdXRQYXJhbS5yZXN0ID0gYUluZGV4O1xufTtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2Jhc2U2NC12bHEuanNcbi8vIG1vZHVsZSBpZCA9IDJcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgaW50VG9DaGFyTWFwID0gJ0FCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaYWJjZGVmZ2hpamtsbW5vcHFyc3R1dnd4eXowMTIzNDU2Nzg5Ky8nLnNwbGl0KCcnKTtcblxuLyoqXG4gKiBFbmNvZGUgYW4gaW50ZWdlciBpbiB0aGUgcmFuZ2Ugb2YgMCB0byA2MyB0byBhIHNpbmdsZSBiYXNlIDY0IGRpZ2l0LlxuICovXG5leHBvcnRzLmVuY29kZSA9IGZ1bmN0aW9uIChudW1iZXIpIHtcbiAgaWYgKDAgPD0gbnVtYmVyICYmIG51bWJlciA8IGludFRvQ2hhck1hcC5sZW5ndGgpIHtcbiAgICByZXR1cm4gaW50VG9DaGFyTWFwW251bWJlcl07XG4gIH1cbiAgdGhyb3cgbmV3IFR5cGVFcnJvcihcIk11c3QgYmUgYmV0d2VlbiAwIGFuZCA2MzogXCIgKyBudW1iZXIpO1xufTtcblxuLyoqXG4gKiBEZWNvZGUgYSBzaW5nbGUgYmFzZSA2NCBjaGFyYWN0ZXIgY29kZSBkaWdpdCB0byBhbiBpbnRlZ2VyLiBSZXR1cm5zIC0xIG9uXG4gKiBmYWlsdXJlLlxuICovXG5leHBvcnRzLmRlY29kZSA9IGZ1bmN0aW9uIChjaGFyQ29kZSkge1xuICB2YXIgYmlnQSA9IDY1OyAgICAgLy8gJ0EnXG4gIHZhciBiaWdaID0gOTA7ICAgICAvLyAnWidcblxuICB2YXIgbGl0dGxlQSA9IDk3OyAgLy8gJ2EnXG4gIHZhciBsaXR0bGVaID0gMTIyOyAvLyAneidcblxuICB2YXIgemVybyA9IDQ4OyAgICAgLy8gJzAnXG4gIHZhciBuaW5lID0gNTc7ICAgICAvLyAnOSdcblxuICB2YXIgcGx1cyA9IDQzOyAgICAgLy8gJysnXG4gIHZhciBzbGFzaCA9IDQ3OyAgICAvLyAnLydcblxuICB2YXIgbGl0dGxlT2Zmc2V0ID0gMjY7XG4gIHZhciBudW1iZXJPZmZzZXQgPSA1MjtcblxuICAvLyAwIC0gMjU6IEFCQ0RFRkdISUpLTE1OT1BRUlNUVVZXWFlaXG4gIGlmIChiaWdBIDw9IGNoYXJDb2RlICYmIGNoYXJDb2RlIDw9IGJpZ1opIHtcbiAgICByZXR1cm4gKGNoYXJDb2RlIC0gYmlnQSk7XG4gIH1cblxuICAvLyAyNiAtIDUxOiBhYmNkZWZnaGlqa2xtbm9wcXJzdHV2d3h5elxuICBpZiAobGl0dGxlQSA8PSBjaGFyQ29kZSAmJiBjaGFyQ29kZSA8PSBsaXR0bGVaKSB7XG4gICAgcmV0dXJuIChjaGFyQ29kZSAtIGxpdHRsZUEgKyBsaXR0bGVPZmZzZXQpO1xuICB9XG5cbiAgLy8gNTIgLSA2MTogMDEyMzQ1Njc4OVxuICBpZiAoemVybyA8PSBjaGFyQ29kZSAmJiBjaGFyQ29kZSA8PSBuaW5lKSB7XG4gICAgcmV0dXJuIChjaGFyQ29kZSAtIHplcm8gKyBudW1iZXJPZmZzZXQpO1xuICB9XG5cbiAgLy8gNjI6ICtcbiAgaWYgKGNoYXJDb2RlID09IHBsdXMpIHtcbiAgICByZXR1cm4gNjI7XG4gIH1cblxuICAvLyA2MzogL1xuICBpZiAoY2hhckNvZGUgPT0gc2xhc2gpIHtcbiAgICByZXR1cm4gNjM7XG4gIH1cblxuICAvLyBJbnZhbGlkIGJhc2U2NCBkaWdpdC5cbiAgcmV0dXJuIC0xO1xufTtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2Jhc2U2NC5qc1xuLy8gbW9kdWxlIGlkID0gM1xuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbi8qKlxuICogVGhpcyBpcyBhIGhlbHBlciBmdW5jdGlvbiBmb3IgZ2V0dGluZyB2YWx1ZXMgZnJvbSBwYXJhbWV0ZXIvb3B0aW9uc1xuICogb2JqZWN0cy5cbiAqXG4gKiBAcGFyYW0gYXJncyBUaGUgb2JqZWN0IHdlIGFyZSBleHRyYWN0aW5nIHZhbHVlcyBmcm9tXG4gKiBAcGFyYW0gbmFtZSBUaGUgbmFtZSBvZiB0aGUgcHJvcGVydHkgd2UgYXJlIGdldHRpbmcuXG4gKiBAcGFyYW0gZGVmYXVsdFZhbHVlIEFuIG9wdGlvbmFsIHZhbHVlIHRvIHJldHVybiBpZiB0aGUgcHJvcGVydHkgaXMgbWlzc2luZ1xuICogZnJvbSB0aGUgb2JqZWN0LiBJZiB0aGlzIGlzIG5vdCBzcGVjaWZpZWQgYW5kIHRoZSBwcm9wZXJ0eSBpcyBtaXNzaW5nLCBhblxuICogZXJyb3Igd2lsbCBiZSB0aHJvd24uXG4gKi9cbmZ1bmN0aW9uIGdldEFyZyhhQXJncywgYU5hbWUsIGFEZWZhdWx0VmFsdWUpIHtcbiAgaWYgKGFOYW1lIGluIGFBcmdzKSB7XG4gICAgcmV0dXJuIGFBcmdzW2FOYW1lXTtcbiAgfSBlbHNlIGlmIChhcmd1bWVudHMubGVuZ3RoID09PSAzKSB7XG4gICAgcmV0dXJuIGFEZWZhdWx0VmFsdWU7XG4gIH0gZWxzZSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdcIicgKyBhTmFtZSArICdcIiBpcyBhIHJlcXVpcmVkIGFyZ3VtZW50LicpO1xuICB9XG59XG5leHBvcnRzLmdldEFyZyA9IGdldEFyZztcblxudmFyIHVybFJlZ2V4cCA9IC9eKD86KFtcXHcrXFwtLl0rKTopP1xcL1xcLyg/OihcXHcrOlxcdyspQCk/KFtcXHcuLV0qKSg/OjooXFxkKykpPyguKikkLztcbnZhciBkYXRhVXJsUmVnZXhwID0gL15kYXRhOi4rXFwsLiskLztcblxuZnVuY3Rpb24gdXJsUGFyc2UoYVVybCkge1xuICB2YXIgbWF0Y2ggPSBhVXJsLm1hdGNoKHVybFJlZ2V4cCk7XG4gIGlmICghbWF0Y2gpIHtcbiAgICByZXR1cm4gbnVsbDtcbiAgfVxuICByZXR1cm4ge1xuICAgIHNjaGVtZTogbWF0Y2hbMV0sXG4gICAgYXV0aDogbWF0Y2hbMl0sXG4gICAgaG9zdDogbWF0Y2hbM10sXG4gICAgcG9ydDogbWF0Y2hbNF0sXG4gICAgcGF0aDogbWF0Y2hbNV1cbiAgfTtcbn1cbmV4cG9ydHMudXJsUGFyc2UgPSB1cmxQYXJzZTtcblxuZnVuY3Rpb24gdXJsR2VuZXJhdGUoYVBhcnNlZFVybCkge1xuICB2YXIgdXJsID0gJyc7XG4gIGlmIChhUGFyc2VkVXJsLnNjaGVtZSkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLnNjaGVtZSArICc6JztcbiAgfVxuICB1cmwgKz0gJy8vJztcbiAgaWYgKGFQYXJzZWRVcmwuYXV0aCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmF1dGggKyAnQCc7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwuaG9zdCkge1xuICAgIHVybCArPSBhUGFyc2VkVXJsLmhvc3Q7XG4gIH1cbiAgaWYgKGFQYXJzZWRVcmwucG9ydCkge1xuICAgIHVybCArPSBcIjpcIiArIGFQYXJzZWRVcmwucG9ydFxuICB9XG4gIGlmIChhUGFyc2VkVXJsLnBhdGgpIHtcbiAgICB1cmwgKz0gYVBhcnNlZFVybC5wYXRoO1xuICB9XG4gIHJldHVybiB1cmw7XG59XG5leHBvcnRzLnVybEdlbmVyYXRlID0gdXJsR2VuZXJhdGU7XG5cbi8qKlxuICogTm9ybWFsaXplcyBhIHBhdGgsIG9yIHRoZSBwYXRoIHBvcnRpb24gb2YgYSBVUkw6XG4gKlxuICogLSBSZXBsYWNlcyBjb25zZWN1dGl2ZSBzbGFzaGVzIHdpdGggb25lIHNsYXNoLlxuICogLSBSZW1vdmVzIHVubmVjZXNzYXJ5ICcuJyBwYXJ0cy5cbiAqIC0gUmVtb3ZlcyB1bm5lY2Vzc2FyeSAnPGRpcj4vLi4nIHBhcnRzLlxuICpcbiAqIEJhc2VkIG9uIGNvZGUgaW4gdGhlIE5vZGUuanMgJ3BhdGgnIGNvcmUgbW9kdWxlLlxuICpcbiAqIEBwYXJhbSBhUGF0aCBUaGUgcGF0aCBvciB1cmwgdG8gbm9ybWFsaXplLlxuICovXG5mdW5jdGlvbiBub3JtYWxpemUoYVBhdGgpIHtcbiAgdmFyIHBhdGggPSBhUGF0aDtcbiAgdmFyIHVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgaWYgKHVybCkge1xuICAgIGlmICghdXJsLnBhdGgpIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG4gICAgcGF0aCA9IHVybC5wYXRoO1xuICB9XG4gIHZhciBpc0Fic29sdXRlID0gZXhwb3J0cy5pc0Fic29sdXRlKHBhdGgpO1xuXG4gIHZhciBwYXJ0cyA9IHBhdGguc3BsaXQoL1xcLysvKTtcbiAgZm9yICh2YXIgcGFydCwgdXAgPSAwLCBpID0gcGFydHMubGVuZ3RoIC0gMTsgaSA+PSAwOyBpLS0pIHtcbiAgICBwYXJ0ID0gcGFydHNbaV07XG4gICAgaWYgKHBhcnQgPT09ICcuJykge1xuICAgICAgcGFydHMuc3BsaWNlKGksIDEpO1xuICAgIH0gZWxzZSBpZiAocGFydCA9PT0gJy4uJykge1xuICAgICAgdXArKztcbiAgICB9IGVsc2UgaWYgKHVwID4gMCkge1xuICAgICAgaWYgKHBhcnQgPT09ICcnKSB7XG4gICAgICAgIC8vIFRoZSBmaXJzdCBwYXJ0IGlzIGJsYW5rIGlmIHRoZSBwYXRoIGlzIGFic29sdXRlLiBUcnlpbmcgdG8gZ29cbiAgICAgICAgLy8gYWJvdmUgdGhlIHJvb3QgaXMgYSBuby1vcC4gVGhlcmVmb3JlIHdlIGNhbiByZW1vdmUgYWxsICcuLicgcGFydHNcbiAgICAgICAgLy8gZGlyZWN0bHkgYWZ0ZXIgdGhlIHJvb3QuXG4gICAgICAgIHBhcnRzLnNwbGljZShpICsgMSwgdXApO1xuICAgICAgICB1cCA9IDA7XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBwYXJ0cy5zcGxpY2UoaSwgMik7XG4gICAgICAgIHVwLS07XG4gICAgICB9XG4gICAgfVxuICB9XG4gIHBhdGggPSBwYXJ0cy5qb2luKCcvJyk7XG5cbiAgaWYgKHBhdGggPT09ICcnKSB7XG4gICAgcGF0aCA9IGlzQWJzb2x1dGUgPyAnLycgOiAnLic7XG4gIH1cblxuICBpZiAodXJsKSB7XG4gICAgdXJsLnBhdGggPSBwYXRoO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZSh1cmwpO1xuICB9XG4gIHJldHVybiBwYXRoO1xufVxuZXhwb3J0cy5ub3JtYWxpemUgPSBub3JtYWxpemU7XG5cbi8qKlxuICogSm9pbnMgdHdvIHBhdGhzL1VSTHMuXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBqb2luZWQgd2l0aCB0aGUgcm9vdC5cbiAqXG4gKiAtIElmIGFQYXRoIGlzIGEgVVJMIG9yIGEgZGF0YSBVUkksIGFQYXRoIGlzIHJldHVybmVkLCB1bmxlc3MgYVBhdGggaXMgYVxuICogICBzY2hlbWUtcmVsYXRpdmUgVVJMOiBUaGVuIHRoZSBzY2hlbWUgb2YgYVJvb3QsIGlmIGFueSwgaXMgcHJlcGVuZGVkXG4gKiAgIGZpcnN0LlxuICogLSBPdGhlcndpc2UgYVBhdGggaXMgYSBwYXRoLiBJZiBhUm9vdCBpcyBhIFVSTCwgdGhlbiBpdHMgcGF0aCBwb3J0aW9uXG4gKiAgIGlzIHVwZGF0ZWQgd2l0aCB0aGUgcmVzdWx0IGFuZCBhUm9vdCBpcyByZXR1cm5lZC4gT3RoZXJ3aXNlIHRoZSByZXN1bHRcbiAqICAgaXMgcmV0dXJuZWQuXG4gKiAgIC0gSWYgYVBhdGggaXMgYWJzb2x1dGUsIHRoZSByZXN1bHQgaXMgYVBhdGguXG4gKiAgIC0gT3RoZXJ3aXNlIHRoZSB0d28gcGF0aHMgYXJlIGpvaW5lZCB3aXRoIGEgc2xhc2guXG4gKiAtIEpvaW5pbmcgZm9yIGV4YW1wbGUgJ2h0dHA6Ly8nIGFuZCAnd3d3LmV4YW1wbGUuY29tJyBpcyBhbHNvIHN1cHBvcnRlZC5cbiAqL1xuZnVuY3Rpb24gam9pbihhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuICBpZiAoYVBhdGggPT09IFwiXCIpIHtcbiAgICBhUGF0aCA9IFwiLlwiO1xuICB9XG4gIHZhciBhUGF0aFVybCA9IHVybFBhcnNlKGFQYXRoKTtcbiAgdmFyIGFSb290VXJsID0gdXJsUGFyc2UoYVJvb3QpO1xuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdCA9IGFSb290VXJsLnBhdGggfHwgJy8nO1xuICB9XG5cbiAgLy8gYGpvaW4oZm9vLCAnLy93d3cuZXhhbXBsZS5vcmcnKWBcbiAgaWYgKGFQYXRoVXJsICYmICFhUGF0aFVybC5zY2hlbWUpIHtcbiAgICBpZiAoYVJvb3RVcmwpIHtcbiAgICAgIGFQYXRoVXJsLnNjaGVtZSA9IGFSb290VXJsLnNjaGVtZTtcbiAgICB9XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFQYXRoVXJsKTtcbiAgfVxuXG4gIGlmIChhUGF0aFVybCB8fCBhUGF0aC5tYXRjaChkYXRhVXJsUmVnZXhwKSkge1xuICAgIHJldHVybiBhUGF0aDtcbiAgfVxuXG4gIC8vIGBqb2luKCdodHRwOi8vJywgJ3d3dy5leGFtcGxlLmNvbScpYFxuICBpZiAoYVJvb3RVcmwgJiYgIWFSb290VXJsLmhvc3QgJiYgIWFSb290VXJsLnBhdGgpIHtcbiAgICBhUm9vdFVybC5ob3N0ID0gYVBhdGg7XG4gICAgcmV0dXJuIHVybEdlbmVyYXRlKGFSb290VXJsKTtcbiAgfVxuXG4gIHZhciBqb2luZWQgPSBhUGF0aC5jaGFyQXQoMCkgPT09ICcvJ1xuICAgID8gYVBhdGhcbiAgICA6IG5vcm1hbGl6ZShhUm9vdC5yZXBsYWNlKC9cXC8rJC8sICcnKSArICcvJyArIGFQYXRoKTtcblxuICBpZiAoYVJvb3RVcmwpIHtcbiAgICBhUm9vdFVybC5wYXRoID0gam9pbmVkO1xuICAgIHJldHVybiB1cmxHZW5lcmF0ZShhUm9vdFVybCk7XG4gIH1cbiAgcmV0dXJuIGpvaW5lZDtcbn1cbmV4cG9ydHMuam9pbiA9IGpvaW47XG5cbmV4cG9ydHMuaXNBYnNvbHV0ZSA9IGZ1bmN0aW9uIChhUGF0aCkge1xuICByZXR1cm4gYVBhdGguY2hhckF0KDApID09PSAnLycgfHwgdXJsUmVnZXhwLnRlc3QoYVBhdGgpO1xufTtcblxuLyoqXG4gKiBNYWtlIGEgcGF0aCByZWxhdGl2ZSB0byBhIFVSTCBvciBhbm90aGVyIHBhdGguXG4gKlxuICogQHBhcmFtIGFSb290IFRoZSByb290IHBhdGggb3IgVVJMLlxuICogQHBhcmFtIGFQYXRoIFRoZSBwYXRoIG9yIFVSTCB0byBiZSBtYWRlIHJlbGF0aXZlIHRvIGFSb290LlxuICovXG5mdW5jdGlvbiByZWxhdGl2ZShhUm9vdCwgYVBhdGgpIHtcbiAgaWYgKGFSb290ID09PSBcIlwiKSB7XG4gICAgYVJvb3QgPSBcIi5cIjtcbiAgfVxuXG4gIGFSb290ID0gYVJvb3QucmVwbGFjZSgvXFwvJC8sICcnKTtcblxuICAvLyBJdCBpcyBwb3NzaWJsZSBmb3IgdGhlIHBhdGggdG8gYmUgYWJvdmUgdGhlIHJvb3QuIEluIHRoaXMgY2FzZSwgc2ltcGx5XG4gIC8vIGNoZWNraW5nIHdoZXRoZXIgdGhlIHJvb3QgaXMgYSBwcmVmaXggb2YgdGhlIHBhdGggd29uJ3Qgd29yay4gSW5zdGVhZCwgd2VcbiAgLy8gbmVlZCB0byByZW1vdmUgY29tcG9uZW50cyBmcm9tIHRoZSByb290IG9uZSBieSBvbmUsIHVudGlsIGVpdGhlciB3ZSBmaW5kXG4gIC8vIGEgcHJlZml4IHRoYXQgZml0cywgb3Igd2UgcnVuIG91dCBvZiBjb21wb25lbnRzIHRvIHJlbW92ZS5cbiAgdmFyIGxldmVsID0gMDtcbiAgd2hpbGUgKGFQYXRoLmluZGV4T2YoYVJvb3QgKyAnLycpICE9PSAwKSB7XG4gICAgdmFyIGluZGV4ID0gYVJvb3QubGFzdEluZGV4T2YoXCIvXCIpO1xuICAgIGlmIChpbmRleCA8IDApIHtcbiAgICAgIHJldHVybiBhUGF0aDtcbiAgICB9XG5cbiAgICAvLyBJZiB0aGUgb25seSBwYXJ0IG9mIHRoZSByb290IHRoYXQgaXMgbGVmdCBpcyB0aGUgc2NoZW1lIChpLmUuIGh0dHA6Ly8sXG4gICAgLy8gZmlsZTovLy8sIGV0Yy4pLCBvbmUgb3IgbW9yZSBzbGFzaGVzICgvKSwgb3Igc2ltcGx5IG5vdGhpbmcgYXQgYWxsLCB3ZVxuICAgIC8vIGhhdmUgZXhoYXVzdGVkIGFsbCBjb21wb25lbnRzLCBzbyB0aGUgcGF0aCBpcyBub3QgcmVsYXRpdmUgdG8gdGhlIHJvb3QuXG4gICAgYVJvb3QgPSBhUm9vdC5zbGljZSgwLCBpbmRleCk7XG4gICAgaWYgKGFSb290Lm1hdGNoKC9eKFteXFwvXSs6XFwvKT9cXC8qJC8pKSB7XG4gICAgICByZXR1cm4gYVBhdGg7XG4gICAgfVxuXG4gICAgKytsZXZlbDtcbiAgfVxuXG4gIC8vIE1ha2Ugc3VyZSB3ZSBhZGQgYSBcIi4uL1wiIGZvciBlYWNoIGNvbXBvbmVudCB3ZSByZW1vdmVkIGZyb20gdGhlIHJvb3QuXG4gIHJldHVybiBBcnJheShsZXZlbCArIDEpLmpvaW4oXCIuLi9cIikgKyBhUGF0aC5zdWJzdHIoYVJvb3QubGVuZ3RoICsgMSk7XG59XG5leHBvcnRzLnJlbGF0aXZlID0gcmVsYXRpdmU7XG5cbnZhciBzdXBwb3J0c051bGxQcm90byA9IChmdW5jdGlvbiAoKSB7XG4gIHZhciBvYmogPSBPYmplY3QuY3JlYXRlKG51bGwpO1xuICByZXR1cm4gISgnX19wcm90b19fJyBpbiBvYmopO1xufSgpKTtcblxuZnVuY3Rpb24gaWRlbnRpdHkgKHMpIHtcbiAgcmV0dXJuIHM7XG59XG5cbi8qKlxuICogQmVjYXVzZSBiZWhhdmlvciBnb2VzIHdhY2t5IHdoZW4geW91IHNldCBgX19wcm90b19fYCBvbiBvYmplY3RzLCB3ZVxuICogaGF2ZSB0byBwcmVmaXggYWxsIHRoZSBzdHJpbmdzIGluIG91ciBzZXQgd2l0aCBhbiBhcmJpdHJhcnkgY2hhcmFjdGVyLlxuICpcbiAqIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL3B1bGwvMzEgYW5kXG4gKiBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8zMFxuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5mdW5jdGlvbiB0b1NldFN0cmluZyhhU3RyKSB7XG4gIGlmIChpc1Byb3RvU3RyaW5nKGFTdHIpKSB7XG4gICAgcmV0dXJuICckJyArIGFTdHI7XG4gIH1cblxuICByZXR1cm4gYVN0cjtcbn1cbmV4cG9ydHMudG9TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogdG9TZXRTdHJpbmc7XG5cbmZ1bmN0aW9uIGZyb21TZXRTdHJpbmcoYVN0cikge1xuICBpZiAoaXNQcm90b1N0cmluZyhhU3RyKSkge1xuICAgIHJldHVybiBhU3RyLnNsaWNlKDEpO1xuICB9XG5cbiAgcmV0dXJuIGFTdHI7XG59XG5leHBvcnRzLmZyb21TZXRTdHJpbmcgPSBzdXBwb3J0c051bGxQcm90byA/IGlkZW50aXR5IDogZnJvbVNldFN0cmluZztcblxuZnVuY3Rpb24gaXNQcm90b1N0cmluZyhzKSB7XG4gIGlmICghcykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIHZhciBsZW5ndGggPSBzLmxlbmd0aDtcblxuICBpZiAobGVuZ3RoIDwgOSAvKiBcIl9fcHJvdG9fX1wiLmxlbmd0aCAqLykge1xuICAgIHJldHVybiBmYWxzZTtcbiAgfVxuXG4gIGlmIChzLmNoYXJDb2RlQXQobGVuZ3RoIC0gMSkgIT09IDk1ICAvKiAnXycgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSAyKSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDMpICE9PSAxMTEgLyogJ28nICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNCkgIT09IDExNiAvKiAndCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA1KSAhPT0gMTExIC8qICdvJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDYpICE9PSAxMTQgLyogJ3InICovIHx8XG4gICAgICBzLmNoYXJDb2RlQXQobGVuZ3RoIC0gNykgIT09IDExMiAvKiAncCcgKi8gfHxcbiAgICAgIHMuY2hhckNvZGVBdChsZW5ndGggLSA4KSAhPT0gOTUgIC8qICdfJyAqLyB8fFxuICAgICAgcy5jaGFyQ29kZUF0KGxlbmd0aCAtIDkpICE9PSA5NSAgLyogJ18nICovKSB7XG4gICAgcmV0dXJuIGZhbHNlO1xuICB9XG5cbiAgZm9yICh2YXIgaSA9IGxlbmd0aCAtIDEwOyBpID49IDA7IGktLSkge1xuICAgIGlmIChzLmNoYXJDb2RlQXQoaSkgIT09IDM2IC8qICckJyAqLykge1xuICAgICAgcmV0dXJuIGZhbHNlO1xuICAgIH1cbiAgfVxuXG4gIHJldHVybiB0cnVlO1xufVxuXG4vKipcbiAqIENvbXBhcmF0b3IgYmV0d2VlbiB0d28gbWFwcGluZ3Mgd2hlcmUgdGhlIG9yaWdpbmFsIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKlxuICogT3B0aW9uYWxseSBwYXNzIGluIGB0cnVlYCBhcyBgb25seUNvbXBhcmVHZW5lcmF0ZWRgIHRvIGNvbnNpZGVyIHR3b1xuICogbWFwcGluZ3Mgd2l0aCB0aGUgc2FtZSBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4sIGJ1dCBkaWZmZXJlbnQgZ2VuZXJhdGVkXG4gKiBsaW5lIGFuZCBjb2x1bW4gdGhlIHNhbWUuIFVzZWZ1bCB3aGVuIHNlYXJjaGluZyBmb3IgYSBtYXBwaW5nIHdpdGggYVxuICogc3R1YmJlZCBvdXQgbWFwcGluZy5cbiAqL1xuZnVuY3Rpb24gY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMobWFwcGluZ0EsIG1hcHBpbmdCLCBvbmx5Q29tcGFyZU9yaWdpbmFsKSB7XG4gIHZhciBjbXAgPSBzdHJjbXAobWFwcGluZ0Euc291cmNlLCBtYXBwaW5nQi5zb3VyY2UpO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsTGluZSAtIG1hcHBpbmdCLm9yaWdpbmFsTGluZTtcbiAgaWYgKGNtcCAhPT0gMCkge1xuICAgIHJldHVybiBjbXA7XG4gIH1cblxuICBjbXAgPSBtYXBwaW5nQS5vcmlnaW5hbENvbHVtbiAtIG1hcHBpbmdCLm9yaWdpbmFsQ29sdW1uO1xuICBpZiAoY21wICE9PSAwIHx8IG9ubHlDb21wYXJlT3JpZ2luYWwpIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLmdlbmVyYXRlZExpbmUgLSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIHJldHVybiBzdHJjbXAobWFwcGluZ0EubmFtZSwgbWFwcGluZ0IubmFtZSk7XG59XG5leHBvcnRzLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zID0gY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnM7XG5cbi8qKlxuICogQ29tcGFyYXRvciBiZXR3ZWVuIHR3byBtYXBwaW5ncyB3aXRoIGRlZmxhdGVkIHNvdXJjZSBhbmQgbmFtZSBpbmRpY2VzIHdoZXJlXG4gKiB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKlxuICogT3B0aW9uYWxseSBwYXNzIGluIGB0cnVlYCBhcyBgb25seUNvbXBhcmVHZW5lcmF0ZWRgIHRvIGNvbnNpZGVyIHR3b1xuICogbWFwcGluZ3Mgd2l0aCB0aGUgc2FtZSBnZW5lcmF0ZWQgbGluZSBhbmQgY29sdW1uLCBidXQgZGlmZmVyZW50XG4gKiBzb3VyY2UvbmFtZS9vcmlnaW5hbCBsaW5lIGFuZCBjb2x1bW4gdGhlIHNhbWUuIFVzZWZ1bCB3aGVuIHNlYXJjaGluZyBmb3IgYVxuICogbWFwcGluZyB3aXRoIGEgc3R1YmJlZCBvdXQgbWFwcGluZy5cbiAqL1xuZnVuY3Rpb24gY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQobWFwcGluZ0EsIG1hcHBpbmdCLCBvbmx5Q29tcGFyZUdlbmVyYXRlZCkge1xuICB2YXIgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwIHx8IG9ubHlDb21wYXJlR2VuZXJhdGVkKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IHN0cmNtcChtYXBwaW5nQS5zb3VyY2UsIG1hcHBpbmdCLnNvdXJjZSk7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIHN0cmNtcChtYXBwaW5nQS5uYW1lLCBtYXBwaW5nQi5uYW1lKTtcbn1cbmV4cG9ydHMuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQgPSBjb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNEZWZsYXRlZDtcblxuZnVuY3Rpb24gc3RyY21wKGFTdHIxLCBhU3RyMikge1xuICBpZiAoYVN0cjEgPT09IGFTdHIyKSB7XG4gICAgcmV0dXJuIDA7XG4gIH1cblxuICBpZiAoYVN0cjEgPT09IG51bGwpIHtcbiAgICByZXR1cm4gMTsgLy8gYVN0cjIgIT09IG51bGxcbiAgfVxuXG4gIGlmIChhU3RyMiA9PT0gbnVsbCkge1xuICAgIHJldHVybiAtMTsgLy8gYVN0cjEgIT09IG51bGxcbiAgfVxuXG4gIGlmIChhU3RyMSA+IGFTdHIyKSB7XG4gICAgcmV0dXJuIDE7XG4gIH1cblxuICByZXR1cm4gLTE7XG59XG5cbi8qKlxuICogQ29tcGFyYXRvciBiZXR3ZWVuIHR3byBtYXBwaW5ncyB3aXRoIGluZmxhdGVkIHNvdXJjZSBhbmQgbmFtZSBzdHJpbmdzIHdoZXJlXG4gKiB0aGUgZ2VuZXJhdGVkIHBvc2l0aW9ucyBhcmUgY29tcGFyZWQuXG4gKi9cbmZ1bmN0aW9uIGNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0luZmxhdGVkKG1hcHBpbmdBLCBtYXBwaW5nQikge1xuICB2YXIgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkTGluZSAtIG1hcHBpbmdCLmdlbmVyYXRlZExpbmU7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0EuZ2VuZXJhdGVkQ29sdW1uIC0gbWFwcGluZ0IuZ2VuZXJhdGVkQ29sdW1uO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IHN0cmNtcChtYXBwaW5nQS5zb3VyY2UsIG1hcHBpbmdCLnNvdXJjZSk7XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgY21wID0gbWFwcGluZ0Eub3JpZ2luYWxMaW5lIC0gbWFwcGluZ0Iub3JpZ2luYWxMaW5lO1xuICBpZiAoY21wICE9PSAwKSB7XG4gICAgcmV0dXJuIGNtcDtcbiAgfVxuXG4gIGNtcCA9IG1hcHBpbmdBLm9yaWdpbmFsQ29sdW1uIC0gbWFwcGluZ0Iub3JpZ2luYWxDb2x1bW47XG4gIGlmIChjbXAgIT09IDApIHtcbiAgICByZXR1cm4gY21wO1xuICB9XG5cbiAgcmV0dXJuIHN0cmNtcChtYXBwaW5nQS5uYW1lLCBtYXBwaW5nQi5uYW1lKTtcbn1cbmV4cG9ydHMuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zSW5mbGF0ZWQgPSBjb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZDtcblxuLyoqXG4gKiBTdHJpcCBhbnkgSlNPTiBYU1NJIGF2b2lkYW5jZSBwcmVmaXggZnJvbSB0aGUgc3RyaW5nIChhcyBkb2N1bWVudGVkXG4gKiBpbiB0aGUgc291cmNlIG1hcHMgc3BlY2lmaWNhdGlvbiksIGFuZCB0aGVuIHBhcnNlIHRoZSBzdHJpbmcgYXNcbiAqIEpTT04uXG4gKi9cbmZ1bmN0aW9uIHBhcnNlU291cmNlTWFwSW5wdXQoc3RyKSB7XG4gIHJldHVybiBKU09OLnBhcnNlKHN0ci5yZXBsYWNlKC9eXFwpXX0nW15cXG5dKlxcbi8sICcnKSk7XG59XG5leHBvcnRzLnBhcnNlU291cmNlTWFwSW5wdXQgPSBwYXJzZVNvdXJjZU1hcElucHV0O1xuXG4vKipcbiAqIENvbXB1dGUgdGhlIFVSTCBvZiBhIHNvdXJjZSBnaXZlbiB0aGUgdGhlIHNvdXJjZSByb290LCB0aGUgc291cmNlJ3NcbiAqIFVSTCwgYW5kIHRoZSBzb3VyY2UgbWFwJ3MgVVJMLlxuICovXG5mdW5jdGlvbiBjb21wdXRlU291cmNlVVJMKHNvdXJjZVJvb3QsIHNvdXJjZVVSTCwgc291cmNlTWFwVVJMKSB7XG4gIHNvdXJjZVVSTCA9IHNvdXJjZVVSTCB8fCAnJztcblxuICBpZiAoc291cmNlUm9vdCkge1xuICAgIC8vIFRoaXMgZm9sbG93cyB3aGF0IENocm9tZSBkb2VzLlxuICAgIGlmIChzb3VyY2VSb290W3NvdXJjZVJvb3QubGVuZ3RoIC0gMV0gIT09ICcvJyAmJiBzb3VyY2VVUkxbMF0gIT09ICcvJykge1xuICAgICAgc291cmNlUm9vdCArPSAnLyc7XG4gICAgfVxuICAgIC8vIFRoZSBzcGVjIHNheXM6XG4gICAgLy8gICBMaW5lIDQ6IEFuIG9wdGlvbmFsIHNvdXJjZSByb290LCB1c2VmdWwgZm9yIHJlbG9jYXRpbmcgc291cmNlXG4gICAgLy8gICBmaWxlcyBvbiBhIHNlcnZlciBvciByZW1vdmluZyByZXBlYXRlZCB2YWx1ZXMgaW4gdGhlXG4gICAgLy8gICDigJxzb3VyY2Vz4oCdIGVudHJ5LiAgVGhpcyB2YWx1ZSBpcyBwcmVwZW5kZWQgdG8gdGhlIGluZGl2aWR1YWxcbiAgICAvLyAgIGVudHJpZXMgaW4gdGhlIOKAnHNvdXJjZeKAnSBmaWVsZC5cbiAgICBzb3VyY2VVUkwgPSBzb3VyY2VSb290ICsgc291cmNlVVJMO1xuICB9XG5cbiAgLy8gSGlzdG9yaWNhbGx5LCBTb3VyY2VNYXBDb25zdW1lciBkaWQgbm90IHRha2UgdGhlIHNvdXJjZU1hcFVSTCBhc1xuICAvLyBhIHBhcmFtZXRlci4gIFRoaXMgbW9kZSBpcyBzdGlsbCBzb21ld2hhdCBzdXBwb3J0ZWQsIHdoaWNoIGlzIHdoeVxuICAvLyB0aGlzIGNvZGUgYmxvY2sgaXMgY29uZGl0aW9uYWwuICBIb3dldmVyLCBpdCdzIHByZWZlcmFibGUgdG8gcGFzc1xuICAvLyB0aGUgc291cmNlIG1hcCBVUkwgdG8gU291cmNlTWFwQ29uc3VtZXIsIHNvIHRoYXQgdGhpcyBmdW5jdGlvblxuICAvLyBjYW4gaW1wbGVtZW50IHRoZSBzb3VyY2UgVVJMIHJlc29sdXRpb24gYWxnb3JpdGhtIGFzIG91dGxpbmVkIGluXG4gIC8vIHRoZSBzcGVjLiAgVGhpcyBibG9jayBpcyBiYXNpY2FsbHkgdGhlIGVxdWl2YWxlbnQgb2Y6XG4gIC8vICAgIG5ldyBVUkwoc291cmNlVVJMLCBzb3VyY2VNYXBVUkwpLnRvU3RyaW5nKClcbiAgLy8gLi4uIGV4Y2VwdCBpdCBhdm9pZHMgdXNpbmcgVVJMLCB3aGljaCB3YXNuJ3QgYXZhaWxhYmxlIGluIHRoZVxuICAvLyBvbGRlciByZWxlYXNlcyBvZiBub2RlIHN0aWxsIHN1cHBvcnRlZCBieSB0aGlzIGxpYnJhcnkuXG4gIC8vXG4gIC8vIFRoZSBzcGVjIHNheXM6XG4gIC8vICAgSWYgdGhlIHNvdXJjZXMgYXJlIG5vdCBhYnNvbHV0ZSBVUkxzIGFmdGVyIHByZXBlbmRpbmcgb2YgdGhlXG4gIC8vICAg4oCcc291cmNlUm9vdOKAnSwgdGhlIHNvdXJjZXMgYXJlIHJlc29sdmVkIHJlbGF0aXZlIHRvIHRoZVxuICAvLyAgIFNvdXJjZU1hcCAobGlrZSByZXNvbHZpbmcgc2NyaXB0IHNyYyBpbiBhIGh0bWwgZG9jdW1lbnQpLlxuICBpZiAoc291cmNlTWFwVVJMKSB7XG4gICAgdmFyIHBhcnNlZCA9IHVybFBhcnNlKHNvdXJjZU1hcFVSTCk7XG4gICAgaWYgKCFwYXJzZWQpIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcihcInNvdXJjZU1hcFVSTCBjb3VsZCBub3QgYmUgcGFyc2VkXCIpO1xuICAgIH1cbiAgICBpZiAocGFyc2VkLnBhdGgpIHtcbiAgICAgIC8vIFN0cmlwIHRoZSBsYXN0IHBhdGggY29tcG9uZW50LCBidXQga2VlcCB0aGUgXCIvXCIuXG4gICAgICB2YXIgaW5kZXggPSBwYXJzZWQucGF0aC5sYXN0SW5kZXhPZignLycpO1xuICAgICAgaWYgKGluZGV4ID49IDApIHtcbiAgICAgICAgcGFyc2VkLnBhdGggPSBwYXJzZWQucGF0aC5zdWJzdHJpbmcoMCwgaW5kZXggKyAxKTtcbiAgICAgIH1cbiAgICB9XG4gICAgc291cmNlVVJMID0gam9pbih1cmxHZW5lcmF0ZShwYXJzZWQpLCBzb3VyY2VVUkwpO1xuICB9XG5cbiAgcmV0dXJuIG5vcm1hbGl6ZShzb3VyY2VVUkwpO1xufVxuZXhwb3J0cy5jb21wdXRlU291cmNlVVJMID0gY29tcHV0ZVNvdXJjZVVSTDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL3V0aWwuanNcbi8vIG1vZHVsZSBpZCA9IDRcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGhhcyA9IE9iamVjdC5wcm90b3R5cGUuaGFzT3duUHJvcGVydHk7XG52YXIgaGFzTmF0aXZlTWFwID0gdHlwZW9mIE1hcCAhPT0gXCJ1bmRlZmluZWRcIjtcblxuLyoqXG4gKiBBIGRhdGEgc3RydWN0dXJlIHdoaWNoIGlzIGEgY29tYmluYXRpb24gb2YgYW4gYXJyYXkgYW5kIGEgc2V0LiBBZGRpbmcgYSBuZXdcbiAqIG1lbWJlciBpcyBPKDEpLCB0ZXN0aW5nIGZvciBtZW1iZXJzaGlwIGlzIE8oMSksIGFuZCBmaW5kaW5nIHRoZSBpbmRleCBvZiBhblxuICogZWxlbWVudCBpcyBPKDEpLiBSZW1vdmluZyBlbGVtZW50cyBmcm9tIHRoZSBzZXQgaXMgbm90IHN1cHBvcnRlZC4gT25seVxuICogc3RyaW5ncyBhcmUgc3VwcG9ydGVkIGZvciBtZW1iZXJzaGlwLlxuICovXG5mdW5jdGlvbiBBcnJheVNldCgpIHtcbiAgdGhpcy5fYXJyYXkgPSBbXTtcbiAgdGhpcy5fc2V0ID0gaGFzTmF0aXZlTWFwID8gbmV3IE1hcCgpIDogT2JqZWN0LmNyZWF0ZShudWxsKTtcbn1cblxuLyoqXG4gKiBTdGF0aWMgbWV0aG9kIGZvciBjcmVhdGluZyBBcnJheVNldCBpbnN0YW5jZXMgZnJvbSBhbiBleGlzdGluZyBhcnJheS5cbiAqL1xuQXJyYXlTZXQuZnJvbUFycmF5ID0gZnVuY3Rpb24gQXJyYXlTZXRfZnJvbUFycmF5KGFBcnJheSwgYUFsbG93RHVwbGljYXRlcykge1xuICB2YXIgc2V0ID0gbmV3IEFycmF5U2V0KCk7XG4gIGZvciAodmFyIGkgPSAwLCBsZW4gPSBhQXJyYXkubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICBzZXQuYWRkKGFBcnJheVtpXSwgYUFsbG93RHVwbGljYXRlcyk7XG4gIH1cbiAgcmV0dXJuIHNldDtcbn07XG5cbi8qKlxuICogUmV0dXJuIGhvdyBtYW55IHVuaXF1ZSBpdGVtcyBhcmUgaW4gdGhpcyBBcnJheVNldC4gSWYgZHVwbGljYXRlcyBoYXZlIGJlZW5cbiAqIGFkZGVkLCB0aGFuIHRob3NlIGRvIG5vdCBjb3VudCB0b3dhcmRzIHRoZSBzaXplLlxuICpcbiAqIEByZXR1cm5zIE51bWJlclxuICovXG5BcnJheVNldC5wcm90b3R5cGUuc2l6ZSA9IGZ1bmN0aW9uIEFycmF5U2V0X3NpemUoKSB7XG4gIHJldHVybiBoYXNOYXRpdmVNYXAgPyB0aGlzLl9zZXQuc2l6ZSA6IE9iamVjdC5nZXRPd25Qcm9wZXJ0eU5hbWVzKHRoaXMuX3NldCkubGVuZ3RoO1xufTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHN0cmluZyB0byB0aGlzIHNldC5cbiAqXG4gKiBAcGFyYW0gU3RyaW5nIGFTdHJcbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIEFycmF5U2V0X2FkZChhU3RyLCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gIHZhciBzU3RyID0gaGFzTmF0aXZlTWFwID8gYVN0ciA6IHV0aWwudG9TZXRTdHJpbmcoYVN0cik7XG4gIHZhciBpc0R1cGxpY2F0ZSA9IGhhc05hdGl2ZU1hcCA/IHRoaXMuaGFzKGFTdHIpIDogaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKTtcbiAgdmFyIGlkeCA9IHRoaXMuX2FycmF5Lmxlbmd0aDtcbiAgaWYgKCFpc0R1cGxpY2F0ZSB8fCBhQWxsb3dEdXBsaWNhdGVzKSB7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhU3RyKTtcbiAgfVxuICBpZiAoIWlzRHVwbGljYXRlKSB7XG4gICAgaWYgKGhhc05hdGl2ZU1hcCkge1xuICAgICAgdGhpcy5fc2V0LnNldChhU3RyLCBpZHgpO1xuICAgIH0gZWxzZSB7XG4gICAgICB0aGlzLl9zZXRbc1N0cl0gPSBpZHg7XG4gICAgfVxuICB9XG59O1xuXG4vKipcbiAqIElzIHRoZSBnaXZlbiBzdHJpbmcgYSBtZW1iZXIgb2YgdGhpcyBzZXQ/XG4gKlxuICogQHBhcmFtIFN0cmluZyBhU3RyXG4gKi9cbkFycmF5U2V0LnByb3RvdHlwZS5oYXMgPSBmdW5jdGlvbiBBcnJheVNldF9oYXMoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgcmV0dXJuIHRoaXMuX3NldC5oYXMoYVN0cik7XG4gIH0gZWxzZSB7XG4gICAgdmFyIHNTdHIgPSB1dGlsLnRvU2V0U3RyaW5nKGFTdHIpO1xuICAgIHJldHVybiBoYXMuY2FsbCh0aGlzLl9zZXQsIHNTdHIpO1xuICB9XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGluZGV4IG9mIHRoZSBnaXZlbiBzdHJpbmcgaW4gdGhlIGFycmF5P1xuICpcbiAqIEBwYXJhbSBTdHJpbmcgYVN0clxuICovXG5BcnJheVNldC5wcm90b3R5cGUuaW5kZXhPZiA9IGZ1bmN0aW9uIEFycmF5U2V0X2luZGV4T2YoYVN0cikge1xuICBpZiAoaGFzTmF0aXZlTWFwKSB7XG4gICAgdmFyIGlkeCA9IHRoaXMuX3NldC5nZXQoYVN0cik7XG4gICAgaWYgKGlkeCA+PSAwKSB7XG4gICAgICAgIHJldHVybiBpZHg7XG4gICAgfVxuICB9IGVsc2Uge1xuICAgIHZhciBzU3RyID0gdXRpbC50b1NldFN0cmluZyhhU3RyKTtcbiAgICBpZiAoaGFzLmNhbGwodGhpcy5fc2V0LCBzU3RyKSkge1xuICAgICAgcmV0dXJuIHRoaXMuX3NldFtzU3RyXTtcbiAgICB9XG4gIH1cblxuICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFTdHIgKyAnXCIgaXMgbm90IGluIHRoZSBzZXQuJyk7XG59O1xuXG4vKipcbiAqIFdoYXQgaXMgdGhlIGVsZW1lbnQgYXQgdGhlIGdpdmVuIGluZGV4P1xuICpcbiAqIEBwYXJhbSBOdW1iZXIgYUlkeFxuICovXG5BcnJheVNldC5wcm90b3R5cGUuYXQgPSBmdW5jdGlvbiBBcnJheVNldF9hdChhSWR4KSB7XG4gIGlmIChhSWR4ID49IDAgJiYgYUlkeCA8IHRoaXMuX2FycmF5Lmxlbmd0aCkge1xuICAgIHJldHVybiB0aGlzLl9hcnJheVthSWR4XTtcbiAgfVxuICB0aHJvdyBuZXcgRXJyb3IoJ05vIGVsZW1lbnQgaW5kZXhlZCBieSAnICsgYUlkeCk7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGFycmF5IHJlcHJlc2VudGF0aW9uIG9mIHRoaXMgc2V0ICh3aGljaCBoYXMgdGhlIHByb3BlciBpbmRpY2VzXG4gKiBpbmRpY2F0ZWQgYnkgaW5kZXhPZikuIE5vdGUgdGhhdCB0aGlzIGlzIGEgY29weSBvZiB0aGUgaW50ZXJuYWwgYXJyYXkgdXNlZFxuICogZm9yIHN0b3JpbmcgdGhlIG1lbWJlcnMgc28gdGhhdCBubyBvbmUgY2FuIG1lc3Mgd2l0aCBpbnRlcm5hbCBzdGF0ZS5cbiAqL1xuQXJyYXlTZXQucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBBcnJheVNldF90b0FycmF5KCkge1xuICByZXR1cm4gdGhpcy5fYXJyYXkuc2xpY2UoKTtcbn07XG5cbmV4cG9ydHMuQXJyYXlTZXQgPSBBcnJheVNldDtcblxuXG5cbi8vLy8vLy8vLy8vLy8vLy8vL1xuLy8gV0VCUEFDSyBGT09URVJcbi8vIC4vbGliL2FycmF5LXNldC5qc1xuLy8gbW9kdWxlIGlkID0gNVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTQgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciB1dGlsID0gcmVxdWlyZSgnLi91dGlsJyk7XG5cbi8qKlxuICogRGV0ZXJtaW5lIHdoZXRoZXIgbWFwcGluZ0IgaXMgYWZ0ZXIgbWFwcGluZ0Egd2l0aCByZXNwZWN0IHRvIGdlbmVyYXRlZFxuICogcG9zaXRpb24uXG4gKi9cbmZ1bmN0aW9uIGdlbmVyYXRlZFBvc2l0aW9uQWZ0ZXIobWFwcGluZ0EsIG1hcHBpbmdCKSB7XG4gIC8vIE9wdGltaXplZCBmb3IgbW9zdCBjb21tb24gY2FzZVxuICB2YXIgbGluZUEgPSBtYXBwaW5nQS5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgbGluZUIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRMaW5lO1xuICB2YXIgY29sdW1uQSA9IG1hcHBpbmdBLmdlbmVyYXRlZENvbHVtbjtcbiAgdmFyIGNvbHVtbkIgPSBtYXBwaW5nQi5nZW5lcmF0ZWRDb2x1bW47XG4gIHJldHVybiBsaW5lQiA+IGxpbmVBIHx8IGxpbmVCID09IGxpbmVBICYmIGNvbHVtbkIgPj0gY29sdW1uQSB8fFxuICAgICAgICAgdXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZChtYXBwaW5nQSwgbWFwcGluZ0IpIDw9IDA7XG59XG5cbi8qKlxuICogQSBkYXRhIHN0cnVjdHVyZSB0byBwcm92aWRlIGEgc29ydGVkIHZpZXcgb2YgYWNjdW11bGF0ZWQgbWFwcGluZ3MgaW4gYVxuICogcGVyZm9ybWFuY2UgY29uc2Npb3VzIG1hbm5lci4gSXQgdHJhZGVzIGEgbmVnbGliYWJsZSBvdmVyaGVhZCBpbiBnZW5lcmFsXG4gKiBjYXNlIGZvciBhIGxhcmdlIHNwZWVkdXAgaW4gY2FzZSBvZiBtYXBwaW5ncyBiZWluZyBhZGRlZCBpbiBvcmRlci5cbiAqL1xuZnVuY3Rpb24gTWFwcGluZ0xpc3QoKSB7XG4gIHRoaXMuX2FycmF5ID0gW107XG4gIHRoaXMuX3NvcnRlZCA9IHRydWU7XG4gIC8vIFNlcnZlcyBhcyBpbmZpbXVtXG4gIHRoaXMuX2xhc3QgPSB7Z2VuZXJhdGVkTGluZTogLTEsIGdlbmVyYXRlZENvbHVtbjogMH07XG59XG5cbi8qKlxuICogSXRlcmF0ZSB0aHJvdWdoIGludGVybmFsIGl0ZW1zLiBUaGlzIG1ldGhvZCB0YWtlcyB0aGUgc2FtZSBhcmd1bWVudHMgdGhhdFxuICogYEFycmF5LnByb3RvdHlwZS5mb3JFYWNoYCB0YWtlcy5cbiAqXG4gKiBOT1RFOiBUaGUgb3JkZXIgb2YgdGhlIG1hcHBpbmdzIGlzIE5PVCBndWFyYW50ZWVkLlxuICovXG5NYXBwaW5nTGlzdC5wcm90b3R5cGUudW5zb3J0ZWRGb3JFYWNoID1cbiAgZnVuY3Rpb24gTWFwcGluZ0xpc3RfZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKSB7XG4gICAgdGhpcy5fYXJyYXkuZm9yRWFjaChhQ2FsbGJhY2ssIGFUaGlzQXJnKTtcbiAgfTtcblxuLyoqXG4gKiBBZGQgdGhlIGdpdmVuIHNvdXJjZSBtYXBwaW5nLlxuICpcbiAqIEBwYXJhbSBPYmplY3QgYU1hcHBpbmdcbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLmFkZCA9IGZ1bmN0aW9uIE1hcHBpbmdMaXN0X2FkZChhTWFwcGluZykge1xuICBpZiAoZ2VuZXJhdGVkUG9zaXRpb25BZnRlcih0aGlzLl9sYXN0LCBhTWFwcGluZykpIHtcbiAgICB0aGlzLl9sYXN0ID0gYU1hcHBpbmc7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH0gZWxzZSB7XG4gICAgdGhpcy5fc29ydGVkID0gZmFsc2U7XG4gICAgdGhpcy5fYXJyYXkucHVzaChhTWFwcGluZyk7XG4gIH1cbn07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgZmxhdCwgc29ydGVkIGFycmF5IG9mIG1hcHBpbmdzLiBUaGUgbWFwcGluZ3MgYXJlIHNvcnRlZCBieVxuICogZ2VuZXJhdGVkIHBvc2l0aW9uLlxuICpcbiAqIFdBUk5JTkc6IFRoaXMgbWV0aG9kIHJldHVybnMgaW50ZXJuYWwgZGF0YSB3aXRob3V0IGNvcHlpbmcsIGZvclxuICogcGVyZm9ybWFuY2UuIFRoZSByZXR1cm4gdmFsdWUgbXVzdCBOT1QgYmUgbXV0YXRlZCwgYW5kIHNob3VsZCBiZSB0cmVhdGVkIGFzXG4gKiBhbiBpbW11dGFibGUgYm9ycm93LiBJZiB5b3Ugd2FudCB0byB0YWtlIG93bmVyc2hpcCwgeW91IG11c3QgbWFrZSB5b3VyIG93blxuICogY29weS5cbiAqL1xuTWFwcGluZ0xpc3QucHJvdG90eXBlLnRvQXJyYXkgPSBmdW5jdGlvbiBNYXBwaW5nTGlzdF90b0FycmF5KCkge1xuICBpZiAoIXRoaXMuX3NvcnRlZCkge1xuICAgIHRoaXMuX2FycmF5LnNvcnQodXRpbC5jb21wYXJlQnlHZW5lcmF0ZWRQb3NpdGlvbnNJbmZsYXRlZCk7XG4gICAgdGhpcy5fc29ydGVkID0gdHJ1ZTtcbiAgfVxuICByZXR1cm4gdGhpcy5fYXJyYXk7XG59O1xuXG5leHBvcnRzLk1hcHBpbmdMaXN0ID0gTWFwcGluZ0xpc3Q7XG5cblxuXG4vLy8vLy8vLy8vLy8vLy8vLy9cbi8vIFdFQlBBQ0sgRk9PVEVSXG4vLyAuL2xpYi9tYXBwaW5nLWxpc3QuanNcbi8vIG1vZHVsZSBpZCA9IDZcbi8vIG1vZHVsZSBjaHVua3MgPSAwIiwiLyogLSotIE1vZGU6IGpzOyBqcy1pbmRlbnQtbGV2ZWw6IDI7IC0qLSAqL1xuLypcbiAqIENvcHlyaWdodCAyMDExIE1vemlsbGEgRm91bmRhdGlvbiBhbmQgY29udHJpYnV0b3JzXG4gKiBMaWNlbnNlZCB1bmRlciB0aGUgTmV3IEJTRCBsaWNlbnNlLiBTZWUgTElDRU5TRSBvcjpcbiAqIGh0dHA6Ly9vcGVuc291cmNlLm9yZy9saWNlbnNlcy9CU0QtMy1DbGF1c2VcbiAqL1xuXG52YXIgdXRpbCA9IHJlcXVpcmUoJy4vdXRpbCcpO1xudmFyIGJpbmFyeVNlYXJjaCA9IHJlcXVpcmUoJy4vYmluYXJ5LXNlYXJjaCcpO1xudmFyIEFycmF5U2V0ID0gcmVxdWlyZSgnLi9hcnJheS1zZXQnKS5BcnJheVNldDtcbnZhciBiYXNlNjRWTFEgPSByZXF1aXJlKCcuL2Jhc2U2NC12bHEnKTtcbnZhciBxdWlja1NvcnQgPSByZXF1aXJlKCcuL3F1aWNrLXNvcnQnKS5xdWlja1NvcnQ7XG5cbmZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgdmFyIHNvdXJjZU1hcCA9IGFTb3VyY2VNYXA7XG4gIGlmICh0eXBlb2YgYVNvdXJjZU1hcCA9PT0gJ3N0cmluZycpIHtcbiAgICBzb3VyY2VNYXAgPSB1dGlsLnBhcnNlU291cmNlTWFwSW5wdXQoYVNvdXJjZU1hcCk7XG4gIH1cblxuICByZXR1cm4gc291cmNlTWFwLnNlY3Rpb25zICE9IG51bGxcbiAgICA/IG5ldyBJbmRleGVkU291cmNlTWFwQ29uc3VtZXIoc291cmNlTWFwLCBhU291cmNlTWFwVVJMKVxuICAgIDogbmV3IEJhc2ljU291cmNlTWFwQ29uc3VtZXIoc291cmNlTWFwLCBhU291cmNlTWFwVVJMKTtcbn1cblxuU291cmNlTWFwQ29uc3VtZXIuZnJvbVNvdXJjZU1hcCA9IGZ1bmN0aW9uKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgcmV0dXJuIEJhc2ljU291cmNlTWFwQ29uc3VtZXIuZnJvbVNvdXJjZU1hcChhU291cmNlTWFwLCBhU291cmNlTWFwVVJMKTtcbn1cblxuLyoqXG4gKiBUaGUgdmVyc2lvbiBvZiB0aGUgc291cmNlIG1hcHBpbmcgc3BlYyB0aGF0IHdlIGFyZSBjb25zdW1pbmcuXG4gKi9cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8vIGBfX2dlbmVyYXRlZE1hcHBpbmdzYCBhbmQgYF9fb3JpZ2luYWxNYXBwaW5nc2AgYXJlIGFycmF5cyB0aGF0IGhvbGQgdGhlXG4vLyBwYXJzZWQgbWFwcGluZyBjb29yZGluYXRlcyBmcm9tIHRoZSBzb3VyY2UgbWFwJ3MgXCJtYXBwaW5nc1wiIGF0dHJpYnV0ZS4gVGhleVxuLy8gYXJlIGxhemlseSBpbnN0YW50aWF0ZWQsIGFjY2Vzc2VkIHZpYSB0aGUgYF9nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kXG4vLyBgX29yaWdpbmFsTWFwcGluZ3NgIGdldHRlcnMgcmVzcGVjdGl2ZWx5LCBhbmQgd2Ugb25seSBwYXJzZSB0aGUgbWFwcGluZ3Ncbi8vIGFuZCBjcmVhdGUgdGhlc2UgYXJyYXlzIG9uY2UgcXVlcmllZCBmb3IgYSBzb3VyY2UgbG9jYXRpb24uIFdlIGp1bXAgdGhyb3VnaFxuLy8gdGhlc2UgaG9vcHMgYmVjYXVzZSB0aGVyZSBjYW4gYmUgbWFueSB0aG91c2FuZHMgb2YgbWFwcGluZ3MsIGFuZCBwYXJzaW5nXG4vLyB0aGVtIGlzIGV4cGVuc2l2ZSwgc28gd2Ugb25seSB3YW50IHRvIGRvIGl0IGlmIHdlIG11c3QuXG4vL1xuLy8gRWFjaCBvYmplY3QgaW4gdGhlIGFycmF5cyBpcyBvZiB0aGUgZm9ybTpcbi8vXG4vLyAgICAge1xuLy8gICAgICAgZ2VuZXJhdGVkTGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgY29kZSxcbi8vICAgICAgIGdlbmVyYXRlZENvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBjb2RlLFxuLy8gICAgICAgc291cmNlOiBUaGUgcGF0aCB0byB0aGUgb3JpZ2luYWwgc291cmNlIGZpbGUgdGhhdCBnZW5lcmF0ZWQgdGhpc1xuLy8gICAgICAgICAgICAgICBjaHVuayBvZiBjb2RlLFxuLy8gICAgICAgb3JpZ2luYWxMaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSB0aGF0XG4vLyAgICAgICAgICAgICAgICAgICAgIGNvcnJlc3BvbmRzIHRvIHRoaXMgY2h1bmsgb2YgZ2VuZXJhdGVkIGNvZGUsXG4vLyAgICAgICBvcmlnaW5hbENvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSB0aGF0XG4vLyAgICAgICAgICAgICAgICAgICAgICAgY29ycmVzcG9uZHMgdG8gdGhpcyBjaHVuayBvZiBnZW5lcmF0ZWQgY29kZSxcbi8vICAgICAgIG5hbWU6IFRoZSBuYW1lIG9mIHRoZSBvcmlnaW5hbCBzeW1ib2wgd2hpY2ggZ2VuZXJhdGVkIHRoaXMgY2h1bmsgb2Zcbi8vICAgICAgICAgICAgIGNvZGUuXG4vLyAgICAgfVxuLy9cbi8vIEFsbCBwcm9wZXJ0aWVzIGV4Y2VwdCBmb3IgYGdlbmVyYXRlZExpbmVgIGFuZCBgZ2VuZXJhdGVkQ29sdW1uYCBjYW4gYmVcbi8vIGBudWxsYC5cbi8vXG4vLyBgX2dlbmVyYXRlZE1hcHBpbmdzYCBpcyBvcmRlcmVkIGJ5IHRoZSBnZW5lcmF0ZWQgcG9zaXRpb25zLlxuLy9cbi8vIGBfb3JpZ2luYWxNYXBwaW5nc2AgaXMgb3JkZXJlZCBieSB0aGUgb3JpZ2luYWwgcG9zaXRpb25zLlxuXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX19nZW5lcmF0ZWRNYXBwaW5ncyA9IG51bGw7XG5PYmplY3QuZGVmaW5lUHJvcGVydHkoU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLCAnX2dlbmVyYXRlZE1hcHBpbmdzJywge1xuICBjb25maWd1cmFibGU6IHRydWUsXG4gIGVudW1lcmFibGU6IHRydWUsXG4gIGdldDogZnVuY3Rpb24gKCkge1xuICAgIGlmICghdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzKSB7XG4gICAgICB0aGlzLl9wYXJzZU1hcHBpbmdzKHRoaXMuX21hcHBpbmdzLCB0aGlzLnNvdXJjZVJvb3QpO1xuICAgIH1cblxuICAgIHJldHVybiB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3M7XG4gIH1cbn0pO1xuXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX19vcmlnaW5hbE1hcHBpbmdzID0gbnVsbDtcbk9iamVjdC5kZWZpbmVQcm9wZXJ0eShTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUsICdfb3JpZ2luYWxNYXBwaW5ncycsIHtcbiAgY29uZmlndXJhYmxlOiB0cnVlLFxuICBlbnVtZXJhYmxlOiB0cnVlLFxuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICBpZiAoIXRoaXMuX19vcmlnaW5hbE1hcHBpbmdzKSB7XG4gICAgICB0aGlzLl9wYXJzZU1hcHBpbmdzKHRoaXMuX21hcHBpbmdzLCB0aGlzLnNvdXJjZVJvb3QpO1xuICAgIH1cblxuICAgIHJldHVybiB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncztcbiAgfVxufSk7XG5cblNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fY2hhcklzTWFwcGluZ1NlcGFyYXRvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NoYXJJc01hcHBpbmdTZXBhcmF0b3IoYVN0ciwgaW5kZXgpIHtcbiAgICB2YXIgYyA9IGFTdHIuY2hhckF0KGluZGV4KTtcbiAgICByZXR1cm4gYyA9PT0gXCI7XCIgfHwgYyA9PT0gXCIsXCI7XG4gIH07XG5cbi8qKlxuICogUGFyc2UgdGhlIG1hcHBpbmdzIGluIGEgc3RyaW5nIGluIHRvIGEgZGF0YSBzdHJ1Y3R1cmUgd2hpY2ggd2UgY2FuIGVhc2lseVxuICogcXVlcnkgKHRoZSBvcmRlcmVkIGFycmF5cyBpbiB0aGUgYHRoaXMuX19nZW5lcmF0ZWRNYXBwaW5nc2AgYW5kXG4gKiBgdGhpcy5fX29yaWdpbmFsTWFwcGluZ3NgIHByb3BlcnRpZXMpLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKFwiU3ViY2xhc3NlcyBtdXN0IGltcGxlbWVudCBfcGFyc2VNYXBwaW5nc1wiKTtcbiAgfTtcblxuU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSID0gMTtcblNvdXJjZU1hcENvbnN1bWVyLk9SSUdJTkFMX09SREVSID0gMjtcblxuU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuU291cmNlTWFwQ29uc3VtZXIuTEVBU1RfVVBQRVJfQk9VTkQgPSAyO1xuXG4vKipcbiAqIEl0ZXJhdGUgb3ZlciBlYWNoIG1hcHBpbmcgYmV0d2VlbiBhbiBvcmlnaW5hbCBzb3VyY2UvbGluZS9jb2x1bW4gYW5kIGFcbiAqIGdlbmVyYXRlZCBsaW5lL2NvbHVtbiBpbiB0aGlzIHNvdXJjZSBtYXAuXG4gKlxuICogQHBhcmFtIEZ1bmN0aW9uIGFDYWxsYmFja1xuICogICAgICAgIFRoZSBmdW5jdGlvbiB0aGF0IGlzIGNhbGxlZCB3aXRoIGVhY2ggbWFwcGluZy5cbiAqIEBwYXJhbSBPYmplY3QgYUNvbnRleHRcbiAqICAgICAgICBPcHRpb25hbC4gSWYgc3BlY2lmaWVkLCB0aGlzIG9iamVjdCB3aWxsIGJlIHRoZSB2YWx1ZSBvZiBgdGhpc2AgZXZlcnlcbiAqICAgICAgICB0aW1lIHRoYXQgYGFDYWxsYmFja2AgaXMgY2FsbGVkLlxuICogQHBhcmFtIGFPcmRlclxuICogICAgICAgIEVpdGhlciBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYCBvclxuICogICAgICAgIGBTb3VyY2VNYXBDb25zdW1lci5PUklHSU5BTF9PUkRFUmAuIFNwZWNpZmllcyB3aGV0aGVyIHlvdSB3YW50IHRvXG4gKiAgICAgICAgaXRlcmF0ZSBvdmVyIHRoZSBtYXBwaW5ncyBzb3J0ZWQgYnkgdGhlIGdlbmVyYXRlZCBmaWxlJ3MgbGluZS9jb2x1bW5cbiAqICAgICAgICBvcmRlciBvciB0aGUgb3JpZ2luYWwncyBzb3VyY2UvbGluZS9jb2x1bW4gb3JkZXIsIHJlc3BlY3RpdmVseS4gRGVmYXVsdHMgdG9cbiAqICAgICAgICBgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSYC5cbiAqL1xuU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmVhY2hNYXBwaW5nID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfZWFjaE1hcHBpbmcoYUNhbGxiYWNrLCBhQ29udGV4dCwgYU9yZGVyKSB7XG4gICAgdmFyIGNvbnRleHQgPSBhQ29udGV4dCB8fCBudWxsO1xuICAgIHZhciBvcmRlciA9IGFPcmRlciB8fCBTb3VyY2VNYXBDb25zdW1lci5HRU5FUkFURURfT1JERVI7XG5cbiAgICB2YXIgbWFwcGluZ3M7XG4gICAgc3dpdGNoIChvcmRlcikge1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuR0VORVJBVEVEX09SREVSOlxuICAgICAgbWFwcGluZ3MgPSB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncztcbiAgICAgIGJyZWFrO1xuICAgIGNhc2UgU291cmNlTWFwQ29uc3VtZXIuT1JJR0lOQUxfT1JERVI6XG4gICAgICBtYXBwaW5ncyA9IHRoaXMuX29yaWdpbmFsTWFwcGluZ3M7XG4gICAgICBicmVhaztcbiAgICBkZWZhdWx0OlxuICAgICAgdGhyb3cgbmV3IEVycm9yKFwiVW5rbm93biBvcmRlciBvZiBpdGVyYXRpb24uXCIpO1xuICAgIH1cblxuICAgIHZhciBzb3VyY2VSb290ID0gdGhpcy5zb3VyY2VSb290O1xuICAgIG1hcHBpbmdzLm1hcChmdW5jdGlvbiAobWFwcGluZykge1xuICAgICAgdmFyIHNvdXJjZSA9IG1hcHBpbmcuc291cmNlID09PSBudWxsID8gbnVsbCA6IHRoaXMuX3NvdXJjZXMuYXQobWFwcGluZy5zb3VyY2UpO1xuICAgICAgc291cmNlID0gdXRpbC5jb21wdXRlU291cmNlVVJMKHNvdXJjZVJvb3QsIHNvdXJjZSwgdGhpcy5fc291cmNlTWFwVVJMKTtcbiAgICAgIHJldHVybiB7XG4gICAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgICBnZW5lcmF0ZWRMaW5lOiBtYXBwaW5nLmdlbmVyYXRlZExpbmUsXG4gICAgICAgIGdlbmVyYXRlZENvbHVtbjogbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4sXG4gICAgICAgIG9yaWdpbmFsTGluZTogbWFwcGluZy5vcmlnaW5hbExpbmUsXG4gICAgICAgIG9yaWdpbmFsQ29sdW1uOiBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uLFxuICAgICAgICBuYW1lOiBtYXBwaW5nLm5hbWUgPT09IG51bGwgPyBudWxsIDogdGhpcy5fbmFtZXMuYXQobWFwcGluZy5uYW1lKVxuICAgICAgfTtcbiAgICB9LCB0aGlzKS5mb3JFYWNoKGFDYWxsYmFjaywgY29udGV4dCk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyBhbGwgZ2VuZXJhdGVkIGxpbmUgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIG9yaWdpbmFsIHNvdXJjZSxcbiAqIGxpbmUsIGFuZCBjb2x1bW4gcHJvdmlkZWQuIElmIG5vIGNvbHVtbiBpcyBwcm92aWRlZCwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gYSBlaXRoZXIgdGhlIGxpbmUgd2UgYXJlIHNlYXJjaGluZyBmb3Igb3IgdGhlIG5leHRcbiAqIGNsb3Nlc3QgbGluZSB0aGF0IGhhcyBhbnkgbWFwcGluZ3MuIE90aGVyd2lzZSwgcmV0dXJucyBhbGwgbWFwcGluZ3NcbiAqIGNvcnJlc3BvbmRpbmcgdG8gdGhlIGdpdmVuIGxpbmUgYW5kIGVpdGhlciB0aGUgY29sdW1uIHdlIGFyZSBzZWFyY2hpbmcgZm9yXG4gKiBvciB0aGUgbmV4dCBjbG9zZXN0IGNvbHVtbiB0aGF0IGhhcyBhbnkgb2Zmc2V0cy5cbiAqXG4gKiBUaGUgb25seSBhcmd1bWVudCBpcyBhbiBvYmplY3Qgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIGZpbGVuYW1lIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UuXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UuICBUaGUgbGluZSBudW1iZXIgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IE9wdGlvbmFsLiB0aGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLlxuICogICAgVGhlIGNvbHVtbiBudW1iZXIgaXMgMC1iYXNlZC5cbiAqXG4gKiBhbmQgYW4gYXJyYXkgb2Ygb2JqZWN0cyBpcyByZXR1cm5lZCwgZWFjaCB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICBsaW5lIG51bWJlciBpcyAxLWJhc2VkLlxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UsIG9yIG51bGwuXG4gKiAgICBUaGUgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICovXG5Tb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuYWxsR2VuZXJhdGVkUG9zaXRpb25zRm9yID1cbiAgZnVuY3Rpb24gU291cmNlTWFwQ29uc3VtZXJfYWxsR2VuZXJhdGVkUG9zaXRpb25zRm9yKGFBcmdzKSB7XG4gICAgdmFyIGxpbmUgPSB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKTtcblxuICAgIC8vIFdoZW4gdGhlcmUgaXMgbm8gZXhhY3QgbWF0Y2gsIEJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLl9maW5kTWFwcGluZ1xuICAgIC8vIHJldHVybnMgdGhlIGluZGV4IG9mIHRoZSBjbG9zZXN0IG1hcHBpbmcgbGVzcyB0aGFuIHRoZSBuZWVkbGUuIEJ5XG4gICAgLy8gc2V0dGluZyBuZWVkbGUub3JpZ2luYWxDb2x1bW4gdG8gMCwgd2UgdGh1cyBmaW5kIHRoZSBsYXN0IG1hcHBpbmcgZm9yXG4gICAgLy8gdGhlIGdpdmVuIGxpbmUsIHByb3ZpZGVkIHN1Y2ggYSBtYXBwaW5nIGV4aXN0cy5cbiAgICB2YXIgbmVlZGxlID0ge1xuICAgICAgc291cmNlOiB1dGlsLmdldEFyZyhhQXJncywgJ3NvdXJjZScpLFxuICAgICAgb3JpZ2luYWxMaW5lOiBsaW5lLFxuICAgICAgb3JpZ2luYWxDb2x1bW46IHV0aWwuZ2V0QXJnKGFBcmdzLCAnY29sdW1uJywgMClcbiAgICB9O1xuXG4gICAgbmVlZGxlLnNvdXJjZSA9IHRoaXMuX2ZpbmRTb3VyY2VJbmRleChuZWVkbGUuc291cmNlKTtcbiAgICBpZiAobmVlZGxlLnNvdXJjZSA8IDApIHtcbiAgICAgIHJldHVybiBbXTtcbiAgICB9XG5cbiAgICB2YXIgbWFwcGluZ3MgPSBbXTtcblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRNYXBwaW5nKG5lZWRsZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIFwib3JpZ2luYWxMaW5lXCIsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgXCJvcmlnaW5hbENvbHVtblwiLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIHV0aWwuY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMsXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYmluYXJ5U2VhcmNoLkxFQVNUX1VQUEVSX0JPVU5EKTtcbiAgICBpZiAoaW5kZXggPj0gMCkge1xuICAgICAgdmFyIG1hcHBpbmcgPSB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgaWYgKGFBcmdzLmNvbHVtbiA9PT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIHZhciBvcmlnaW5hbExpbmUgPSBtYXBwaW5nLm9yaWdpbmFsTGluZTtcblxuICAgICAgICAvLyBJdGVyYXRlIHVudGlsIGVpdGhlciB3ZSBydW4gb3V0IG9mIG1hcHBpbmdzLCBvciB3ZSBydW4gaW50b1xuICAgICAgICAvLyBhIG1hcHBpbmcgZm9yIGEgZGlmZmVyZW50IGxpbmUgdGhhbiB0aGUgb25lIHdlIGZvdW5kLiBTaW5jZVxuICAgICAgICAvLyBtYXBwaW5ncyBhcmUgc29ydGVkLCB0aGlzIGlzIGd1YXJhbnRlZWQgdG8gZmluZCBhbGwgbWFwcGluZ3MgZm9yXG4gICAgICAgIC8vIHRoZSBsaW5lIHdlIGZvdW5kLlxuICAgICAgICB3aGlsZSAobWFwcGluZyAmJiBtYXBwaW5nLm9yaWdpbmFsTGluZSA9PT0gb3JpZ2luYWxMaW5lKSB7XG4gICAgICAgICAgbWFwcGluZ3MucHVzaCh7XG4gICAgICAgICAgICBsaW5lOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkTGluZScsIG51bGwpLFxuICAgICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgICBsYXN0Q29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbGFzdEdlbmVyYXRlZENvbHVtbicsIG51bGwpXG4gICAgICAgICAgfSk7XG5cbiAgICAgICAgICBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1srK2luZGV4XTtcbiAgICAgICAgfVxuICAgICAgfSBlbHNlIHtcbiAgICAgICAgdmFyIG9yaWdpbmFsQ29sdW1uID0gbWFwcGluZy5vcmlnaW5hbENvbHVtbjtcblxuICAgICAgICAvLyBJdGVyYXRlIHVudGlsIGVpdGhlciB3ZSBydW4gb3V0IG9mIG1hcHBpbmdzLCBvciB3ZSBydW4gaW50b1xuICAgICAgICAvLyBhIG1hcHBpbmcgZm9yIGEgZGlmZmVyZW50IGxpbmUgdGhhbiB0aGUgb25lIHdlIHdlcmUgc2VhcmNoaW5nIGZvci5cbiAgICAgICAgLy8gU2luY2UgbWFwcGluZ3MgYXJlIHNvcnRlZCwgdGhpcyBpcyBndWFyYW50ZWVkIHRvIGZpbmQgYWxsIG1hcHBpbmdzIGZvclxuICAgICAgICAvLyB0aGUgbGluZSB3ZSBhcmUgc2VhcmNoaW5nIGZvci5cbiAgICAgICAgd2hpbGUgKG1hcHBpbmcgJiZcbiAgICAgICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxMaW5lID09PSBsaW5lICYmXG4gICAgICAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uID09IG9yaWdpbmFsQ29sdW1uKSB7XG4gICAgICAgICAgbWFwcGluZ3MucHVzaCh7XG4gICAgICAgICAgICBsaW5lOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkTGluZScsIG51bGwpLFxuICAgICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgICBsYXN0Q29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbGFzdEdlbmVyYXRlZENvbHVtbicsIG51bGwpXG4gICAgICAgICAgfSk7XG5cbiAgICAgICAgICBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1srK2luZGV4XTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiBtYXBwaW5ncztcbiAgfTtcblxuZXhwb3J0cy5Tb3VyY2VNYXBDb25zdW1lciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIEEgQmFzaWNTb3VyY2VNYXBDb25zdW1lciBpbnN0YW5jZSByZXByZXNlbnRzIGEgcGFyc2VkIHNvdXJjZSBtYXAgd2hpY2ggd2UgY2FuXG4gKiBxdWVyeSBmb3IgaW5mb3JtYXRpb24gYWJvdXQgdGhlIG9yaWdpbmFsIGZpbGUgcG9zaXRpb25zIGJ5IGdpdmluZyBpdCBhIGZpbGVcbiAqIHBvc2l0aW9uIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLlxuICpcbiAqIFRoZSBmaXJzdCBwYXJhbWV0ZXIgaXMgdGhlIHJhdyBzb3VyY2UgbWFwIChlaXRoZXIgYXMgYSBKU09OIHN0cmluZywgb3JcbiAqIGFscmVhZHkgcGFyc2VkIHRvIGFuIG9iamVjdCkuIEFjY29yZGluZyB0byB0aGUgc3BlYywgc291cmNlIG1hcHMgaGF2ZSB0aGVcbiAqIGZvbGxvd2luZyBhdHRyaWJ1dGVzOlxuICpcbiAqICAgLSB2ZXJzaW9uOiBXaGljaCB2ZXJzaW9uIG9mIHRoZSBzb3VyY2UgbWFwIHNwZWMgdGhpcyBtYXAgaXMgZm9sbG93aW5nLlxuICogICAtIHNvdXJjZXM6IEFuIGFycmF5IG9mIFVSTHMgdG8gdGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlcy5cbiAqICAgLSBuYW1lczogQW4gYXJyYXkgb2YgaWRlbnRpZmllcnMgd2hpY2ggY2FuIGJlIHJlZmVycmVuY2VkIGJ5IGluZGl2aWR1YWwgbWFwcGluZ3MuXG4gKiAgIC0gc291cmNlUm9vdDogT3B0aW9uYWwuIFRoZSBVUkwgcm9vdCBmcm9tIHdoaWNoIGFsbCBzb3VyY2VzIGFyZSByZWxhdGl2ZS5cbiAqICAgLSBzb3VyY2VzQ29udGVudDogT3B0aW9uYWwuIEFuIGFycmF5IG9mIGNvbnRlbnRzIG9mIHRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZXMuXG4gKiAgIC0gbWFwcGluZ3M6IEEgc3RyaW5nIG9mIGJhc2U2NCBWTFFzIHdoaWNoIGNvbnRhaW4gdGhlIGFjdHVhbCBtYXBwaW5ncy5cbiAqICAgLSBmaWxlOiBPcHRpb25hbC4gVGhlIGdlbmVyYXRlZCBmaWxlIHRoaXMgc291cmNlIG1hcCBpcyBhc3NvY2lhdGVkIHdpdGguXG4gKlxuICogSGVyZSBpcyBhbiBleGFtcGxlIHNvdXJjZSBtYXAsIHRha2VuIGZyb20gdGhlIHNvdXJjZSBtYXAgc3BlY1swXTpcbiAqXG4gKiAgICAge1xuICogICAgICAgdmVyc2lvbiA6IDMsXG4gKiAgICAgICBmaWxlOiBcIm91dC5qc1wiLFxuICogICAgICAgc291cmNlUm9vdCA6IFwiXCIsXG4gKiAgICAgICBzb3VyY2VzOiBbXCJmb28uanNcIiwgXCJiYXIuanNcIl0sXG4gKiAgICAgICBuYW1lczogW1wic3JjXCIsIFwibWFwc1wiLCBcImFyZVwiLCBcImZ1blwiXSxcbiAqICAgICAgIG1hcHBpbmdzOiBcIkFBLEFCOztBQkNERTtcIlxuICogICAgIH1cbiAqXG4gKiBUaGUgc2Vjb25kIHBhcmFtZXRlciwgaWYgZ2l2ZW4sIGlzIGEgc3RyaW5nIHdob3NlIHZhbHVlIGlzIHRoZSBVUkxcbiAqIGF0IHdoaWNoIHRoZSBzb3VyY2UgbWFwIHdhcyBmb3VuZC4gIFRoaXMgVVJMIGlzIHVzZWQgdG8gY29tcHV0ZSB0aGVcbiAqIHNvdXJjZXMgYXJyYXkuXG4gKlxuICogWzBdOiBodHRwczovL2RvY3MuZ29vZ2xlLmNvbS9kb2N1bWVudC9kLzFVMVJHQWVoUXdSeXBVVG92RjFLUmxwaU9GemUwYi1fMmdjNmZBSDBLWTBrL2VkaXQ/cGxpPTEjXG4gKi9cbmZ1bmN0aW9uIEJhc2ljU291cmNlTWFwQ29uc3VtZXIoYVNvdXJjZU1hcCwgYVNvdXJjZU1hcFVSTCkge1xuICB2YXIgc291cmNlTWFwID0gYVNvdXJjZU1hcDtcbiAgaWYgKHR5cGVvZiBhU291cmNlTWFwID09PSAnc3RyaW5nJykge1xuICAgIHNvdXJjZU1hcCA9IHV0aWwucGFyc2VTb3VyY2VNYXBJbnB1dChhU291cmNlTWFwKTtcbiAgfVxuXG4gIHZhciB2ZXJzaW9uID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAndmVyc2lvbicpO1xuICB2YXIgc291cmNlcyA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3NvdXJjZXMnKTtcbiAgLy8gU2FzcyAzLjMgbGVhdmVzIG91dCB0aGUgJ25hbWVzJyBhcnJheSwgc28gd2UgZGV2aWF0ZSBmcm9tIHRoZSBzcGVjICh3aGljaFxuICAvLyByZXF1aXJlcyB0aGUgYXJyYXkpIHRvIHBsYXkgbmljZSBoZXJlLlxuICB2YXIgbmFtZXMgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICduYW1lcycsIFtdKTtcbiAgdmFyIHNvdXJjZVJvb3QgPSB1dGlsLmdldEFyZyhzb3VyY2VNYXAsICdzb3VyY2VSb290JywgbnVsbCk7XG4gIHZhciBzb3VyY2VzQ29udGVudCA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3NvdXJjZXNDb250ZW50JywgbnVsbCk7XG4gIHZhciBtYXBwaW5ncyA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ21hcHBpbmdzJyk7XG4gIHZhciBmaWxlID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnZmlsZScsIG51bGwpO1xuXG4gIC8vIE9uY2UgYWdhaW4sIFNhc3MgZGV2aWF0ZXMgZnJvbSB0aGUgc3BlYyBhbmQgc3VwcGxpZXMgdGhlIHZlcnNpb24gYXMgYVxuICAvLyBzdHJpbmcgcmF0aGVyIHRoYW4gYSBudW1iZXIsIHNvIHdlIHVzZSBsb29zZSBlcXVhbGl0eSBjaGVja2luZyBoZXJlLlxuICBpZiAodmVyc2lvbiAhPSB0aGlzLl92ZXJzaW9uKSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdVbnN1cHBvcnRlZCB2ZXJzaW9uOiAnICsgdmVyc2lvbik7XG4gIH1cblxuICBpZiAoc291cmNlUm9vdCkge1xuICAgIHNvdXJjZVJvb3QgPSB1dGlsLm5vcm1hbGl6ZShzb3VyY2VSb290KTtcbiAgfVxuXG4gIHNvdXJjZXMgPSBzb3VyY2VzXG4gICAgLm1hcChTdHJpbmcpXG4gICAgLy8gU29tZSBzb3VyY2UgbWFwcyBwcm9kdWNlIHJlbGF0aXZlIHNvdXJjZSBwYXRocyBsaWtlIFwiLi9mb28uanNcIiBpbnN0ZWFkIG9mXG4gICAgLy8gXCJmb28uanNcIi4gIE5vcm1hbGl6ZSB0aGVzZSBmaXJzdCBzbyB0aGF0IGZ1dHVyZSBjb21wYXJpc29ucyB3aWxsIHN1Y2NlZWQuXG4gICAgLy8gU2VlIGJ1Z3ppbC5sYS8xMDkwNzY4LlxuICAgIC5tYXAodXRpbC5ub3JtYWxpemUpXG4gICAgLy8gQWx3YXlzIGVuc3VyZSB0aGF0IGFic29sdXRlIHNvdXJjZXMgYXJlIGludGVybmFsbHkgc3RvcmVkIHJlbGF0aXZlIHRvXG4gICAgLy8gdGhlIHNvdXJjZSByb290LCBpZiB0aGUgc291cmNlIHJvb3QgaXMgYWJzb2x1dGUuIE5vdCBkb2luZyB0aGlzIHdvdWxkXG4gICAgLy8gYmUgcGFydGljdWxhcmx5IHByb2JsZW1hdGljIHdoZW4gdGhlIHNvdXJjZSByb290IGlzIGEgcHJlZml4IG9mIHRoZVxuICAgIC8vIHNvdXJjZSAodmFsaWQsIGJ1dCB3aHk/PykuIFNlZSBnaXRodWIgaXNzdWUgIzE5OSBhbmQgYnVnemlsLmxhLzExODg5ODIuXG4gICAgLm1hcChmdW5jdGlvbiAoc291cmNlKSB7XG4gICAgICByZXR1cm4gc291cmNlUm9vdCAmJiB1dGlsLmlzQWJzb2x1dGUoc291cmNlUm9vdCkgJiYgdXRpbC5pc0Fic29sdXRlKHNvdXJjZSlcbiAgICAgICAgPyB1dGlsLnJlbGF0aXZlKHNvdXJjZVJvb3QsIHNvdXJjZSlcbiAgICAgICAgOiBzb3VyY2U7XG4gICAgfSk7XG5cbiAgLy8gUGFzcyBgdHJ1ZWAgYmVsb3cgdG8gYWxsb3cgZHVwbGljYXRlIG5hbWVzIGFuZCBzb3VyY2VzLiBXaGlsZSBzb3VyY2UgbWFwc1xuICAvLyBhcmUgaW50ZW5kZWQgdG8gYmUgY29tcHJlc3NlZCBhbmQgZGVkdXBsaWNhdGVkLCB0aGUgVHlwZVNjcmlwdCBjb21waWxlclxuICAvLyBzb21ldGltZXMgZ2VuZXJhdGVzIHNvdXJjZSBtYXBzIHdpdGggZHVwbGljYXRlcyBpbiB0aGVtLiBTZWUgR2l0aHViIGlzc3VlXG4gIC8vICM3MiBhbmQgYnVnemlsLmxhLzg4OTQ5Mi5cbiAgdGhpcy5fbmFtZXMgPSBBcnJheVNldC5mcm9tQXJyYXkobmFtZXMubWFwKFN0cmluZyksIHRydWUpO1xuICB0aGlzLl9zb3VyY2VzID0gQXJyYXlTZXQuZnJvbUFycmF5KHNvdXJjZXMsIHRydWUpO1xuXG4gIHRoaXMuX2Fic29sdXRlU291cmNlcyA9IHRoaXMuX3NvdXJjZXMudG9BcnJheSgpLm1hcChmdW5jdGlvbiAocykge1xuICAgIHJldHVybiB1dGlsLmNvbXB1dGVTb3VyY2VVUkwoc291cmNlUm9vdCwgcywgYVNvdXJjZU1hcFVSTCk7XG4gIH0pO1xuXG4gIHRoaXMuc291cmNlUm9vdCA9IHNvdXJjZVJvb3Q7XG4gIHRoaXMuc291cmNlc0NvbnRlbnQgPSBzb3VyY2VzQ29udGVudDtcbiAgdGhpcy5fbWFwcGluZ3MgPSBtYXBwaW5ncztcbiAgdGhpcy5fc291cmNlTWFwVVJMID0gYVNvdXJjZU1hcFVSTDtcbiAgdGhpcy5maWxlID0gZmlsZTtcbn1cblxuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUgPSBPYmplY3QuY3JlYXRlKFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSk7XG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5jb25zdW1lciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIFV0aWxpdHkgZnVuY3Rpb24gdG8gZmluZCB0aGUgaW5kZXggb2YgYSBzb3VyY2UuICBSZXR1cm5zIC0xIGlmIG5vdFxuICogZm91bmQuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLl9maW5kU291cmNlSW5kZXggPSBmdW5jdGlvbihhU291cmNlKSB7XG4gIHZhciByZWxhdGl2ZVNvdXJjZSA9IGFTb3VyY2U7XG4gIGlmICh0aGlzLnNvdXJjZVJvb3QgIT0gbnVsbCkge1xuICAgIHJlbGF0aXZlU291cmNlID0gdXRpbC5yZWxhdGl2ZSh0aGlzLnNvdXJjZVJvb3QsIHJlbGF0aXZlU291cmNlKTtcbiAgfVxuXG4gIGlmICh0aGlzLl9zb3VyY2VzLmhhcyhyZWxhdGl2ZVNvdXJjZSkpIHtcbiAgICByZXR1cm4gdGhpcy5fc291cmNlcy5pbmRleE9mKHJlbGF0aXZlU291cmNlKTtcbiAgfVxuXG4gIC8vIE1heWJlIGFTb3VyY2UgaXMgYW4gYWJzb2x1dGUgVVJMIGFzIHJldHVybmVkIGJ5IHxzb3VyY2VzfC4gIEluXG4gIC8vIHRoaXMgY2FzZSB3ZSBjYW4ndCBzaW1wbHkgdW5kbyB0aGUgdHJhbnNmb3JtLlxuICB2YXIgaTtcbiAgZm9yIChpID0gMDsgaSA8IHRoaXMuX2Fic29sdXRlU291cmNlcy5sZW5ndGg7ICsraSkge1xuICAgIGlmICh0aGlzLl9hYnNvbHV0ZVNvdXJjZXNbaV0gPT0gYVNvdXJjZSkge1xuICAgICAgcmV0dXJuIGk7XG4gICAgfVxuICB9XG5cbiAgcmV0dXJuIC0xO1xufTtcblxuLyoqXG4gKiBDcmVhdGUgYSBCYXNpY1NvdXJjZU1hcENvbnN1bWVyIGZyb20gYSBTb3VyY2VNYXBHZW5lcmF0b3IuXG4gKlxuICogQHBhcmFtIFNvdXJjZU1hcEdlbmVyYXRvciBhU291cmNlTWFwXG4gKiAgICAgICAgVGhlIHNvdXJjZSBtYXAgdGhhdCB3aWxsIGJlIGNvbnN1bWVkLlxuICogQHBhcmFtIFN0cmluZyBhU291cmNlTWFwVVJMXG4gKiAgICAgICAgVGhlIFVSTCBhdCB3aGljaCB0aGUgc291cmNlIG1hcCBjYW4gYmUgZm91bmQgKG9wdGlvbmFsKVxuICogQHJldHVybnMgQmFzaWNTb3VyY2VNYXBDb25zdW1lclxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLmZyb21Tb3VyY2VNYXAgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9mcm9tU291cmNlTWFwKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgICB2YXIgc21jID0gT2JqZWN0LmNyZWF0ZShCYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZSk7XG5cbiAgICB2YXIgbmFtZXMgPSBzbWMuX25hbWVzID0gQXJyYXlTZXQuZnJvbUFycmF5KGFTb3VyY2VNYXAuX25hbWVzLnRvQXJyYXkoKSwgdHJ1ZSk7XG4gICAgdmFyIHNvdXJjZXMgPSBzbWMuX3NvdXJjZXMgPSBBcnJheVNldC5mcm9tQXJyYXkoYVNvdXJjZU1hcC5fc291cmNlcy50b0FycmF5KCksIHRydWUpO1xuICAgIHNtYy5zb3VyY2VSb290ID0gYVNvdXJjZU1hcC5fc291cmNlUm9vdDtcbiAgICBzbWMuc291cmNlc0NvbnRlbnQgPSBhU291cmNlTWFwLl9nZW5lcmF0ZVNvdXJjZXNDb250ZW50KHNtYy5fc291cmNlcy50b0FycmF5KCksXG4gICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBzbWMuc291cmNlUm9vdCk7XG4gICAgc21jLmZpbGUgPSBhU291cmNlTWFwLl9maWxlO1xuICAgIHNtYy5fc291cmNlTWFwVVJMID0gYVNvdXJjZU1hcFVSTDtcbiAgICBzbWMuX2Fic29sdXRlU291cmNlcyA9IHNtYy5fc291cmNlcy50b0FycmF5KCkubWFwKGZ1bmN0aW9uIChzKSB7XG4gICAgICByZXR1cm4gdXRpbC5jb21wdXRlU291cmNlVVJMKHNtYy5zb3VyY2VSb290LCBzLCBhU291cmNlTWFwVVJMKTtcbiAgICB9KTtcblxuICAgIC8vIEJlY2F1c2Ugd2UgYXJlIG1vZGlmeWluZyB0aGUgZW50cmllcyAoYnkgY29udmVydGluZyBzdHJpbmcgc291cmNlcyBhbmRcbiAgICAvLyBuYW1lcyB0byBpbmRpY2VzIGludG8gdGhlIHNvdXJjZXMgYW5kIG5hbWVzIEFycmF5U2V0cyksIHdlIGhhdmUgdG8gbWFrZVxuICAgIC8vIGEgY29weSBvZiB0aGUgZW50cnkgb3IgZWxzZSBiYWQgdGhpbmdzIGhhcHBlbi4gU2hhcmVkIG11dGFibGUgc3RhdGVcbiAgICAvLyBzdHJpa2VzIGFnYWluISBTZWUgZ2l0aHViIGlzc3VlICMxOTEuXG5cbiAgICB2YXIgZ2VuZXJhdGVkTWFwcGluZ3MgPSBhU291cmNlTWFwLl9tYXBwaW5ncy50b0FycmF5KCkuc2xpY2UoKTtcbiAgICB2YXIgZGVzdEdlbmVyYXRlZE1hcHBpbmdzID0gc21jLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBbXTtcbiAgICB2YXIgZGVzdE9yaWdpbmFsTWFwcGluZ3MgPSBzbWMuX19vcmlnaW5hbE1hcHBpbmdzID0gW107XG5cbiAgICBmb3IgKHZhciBpID0gMCwgbGVuZ3RoID0gZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyBpIDwgbGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzcmNNYXBwaW5nID0gZ2VuZXJhdGVkTWFwcGluZ3NbaV07XG4gICAgICB2YXIgZGVzdE1hcHBpbmcgPSBuZXcgTWFwcGluZztcbiAgICAgIGRlc3RNYXBwaW5nLmdlbmVyYXRlZExpbmUgPSBzcmNNYXBwaW5nLmdlbmVyYXRlZExpbmU7XG4gICAgICBkZXN0TWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gPSBzcmNNYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgaWYgKHNyY01hcHBpbmcuc291cmNlKSB7XG4gICAgICAgIGRlc3RNYXBwaW5nLnNvdXJjZSA9IHNvdXJjZXMuaW5kZXhPZihzcmNNYXBwaW5nLnNvdXJjZSk7XG4gICAgICAgIGRlc3RNYXBwaW5nLm9yaWdpbmFsTGluZSA9IHNyY01hcHBpbmcub3JpZ2luYWxMaW5lO1xuICAgICAgICBkZXN0TWFwcGluZy5vcmlnaW5hbENvbHVtbiA9IHNyY01hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgaWYgKHNyY01hcHBpbmcubmFtZSkge1xuICAgICAgICAgIGRlc3RNYXBwaW5nLm5hbWUgPSBuYW1lcy5pbmRleE9mKHNyY01hcHBpbmcubmFtZSk7XG4gICAgICAgIH1cblxuICAgICAgICBkZXN0T3JpZ2luYWxNYXBwaW5ncy5wdXNoKGRlc3RNYXBwaW5nKTtcbiAgICAgIH1cblxuICAgICAgZGVzdEdlbmVyYXRlZE1hcHBpbmdzLnB1c2goZGVzdE1hcHBpbmcpO1xuICAgIH1cblxuICAgIHF1aWNrU29ydChzbWMuX19vcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcblxuICAgIHJldHVybiBzbWM7XG4gIH07XG5cbi8qKlxuICogVGhlIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXBwaW5nIHNwZWMgdGhhdCB3ZSBhcmUgY29uc3VtaW5nLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLCAnc291cmNlcycsIHtcbiAgZ2V0OiBmdW5jdGlvbiAoKSB7XG4gICAgcmV0dXJuIHRoaXMuX2Fic29sdXRlU291cmNlcy5zbGljZSgpO1xuICB9XG59KTtcblxuLyoqXG4gKiBQcm92aWRlIHRoZSBKSVQgd2l0aCBhIG5pY2Ugc2hhcGUgLyBoaWRkZW4gY2xhc3MuXG4gKi9cbmZ1bmN0aW9uIE1hcHBpbmcoKSB7XG4gIHRoaXMuZ2VuZXJhdGVkTGluZSA9IDA7XG4gIHRoaXMuZ2VuZXJhdGVkQ29sdW1uID0gMDtcbiAgdGhpcy5zb3VyY2UgPSBudWxsO1xuICB0aGlzLm9yaWdpbmFsTGluZSA9IG51bGw7XG4gIHRoaXMub3JpZ2luYWxDb2x1bW4gPSBudWxsO1xuICB0aGlzLm5hbWUgPSBudWxsO1xufVxuXG4vKipcbiAqIFBhcnNlIHRoZSBtYXBwaW5ncyBpbiBhIHN0cmluZyBpbiB0byBhIGRhdGEgc3RydWN0dXJlIHdoaWNoIHdlIGNhbiBlYXNpbHlcbiAqIHF1ZXJ5ICh0aGUgb3JkZXJlZCBhcnJheXMgaW4gdGhlIGB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuICogYHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzYCBwcm9wZXJ0aWVzKS5cbiAqL1xuQmFzaWNTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUuX3BhcnNlTWFwcGluZ3MgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdmFyIGdlbmVyYXRlZExpbmUgPSAxO1xuICAgIHZhciBwcmV2aW91c0dlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gMDtcbiAgICB2YXIgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IDA7XG4gICAgdmFyIHByZXZpb3VzU291cmNlID0gMDtcbiAgICB2YXIgcHJldmlvdXNOYW1lID0gMDtcbiAgICB2YXIgbGVuZ3RoID0gYVN0ci5sZW5ndGg7XG4gICAgdmFyIGluZGV4ID0gMDtcbiAgICB2YXIgY2FjaGVkU2VnbWVudHMgPSB7fTtcbiAgICB2YXIgdGVtcCA9IHt9O1xuICAgIHZhciBvcmlnaW5hbE1hcHBpbmdzID0gW107XG4gICAgdmFyIGdlbmVyYXRlZE1hcHBpbmdzID0gW107XG4gICAgdmFyIG1hcHBpbmcsIHN0ciwgc2VnbWVudCwgZW5kLCB2YWx1ZTtcblxuICAgIHdoaWxlIChpbmRleCA8IGxlbmd0aCkge1xuICAgICAgaWYgKGFTdHIuY2hhckF0KGluZGV4KSA9PT0gJzsnKSB7XG4gICAgICAgIGdlbmVyYXRlZExpbmUrKztcbiAgICAgICAgaW5kZXgrKztcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSAwO1xuICAgICAgfVxuICAgICAgZWxzZSBpZiAoYVN0ci5jaGFyQXQoaW5kZXgpID09PSAnLCcpIHtcbiAgICAgICAgaW5kZXgrKztcbiAgICAgIH1cbiAgICAgIGVsc2Uge1xuICAgICAgICBtYXBwaW5nID0gbmV3IE1hcHBpbmcoKTtcbiAgICAgICAgbWFwcGluZy5nZW5lcmF0ZWRMaW5lID0gZ2VuZXJhdGVkTGluZTtcblxuICAgICAgICAvLyBCZWNhdXNlIGVhY2ggb2Zmc2V0IGlzIGVuY29kZWQgcmVsYXRpdmUgdG8gdGhlIHByZXZpb3VzIG9uZSxcbiAgICAgICAgLy8gbWFueSBzZWdtZW50cyBvZnRlbiBoYXZlIHRoZSBzYW1lIGVuY29kaW5nLiBXZSBjYW4gZXhwbG9pdCB0aGlzXG4gICAgICAgIC8vIGZhY3QgYnkgY2FjaGluZyB0aGUgcGFyc2VkIHZhcmlhYmxlIGxlbmd0aCBmaWVsZHMgb2YgZWFjaCBzZWdtZW50LFxuICAgICAgICAvLyBhbGxvd2luZyB1cyB0byBhdm9pZCBhIHNlY29uZCBwYXJzZSBpZiB3ZSBlbmNvdW50ZXIgdGhlIHNhbWVcbiAgICAgICAgLy8gc2VnbWVudCBhZ2Fpbi5cbiAgICAgICAgZm9yIChlbmQgPSBpbmRleDsgZW5kIDwgbGVuZ3RoOyBlbmQrKykge1xuICAgICAgICAgIGlmICh0aGlzLl9jaGFySXNNYXBwaW5nU2VwYXJhdG9yKGFTdHIsIGVuZCkpIHtcbiAgICAgICAgICAgIGJyZWFrO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuICAgICAgICBzdHIgPSBhU3RyLnNsaWNlKGluZGV4LCBlbmQpO1xuXG4gICAgICAgIHNlZ21lbnQgPSBjYWNoZWRTZWdtZW50c1tzdHJdO1xuICAgICAgICBpZiAoc2VnbWVudCkge1xuICAgICAgICAgIGluZGV4ICs9IHN0ci5sZW5ndGg7XG4gICAgICAgIH0gZWxzZSB7XG4gICAgICAgICAgc2VnbWVudCA9IFtdO1xuICAgICAgICAgIHdoaWxlIChpbmRleCA8IGVuZCkge1xuICAgICAgICAgICAgYmFzZTY0VkxRLmRlY29kZShhU3RyLCBpbmRleCwgdGVtcCk7XG4gICAgICAgICAgICB2YWx1ZSA9IHRlbXAudmFsdWU7XG4gICAgICAgICAgICBpbmRleCA9IHRlbXAucmVzdDtcbiAgICAgICAgICAgIHNlZ21lbnQucHVzaCh2YWx1ZSk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAyKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlLCBidXQgbm8gbGluZSBhbmQgY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgaWYgKHNlZ21lbnQubGVuZ3RoID09PSAzKSB7XG4gICAgICAgICAgICB0aHJvdyBuZXcgRXJyb3IoJ0ZvdW5kIGEgc291cmNlIGFuZCBsaW5lLCBidXQgbm8gY29sdW1uJyk7XG4gICAgICAgICAgfVxuXG4gICAgICAgICAgY2FjaGVkU2VnbWVudHNbc3RyXSA9IHNlZ21lbnQ7XG4gICAgICAgIH1cblxuICAgICAgICAvLyBHZW5lcmF0ZWQgY29sdW1uLlxuICAgICAgICBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiA9IHByZXZpb3VzR2VuZXJhdGVkQ29sdW1uICsgc2VnbWVudFswXTtcbiAgICAgICAgcHJldmlvdXNHZW5lcmF0ZWRDb2x1bW4gPSBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbjtcblxuICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiAxKSB7XG4gICAgICAgICAgLy8gT3JpZ2luYWwgc291cmNlLlxuICAgICAgICAgIG1hcHBpbmcuc291cmNlID0gcHJldmlvdXNTb3VyY2UgKyBzZWdtZW50WzFdO1xuICAgICAgICAgIHByZXZpb3VzU291cmNlICs9IHNlZ21lbnRbMV07XG5cbiAgICAgICAgICAvLyBPcmlnaW5hbCBsaW5lLlxuICAgICAgICAgIG1hcHBpbmcub3JpZ2luYWxMaW5lID0gcHJldmlvdXNPcmlnaW5hbExpbmUgKyBzZWdtZW50WzJdO1xuICAgICAgICAgIHByZXZpb3VzT3JpZ2luYWxMaW5lID0gbWFwcGluZy5vcmlnaW5hbExpbmU7XG4gICAgICAgICAgLy8gTGluZXMgYXJlIHN0b3JlZCAwLWJhc2VkXG4gICAgICAgICAgbWFwcGluZy5vcmlnaW5hbExpbmUgKz0gMTtcblxuICAgICAgICAgIC8vIE9yaWdpbmFsIGNvbHVtbi5cbiAgICAgICAgICBtYXBwaW5nLm9yaWdpbmFsQ29sdW1uID0gcHJldmlvdXNPcmlnaW5hbENvbHVtbiArIHNlZ21lbnRbM107XG4gICAgICAgICAgcHJldmlvdXNPcmlnaW5hbENvbHVtbiA9IG1hcHBpbmcub3JpZ2luYWxDb2x1bW47XG5cbiAgICAgICAgICBpZiAoc2VnbWVudC5sZW5ndGggPiA0KSB7XG4gICAgICAgICAgICAvLyBPcmlnaW5hbCBuYW1lLlxuICAgICAgICAgICAgbWFwcGluZy5uYW1lID0gcHJldmlvdXNOYW1lICsgc2VnbWVudFs0XTtcbiAgICAgICAgICAgIHByZXZpb3VzTmFtZSArPSBzZWdtZW50WzRdO1xuICAgICAgICAgIH1cbiAgICAgICAgfVxuXG4gICAgICAgIGdlbmVyYXRlZE1hcHBpbmdzLnB1c2gobWFwcGluZyk7XG4gICAgICAgIGlmICh0eXBlb2YgbWFwcGluZy5vcmlnaW5hbExpbmUgPT09ICdudW1iZXInKSB7XG4gICAgICAgICAgb3JpZ2luYWxNYXBwaW5ncy5wdXNoKG1hcHBpbmcpO1xuICAgICAgICB9XG4gICAgICB9XG4gICAgfVxuXG4gICAgcXVpY2tTb3J0KGdlbmVyYXRlZE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkKTtcbiAgICB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MgPSBnZW5lcmF0ZWRNYXBwaW5ncztcblxuICAgIHF1aWNrU29ydChvcmlnaW5hbE1hcHBpbmdzLCB1dGlsLmNvbXBhcmVCeU9yaWdpbmFsUG9zaXRpb25zKTtcbiAgICB0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncyA9IG9yaWdpbmFsTWFwcGluZ3M7XG4gIH07XG5cbi8qKlxuICogRmluZCB0aGUgbWFwcGluZyB0aGF0IGJlc3QgbWF0Y2hlcyB0aGUgaHlwb3RoZXRpY2FsIFwibmVlZGxlXCIgbWFwcGluZyB0aGF0XG4gKiB3ZSBhcmUgc2VhcmNoaW5nIGZvciBpbiB0aGUgZ2l2ZW4gXCJoYXlzdGFja1wiIG9mIG1hcHBpbmdzLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fZmluZE1hcHBpbmcgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9maW5kTWFwcGluZyhhTmVlZGxlLCBhTWFwcGluZ3MsIGFMaW5lTmFtZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgYUNvbHVtbk5hbWUsIGFDb21wYXJhdG9yLCBhQmlhcykge1xuICAgIC8vIFRvIHJldHVybiB0aGUgcG9zaXRpb24gd2UgYXJlIHNlYXJjaGluZyBmb3IsIHdlIG11c3QgZmlyc3QgZmluZCB0aGVcbiAgICAvLyBtYXBwaW5nIGZvciB0aGUgZ2l2ZW4gcG9zaXRpb24gYW5kIHRoZW4gcmV0dXJuIHRoZSBvcHBvc2l0ZSBwb3NpdGlvbiBpdFxuICAgIC8vIHBvaW50cyB0by4gQmVjYXVzZSB0aGUgbWFwcGluZ3MgYXJlIHNvcnRlZCwgd2UgY2FuIHVzZSBiaW5hcnkgc2VhcmNoIHRvXG4gICAgLy8gZmluZCB0aGUgYmVzdCBtYXBwaW5nLlxuXG4gICAgaWYgKGFOZWVkbGVbYUxpbmVOYW1lXSA8PSAwKSB7XG4gICAgICB0aHJvdyBuZXcgVHlwZUVycm9yKCdMaW5lIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDEsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthTGluZU5hbWVdKTtcbiAgICB9XG4gICAgaWYgKGFOZWVkbGVbYUNvbHVtbk5hbWVdIDwgMCkge1xuICAgICAgdGhyb3cgbmV3IFR5cGVFcnJvcignQ29sdW1uIG11c3QgYmUgZ3JlYXRlciB0aGFuIG9yIGVxdWFsIHRvIDAsIGdvdCAnXG4gICAgICAgICAgICAgICAgICAgICAgICAgICsgYU5lZWRsZVthQ29sdW1uTmFtZV0pO1xuICAgIH1cblxuICAgIHJldHVybiBiaW5hcnlTZWFyY2guc2VhcmNoKGFOZWVkbGUsIGFNYXBwaW5ncywgYUNvbXBhcmF0b3IsIGFCaWFzKTtcbiAgfTtcblxuLyoqXG4gKiBDb21wdXRlIHRoZSBsYXN0IGNvbHVtbiBmb3IgZWFjaCBnZW5lcmF0ZWQgbWFwcGluZy4gVGhlIGxhc3QgY29sdW1uIGlzXG4gKiBpbmNsdXNpdmUuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmNvbXB1dGVDb2x1bW5TcGFucyA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2NvbXB1dGVDb2x1bW5TcGFucygpIHtcbiAgICBmb3IgKHZhciBpbmRleCA9IDA7IGluZGV4IDwgdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3MubGVuZ3RoOyArK2luZGV4KSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgLy8gTWFwcGluZ3MgZG8gbm90IGNvbnRhaW4gYSBmaWVsZCBmb3IgdGhlIGxhc3QgZ2VuZXJhdGVkIGNvbHVtbnQuIFdlXG4gICAgICAvLyBjYW4gY29tZSB1cCB3aXRoIGFuIG9wdGltaXN0aWMgZXN0aW1hdGUsIGhvd2V2ZXIsIGJ5IGFzc3VtaW5nIHRoYXRcbiAgICAgIC8vIG1hcHBpbmdzIGFyZSBjb250aWd1b3VzIChpLmUuIGdpdmVuIHR3byBjb25zZWN1dGl2ZSBtYXBwaW5ncywgdGhlXG4gICAgICAvLyBmaXJzdCBtYXBwaW5nIGVuZHMgd2hlcmUgdGhlIHNlY29uZCBvbmUgc3RhcnRzKS5cbiAgICAgIGlmIChpbmRleCArIDEgPCB0aGlzLl9nZW5lcmF0ZWRNYXBwaW5ncy5sZW5ndGgpIHtcbiAgICAgICAgdmFyIG5leHRNYXBwaW5nID0gdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3NbaW5kZXggKyAxXTtcblxuICAgICAgICBpZiAobWFwcGluZy5nZW5lcmF0ZWRMaW5lID09PSBuZXh0TWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gbmV4dE1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC0gMTtcbiAgICAgICAgICBjb250aW51ZTtcbiAgICAgICAgfVxuICAgICAgfVxuXG4gICAgICAvLyBUaGUgbGFzdCBtYXBwaW5nIGZvciBlYWNoIGxpbmUgc3BhbnMgdGhlIGVudGlyZSBsaW5lLlxuICAgICAgbWFwcGluZy5sYXN0R2VuZXJhdGVkQ29sdW1uID0gSW5maW5pdHk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIG9yaWdpbmFsIHNvdXJjZSwgbGluZSwgYW5kIGNvbHVtbiBpbmZvcm1hdGlvbiBmb3IgdGhlIGdlbmVyYXRlZFxuICogc291cmNlJ3MgbGluZSBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0XG4gKiB3aXRoIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gbGluZTogVGhlIGxpbmUgbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLiAgVGhlIGxpbmUgbnVtYmVyXG4gKiAgICAgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBnZW5lcmF0ZWQgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIGJpYXM6IEVpdGhlciAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnIG9yXG4gKiAgICAgJ1NvdXJjZU1hcENvbnN1bWVyLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIHNvdXJjZTogVGhlIG9yaWdpbmFsIHNvdXJjZSBmaWxlLCBvciBudWxsLlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICAgbGluZSBudW1iZXIgaXMgMS1iYXNlZC5cbiAqICAgLSBjb2x1bW46IFRoZSBjb2x1bW4gbnVtYmVyIGluIHRoZSBvcmlnaW5hbCBzb3VyY2UsIG9yIG51bGwuICBUaGVcbiAqICAgICBjb2x1bW4gbnVtYmVyIGlzIDAtYmFzZWQuXG4gKiAgIC0gbmFtZTogVGhlIG9yaWdpbmFsIGlkZW50aWZpZXIsIG9yIG51bGwuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLm9yaWdpbmFsUG9zaXRpb25Gb3IgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9vcmlnaW5hbFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgdmFyIG5lZWRsZSA9IHtcbiAgICAgIGdlbmVyYXRlZExpbmU6IHV0aWwuZ2V0QXJnKGFBcmdzLCAnbGluZScpLFxuICAgICAgZ2VuZXJhdGVkQ29sdW1uOiB1dGlsLmdldEFyZyhhQXJncywgJ2NvbHVtbicpXG4gICAgfTtcblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRNYXBwaW5nKFxuICAgICAgbmVlZGxlLFxuICAgICAgdGhpcy5fZ2VuZXJhdGVkTWFwcGluZ3MsXG4gICAgICBcImdlbmVyYXRlZExpbmVcIixcbiAgICAgIFwiZ2VuZXJhdGVkQ29sdW1uXCIsXG4gICAgICB1dGlsLmNvbXBhcmVCeUdlbmVyYXRlZFBvc2l0aW9uc0RlZmxhdGVkLFxuICAgICAgdXRpbC5nZXRBcmcoYUFyZ3MsICdiaWFzJywgU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQpXG4gICAgKTtcblxuICAgIGlmIChpbmRleCA+PSAwKSB7XG4gICAgICB2YXIgbWFwcGluZyA9IHRoaXMuX2dlbmVyYXRlZE1hcHBpbmdzW2luZGV4XTtcblxuICAgICAgaWYgKG1hcHBpbmcuZ2VuZXJhdGVkTGluZSA9PT0gbmVlZGxlLmdlbmVyYXRlZExpbmUpIHtcbiAgICAgICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdzb3VyY2UnLCBudWxsKTtcbiAgICAgICAgaWYgKHNvdXJjZSAhPT0gbnVsbCkge1xuICAgICAgICAgIHNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuYXQoc291cmNlKTtcbiAgICAgICAgICBzb3VyY2UgPSB1dGlsLmNvbXB1dGVTb3VyY2VVUkwodGhpcy5zb3VyY2VSb290LCBzb3VyY2UsIHRoaXMuX3NvdXJjZU1hcFVSTCk7XG4gICAgICAgIH1cbiAgICAgICAgdmFyIG5hbWUgPSB1dGlsLmdldEFyZyhtYXBwaW5nLCAnbmFtZScsIG51bGwpO1xuICAgICAgICBpZiAobmFtZSAhPT0gbnVsbCkge1xuICAgICAgICAgIG5hbWUgPSB0aGlzLl9uYW1lcy5hdChuYW1lKTtcbiAgICAgICAgfVxuICAgICAgICByZXR1cm4ge1xuICAgICAgICAgIHNvdXJjZTogc291cmNlLFxuICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdvcmlnaW5hbExpbmUnLCBudWxsKSxcbiAgICAgICAgICBjb2x1bW46IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdvcmlnaW5hbENvbHVtbicsIG51bGwpLFxuICAgICAgICAgIG5hbWU6IG5hbWVcbiAgICAgICAgfTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICByZXR1cm4ge1xuICAgICAgc291cmNlOiBudWxsLFxuICAgICAgbGluZTogbnVsbCxcbiAgICAgIGNvbHVtbjogbnVsbCxcbiAgICAgIG5hbWU6IG51bGxcbiAgICB9O1xuICB9O1xuXG4vKipcbiAqIFJldHVybiB0cnVlIGlmIHdlIGhhdmUgdGhlIHNvdXJjZSBjb250ZW50IGZvciBldmVyeSBzb3VyY2UgaW4gdGhlIHNvdXJjZVxuICogbWFwLCBmYWxzZSBvdGhlcndpc2UuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmhhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzID1cbiAgZnVuY3Rpb24gQmFzaWNTb3VyY2VNYXBDb25zdW1lcl9oYXNDb250ZW50c09mQWxsU291cmNlcygpIHtcbiAgICBpZiAoIXRoaXMuc291cmNlc0NvbnRlbnQpIHtcbiAgICAgIHJldHVybiBmYWxzZTtcbiAgICB9XG4gICAgcmV0dXJuIHRoaXMuc291cmNlc0NvbnRlbnQubGVuZ3RoID49IHRoaXMuX3NvdXJjZXMuc2l6ZSgpICYmXG4gICAgICAhdGhpcy5zb3VyY2VzQ29udGVudC5zb21lKGZ1bmN0aW9uIChzYykgeyByZXR1cm4gc2MgPT0gbnVsbDsgfSk7XG4gIH07XG5cbi8qKlxuICogUmV0dXJucyB0aGUgb3JpZ2luYWwgc291cmNlIGNvbnRlbnQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIHRoZSB1cmwgb2YgdGhlXG4gKiBvcmlnaW5hbCBzb3VyY2UgZmlsZS4gUmV0dXJucyBudWxsIGlmIG5vIG9yaWdpbmFsIHNvdXJjZSBjb250ZW50IGlzXG4gKiBhdmFpbGFibGUuXG4gKi9cbkJhc2ljU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLnNvdXJjZUNvbnRlbnRGb3IgPVxuICBmdW5jdGlvbiBTb3VyY2VNYXBDb25zdW1lcl9zb3VyY2VDb250ZW50Rm9yKGFTb3VyY2UsIG51bGxPbk1pc3NpbmcpIHtcbiAgICBpZiAoIXRoaXMuc291cmNlc0NvbnRlbnQpIHtcbiAgICAgIHJldHVybiBudWxsO1xuICAgIH1cblxuICAgIHZhciBpbmRleCA9IHRoaXMuX2ZpbmRTb3VyY2VJbmRleChhU291cmNlKTtcbiAgICBpZiAoaW5kZXggPj0gMCkge1xuICAgICAgcmV0dXJuIHRoaXMuc291cmNlc0NvbnRlbnRbaW5kZXhdO1xuICAgIH1cblxuICAgIHZhciByZWxhdGl2ZVNvdXJjZSA9IGFTb3VyY2U7XG4gICAgaWYgKHRoaXMuc291cmNlUm9vdCAhPSBudWxsKSB7XG4gICAgICByZWxhdGl2ZVNvdXJjZSA9IHV0aWwucmVsYXRpdmUodGhpcy5zb3VyY2VSb290LCByZWxhdGl2ZVNvdXJjZSk7XG4gICAgfVxuXG4gICAgdmFyIHVybDtcbiAgICBpZiAodGhpcy5zb3VyY2VSb290ICE9IG51bGxcbiAgICAgICAgJiYgKHVybCA9IHV0aWwudXJsUGFyc2UodGhpcy5zb3VyY2VSb290KSkpIHtcbiAgICAgIC8vIFhYWDogZmlsZTovLyBVUklzIGFuZCBhYnNvbHV0ZSBwYXRocyBsZWFkIHRvIHVuZXhwZWN0ZWQgYmVoYXZpb3IgZm9yXG4gICAgICAvLyBtYW55IHVzZXJzLiBXZSBjYW4gaGVscCB0aGVtIG91dCB3aGVuIHRoZXkgZXhwZWN0IGZpbGU6Ly8gVVJJcyB0b1xuICAgICAgLy8gYmVoYXZlIGxpa2UgaXQgd291bGQgaWYgdGhleSB3ZXJlIHJ1bm5pbmcgYSBsb2NhbCBIVFRQIHNlcnZlci4gU2VlXG4gICAgICAvLyBodHRwczovL2J1Z3ppbGxhLm1vemlsbGEub3JnL3Nob3dfYnVnLmNnaT9pZD04ODU1OTcuXG4gICAgICB2YXIgZmlsZVVyaUFic1BhdGggPSByZWxhdGl2ZVNvdXJjZS5yZXBsYWNlKC9eZmlsZTpcXC9cXC8vLCBcIlwiKTtcbiAgICAgIGlmICh1cmwuc2NoZW1lID09IFwiZmlsZVwiXG4gICAgICAgICAgJiYgdGhpcy5fc291cmNlcy5oYXMoZmlsZVVyaUFic1BhdGgpKSB7XG4gICAgICAgIHJldHVybiB0aGlzLnNvdXJjZXNDb250ZW50W3RoaXMuX3NvdXJjZXMuaW5kZXhPZihmaWxlVXJpQWJzUGF0aCldXG4gICAgICB9XG5cbiAgICAgIGlmICgoIXVybC5wYXRoIHx8IHVybC5wYXRoID09IFwiL1wiKVxuICAgICAgICAgICYmIHRoaXMuX3NvdXJjZXMuaGFzKFwiL1wiICsgcmVsYXRpdmVTb3VyY2UpKSB7XG4gICAgICAgIHJldHVybiB0aGlzLnNvdXJjZXNDb250ZW50W3RoaXMuX3NvdXJjZXMuaW5kZXhPZihcIi9cIiArIHJlbGF0aXZlU291cmNlKV07XG4gICAgICB9XG4gICAgfVxuXG4gICAgLy8gVGhpcyBmdW5jdGlvbiBpcyB1c2VkIHJlY3Vyc2l2ZWx5IGZyb21cbiAgICAvLyBJbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLnNvdXJjZUNvbnRlbnRGb3IuIEluIHRoYXQgY2FzZSwgd2VcbiAgICAvLyBkb24ndCB3YW50IHRvIHRocm93IGlmIHdlIGNhbid0IGZpbmQgdGhlIHNvdXJjZSAtIHdlIGp1c3Qgd2FudCB0b1xuICAgIC8vIHJldHVybiBudWxsLCBzbyB3ZSBwcm92aWRlIGEgZmxhZyB0byBleGl0IGdyYWNlZnVsbHkuXG4gICAgaWYgKG51bGxPbk1pc3NpbmcpIHtcbiAgICAgIHJldHVybiBudWxsO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIHRocm93IG5ldyBFcnJvcignXCInICsgcmVsYXRpdmVTb3VyY2UgKyAnXCIgaXMgbm90IGluIHRoZSBTb3VyY2VNYXAuJyk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGdlbmVyYXRlZCBsaW5lIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBvcmlnaW5hbCBzb3VyY2UsXG4gKiBsaW5lLCBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0IHdpdGhcbiAqIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gc291cmNlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIG9yaWdpbmFsIHNvdXJjZS5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIGJpYXM6IEVpdGhlciAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnIG9yXG4gKiAgICAgJ1NvdXJjZU1hcENvbnN1bWVyLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnU291cmNlTWFwQ29uc3VtZXIuR1JFQVRFU1RfTE9XRVJfQk9VTkQnLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC5cbiAqICAgICBUaGUgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICovXG5CYXNpY1NvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5nZW5lcmF0ZWRQb3NpdGlvbkZvciA9XG4gIGZ1bmN0aW9uIFNvdXJjZU1hcENvbnN1bWVyX2dlbmVyYXRlZFBvc2l0aW9uRm9yKGFBcmdzKSB7XG4gICAgdmFyIHNvdXJjZSA9IHV0aWwuZ2V0QXJnKGFBcmdzLCAnc291cmNlJyk7XG4gICAgc291cmNlID0gdGhpcy5fZmluZFNvdXJjZUluZGV4KHNvdXJjZSk7XG4gICAgaWYgKHNvdXJjZSA8IDApIHtcbiAgICAgIHJldHVybiB7XG4gICAgICAgIGxpbmU6IG51bGwsXG4gICAgICAgIGNvbHVtbjogbnVsbCxcbiAgICAgICAgbGFzdENvbHVtbjogbnVsbFxuICAgICAgfTtcbiAgICB9XG5cbiAgICB2YXIgbmVlZGxlID0ge1xuICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICBvcmlnaW5hbExpbmU6IHV0aWwuZ2V0QXJnKGFBcmdzLCAnbGluZScpLFxuICAgICAgb3JpZ2luYWxDb2x1bW46IHV0aWwuZ2V0QXJnKGFBcmdzLCAnY29sdW1uJylcbiAgICB9O1xuXG4gICAgdmFyIGluZGV4ID0gdGhpcy5fZmluZE1hcHBpbmcoXG4gICAgICBuZWVkbGUsXG4gICAgICB0aGlzLl9vcmlnaW5hbE1hcHBpbmdzLFxuICAgICAgXCJvcmlnaW5hbExpbmVcIixcbiAgICAgIFwib3JpZ2luYWxDb2x1bW5cIixcbiAgICAgIHV0aWwuY29tcGFyZUJ5T3JpZ2luYWxQb3NpdGlvbnMsXG4gICAgICB1dGlsLmdldEFyZyhhQXJncywgJ2JpYXMnLCBTb3VyY2VNYXBDb25zdW1lci5HUkVBVEVTVF9MT1dFUl9CT1VORClcbiAgICApO1xuXG4gICAgaWYgKGluZGV4ID49IDApIHtcbiAgICAgIHZhciBtYXBwaW5nID0gdGhpcy5fb3JpZ2luYWxNYXBwaW5nc1tpbmRleF07XG5cbiAgICAgIGlmIChtYXBwaW5nLnNvdXJjZSA9PT0gbmVlZGxlLnNvdXJjZSkge1xuICAgICAgICByZXR1cm4ge1xuICAgICAgICAgIGxpbmU6IHV0aWwuZ2V0QXJnKG1hcHBpbmcsICdnZW5lcmF0ZWRMaW5lJywgbnVsbCksXG4gICAgICAgICAgY29sdW1uOiB1dGlsLmdldEFyZyhtYXBwaW5nLCAnZ2VuZXJhdGVkQ29sdW1uJywgbnVsbCksXG4gICAgICAgICAgbGFzdENvbHVtbjogdXRpbC5nZXRBcmcobWFwcGluZywgJ2xhc3RHZW5lcmF0ZWRDb2x1bW4nLCBudWxsKVxuICAgICAgICB9O1xuICAgICAgfVxuICAgIH1cblxuICAgIHJldHVybiB7XG4gICAgICBsaW5lOiBudWxsLFxuICAgICAgY29sdW1uOiBudWxsLFxuICAgICAgbGFzdENvbHVtbjogbnVsbFxuICAgIH07XG4gIH07XG5cbmV4cG9ydHMuQmFzaWNTb3VyY2VNYXBDb25zdW1lciA9IEJhc2ljU291cmNlTWFwQ29uc3VtZXI7XG5cbi8qKlxuICogQW4gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyIGluc3RhbmNlIHJlcHJlc2VudHMgYSBwYXJzZWQgc291cmNlIG1hcCB3aGljaFxuICogd2UgY2FuIHF1ZXJ5IGZvciBpbmZvcm1hdGlvbi4gSXQgZGlmZmVycyBmcm9tIEJhc2ljU291cmNlTWFwQ29uc3VtZXIgaW5cbiAqIHRoYXQgaXQgdGFrZXMgXCJpbmRleGVkXCIgc291cmNlIG1hcHMgKGkuZS4gb25lcyB3aXRoIGEgXCJzZWN0aW9uc1wiIGZpZWxkKSBhc1xuICogaW5wdXQuXG4gKlxuICogVGhlIGZpcnN0IHBhcmFtZXRlciBpcyBhIHJhdyBzb3VyY2UgbWFwIChlaXRoZXIgYXMgYSBKU09OIHN0cmluZywgb3IgYWxyZWFkeVxuICogcGFyc2VkIHRvIGFuIG9iamVjdCkuIEFjY29yZGluZyB0byB0aGUgc3BlYyBmb3IgaW5kZXhlZCBzb3VyY2UgbWFwcywgdGhleVxuICogaGF2ZSB0aGUgZm9sbG93aW5nIGF0dHJpYnV0ZXM6XG4gKlxuICogICAtIHZlcnNpb246IFdoaWNoIHZlcnNpb24gb2YgdGhlIHNvdXJjZSBtYXAgc3BlYyB0aGlzIG1hcCBpcyBmb2xsb3dpbmcuXG4gKiAgIC0gZmlsZTogT3B0aW9uYWwuIFRoZSBnZW5lcmF0ZWQgZmlsZSB0aGlzIHNvdXJjZSBtYXAgaXMgYXNzb2NpYXRlZCB3aXRoLlxuICogICAtIHNlY3Rpb25zOiBBIGxpc3Qgb2Ygc2VjdGlvbiBkZWZpbml0aW9ucy5cbiAqXG4gKiBFYWNoIHZhbHVlIHVuZGVyIHRoZSBcInNlY3Rpb25zXCIgZmllbGQgaGFzIHR3byBmaWVsZHM6XG4gKiAgIC0gb2Zmc2V0OiBUaGUgb2Zmc2V0IGludG8gdGhlIG9yaWdpbmFsIHNwZWNpZmllZCBhdCB3aGljaCB0aGlzIHNlY3Rpb25cbiAqICAgICAgIGJlZ2lucyB0byBhcHBseSwgZGVmaW5lZCBhcyBhbiBvYmplY3Qgd2l0aCBhIFwibGluZVwiIGFuZCBcImNvbHVtblwiXG4gKiAgICAgICBmaWVsZC5cbiAqICAgLSBtYXA6IEEgc291cmNlIG1hcCBkZWZpbml0aW9uLiBUaGlzIHNvdXJjZSBtYXAgY291bGQgYWxzbyBiZSBpbmRleGVkLFxuICogICAgICAgYnV0IGRvZXNuJ3QgaGF2ZSB0byBiZS5cbiAqXG4gKiBJbnN0ZWFkIG9mIHRoZSBcIm1hcFwiIGZpZWxkLCBpdCdzIGFsc28gcG9zc2libGUgdG8gaGF2ZSBhIFwidXJsXCIgZmllbGRcbiAqIHNwZWNpZnlpbmcgYSBVUkwgdG8gcmV0cmlldmUgYSBzb3VyY2UgbWFwIGZyb20sIGJ1dCB0aGF0J3MgY3VycmVudGx5XG4gKiB1bnN1cHBvcnRlZC5cbiAqXG4gKiBIZXJlJ3MgYW4gZXhhbXBsZSBzb3VyY2UgbWFwLCB0YWtlbiBmcm9tIHRoZSBzb3VyY2UgbWFwIHNwZWNbMF0sIGJ1dFxuICogbW9kaWZpZWQgdG8gb21pdCBhIHNlY3Rpb24gd2hpY2ggdXNlcyB0aGUgXCJ1cmxcIiBmaWVsZC5cbiAqXG4gKiAge1xuICogICAgdmVyc2lvbiA6IDMsXG4gKiAgICBmaWxlOiBcImFwcC5qc1wiLFxuICogICAgc2VjdGlvbnM6IFt7XG4gKiAgICAgIG9mZnNldDoge2xpbmU6MTAwLCBjb2x1bW46MTB9LFxuICogICAgICBtYXA6IHtcbiAqICAgICAgICB2ZXJzaW9uIDogMyxcbiAqICAgICAgICBmaWxlOiBcInNlY3Rpb24uanNcIixcbiAqICAgICAgICBzb3VyY2VzOiBbXCJmb28uanNcIiwgXCJiYXIuanNcIl0sXG4gKiAgICAgICAgbmFtZXM6IFtcInNyY1wiLCBcIm1hcHNcIiwgXCJhcmVcIiwgXCJmdW5cIl0sXG4gKiAgICAgICAgbWFwcGluZ3M6IFwiQUFBQSxFOztBQkNERTtcIlxuICogICAgICB9XG4gKiAgICB9XSxcbiAqICB9XG4gKlxuICogVGhlIHNlY29uZCBwYXJhbWV0ZXIsIGlmIGdpdmVuLCBpcyBhIHN0cmluZyB3aG9zZSB2YWx1ZSBpcyB0aGUgVVJMXG4gKiBhdCB3aGljaCB0aGUgc291cmNlIG1hcCB3YXMgZm91bmQuICBUaGlzIFVSTCBpcyB1c2VkIHRvIGNvbXB1dGUgdGhlXG4gKiBzb3VyY2VzIGFycmF5LlxuICpcbiAqIFswXTogaHR0cHM6Ly9kb2NzLmdvb2dsZS5jb20vZG9jdW1lbnQvZC8xVTFSR0FlaFF3UnlwVVRvdkYxS1JscGlPRnplMGItXzJnYzZmQUgwS1kway9lZGl0I2hlYWRpbmc9aC41MzVlczN4ZXByZ3RcbiAqL1xuZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyKGFTb3VyY2VNYXAsIGFTb3VyY2VNYXBVUkwpIHtcbiAgdmFyIHNvdXJjZU1hcCA9IGFTb3VyY2VNYXA7XG4gIGlmICh0eXBlb2YgYVNvdXJjZU1hcCA9PT0gJ3N0cmluZycpIHtcbiAgICBzb3VyY2VNYXAgPSB1dGlsLnBhcnNlU291cmNlTWFwSW5wdXQoYVNvdXJjZU1hcCk7XG4gIH1cblxuICB2YXIgdmVyc2lvbiA9IHV0aWwuZ2V0QXJnKHNvdXJjZU1hcCwgJ3ZlcnNpb24nKTtcbiAgdmFyIHNlY3Rpb25zID0gdXRpbC5nZXRBcmcoc291cmNlTWFwLCAnc2VjdGlvbnMnKTtcblxuICBpZiAodmVyc2lvbiAhPSB0aGlzLl92ZXJzaW9uKSB7XG4gICAgdGhyb3cgbmV3IEVycm9yKCdVbnN1cHBvcnRlZCB2ZXJzaW9uOiAnICsgdmVyc2lvbik7XG4gIH1cblxuICB0aGlzLl9zb3VyY2VzID0gbmV3IEFycmF5U2V0KCk7XG4gIHRoaXMuX25hbWVzID0gbmV3IEFycmF5U2V0KCk7XG5cbiAgdmFyIGxhc3RPZmZzZXQgPSB7XG4gICAgbGluZTogLTEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHRoaXMuX3NlY3Rpb25zID0gc2VjdGlvbnMubWFwKGZ1bmN0aW9uIChzKSB7XG4gICAgaWYgKHMudXJsKSB7XG4gICAgICAvLyBUaGUgdXJsIGZpZWxkIHdpbGwgcmVxdWlyZSBzdXBwb3J0IGZvciBhc3luY2hyb25pY2l0eS5cbiAgICAgIC8vIFNlZSBodHRwczovL2dpdGh1Yi5jb20vbW96aWxsYS9zb3VyY2UtbWFwL2lzc3Vlcy8xNlxuICAgICAgdGhyb3cgbmV3IEVycm9yKCdTdXBwb3J0IGZvciB1cmwgZmllbGQgaW4gc2VjdGlvbnMgbm90IGltcGxlbWVudGVkLicpO1xuICAgIH1cbiAgICB2YXIgb2Zmc2V0ID0gdXRpbC5nZXRBcmcocywgJ29mZnNldCcpO1xuICAgIHZhciBvZmZzZXRMaW5lID0gdXRpbC5nZXRBcmcob2Zmc2V0LCAnbGluZScpO1xuICAgIHZhciBvZmZzZXRDb2x1bW4gPSB1dGlsLmdldEFyZyhvZmZzZXQsICdjb2x1bW4nKTtcblxuICAgIGlmIChvZmZzZXRMaW5lIDwgbGFzdE9mZnNldC5saW5lIHx8XG4gICAgICAgIChvZmZzZXRMaW5lID09PSBsYXN0T2Zmc2V0LmxpbmUgJiYgb2Zmc2V0Q29sdW1uIDwgbGFzdE9mZnNldC5jb2x1bW4pKSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ1NlY3Rpb24gb2Zmc2V0cyBtdXN0IGJlIG9yZGVyZWQgYW5kIG5vbi1vdmVybGFwcGluZy4nKTtcbiAgICB9XG4gICAgbGFzdE9mZnNldCA9IG9mZnNldDtcblxuICAgIHJldHVybiB7XG4gICAgICBnZW5lcmF0ZWRPZmZzZXQ6IHtcbiAgICAgICAgLy8gVGhlIG9mZnNldCBmaWVsZHMgYXJlIDAtYmFzZWQsIGJ1dCB3ZSB1c2UgMS1iYXNlZCBpbmRpY2VzIHdoZW5cbiAgICAgICAgLy8gZW5jb2RpbmcvZGVjb2RpbmcgZnJvbSBWTFEuXG4gICAgICAgIGdlbmVyYXRlZExpbmU6IG9mZnNldExpbmUgKyAxLFxuICAgICAgICBnZW5lcmF0ZWRDb2x1bW46IG9mZnNldENvbHVtbiArIDFcbiAgICAgIH0sXG4gICAgICBjb25zdW1lcjogbmV3IFNvdXJjZU1hcENvbnN1bWVyKHV0aWwuZ2V0QXJnKHMsICdtYXAnKSwgYVNvdXJjZU1hcFVSTClcbiAgICB9XG4gIH0pO1xufVxuXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlID0gT2JqZWN0LmNyZWF0ZShTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUpO1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5jb25zdHJ1Y3RvciA9IFNvdXJjZU1hcENvbnN1bWVyO1xuXG4vKipcbiAqIFRoZSB2ZXJzaW9uIG9mIHRoZSBzb3VyY2UgbWFwcGluZyBzcGVjIHRoYXQgd2UgYXJlIGNvbnN1bWluZy5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fdmVyc2lvbiA9IDM7XG5cbi8qKlxuICogVGhlIGxpc3Qgb2Ygb3JpZ2luYWwgc291cmNlcy5cbiAqL1xuT2JqZWN0LmRlZmluZVByb3BlcnR5KEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lci5wcm90b3R5cGUsICdzb3VyY2VzJywge1xuICBnZXQ6IGZ1bmN0aW9uICgpIHtcbiAgICB2YXIgc291cmNlcyA9IFtdO1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIGZvciAodmFyIGogPSAwOyBqIDwgdGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlcy5sZW5ndGg7IGorKykge1xuICAgICAgICBzb3VyY2VzLnB1c2godGhpcy5fc2VjdGlvbnNbaV0uY29uc3VtZXIuc291cmNlc1tqXSk7XG4gICAgICB9XG4gICAgfVxuICAgIHJldHVybiBzb3VyY2VzO1xuICB9XG59KTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UsIGxpbmUsIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBnZW5lcmF0ZWRcbiAqIHNvdXJjZSdzIGxpbmUgYW5kIGNvbHVtbiBwb3NpdGlvbnMgcHJvdmlkZWQuIFRoZSBvbmx5IGFyZ3VtZW50IGlzIGFuIG9iamVjdFxuICogd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZS4gIFRoZSBjb2x1bW5cbiAqICAgICBudW1iZXIgaXMgMC1iYXNlZC5cbiAqXG4gKiBhbmQgYW4gb2JqZWN0IGlzIHJldHVybmVkIHdpdGggdGhlIGZvbGxvd2luZyBwcm9wZXJ0aWVzOlxuICpcbiAqICAgLSBzb3VyY2U6IFRoZSBvcmlnaW5hbCBzb3VyY2UgZmlsZSwgb3IgbnVsbC5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLCBvciBudWxsLiAgVGhlXG4gKiAgICAgY29sdW1uIG51bWJlciBpcyAwLWJhc2VkLlxuICogICAtIG5hbWU6IFRoZSBvcmlnaW5hbCBpZGVudGlmaWVyLCBvciBudWxsLlxuICovXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLm9yaWdpbmFsUG9zaXRpb25Gb3IgPVxuICBmdW5jdGlvbiBJbmRleGVkU291cmNlTWFwQ29uc3VtZXJfb3JpZ2luYWxQb3NpdGlvbkZvcihhQXJncykge1xuICAgIHZhciBuZWVkbGUgPSB7XG4gICAgICBnZW5lcmF0ZWRMaW5lOiB1dGlsLmdldEFyZyhhQXJncywgJ2xpbmUnKSxcbiAgICAgIGdlbmVyYXRlZENvbHVtbjogdXRpbC5nZXRBcmcoYUFyZ3MsICdjb2x1bW4nKVxuICAgIH07XG5cbiAgICAvLyBGaW5kIHRoZSBzZWN0aW9uIGNvbnRhaW5pbmcgdGhlIGdlbmVyYXRlZCBwb3NpdGlvbiB3ZSdyZSB0cnlpbmcgdG8gbWFwXG4gICAgLy8gdG8gYW4gb3JpZ2luYWwgcG9zaXRpb24uXG4gICAgdmFyIHNlY3Rpb25JbmRleCA9IGJpbmFyeVNlYXJjaC5zZWFyY2gobmVlZGxlLCB0aGlzLl9zZWN0aW9ucyxcbiAgICAgIGZ1bmN0aW9uKG5lZWRsZSwgc2VjdGlvbikge1xuICAgICAgICB2YXIgY21wID0gbmVlZGxlLmdlbmVyYXRlZExpbmUgLSBzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lO1xuICAgICAgICBpZiAoY21wKSB7XG4gICAgICAgICAgcmV0dXJuIGNtcDtcbiAgICAgICAgfVxuXG4gICAgICAgIHJldHVybiAobmVlZGxlLmdlbmVyYXRlZENvbHVtbiAtXG4gICAgICAgICAgICAgICAgc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkQ29sdW1uKTtcbiAgICAgIH0pO1xuICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbc2VjdGlvbkluZGV4XTtcblxuICAgIGlmICghc2VjdGlvbikge1xuICAgICAgcmV0dXJuIHtcbiAgICAgICAgc291cmNlOiBudWxsLFxuICAgICAgICBsaW5lOiBudWxsLFxuICAgICAgICBjb2x1bW46IG51bGwsXG4gICAgICAgIG5hbWU6IG51bGxcbiAgICAgIH07XG4gICAgfVxuXG4gICAgcmV0dXJuIHNlY3Rpb24uY29uc3VtZXIub3JpZ2luYWxQb3NpdGlvbkZvcih7XG4gICAgICBsaW5lOiBuZWVkbGUuZ2VuZXJhdGVkTGluZSAtXG4gICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICBjb2x1bW46IG5lZWRsZS5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSA9PT0gbmVlZGxlLmdlbmVyYXRlZExpbmVcbiAgICAgICAgID8gc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkQ29sdW1uIC0gMVxuICAgICAgICAgOiAwKSxcbiAgICAgIGJpYXM6IGFBcmdzLmJpYXNcbiAgICB9KTtcbiAgfTtcblxuLyoqXG4gKiBSZXR1cm4gdHJ1ZSBpZiB3ZSBoYXZlIHRoZSBzb3VyY2UgY29udGVudCBmb3IgZXZlcnkgc291cmNlIGluIHRoZSBzb3VyY2VcbiAqIG1hcCwgZmFsc2Ugb3RoZXJ3aXNlLlxuICovXG5JbmRleGVkU291cmNlTWFwQ29uc3VtZXIucHJvdG90eXBlLmhhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX2hhc0NvbnRlbnRzT2ZBbGxTb3VyY2VzKCkge1xuICAgIHJldHVybiB0aGlzLl9zZWN0aW9ucy5ldmVyeShmdW5jdGlvbiAocykge1xuICAgICAgcmV0dXJuIHMuY29uc3VtZXIuaGFzQ29udGVudHNPZkFsbFNvdXJjZXMoKTtcbiAgICB9KTtcbiAgfTtcblxuLyoqXG4gKiBSZXR1cm5zIHRoZSBvcmlnaW5hbCBzb3VyY2UgY29udGVudC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgdGhlIHVybCBvZiB0aGVcbiAqIG9yaWdpbmFsIHNvdXJjZSBmaWxlLiBSZXR1cm5zIG51bGwgaWYgbm8gb3JpZ2luYWwgc291cmNlIGNvbnRlbnQgaXNcbiAqIGF2YWlsYWJsZS5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5zb3VyY2VDb250ZW50Rm9yID1cbiAgZnVuY3Rpb24gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyX3NvdXJjZUNvbnRlbnRGb3IoYVNvdXJjZSwgbnVsbE9uTWlzc2luZykge1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbaV07XG5cbiAgICAgIHZhciBjb250ZW50ID0gc2VjdGlvbi5jb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKGFTb3VyY2UsIHRydWUpO1xuICAgICAgaWYgKGNvbnRlbnQpIHtcbiAgICAgICAgcmV0dXJuIGNvbnRlbnQ7XG4gICAgICB9XG4gICAgfVxuICAgIGlmIChudWxsT25NaXNzaW5nKSB7XG4gICAgICByZXR1cm4gbnVsbDtcbiAgICB9XG4gICAgZWxzZSB7XG4gICAgICB0aHJvdyBuZXcgRXJyb3IoJ1wiJyArIGFTb3VyY2UgKyAnXCIgaXMgbm90IGluIHRoZSBTb3VyY2VNYXAuJyk7XG4gICAgfVxuICB9O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIGdlbmVyYXRlZCBsaW5lIGFuZCBjb2x1bW4gaW5mb3JtYXRpb24gZm9yIHRoZSBvcmlnaW5hbCBzb3VyY2UsXG4gKiBsaW5lLCBhbmQgY29sdW1uIHBvc2l0aW9ucyBwcm92aWRlZC4gVGhlIG9ubHkgYXJndW1lbnQgaXMgYW4gb2JqZWN0IHdpdGhcbiAqIHRoZSBmb2xsb3dpbmcgcHJvcGVydGllczpcbiAqXG4gKiAgIC0gc291cmNlOiBUaGUgZmlsZW5hbWUgb2YgdGhlIG9yaWdpbmFsIHNvdXJjZS5cbiAqICAgLSBsaW5lOiBUaGUgbGluZSBudW1iZXIgaW4gdGhlIG9yaWdpbmFsIHNvdXJjZS4gIFRoZSBsaW5lIG51bWJlclxuICogICAgIGlzIDEtYmFzZWQuXG4gKiAgIC0gY29sdW1uOiBUaGUgY29sdW1uIG51bWJlciBpbiB0aGUgb3JpZ2luYWwgc291cmNlLiAgVGhlIGNvbHVtblxuICogICAgIG51bWJlciBpcyAwLWJhc2VkLlxuICpcbiAqIGFuZCBhbiBvYmplY3QgaXMgcmV0dXJuZWQgd2l0aCB0aGUgZm9sbG93aW5nIHByb3BlcnRpZXM6XG4gKlxuICogICAtIGxpbmU6IFRoZSBsaW5lIG51bWJlciBpbiB0aGUgZ2VuZXJhdGVkIHNvdXJjZSwgb3IgbnVsbC4gIFRoZVxuICogICAgIGxpbmUgbnVtYmVyIGlzIDEtYmFzZWQuIFxuICogICAtIGNvbHVtbjogVGhlIGNvbHVtbiBudW1iZXIgaW4gdGhlIGdlbmVyYXRlZCBzb3VyY2UsIG9yIG51bGwuXG4gKiAgICAgVGhlIGNvbHVtbiBudW1iZXIgaXMgMC1iYXNlZC5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5nZW5lcmF0ZWRQb3NpdGlvbkZvciA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9nZW5lcmF0ZWRQb3NpdGlvbkZvcihhQXJncykge1xuICAgIGZvciAodmFyIGkgPSAwOyBpIDwgdGhpcy5fc2VjdGlvbnMubGVuZ3RoOyBpKyspIHtcbiAgICAgIHZhciBzZWN0aW9uID0gdGhpcy5fc2VjdGlvbnNbaV07XG5cbiAgICAgIC8vIE9ubHkgY29uc2lkZXIgdGhpcyBzZWN0aW9uIGlmIHRoZSByZXF1ZXN0ZWQgc291cmNlIGlzIGluIHRoZSBsaXN0IG9mXG4gICAgICAvLyBzb3VyY2VzIG9mIHRoZSBjb25zdW1lci5cbiAgICAgIGlmIChzZWN0aW9uLmNvbnN1bWVyLl9maW5kU291cmNlSW5kZXgodXRpbC5nZXRBcmcoYUFyZ3MsICdzb3VyY2UnKSkgPT09IC0xKSB7XG4gICAgICAgIGNvbnRpbnVlO1xuICAgICAgfVxuICAgICAgdmFyIGdlbmVyYXRlZFBvc2l0aW9uID0gc2VjdGlvbi5jb25zdW1lci5nZW5lcmF0ZWRQb3NpdGlvbkZvcihhQXJncyk7XG4gICAgICBpZiAoZ2VuZXJhdGVkUG9zaXRpb24pIHtcbiAgICAgICAgdmFyIHJldCA9IHtcbiAgICAgICAgICBsaW5lOiBnZW5lcmF0ZWRQb3NpdGlvbi5saW5lICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICAgICAgY29sdW1uOiBnZW5lcmF0ZWRQb3NpdGlvbi5jb2x1bW4gK1xuICAgICAgICAgICAgKHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZExpbmUgPT09IGdlbmVyYXRlZFBvc2l0aW9uLmxpbmVcbiAgICAgICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgICAgICA6IDApXG4gICAgICAgIH07XG4gICAgICAgIHJldHVybiByZXQ7XG4gICAgICB9XG4gICAgfVxuXG4gICAgcmV0dXJuIHtcbiAgICAgIGxpbmU6IG51bGwsXG4gICAgICBjb2x1bW46IG51bGxcbiAgICB9O1xuICB9O1xuXG4vKipcbiAqIFBhcnNlIHRoZSBtYXBwaW5ncyBpbiBhIHN0cmluZyBpbiB0byBhIGRhdGEgc3RydWN0dXJlIHdoaWNoIHdlIGNhbiBlYXNpbHlcbiAqIHF1ZXJ5ICh0aGUgb3JkZXJlZCBhcnJheXMgaW4gdGhlIGB0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3NgIGFuZFxuICogYHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzYCBwcm9wZXJ0aWVzKS5cbiAqL1xuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyLnByb3RvdHlwZS5fcGFyc2VNYXBwaW5ncyA9XG4gIGZ1bmN0aW9uIEluZGV4ZWRTb3VyY2VNYXBDb25zdW1lcl9wYXJzZU1hcHBpbmdzKGFTdHIsIGFTb3VyY2VSb290KSB7XG4gICAgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzID0gW107XG4gICAgdGhpcy5fX29yaWdpbmFsTWFwcGluZ3MgPSBbXTtcbiAgICBmb3IgKHZhciBpID0gMDsgaSA8IHRoaXMuX3NlY3Rpb25zLmxlbmd0aDsgaSsrKSB7XG4gICAgICB2YXIgc2VjdGlvbiA9IHRoaXMuX3NlY3Rpb25zW2ldO1xuICAgICAgdmFyIHNlY3Rpb25NYXBwaW5ncyA9IHNlY3Rpb24uY29uc3VtZXIuX2dlbmVyYXRlZE1hcHBpbmdzO1xuICAgICAgZm9yICh2YXIgaiA9IDA7IGogPCBzZWN0aW9uTWFwcGluZ3MubGVuZ3RoOyBqKyspIHtcbiAgICAgICAgdmFyIG1hcHBpbmcgPSBzZWN0aW9uTWFwcGluZ3Nbal07XG5cbiAgICAgICAgdmFyIHNvdXJjZSA9IHNlY3Rpb24uY29uc3VtZXIuX3NvdXJjZXMuYXQobWFwcGluZy5zb3VyY2UpO1xuICAgICAgICBzb3VyY2UgPSB1dGlsLmNvbXB1dGVTb3VyY2VVUkwoc2VjdGlvbi5jb25zdW1lci5zb3VyY2VSb290LCBzb3VyY2UsIHRoaXMuX3NvdXJjZU1hcFVSTCk7XG4gICAgICAgIHRoaXMuX3NvdXJjZXMuYWRkKHNvdXJjZSk7XG4gICAgICAgIHNvdXJjZSA9IHRoaXMuX3NvdXJjZXMuaW5kZXhPZihzb3VyY2UpO1xuXG4gICAgICAgIHZhciBuYW1lID0gbnVsbDtcbiAgICAgICAgaWYgKG1hcHBpbmcubmFtZSkge1xuICAgICAgICAgIG5hbWUgPSBzZWN0aW9uLmNvbnN1bWVyLl9uYW1lcy5hdChtYXBwaW5nLm5hbWUpO1xuICAgICAgICAgIHRoaXMuX25hbWVzLmFkZChuYW1lKTtcbiAgICAgICAgICBuYW1lID0gdGhpcy5fbmFtZXMuaW5kZXhPZihuYW1lKTtcbiAgICAgICAgfVxuXG4gICAgICAgIC8vIFRoZSBtYXBwaW5ncyBjb21pbmcgZnJvbSB0aGUgY29uc3VtZXIgZm9yIHRoZSBzZWN0aW9uIGhhdmVcbiAgICAgICAgLy8gZ2VuZXJhdGVkIHBvc2l0aW9ucyByZWxhdGl2ZSB0byB0aGUgc3RhcnQgb2YgdGhlIHNlY3Rpb24sIHNvIHdlXG4gICAgICAgIC8vIG5lZWQgdG8gb2Zmc2V0IHRoZW0gdG8gYmUgcmVsYXRpdmUgdG8gdGhlIHN0YXJ0IG9mIHRoZSBjb25jYXRlbmF0ZWRcbiAgICAgICAgLy8gZ2VuZXJhdGVkIGZpbGUuXG4gICAgICAgIHZhciBhZGp1c3RlZE1hcHBpbmcgPSB7XG4gICAgICAgICAgc291cmNlOiBzb3VyY2UsXG4gICAgICAgICAgZ2VuZXJhdGVkTGluZTogbWFwcGluZy5nZW5lcmF0ZWRMaW5lICtcbiAgICAgICAgICAgIChzZWN0aW9uLmdlbmVyYXRlZE9mZnNldC5nZW5lcmF0ZWRMaW5lIC0gMSksXG4gICAgICAgICAgZ2VuZXJhdGVkQ29sdW1uOiBtYXBwaW5nLmdlbmVyYXRlZENvbHVtbiArXG4gICAgICAgICAgICAoc2VjdGlvbi5nZW5lcmF0ZWRPZmZzZXQuZ2VuZXJhdGVkTGluZSA9PT0gbWFwcGluZy5nZW5lcmF0ZWRMaW5lXG4gICAgICAgICAgICA/IHNlY3Rpb24uZ2VuZXJhdGVkT2Zmc2V0LmdlbmVyYXRlZENvbHVtbiAtIDFcbiAgICAgICAgICAgIDogMCksXG4gICAgICAgICAgb3JpZ2luYWxMaW5lOiBtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICBvcmlnaW5hbENvbHVtbjogbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICBuYW1lOiBuYW1lXG4gICAgICAgIH07XG5cbiAgICAgICAgdGhpcy5fX2dlbmVyYXRlZE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgaWYgKHR5cGVvZiBhZGp1c3RlZE1hcHBpbmcub3JpZ2luYWxMaW5lID09PSAnbnVtYmVyJykge1xuICAgICAgICAgIHRoaXMuX19vcmlnaW5hbE1hcHBpbmdzLnB1c2goYWRqdXN0ZWRNYXBwaW5nKTtcbiAgICAgICAgfVxuICAgICAgfVxuICAgIH1cblxuICAgIHF1aWNrU29ydCh0aGlzLl9fZ2VuZXJhdGVkTWFwcGluZ3MsIHV0aWwuY29tcGFyZUJ5R2VuZXJhdGVkUG9zaXRpb25zRGVmbGF0ZWQpO1xuICAgIHF1aWNrU29ydCh0aGlzLl9fb3JpZ2luYWxNYXBwaW5ncywgdXRpbC5jb21wYXJlQnlPcmlnaW5hbFBvc2l0aW9ucyk7XG4gIH07XG5cbmV4cG9ydHMuSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyID0gSW5kZXhlZFNvdXJjZU1hcENvbnN1bWVyO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW1hcC1jb25zdW1lci5qc1xuLy8gbW9kdWxlIGlkID0gN1xuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbmV4cG9ydHMuR1JFQVRFU1RfTE9XRVJfQk9VTkQgPSAxO1xuZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCA9IDI7XG5cbi8qKlxuICogUmVjdXJzaXZlIGltcGxlbWVudGF0aW9uIG9mIGJpbmFyeSBzZWFyY2guXG4gKlxuICogQHBhcmFtIGFMb3cgSW5kaWNlcyBoZXJlIGFuZCBsb3dlciBkbyBub3QgY29udGFpbiB0aGUgbmVlZGxlLlxuICogQHBhcmFtIGFIaWdoIEluZGljZXMgaGVyZSBhbmQgaGlnaGVyIGRvIG5vdCBjb250YWluIHRoZSBuZWVkbGUuXG4gKiBAcGFyYW0gYU5lZWRsZSBUaGUgZWxlbWVudCBiZWluZyBzZWFyY2hlZCBmb3IuXG4gKiBAcGFyYW0gYUhheXN0YWNrIFRoZSBub24tZW1wdHkgYXJyYXkgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgRnVuY3Rpb24gd2hpY2ggdGFrZXMgdHdvIGVsZW1lbnRzIGFuZCByZXR1cm5zIC0xLCAwLCBvciAxLlxuICogQHBhcmFtIGFCaWFzIEVpdGhlciAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJyBvclxuICogICAgICdiaW5hcnlTZWFyY2guTEVBU1RfVVBQRVJfQk9VTkQnLiBTcGVjaWZpZXMgd2hldGhlciB0byByZXR1cm4gdGhlXG4gKiAgICAgY2xvc2VzdCBlbGVtZW50IHRoYXQgaXMgc21hbGxlciB0aGFuIG9yIGdyZWF0ZXIgdGhhbiB0aGUgb25lIHdlIGFyZVxuICogICAgIHNlYXJjaGluZyBmb3IsIHJlc3BlY3RpdmVseSwgaWYgdGhlIGV4YWN0IGVsZW1lbnQgY2Fubm90IGJlIGZvdW5kLlxuICovXG5mdW5jdGlvbiByZWN1cnNpdmVTZWFyY2goYUxvdywgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKSB7XG4gIC8vIFRoaXMgZnVuY3Rpb24gdGVybWluYXRlcyB3aGVuIG9uZSBvZiB0aGUgZm9sbG93aW5nIGlzIHRydWU6XG4gIC8vXG4gIC8vICAgMS4gV2UgZmluZCB0aGUgZXhhY3QgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gIC8vXG4gIC8vICAgMi4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBidXQgd2UgY2FuIHJldHVybiB0aGUgaW5kZXggb2ZcbiAgLy8gICAgICB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQuXG4gIC8vXG4gIC8vICAgMy4gV2UgZGlkIG5vdCBmaW5kIHRoZSBleGFjdCBlbGVtZW50LCBhbmQgdGhlcmUgaXMgbm8gbmV4dC1jbG9zZXN0XG4gIC8vICAgICAgZWxlbWVudCB0aGFuIHRoZSBvbmUgd2UgYXJlIHNlYXJjaGluZyBmb3IsIHNvIHdlIHJldHVybiAtMS5cbiAgdmFyIG1pZCA9IE1hdGguZmxvb3IoKGFIaWdoIC0gYUxvdykgLyAyKSArIGFMb3c7XG4gIHZhciBjbXAgPSBhQ29tcGFyZShhTmVlZGxlLCBhSGF5c3RhY2tbbWlkXSwgdHJ1ZSk7XG4gIGlmIChjbXAgPT09IDApIHtcbiAgICAvLyBGb3VuZCB0aGUgZWxlbWVudCB3ZSBhcmUgbG9va2luZyBmb3IuXG4gICAgcmV0dXJuIG1pZDtcbiAgfVxuICBlbHNlIGlmIChjbXAgPiAwKSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBncmVhdGVyIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKGFIaWdoIC0gbWlkID4gMSkge1xuICAgICAgLy8gVGhlIGVsZW1lbnQgaXMgaW4gdGhlIHVwcGVyIGhhbGYuXG4gICAgICByZXR1cm4gcmVjdXJzaXZlU2VhcmNoKG1pZCwgYUhpZ2gsIGFOZWVkbGUsIGFIYXlzdGFjaywgYUNvbXBhcmUsIGFCaWFzKTtcbiAgICB9XG5cbiAgICAvLyBUaGUgZXhhY3QgbmVlZGxlIGVsZW1lbnQgd2FzIG5vdCBmb3VuZCBpbiB0aGlzIGhheXN0YWNrLiBEZXRlcm1pbmUgaWZcbiAgICAvLyB3ZSBhcmUgaW4gdGVybWluYXRpb24gY2FzZSAoMykgb3IgKDIpIGFuZCByZXR1cm4gdGhlIGFwcHJvcHJpYXRlIHRoaW5nLlxuICAgIGlmIChhQmlhcyA9PSBleHBvcnRzLkxFQVNUX1VQUEVSX0JPVU5EKSB7XG4gICAgICByZXR1cm4gYUhpZ2ggPCBhSGF5c3RhY2subGVuZ3RoID8gYUhpZ2ggOiAtMTtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9XG4gIH1cbiAgZWxzZSB7XG4gICAgLy8gT3VyIG5lZWRsZSBpcyBsZXNzIHRoYW4gYUhheXN0YWNrW21pZF0uXG4gICAgaWYgKG1pZCAtIGFMb3cgPiAxKSB7XG4gICAgICAvLyBUaGUgZWxlbWVudCBpcyBpbiB0aGUgbG93ZXIgaGFsZi5cbiAgICAgIHJldHVybiByZWN1cnNpdmVTZWFyY2goYUxvdywgbWlkLCBhTmVlZGxlLCBhSGF5c3RhY2ssIGFDb21wYXJlLCBhQmlhcyk7XG4gICAgfVxuXG4gICAgLy8gd2UgYXJlIGluIHRlcm1pbmF0aW9uIGNhc2UgKDMpIG9yICgyKSBhbmQgcmV0dXJuIHRoZSBhcHByb3ByaWF0ZSB0aGluZy5cbiAgICBpZiAoYUJpYXMgPT0gZXhwb3J0cy5MRUFTVF9VUFBFUl9CT1VORCkge1xuICAgICAgcmV0dXJuIG1pZDtcbiAgICB9IGVsc2Uge1xuICAgICAgcmV0dXJuIGFMb3cgPCAwID8gLTEgOiBhTG93O1xuICAgIH1cbiAgfVxufVxuXG4vKipcbiAqIFRoaXMgaXMgYW4gaW1wbGVtZW50YXRpb24gb2YgYmluYXJ5IHNlYXJjaCB3aGljaCB3aWxsIGFsd2F5cyB0cnkgYW5kIHJldHVyblxuICogdGhlIGluZGV4IG9mIHRoZSBjbG9zZXN0IGVsZW1lbnQgaWYgdGhlcmUgaXMgbm8gZXhhY3QgaGl0LiBUaGlzIGlzIGJlY2F1c2VcbiAqIG1hcHBpbmdzIGJldHdlZW4gb3JpZ2luYWwgYW5kIGdlbmVyYXRlZCBsaW5lL2NvbCBwYWlycyBhcmUgc2luZ2xlIHBvaW50cyxcbiAqIGFuZCB0aGVyZSBpcyBhbiBpbXBsaWNpdCByZWdpb24gYmV0d2VlbiBlYWNoIG9mIHRoZW0sIHNvIGEgbWlzcyBqdXN0IG1lYW5zXG4gKiB0aGF0IHlvdSBhcmVuJ3Qgb24gdGhlIHZlcnkgc3RhcnQgb2YgYSByZWdpb24uXG4gKlxuICogQHBhcmFtIGFOZWVkbGUgVGhlIGVsZW1lbnQgeW91IGFyZSBsb29raW5nIGZvci5cbiAqIEBwYXJhbSBhSGF5c3RhY2sgVGhlIGFycmF5IHRoYXQgaXMgYmVpbmcgc2VhcmNoZWQuXG4gKiBAcGFyYW0gYUNvbXBhcmUgQSBmdW5jdGlvbiB3aGljaCB0YWtlcyB0aGUgbmVlZGxlIGFuZCBhbiBlbGVtZW50IGluIHRoZVxuICogICAgIGFycmF5IGFuZCByZXR1cm5zIC0xLCAwLCBvciAxIGRlcGVuZGluZyBvbiB3aGV0aGVyIHRoZSBuZWVkbGUgaXMgbGVzc1xuICogICAgIHRoYW4sIGVxdWFsIHRvLCBvciBncmVhdGVyIHRoYW4gdGhlIGVsZW1lbnQsIHJlc3BlY3RpdmVseS5cbiAqIEBwYXJhbSBhQmlhcyBFaXRoZXIgJ2JpbmFyeVNlYXJjaC5HUkVBVEVTVF9MT1dFUl9CT1VORCcgb3JcbiAqICAgICAnYmluYXJ5U2VhcmNoLkxFQVNUX1VQUEVSX0JPVU5EJy4gU3BlY2lmaWVzIHdoZXRoZXIgdG8gcmV0dXJuIHRoZVxuICogICAgIGNsb3Nlc3QgZWxlbWVudCB0aGF0IGlzIHNtYWxsZXIgdGhhbiBvciBncmVhdGVyIHRoYW4gdGhlIG9uZSB3ZSBhcmVcbiAqICAgICBzZWFyY2hpbmcgZm9yLCByZXNwZWN0aXZlbHksIGlmIHRoZSBleGFjdCBlbGVtZW50IGNhbm5vdCBiZSBmb3VuZC5cbiAqICAgICBEZWZhdWx0cyB0byAnYmluYXJ5U2VhcmNoLkdSRUFURVNUX0xPV0VSX0JPVU5EJy5cbiAqL1xuZXhwb3J0cy5zZWFyY2ggPSBmdW5jdGlvbiBzZWFyY2goYU5lZWRsZSwgYUhheXN0YWNrLCBhQ29tcGFyZSwgYUJpYXMpIHtcbiAgaWYgKGFIYXlzdGFjay5sZW5ndGggPT09IDApIHtcbiAgICByZXR1cm4gLTE7XG4gIH1cblxuICB2YXIgaW5kZXggPSByZWN1cnNpdmVTZWFyY2goLTEsIGFIYXlzdGFjay5sZW5ndGgsIGFOZWVkbGUsIGFIYXlzdGFjayxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGFDb21wYXJlLCBhQmlhcyB8fCBleHBvcnRzLkdSRUFURVNUX0xPV0VSX0JPVU5EKTtcbiAgaWYgKGluZGV4IDwgMCkge1xuICAgIHJldHVybiAtMTtcbiAgfVxuXG4gIC8vIFdlIGhhdmUgZm91bmQgZWl0aGVyIHRoZSBleGFjdCBlbGVtZW50LCBvciB0aGUgbmV4dC1jbG9zZXN0IGVsZW1lbnQgdGhhblxuICAvLyB0aGUgb25lIHdlIGFyZSBzZWFyY2hpbmcgZm9yLiBIb3dldmVyLCB0aGVyZSBtYXkgYmUgbW9yZSB0aGFuIG9uZSBzdWNoXG4gIC8vIGVsZW1lbnQuIE1ha2Ugc3VyZSB3ZSBhbHdheXMgcmV0dXJuIHRoZSBzbWFsbGVzdCBvZiB0aGVzZS5cbiAgd2hpbGUgKGluZGV4IC0gMSA+PSAwKSB7XG4gICAgaWYgKGFDb21wYXJlKGFIYXlzdGFja1tpbmRleF0sIGFIYXlzdGFja1tpbmRleCAtIDFdLCB0cnVlKSAhPT0gMCkge1xuICAgICAgYnJlYWs7XG4gICAgfVxuICAgIC0taW5kZXg7XG4gIH1cblxuICByZXR1cm4gaW5kZXg7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvYmluYXJ5LXNlYXJjaC5qc1xuLy8gbW9kdWxlIGlkID0gOFxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbi8vIEl0IHR1cm5zIG91dCB0aGF0IHNvbWUgKG1vc3Q/KSBKYXZhU2NyaXB0IGVuZ2luZXMgZG9uJ3Qgc2VsZi1ob3N0XG4vLyBgQXJyYXkucHJvdG90eXBlLnNvcnRgLiBUaGlzIG1ha2VzIHNlbnNlIGJlY2F1c2UgQysrIHdpbGwgbGlrZWx5IHJlbWFpblxuLy8gZmFzdGVyIHRoYW4gSlMgd2hlbiBkb2luZyByYXcgQ1BVLWludGVuc2l2ZSBzb3J0aW5nLiBIb3dldmVyLCB3aGVuIHVzaW5nIGFcbi8vIGN1c3RvbSBjb21wYXJhdG9yIGZ1bmN0aW9uLCBjYWxsaW5nIGJhY2sgYW5kIGZvcnRoIGJldHdlZW4gdGhlIFZNJ3MgQysrIGFuZFxuLy8gSklUJ2QgSlMgaXMgcmF0aGVyIHNsb3cgKmFuZCogbG9zZXMgSklUIHR5cGUgaW5mb3JtYXRpb24sIHJlc3VsdGluZyBpblxuLy8gd29yc2UgZ2VuZXJhdGVkIGNvZGUgZm9yIHRoZSBjb21wYXJhdG9yIGZ1bmN0aW9uIHRoYW4gd291bGQgYmUgb3B0aW1hbC4gSW5cbi8vIGZhY3QsIHdoZW4gc29ydGluZyB3aXRoIGEgY29tcGFyYXRvciwgdGhlc2UgY29zdHMgb3V0d2VpZ2ggdGhlIGJlbmVmaXRzIG9mXG4vLyBzb3J0aW5nIGluIEMrKy4gQnkgdXNpbmcgb3VyIG93biBKUy1pbXBsZW1lbnRlZCBRdWljayBTb3J0IChiZWxvdyksIHdlIGdldFxuLy8gYSB+MzUwMG1zIG1lYW4gc3BlZWQtdXAgaW4gYGJlbmNoL2JlbmNoLmh0bWxgLlxuXG4vKipcbiAqIFN3YXAgdGhlIGVsZW1lbnRzIGluZGV4ZWQgYnkgYHhgIGFuZCBgeWAgaW4gdGhlIGFycmF5IGBhcnlgLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIFRoZSBhcnJheS5cbiAqIEBwYXJhbSB7TnVtYmVyfSB4XG4gKiAgICAgICAgVGhlIGluZGV4IG9mIHRoZSBmaXJzdCBpdGVtLlxuICogQHBhcmFtIHtOdW1iZXJ9IHlcbiAqICAgICAgICBUaGUgaW5kZXggb2YgdGhlIHNlY29uZCBpdGVtLlxuICovXG5mdW5jdGlvbiBzd2FwKGFyeSwgeCwgeSkge1xuICB2YXIgdGVtcCA9IGFyeVt4XTtcbiAgYXJ5W3hdID0gYXJ5W3ldO1xuICBhcnlbeV0gPSB0ZW1wO1xufVxuXG4vKipcbiAqIFJldHVybnMgYSByYW5kb20gaW50ZWdlciB3aXRoaW4gdGhlIHJhbmdlIGBsb3cgLi4gaGlnaGAgaW5jbHVzaXZlLlxuICpcbiAqIEBwYXJhbSB7TnVtYmVyfSBsb3dcbiAqICAgICAgICBUaGUgbG93ZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICogQHBhcmFtIHtOdW1iZXJ9IGhpZ2hcbiAqICAgICAgICBUaGUgdXBwZXIgYm91bmQgb24gdGhlIHJhbmdlLlxuICovXG5mdW5jdGlvbiByYW5kb21JbnRJblJhbmdlKGxvdywgaGlnaCkge1xuICByZXR1cm4gTWF0aC5yb3VuZChsb3cgKyAoTWF0aC5yYW5kb20oKSAqIChoaWdoIC0gbG93KSkpO1xufVxuXG4vKipcbiAqIFRoZSBRdWljayBTb3J0IGFsZ29yaXRobS5cbiAqXG4gKiBAcGFyYW0ge0FycmF5fSBhcnlcbiAqICAgICAgICBBbiBhcnJheSB0byBzb3J0LlxuICogQHBhcmFtIHtmdW5jdGlvbn0gY29tcGFyYXRvclxuICogICAgICAgIEZ1bmN0aW9uIHRvIHVzZSB0byBjb21wYXJlIHR3byBpdGVtcy5cbiAqIEBwYXJhbSB7TnVtYmVyfSBwXG4gKiAgICAgICAgU3RhcnQgaW5kZXggb2YgdGhlIGFycmF5XG4gKiBAcGFyYW0ge051bWJlcn0gclxuICogICAgICAgIEVuZCBpbmRleCBvZiB0aGUgYXJyYXlcbiAqL1xuZnVuY3Rpb24gZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCByKSB7XG4gIC8vIElmIG91ciBsb3dlciBib3VuZCBpcyBsZXNzIHRoYW4gb3VyIHVwcGVyIGJvdW5kLCB3ZSAoMSkgcGFydGl0aW9uIHRoZVxuICAvLyBhcnJheSBpbnRvIHR3byBwaWVjZXMgYW5kICgyKSByZWN1cnNlIG9uIGVhY2ggaGFsZi4gSWYgaXQgaXMgbm90LCB0aGlzIGlzXG4gIC8vIHRoZSBlbXB0eSBhcnJheSBhbmQgb3VyIGJhc2UgY2FzZS5cblxuICBpZiAocCA8IHIpIHtcbiAgICAvLyAoMSkgUGFydGl0aW9uaW5nLlxuICAgIC8vXG4gICAgLy8gVGhlIHBhcnRpdGlvbmluZyBjaG9vc2VzIGEgcGl2b3QgYmV0d2VlbiBgcGAgYW5kIGByYCBhbmQgbW92ZXMgYWxsXG4gICAgLy8gZWxlbWVudHMgdGhhdCBhcmUgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdCB0byB0aGUgYmVmb3JlIGl0LCBhbmRcbiAgICAvLyBhbGwgdGhlIGVsZW1lbnRzIHRoYXQgYXJlIGdyZWF0ZXIgdGhhbiBpdCBhZnRlciBpdC4gVGhlIGVmZmVjdCBpcyB0aGF0XG4gICAgLy8gb25jZSBwYXJ0aXRpb24gaXMgZG9uZSwgdGhlIHBpdm90IGlzIGluIHRoZSBleGFjdCBwbGFjZSBpdCB3aWxsIGJlIHdoZW5cbiAgICAvLyB0aGUgYXJyYXkgaXMgcHV0IGluIHNvcnRlZCBvcmRlciwgYW5kIGl0IHdpbGwgbm90IG5lZWQgdG8gYmUgbW92ZWRcbiAgICAvLyBhZ2Fpbi4gVGhpcyBydW5zIGluIE8obikgdGltZS5cblxuICAgIC8vIEFsd2F5cyBjaG9vc2UgYSByYW5kb20gcGl2b3Qgc28gdGhhdCBhbiBpbnB1dCBhcnJheSB3aGljaCBpcyByZXZlcnNlXG4gICAgLy8gc29ydGVkIGRvZXMgbm90IGNhdXNlIE8obl4yKSBydW5uaW5nIHRpbWUuXG4gICAgdmFyIHBpdm90SW5kZXggPSByYW5kb21JbnRJblJhbmdlKHAsIHIpO1xuICAgIHZhciBpID0gcCAtIDE7XG5cbiAgICBzd2FwKGFyeSwgcGl2b3RJbmRleCwgcik7XG4gICAgdmFyIHBpdm90ID0gYXJ5W3JdO1xuXG4gICAgLy8gSW1tZWRpYXRlbHkgYWZ0ZXIgYGpgIGlzIGluY3JlbWVudGVkIGluIHRoaXMgbG9vcCwgdGhlIGZvbGxvd2luZyBob2xkXG4gICAgLy8gdHJ1ZTpcbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbcCAuLiBpXWAgaXMgbGVzcyB0aGFuIG9yIGVxdWFsIHRvIHRoZSBwaXZvdC5cbiAgICAvL1xuICAgIC8vICAgKiBFdmVyeSBlbGVtZW50IGluIGBhcnlbaSsxIC4uIGotMV1gIGlzIGdyZWF0ZXIgdGhhbiB0aGUgcGl2b3QuXG4gICAgZm9yICh2YXIgaiA9IHA7IGogPCByOyBqKyspIHtcbiAgICAgIGlmIChjb21wYXJhdG9yKGFyeVtqXSwgcGl2b3QpIDw9IDApIHtcbiAgICAgICAgaSArPSAxO1xuICAgICAgICBzd2FwKGFyeSwgaSwgaik7XG4gICAgICB9XG4gICAgfVxuXG4gICAgc3dhcChhcnksIGkgKyAxLCBqKTtcbiAgICB2YXIgcSA9IGkgKyAxO1xuXG4gICAgLy8gKDIpIFJlY3Vyc2Ugb24gZWFjaCBoYWxmLlxuXG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBwLCBxIC0gMSk7XG4gICAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCBxICsgMSwgcik7XG4gIH1cbn1cblxuLyoqXG4gKiBTb3J0IHRoZSBnaXZlbiBhcnJheSBpbi1wbGFjZSB3aXRoIHRoZSBnaXZlbiBjb21wYXJhdG9yIGZ1bmN0aW9uLlxuICpcbiAqIEBwYXJhbSB7QXJyYXl9IGFyeVxuICogICAgICAgIEFuIGFycmF5IHRvIHNvcnQuXG4gKiBAcGFyYW0ge2Z1bmN0aW9ufSBjb21wYXJhdG9yXG4gKiAgICAgICAgRnVuY3Rpb24gdG8gdXNlIHRvIGNvbXBhcmUgdHdvIGl0ZW1zLlxuICovXG5leHBvcnRzLnF1aWNrU29ydCA9IGZ1bmN0aW9uIChhcnksIGNvbXBhcmF0b3IpIHtcbiAgZG9RdWlja1NvcnQoYXJ5LCBjb21wYXJhdG9yLCAwLCBhcnkubGVuZ3RoIC0gMSk7XG59O1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvcXVpY2stc29ydC5qc1xuLy8gbW9kdWxlIGlkID0gOVxuLy8gbW9kdWxlIGNodW5rcyA9IDAiLCIvKiAtKi0gTW9kZToganM7IGpzLWluZGVudC1sZXZlbDogMjsgLSotICovXG4vKlxuICogQ29weXJpZ2h0IDIwMTEgTW96aWxsYSBGb3VuZGF0aW9uIGFuZCBjb250cmlidXRvcnNcbiAqIExpY2Vuc2VkIHVuZGVyIHRoZSBOZXcgQlNEIGxpY2Vuc2UuIFNlZSBMSUNFTlNFIG9yOlxuICogaHR0cDovL29wZW5zb3VyY2Uub3JnL2xpY2Vuc2VzL0JTRC0zLUNsYXVzZVxuICovXG5cbnZhciBTb3VyY2VNYXBHZW5lcmF0b3IgPSByZXF1aXJlKCcuL3NvdXJjZS1tYXAtZ2VuZXJhdG9yJykuU291cmNlTWFwR2VuZXJhdG9yO1xudmFyIHV0aWwgPSByZXF1aXJlKCcuL3V0aWwnKTtcblxuLy8gTWF0Y2hlcyBhIFdpbmRvd3Mtc3R5bGUgYFxcclxcbmAgbmV3bGluZSBvciBhIGBcXG5gIG5ld2xpbmUgdXNlZCBieSBhbGwgb3RoZXJcbi8vIG9wZXJhdGluZyBzeXN0ZW1zIHRoZXNlIGRheXMgKGNhcHR1cmluZyB0aGUgcmVzdWx0KS5cbnZhciBSRUdFWF9ORVdMSU5FID0gLyhcXHI/XFxuKS87XG5cbi8vIE5ld2xpbmUgY2hhcmFjdGVyIGNvZGUgZm9yIGNoYXJDb2RlQXQoKSBjb21wYXJpc29uc1xudmFyIE5FV0xJTkVfQ09ERSA9IDEwO1xuXG4vLyBQcml2YXRlIHN5bWJvbCBmb3IgaWRlbnRpZnlpbmcgYFNvdXJjZU5vZGVgcyB3aGVuIG11bHRpcGxlIHZlcnNpb25zIG9mXG4vLyB0aGUgc291cmNlLW1hcCBsaWJyYXJ5IGFyZSBsb2FkZWQuIFRoaXMgTVVTVCBOT1QgQ0hBTkdFIGFjcm9zc1xuLy8gdmVyc2lvbnMhXG52YXIgaXNTb3VyY2VOb2RlID0gXCIkJCRpc1NvdXJjZU5vZGUkJCRcIjtcblxuLyoqXG4gKiBTb3VyY2VOb2RlcyBwcm92aWRlIGEgd2F5IHRvIGFic3RyYWN0IG92ZXIgaW50ZXJwb2xhdGluZy9jb25jYXRlbmF0aW5nXG4gKiBzbmlwcGV0cyBvZiBnZW5lcmF0ZWQgSmF2YVNjcmlwdCBzb3VyY2UgY29kZSB3aGlsZSBtYWludGFpbmluZyB0aGUgbGluZSBhbmRcbiAqIGNvbHVtbiBpbmZvcm1hdGlvbiBhc3NvY2lhdGVkIHdpdGggdGhlIG9yaWdpbmFsIHNvdXJjZSBjb2RlLlxuICpcbiAqIEBwYXJhbSBhTGluZSBUaGUgb3JpZ2luYWwgbGluZSBudW1iZXIuXG4gKiBAcGFyYW0gYUNvbHVtbiBUaGUgb3JpZ2luYWwgY29sdW1uIG51bWJlci5cbiAqIEBwYXJhbSBhU291cmNlIFRoZSBvcmlnaW5hbCBzb3VyY2UncyBmaWxlbmFtZS5cbiAqIEBwYXJhbSBhQ2h1bmtzIE9wdGlvbmFsLiBBbiBhcnJheSBvZiBzdHJpbmdzIHdoaWNoIGFyZSBzbmlwcGV0cyBvZlxuICogICAgICAgIGdlbmVyYXRlZCBKUywgb3Igb3RoZXIgU291cmNlTm9kZXMuXG4gKiBAcGFyYW0gYU5hbWUgVGhlIG9yaWdpbmFsIGlkZW50aWZpZXIuXG4gKi9cbmZ1bmN0aW9uIFNvdXJjZU5vZGUoYUxpbmUsIGFDb2x1bW4sIGFTb3VyY2UsIGFDaHVua3MsIGFOYW1lKSB7XG4gIHRoaXMuY2hpbGRyZW4gPSBbXTtcbiAgdGhpcy5zb3VyY2VDb250ZW50cyA9IHt9O1xuICB0aGlzLmxpbmUgPSBhTGluZSA9PSBudWxsID8gbnVsbCA6IGFMaW5lO1xuICB0aGlzLmNvbHVtbiA9IGFDb2x1bW4gPT0gbnVsbCA/IG51bGwgOiBhQ29sdW1uO1xuICB0aGlzLnNvdXJjZSA9IGFTb3VyY2UgPT0gbnVsbCA/IG51bGwgOiBhU291cmNlO1xuICB0aGlzLm5hbWUgPSBhTmFtZSA9PSBudWxsID8gbnVsbCA6IGFOYW1lO1xuICB0aGlzW2lzU291cmNlTm9kZV0gPSB0cnVlO1xuICBpZiAoYUNodW5rcyAhPSBudWxsKSB0aGlzLmFkZChhQ2h1bmtzKTtcbn1cblxuLyoqXG4gKiBDcmVhdGVzIGEgU291cmNlTm9kZSBmcm9tIGdlbmVyYXRlZCBjb2RlIGFuZCBhIFNvdXJjZU1hcENvbnN1bWVyLlxuICpcbiAqIEBwYXJhbSBhR2VuZXJhdGVkQ29kZSBUaGUgZ2VuZXJhdGVkIGNvZGVcbiAqIEBwYXJhbSBhU291cmNlTWFwQ29uc3VtZXIgVGhlIFNvdXJjZU1hcCBmb3IgdGhlIGdlbmVyYXRlZCBjb2RlXG4gKiBAcGFyYW0gYVJlbGF0aXZlUGF0aCBPcHRpb25hbC4gVGhlIHBhdGggdGhhdCByZWxhdGl2ZSBzb3VyY2VzIGluIHRoZVxuICogICAgICAgIFNvdXJjZU1hcENvbnN1bWVyIHNob3VsZCBiZSByZWxhdGl2ZSB0by5cbiAqL1xuU291cmNlTm9kZS5mcm9tU3RyaW5nV2l0aFNvdXJjZU1hcCA9XG4gIGZ1bmN0aW9uIFNvdXJjZU5vZGVfZnJvbVN0cmluZ1dpdGhTb3VyY2VNYXAoYUdlbmVyYXRlZENvZGUsIGFTb3VyY2VNYXBDb25zdW1lciwgYVJlbGF0aXZlUGF0aCkge1xuICAgIC8vIFRoZSBTb3VyY2VOb2RlIHdlIHdhbnQgdG8gZmlsbCB3aXRoIHRoZSBnZW5lcmF0ZWQgY29kZVxuICAgIC8vIGFuZCB0aGUgU291cmNlTWFwXG4gICAgdmFyIG5vZGUgPSBuZXcgU291cmNlTm9kZSgpO1xuXG4gICAgLy8gQWxsIGV2ZW4gaW5kaWNlcyBvZiB0aGlzIGFycmF5IGFyZSBvbmUgbGluZSBvZiB0aGUgZ2VuZXJhdGVkIGNvZGUsXG4gICAgLy8gd2hpbGUgYWxsIG9kZCBpbmRpY2VzIGFyZSB0aGUgbmV3bGluZXMgYmV0d2VlbiB0d28gYWRqYWNlbnQgbGluZXNcbiAgICAvLyAoc2luY2UgYFJFR0VYX05FV0xJTkVgIGNhcHR1cmVzIGl0cyBtYXRjaCkuXG4gICAgLy8gUHJvY2Vzc2VkIGZyYWdtZW50cyBhcmUgYWNjZXNzZWQgYnkgY2FsbGluZyBgc2hpZnROZXh0TGluZWAuXG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzID0gYUdlbmVyYXRlZENvZGUuc3BsaXQoUkVHRVhfTkVXTElORSk7XG4gICAgdmFyIHJlbWFpbmluZ0xpbmVzSW5kZXggPSAwO1xuICAgIHZhciBzaGlmdE5leHRMaW5lID0gZnVuY3Rpb24oKSB7XG4gICAgICB2YXIgbGluZUNvbnRlbnRzID0gZ2V0TmV4dExpbmUoKTtcbiAgICAgIC8vIFRoZSBsYXN0IGxpbmUgb2YgYSBmaWxlIG1pZ2h0IG5vdCBoYXZlIGEgbmV3bGluZS5cbiAgICAgIHZhciBuZXdMaW5lID0gZ2V0TmV4dExpbmUoKSB8fCBcIlwiO1xuICAgICAgcmV0dXJuIGxpbmVDb250ZW50cyArIG5ld0xpbmU7XG5cbiAgICAgIGZ1bmN0aW9uIGdldE5leHRMaW5lKCkge1xuICAgICAgICByZXR1cm4gcmVtYWluaW5nTGluZXNJbmRleCA8IHJlbWFpbmluZ0xpbmVzLmxlbmd0aCA/XG4gICAgICAgICAgICByZW1haW5pbmdMaW5lc1tyZW1haW5pbmdMaW5lc0luZGV4KytdIDogdW5kZWZpbmVkO1xuICAgICAgfVxuICAgIH07XG5cbiAgICAvLyBXZSBuZWVkIHRvIHJlbWVtYmVyIHRoZSBwb3NpdGlvbiBvZiBcInJlbWFpbmluZ0xpbmVzXCJcbiAgICB2YXIgbGFzdEdlbmVyYXRlZExpbmUgPSAxLCBsYXN0R2VuZXJhdGVkQ29sdW1uID0gMDtcblxuICAgIC8vIFRoZSBnZW5lcmF0ZSBTb3VyY2VOb2RlcyB3ZSBuZWVkIGEgY29kZSByYW5nZS5cbiAgICAvLyBUbyBleHRyYWN0IGl0IGN1cnJlbnQgYW5kIGxhc3QgbWFwcGluZyBpcyB1c2VkLlxuICAgIC8vIEhlcmUgd2Ugc3RvcmUgdGhlIGxhc3QgbWFwcGluZy5cbiAgICB2YXIgbGFzdE1hcHBpbmcgPSBudWxsO1xuXG4gICAgYVNvdXJjZU1hcENvbnN1bWVyLmVhY2hNYXBwaW5nKGZ1bmN0aW9uIChtYXBwaW5nKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcgIT09IG51bGwpIHtcbiAgICAgICAgLy8gV2UgYWRkIHRoZSBjb2RlIGZyb20gXCJsYXN0TWFwcGluZ1wiIHRvIFwibWFwcGluZ1wiOlxuICAgICAgICAvLyBGaXJzdCBjaGVjayBpZiB0aGVyZSBpcyBhIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgIGlmIChsYXN0R2VuZXJhdGVkTGluZSA8IG1hcHBpbmcuZ2VuZXJhdGVkTGluZSkge1xuICAgICAgICAgIC8vIEFzc29jaWF0ZSBmaXJzdCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBzaGlmdE5leHRMaW5lKCkpO1xuICAgICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICAgICAgbGFzdEdlbmVyYXRlZENvbHVtbiA9IDA7XG4gICAgICAgICAgLy8gVGhlIHJlbWFpbmluZyBjb2RlIGlzIGFkZGVkIHdpdGhvdXQgbWFwcGluZ1xuICAgICAgICB9IGVsc2Uge1xuICAgICAgICAgIC8vIFRoZXJlIGlzIG5vIG5ldyBsaW5lIGluIGJldHdlZW4uXG4gICAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSBjb2RlIGJldHdlZW4gXCJsYXN0R2VuZXJhdGVkQ29sdW1uXCIgYW5kXG4gICAgICAgICAgLy8gXCJtYXBwaW5nLmdlbmVyYXRlZENvbHVtblwiIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgICAgdmFyIG5leHRMaW5lID0gcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF0gfHwgJyc7XG4gICAgICAgICAgdmFyIGNvZGUgPSBuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4gLVxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgIGxhc3RHZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICAgIHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdID0gbmV4dExpbmUuc3Vic3RyKG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uIC1cbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uKTtcbiAgICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICAgICAgYWRkTWFwcGluZ1dpdGhDb2RlKGxhc3RNYXBwaW5nLCBjb2RlKTtcbiAgICAgICAgICAvLyBObyBtb3JlIHJlbWFpbmluZyBjb2RlLCBjb250aW51ZVxuICAgICAgICAgIGxhc3RNYXBwaW5nID0gbWFwcGluZztcbiAgICAgICAgICByZXR1cm47XG4gICAgICAgIH1cbiAgICAgIH1cbiAgICAgIC8vIFdlIGFkZCB0aGUgZ2VuZXJhdGVkIGNvZGUgdW50aWwgdGhlIGZpcnN0IG1hcHBpbmdcbiAgICAgIC8vIHRvIHRoZSBTb3VyY2VOb2RlIHdpdGhvdXQgYW55IG1hcHBpbmcuXG4gICAgICAvLyBFYWNoIGxpbmUgaXMgYWRkZWQgYXMgc2VwYXJhdGUgc3RyaW5nLlxuICAgICAgd2hpbGUgKGxhc3RHZW5lcmF0ZWRMaW5lIDwgbWFwcGluZy5nZW5lcmF0ZWRMaW5lKSB7XG4gICAgICAgIG5vZGUuYWRkKHNoaWZ0TmV4dExpbmUoKSk7XG4gICAgICAgIGxhc3RHZW5lcmF0ZWRMaW5lKys7XG4gICAgICB9XG4gICAgICBpZiAobGFzdEdlbmVyYXRlZENvbHVtbiA8IG1hcHBpbmcuZ2VuZXJhdGVkQ29sdW1uKSB7XG4gICAgICAgIHZhciBuZXh0TGluZSA9IHJlbWFpbmluZ0xpbmVzW3JlbWFpbmluZ0xpbmVzSW5kZXhdIHx8ICcnO1xuICAgICAgICBub2RlLmFkZChuZXh0TGluZS5zdWJzdHIoMCwgbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pKTtcbiAgICAgICAgcmVtYWluaW5nTGluZXNbcmVtYWluaW5nTGluZXNJbmRleF0gPSBuZXh0TGluZS5zdWJzdHIobWFwcGluZy5nZW5lcmF0ZWRDb2x1bW4pO1xuICAgICAgICBsYXN0R2VuZXJhdGVkQ29sdW1uID0gbWFwcGluZy5nZW5lcmF0ZWRDb2x1bW47XG4gICAgICB9XG4gICAgICBsYXN0TWFwcGluZyA9IG1hcHBpbmc7XG4gICAgfSwgdGhpcyk7XG4gICAgLy8gV2UgaGF2ZSBwcm9jZXNzZWQgYWxsIG1hcHBpbmdzLlxuICAgIGlmIChyZW1haW5pbmdMaW5lc0luZGV4IDwgcmVtYWluaW5nTGluZXMubGVuZ3RoKSB7XG4gICAgICBpZiAobGFzdE1hcHBpbmcpIHtcbiAgICAgICAgLy8gQXNzb2NpYXRlIHRoZSByZW1haW5pbmcgY29kZSBpbiB0aGUgY3VycmVudCBsaW5lIHdpdGggXCJsYXN0TWFwcGluZ1wiXG4gICAgICAgIGFkZE1hcHBpbmdXaXRoQ29kZShsYXN0TWFwcGluZywgc2hpZnROZXh0TGluZSgpKTtcbiAgICAgIH1cbiAgICAgIC8vIGFuZCBhZGQgdGhlIHJlbWFpbmluZyBsaW5lcyB3aXRob3V0IGFueSBtYXBwaW5nXG4gICAgICBub2RlLmFkZChyZW1haW5pbmdMaW5lcy5zcGxpY2UocmVtYWluaW5nTGluZXNJbmRleCkuam9pbihcIlwiKSk7XG4gICAgfVxuXG4gICAgLy8gQ29weSBzb3VyY2VzQ29udGVudCBpbnRvIFNvdXJjZU5vZGVcbiAgICBhU291cmNlTWFwQ29uc3VtZXIuc291cmNlcy5mb3JFYWNoKGZ1bmN0aW9uIChzb3VyY2VGaWxlKSB7XG4gICAgICB2YXIgY29udGVudCA9IGFTb3VyY2VNYXBDb25zdW1lci5zb3VyY2VDb250ZW50Rm9yKHNvdXJjZUZpbGUpO1xuICAgICAgaWYgKGNvbnRlbnQgIT0gbnVsbCkge1xuICAgICAgICBpZiAoYVJlbGF0aXZlUGF0aCAhPSBudWxsKSB7XG4gICAgICAgICAgc291cmNlRmlsZSA9IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBzb3VyY2VGaWxlKTtcbiAgICAgICAgfVxuICAgICAgICBub2RlLnNldFNvdXJjZUNvbnRlbnQoc291cmNlRmlsZSwgY29udGVudCk7XG4gICAgICB9XG4gICAgfSk7XG5cbiAgICByZXR1cm4gbm9kZTtcblxuICAgIGZ1bmN0aW9uIGFkZE1hcHBpbmdXaXRoQ29kZShtYXBwaW5nLCBjb2RlKSB7XG4gICAgICBpZiAobWFwcGluZyA9PT0gbnVsbCB8fCBtYXBwaW5nLnNvdXJjZSA9PT0gdW5kZWZpbmVkKSB7XG4gICAgICAgIG5vZGUuYWRkKGNvZGUpO1xuICAgICAgfSBlbHNlIHtcbiAgICAgICAgdmFyIHNvdXJjZSA9IGFSZWxhdGl2ZVBhdGhcbiAgICAgICAgICA/IHV0aWwuam9pbihhUmVsYXRpdmVQYXRoLCBtYXBwaW5nLnNvdXJjZSlcbiAgICAgICAgICA6IG1hcHBpbmcuc291cmNlO1xuICAgICAgICBub2RlLmFkZChuZXcgU291cmNlTm9kZShtYXBwaW5nLm9yaWdpbmFsTGluZSxcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgbWFwcGluZy5vcmlnaW5hbENvbHVtbixcbiAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgc291cmNlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBjb2RlLFxuICAgICAgICAgICAgICAgICAgICAgICAgICAgICAgICBtYXBwaW5nLm5hbWUpKTtcbiAgICAgIH1cbiAgICB9XG4gIH07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoaXMgc291cmNlIG5vZGUuXG4gKlxuICogQHBhcmFtIGFDaHVuayBBIHN0cmluZyBzbmlwcGV0IG9mIGdlbmVyYXRlZCBKUyBjb2RlLCBhbm90aGVyIGluc3RhbmNlIG9mXG4gKiAgICAgICAgU291cmNlTm9kZSwgb3IgYW4gYXJyYXkgd2hlcmUgZWFjaCBtZW1iZXIgaXMgb25lIG9mIHRob3NlIHRoaW5ncy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUuYWRkID0gZnVuY3Rpb24gU291cmNlTm9kZV9hZGQoYUNodW5rKSB7XG4gIGlmIChBcnJheS5pc0FycmF5KGFDaHVuaykpIHtcbiAgICBhQ2h1bmsuZm9yRWFjaChmdW5jdGlvbiAoY2h1bmspIHtcbiAgICAgIHRoaXMuYWRkKGNodW5rKTtcbiAgICB9LCB0aGlzKTtcbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgaWYgKGFDaHVuaykge1xuICAgICAgdGhpcy5jaGlsZHJlbi5wdXNoKGFDaHVuayk7XG4gICAgfVxuICB9XG4gIGVsc2Uge1xuICAgIHRocm93IG5ldyBUeXBlRXJyb3IoXG4gICAgICBcIkV4cGVjdGVkIGEgU291cmNlTm9kZSwgc3RyaW5nLCBvciBhbiBhcnJheSBvZiBTb3VyY2VOb2RlcyBhbmQgc3RyaW5ncy4gR290IFwiICsgYUNodW5rXG4gICAgKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogQWRkIGEgY2h1bmsgb2YgZ2VuZXJhdGVkIEpTIHRvIHRoZSBiZWdpbm5pbmcgb2YgdGhpcyBzb3VyY2Ugbm9kZS5cbiAqXG4gKiBAcGFyYW0gYUNodW5rIEEgc3RyaW5nIHNuaXBwZXQgb2YgZ2VuZXJhdGVkIEpTIGNvZGUsIGFub3RoZXIgaW5zdGFuY2Ugb2ZcbiAqICAgICAgICBTb3VyY2VOb2RlLCBvciBhbiBhcnJheSB3aGVyZSBlYWNoIG1lbWJlciBpcyBvbmUgb2YgdGhvc2UgdGhpbmdzLlxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5wcmVwZW5kID0gZnVuY3Rpb24gU291cmNlTm9kZV9wcmVwZW5kKGFDaHVuaykge1xuICBpZiAoQXJyYXkuaXNBcnJheShhQ2h1bmspKSB7XG4gICAgZm9yICh2YXIgaSA9IGFDaHVuay5sZW5ndGgtMTsgaSA+PSAwOyBpLS0pIHtcbiAgICAgIHRoaXMucHJlcGVuZChhQ2h1bmtbaV0pO1xuICAgIH1cbiAgfVxuICBlbHNlIGlmIChhQ2h1bmtbaXNTb3VyY2VOb2RlXSB8fCB0eXBlb2YgYUNodW5rID09PSBcInN0cmluZ1wiKSB7XG4gICAgdGhpcy5jaGlsZHJlbi51bnNoaWZ0KGFDaHVuayk7XG4gIH1cbiAgZWxzZSB7XG4gICAgdGhyb3cgbmV3IFR5cGVFcnJvcihcbiAgICAgIFwiRXhwZWN0ZWQgYSBTb3VyY2VOb2RlLCBzdHJpbmcsIG9yIGFuIGFycmF5IG9mIFNvdXJjZU5vZGVzIGFuZCBzdHJpbmdzLiBHb3QgXCIgKyBhQ2h1bmtcbiAgICApO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBXYWxrIG92ZXIgdGhlIHRyZWUgb2YgSlMgc25pcHBldHMgaW4gdGhpcyBub2RlIGFuZCBpdHMgY2hpbGRyZW4uIFRoZVxuICogd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgb25jZSBmb3IgZWFjaCBzbmlwcGV0IG9mIEpTIGFuZCBpcyBwYXNzZWQgdGhhdFxuICogc25pcHBldCBhbmQgdGhlIGl0cyBvcmlnaW5hbCBhc3NvY2lhdGVkIHNvdXJjZSdzIGxpbmUvY29sdW1uIGxvY2F0aW9uLlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2FsayA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfd2FsayhhRm4pIHtcbiAgdmFyIGNodW5rO1xuICBmb3IgKHZhciBpID0gMCwgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7IGkgPCBsZW47IGkrKykge1xuICAgIGNodW5rID0gdGhpcy5jaGlsZHJlbltpXTtcbiAgICBpZiAoY2h1bmtbaXNTb3VyY2VOb2RlXSkge1xuICAgICAgY2h1bmsud2FsayhhRm4pO1xuICAgIH1cbiAgICBlbHNlIHtcbiAgICAgIGlmIChjaHVuayAhPT0gJycpIHtcbiAgICAgICAgYUZuKGNodW5rLCB7IHNvdXJjZTogdGhpcy5zb3VyY2UsXG4gICAgICAgICAgICAgICAgICAgICBsaW5lOiB0aGlzLmxpbmUsXG4gICAgICAgICAgICAgICAgICAgICBjb2x1bW46IHRoaXMuY29sdW1uLFxuICAgICAgICAgICAgICAgICAgICAgbmFtZTogdGhpcy5uYW1lIH0pO1xuICAgICAgfVxuICAgIH1cbiAgfVxufTtcblxuLyoqXG4gKiBMaWtlIGBTdHJpbmcucHJvdG90eXBlLmpvaW5gIGV4Y2VwdCBmb3IgU291cmNlTm9kZXMuIEluc2VydHMgYGFTdHJgIGJldHdlZW5cbiAqIGVhY2ggb2YgYHRoaXMuY2hpbGRyZW5gLlxuICpcbiAqIEBwYXJhbSBhU2VwIFRoZSBzZXBhcmF0b3IuXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLmpvaW4gPSBmdW5jdGlvbiBTb3VyY2VOb2RlX2pvaW4oYVNlcCkge1xuICB2YXIgbmV3Q2hpbGRyZW47XG4gIHZhciBpO1xuICB2YXIgbGVuID0gdGhpcy5jaGlsZHJlbi5sZW5ndGg7XG4gIGlmIChsZW4gPiAwKSB7XG4gICAgbmV3Q2hpbGRyZW4gPSBbXTtcbiAgICBmb3IgKGkgPSAwOyBpIDwgbGVuLTE7IGkrKykge1xuICAgICAgbmV3Q2hpbGRyZW4ucHVzaCh0aGlzLmNoaWxkcmVuW2ldKTtcbiAgICAgIG5ld0NoaWxkcmVuLnB1c2goYVNlcCk7XG4gICAgfVxuICAgIG5ld0NoaWxkcmVuLnB1c2godGhpcy5jaGlsZHJlbltpXSk7XG4gICAgdGhpcy5jaGlsZHJlbiA9IG5ld0NoaWxkcmVuO1xuICB9XG4gIHJldHVybiB0aGlzO1xufTtcblxuLyoqXG4gKiBDYWxsIFN0cmluZy5wcm90b3R5cGUucmVwbGFjZSBvbiB0aGUgdmVyeSByaWdodC1tb3N0IHNvdXJjZSBzbmlwcGV0LiBVc2VmdWxcbiAqIGZvciB0cmltbWluZyB3aGl0ZXNwYWNlIGZyb20gdGhlIGVuZCBvZiBhIHNvdXJjZSBub2RlLCBldGMuXG4gKlxuICogQHBhcmFtIGFQYXR0ZXJuIFRoZSBwYXR0ZXJuIHRvIHJlcGxhY2UuXG4gKiBAcGFyYW0gYVJlcGxhY2VtZW50IFRoZSB0aGluZyB0byByZXBsYWNlIHRoZSBwYXR0ZXJuIHdpdGguXG4gKi9cblNvdXJjZU5vZGUucHJvdG90eXBlLnJlcGxhY2VSaWdodCA9IGZ1bmN0aW9uIFNvdXJjZU5vZGVfcmVwbGFjZVJpZ2h0KGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpIHtcbiAgdmFyIGxhc3RDaGlsZCA9IHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXTtcbiAgaWYgKGxhc3RDaGlsZFtpc1NvdXJjZU5vZGVdKSB7XG4gICAgbGFzdENoaWxkLnJlcGxhY2VSaWdodChhUGF0dGVybiwgYVJlcGxhY2VtZW50KTtcbiAgfVxuICBlbHNlIGlmICh0eXBlb2YgbGFzdENoaWxkID09PSAnc3RyaW5nJykge1xuICAgIHRoaXMuY2hpbGRyZW5bdGhpcy5jaGlsZHJlbi5sZW5ndGggLSAxXSA9IGxhc3RDaGlsZC5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpO1xuICB9XG4gIGVsc2Uge1xuICAgIHRoaXMuY2hpbGRyZW4ucHVzaCgnJy5yZXBsYWNlKGFQYXR0ZXJuLCBhUmVwbGFjZW1lbnQpKTtcbiAgfVxuICByZXR1cm4gdGhpcztcbn07XG5cbi8qKlxuICogU2V0IHRoZSBzb3VyY2UgY29udGVudCBmb3IgYSBzb3VyY2UgZmlsZS4gVGhpcyB3aWxsIGJlIGFkZGVkIHRvIHRoZSBTb3VyY2VNYXBHZW5lcmF0b3JcbiAqIGluIHRoZSBzb3VyY2VzQ29udGVudCBmaWVsZC5cbiAqXG4gKiBAcGFyYW0gYVNvdXJjZUZpbGUgVGhlIGZpbGVuYW1lIG9mIHRoZSBzb3VyY2UgZmlsZVxuICogQHBhcmFtIGFTb3VyY2VDb250ZW50IFRoZSBjb250ZW50IG9mIHRoZSBzb3VyY2UgZmlsZVxuICovXG5Tb3VyY2VOb2RlLnByb3RvdHlwZS5zZXRTb3VyY2VDb250ZW50ID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV9zZXRTb3VyY2VDb250ZW50KGFTb3VyY2VGaWxlLCBhU291cmNlQ29udGVudCkge1xuICAgIHRoaXMuc291cmNlQ29udGVudHNbdXRpbC50b1NldFN0cmluZyhhU291cmNlRmlsZSldID0gYVNvdXJjZUNvbnRlbnQ7XG4gIH07XG5cbi8qKlxuICogV2FsayBvdmVyIHRoZSB0cmVlIG9mIFNvdXJjZU5vZGVzLiBUaGUgd2Fsa2luZyBmdW5jdGlvbiBpcyBjYWxsZWQgZm9yIGVhY2hcbiAqIHNvdXJjZSBmaWxlIGNvbnRlbnQgYW5kIGlzIHBhc3NlZCB0aGUgZmlsZW5hbWUgYW5kIHNvdXJjZSBjb250ZW50LlxuICpcbiAqIEBwYXJhbSBhRm4gVGhlIHRyYXZlcnNhbCBmdW5jdGlvbi5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUud2Fsa1NvdXJjZUNvbnRlbnRzID1cbiAgZnVuY3Rpb24gU291cmNlTm9kZV93YWxrU291cmNlQ29udGVudHMoYUZuKSB7XG4gICAgZm9yICh2YXIgaSA9IDAsIGxlbiA9IHRoaXMuY2hpbGRyZW4ubGVuZ3RoOyBpIDwgbGVuOyBpKyspIHtcbiAgICAgIGlmICh0aGlzLmNoaWxkcmVuW2ldW2lzU291cmNlTm9kZV0pIHtcbiAgICAgICAgdGhpcy5jaGlsZHJlbltpXS53YWxrU291cmNlQ29udGVudHMoYUZuKTtcbiAgICAgIH1cbiAgICB9XG5cbiAgICB2YXIgc291cmNlcyA9IE9iamVjdC5rZXlzKHRoaXMuc291cmNlQ29udGVudHMpO1xuICAgIGZvciAodmFyIGkgPSAwLCBsZW4gPSBzb3VyY2VzLmxlbmd0aDsgaSA8IGxlbjsgaSsrKSB7XG4gICAgICBhRm4odXRpbC5mcm9tU2V0U3RyaW5nKHNvdXJjZXNbaV0pLCB0aGlzLnNvdXJjZUNvbnRlbnRzW3NvdXJjZXNbaV1dKTtcbiAgICB9XG4gIH07XG5cbi8qKlxuICogUmV0dXJuIHRoZSBzdHJpbmcgcmVwcmVzZW50YXRpb24gb2YgdGhpcyBzb3VyY2Ugbm9kZS4gV2Fsa3Mgb3ZlciB0aGUgdHJlZVxuICogYW5kIGNvbmNhdGVuYXRlcyBhbGwgdGhlIHZhcmlvdXMgc25pcHBldHMgdG9nZXRoZXIgdG8gb25lIHN0cmluZy5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmcgPSBmdW5jdGlvbiBTb3VyY2VOb2RlX3RvU3RyaW5nKCkge1xuICB2YXIgc3RyID0gXCJcIjtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaykge1xuICAgIHN0ciArPSBjaHVuaztcbiAgfSk7XG4gIHJldHVybiBzdHI7XG59O1xuXG4vKipcbiAqIFJldHVybnMgdGhlIHN0cmluZyByZXByZXNlbnRhdGlvbiBvZiB0aGlzIHNvdXJjZSBub2RlIGFsb25nIHdpdGggYSBzb3VyY2VcbiAqIG1hcC5cbiAqL1xuU291cmNlTm9kZS5wcm90b3R5cGUudG9TdHJpbmdXaXRoU291cmNlTWFwID0gZnVuY3Rpb24gU291cmNlTm9kZV90b1N0cmluZ1dpdGhTb3VyY2VNYXAoYUFyZ3MpIHtcbiAgdmFyIGdlbmVyYXRlZCA9IHtcbiAgICBjb2RlOiBcIlwiLFxuICAgIGxpbmU6IDEsXG4gICAgY29sdW1uOiAwXG4gIH07XG4gIHZhciBtYXAgPSBuZXcgU291cmNlTWFwR2VuZXJhdG9yKGFBcmdzKTtcbiAgdmFyIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgdmFyIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxMaW5lID0gbnVsbDtcbiAgdmFyIGxhc3RPcmlnaW5hbENvbHVtbiA9IG51bGw7XG4gIHZhciBsYXN0T3JpZ2luYWxOYW1lID0gbnVsbDtcbiAgdGhpcy53YWxrKGZ1bmN0aW9uIChjaHVuaywgb3JpZ2luYWwpIHtcbiAgICBnZW5lcmF0ZWQuY29kZSArPSBjaHVuaztcbiAgICBpZiAob3JpZ2luYWwuc291cmNlICE9PSBudWxsXG4gICAgICAgICYmIG9yaWdpbmFsLmxpbmUgIT09IG51bGxcbiAgICAgICAgJiYgb3JpZ2luYWwuY29sdW1uICE9PSBudWxsKSB7XG4gICAgICBpZihsYXN0T3JpZ2luYWxTb3VyY2UgIT09IG9yaWdpbmFsLnNvdXJjZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsTGluZSAhPT0gb3JpZ2luYWwubGluZVxuICAgICAgICAgfHwgbGFzdE9yaWdpbmFsQ29sdW1uICE9PSBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgIHx8IGxhc3RPcmlnaW5hbE5hbWUgIT09IG9yaWdpbmFsLm5hbWUpIHtcbiAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgIHNvdXJjZTogb3JpZ2luYWwuc291cmNlLFxuICAgICAgICAgIG9yaWdpbmFsOiB7XG4gICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgY29sdW1uOiBvcmlnaW5hbC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgbGluZTogZ2VuZXJhdGVkLmxpbmUsXG4gICAgICAgICAgICBjb2x1bW46IGdlbmVyYXRlZC5jb2x1bW5cbiAgICAgICAgICB9LFxuICAgICAgICAgIG5hbWU6IG9yaWdpbmFsLm5hbWVcbiAgICAgICAgfSk7XG4gICAgICB9XG4gICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBvcmlnaW5hbC5zb3VyY2U7XG4gICAgICBsYXN0T3JpZ2luYWxMaW5lID0gb3JpZ2luYWwubGluZTtcbiAgICAgIGxhc3RPcmlnaW5hbENvbHVtbiA9IG9yaWdpbmFsLmNvbHVtbjtcbiAgICAgIGxhc3RPcmlnaW5hbE5hbWUgPSBvcmlnaW5hbC5uYW1lO1xuICAgICAgc291cmNlTWFwcGluZ0FjdGl2ZSA9IHRydWU7XG4gICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICBtYXAuYWRkTWFwcGluZyh7XG4gICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgIGxpbmU6IGdlbmVyYXRlZC5saW5lLFxuICAgICAgICAgIGNvbHVtbjogZ2VuZXJhdGVkLmNvbHVtblxuICAgICAgICB9XG4gICAgICB9KTtcbiAgICAgIGxhc3RPcmlnaW5hbFNvdXJjZSA9IG51bGw7XG4gICAgICBzb3VyY2VNYXBwaW5nQWN0aXZlID0gZmFsc2U7XG4gICAgfVxuICAgIGZvciAodmFyIGlkeCA9IDAsIGxlbmd0aCA9IGNodW5rLmxlbmd0aDsgaWR4IDwgbGVuZ3RoOyBpZHgrKykge1xuICAgICAgaWYgKGNodW5rLmNoYXJDb2RlQXQoaWR4KSA9PT0gTkVXTElORV9DT0RFKSB7XG4gICAgICAgIGdlbmVyYXRlZC5saW5lKys7XG4gICAgICAgIGdlbmVyYXRlZC5jb2x1bW4gPSAwO1xuICAgICAgICAvLyBNYXBwaW5ncyBlbmQgYXQgZW9sXG4gICAgICAgIGlmIChpZHggKyAxID09PSBsZW5ndGgpIHtcbiAgICAgICAgICBsYXN0T3JpZ2luYWxTb3VyY2UgPSBudWxsO1xuICAgICAgICAgIHNvdXJjZU1hcHBpbmdBY3RpdmUgPSBmYWxzZTtcbiAgICAgICAgfSBlbHNlIGlmIChzb3VyY2VNYXBwaW5nQWN0aXZlKSB7XG4gICAgICAgICAgbWFwLmFkZE1hcHBpbmcoe1xuICAgICAgICAgICAgc291cmNlOiBvcmlnaW5hbC5zb3VyY2UsXG4gICAgICAgICAgICBvcmlnaW5hbDoge1xuICAgICAgICAgICAgICBsaW5lOiBvcmlnaW5hbC5saW5lLFxuICAgICAgICAgICAgICBjb2x1bW46IG9yaWdpbmFsLmNvbHVtblxuICAgICAgICAgICAgfSxcbiAgICAgICAgICAgIGdlbmVyYXRlZDoge1xuICAgICAgICAgICAgICBsaW5lOiBnZW5lcmF0ZWQubGluZSxcbiAgICAgICAgICAgICAgY29sdW1uOiBnZW5lcmF0ZWQuY29sdW1uXG4gICAgICAgICAgICB9LFxuICAgICAgICAgICAgbmFtZTogb3JpZ2luYWwubmFtZVxuICAgICAgICAgIH0pO1xuICAgICAgICB9XG4gICAgICB9IGVsc2Uge1xuICAgICAgICBnZW5lcmF0ZWQuY29sdW1uKys7XG4gICAgICB9XG4gICAgfVxuICB9KTtcbiAgdGhpcy53YWxrU291cmNlQ29udGVudHMoZnVuY3Rpb24gKHNvdXJjZUZpbGUsIHNvdXJjZUNvbnRlbnQpIHtcbiAgICBtYXAuc2V0U291cmNlQ29udGVudChzb3VyY2VGaWxlLCBzb3VyY2VDb250ZW50KTtcbiAgfSk7XG5cbiAgcmV0dXJuIHsgY29kZTogZ2VuZXJhdGVkLmNvZGUsIG1hcDogbWFwIH07XG59O1xuXG5leHBvcnRzLlNvdXJjZU5vZGUgPSBTb3VyY2VOb2RlO1xuXG5cblxuLy8vLy8vLy8vLy8vLy8vLy8vXG4vLyBXRUJQQUNLIEZPT1RFUlxuLy8gLi9saWIvc291cmNlLW5vZGUuanNcbi8vIG1vZHVsZSBpZCA9IDEwXG4vLyBtb2R1bGUgY2h1bmtzID0gMCJdLCJzb3VyY2VSb290IjoiIn0=
\ No newline at end of file diff --git a/node_modules/ava/node_modules/source-map/dist/source-map.js b/node_modules/ava/node_modules/source-map/dist/source-map.js new file mode 100644 index 000000000..b4eb08742 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/dist/source-map.js @@ -0,0 +1,3233 @@ +(function webpackUniversalModuleDefinition(root, factory) { + if(typeof exports === 'object' && typeof module === 'object') + module.exports = factory(); + else if(typeof define === 'function' && define.amd) + define([], factory); + else if(typeof exports === 'object') + exports["sourceMap"] = factory(); + else + root["sourceMap"] = factory(); +})(this, function() { +return /******/ (function(modules) { // webpackBootstrap +/******/ // The module cache +/******/ var installedModules = {}; + +/******/ // The require function +/******/ function __webpack_require__(moduleId) { + +/******/ // Check if module is in cache +/******/ if(installedModules[moduleId]) +/******/ return installedModules[moduleId].exports; + +/******/ // Create a new module (and put it into the cache) +/******/ var module = installedModules[moduleId] = { +/******/ exports: {}, +/******/ id: moduleId, +/******/ loaded: false +/******/ }; + +/******/ // Execute the module function +/******/ modules[moduleId].call(module.exports, module, module.exports, __webpack_require__); + +/******/ // Flag the module as loaded +/******/ module.loaded = true; + +/******/ // Return the exports of the module +/******/ return module.exports; +/******/ } + + +/******/ // expose the modules object (__webpack_modules__) +/******/ __webpack_require__.m = modules; + +/******/ // expose the module cache +/******/ __webpack_require__.c = installedModules; + +/******/ // __webpack_public_path__ +/******/ __webpack_require__.p = ""; + +/******/ // Load entry module and return exports +/******/ return __webpack_require__(0); +/******/ }) +/************************************************************************/ +/******/ ([ +/* 0 */ +/***/ (function(module, exports, __webpack_require__) { + + /* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ + exports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + exports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer; + exports.SourceNode = __webpack_require__(10).SourceNode; + + +/***/ }), +/* 1 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var base64VLQ = __webpack_require__(2); + var util = __webpack_require__(4); + var ArraySet = __webpack_require__(5).ArraySet; + var MappingList = __webpack_require__(6).MappingList; + + /** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ + function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; + } + + SourceMapGenerator.prototype._version = 3; + + /** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ + SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + + /** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ + SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + + /** + * Set the source content for a source file. + */ + SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + + /** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ + SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + + /** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ + SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + + /** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ + SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + + SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + + /** + * Externalize the source map. + */ + SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + + /** + * Render the source map being generated to a string. + */ + SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + + exports.SourceMapGenerator = SourceMapGenerator; + + +/***/ }), +/* 2 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + + var base64 = __webpack_require__(3); + + // A single base 64 digit can contain 6 bits of data. For the base 64 variable + // length quantities we use in the source map spec, the first bit is the sign, + // the next four bits are the actual value, and the 6th bit is the + // continuation bit. The continuation bit tells us whether there are more + // digits in this value following this digit. + // + // Continuation + // | Sign + // | | + // V V + // 101011 + + var VLQ_BASE_SHIFT = 5; + + // binary: 100000 + var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + + // binary: 011111 + var VLQ_BASE_MASK = VLQ_BASE - 1; + + // binary: 100000 + var VLQ_CONTINUATION_BIT = VLQ_BASE; + + /** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ + function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; + } + + /** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ + function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; + } + + /** + * Returns the base 64 VLQ encoded value. + */ + exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; + }; + + /** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ + exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; + }; + + +/***/ }), +/* 3 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + + /** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ + exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); + }; + + /** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ + exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; + }; + + +/***/ }), +/* 4 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + /** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ + function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } + } + exports.getArg = getArg; + + var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; + var dataUrlRegexp = /^data:.+\,.+$/; + + function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; + } + exports.urlParse = urlParse; + + function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; + } + exports.urlGenerate = urlGenerate; + + /** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ + function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; + } + exports.normalize = normalize; + + /** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ + function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; + } + exports.join = join; + + exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); + }; + + /** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ + function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); + } + exports.relative = relative; + + var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); + }()); + + function identity (s) { + return s; + } + + /** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ + function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; + } + exports.toSetString = supportsNullProto ? identity : toSetString; + + function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; + } + exports.fromSetString = supportsNullProto ? identity : fromSetString; + + function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; + } + + /** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ + function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByOriginalPositions = compareByOriginalPositions; + + /** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ + function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + + function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; + } + + /** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ + function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); + } + exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + + /** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ + function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); + } + exports.parseSourceMapInput = parseSourceMapInput; + + /** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ + function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); + } + exports.computeSourceURL = computeSourceURL; + + +/***/ }), +/* 5 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var has = Object.prototype.hasOwnProperty; + var hasNativeMap = typeof Map !== "undefined"; + + /** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ + function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); + } + + /** + * Static method for creating ArraySet instances from an existing array. + */ + ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; + }; + + /** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ + ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; + }; + + /** + * Add the given string to this set. + * + * @param String aStr + */ + ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } + }; + + /** + * Is the given string a member of this set? + * + * @param String aStr + */ + ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } + }; + + /** + * What is the index of the given string in the array? + * + * @param String aStr + */ + ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); + }; + + /** + * What is the element at the given index? + * + * @param Number aIdx + */ + ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); + }; + + /** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ + ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); + }; + + exports.ArraySet = ArraySet; + + +/***/ }), +/* 6 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + + /** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ + function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; + } + + /** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ + function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; + } + + /** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ + MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + + /** + * Add the given source mapping. + * + * @param Object aMapping + */ + MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } + }; + + /** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ + MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; + }; + + exports.MappingList = MappingList; + + +/***/ }), +/* 7 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var util = __webpack_require__(4); + var binarySearch = __webpack_require__(8); + var ArraySet = __webpack_require__(5).ArraySet; + var base64VLQ = __webpack_require__(2); + var quickSort = __webpack_require__(9).quickSort; + + function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); + } + + SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); + } + + /** + * The version of the source mapping spec that we are consuming. + */ + SourceMapConsumer.prototype._version = 3; + + // `__generatedMappings` and `__originalMappings` are arrays that hold the + // parsed mapping coordinates from the source map's "mappings" attribute. They + // are lazily instantiated, accessed via the `_generatedMappings` and + // `_originalMappings` getters respectively, and we only parse the mappings + // and create these arrays once queried for a source location. We jump through + // these hoops because there can be many thousands of mappings, and parsing + // them is expensive, so we only want to do it if we must. + // + // Each object in the arrays is of the form: + // + // { + // generatedLine: The line number in the generated code, + // generatedColumn: The column number in the generated code, + // source: The path to the original source file that generated this + // chunk of code, + // originalLine: The line number in the original source that + // corresponds to this chunk of generated code, + // originalColumn: The column number in the original source that + // corresponds to this chunk of generated code, + // name: The name of the original symbol which generated this chunk of + // code. + // } + // + // All properties except for `generatedLine` and `generatedColumn` can be + // `null`. + // + // `_generatedMappings` is ordered by the generated positions. + // + // `_originalMappings` is ordered by the original positions. + + SourceMapConsumer.prototype.__generatedMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } + }); + + SourceMapConsumer.prototype.__originalMappings = null; + Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } + }); + + SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + + SourceMapConsumer.GENERATED_ORDER = 1; + SourceMapConsumer.ORIGINAL_ORDER = 2; + + SourceMapConsumer.GREATEST_LOWER_BOUND = 1; + SourceMapConsumer.LEAST_UPPER_BOUND = 2; + + /** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ + SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + + /** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + + exports.SourceMapConsumer = SourceMapConsumer; + + /** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ + function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; + } + + BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + + /** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ + BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; + }; + + /** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ + BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + + /** + * The version of the source mapping spec that we are consuming. + */ + BasicSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } + }); + + /** + * Provide the JIT with a nice shape / hidden class. + */ + function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; + } + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + + /** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ + BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + + /** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ + BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + + exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + + /** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ + function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); + } + + IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); + IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + + /** + * The version of the source mapping spec that we are consuming. + */ + IndexedSourceMapConsumer.prototype._version = 3; + + /** + * The list of original sources. + */ + Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } + }); + + /** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ + IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + + /** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ + IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + + /** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ + IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + + /** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ + IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + + /** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ + IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + + exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; + + +/***/ }), +/* 8 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + exports.GREATEST_LOWER_BOUND = 1; + exports.LEAST_UPPER_BOUND = 2; + + /** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ + function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } + } + + /** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ + exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; + }; + + +/***/ }), +/* 9 */ +/***/ (function(module, exports) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + // It turns out that some (most?) JavaScript engines don't self-host + // `Array.prototype.sort`. This makes sense because C++ will likely remain + // faster than JS when doing raw CPU-intensive sorting. However, when using a + // custom comparator function, calling back and forth between the VM's C++ and + // JIT'd JS is rather slow *and* loses JIT type information, resulting in + // worse generated code for the comparator function than would be optimal. In + // fact, when sorting with a comparator, these costs outweigh the benefits of + // sorting in C++. By using our own JS-implemented Quick Sort (below), we get + // a ~3500ms mean speed-up in `bench/bench.html`. + + /** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ + function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; + } + + /** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ + function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); + } + + /** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ + function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } + } + + /** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ + exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); + }; + + +/***/ }), +/* 10 */ +/***/ (function(module, exports, __webpack_require__) { + + /* -*- Mode: js; js-indent-level: 2; -*- */ + /* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + + var SourceMapGenerator = __webpack_require__(1).SourceMapGenerator; + var util = __webpack_require__(4); + + // Matches a Windows-style `\r\n` newline or a `\n` newline used by all other + // operating systems these days (capturing the result). + var REGEX_NEWLINE = /(\r?\n)/; + + // Newline character code for charCodeAt() comparisons + var NEWLINE_CODE = 10; + + // Private symbol for identifying `SourceNode`s when multiple versions of + // the source-map library are loaded. This MUST NOT CHANGE across + // versions! + var isSourceNode = "$$$isSourceNode$$$"; + + /** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ + function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); + } + + /** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ + SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + + /** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ + SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; + }; + + /** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } + }; + + /** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ + SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; + }; + + /** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ + SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; + }; + + /** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ + SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + + /** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ + SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + + /** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ + SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; + }; + + /** + * Returns the string representation of this source node along with a source + * map. + */ + SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; + }; + + exports.SourceNode = SourceNode; + + +/***/ }) +/******/ ]) +}); +;
\ No newline at end of file diff --git a/node_modules/ava/node_modules/source-map/dist/source-map.min.js b/node_modules/ava/node_modules/source-map/dist/source-map.min.js new file mode 100644 index 000000000..c7c72dad8 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/dist/source-map.min.js @@ -0,0 +1,2 @@ +!function(e,n){"object"==typeof exports&&"object"==typeof module?module.exports=n():"function"==typeof define&&define.amd?define([],n):"object"==typeof exports?exports.sourceMap=n():e.sourceMap=n()}(this,function(){return function(e){function n(t){if(r[t])return r[t].exports;var o=r[t]={exports:{},id:t,loaded:!1};return e[t].call(o.exports,o,o.exports,n),o.loaded=!0,o.exports}var r={};return n.m=e,n.c=r,n.p="",n(0)}([function(e,n,r){n.SourceMapGenerator=r(1).SourceMapGenerator,n.SourceMapConsumer=r(7).SourceMapConsumer,n.SourceNode=r(10).SourceNode},function(e,n,r){function t(e){e||(e={}),this._file=i.getArg(e,"file",null),this._sourceRoot=i.getArg(e,"sourceRoot",null),this._skipValidation=i.getArg(e,"skipValidation",!1),this._sources=new s,this._names=new s,this._mappings=new a,this._sourcesContents=null}var o=r(2),i=r(4),s=r(5).ArraySet,a=r(6).MappingList;t.prototype._version=3,t.fromSourceMap=function(e){var n=e.sourceRoot,r=new t({file:e.file,sourceRoot:n});return e.eachMapping(function(e){var t={generated:{line:e.generatedLine,column:e.generatedColumn}};null!=e.source&&(t.source=e.source,null!=n&&(t.source=i.relative(n,t.source)),t.original={line:e.originalLine,column:e.originalColumn},null!=e.name&&(t.name=e.name)),r.addMapping(t)}),e.sources.forEach(function(t){var o=t;null!==n&&(o=i.relative(n,t)),r._sources.has(o)||r._sources.add(o);var s=e.sourceContentFor(t);null!=s&&r.setSourceContent(t,s)}),r},t.prototype.addMapping=function(e){var n=i.getArg(e,"generated"),r=i.getArg(e,"original",null),t=i.getArg(e,"source",null),o=i.getArg(e,"name",null);this._skipValidation||this._validateMapping(n,r,t,o),null!=t&&(t=String(t),this._sources.has(t)||this._sources.add(t)),null!=o&&(o=String(o),this._names.has(o)||this._names.add(o)),this._mappings.add({generatedLine:n.line,generatedColumn:n.column,originalLine:null!=r&&r.line,originalColumn:null!=r&&r.column,source:t,name:o})},t.prototype.setSourceContent=function(e,n){var r=e;null!=this._sourceRoot&&(r=i.relative(this._sourceRoot,r)),null!=n?(this._sourcesContents||(this._sourcesContents=Object.create(null)),this._sourcesContents[i.toSetString(r)]=n):this._sourcesContents&&(delete this._sourcesContents[i.toSetString(r)],0===Object.keys(this._sourcesContents).length&&(this._sourcesContents=null))},t.prototype.applySourceMap=function(e,n,r){var t=n;if(null==n){if(null==e.file)throw new Error('SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, or the source map\'s "file" property. Both were omitted.');t=e.file}var o=this._sourceRoot;null!=o&&(t=i.relative(o,t));var a=new s,u=new s;this._mappings.unsortedForEach(function(n){if(n.source===t&&null!=n.originalLine){var s=e.originalPositionFor({line:n.originalLine,column:n.originalColumn});null!=s.source&&(n.source=s.source,null!=r&&(n.source=i.join(r,n.source)),null!=o&&(n.source=i.relative(o,n.source)),n.originalLine=s.line,n.originalColumn=s.column,null!=s.name&&(n.name=s.name))}var l=n.source;null==l||a.has(l)||a.add(l);var c=n.name;null==c||u.has(c)||u.add(c)},this),this._sources=a,this._names=u,e.sources.forEach(function(n){var t=e.sourceContentFor(n);null!=t&&(null!=r&&(n=i.join(r,n)),null!=o&&(n=i.relative(o,n)),this.setSourceContent(n,t))},this)},t.prototype._validateMapping=function(e,n,r,t){if(n&&"number"!=typeof n.line&&"number"!=typeof n.column)throw new Error("original.line and original.column are not numbers -- you probably meant to omit the original mapping entirely and only map the generated position. If so, pass null for the original mapping instead of an object with empty or null values.");if((!(e&&"line"in e&&"column"in e&&e.line>0&&e.column>=0)||n||r||t)&&!(e&&"line"in e&&"column"in e&&n&&"line"in n&&"column"in n&&e.line>0&&e.column>=0&&n.line>0&&n.column>=0&&r))throw new Error("Invalid mapping: "+JSON.stringify({generated:e,source:r,original:n,name:t}))},t.prototype._serializeMappings=function(){for(var e,n,r,t,s=0,a=1,u=0,l=0,c=0,g=0,p="",h=this._mappings.toArray(),f=0,d=h.length;f<d;f++){if(n=h[f],e="",n.generatedLine!==a)for(s=0;n.generatedLine!==a;)e+=";",a++;else if(f>0){if(!i.compareByGeneratedPositionsInflated(n,h[f-1]))continue;e+=","}e+=o.encode(n.generatedColumn-s),s=n.generatedColumn,null!=n.source&&(t=this._sources.indexOf(n.source),e+=o.encode(t-g),g=t,e+=o.encode(n.originalLine-1-l),l=n.originalLine-1,e+=o.encode(n.originalColumn-u),u=n.originalColumn,null!=n.name&&(r=this._names.indexOf(n.name),e+=o.encode(r-c),c=r)),p+=e}return p},t.prototype._generateSourcesContent=function(e,n){return e.map(function(e){if(!this._sourcesContents)return null;null!=n&&(e=i.relative(n,e));var r=i.toSetString(e);return Object.prototype.hasOwnProperty.call(this._sourcesContents,r)?this._sourcesContents[r]:null},this)},t.prototype.toJSON=function(){var e={version:this._version,sources:this._sources.toArray(),names:this._names.toArray(),mappings:this._serializeMappings()};return null!=this._file&&(e.file=this._file),null!=this._sourceRoot&&(e.sourceRoot=this._sourceRoot),this._sourcesContents&&(e.sourcesContent=this._generateSourcesContent(e.sources,e.sourceRoot)),e},t.prototype.toString=function(){return JSON.stringify(this.toJSON())},n.SourceMapGenerator=t},function(e,n,r){function t(e){return e<0?(-e<<1)+1:(e<<1)+0}function o(e){var n=1===(1&e),r=e>>1;return n?-r:r}var i=r(3),s=5,a=1<<s,u=a-1,l=a;n.encode=function(e){var n,r="",o=t(e);do n=o&u,o>>>=s,o>0&&(n|=l),r+=i.encode(n);while(o>0);return r},n.decode=function(e,n,r){var t,a,c=e.length,g=0,p=0;do{if(n>=c)throw new Error("Expected more digits in base 64 VLQ value.");if(a=i.decode(e.charCodeAt(n++)),a===-1)throw new Error("Invalid base64 digit: "+e.charAt(n-1));t=!!(a&l),a&=u,g+=a<<p,p+=s}while(t);r.value=o(g),r.rest=n}},function(e,n){var r="ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/".split("");n.encode=function(e){if(0<=e&&e<r.length)return r[e];throw new TypeError("Must be between 0 and 63: "+e)},n.decode=function(e){var n=65,r=90,t=97,o=122,i=48,s=57,a=43,u=47,l=26,c=52;return n<=e&&e<=r?e-n:t<=e&&e<=o?e-t+l:i<=e&&e<=s?e-i+c:e==a?62:e==u?63:-1}},function(e,n){function r(e,n,r){if(n in e)return e[n];if(3===arguments.length)return r;throw new Error('"'+n+'" is a required argument.')}function t(e){var n=e.match(v);return n?{scheme:n[1],auth:n[2],host:n[3],port:n[4],path:n[5]}:null}function o(e){var n="";return e.scheme&&(n+=e.scheme+":"),n+="//",e.auth&&(n+=e.auth+"@"),e.host&&(n+=e.host),e.port&&(n+=":"+e.port),e.path&&(n+=e.path),n}function i(e){var r=e,i=t(e);if(i){if(!i.path)return e;r=i.path}for(var s,a=n.isAbsolute(r),u=r.split(/\/+/),l=0,c=u.length-1;c>=0;c--)s=u[c],"."===s?u.splice(c,1):".."===s?l++:l>0&&(""===s?(u.splice(c+1,l),l=0):(u.splice(c,2),l--));return r=u.join("/"),""===r&&(r=a?"/":"."),i?(i.path=r,o(i)):r}function s(e,n){""===e&&(e="."),""===n&&(n=".");var r=t(n),s=t(e);if(s&&(e=s.path||"/"),r&&!r.scheme)return s&&(r.scheme=s.scheme),o(r);if(r||n.match(y))return n;if(s&&!s.host&&!s.path)return s.host=n,o(s);var a="/"===n.charAt(0)?n:i(e.replace(/\/+$/,"")+"/"+n);return s?(s.path=a,o(s)):a}function a(e,n){""===e&&(e="."),e=e.replace(/\/$/,"");for(var r=0;0!==n.indexOf(e+"/");){var t=e.lastIndexOf("/");if(t<0)return n;if(e=e.slice(0,t),e.match(/^([^\/]+:\/)?\/*$/))return n;++r}return Array(r+1).join("../")+n.substr(e.length+1)}function u(e){return e}function l(e){return g(e)?"$"+e:e}function c(e){return g(e)?e.slice(1):e}function g(e){if(!e)return!1;var n=e.length;if(n<9)return!1;if(95!==e.charCodeAt(n-1)||95!==e.charCodeAt(n-2)||111!==e.charCodeAt(n-3)||116!==e.charCodeAt(n-4)||111!==e.charCodeAt(n-5)||114!==e.charCodeAt(n-6)||112!==e.charCodeAt(n-7)||95!==e.charCodeAt(n-8)||95!==e.charCodeAt(n-9))return!1;for(var r=n-10;r>=0;r--)if(36!==e.charCodeAt(r))return!1;return!0}function p(e,n,r){var t=f(e.source,n.source);return 0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t||r?t:(t=e.generatedColumn-n.generatedColumn,0!==t?t:(t=e.generatedLine-n.generatedLine,0!==t?t:f(e.name,n.name)))))}function h(e,n,r){var t=e.generatedLine-n.generatedLine;return 0!==t?t:(t=e.generatedColumn-n.generatedColumn,0!==t||r?t:(t=f(e.source,n.source),0!==t?t:(t=e.originalLine-n.originalLine,0!==t?t:(t=e.originalColumn-n.originalColumn,0!==t?t:f(e.name,n.name)))))}function f(e,n){return e===n?0:null===e?1:null===n?-1:e>n?1:-1}function d(e,n){var r=e.generatedLine-n.generatedLine;return 0!==r?r:(r=e.generatedColumn-n.generatedColumn,0!==r?r:(r=f(e.source,n.source),0!==r?r:(r=e.originalLine-n.originalLine,0!==r?r:(r=e.originalColumn-n.originalColumn,0!==r?r:f(e.name,n.name)))))}function m(e){return JSON.parse(e.replace(/^\)]}'[^\n]*\n/,""))}function _(e,n,r){if(n=n||"",e&&("/"!==e[e.length-1]&&"/"!==n[0]&&(e+="/"),n=e+n),r){var a=t(r);if(!a)throw new Error("sourceMapURL could not be parsed");if(a.path){var u=a.path.lastIndexOf("/");u>=0&&(a.path=a.path.substring(0,u+1))}n=s(o(a),n)}return i(n)}n.getArg=r;var v=/^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/,y=/^data:.+\,.+$/;n.urlParse=t,n.urlGenerate=o,n.normalize=i,n.join=s,n.isAbsolute=function(e){return"/"===e.charAt(0)||v.test(e)},n.relative=a;var C=function(){var e=Object.create(null);return!("__proto__"in e)}();n.toSetString=C?u:l,n.fromSetString=C?u:c,n.compareByOriginalPositions=p,n.compareByGeneratedPositionsDeflated=h,n.compareByGeneratedPositionsInflated=d,n.parseSourceMapInput=m,n.computeSourceURL=_},function(e,n,r){function t(){this._array=[],this._set=s?new Map:Object.create(null)}var o=r(4),i=Object.prototype.hasOwnProperty,s="undefined"!=typeof Map;t.fromArray=function(e,n){for(var r=new t,o=0,i=e.length;o<i;o++)r.add(e[o],n);return r},t.prototype.size=function(){return s?this._set.size:Object.getOwnPropertyNames(this._set).length},t.prototype.add=function(e,n){var r=s?e:o.toSetString(e),t=s?this.has(e):i.call(this._set,r),a=this._array.length;t&&!n||this._array.push(e),t||(s?this._set.set(e,a):this._set[r]=a)},t.prototype.has=function(e){if(s)return this._set.has(e);var n=o.toSetString(e);return i.call(this._set,n)},t.prototype.indexOf=function(e){if(s){var n=this._set.get(e);if(n>=0)return n}else{var r=o.toSetString(e);if(i.call(this._set,r))return this._set[r]}throw new Error('"'+e+'" is not in the set.')},t.prototype.at=function(e){if(e>=0&&e<this._array.length)return this._array[e];throw new Error("No element indexed by "+e)},t.prototype.toArray=function(){return this._array.slice()},n.ArraySet=t},function(e,n,r){function t(e,n){var r=e.generatedLine,t=n.generatedLine,o=e.generatedColumn,s=n.generatedColumn;return t>r||t==r&&s>=o||i.compareByGeneratedPositionsInflated(e,n)<=0}function o(){this._array=[],this._sorted=!0,this._last={generatedLine:-1,generatedColumn:0}}var i=r(4);o.prototype.unsortedForEach=function(e,n){this._array.forEach(e,n)},o.prototype.add=function(e){t(this._last,e)?(this._last=e,this._array.push(e)):(this._sorted=!1,this._array.push(e))},o.prototype.toArray=function(){return this._sorted||(this._array.sort(i.compareByGeneratedPositionsInflated),this._sorted=!0),this._array},n.MappingList=o},function(e,n,r){function t(e,n){var r=e;return"string"==typeof e&&(r=a.parseSourceMapInput(e)),null!=r.sections?new s(r,n):new o(r,n)}function o(e,n){var r=e;"string"==typeof e&&(r=a.parseSourceMapInput(e));var t=a.getArg(r,"version"),o=a.getArg(r,"sources"),i=a.getArg(r,"names",[]),s=a.getArg(r,"sourceRoot",null),u=a.getArg(r,"sourcesContent",null),c=a.getArg(r,"mappings"),g=a.getArg(r,"file",null);if(t!=this._version)throw new Error("Unsupported version: "+t);s&&(s=a.normalize(s)),o=o.map(String).map(a.normalize).map(function(e){return s&&a.isAbsolute(s)&&a.isAbsolute(e)?a.relative(s,e):e}),this._names=l.fromArray(i.map(String),!0),this._sources=l.fromArray(o,!0),this._absoluteSources=this._sources.toArray().map(function(e){return a.computeSourceURL(s,e,n)}),this.sourceRoot=s,this.sourcesContent=u,this._mappings=c,this._sourceMapURL=n,this.file=g}function i(){this.generatedLine=0,this.generatedColumn=0,this.source=null,this.originalLine=null,this.originalColumn=null,this.name=null}function s(e,n){var r=e;"string"==typeof e&&(r=a.parseSourceMapInput(e));var o=a.getArg(r,"version"),i=a.getArg(r,"sections");if(o!=this._version)throw new Error("Unsupported version: "+o);this._sources=new l,this._names=new l;var s={line:-1,column:0};this._sections=i.map(function(e){if(e.url)throw new Error("Support for url field in sections not implemented.");var r=a.getArg(e,"offset"),o=a.getArg(r,"line"),i=a.getArg(r,"column");if(o<s.line||o===s.line&&i<s.column)throw new Error("Section offsets must be ordered and non-overlapping.");return s=r,{generatedOffset:{generatedLine:o+1,generatedColumn:i+1},consumer:new t(a.getArg(e,"map"),n)}})}var a=r(4),u=r(8),l=r(5).ArraySet,c=r(2),g=r(9).quickSort;t.fromSourceMap=function(e,n){return o.fromSourceMap(e,n)},t.prototype._version=3,t.prototype.__generatedMappings=null,Object.defineProperty(t.prototype,"_generatedMappings",{configurable:!0,enumerable:!0,get:function(){return this.__generatedMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__generatedMappings}}),t.prototype.__originalMappings=null,Object.defineProperty(t.prototype,"_originalMappings",{configurable:!0,enumerable:!0,get:function(){return this.__originalMappings||this._parseMappings(this._mappings,this.sourceRoot),this.__originalMappings}}),t.prototype._charIsMappingSeparator=function(e,n){var r=e.charAt(n);return";"===r||","===r},t.prototype._parseMappings=function(e,n){throw new Error("Subclasses must implement _parseMappings")},t.GENERATED_ORDER=1,t.ORIGINAL_ORDER=2,t.GREATEST_LOWER_BOUND=1,t.LEAST_UPPER_BOUND=2,t.prototype.eachMapping=function(e,n,r){var o,i=n||null,s=r||t.GENERATED_ORDER;switch(s){case t.GENERATED_ORDER:o=this._generatedMappings;break;case t.ORIGINAL_ORDER:o=this._originalMappings;break;default:throw new Error("Unknown order of iteration.")}var u=this.sourceRoot;o.map(function(e){var n=null===e.source?null:this._sources.at(e.source);return n=a.computeSourceURL(u,n,this._sourceMapURL),{source:n,generatedLine:e.generatedLine,generatedColumn:e.generatedColumn,originalLine:e.originalLine,originalColumn:e.originalColumn,name:null===e.name?null:this._names.at(e.name)}},this).forEach(e,i)},t.prototype.allGeneratedPositionsFor=function(e){var n=a.getArg(e,"line"),r={source:a.getArg(e,"source"),originalLine:n,originalColumn:a.getArg(e,"column",0)};if(r.source=this._findSourceIndex(r.source),r.source<0)return[];var t=[],o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,u.LEAST_UPPER_BOUND);if(o>=0){var i=this._originalMappings[o];if(void 0===e.column)for(var s=i.originalLine;i&&i.originalLine===s;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o];else for(var l=i.originalColumn;i&&i.originalLine===n&&i.originalColumn==l;)t.push({line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}),i=this._originalMappings[++o]}return t},n.SourceMapConsumer=t,o.prototype=Object.create(t.prototype),o.prototype.consumer=t,o.prototype._findSourceIndex=function(e){var n=e;if(null!=this.sourceRoot&&(n=a.relative(this.sourceRoot,n)),this._sources.has(n))return this._sources.indexOf(n);var r;for(r=0;r<this._absoluteSources.length;++r)if(this._absoluteSources[r]==e)return r;return-1},o.fromSourceMap=function(e,n){var r=Object.create(o.prototype),t=r._names=l.fromArray(e._names.toArray(),!0),s=r._sources=l.fromArray(e._sources.toArray(),!0);r.sourceRoot=e._sourceRoot,r.sourcesContent=e._generateSourcesContent(r._sources.toArray(),r.sourceRoot),r.file=e._file,r._sourceMapURL=n,r._absoluteSources=r._sources.toArray().map(function(e){return a.computeSourceURL(r.sourceRoot,e,n)});for(var u=e._mappings.toArray().slice(),c=r.__generatedMappings=[],p=r.__originalMappings=[],h=0,f=u.length;h<f;h++){var d=u[h],m=new i;m.generatedLine=d.generatedLine,m.generatedColumn=d.generatedColumn,d.source&&(m.source=s.indexOf(d.source),m.originalLine=d.originalLine,m.originalColumn=d.originalColumn,d.name&&(m.name=t.indexOf(d.name)),p.push(m)),c.push(m)}return g(r.__originalMappings,a.compareByOriginalPositions),r},o.prototype._version=3,Object.defineProperty(o.prototype,"sources",{get:function(){return this._absoluteSources.slice()}}),o.prototype._parseMappings=function(e,n){for(var r,t,o,s,u,l=1,p=0,h=0,f=0,d=0,m=0,_=e.length,v=0,y={},C={},S=[],A=[];v<_;)if(";"===e.charAt(v))l++,v++,p=0;else if(","===e.charAt(v))v++;else{for(r=new i,r.generatedLine=l,s=v;s<_&&!this._charIsMappingSeparator(e,s);s++);if(t=e.slice(v,s),o=y[t])v+=t.length;else{for(o=[];v<s;)c.decode(e,v,C),u=C.value,v=C.rest,o.push(u);if(2===o.length)throw new Error("Found a source, but no line and column");if(3===o.length)throw new Error("Found a source and line, but no column");y[t]=o}r.generatedColumn=p+o[0],p=r.generatedColumn,o.length>1&&(r.source=d+o[1],d+=o[1],r.originalLine=h+o[2],h=r.originalLine,r.originalLine+=1,r.originalColumn=f+o[3],f=r.originalColumn,o.length>4&&(r.name=m+o[4],m+=o[4])),A.push(r),"number"==typeof r.originalLine&&S.push(r)}g(A,a.compareByGeneratedPositionsDeflated),this.__generatedMappings=A,g(S,a.compareByOriginalPositions),this.__originalMappings=S},o.prototype._findMapping=function(e,n,r,t,o,i){if(e[r]<=0)throw new TypeError("Line must be greater than or equal to 1, got "+e[r]);if(e[t]<0)throw new TypeError("Column must be greater than or equal to 0, got "+e[t]);return u.search(e,n,o,i)},o.prototype.computeColumnSpans=function(){for(var e=0;e<this._generatedMappings.length;++e){var n=this._generatedMappings[e];if(e+1<this._generatedMappings.length){var r=this._generatedMappings[e+1];if(n.generatedLine===r.generatedLine){n.lastGeneratedColumn=r.generatedColumn-1;continue}}n.lastGeneratedColumn=1/0}},o.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=this._findMapping(n,this._generatedMappings,"generatedLine","generatedColumn",a.compareByGeneratedPositionsDeflated,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(r>=0){var o=this._generatedMappings[r];if(o.generatedLine===n.generatedLine){var i=a.getArg(o,"source",null);null!==i&&(i=this._sources.at(i),i=a.computeSourceURL(this.sourceRoot,i,this._sourceMapURL));var s=a.getArg(o,"name",null);return null!==s&&(s=this._names.at(s)),{source:i,line:a.getArg(o,"originalLine",null),column:a.getArg(o,"originalColumn",null),name:s}}}return{source:null,line:null,column:null,name:null}},o.prototype.hasContentsOfAllSources=function(){return!!this.sourcesContent&&(this.sourcesContent.length>=this._sources.size()&&!this.sourcesContent.some(function(e){return null==e}))},o.prototype.sourceContentFor=function(e,n){if(!this.sourcesContent)return null;var r=this._findSourceIndex(e);if(r>=0)return this.sourcesContent[r];var t=e;null!=this.sourceRoot&&(t=a.relative(this.sourceRoot,t));var o;if(null!=this.sourceRoot&&(o=a.urlParse(this.sourceRoot))){var i=t.replace(/^file:\/\//,"");if("file"==o.scheme&&this._sources.has(i))return this.sourcesContent[this._sources.indexOf(i)];if((!o.path||"/"==o.path)&&this._sources.has("/"+t))return this.sourcesContent[this._sources.indexOf("/"+t)]}if(n)return null;throw new Error('"'+t+'" is not in the SourceMap.')},o.prototype.generatedPositionFor=function(e){var n=a.getArg(e,"source");if(n=this._findSourceIndex(n),n<0)return{line:null,column:null,lastColumn:null};var r={source:n,originalLine:a.getArg(e,"line"),originalColumn:a.getArg(e,"column")},o=this._findMapping(r,this._originalMappings,"originalLine","originalColumn",a.compareByOriginalPositions,a.getArg(e,"bias",t.GREATEST_LOWER_BOUND));if(o>=0){var i=this._originalMappings[o];if(i.source===r.source)return{line:a.getArg(i,"generatedLine",null),column:a.getArg(i,"generatedColumn",null),lastColumn:a.getArg(i,"lastGeneratedColumn",null)}}return{line:null,column:null,lastColumn:null}},n.BasicSourceMapConsumer=o,s.prototype=Object.create(t.prototype),s.prototype.constructor=t,s.prototype._version=3,Object.defineProperty(s.prototype,"sources",{get:function(){for(var e=[],n=0;n<this._sections.length;n++)for(var r=0;r<this._sections[n].consumer.sources.length;r++)e.push(this._sections[n].consumer.sources[r]);return e}}),s.prototype.originalPositionFor=function(e){var n={generatedLine:a.getArg(e,"line"),generatedColumn:a.getArg(e,"column")},r=u.search(n,this._sections,function(e,n){var r=e.generatedLine-n.generatedOffset.generatedLine;return r?r:e.generatedColumn-n.generatedOffset.generatedColumn}),t=this._sections[r];return t?t.consumer.originalPositionFor({line:n.generatedLine-(t.generatedOffset.generatedLine-1),column:n.generatedColumn-(t.generatedOffset.generatedLine===n.generatedLine?t.generatedOffset.generatedColumn-1:0),bias:e.bias}):{source:null,line:null,column:null,name:null}},s.prototype.hasContentsOfAllSources=function(){return this._sections.every(function(e){return e.consumer.hasContentsOfAllSources()})},s.prototype.sourceContentFor=function(e,n){for(var r=0;r<this._sections.length;r++){var t=this._sections[r],o=t.consumer.sourceContentFor(e,!0);if(o)return o}if(n)return null;throw new Error('"'+e+'" is not in the SourceMap.')},s.prototype.generatedPositionFor=function(e){for(var n=0;n<this._sections.length;n++){var r=this._sections[n];if(r.consumer._findSourceIndex(a.getArg(e,"source"))!==-1){var t=r.consumer.generatedPositionFor(e);if(t){var o={line:t.line+(r.generatedOffset.generatedLine-1),column:t.column+(r.generatedOffset.generatedLine===t.line?r.generatedOffset.generatedColumn-1:0)};return o}}}return{line:null,column:null}},s.prototype._parseMappings=function(e,n){this.__generatedMappings=[],this.__originalMappings=[];for(var r=0;r<this._sections.length;r++)for(var t=this._sections[r],o=t.consumer._generatedMappings,i=0;i<o.length;i++){var s=o[i],u=t.consumer._sources.at(s.source);u=a.computeSourceURL(t.consumer.sourceRoot,u,this._sourceMapURL),this._sources.add(u),u=this._sources.indexOf(u);var l=null;s.name&&(l=t.consumer._names.at(s.name),this._names.add(l),l=this._names.indexOf(l));var c={source:u,generatedLine:s.generatedLine+(t.generatedOffset.generatedLine-1),generatedColumn:s.generatedColumn+(t.generatedOffset.generatedLine===s.generatedLine?t.generatedOffset.generatedColumn-1:0),originalLine:s.originalLine,originalColumn:s.originalColumn,name:l};this.__generatedMappings.push(c),"number"==typeof c.originalLine&&this.__originalMappings.push(c)}g(this.__generatedMappings,a.compareByGeneratedPositionsDeflated),g(this.__originalMappings,a.compareByOriginalPositions)},n.IndexedSourceMapConsumer=s},function(e,n){function r(e,t,o,i,s,a){var u=Math.floor((t-e)/2)+e,l=s(o,i[u],!0);return 0===l?u:l>0?t-u>1?r(u,t,o,i,s,a):a==n.LEAST_UPPER_BOUND?t<i.length?t:-1:u:u-e>1?r(e,u,o,i,s,a):a==n.LEAST_UPPER_BOUND?u:e<0?-1:e}n.GREATEST_LOWER_BOUND=1,n.LEAST_UPPER_BOUND=2,n.search=function(e,t,o,i){if(0===t.length)return-1;var s=r(-1,t.length,e,t,o,i||n.GREATEST_LOWER_BOUND);if(s<0)return-1;for(;s-1>=0&&0===o(t[s],t[s-1],!0);)--s;return s}},function(e,n){function r(e,n,r){var t=e[n];e[n]=e[r],e[r]=t}function t(e,n){return Math.round(e+Math.random()*(n-e))}function o(e,n,i,s){if(i<s){var a=t(i,s),u=i-1;r(e,a,s);for(var l=e[s],c=i;c<s;c++)n(e[c],l)<=0&&(u+=1,r(e,u,c));r(e,u+1,c);var g=u+1;o(e,n,i,g-1),o(e,n,g+1,s)}}n.quickSort=function(e,n){o(e,n,0,e.length-1)}},function(e,n,r){function t(e,n,r,t,o){this.children=[],this.sourceContents={},this.line=null==e?null:e,this.column=null==n?null:n,this.source=null==r?null:r,this.name=null==o?null:o,this[u]=!0,null!=t&&this.add(t)}var o=r(1).SourceMapGenerator,i=r(4),s=/(\r?\n)/,a=10,u="$$$isSourceNode$$$";t.fromStringWithSourceMap=function(e,n,r){function o(e,n){if(null===e||void 0===e.source)a.add(n);else{var o=r?i.join(r,e.source):e.source;a.add(new t(e.originalLine,e.originalColumn,o,n,e.name))}}var a=new t,u=e.split(s),l=0,c=function(){function e(){return l<u.length?u[l++]:void 0}var n=e(),r=e()||"";return n+r},g=1,p=0,h=null;return n.eachMapping(function(e){if(null!==h){if(!(g<e.generatedLine)){var n=u[l]||"",r=n.substr(0,e.generatedColumn-p);return u[l]=n.substr(e.generatedColumn-p),p=e.generatedColumn,o(h,r),void(h=e)}o(h,c()),g++,p=0}for(;g<e.generatedLine;)a.add(c()),g++;if(p<e.generatedColumn){var n=u[l]||"";a.add(n.substr(0,e.generatedColumn)),u[l]=n.substr(e.generatedColumn),p=e.generatedColumn}h=e},this),l<u.length&&(h&&o(h,c()),a.add(u.splice(l).join(""))),n.sources.forEach(function(e){var t=n.sourceContentFor(e);null!=t&&(null!=r&&(e=i.join(r,e)),a.setSourceContent(e,t))}),a},t.prototype.add=function(e){if(Array.isArray(e))e.forEach(function(e){this.add(e)},this);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);e&&this.children.push(e)}return this},t.prototype.prepend=function(e){if(Array.isArray(e))for(var n=e.length-1;n>=0;n--)this.prepend(e[n]);else{if(!e[u]&&"string"!=typeof e)throw new TypeError("Expected a SourceNode, string, or an array of SourceNodes and strings. Got "+e);this.children.unshift(e)}return this},t.prototype.walk=function(e){for(var n,r=0,t=this.children.length;r<t;r++)n=this.children[r],n[u]?n.walk(e):""!==n&&e(n,{source:this.source,line:this.line,column:this.column,name:this.name})},t.prototype.join=function(e){var n,r,t=this.children.length;if(t>0){for(n=[],r=0;r<t-1;r++)n.push(this.children[r]),n.push(e);n.push(this.children[r]),this.children=n}return this},t.prototype.replaceRight=function(e,n){var r=this.children[this.children.length-1];return r[u]?r.replaceRight(e,n):"string"==typeof r?this.children[this.children.length-1]=r.replace(e,n):this.children.push("".replace(e,n)),this},t.prototype.setSourceContent=function(e,n){this.sourceContents[i.toSetString(e)]=n},t.prototype.walkSourceContents=function(e){for(var n=0,r=this.children.length;n<r;n++)this.children[n][u]&&this.children[n].walkSourceContents(e);for(var t=Object.keys(this.sourceContents),n=0,r=t.length;n<r;n++)e(i.fromSetString(t[n]),this.sourceContents[t[n]])},t.prototype.toString=function(){var e="";return this.walk(function(n){e+=n}),e},t.prototype.toStringWithSourceMap=function(e){var n={code:"",line:1,column:0},r=new o(e),t=!1,i=null,s=null,u=null,l=null;return this.walk(function(e,o){n.code+=e,null!==o.source&&null!==o.line&&null!==o.column?(i===o.source&&s===o.line&&u===o.column&&l===o.name||r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name}),i=o.source,s=o.line,u=o.column,l=o.name,t=!0):t&&(r.addMapping({generated:{line:n.line,column:n.column}}),i=null,t=!1);for(var c=0,g=e.length;c<g;c++)e.charCodeAt(c)===a?(n.line++,n.column=0,c+1===g?(i=null,t=!1):t&&r.addMapping({source:o.source,original:{line:o.line,column:o.column},generated:{line:n.line,column:n.column},name:o.name})):n.column++}),this.walkSourceContents(function(e,n){r.setSourceContent(e,n)}),{code:n.code,map:r}},n.SourceNode=t}])}); +//# sourceMappingURL=source-map.min.js.map
\ No newline at end of file diff --git a/node_modules/ava/node_modules/source-map/dist/source-map.min.js.map b/node_modules/ava/node_modules/source-map/dist/source-map.min.js.map new file mode 100644 index 000000000..d2cc86eb2 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/dist/source-map.min.js.map @@ -0,0 +1 @@ +{"version":3,"sources":["webpack:///webpack/universalModuleDefinition","webpack:///source-map.min.js","webpack:///webpack/bootstrap 0fd5815da764db5fb9fe","webpack:///./source-map.js","webpack:///./lib/source-map-generator.js","webpack:///./lib/base64-vlq.js","webpack:///./lib/base64.js","webpack:///./lib/util.js","webpack:///./lib/array-set.js","webpack:///./lib/mapping-list.js","webpack:///./lib/source-map-consumer.js","webpack:///./lib/binary-search.js","webpack:///./lib/quick-sort.js","webpack:///./lib/source-node.js"],"names":["root","factory","exports","module","define","amd","this","modules","__webpack_require__","moduleId","installedModules","id","loaded","call","m","c","p","SourceMapGenerator","SourceMapConsumer","SourceNode","aArgs","_file","util","getArg","_sourceRoot","_skipValidation","_sources","ArraySet","_names","_mappings","MappingList","_sourcesContents","base64VLQ","prototype","_version","fromSourceMap","aSourceMapConsumer","sourceRoot","generator","file","eachMapping","mapping","newMapping","generated","line","generatedLine","column","generatedColumn","source","relative","original","originalLine","originalColumn","name","addMapping","sources","forEach","sourceFile","sourceRelative","has","add","content","sourceContentFor","setSourceContent","_validateMapping","String","aSourceFile","aSourceContent","Object","create","toSetString","keys","length","applySourceMap","aSourceMapPath","Error","newSources","newNames","unsortedForEach","originalPositionFor","join","aGenerated","aOriginal","aSource","aName","JSON","stringify","_serializeMappings","next","nameIdx","sourceIdx","previousGeneratedColumn","previousGeneratedLine","previousOriginalColumn","previousOriginalLine","previousName","previousSource","result","mappings","toArray","i","len","compareByGeneratedPositionsInflated","encode","indexOf","_generateSourcesContent","aSources","aSourceRoot","map","key","hasOwnProperty","toJSON","version","names","sourcesContent","toString","toVLQSigned","aValue","fromVLQSigned","isNegative","shifted","base64","VLQ_BASE_SHIFT","VLQ_BASE","VLQ_BASE_MASK","VLQ_CONTINUATION_BIT","digit","encoded","vlq","decode","aStr","aIndex","aOutParam","continuation","strLen","shift","charCodeAt","charAt","value","rest","intToCharMap","split","number","TypeError","charCode","bigA","bigZ","littleA","littleZ","zero","nine","plus","slash","littleOffset","numberOffset","aDefaultValue","arguments","urlParse","aUrl","match","urlRegexp","scheme","auth","host","port","path","urlGenerate","aParsedUrl","url","normalize","aPath","part","isAbsolute","parts","up","splice","aRoot","aPathUrl","aRootUrl","dataUrlRegexp","joined","replace","level","index","lastIndexOf","slice","Array","substr","identity","s","isProtoString","fromSetString","compareByOriginalPositions","mappingA","mappingB","onlyCompareOriginal","cmp","strcmp","compareByGeneratedPositionsDeflated","onlyCompareGenerated","aStr1","aStr2","parseSourceMapInput","str","parse","computeSourceURL","sourceURL","sourceMapURL","parsed","substring","test","supportsNullProto","obj","_array","_set","hasNativeMap","Map","fromArray","aArray","aAllowDuplicates","set","size","getOwnPropertyNames","sStr","isDuplicate","idx","push","get","at","aIdx","generatedPositionAfter","lineA","lineB","columnA","columnB","_sorted","_last","aCallback","aThisArg","aMapping","sort","aSourceMap","aSourceMapURL","sourceMap","sections","IndexedSourceMapConsumer","BasicSourceMapConsumer","_absoluteSources","_sourceMapURL","Mapping","lastOffset","_sections","offset","offsetLine","offsetColumn","generatedOffset","consumer","binarySearch","quickSort","__generatedMappings","defineProperty","configurable","enumerable","_parseMappings","__originalMappings","_charIsMappingSeparator","GENERATED_ORDER","ORIGINAL_ORDER","GREATEST_LOWER_BOUND","LEAST_UPPER_BOUND","aContext","aOrder","context","order","_generatedMappings","_originalMappings","allGeneratedPositionsFor","needle","_findSourceIndex","_findMapping","undefined","lastColumn","relativeSource","smc","generatedMappings","destGeneratedMappings","destOriginalMappings","srcMapping","destMapping","segment","end","cachedSegments","temp","originalMappings","aNeedle","aMappings","aLineName","aColumnName","aComparator","aBias","search","computeColumnSpans","nextMapping","lastGeneratedColumn","Infinity","hasContentsOfAllSources","some","sc","nullOnMissing","fileUriAbsPath","generatedPositionFor","constructor","j","sectionIndex","section","bias","every","generatedPosition","ret","sectionMappings","adjustedMapping","recursiveSearch","aLow","aHigh","aHaystack","aCompare","mid","Math","floor","swap","ary","x","y","randomIntInRange","low","high","round","random","doQuickSort","comparator","r","pivotIndex","pivot","q","aLine","aColumn","aChunks","children","sourceContents","isSourceNode","REGEX_NEWLINE","NEWLINE_CODE","fromStringWithSourceMap","aGeneratedCode","aRelativePath","addMappingWithCode","code","node","remainingLines","remainingLinesIndex","shiftNextLine","getNextLine","lineContents","newLine","lastGeneratedLine","lastMapping","nextLine","aChunk","isArray","chunk","prepend","unshift","walk","aFn","aSep","newChildren","replaceRight","aPattern","aReplacement","lastChild","walkSourceContents","toStringWithSourceMap","sourceMappingActive","lastOriginalSource","lastOriginalLine","lastOriginalColumn","lastOriginalName","sourceContent"],"mappings":"CAAA,SAAAA,EAAAC,GACA,gBAAAC,UAAA,gBAAAC,QACAA,OAAAD,QAAAD,IACA,kBAAAG,gBAAAC,IACAD,UAAAH,GACA,gBAAAC,SACAA,QAAA,UAAAD,IAEAD,EAAA,UAAAC,KACCK,KAAA,WACD,MCAgB,UAAUC,GCN1B,QAAAC,GAAAC,GAGA,GAAAC,EAAAD,GACA,MAAAC,GAAAD,GAAAP,OAGA,IAAAC,GAAAO,EAAAD,IACAP,WACAS,GAAAF,EACAG,QAAA,EAUA,OANAL,GAAAE,GAAAI,KAAAV,EAAAD,QAAAC,IAAAD,QAAAM,GAGAL,EAAAS,QAAA,EAGAT,EAAAD,QAvBA,GAAAQ,KAqCA,OATAF,GAAAM,EAAAP,EAGAC,EAAAO,EAAAL,EAGAF,EAAAQ,EAAA,GAGAR,EAAA,KDgBM,SAAUL,EAAQD,EAASM,GEjDjCN,EAAAe,mBAAAT,EAAA,GAAAS,mBACAf,EAAAgB,kBAAAV,EAAA,GAAAU,kBACAhB,EAAAiB,WAAAX,EAAA,IAAAW,YF6DM,SAAUhB,EAAQD,EAASM,GGhDjC,QAAAS,GAAAG,GACAA,IACAA,MAEAd,KAAAe,MAAAC,EAAAC,OAAAH,EAAA,aACAd,KAAAkB,YAAAF,EAAAC,OAAAH,EAAA,mBACAd,KAAAmB,gBAAAH,EAAAC,OAAAH,EAAA,qBACAd,KAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,GACArB,KAAAuB,UAAA,GAAAC,GACAxB,KAAAyB,iBAAA,KAvBA,GAAAC,GAAAxB,EAAA,GACAc,EAAAd,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAG,EAAAtB,EAAA,GAAAsB,WAuBAb,GAAAgB,UAAAC,SAAA,EAOAjB,EAAAkB,cACA,SAAAC,GACA,GAAAC,GAAAD,EAAAC,WACAC,EAAA,GAAArB,IACAsB,KAAAH,EAAAG,KACAF,cA2CA,OAzCAD,GAAAI,YAAA,SAAAC,GACA,GAAAC,IACAC,WACAC,KAAAH,EAAAI,cACAC,OAAAL,EAAAM,iBAIA,OAAAN,EAAAO,SACAN,EAAAM,OAAAP,EAAAO,OACA,MAAAX,IACAK,EAAAM,OAAA1B,EAAA2B,SAAAZ,EAAAK,EAAAM,SAGAN,EAAAQ,UACAN,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAGA,MAAAX,EAAAY,OACAX,EAAAW,KAAAZ,EAAAY,OAIAf,EAAAgB,WAAAZ,KAEAN,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAC,GAAAD,CACA,QAAApB,IACAqB,EAAApC,EAAA2B,SAAAZ,EAAAoB,IAGAnB,EAAAZ,SAAAiC,IAAAD,IACApB,EAAAZ,SAAAkC,IAAAF,EAGA,IAAAG,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,GACAvB,EAAAyB,iBAAAN,EAAAI,KAGAvB,GAaArB,EAAAgB,UAAAqB,WACA,SAAAlC,GACA,GAAAuB,GAAArB,EAAAC,OAAAH,EAAA,aACA8B,EAAA5B,EAAAC,OAAAH,EAAA,iBACA4B,EAAA1B,EAAAC,OAAAH,EAAA,eACAiC,EAAA/B,EAAAC,OAAAH,EAAA,YAEAd,MAAAmB,iBACAnB,KAAA0D,iBAAArB,EAAAO,EAAAF,EAAAK,GAGA,MAAAL,IACAA,EAAAiB,OAAAjB,GACA1C,KAAAoB,SAAAiC,IAAAX,IACA1C,KAAAoB,SAAAkC,IAAAZ,IAIA,MAAAK,IACAA,EAAAY,OAAAZ,GACA/C,KAAAsB,OAAA+B,IAAAN,IACA/C,KAAAsB,OAAAgC,IAAAP,IAIA/C,KAAAuB,UAAA+B,KACAf,cAAAF,EAAAC,KACAG,gBAAAJ,EAAAG,OACAK,aAAA,MAAAD,KAAAN,KACAQ,eAAA,MAAAF,KAAAJ,OACAE,SACAK,UAOApC,EAAAgB,UAAA8B,iBACA,SAAAG,EAAAC,GACA,GAAAnB,GAAAkB,CACA,OAAA5D,KAAAkB,cACAwB,EAAA1B,EAAA2B,SAAA3C,KAAAkB,YAAAwB,IAGA,MAAAmB,GAGA7D,KAAAyB,mBACAzB,KAAAyB,iBAAAqC,OAAAC,OAAA,OAEA/D,KAAAyB,iBAAAT,EAAAgD,YAAAtB,IAAAmB,GACK7D,KAAAyB,yBAGLzB,MAAAyB,iBAAAT,EAAAgD,YAAAtB,IACA,IAAAoB,OAAAG,KAAAjE,KAAAyB,kBAAAyC,SACAlE,KAAAyB,iBAAA,QAqBAd,EAAAgB,UAAAwC,eACA,SAAArC,EAAA8B,EAAAQ,GACA,GAAAjB,GAAAS,CAEA,UAAAA,EAAA,CACA,SAAA9B,EAAAG,KACA,SAAAoC,OACA,gJAIAlB,GAAArB,EAAAG,KAEA,GAAAF,GAAA/B,KAAAkB,WAEA,OAAAa,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,GAIA,IAAAmB,GAAA,GAAAjD,GACAkD,EAAA,GAAAlD,EAGArB,MAAAuB,UAAAiD,gBAAA,SAAArC,GACA,GAAAA,EAAAO,SAAAS,GAAA,MAAAhB,EAAAU,aAAA,CAEA,GAAAD,GAAAd,EAAA2C,qBACAnC,KAAAH,EAAAU,aACAL,OAAAL,EAAAW,gBAEA,OAAAF,EAAAF,SAEAP,EAAAO,OAAAE,EAAAF,OACA,MAAA0B,IACAjC,EAAAO,OAAA1B,EAAA0D,KAAAN,EAAAjC,EAAAO,SAEA,MAAAX,IACAI,EAAAO,OAAA1B,EAAA2B,SAAAZ,EAAAI,EAAAO,SAEAP,EAAAU,aAAAD,EAAAN,KACAH,EAAAW,eAAAF,EAAAJ,OACA,MAAAI,EAAAG,OACAZ,EAAAY,KAAAH,EAAAG,OAKA,GAAAL,GAAAP,EAAAO,MACA,OAAAA,GAAA4B,EAAAjB,IAAAX,IACA4B,EAAAhB,IAAAZ,EAGA,IAAAK,GAAAZ,EAAAY,IACA,OAAAA,GAAAwB,EAAAlB,IAAAN,IACAwB,EAAAjB,IAAAP,IAGK/C,MACLA,KAAAoB,SAAAkD,EACAtE,KAAAsB,OAAAiD,EAGAzC,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAI,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,IACA,MAAAa,IACAjB,EAAAnC,EAAA0D,KAAAN,EAAAjB,IAEA,MAAApB,IACAoB,EAAAnC,EAAA2B,SAAAZ,EAAAoB,IAEAnD,KAAAyD,iBAAAN,EAAAI,KAEKvD,OAcLW,EAAAgB,UAAA+B,iBACA,SAAAiB,EAAAC,EAAAC,EACAC,GAKA,GAAAF,GAAA,gBAAAA,GAAAtC,MAAA,gBAAAsC,GAAApC,OACA,SAAA6B,OACA,+OAMA,OAAAM,GAAA,QAAAA,IAAA,UAAAA,IACAA,EAAArC,KAAA,GAAAqC,EAAAnC,QAAA,IACAoC,GAAAC,GAAAC,MAIAH,GAAA,QAAAA,IAAA,UAAAA,IACAC,GAAA,QAAAA,IAAA,UAAAA,IACAD,EAAArC,KAAA,GAAAqC,EAAAnC,QAAA,GACAoC,EAAAtC,KAAA,GAAAsC,EAAApC,QAAA,GACAqC,GAKA,SAAAR,OAAA,oBAAAU,KAAAC,WACA3C,UAAAsC,EACAjC,OAAAmC,EACAjC,SAAAgC,EACA7B,KAAA+B,MASAnE,EAAAgB,UAAAsD,mBACA,WAcA,OANAC,GACA/C,EACAgD,EACAC,EAVAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,EACAC,EAAA,GAMAC,EAAA5F,KAAAuB,UAAAsE,UACAC,EAAA,EAAAC,EAAAH,EAAA1B,OAA0C4B,EAAAC,EAASD,IAAA,CAInD,GAHA3D,EAAAyD,EAAAE,GACAZ,EAAA,GAEA/C,EAAAI,gBAAA+C,EAEA,IADAD,EAAA,EACAlD,EAAAI,gBAAA+C,GACAJ,GAAA,IACAI,QAIA,IAAAQ,EAAA,GACA,IAAA9E,EAAAgF,oCAAA7D,EAAAyD,EAAAE,EAAA,IACA,QAEAZ,IAAA,IAIAA,GAAAxD,EAAAuE,OAAA9D,EAAAM,gBACA4C,GACAA,EAAAlD,EAAAM,gBAEA,MAAAN,EAAAO,SACA0C,EAAApF,KAAAoB,SAAA8E,QAAA/D,EAAAO,QACAwC,GAAAxD,EAAAuE,OAAAb,EAAAM,GACAA,EAAAN,EAGAF,GAAAxD,EAAAuE,OAAA9D,EAAAU,aAAA,EACA2C,GACAA,EAAArD,EAAAU,aAAA,EAEAqC,GAAAxD,EAAAuE,OAAA9D,EAAAW,eACAyC,GACAA,EAAApD,EAAAW,eAEA,MAAAX,EAAAY,OACAoC,EAAAnF,KAAAsB,OAAA4E,QAAA/D,EAAAY,MACAmC,GAAAxD,EAAAuE,OAAAd,EAAAM,GACAA,EAAAN,IAIAQ,GAAAT,EAGA,MAAAS,IAGAhF,EAAAgB,UAAAwE,wBACA,SAAAC,EAAAC,GACA,MAAAD,GAAAE,IAAA,SAAA5D,GACA,IAAA1C,KAAAyB,iBACA,WAEA,OAAA4E,IACA3D,EAAA1B,EAAA2B,SAAA0D,EAAA3D,GAEA,IAAA6D,GAAAvF,EAAAgD,YAAAtB,EACA,OAAAoB,QAAAnC,UAAA6E,eAAAjG,KAAAP,KAAAyB,iBAAA8E,GACAvG,KAAAyB,iBAAA8E,GACA,MACKvG,OAMLW,EAAAgB,UAAA8E,OACA,WACA,GAAAH,IACAI,QAAA1G,KAAA4B,SACAqB,QAAAjD,KAAAoB,SAAAyE,UACAc,MAAA3G,KAAAsB,OAAAuE,UACAD,SAAA5F,KAAAiF,qBAYA,OAVA,OAAAjF,KAAAe,QACAuF,EAAArE,KAAAjC,KAAAe,OAEA,MAAAf,KAAAkB,cACAoF,EAAAvE,WAAA/B,KAAAkB,aAEAlB,KAAAyB,mBACA6E,EAAAM,eAAA5G,KAAAmG,wBAAAG,EAAArD,QAAAqD,EAAAvE,aAGAuE,GAMA3F,EAAAgB,UAAAkF,SACA,WACA,MAAA9B,MAAAC,UAAAhF,KAAAyG,WAGA7G,EAAAe,sBH2EM,SAAUd,EAAQD,EAASM,GI/ajC,QAAA4G,GAAAC,GACA,MAAAA,GAAA,IACAA,GAAA,MACAA,GAAA,KASA,QAAAC,GAAAD,GACA,GAAAE,GAAA,OAAAF,GACAG,EAAAH,GAAA,CACA,OAAAE,IACAC,EACAA,EAhDA,GAAAC,GAAAjH,EAAA,GAcAkH,EAAA,EAGAC,EAAA,GAAAD,EAGAE,EAAAD,EAAA,EAGAE,EAAAF,CA+BAzH,GAAAqG,OAAA,SAAAc,GACA,GACAS,GADAC,EAAA,GAGAC,EAAAZ,EAAAC,EAEA,GACAS,GAAAE,EAAAJ,EACAI,KAAAN,EACAM,EAAA,IAGAF,GAAAD,GAEAE,GAAAN,EAAAlB,OAAAuB,SACGE,EAAA,EAEH,OAAAD,IAOA7H,EAAA+H,OAAA,SAAAC,EAAAC,EAAAC,GACA,GAGAC,GAAAP,EAHAQ,EAAAJ,EAAA1D,OACAyB,EAAA,EACAsC,EAAA,CAGA,IACA,GAAAJ,GAAAG,EACA,SAAA3D,OAAA,6CAIA,IADAmD,EAAAL,EAAAQ,OAAAC,EAAAM,WAAAL,MACAL,KAAA,EACA,SAAAnD,OAAA,yBAAAuD,EAAAO,OAAAN,EAAA,GAGAE,MAAAP,EAAAD,GACAC,GAAAF,EACA3B,GAAA6B,GAAAS,EACAA,GAAAb,QACGW,EAEHD,GAAAM,MAAApB,EAAArB,GACAmC,EAAAO,KAAAR,IJ2fM,SAAUhI,EAAQD,GK9nBxB,GAAA0I,GAAA,mEAAAC,MAAA,GAKA3I,GAAAqG,OAAA,SAAAuC,GACA,MAAAA,KAAAF,EAAApE,OACA,MAAAoE,GAAAE,EAEA,UAAAC,WAAA,6BAAAD,IAOA5I,EAAA+H,OAAA,SAAAe,GACA,GAAAC,GAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,IAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,GAEAC,EAAA,GACAC,EAAA,EAGA,OAAAT,IAAAD,MAAAE,EACAF,EAAAC,EAIAE,GAAAH,MAAAI,EACAJ,EAAAG,EAAAM,EAIAJ,GAAAL,MAAAM,EACAN,EAAAK,EAAAK,EAIAV,GAAAO,EACA,GAIAP,GAAAQ,EACA,IAIA,IL6oBM,SAAUrJ,EAAQD,GM7rBxB,QAAAqB,GAAAH,EAAAgE,EAAAuE,GACA,GAAAvE,IAAAhE,GACA,MAAAA,GAAAgE,EACG,QAAAwE,UAAApF,OACH,MAAAmF,EAEA,UAAAhF,OAAA,IAAAS,EAAA,6BAQA,QAAAyE,GAAAC,GACA,GAAAC,GAAAD,EAAAC,MAAAC,EACA,OAAAD,IAIAE,OAAAF,EAAA,GACAG,KAAAH,EAAA,GACAI,KAAAJ,EAAA,GACAK,KAAAL,EAAA,GACAM,KAAAN,EAAA,IAPA,KAYA,QAAAO,GAAAC,GACA,GAAAC,GAAA,EAiBA,OAhBAD,GAAAN,SACAO,GAAAD,EAAAN,OAAA,KAEAO,GAAA,KACAD,EAAAL,OACAM,GAAAD,EAAAL,KAAA,KAEAK,EAAAJ,OACAK,GAAAD,EAAAJ,MAEAI,EAAAH,OACAI,GAAA,IAAAD,EAAAH,MAEAG,EAAAF,OACAG,GAAAD,EAAAF,MAEAG,EAeA,QAAAC,GAAAC,GACA,GAAAL,GAAAK,EACAF,EAAAX,EAAAa,EACA,IAAAF,EAAA,CACA,IAAAA,EAAAH,KACA,MAAAK,EAEAL,GAAAG,EAAAH,KAKA,OAAAM,GAHAC,EAAA1K,EAAA0K,WAAAP,GAEAQ,EAAAR,EAAAxB,MAAA,OACAiC,EAAA,EAAA1E,EAAAyE,EAAArG,OAAA,EAA8C4B,GAAA,EAAQA,IACtDuE,EAAAE,EAAAzE,GACA,MAAAuE,EACAE,EAAAE,OAAA3E,EAAA,GACK,OAAAuE,EACLG,IACKA,EAAA,IACL,KAAAH,GAIAE,EAAAE,OAAA3E,EAAA,EAAA0E,GACAA,EAAA,IAEAD,EAAAE,OAAA3E,EAAA,GACA0E,KAUA,OANAT,GAAAQ,EAAA7F,KAAA,KAEA,KAAAqF,IACAA,EAAAO,EAAA,SAGAJ,GACAA,EAAAH,OACAC,EAAAE,IAEAH,EAoBA,QAAArF,GAAAgG,EAAAN,GACA,KAAAM,IACAA,EAAA,KAEA,KAAAN,IACAA,EAAA,IAEA,IAAAO,GAAApB,EAAAa,GACAQ,EAAArB,EAAAmB,EAMA,IALAE,IACAF,EAAAE,EAAAb,MAAA,KAIAY,MAAAhB,OAIA,MAHAiB,KACAD,EAAAhB,OAAAiB,EAAAjB,QAEAK,EAAAW,EAGA,IAAAA,GAAAP,EAAAX,MAAAoB,GACA,MAAAT,EAIA,IAAAQ,MAAAf,OAAAe,EAAAb,KAEA,MADAa,GAAAf,KAAAO,EACAJ,EAAAY,EAGA,IAAAE,GAAA,MAAAV,EAAAjC,OAAA,GACAiC,EACAD,EAAAO,EAAAK,QAAA,eAAAX,EAEA,OAAAQ,IACAA,EAAAb,KAAAe,EACAd,EAAAY,IAEAE,EAcA,QAAAnI,GAAA+H,EAAAN,GACA,KAAAM,IACAA,EAAA,KAGAA,IAAAK,QAAA,SAOA,KADA,GAAAC,GAAA,EACA,IAAAZ,EAAAlE,QAAAwE,EAAA,OACA,GAAAO,GAAAP,EAAAQ,YAAA,IACA,IAAAD,EAAA,EACA,MAAAb,EAOA,IADAM,IAAAS,MAAA,EAAAF,GACAP,EAAAjB,MAAA,qBACA,MAAAW,KAGAY,EAIA,MAAAI,OAAAJ,EAAA,GAAAtG,KAAA,OAAA0F,EAAAiB,OAAAX,EAAAxG,OAAA,GASA,QAAAoH,GAAAC,GACA,MAAAA,GAYA,QAAAvH,GAAA4D,GACA,MAAA4D,GAAA5D,GACA,IAAAA,EAGAA,EAIA,QAAA6D,GAAA7D,GACA,MAAA4D,GAAA5D,GACAA,EAAAuD,MAAA,GAGAvD,EAIA,QAAA4D,GAAAD,GACA,IAAAA,EACA,QAGA,IAAArH,GAAAqH,EAAArH,MAEA,IAAAA,EAAA,EACA,QAGA,SAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,MAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,IACA,KAAAqH,EAAArD,WAAAhE,EAAA,GACA,QAGA,QAAA4B,GAAA5B,EAAA,GAA2B4B,GAAA,EAAQA,IACnC,QAAAyF,EAAArD,WAAApC,GACA,QAIA,UAWA,QAAA4F,GAAAC,EAAAC,EAAAC,GACA,GAAAC,GAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,OACA,YAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,GAAAD,EACAC,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,EACAA,GAGAA,EAAAH,EAAApJ,cAAAqJ,EAAArJ,cACA,IAAAuJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UAaA,QAAAiJ,GAAAL,EAAAC,EAAAK,GACA,GAAAH,GAAAH,EAAApJ,cAAAqJ,EAAArJ,aACA,YAAAuJ,EACAA,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,GAAAG,EACAH,GAGAA,EAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,QACA,IAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UAIA,QAAAgJ,GAAAG,EAAAC,GACA,MAAAD,KAAAC,EACA,EAGA,OAAAD,EACA,EAGA,OAAAC,GACA,EAGAD,EAAAC,EACA,GAGA,EAOA,QAAAnG,GAAA2F,EAAAC,GACA,GAAAE,GAAAH,EAAApJ,cAAAqJ,EAAArJ,aACA,YAAAuJ,EACAA,GAGAA,EAAAH,EAAAlJ,gBAAAmJ,EAAAnJ,gBACA,IAAAqJ,EACAA,GAGAA,EAAAC,EAAAJ,EAAAjJ,OAAAkJ,EAAAlJ,QACA,IAAAoJ,EACAA,GAGAA,EAAAH,EAAA9I,aAAA+I,EAAA/I,aACA,IAAAiJ,EACAA,GAGAA,EAAAH,EAAA7I,eAAA8I,EAAA9I,eACA,IAAAgJ,EACAA,EAGAC,EAAAJ,EAAA5I,KAAA6I,EAAA7I,UASA,QAAAqJ,GAAAC,GACA,MAAAtH,MAAAuH,MAAAD,EAAAtB,QAAA,iBAAsC,KAQtC,QAAAwB,GAAAxK,EAAAyK,EAAAC,GA8BA,GA7BAD,KAAA,GAEAzK,IAEA,MAAAA,IAAAmC,OAAA,UAAAsI,EAAA,KACAzK,GAAA,KAOAyK,EAAAzK,EAAAyK,GAiBAC,EAAA,CACA,GAAAC,GAAAnD,EAAAkD,EACA,KAAAC,EACA,SAAArI,OAAA,mCAEA,IAAAqI,EAAA3C,KAAA,CAEA,GAAAkB,GAAAyB,EAAA3C,KAAAmB,YAAA,IACAD,IAAA,IACAyB,EAAA3C,KAAA2C,EAAA3C,KAAA4C,UAAA,EAAA1B,EAAA,IAGAuB,EAAA9H,EAAAsF,EAAA0C,GAAAF,GAGA,MAAArC,GAAAqC,GA3cA5M,EAAAqB,QAEA,IAAAyI,GAAA,iEACAmB,EAAA,eAeAjL,GAAA2J,WAsBA3J,EAAAoK,cAwDApK,EAAAuK,YA2DAvK,EAAA8E,OAEA9E,EAAA0K,WAAA,SAAAF,GACA,YAAAA,EAAAjC,OAAA,IAAAuB,EAAAkD,KAAAxC,IAyCAxK,EAAA+C,UAEA,IAAAkK,GAAA,WACA,GAAAC,GAAAhJ,OAAAC,OAAA,KACA,sBAAA+I,MAuBAlN,GAAAoE,YAAA6I,EAAAvB,EAAAtH,EASApE,EAAA6L,cAAAoB,EAAAvB,EAAAG,EAsEA7L,EAAA8L,6BAuCA9L,EAAAoM,sCAsDApM,EAAAoG,sCAUApG,EAAAwM,sBAqDAxM,EAAA2M,oBNqtBM,SAAU1M,EAAQD,EAASM,GO3qCjC,QAAAmB,KACArB,KAAA+M,UACA/M,KAAAgN,KAAAC,EAAA,GAAAC,KAAApJ,OAAAC,OAAA,MAZA,GAAA/C,GAAAd,EAAA,GACAmD,EAAAS,OAAAnC,UAAA6E,eACAyG,EAAA,mBAAAC,IAgBA7L,GAAA8L,UAAA,SAAAC,EAAAC,GAEA,OADAC,GAAA,GAAAjM,GACAyE,EAAA,EAAAC,EAAAqH,EAAAlJ,OAAsC4B,EAAAC,EAASD,IAC/CwH,EAAAhK,IAAA8J,EAAAtH,GAAAuH,EAEA,OAAAC,IASAjM,EAAAM,UAAA4L,KAAA,WACA,MAAAN,GAAAjN,KAAAgN,KAAAO,KAAAzJ,OAAA0J,oBAAAxN,KAAAgN,MAAA9I,QAQA7C,EAAAM,UAAA2B,IAAA,SAAAsE,EAAAyF,GACA,GAAAI,GAAAR,EAAArF,EAAA5G,EAAAgD,YAAA4D,GACA8F,EAAAT,EAAAjN,KAAAqD,IAAAuE,GAAAvE,EAAA9C,KAAAP,KAAAgN,KAAAS,GACAE,EAAA3N,KAAA+M,OAAA7I,MACAwJ,KAAAL,GACArN,KAAA+M,OAAAa,KAAAhG,GAEA8F,IACAT,EACAjN,KAAAgN,KAAAM,IAAA1F,EAAA+F,GAEA3N,KAAAgN,KAAAS,GAAAE,IAUAtM,EAAAM,UAAA0B,IAAA,SAAAuE,GACA,GAAAqF,EACA,MAAAjN,MAAAgN,KAAA3J,IAAAuE,EAEA,IAAA6F,GAAAzM,EAAAgD,YAAA4D,EACA,OAAAvE,GAAA9C,KAAAP,KAAAgN,KAAAS,IASApM,EAAAM,UAAAuE,QAAA,SAAA0B,GACA,GAAAqF,EAAA,CACA,GAAAU,GAAA3N,KAAAgN,KAAAa,IAAAjG,EACA,IAAA+F,GAAA,EACA,MAAAA,OAEG,CACH,GAAAF,GAAAzM,EAAAgD,YAAA4D,EACA,IAAAvE,EAAA9C,KAAAP,KAAAgN,KAAAS,GACA,MAAAzN,MAAAgN,KAAAS,GAIA,SAAApJ,OAAA,IAAAuD,EAAA,yBAQAvG,EAAAM,UAAAmM,GAAA,SAAAC,GACA,GAAAA,GAAA,GAAAA,EAAA/N,KAAA+M,OAAA7I,OACA,MAAAlE,MAAA+M,OAAAgB,EAEA,UAAA1J,OAAA,yBAAA0J,IAQA1M,EAAAM,UAAAkE,QAAA,WACA,MAAA7F,MAAA+M,OAAA5B,SAGAvL,EAAAyB,YPmsCM,SAAUxB,EAAQD,EAASM,GQ9yCjC,QAAA8N,GAAArC,EAAAC,GAEA,GAAAqC,GAAAtC,EAAApJ,cACA2L,EAAAtC,EAAArJ,cACA4L,EAAAxC,EAAAlJ,gBACA2L,EAAAxC,EAAAnJ,eACA,OAAAyL,GAAAD,GAAAC,GAAAD,GAAAG,GAAAD,GACAnN,EAAAgF,oCAAA2F,EAAAC,IAAA,EAQA,QAAApK,KACAxB,KAAA+M,UACA/M,KAAAqO,SAAA,EAEArO,KAAAsO,OAAgB/L,eAAA,EAAAE,gBAAA,GAzBhB,GAAAzB,GAAAd,EAAA,EAkCAsB,GAAAG,UAAA6C,gBACA,SAAA+J,EAAAC,GACAxO,KAAA+M,OAAA7J,QAAAqL,EAAAC,IAQAhN,EAAAG,UAAA2B,IAAA,SAAAmL,GACAT,EAAAhO,KAAAsO,MAAAG,IACAzO,KAAAsO,MAAAG,EACAzO,KAAA+M,OAAAa,KAAAa,KAEAzO,KAAAqO,SAAA,EACArO,KAAA+M,OAAAa,KAAAa,KAaAjN,EAAAG,UAAAkE,QAAA,WAKA,MAJA7F,MAAAqO,UACArO,KAAA+M,OAAA2B,KAAA1N,EAAAgF,qCACAhG,KAAAqO,SAAA,GAEArO,KAAA+M,QAGAnN,EAAA4B,eRk0CM,SAAU3B,EAAQD,EAASM,GSn4CjC,QAAAU,GAAA+N,EAAAC,GACA,GAAAC,GAAAF,CAKA,OAJA,gBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,IAGA,MAAAE,EAAAC,SACA,GAAAC,GAAAF,EAAAD,GACA,GAAAI,GAAAH,EAAAD,GA0QA,QAAAI,GAAAL,EAAAC,GACA,GAAAC,GAAAF,CACA,iBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,GAGA,IAAAjI,GAAA1F,EAAAC,OAAA4N,EAAA,WACA5L,EAAAjC,EAAAC,OAAA4N,EAAA,WAGAlI,EAAA3F,EAAAC,OAAA4N,EAAA,YACA9M,EAAAf,EAAAC,OAAA4N,EAAA,mBACAjI,EAAA5F,EAAAC,OAAA4N,EAAA,uBACAjJ,EAAA5E,EAAAC,OAAA4N,EAAA,YACA5M,EAAAjB,EAAAC,OAAA4N,EAAA,YAIA,IAAAnI,GAAA1G,KAAA4B,SACA,SAAAyC,OAAA,wBAAAqC,EAGA3E,KACAA,EAAAf,EAAAmJ,UAAApI,IAGAkB,IACAqD,IAAA3C,QAIA2C,IAAAtF,EAAAmJ,WAKA7D,IAAA,SAAA5D,GACA,MAAAX,IAAAf,EAAAsJ,WAAAvI,IAAAf,EAAAsJ,WAAA5H,GACA1B,EAAA2B,SAAAZ,EAAAW,GACAA,IAOA1C,KAAAsB,OAAAD,EAAA8L,UAAAxG,EAAAL,IAAA3C,SAAA,GACA3D,KAAAoB,SAAAC,EAAA8L,UAAAlK,GAAA,GAEAjD,KAAAiP,iBAAAjP,KAAAoB,SAAAyE,UAAAS,IAAA,SAAAiF,GACA,MAAAvK,GAAAuL,iBAAAxK,EAAAwJ,EAAAqD,KAGA5O,KAAA+B,aACA/B,KAAA4G,iBACA5G,KAAAuB,UAAAqE,EACA5F,KAAAkP,cAAAN,EACA5O,KAAAiC,OA4GA,QAAAkN,KACAnP,KAAAuC,cAAA,EACAvC,KAAAyC,gBAAA,EACAzC,KAAA0C,OAAA,KACA1C,KAAA6C,aAAA,KACA7C,KAAA8C,eAAA,KACA9C,KAAA+C,KAAA,KAkaA,QAAAgM,GAAAJ,EAAAC,GACA,GAAAC,GAAAF,CACA,iBAAAA,KACAE,EAAA7N,EAAAoL,oBAAAuC,GAGA,IAAAjI,GAAA1F,EAAAC,OAAA4N,EAAA,WACAC,EAAA9N,EAAAC,OAAA4N,EAAA,WAEA,IAAAnI,GAAA1G,KAAA4B,SACA,SAAAyC,OAAA,wBAAAqC,EAGA1G,MAAAoB,SAAA,GAAAC,GACArB,KAAAsB,OAAA,GAAAD,EAEA,IAAA+N,IACA9M,MAAA,EACAE,OAAA,EAEAxC,MAAAqP,UAAAP,EAAAxI,IAAA,SAAAiF,GACA,GAAAA,EAAArB,IAGA,SAAA7F,OAAA,qDAEA,IAAAiL,GAAAtO,EAAAC,OAAAsK,EAAA,UACAgE,EAAAvO,EAAAC,OAAAqO,EAAA,QACAE,EAAAxO,EAAAC,OAAAqO,EAAA,SAEA,IAAAC,EAAAH,EAAA9M,MACAiN,IAAAH,EAAA9M,MAAAkN,EAAAJ,EAAA5M,OACA,SAAA6B,OAAA,uDAIA,OAFA+K,GAAAE,GAGAG,iBAGAlN,cAAAgN,EAAA,EACA9M,gBAAA+M,EAAA,GAEAE,SAAA,GAAA9O,GAAAI,EAAAC,OAAAsK,EAAA,OAAAqD,MAh5BA,GAAA5N,GAAAd,EAAA,GACAyP,EAAAzP,EAAA,GACAmB,EAAAnB,EAAA,GAAAmB,SACAK,EAAAxB,EAAA,GACA0P,EAAA1P,EAAA,GAAA0P,SAaAhP,GAAAiB,cAAA,SAAA8M,EAAAC,GACA,MAAAI,GAAAnN,cAAA8M,EAAAC,IAMAhO,EAAAe,UAAAC,SAAA,EAgCAhB,EAAAe,UAAAkO,oBAAA,KACA/L,OAAAgM,eAAAlP,EAAAe,UAAA,sBACAoO,cAAA,EACAC,YAAA,EACAnC,IAAA,WAKA,MAJA7N,MAAA6P,qBACA7P,KAAAiQ,eAAAjQ,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAA6P,uBAIAjP,EAAAe,UAAAuO,mBAAA,KACApM,OAAAgM,eAAAlP,EAAAe,UAAA,qBACAoO,cAAA,EACAC,YAAA,EACAnC,IAAA,WAKA,MAJA7N,MAAAkQ,oBACAlQ,KAAAiQ,eAAAjQ,KAAAuB,UAAAvB,KAAA+B,YAGA/B,KAAAkQ,sBAIAtP,EAAAe,UAAAwO,wBACA,SAAAvI,EAAAqD,GACA,GAAAxK,GAAAmH,EAAAO,OAAA8C,EACA,aAAAxK,GAAmB,MAAAA,GAQnBG,EAAAe,UAAAsO,eACA,SAAArI,EAAAvB,GACA,SAAAhC,OAAA,6CAGAzD,EAAAwP,gBAAA,EACAxP,EAAAyP,eAAA,EAEAzP,EAAA0P,qBAAA,EACA1P,EAAA2P,kBAAA,EAkBA3P,EAAAe,UAAAO,YACA,SAAAqM,EAAAiC,EAAAC,GACA,GAGA7K,GAHA8K,EAAAF,GAAA,KACAG,EAAAF,GAAA7P,EAAAwP,eAGA,QAAAO,GACA,IAAA/P,GAAAwP,gBACAxK,EAAA5F,KAAA4Q,kBACA,MACA,KAAAhQ,GAAAyP,eACAzK,EAAA5F,KAAA6Q,iBACA,MACA,SACA,SAAAxM,OAAA,+BAGA,GAAAtC,GAAA/B,KAAA+B,UACA6D,GAAAU,IAAA,SAAAnE,GACA,GAAAO,GAAA,OAAAP,EAAAO,OAAA,KAAA1C,KAAAoB,SAAA0M,GAAA3L,EAAAO,OAEA,OADAA,GAAA1B,EAAAuL,iBAAAxK,EAAAW,EAAA1C,KAAAkP,gBAEAxM,SACAH,cAAAJ,EAAAI,cACAE,gBAAAN,EAAAM,gBACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,KAAA,OAAAZ,EAAAY,KAAA,KAAA/C,KAAAsB,OAAAwM,GAAA3L,EAAAY,QAEK/C,MAAAkD,QAAAqL,EAAAmC,IAyBL9P,EAAAe,UAAAmP,yBACA,SAAAhQ,GACA,GAAAwB,GAAAtB,EAAAC,OAAAH,EAAA,QAMAiQ,GACArO,OAAA1B,EAAAC,OAAAH,EAAA,UACA+B,aAAAP,EACAQ,eAAA9B,EAAAC,OAAAH,EAAA,YAIA,IADAiQ,EAAArO,OAAA1C,KAAAgR,iBAAAD,EAAArO,QACAqO,EAAArO,OAAA,EACA,QAGA,IAAAkD,MAEAqF,EAAAjL,KAAAiR,aAAAF,EACA/Q,KAAA6Q,kBACA,eACA,iBACA7P,EAAA0K,2BACAiE,EAAAY,kBACA,IAAAtF,GAAA,GACA,GAAA9I,GAAAnC,KAAA6Q,kBAAA5F,EAEA,IAAAiG,SAAApQ,EAAA0B,OAOA,IANA,GAAAK,GAAAV,EAAAU,aAMAV,KAAAU,kBACA+C,EAAAgI,MACAtL,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA6Q,oBAAA5F,OASA,KANA,GAAAnI,GAAAX,EAAAW,eAMAX,GACAA,EAAAU,eAAAP,GACAH,EAAAW,mBACA8C,EAAAgI,MACAtL,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,8BAGAA,EAAAnC,KAAA6Q,oBAAA5F,GAKA,MAAArF,IAGAhG,EAAAgB,oBAgGAoO,EAAArN,UAAAmC,OAAAC,OAAAnD,EAAAe,WACAqN,EAAArN,UAAA+N,SAAA9O,EAMAoO,EAAArN,UAAAqP,iBAAA,SAAAnM,GACA,GAAAuM,GAAAvM,CAKA,IAJA,MAAA7E,KAAA+B,aACAqP,EAAApQ,EAAA2B,SAAA3C,KAAA+B,WAAAqP,IAGApR,KAAAoB,SAAAiC,IAAA+N,GACA,MAAApR,MAAAoB,SAAA8E,QAAAkL,EAKA,IAAAtL,EACA,KAAAA,EAAA,EAAaA,EAAA9F,KAAAiP,iBAAA/K,SAAkC4B,EAC/C,GAAA9F,KAAAiP,iBAAAnJ,IAAAjB,EACA,MAAAiB,EAIA,WAYAkJ,EAAAnN,cACA,SAAA8M,EAAAC,GACA,GAAAyC,GAAAvN,OAAAC,OAAAiL,EAAArN,WAEAgF,EAAA0K,EAAA/P,OAAAD,EAAA8L,UAAAwB,EAAArN,OAAAuE,WAAA,GACA5C,EAAAoO,EAAAjQ,SAAAC,EAAA8L,UAAAwB,EAAAvN,SAAAyE,WAAA,EACAwL,GAAAtP,WAAA4M,EAAAzN,YACAmQ,EAAAzK,eAAA+H,EAAAxI,wBAAAkL,EAAAjQ,SAAAyE,UACAwL,EAAAtP,YACAsP,EAAApP,KAAA0M,EAAA5N,MACAsQ,EAAAnC,cAAAN,EACAyC,EAAApC,iBAAAoC,EAAAjQ,SAAAyE,UAAAS,IAAA,SAAAiF,GACA,MAAAvK,GAAAuL,iBAAA8E,EAAAtP,WAAAwJ,EAAAqD,IAYA,QAJA0C,GAAA3C,EAAApN,UAAAsE,UAAAsF,QACAoG,EAAAF,EAAAxB,uBACA2B,EAAAH,EAAAnB,sBAEApK,EAAA,EAAA5B,EAAAoN,EAAApN,OAAsD4B,EAAA5B,EAAY4B,IAAA,CAClE,GAAA2L,GAAAH,EAAAxL,GACA4L,EAAA,GAAAvC,EACAuC,GAAAnP,cAAAkP,EAAAlP,cACAmP,EAAAjP,gBAAAgP,EAAAhP,gBAEAgP,EAAA/O,SACAgP,EAAAhP,OAAAO,EAAAiD,QAAAuL,EAAA/O,QACAgP,EAAA7O,aAAA4O,EAAA5O,aACA6O,EAAA5O,eAAA2O,EAAA3O,eAEA2O,EAAA1O,OACA2O,EAAA3O,KAAA4D,EAAAT,QAAAuL,EAAA1O,OAGAyO,EAAA5D,KAAA8D,IAGAH,EAAA3D,KAAA8D,GAKA,MAFA9B,GAAAyB,EAAAnB,mBAAAlP,EAAA0K,4BAEA2F,GAMArC,EAAArN,UAAAC,SAAA,EAKAkC,OAAAgM,eAAAd,EAAArN,UAAA,WACAkM,IAAA,WACA,MAAA7N,MAAAiP,iBAAA9D,WAqBA6D,EAAArN,UAAAsO,eACA,SAAArI,EAAAvB,GAeA,IAdA,GAYAlE,GAAAkK,EAAAsF,EAAAC,EAAAxJ,EAZA7F,EAAA,EACA8C,EAAA,EACAG,EAAA,EACAD,EAAA,EACAG,EAAA,EACAD,EAAA,EACAvB,EAAA0D,EAAA1D,OACA+G,EAAA,EACA4G,KACAC,KACAC,KACAT,KAGArG,EAAA/G,GACA,SAAA0D,EAAAO,OAAA8C,GACA1I,IACA0I,IACA5F,EAAA,MAEA,UAAAuC,EAAAO,OAAA8C,GACAA,QAEA,CASA,IARA9I,EAAA,GAAAgN,GACAhN,EAAAI,gBAOAqP,EAAA3G,EAAyB2G,EAAA1N,IACzBlE,KAAAmQ,wBAAAvI,EAAAgK,GADuCA,KAQvC,GAHAvF,EAAAzE,EAAAuD,MAAAF,EAAA2G,GAEAD,EAAAE,EAAAxF,GAEApB,GAAAoB,EAAAnI,WACS,CAET,IADAyN,KACA1G,EAAA2G,GACAlQ,EAAAiG,OAAAC,EAAAqD,EAAA6G,GACA1J,EAAA0J,EAAA1J,MACA6C,EAAA6G,EAAAzJ,KACAsJ,EAAA/D,KAAAxF,EAGA,QAAAuJ,EAAAzN,OACA,SAAAG,OAAA,yCAGA,QAAAsN,EAAAzN,OACA,SAAAG,OAAA,yCAGAwN,GAAAxF,GAAAsF,EAIAxP,EAAAM,gBAAA4C,EAAAsM,EAAA,GACAtM,EAAAlD,EAAAM,gBAEAkP,EAAAzN,OAAA,IAEA/B,EAAAO,OAAAgD,EAAAiM,EAAA,GACAjM,GAAAiM,EAAA,GAGAxP,EAAAU,aAAA2C,EAAAmM,EAAA,GACAnM,EAAArD,EAAAU,aAEAV,EAAAU,cAAA,EAGAV,EAAAW,eAAAyC,EAAAoM,EAAA,GACApM,EAAApD,EAAAW,eAEA6O,EAAAzN,OAAA,IAEA/B,EAAAY,KAAA0C,EAAAkM,EAAA,GACAlM,GAAAkM,EAAA,KAIAL,EAAA1D,KAAAzL,GACA,gBAAAA,GAAAU,cACAkP,EAAAnE,KAAAzL,GAKAyN,EAAA0B,EAAAtQ,EAAAgL,qCACAhM,KAAA6P,oBAAAyB,EAEA1B,EAAAmC,EAAA/Q,EAAA0K,4BACA1L,KAAAkQ,mBAAA6B,GAOA/C,EAAArN,UAAAsP,aACA,SAAAe,EAAAC,EAAAC,EACAC,EAAAC,EAAAC,GAMA,GAAAL,EAAAE,IAAA,EACA,SAAAzJ,WAAA,gDACAuJ,EAAAE,GAEA,IAAAF,EAAAG,GAAA,EACA,SAAA1J,WAAA,kDACAuJ,EAAAG,GAGA,OAAAxC,GAAA2C,OAAAN,EAAAC,EAAAG,EAAAC,IAOArD,EAAArN,UAAA4Q,mBACA,WACA,OAAAtH,GAAA,EAAuBA,EAAAjL,KAAA4Q,mBAAA1M,SAAwC+G,EAAA,CAC/D,GAAA9I,GAAAnC,KAAA4Q,mBAAA3F,EAMA,IAAAA,EAAA,EAAAjL,KAAA4Q,mBAAA1M,OAAA,CACA,GAAAsO,GAAAxS,KAAA4Q,mBAAA3F,EAAA,EAEA,IAAA9I,EAAAI,gBAAAiQ,EAAAjQ,cAAA,CACAJ,EAAAsQ,oBAAAD,EAAA/P,gBAAA,CACA,WAKAN,EAAAsQ,oBAAAC,MA4BA1D,EAAArN,UAAA8C,oBACA,SAAA3D,GACA,GAAAiQ,IACAxO,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAGAmK,EAAAjL,KAAAiR,aACAF,EACA/Q,KAAA4Q,mBACA,gBACA,kBACA5P,EAAAgL,oCACAhL,EAAAC,OAAAH,EAAA,OAAAF,EAAA0P,sBAGA,IAAArF,GAAA,GACA,GAAA9I,GAAAnC,KAAA4Q,mBAAA3F,EAEA,IAAA9I,EAAAI,gBAAAwO,EAAAxO,cAAA,CACA,GAAAG,GAAA1B,EAAAC,OAAAkB,EAAA,cACA,QAAAO,IACAA,EAAA1C,KAAAoB,SAAA0M,GAAApL,GACAA,EAAA1B,EAAAuL,iBAAAvM,KAAA+B,WAAAW,EAAA1C,KAAAkP,eAEA,IAAAnM,GAAA/B,EAAAC,OAAAkB,EAAA,YAIA,OAHA,QAAAY,IACAA,EAAA/C,KAAAsB,OAAAwM,GAAA/K,KAGAL,SACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,qBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,uBACAY,SAKA,OACAL,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAQAiM,EAAArN,UAAAgR,wBACA,WACA,QAAA3S,KAAA4G,iBAGA5G,KAAA4G,eAAA1C,QAAAlE,KAAAoB,SAAAmM,SACAvN,KAAA4G,eAAAgM,KAAA,SAAAC,GAA+C,aAAAA,MAQ/C7D,EAAArN,UAAA6B,iBACA,SAAAqB,EAAAiO,GACA,IAAA9S,KAAA4G,eACA,WAGA,IAAAqE,GAAAjL,KAAAgR,iBAAAnM,EACA,IAAAoG,GAAA,EACA,MAAAjL,MAAA4G,eAAAqE,EAGA,IAAAmG,GAAAvM,CACA,OAAA7E,KAAA+B,aACAqP,EAAApQ,EAAA2B,SAAA3C,KAAA+B,WAAAqP,GAGA,IAAAlH,EACA,UAAAlK,KAAA+B,aACAmI,EAAAlJ,EAAAuI,SAAAvJ,KAAA+B,aAAA,CAKA,GAAAgR,GAAA3B,EAAArG,QAAA,gBACA,YAAAb,EAAAP,QACA3J,KAAAoB,SAAAiC,IAAA0P,GACA,MAAA/S,MAAA4G,eAAA5G,KAAAoB,SAAA8E,QAAA6M,GAGA,MAAA7I,EAAAH,MAAA,KAAAG,EAAAH,OACA/J,KAAAoB,SAAAiC,IAAA,IAAA+N,GACA,MAAApR,MAAA4G,eAAA5G,KAAAoB,SAAA8E,QAAA,IAAAkL,IAQA,GAAA0B,EACA,WAGA,UAAAzO,OAAA,IAAA+M,EAAA,+BA2BApC,EAAArN,UAAAqR,qBACA,SAAAlS,GACA,GAAA4B,GAAA1B,EAAAC,OAAAH,EAAA,SAEA,IADA4B,EAAA1C,KAAAgR,iBAAAtO,GACAA,EAAA,EACA,OACAJ,KAAA,KACAE,OAAA,KACA2O,WAAA,KAIA,IAAAJ,IACArO,SACAG,aAAA7B,EAAAC,OAAAH,EAAA,QACAgC,eAAA9B,EAAAC,OAAAH,EAAA,WAGAmK,EAAAjL,KAAAiR,aACAF,EACA/Q,KAAA6Q,kBACA,eACA,iBACA7P,EAAA0K,2BACA1K,EAAAC,OAAAH,EAAA,OAAAF,EAAA0P,sBAGA,IAAArF,GAAA,GACA,GAAA9I,GAAAnC,KAAA6Q,kBAAA5F,EAEA,IAAA9I,EAAAO,SAAAqO,EAAArO,OACA,OACAJ,KAAAtB,EAAAC,OAAAkB,EAAA,sBACAK,OAAAxB,EAAAC,OAAAkB,EAAA,wBACAgP,WAAAnQ,EAAAC,OAAAkB,EAAA,6BAKA,OACAG,KAAA,KACAE,OAAA,KACA2O,WAAA,OAIAvR,EAAAoP,yBAmGAD,EAAApN,UAAAmC,OAAAC,OAAAnD,EAAAe,WACAoN,EAAApN,UAAAsR,YAAArS,EAKAmO,EAAApN,UAAAC,SAAA,EAKAkC,OAAAgM,eAAAf,EAAApN,UAAA,WACAkM,IAAA,WAEA,OADA5K,MACA6C,EAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAC9C,OAAAoN,GAAA,EAAqBA,EAAAlT,KAAAqP,UAAAvJ,GAAA4J,SAAAzM,QAAAiB,OAA+CgP,IACpEjQ,EAAA2K,KAAA5N,KAAAqP,UAAAvJ,GAAA4J,SAAAzM,QAAAiQ,GAGA,OAAAjQ,MAuBA8L,EAAApN,UAAA8C,oBACA,SAAA3D,GACA,GAAAiQ,IACAxO,cAAAvB,EAAAC,OAAAH,EAAA,QACA2B,gBAAAzB,EAAAC,OAAAH,EAAA,WAKAqS,EAAAxD,EAAA2C,OAAAvB,EAAA/Q,KAAAqP,UACA,SAAA0B,EAAAqC,GACA,GAAAtH,GAAAiF,EAAAxO,cAAA6Q,EAAA3D,gBAAAlN,aACA,OAAAuJ,GACAA,EAGAiF,EAAAtO,gBACA2Q,EAAA3D,gBAAAhN,kBAEA2Q,EAAApT,KAAAqP,UAAA8D,EAEA,OAAAC,GASAA,EAAA1D,SAAAjL,qBACAnC,KAAAyO,EAAAxO,eACA6Q,EAAA3D,gBAAAlN,cAAA,GACAC,OAAAuO,EAAAtO,iBACA2Q,EAAA3D,gBAAAlN,gBAAAwO,EAAAxO,cACA6Q,EAAA3D,gBAAAhN,gBAAA,EACA,GACA4Q,KAAAvS,EAAAuS,QAdA3Q,OAAA,KACAJ,KAAA,KACAE,OAAA,KACAO,KAAA,OAmBAgM,EAAApN,UAAAgR,wBACA,WACA,MAAA3S,MAAAqP,UAAAiE,MAAA,SAAA/H,GACA,MAAAA,GAAAmE,SAAAiD,6BASA5D,EAAApN,UAAA6B,iBACA,SAAAqB,EAAAiO,GACA,OAAAhN,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAAA,CAC9C,GAAAsN,GAAApT,KAAAqP,UAAAvJ,GAEAvC,EAAA6P,EAAA1D,SAAAlM,iBAAAqB,GAAA,EACA,IAAAtB,EACA,MAAAA,GAGA,GAAAuP,EACA,WAGA,UAAAzO,OAAA,IAAAQ,EAAA,+BAsBAkK,EAAApN,UAAAqR,qBACA,SAAAlS,GACA,OAAAgF,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAAA,CAC9C,GAAAsN,GAAApT,KAAAqP,UAAAvJ,EAIA,IAAAsN,EAAA1D,SAAAsB,iBAAAhQ,EAAAC,OAAAH,EAAA,iBAGA,GAAAyS,GAAAH,EAAA1D,SAAAsD,qBAAAlS,EACA,IAAAyS,EAAA,CACA,GAAAC,IACAlR,KAAAiR,EAAAjR,MACA8Q,EAAA3D,gBAAAlN,cAAA,GACAC,OAAA+Q,EAAA/Q,QACA4Q,EAAA3D,gBAAAlN,gBAAAgR,EAAAjR,KACA8Q,EAAA3D,gBAAAhN,gBAAA,EACA,GAEA,OAAA+Q,KAIA,OACAlR,KAAA,KACAE,OAAA,OASAuM,EAAApN,UAAAsO,eACA,SAAArI,EAAAvB,GACArG,KAAA6P,uBACA7P,KAAAkQ,qBACA,QAAApK,GAAA,EAAmBA,EAAA9F,KAAAqP,UAAAnL,OAA2B4B,IAG9C,OAFAsN,GAAApT,KAAAqP,UAAAvJ,GACA2N,EAAAL,EAAA1D,SAAAkB,mBACAsC,EAAA,EAAqBA,EAAAO,EAAAvP,OAA4BgP,IAAA,CACjD,GAAA/Q,GAAAsR,EAAAP,GAEAxQ,EAAA0Q,EAAA1D,SAAAtO,SAAA0M,GAAA3L,EAAAO,OACAA,GAAA1B,EAAAuL,iBAAA6G,EAAA1D,SAAA3N,WAAAW,EAAA1C,KAAAkP,eACAlP,KAAAoB,SAAAkC,IAAAZ,GACAA,EAAA1C,KAAAoB,SAAA8E,QAAAxD,EAEA,IAAAK,GAAA,IACAZ,GAAAY,OACAA,EAAAqQ,EAAA1D,SAAApO,OAAAwM,GAAA3L,EAAAY,MACA/C,KAAAsB,OAAAgC,IAAAP,GACAA,EAAA/C,KAAAsB,OAAA4E,QAAAnD,GAOA,IAAA2Q,IACAhR,SACAH,cAAAJ,EAAAI,eACA6Q,EAAA3D,gBAAAlN,cAAA,GACAE,gBAAAN,EAAAM,iBACA2Q,EAAA3D,gBAAAlN,gBAAAJ,EAAAI,cACA6Q,EAAA3D,gBAAAhN,gBAAA,EACA,GACAI,aAAAV,EAAAU,aACAC,eAAAX,EAAAW,eACAC,OAGA/C,MAAA6P,oBAAAjC,KAAA8F,GACA,gBAAAA,GAAA7Q,cACA7C,KAAAkQ,mBAAAtC,KAAA8F,GAKA9D,EAAA5P,KAAA6P,oBAAA7O,EAAAgL,qCACA4D,EAAA5P,KAAAkQ,mBAAAlP,EAAA0K,6BAGA9L,EAAAmP,4BTu5CM,SAAUlP,EAAQD,GUx/ExB,QAAA+T,GAAAC,EAAAC,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAUA,GAAA2B,GAAAC,KAAAC,OAAAL,EAAAD,GAAA,GAAAA,EACA9H,EAAAiI,EAAA/B,EAAA8B,EAAAE,IAAA,EACA,YAAAlI,EAEAkI,EAEAlI,EAAA,EAEA+H,EAAAG,EAAA,EAEAL,EAAAK,EAAAH,EAAA7B,EAAA8B,EAAAC,EAAA1B,GAKAA,GAAAzS,EAAA2Q,kBACAsD,EAAAC,EAAA5P,OAAA2P,GAAA,EAEAG,EAKAA,EAAAJ,EAAA,EAEAD,EAAAC,EAAAI,EAAAhC,EAAA8B,EAAAC,EAAA1B,GAIAA,GAAAzS,EAAA2Q,kBACAyD,EAEAJ,EAAA,KAAAA,EA1DAhU,EAAA0Q,qBAAA,EACA1Q,EAAA2Q,kBAAA,EAgFA3Q,EAAA0S,OAAA,SAAAN,EAAA8B,EAAAC,EAAA1B,GACA,OAAAyB,EAAA5P,OACA,QAGA,IAAA+G,GAAA0I,GAAA,EAAAG,EAAA5P,OAAA8N,EAAA8B,EACAC,EAAA1B,GAAAzS,EAAA0Q,qBACA,IAAArF,EAAA,EACA,QAMA,MAAAA,EAAA,MACA,IAAA8I,EAAAD,EAAA7I,GAAA6I,EAAA7I,EAAA,UAGAA,CAGA,OAAAA,KVuhFM,SAAUpL,EAAQD,GWzmFxB,QAAAuU,GAAAC,EAAAC,EAAAC,GACA,GAAAxC,GAAAsC,EAAAC,EACAD,GAAAC,GAAAD,EAAAE,GACAF,EAAAE,GAAAxC,EAWA,QAAAyC,GAAAC,EAAAC,GACA,MAAAR,MAAAS,MAAAF,EAAAP,KAAAU,UAAAF,EAAAD,IAeA,QAAAI,GAAAR,EAAAS,EAAAnU,EAAAoU,GAKA,GAAApU,EAAAoU,EAAA,CAYA,GAAAC,GAAAR,EAAA7T,EAAAoU,GACAhP,EAAApF,EAAA,CAEAyT,GAAAC,EAAAW,EAAAD,EASA,QARAE,GAAAZ,EAAAU,GAQA5B,EAAAxS,EAAmBwS,EAAA4B,EAAO5B,IAC1B2B,EAAAT,EAAAlB,GAAA8B,IAAA,IACAlP,GAAA,EACAqO,EAAAC,EAAAtO,EAAAoN,GAIAiB,GAAAC,EAAAtO,EAAA,EAAAoN,EACA,IAAA+B,GAAAnP,EAAA,CAIA8O,GAAAR,EAAAS,EAAAnU,EAAAuU,EAAA,GACAL,EAAAR,EAAAS,EAAAI,EAAA,EAAAH,IAYAlV,EAAAgQ,UAAA,SAAAwE,EAAAS,GACAD,EAAAR,EAAAS,EAAA,EAAAT,EAAAlQ,OAAA,KX4oFM,SAAUrE,EAAQD,EAASM,GY1tFjC,QAAAW,GAAAqU,EAAAC,EAAAtQ,EAAAuQ,EAAAtQ,GACA9E,KAAAqV,YACArV,KAAAsV,kBACAtV,KAAAsC,KAAA,MAAA4S,EAAA,KAAAA,EACAlV,KAAAwC,OAAA,MAAA2S,EAAA,KAAAA,EACAnV,KAAA0C,OAAA,MAAAmC,EAAA,KAAAA,EACA7E,KAAA+C,KAAA,MAAA+B,EAAA,KAAAA,EACA9E,KAAAuV,IAAA,EACA,MAAAH,GAAApV,KAAAsD,IAAA8R,GAnCA,GAAAzU,GAAAT,EAAA,GAAAS,mBACAK,EAAAd,EAAA,GAIAsV,EAAA,UAGAC,EAAA,GAKAF,EAAA,oBAiCA1U,GAAA6U,wBACA,SAAAC,EAAA7T,EAAA8T,GA+FA,QAAAC,GAAA1T,EAAA2T,GACA,UAAA3T,GAAA+O,SAAA/O,EAAAO,OACAqT,EAAAzS,IAAAwS,OACO,CACP,GAAApT,GAAAkT,EACA5U,EAAA0D,KAAAkR,EAAAzT,EAAAO,QACAP,EAAAO,MACAqT,GAAAzS,IAAA,GAAAzC,GAAAsB,EAAAU,aACAV,EAAAW,eACAJ,EACAoT,EACA3T,EAAAY,QAvGA,GAAAgT,GAAA,GAAAlV,GAMAmV,EAAAL,EAAApN,MAAAiN,GACAS,EAAA,EACAC,EAAA,WAMA,QAAAC,KACA,MAAAF,GAAAD,EAAA9R,OACA8R,EAAAC,KAAA/E,OAPA,GAAAkF,GAAAD,IAEAE,EAAAF,KAAA,EACA,OAAAC,GAAAC,GASAC,EAAA,EAAA7D,EAAA,EAKA8D,EAAA,IAgEA,OA9DAzU,GAAAI,YAAA,SAAAC,GACA,UAAAoU,EAAA,CAGA,KAAAD,EAAAnU,EAAAI,eAMS,CAIT,GAAAiU,GAAAR,EAAAC,IAAA,GACAH,EAAAU,EAAAnL,OAAA,EAAAlJ,EAAAM,gBACAgQ,EAOA,OANAuD,GAAAC,GAAAO,EAAAnL,OAAAlJ,EAAAM,gBACAgQ,GACAA,EAAAtQ,EAAAM,gBACAoT,EAAAU,EAAAT,QAEAS,EAAApU,GAhBA0T,EAAAU,EAAAL,KACAI,IACA7D,EAAA,EAqBA,KAAA6D,EAAAnU,EAAAI,eACAwT,EAAAzS,IAAA4S,KACAI,GAEA,IAAA7D,EAAAtQ,EAAAM,gBAAA,CACA,GAAA+T,GAAAR,EAAAC,IAAA,EACAF,GAAAzS,IAAAkT,EAAAnL,OAAA,EAAAlJ,EAAAM,kBACAuT,EAAAC,GAAAO,EAAAnL,OAAAlJ,EAAAM,iBACAgQ,EAAAtQ,EAAAM,gBAEA8T,EAAApU,GACKnC,MAELiW,EAAAD,EAAA9R,SACAqS,GAEAV,EAAAU,EAAAL,KAGAH,EAAAzS,IAAA0S,EAAAvL,OAAAwL,GAAAvR,KAAA,MAIA5C,EAAAmB,QAAAC,QAAA,SAAAC,GACA,GAAAI,GAAAzB,EAAA0B,iBAAAL,EACA,OAAAI,IACA,MAAAqS,IACAzS,EAAAnC,EAAA0D,KAAAkR,EAAAzS,IAEA4S,EAAAtS,iBAAAN,EAAAI,MAIAwS,GAwBAlV,EAAAc,UAAA2B,IAAA,SAAAmT,GACA,GAAArL,MAAAsL,QAAAD,GACAA,EAAAvT,QAAA,SAAAyT,GACA3W,KAAAsD,IAAAqT,IACK3W,UAEL,KAAAyW,EAAAlB,IAAA,gBAAAkB,GAMA,SAAAhO,WACA,8EAAAgO,EANAA,IACAzW,KAAAqV,SAAAzH,KAAA6I,GAQA,MAAAzW,OASAa,EAAAc,UAAAiV,QAAA,SAAAH,GACA,GAAArL,MAAAsL,QAAAD,GACA,OAAA3Q,GAAA2Q,EAAAvS,OAAA,EAAiC4B,GAAA,EAAQA,IACzC9F,KAAA4W,QAAAH,EAAA3Q,QAGA,KAAA2Q,EAAAlB,IAAA,gBAAAkB,GAIA,SAAAhO,WACA,8EAAAgO,EAJAzW,MAAAqV,SAAAwB,QAAAJ,GAOA,MAAAzW,OAUAa,EAAAc,UAAAmV,KAAA,SAAAC,GAEA,OADAJ,GACA7Q,EAAA,EAAAC,EAAA/F,KAAAqV,SAAAnR,OAA6C4B,EAAAC,EAASD,IACtD6Q,EAAA3W,KAAAqV,SAAAvP,GACA6Q,EAAApB,GACAoB,EAAAG,KAAAC,GAGA,KAAAJ,GACAI,EAAAJ,GAAoBjU,OAAA1C,KAAA0C,OACpBJ,KAAAtC,KAAAsC,KACAE,OAAAxC,KAAAwC,OACAO,KAAA/C,KAAA+C,QAYAlC,EAAAc,UAAA+C,KAAA,SAAAsS,GACA,GAAAC,GACAnR,EACAC,EAAA/F,KAAAqV,SAAAnR,MACA,IAAA6B,EAAA,GAEA,IADAkR,KACAnR,EAAA,EAAeA,EAAAC,EAAA,EAAWD,IAC1BmR,EAAArJ,KAAA5N,KAAAqV,SAAAvP,IACAmR,EAAArJ,KAAAoJ,EAEAC,GAAArJ,KAAA5N,KAAAqV,SAAAvP,IACA9F,KAAAqV,SAAA4B,EAEA,MAAAjX,OAUAa,EAAAc,UAAAuV,aAAA,SAAAC,EAAAC,GACA,GAAAC,GAAArX,KAAAqV,SAAArV,KAAAqV,SAAAnR,OAAA,EAUA,OATAmT,GAAA9B,GACA8B,EAAAH,aAAAC,EAAAC,GAEA,gBAAAC,GACArX,KAAAqV,SAAArV,KAAAqV,SAAAnR,OAAA,GAAAmT,EAAAtM,QAAAoM,EAAAC,GAGApX,KAAAqV,SAAAzH,KAAA,GAAA7C,QAAAoM,EAAAC,IAEApX,MAUAa,EAAAc,UAAA8B,iBACA,SAAAG,EAAAC,GACA7D,KAAAsV,eAAAtU,EAAAgD,YAAAJ,IAAAC,GASAhD,EAAAc,UAAA2V,mBACA,SAAAP,GACA,OAAAjR,GAAA,EAAAC,EAAA/F,KAAAqV,SAAAnR,OAA+C4B,EAAAC,EAASD,IACxD9F,KAAAqV,SAAAvP,GAAAyP,IACAvV,KAAAqV,SAAAvP,GAAAwR,mBAAAP,EAKA,QADA9T,GAAAa,OAAAG,KAAAjE,KAAAsV,gBACAxP,EAAA,EAAAC,EAAA9C,EAAAiB,OAAyC4B,EAAAC,EAASD,IAClDiR,EAAA/V,EAAAyK,cAAAxI,EAAA6C,IAAA9F,KAAAsV,eAAArS,EAAA6C,MAQAjF,EAAAc,UAAAkF,SAAA,WACA,GAAAwF,GAAA,EAIA,OAHArM,MAAA8W,KAAA,SAAAH,GACAtK,GAAAsK,IAEAtK,GAOAxL,EAAAc,UAAA4V,sBAAA,SAAAzW,GACA,GAAAuB,IACAyT,KAAA,GACAxT,KAAA,EACAE,OAAA,GAEA8D,EAAA,GAAA3F,GAAAG,GACA0W,GAAA,EACAC,EAAA,KACAC,EAAA,KACAC,EAAA,KACAC,EAAA,IAqEA,OApEA5X,MAAA8W,KAAA,SAAAH,EAAA/T,GACAP,EAAAyT,MAAAa,EACA,OAAA/T,EAAAF,QACA,OAAAE,EAAAN,MACA,OAAAM,EAAAJ,QACAiV,IAAA7U,EAAAF,QACAgV,IAAA9U,EAAAN,MACAqV,IAAA/U,EAAAJ,QACAoV,IAAAhV,EAAAG,MACAuD,EAAAtD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,OAGA0U,EAAA7U,EAAAF,OACAgV,EAAA9U,EAAAN,KACAqV,EAAA/U,EAAAJ,OACAoV,EAAAhV,EAAAG,KACAyU,GAAA,GACKA,IACLlR,EAAAtD,YACAX,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,UAGAiV,EAAA,KACAD,GAAA,EAEA,QAAA7J,GAAA,EAAAzJ,EAAAyS,EAAAzS,OAA4CyJ,EAAAzJ,EAAcyJ,IAC1DgJ,EAAAzO,WAAAyF,KAAA8H,GACApT,EAAAC,OACAD,EAAAG,OAAA,EAEAmL,EAAA,IAAAzJ,GACAuT,EAAA,KACAD,GAAA,GACSA,GACTlR,EAAAtD,YACAN,OAAAE,EAAAF,OACAE,UACAN,KAAAM,EAAAN,KACAE,OAAAI,EAAAJ,QAEAH,WACAC,KAAAD,EAAAC,KACAE,OAAAH,EAAAG,QAEAO,KAAAH,EAAAG,QAIAV,EAAAG,WAIAxC,KAAAsX,mBAAA,SAAAnU,EAAA0U,GACAvR,EAAA7C,iBAAAN,EAAA0U,MAGU/B,KAAAzT,EAAAyT,KAAAxP,QAGV1G,EAAAiB","file":"source-map.min.js","sourcesContent":["(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn \n\n\n// WEBPACK FOOTER //\n// webpack/universalModuleDefinition","(function webpackUniversalModuleDefinition(root, factory) {\n\tif(typeof exports === 'object' && typeof module === 'object')\n\t\tmodule.exports = factory();\n\telse if(typeof define === 'function' && define.amd)\n\t\tdefine([], factory);\n\telse if(typeof exports === 'object')\n\t\texports[\"sourceMap\"] = factory();\n\telse\n\t\troot[\"sourceMap\"] = factory();\n})(this, function() {\nreturn /******/ (function(modules) { // webpackBootstrap\n/******/ \t// The module cache\n/******/ \tvar installedModules = {};\n/******/\n/******/ \t// The require function\n/******/ \tfunction __webpack_require__(moduleId) {\n/******/\n/******/ \t\t// Check if module is in cache\n/******/ \t\tif(installedModules[moduleId])\n/******/ \t\t\treturn installedModules[moduleId].exports;\n/******/\n/******/ \t\t// Create a new module (and put it into the cache)\n/******/ \t\tvar module = installedModules[moduleId] = {\n/******/ \t\t\texports: {},\n/******/ \t\t\tid: moduleId,\n/******/ \t\t\tloaded: false\n/******/ \t\t};\n/******/\n/******/ \t\t// Execute the module function\n/******/ \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n/******/\n/******/ \t\t// Flag the module as loaded\n/******/ \t\tmodule.loaded = true;\n/******/\n/******/ \t\t// Return the exports of the module\n/******/ \t\treturn module.exports;\n/******/ \t}\n/******/\n/******/\n/******/ \t// expose the modules object (__webpack_modules__)\n/******/ \t__webpack_require__.m = modules;\n/******/\n/******/ \t// expose the module cache\n/******/ \t__webpack_require__.c = installedModules;\n/******/\n/******/ \t// __webpack_public_path__\n/******/ \t__webpack_require__.p = \"\";\n/******/\n/******/ \t// Load entry module and return exports\n/******/ \treturn __webpack_require__(0);\n/******/ })\n/************************************************************************/\n/******/ ([\n/* 0 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/*\n\t * Copyright 2009-2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE.txt or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\texports.SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\texports.SourceMapConsumer = __webpack_require__(7).SourceMapConsumer;\n\texports.SourceNode = __webpack_require__(10).SourceNode;\n\n\n/***/ }),\n/* 1 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar base64VLQ = __webpack_require__(2);\n\tvar util = __webpack_require__(4);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar MappingList = __webpack_require__(6).MappingList;\n\t\n\t/**\n\t * An instance of the SourceMapGenerator represents a source map which is\n\t * being built incrementally. You may pass an object with the following\n\t * properties:\n\t *\n\t * - file: The filename of the generated source.\n\t * - sourceRoot: A root for all relative URLs in this source map.\n\t */\n\tfunction SourceMapGenerator(aArgs) {\n\t if (!aArgs) {\n\t aArgs = {};\n\t }\n\t this._file = util.getArg(aArgs, 'file', null);\n\t this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n\t this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n\t this._sources = new ArraySet();\n\t this._names = new ArraySet();\n\t this._mappings = new MappingList();\n\t this._sourcesContents = null;\n\t}\n\t\n\tSourceMapGenerator.prototype._version = 3;\n\t\n\t/**\n\t * Creates a new SourceMapGenerator based on a SourceMapConsumer\n\t *\n\t * @param aSourceMapConsumer The SourceMap.\n\t */\n\tSourceMapGenerator.fromSourceMap =\n\t function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n\t var sourceRoot = aSourceMapConsumer.sourceRoot;\n\t var generator = new SourceMapGenerator({\n\t file: aSourceMapConsumer.file,\n\t sourceRoot: sourceRoot\n\t });\n\t aSourceMapConsumer.eachMapping(function (mapping) {\n\t var newMapping = {\n\t generated: {\n\t line: mapping.generatedLine,\n\t column: mapping.generatedColumn\n\t }\n\t };\n\t\n\t if (mapping.source != null) {\n\t newMapping.source = mapping.source;\n\t if (sourceRoot != null) {\n\t newMapping.source = util.relative(sourceRoot, newMapping.source);\n\t }\n\t\n\t newMapping.original = {\n\t line: mapping.originalLine,\n\t column: mapping.originalColumn\n\t };\n\t\n\t if (mapping.name != null) {\n\t newMapping.name = mapping.name;\n\t }\n\t }\n\t\n\t generator.addMapping(newMapping);\n\t });\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var sourceRelative = sourceFile;\n\t if (sourceRoot !== null) {\n\t sourceRelative = util.relative(sourceRoot, sourceFile);\n\t }\n\t\n\t if (!generator._sources.has(sourceRelative)) {\n\t generator._sources.add(sourceRelative);\n\t }\n\t\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t generator.setSourceContent(sourceFile, content);\n\t }\n\t });\n\t return generator;\n\t };\n\t\n\t/**\n\t * Add a single mapping from original source line and column to the generated\n\t * source's line and column for this source map being created. The mapping\n\t * object should have the following properties:\n\t *\n\t * - generated: An object with the generated line and column positions.\n\t * - original: An object with the original line and column positions.\n\t * - source: The original source file (relative to the sourceRoot).\n\t * - name: An optional original token name for this mapping.\n\t */\n\tSourceMapGenerator.prototype.addMapping =\n\t function SourceMapGenerator_addMapping(aArgs) {\n\t var generated = util.getArg(aArgs, 'generated');\n\t var original = util.getArg(aArgs, 'original', null);\n\t var source = util.getArg(aArgs, 'source', null);\n\t var name = util.getArg(aArgs, 'name', null);\n\t\n\t if (!this._skipValidation) {\n\t this._validateMapping(generated, original, source, name);\n\t }\n\t\n\t if (source != null) {\n\t source = String(source);\n\t if (!this._sources.has(source)) {\n\t this._sources.add(source);\n\t }\n\t }\n\t\n\t if (name != null) {\n\t name = String(name);\n\t if (!this._names.has(name)) {\n\t this._names.add(name);\n\t }\n\t }\n\t\n\t this._mappings.add({\n\t generatedLine: generated.line,\n\t generatedColumn: generated.column,\n\t originalLine: original != null && original.line,\n\t originalColumn: original != null && original.column,\n\t source: source,\n\t name: name\n\t });\n\t };\n\t\n\t/**\n\t * Set the source content for a source file.\n\t */\n\tSourceMapGenerator.prototype.setSourceContent =\n\t function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n\t var source = aSourceFile;\n\t if (this._sourceRoot != null) {\n\t source = util.relative(this._sourceRoot, source);\n\t }\n\t\n\t if (aSourceContent != null) {\n\t // Add the source content to the _sourcesContents map.\n\t // Create a new _sourcesContents map if the property is null.\n\t if (!this._sourcesContents) {\n\t this._sourcesContents = Object.create(null);\n\t }\n\t this._sourcesContents[util.toSetString(source)] = aSourceContent;\n\t } else if (this._sourcesContents) {\n\t // Remove the source file from the _sourcesContents map.\n\t // If the _sourcesContents map is empty, set the property to null.\n\t delete this._sourcesContents[util.toSetString(source)];\n\t if (Object.keys(this._sourcesContents).length === 0) {\n\t this._sourcesContents = null;\n\t }\n\t }\n\t };\n\t\n\t/**\n\t * Applies the mappings of a sub-source-map for a specific source file to the\n\t * source map being generated. Each mapping to the supplied source file is\n\t * rewritten using the supplied source map. Note: The resolution for the\n\t * resulting mappings is the minimium of this map and the supplied map.\n\t *\n\t * @param aSourceMapConsumer The source map to be applied.\n\t * @param aSourceFile Optional. The filename of the source file.\n\t * If omitted, SourceMapConsumer's file property will be used.\n\t * @param aSourceMapPath Optional. The dirname of the path to the source map\n\t * to be applied. If relative, it is relative to the SourceMapConsumer.\n\t * This parameter is needed when the two source maps aren't in the same\n\t * directory, and the source map to be applied contains relative source\n\t * paths. If so, those relative source paths need to be rewritten\n\t * relative to the SourceMapGenerator.\n\t */\n\tSourceMapGenerator.prototype.applySourceMap =\n\t function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n\t var sourceFile = aSourceFile;\n\t // If aSourceFile is omitted, we will use the file property of the SourceMap\n\t if (aSourceFile == null) {\n\t if (aSourceMapConsumer.file == null) {\n\t throw new Error(\n\t 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n\t 'or the source map\\'s \"file\" property. Both were omitted.'\n\t );\n\t }\n\t sourceFile = aSourceMapConsumer.file;\n\t }\n\t var sourceRoot = this._sourceRoot;\n\t // Make \"sourceFile\" relative if an absolute Url is passed.\n\t if (sourceRoot != null) {\n\t sourceFile = util.relative(sourceRoot, sourceFile);\n\t }\n\t // Applying the SourceMap can add and remove items from the sources and\n\t // the names array.\n\t var newSources = new ArraySet();\n\t var newNames = new ArraySet();\n\t\n\t // Find mappings for the \"sourceFile\"\n\t this._mappings.unsortedForEach(function (mapping) {\n\t if (mapping.source === sourceFile && mapping.originalLine != null) {\n\t // Check if it can be mapped by the source map, then update the mapping.\n\t var original = aSourceMapConsumer.originalPositionFor({\n\t line: mapping.originalLine,\n\t column: mapping.originalColumn\n\t });\n\t if (original.source != null) {\n\t // Copy mapping\n\t mapping.source = original.source;\n\t if (aSourceMapPath != null) {\n\t mapping.source = util.join(aSourceMapPath, mapping.source)\n\t }\n\t if (sourceRoot != null) {\n\t mapping.source = util.relative(sourceRoot, mapping.source);\n\t }\n\t mapping.originalLine = original.line;\n\t mapping.originalColumn = original.column;\n\t if (original.name != null) {\n\t mapping.name = original.name;\n\t }\n\t }\n\t }\n\t\n\t var source = mapping.source;\n\t if (source != null && !newSources.has(source)) {\n\t newSources.add(source);\n\t }\n\t\n\t var name = mapping.name;\n\t if (name != null && !newNames.has(name)) {\n\t newNames.add(name);\n\t }\n\t\n\t }, this);\n\t this._sources = newSources;\n\t this._names = newNames;\n\t\n\t // Copy sourcesContents of applied map.\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t if (aSourceMapPath != null) {\n\t sourceFile = util.join(aSourceMapPath, sourceFile);\n\t }\n\t if (sourceRoot != null) {\n\t sourceFile = util.relative(sourceRoot, sourceFile);\n\t }\n\t this.setSourceContent(sourceFile, content);\n\t }\n\t }, this);\n\t };\n\t\n\t/**\n\t * A mapping can have one of the three levels of data:\n\t *\n\t * 1. Just the generated position.\n\t * 2. The Generated position, original position, and original source.\n\t * 3. Generated and original position, original source, as well as a name\n\t * token.\n\t *\n\t * To maintain consistency, we validate that any new mapping being added falls\n\t * in to one of these categories.\n\t */\n\tSourceMapGenerator.prototype._validateMapping =\n\t function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n\t aName) {\n\t // When aOriginal is truthy but has empty values for .line and .column,\n\t // it is most likely a programmer error. In this case we throw a very\n\t // specific error message to try to guide them the right way.\n\t // For example: https://github.com/Polymer/polymer-bundler/pull/519\n\t if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n\t throw new Error(\n\t 'original.line and original.column are not numbers -- you probably meant to omit ' +\n\t 'the original mapping entirely and only map the generated position. If so, pass ' +\n\t 'null for the original mapping instead of an object with empty or null values.'\n\t );\n\t }\n\t\n\t if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t && aGenerated.line > 0 && aGenerated.column >= 0\n\t && !aOriginal && !aSource && !aName) {\n\t // Case 1.\n\t return;\n\t }\n\t else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n\t && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n\t && aGenerated.line > 0 && aGenerated.column >= 0\n\t && aOriginal.line > 0 && aOriginal.column >= 0\n\t && aSource) {\n\t // Cases 2 and 3.\n\t return;\n\t }\n\t else {\n\t throw new Error('Invalid mapping: ' + JSON.stringify({\n\t generated: aGenerated,\n\t source: aSource,\n\t original: aOriginal,\n\t name: aName\n\t }));\n\t }\n\t };\n\t\n\t/**\n\t * Serialize the accumulated mappings in to the stream of base 64 VLQs\n\t * specified by the source map format.\n\t */\n\tSourceMapGenerator.prototype._serializeMappings =\n\t function SourceMapGenerator_serializeMappings() {\n\t var previousGeneratedColumn = 0;\n\t var previousGeneratedLine = 1;\n\t var previousOriginalColumn = 0;\n\t var previousOriginalLine = 0;\n\t var previousName = 0;\n\t var previousSource = 0;\n\t var result = '';\n\t var next;\n\t var mapping;\n\t var nameIdx;\n\t var sourceIdx;\n\t\n\t var mappings = this._mappings.toArray();\n\t for (var i = 0, len = mappings.length; i < len; i++) {\n\t mapping = mappings[i];\n\t next = ''\n\t\n\t if (mapping.generatedLine !== previousGeneratedLine) {\n\t previousGeneratedColumn = 0;\n\t while (mapping.generatedLine !== previousGeneratedLine) {\n\t next += ';';\n\t previousGeneratedLine++;\n\t }\n\t }\n\t else {\n\t if (i > 0) {\n\t if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n\t continue;\n\t }\n\t next += ',';\n\t }\n\t }\n\t\n\t next += base64VLQ.encode(mapping.generatedColumn\n\t - previousGeneratedColumn);\n\t previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t if (mapping.source != null) {\n\t sourceIdx = this._sources.indexOf(mapping.source);\n\t next += base64VLQ.encode(sourceIdx - previousSource);\n\t previousSource = sourceIdx;\n\t\n\t // lines are stored 0-based in SourceMap spec version 3\n\t next += base64VLQ.encode(mapping.originalLine - 1\n\t - previousOriginalLine);\n\t previousOriginalLine = mapping.originalLine - 1;\n\t\n\t next += base64VLQ.encode(mapping.originalColumn\n\t - previousOriginalColumn);\n\t previousOriginalColumn = mapping.originalColumn;\n\t\n\t if (mapping.name != null) {\n\t nameIdx = this._names.indexOf(mapping.name);\n\t next += base64VLQ.encode(nameIdx - previousName);\n\t previousName = nameIdx;\n\t }\n\t }\n\t\n\t result += next;\n\t }\n\t\n\t return result;\n\t };\n\t\n\tSourceMapGenerator.prototype._generateSourcesContent =\n\t function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n\t return aSources.map(function (source) {\n\t if (!this._sourcesContents) {\n\t return null;\n\t }\n\t if (aSourceRoot != null) {\n\t source = util.relative(aSourceRoot, source);\n\t }\n\t var key = util.toSetString(source);\n\t return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n\t ? this._sourcesContents[key]\n\t : null;\n\t }, this);\n\t };\n\t\n\t/**\n\t * Externalize the source map.\n\t */\n\tSourceMapGenerator.prototype.toJSON =\n\t function SourceMapGenerator_toJSON() {\n\t var map = {\n\t version: this._version,\n\t sources: this._sources.toArray(),\n\t names: this._names.toArray(),\n\t mappings: this._serializeMappings()\n\t };\n\t if (this._file != null) {\n\t map.file = this._file;\n\t }\n\t if (this._sourceRoot != null) {\n\t map.sourceRoot = this._sourceRoot;\n\t }\n\t if (this._sourcesContents) {\n\t map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n\t }\n\t\n\t return map;\n\t };\n\t\n\t/**\n\t * Render the source map being generated to a string.\n\t */\n\tSourceMapGenerator.prototype.toString =\n\t function SourceMapGenerator_toString() {\n\t return JSON.stringify(this.toJSON());\n\t };\n\t\n\texports.SourceMapGenerator = SourceMapGenerator;\n\n\n/***/ }),\n/* 2 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t *\n\t * Based on the Base 64 VLQ implementation in Closure Compiler:\n\t * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n\t *\n\t * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n\t * Redistribution and use in source and binary forms, with or without\n\t * modification, are permitted provided that the following conditions are\n\t * met:\n\t *\n\t * * Redistributions of source code must retain the above copyright\n\t * notice, this list of conditions and the following disclaimer.\n\t * * Redistributions in binary form must reproduce the above\n\t * copyright notice, this list of conditions and the following\n\t * disclaimer in the documentation and/or other materials provided\n\t * with the distribution.\n\t * * Neither the name of Google Inc. nor the names of its\n\t * contributors may be used to endorse or promote products derived\n\t * from this software without specific prior written permission.\n\t *\n\t * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n\t * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n\t * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n\t * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n\t * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n\t * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n\t * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n\t * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n\t * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n\t * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n\t * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n\t */\n\t\n\tvar base64 = __webpack_require__(3);\n\t\n\t// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n\t// length quantities we use in the source map spec, the first bit is the sign,\n\t// the next four bits are the actual value, and the 6th bit is the\n\t// continuation bit. The continuation bit tells us whether there are more\n\t// digits in this value following this digit.\n\t//\n\t// Continuation\n\t// | Sign\n\t// | |\n\t// V V\n\t// 101011\n\t\n\tvar VLQ_BASE_SHIFT = 5;\n\t\n\t// binary: 100000\n\tvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\t\n\t// binary: 011111\n\tvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\t\n\t// binary: 100000\n\tvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\t\n\t/**\n\t * Converts from a two-complement value to a value where the sign bit is\n\t * placed in the least significant bit. For example, as decimals:\n\t * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n\t * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n\t */\n\tfunction toVLQSigned(aValue) {\n\t return aValue < 0\n\t ? ((-aValue) << 1) + 1\n\t : (aValue << 1) + 0;\n\t}\n\t\n\t/**\n\t * Converts to a two-complement value from a value where the sign bit is\n\t * placed in the least significant bit. For example, as decimals:\n\t * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n\t * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n\t */\n\tfunction fromVLQSigned(aValue) {\n\t var isNegative = (aValue & 1) === 1;\n\t var shifted = aValue >> 1;\n\t return isNegative\n\t ? -shifted\n\t : shifted;\n\t}\n\t\n\t/**\n\t * Returns the base 64 VLQ encoded value.\n\t */\n\texports.encode = function base64VLQ_encode(aValue) {\n\t var encoded = \"\";\n\t var digit;\n\t\n\t var vlq = toVLQSigned(aValue);\n\t\n\t do {\n\t digit = vlq & VLQ_BASE_MASK;\n\t vlq >>>= VLQ_BASE_SHIFT;\n\t if (vlq > 0) {\n\t // There are still more digits in this value, so we must make sure the\n\t // continuation bit is marked.\n\t digit |= VLQ_CONTINUATION_BIT;\n\t }\n\t encoded += base64.encode(digit);\n\t } while (vlq > 0);\n\t\n\t return encoded;\n\t};\n\t\n\t/**\n\t * Decodes the next base 64 VLQ value from the given string and returns the\n\t * value and the rest of the string via the out parameter.\n\t */\n\texports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n\t var strLen = aStr.length;\n\t var result = 0;\n\t var shift = 0;\n\t var continuation, digit;\n\t\n\t do {\n\t if (aIndex >= strLen) {\n\t throw new Error(\"Expected more digits in base 64 VLQ value.\");\n\t }\n\t\n\t digit = base64.decode(aStr.charCodeAt(aIndex++));\n\t if (digit === -1) {\n\t throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n\t }\n\t\n\t continuation = !!(digit & VLQ_CONTINUATION_BIT);\n\t digit &= VLQ_BASE_MASK;\n\t result = result + (digit << shift);\n\t shift += VLQ_BASE_SHIFT;\n\t } while (continuation);\n\t\n\t aOutParam.value = fromVLQSigned(result);\n\t aOutParam.rest = aIndex;\n\t};\n\n\n/***/ }),\n/* 3 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\t\n\t/**\n\t * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n\t */\n\texports.encode = function (number) {\n\t if (0 <= number && number < intToCharMap.length) {\n\t return intToCharMap[number];\n\t }\n\t throw new TypeError(\"Must be between 0 and 63: \" + number);\n\t};\n\t\n\t/**\n\t * Decode a single base 64 character code digit to an integer. Returns -1 on\n\t * failure.\n\t */\n\texports.decode = function (charCode) {\n\t var bigA = 65; // 'A'\n\t var bigZ = 90; // 'Z'\n\t\n\t var littleA = 97; // 'a'\n\t var littleZ = 122; // 'z'\n\t\n\t var zero = 48; // '0'\n\t var nine = 57; // '9'\n\t\n\t var plus = 43; // '+'\n\t var slash = 47; // '/'\n\t\n\t var littleOffset = 26;\n\t var numberOffset = 52;\n\t\n\t // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n\t if (bigA <= charCode && charCode <= bigZ) {\n\t return (charCode - bigA);\n\t }\n\t\n\t // 26 - 51: abcdefghijklmnopqrstuvwxyz\n\t if (littleA <= charCode && charCode <= littleZ) {\n\t return (charCode - littleA + littleOffset);\n\t }\n\t\n\t // 52 - 61: 0123456789\n\t if (zero <= charCode && charCode <= nine) {\n\t return (charCode - zero + numberOffset);\n\t }\n\t\n\t // 62: +\n\t if (charCode == plus) {\n\t return 62;\n\t }\n\t\n\t // 63: /\n\t if (charCode == slash) {\n\t return 63;\n\t }\n\t\n\t // Invalid base64 digit.\n\t return -1;\n\t};\n\n\n/***/ }),\n/* 4 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t/**\n\t * This is a helper function for getting values from parameter/options\n\t * objects.\n\t *\n\t * @param args The object we are extracting values from\n\t * @param name The name of the property we are getting.\n\t * @param defaultValue An optional value to return if the property is missing\n\t * from the object. If this is not specified and the property is missing, an\n\t * error will be thrown.\n\t */\n\tfunction getArg(aArgs, aName, aDefaultValue) {\n\t if (aName in aArgs) {\n\t return aArgs[aName];\n\t } else if (arguments.length === 3) {\n\t return aDefaultValue;\n\t } else {\n\t throw new Error('\"' + aName + '\" is a required argument.');\n\t }\n\t}\n\texports.getArg = getArg;\n\t\n\tvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.-]*)(?::(\\d+))?(.*)$/;\n\tvar dataUrlRegexp = /^data:.+\\,.+$/;\n\t\n\tfunction urlParse(aUrl) {\n\t var match = aUrl.match(urlRegexp);\n\t if (!match) {\n\t return null;\n\t }\n\t return {\n\t scheme: match[1],\n\t auth: match[2],\n\t host: match[3],\n\t port: match[4],\n\t path: match[5]\n\t };\n\t}\n\texports.urlParse = urlParse;\n\t\n\tfunction urlGenerate(aParsedUrl) {\n\t var url = '';\n\t if (aParsedUrl.scheme) {\n\t url += aParsedUrl.scheme + ':';\n\t }\n\t url += '//';\n\t if (aParsedUrl.auth) {\n\t url += aParsedUrl.auth + '@';\n\t }\n\t if (aParsedUrl.host) {\n\t url += aParsedUrl.host;\n\t }\n\t if (aParsedUrl.port) {\n\t url += \":\" + aParsedUrl.port\n\t }\n\t if (aParsedUrl.path) {\n\t url += aParsedUrl.path;\n\t }\n\t return url;\n\t}\n\texports.urlGenerate = urlGenerate;\n\t\n\t/**\n\t * Normalizes a path, or the path portion of a URL:\n\t *\n\t * - Replaces consecutive slashes with one slash.\n\t * - Removes unnecessary '.' parts.\n\t * - Removes unnecessary '<dir>/..' parts.\n\t *\n\t * Based on code in the Node.js 'path' core module.\n\t *\n\t * @param aPath The path or url to normalize.\n\t */\n\tfunction normalize(aPath) {\n\t var path = aPath;\n\t var url = urlParse(aPath);\n\t if (url) {\n\t if (!url.path) {\n\t return aPath;\n\t }\n\t path = url.path;\n\t }\n\t var isAbsolute = exports.isAbsolute(path);\n\t\n\t var parts = path.split(/\\/+/);\n\t for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n\t part = parts[i];\n\t if (part === '.') {\n\t parts.splice(i, 1);\n\t } else if (part === '..') {\n\t up++;\n\t } else if (up > 0) {\n\t if (part === '') {\n\t // The first part is blank if the path is absolute. Trying to go\n\t // above the root is a no-op. Therefore we can remove all '..' parts\n\t // directly after the root.\n\t parts.splice(i + 1, up);\n\t up = 0;\n\t } else {\n\t parts.splice(i, 2);\n\t up--;\n\t }\n\t }\n\t }\n\t path = parts.join('/');\n\t\n\t if (path === '') {\n\t path = isAbsolute ? '/' : '.';\n\t }\n\t\n\t if (url) {\n\t url.path = path;\n\t return urlGenerate(url);\n\t }\n\t return path;\n\t}\n\texports.normalize = normalize;\n\t\n\t/**\n\t * Joins two paths/URLs.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be joined with the root.\n\t *\n\t * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n\t * scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n\t * first.\n\t * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n\t * is updated with the result and aRoot is returned. Otherwise the result\n\t * is returned.\n\t * - If aPath is absolute, the result is aPath.\n\t * - Otherwise the two paths are joined with a slash.\n\t * - Joining for example 'http://' and 'www.example.com' is also supported.\n\t */\n\tfunction join(aRoot, aPath) {\n\t if (aRoot === \"\") {\n\t aRoot = \".\";\n\t }\n\t if (aPath === \"\") {\n\t aPath = \".\";\n\t }\n\t var aPathUrl = urlParse(aPath);\n\t var aRootUrl = urlParse(aRoot);\n\t if (aRootUrl) {\n\t aRoot = aRootUrl.path || '/';\n\t }\n\t\n\t // `join(foo, '//www.example.org')`\n\t if (aPathUrl && !aPathUrl.scheme) {\n\t if (aRootUrl) {\n\t aPathUrl.scheme = aRootUrl.scheme;\n\t }\n\t return urlGenerate(aPathUrl);\n\t }\n\t\n\t if (aPathUrl || aPath.match(dataUrlRegexp)) {\n\t return aPath;\n\t }\n\t\n\t // `join('http://', 'www.example.com')`\n\t if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n\t aRootUrl.host = aPath;\n\t return urlGenerate(aRootUrl);\n\t }\n\t\n\t var joined = aPath.charAt(0) === '/'\n\t ? aPath\n\t : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\t\n\t if (aRootUrl) {\n\t aRootUrl.path = joined;\n\t return urlGenerate(aRootUrl);\n\t }\n\t return joined;\n\t}\n\texports.join = join;\n\t\n\texports.isAbsolute = function (aPath) {\n\t return aPath.charAt(0) === '/' || urlRegexp.test(aPath);\n\t};\n\t\n\t/**\n\t * Make a path relative to a URL or another path.\n\t *\n\t * @param aRoot The root path or URL.\n\t * @param aPath The path or URL to be made relative to aRoot.\n\t */\n\tfunction relative(aRoot, aPath) {\n\t if (aRoot === \"\") {\n\t aRoot = \".\";\n\t }\n\t\n\t aRoot = aRoot.replace(/\\/$/, '');\n\t\n\t // It is possible for the path to be above the root. In this case, simply\n\t // checking whether the root is a prefix of the path won't work. Instead, we\n\t // need to remove components from the root one by one, until either we find\n\t // a prefix that fits, or we run out of components to remove.\n\t var level = 0;\n\t while (aPath.indexOf(aRoot + '/') !== 0) {\n\t var index = aRoot.lastIndexOf(\"/\");\n\t if (index < 0) {\n\t return aPath;\n\t }\n\t\n\t // If the only part of the root that is left is the scheme (i.e. http://,\n\t // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n\t // have exhausted all components, so the path is not relative to the root.\n\t aRoot = aRoot.slice(0, index);\n\t if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n\t return aPath;\n\t }\n\t\n\t ++level;\n\t }\n\t\n\t // Make sure we add a \"../\" for each component we removed from the root.\n\t return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n\t}\n\texports.relative = relative;\n\t\n\tvar supportsNullProto = (function () {\n\t var obj = Object.create(null);\n\t return !('__proto__' in obj);\n\t}());\n\t\n\tfunction identity (s) {\n\t return s;\n\t}\n\t\n\t/**\n\t * Because behavior goes wacky when you set `__proto__` on objects, we\n\t * have to prefix all the strings in our set with an arbitrary character.\n\t *\n\t * See https://github.com/mozilla/source-map/pull/31 and\n\t * https://github.com/mozilla/source-map/issues/30\n\t *\n\t * @param String aStr\n\t */\n\tfunction toSetString(aStr) {\n\t if (isProtoString(aStr)) {\n\t return '$' + aStr;\n\t }\n\t\n\t return aStr;\n\t}\n\texports.toSetString = supportsNullProto ? identity : toSetString;\n\t\n\tfunction fromSetString(aStr) {\n\t if (isProtoString(aStr)) {\n\t return aStr.slice(1);\n\t }\n\t\n\t return aStr;\n\t}\n\texports.fromSetString = supportsNullProto ? identity : fromSetString;\n\t\n\tfunction isProtoString(s) {\n\t if (!s) {\n\t return false;\n\t }\n\t\n\t var length = s.length;\n\t\n\t if (length < 9 /* \"__proto__\".length */) {\n\t return false;\n\t }\n\t\n\t if (s.charCodeAt(length - 1) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 2) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n\t s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n\t s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n\t s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n\t s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n\t s.charCodeAt(length - 8) !== 95 /* '_' */ ||\n\t s.charCodeAt(length - 9) !== 95 /* '_' */) {\n\t return false;\n\t }\n\t\n\t for (var i = length - 10; i >= 0; i--) {\n\t if (s.charCodeAt(i) !== 36 /* '$' */) {\n\t return false;\n\t }\n\t }\n\t\n\t return true;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings where the original positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same original source/line/column, but different generated\n\t * line and column the same. Useful when searching for a mapping with a\n\t * stubbed out mapping.\n\t */\n\tfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n\t var cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0 || onlyCompareOriginal) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByOriginalPositions = compareByOriginalPositions;\n\t\n\t/**\n\t * Comparator between two mappings with deflated source and name indices where\n\t * the generated positions are compared.\n\t *\n\t * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n\t * mappings with the same generated line and column, but different\n\t * source/name/original line and column the same. Useful when searching for a\n\t * mapping with a stubbed out mapping.\n\t */\n\tfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n\t var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0 || onlyCompareGenerated) {\n\t return cmp;\n\t }\n\t\n\t cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\t\n\tfunction strcmp(aStr1, aStr2) {\n\t if (aStr1 === aStr2) {\n\t return 0;\n\t }\n\t\n\t if (aStr1 === null) {\n\t return 1; // aStr2 !== null\n\t }\n\t\n\t if (aStr2 === null) {\n\t return -1; // aStr1 !== null\n\t }\n\t\n\t if (aStr1 > aStr2) {\n\t return 1;\n\t }\n\t\n\t return -1;\n\t}\n\t\n\t/**\n\t * Comparator between two mappings with inflated source and name strings where\n\t * the generated positions are compared.\n\t */\n\tfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n\t var cmp = mappingA.generatedLine - mappingB.generatedLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = strcmp(mappingA.source, mappingB.source);\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalLine - mappingB.originalLine;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t cmp = mappingA.originalColumn - mappingB.originalColumn;\n\t if (cmp !== 0) {\n\t return cmp;\n\t }\n\t\n\t return strcmp(mappingA.name, mappingB.name);\n\t}\n\texports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\t\n\t/**\n\t * Strip any JSON XSSI avoidance prefix from the string (as documented\n\t * in the source maps specification), and then parse the string as\n\t * JSON.\n\t */\n\tfunction parseSourceMapInput(str) {\n\t return JSON.parse(str.replace(/^\\)]}'[^\\n]*\\n/, ''));\n\t}\n\texports.parseSourceMapInput = parseSourceMapInput;\n\t\n\t/**\n\t * Compute the URL of a source given the the source root, the source's\n\t * URL, and the source map's URL.\n\t */\n\tfunction computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {\n\t sourceURL = sourceURL || '';\n\t\n\t if (sourceRoot) {\n\t // This follows what Chrome does.\n\t if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {\n\t sourceRoot += '/';\n\t }\n\t // The spec says:\n\t // Line 4: An optional source root, useful for relocating source\n\t // files on a server or removing repeated values in the\n\t // “sources” entry. This value is prepended to the individual\n\t // entries in the “source” field.\n\t sourceURL = sourceRoot + sourceURL;\n\t }\n\t\n\t // Historically, SourceMapConsumer did not take the sourceMapURL as\n\t // a parameter. This mode is still somewhat supported, which is why\n\t // this code block is conditional. However, it's preferable to pass\n\t // the source map URL to SourceMapConsumer, so that this function\n\t // can implement the source URL resolution algorithm as outlined in\n\t // the spec. This block is basically the equivalent of:\n\t // new URL(sourceURL, sourceMapURL).toString()\n\t // ... except it avoids using URL, which wasn't available in the\n\t // older releases of node still supported by this library.\n\t //\n\t // The spec says:\n\t // If the sources are not absolute URLs after prepending of the\n\t // “sourceRoot”, the sources are resolved relative to the\n\t // SourceMap (like resolving script src in a html document).\n\t if (sourceMapURL) {\n\t var parsed = urlParse(sourceMapURL);\n\t if (!parsed) {\n\t throw new Error(\"sourceMapURL could not be parsed\");\n\t }\n\t if (parsed.path) {\n\t // Strip the last path component, but keep the \"/\".\n\t var index = parsed.path.lastIndexOf('/');\n\t if (index >= 0) {\n\t parsed.path = parsed.path.substring(0, index + 1);\n\t }\n\t }\n\t sourceURL = join(urlGenerate(parsed), sourceURL);\n\t }\n\t\n\t return normalize(sourceURL);\n\t}\n\texports.computeSourceURL = computeSourceURL;\n\n\n/***/ }),\n/* 5 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar has = Object.prototype.hasOwnProperty;\n\tvar hasNativeMap = typeof Map !== \"undefined\";\n\t\n\t/**\n\t * A data structure which is a combination of an array and a set. Adding a new\n\t * member is O(1), testing for membership is O(1), and finding the index of an\n\t * element is O(1). Removing elements from the set is not supported. Only\n\t * strings are supported for membership.\n\t */\n\tfunction ArraySet() {\n\t this._array = [];\n\t this._set = hasNativeMap ? new Map() : Object.create(null);\n\t}\n\t\n\t/**\n\t * Static method for creating ArraySet instances from an existing array.\n\t */\n\tArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n\t var set = new ArraySet();\n\t for (var i = 0, len = aArray.length; i < len; i++) {\n\t set.add(aArray[i], aAllowDuplicates);\n\t }\n\t return set;\n\t};\n\t\n\t/**\n\t * Return how many unique items are in this ArraySet. If duplicates have been\n\t * added, than those do not count towards the size.\n\t *\n\t * @returns Number\n\t */\n\tArraySet.prototype.size = function ArraySet_size() {\n\t return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n\t};\n\t\n\t/**\n\t * Add the given string to this set.\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n\t var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n\t var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n\t var idx = this._array.length;\n\t if (!isDuplicate || aAllowDuplicates) {\n\t this._array.push(aStr);\n\t }\n\t if (!isDuplicate) {\n\t if (hasNativeMap) {\n\t this._set.set(aStr, idx);\n\t } else {\n\t this._set[sStr] = idx;\n\t }\n\t }\n\t};\n\t\n\t/**\n\t * Is the given string a member of this set?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.has = function ArraySet_has(aStr) {\n\t if (hasNativeMap) {\n\t return this._set.has(aStr);\n\t } else {\n\t var sStr = util.toSetString(aStr);\n\t return has.call(this._set, sStr);\n\t }\n\t};\n\t\n\t/**\n\t * What is the index of the given string in the array?\n\t *\n\t * @param String aStr\n\t */\n\tArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n\t if (hasNativeMap) {\n\t var idx = this._set.get(aStr);\n\t if (idx >= 0) {\n\t return idx;\n\t }\n\t } else {\n\t var sStr = util.toSetString(aStr);\n\t if (has.call(this._set, sStr)) {\n\t return this._set[sStr];\n\t }\n\t }\n\t\n\t throw new Error('\"' + aStr + '\" is not in the set.');\n\t};\n\t\n\t/**\n\t * What is the element at the given index?\n\t *\n\t * @param Number aIdx\n\t */\n\tArraySet.prototype.at = function ArraySet_at(aIdx) {\n\t if (aIdx >= 0 && aIdx < this._array.length) {\n\t return this._array[aIdx];\n\t }\n\t throw new Error('No element indexed by ' + aIdx);\n\t};\n\t\n\t/**\n\t * Returns the array representation of this set (which has the proper indices\n\t * indicated by indexOf). Note that this is a copy of the internal array used\n\t * for storing the members so that no one can mess with internal state.\n\t */\n\tArraySet.prototype.toArray = function ArraySet_toArray() {\n\t return this._array.slice();\n\t};\n\t\n\texports.ArraySet = ArraySet;\n\n\n/***/ }),\n/* 6 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2014 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\t\n\t/**\n\t * Determine whether mappingB is after mappingA with respect to generated\n\t * position.\n\t */\n\tfunction generatedPositionAfter(mappingA, mappingB) {\n\t // Optimized for most common case\n\t var lineA = mappingA.generatedLine;\n\t var lineB = mappingB.generatedLine;\n\t var columnA = mappingA.generatedColumn;\n\t var columnB = mappingB.generatedColumn;\n\t return lineB > lineA || lineB == lineA && columnB >= columnA ||\n\t util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n\t}\n\t\n\t/**\n\t * A data structure to provide a sorted view of accumulated mappings in a\n\t * performance conscious manner. It trades a neglibable overhead in general\n\t * case for a large speedup in case of mappings being added in order.\n\t */\n\tfunction MappingList() {\n\t this._array = [];\n\t this._sorted = true;\n\t // Serves as infimum\n\t this._last = {generatedLine: -1, generatedColumn: 0};\n\t}\n\t\n\t/**\n\t * Iterate through internal items. This method takes the same arguments that\n\t * `Array.prototype.forEach` takes.\n\t *\n\t * NOTE: The order of the mappings is NOT guaranteed.\n\t */\n\tMappingList.prototype.unsortedForEach =\n\t function MappingList_forEach(aCallback, aThisArg) {\n\t this._array.forEach(aCallback, aThisArg);\n\t };\n\t\n\t/**\n\t * Add the given source mapping.\n\t *\n\t * @param Object aMapping\n\t */\n\tMappingList.prototype.add = function MappingList_add(aMapping) {\n\t if (generatedPositionAfter(this._last, aMapping)) {\n\t this._last = aMapping;\n\t this._array.push(aMapping);\n\t } else {\n\t this._sorted = false;\n\t this._array.push(aMapping);\n\t }\n\t};\n\t\n\t/**\n\t * Returns the flat, sorted array of mappings. The mappings are sorted by\n\t * generated position.\n\t *\n\t * WARNING: This method returns internal data without copying, for\n\t * performance. The return value must NOT be mutated, and should be treated as\n\t * an immutable borrow. If you want to take ownership, you must make your own\n\t * copy.\n\t */\n\tMappingList.prototype.toArray = function MappingList_toArray() {\n\t if (!this._sorted) {\n\t this._array.sort(util.compareByGeneratedPositionsInflated);\n\t this._sorted = true;\n\t }\n\t return this._array;\n\t};\n\t\n\texports.MappingList = MappingList;\n\n\n/***/ }),\n/* 7 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar util = __webpack_require__(4);\n\tvar binarySearch = __webpack_require__(8);\n\tvar ArraySet = __webpack_require__(5).ArraySet;\n\tvar base64VLQ = __webpack_require__(2);\n\tvar quickSort = __webpack_require__(9).quickSort;\n\t\n\tfunction SourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t return sourceMap.sections != null\n\t ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL)\n\t : new BasicSourceMapConsumer(sourceMap, aSourceMapURL);\n\t}\n\t\n\tSourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) {\n\t return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL);\n\t}\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tSourceMapConsumer.prototype._version = 3;\n\t\n\t// `__generatedMappings` and `__originalMappings` are arrays that hold the\n\t// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n\t// are lazily instantiated, accessed via the `_generatedMappings` and\n\t// `_originalMappings` getters respectively, and we only parse the mappings\n\t// and create these arrays once queried for a source location. We jump through\n\t// these hoops because there can be many thousands of mappings, and parsing\n\t// them is expensive, so we only want to do it if we must.\n\t//\n\t// Each object in the arrays is of the form:\n\t//\n\t// {\n\t// generatedLine: The line number in the generated code,\n\t// generatedColumn: The column number in the generated code,\n\t// source: The path to the original source file that generated this\n\t// chunk of code,\n\t// originalLine: The line number in the original source that\n\t// corresponds to this chunk of generated code,\n\t// originalColumn: The column number in the original source that\n\t// corresponds to this chunk of generated code,\n\t// name: The name of the original symbol which generated this chunk of\n\t// code.\n\t// }\n\t//\n\t// All properties except for `generatedLine` and `generatedColumn` can be\n\t// `null`.\n\t//\n\t// `_generatedMappings` is ordered by the generated positions.\n\t//\n\t// `_originalMappings` is ordered by the original positions.\n\t\n\tSourceMapConsumer.prototype.__generatedMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n\t configurable: true,\n\t enumerable: true,\n\t get: function () {\n\t if (!this.__generatedMappings) {\n\t this._parseMappings(this._mappings, this.sourceRoot);\n\t }\n\t\n\t return this.__generatedMappings;\n\t }\n\t});\n\t\n\tSourceMapConsumer.prototype.__originalMappings = null;\n\tObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n\t configurable: true,\n\t enumerable: true,\n\t get: function () {\n\t if (!this.__originalMappings) {\n\t this._parseMappings(this._mappings, this.sourceRoot);\n\t }\n\t\n\t return this.__originalMappings;\n\t }\n\t});\n\t\n\tSourceMapConsumer.prototype._charIsMappingSeparator =\n\t function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n\t var c = aStr.charAt(index);\n\t return c === \";\" || c === \",\";\n\t };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tSourceMapConsumer.prototype._parseMappings =\n\t function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t throw new Error(\"Subclasses must implement _parseMappings\");\n\t };\n\t\n\tSourceMapConsumer.GENERATED_ORDER = 1;\n\tSourceMapConsumer.ORIGINAL_ORDER = 2;\n\t\n\tSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\n\tSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Iterate over each mapping between an original source/line/column and a\n\t * generated line/column in this source map.\n\t *\n\t * @param Function aCallback\n\t * The function that is called with each mapping.\n\t * @param Object aContext\n\t * Optional. If specified, this object will be the value of `this` every\n\t * time that `aCallback` is called.\n\t * @param aOrder\n\t * Either `SourceMapConsumer.GENERATED_ORDER` or\n\t * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n\t * iterate over the mappings sorted by the generated file's line/column\n\t * order or the original's source/line/column order, respectively. Defaults to\n\t * `SourceMapConsumer.GENERATED_ORDER`.\n\t */\n\tSourceMapConsumer.prototype.eachMapping =\n\t function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n\t var context = aContext || null;\n\t var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\t\n\t var mappings;\n\t switch (order) {\n\t case SourceMapConsumer.GENERATED_ORDER:\n\t mappings = this._generatedMappings;\n\t break;\n\t case SourceMapConsumer.ORIGINAL_ORDER:\n\t mappings = this._originalMappings;\n\t break;\n\t default:\n\t throw new Error(\"Unknown order of iteration.\");\n\t }\n\t\n\t var sourceRoot = this.sourceRoot;\n\t mappings.map(function (mapping) {\n\t var source = mapping.source === null ? null : this._sources.at(mapping.source);\n\t source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL);\n\t return {\n\t source: source,\n\t generatedLine: mapping.generatedLine,\n\t generatedColumn: mapping.generatedColumn,\n\t originalLine: mapping.originalLine,\n\t originalColumn: mapping.originalColumn,\n\t name: mapping.name === null ? null : this._names.at(mapping.name)\n\t };\n\t }, this).forEach(aCallback, context);\n\t };\n\t\n\t/**\n\t * Returns all generated line and column information for the original source,\n\t * line, and column provided. If no column is provided, returns all mappings\n\t * corresponding to a either the line we are searching for or the next\n\t * closest line that has any mappings. Otherwise, returns all mappings\n\t * corresponding to the given line and either the column we are searching for\n\t * or the next closest column that has any offsets.\n\t *\n\t * The only argument is an object with the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number is 1-based.\n\t * - column: Optional. the column number in the original source.\n\t * The column number is 0-based.\n\t *\n\t * and an array of objects is returned, each with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tSourceMapConsumer.prototype.allGeneratedPositionsFor =\n\t function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n\t var line = util.getArg(aArgs, 'line');\n\t\n\t // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n\t // returns the index of the closest mapping less than the needle. By\n\t // setting needle.originalColumn to 0, we thus find the last mapping for\n\t // the given line, provided such a mapping exists.\n\t var needle = {\n\t source: util.getArg(aArgs, 'source'),\n\t originalLine: line,\n\t originalColumn: util.getArg(aArgs, 'column', 0)\n\t };\n\t\n\t needle.source = this._findSourceIndex(needle.source);\n\t if (needle.source < 0) {\n\t return [];\n\t }\n\t\n\t var mappings = [];\n\t\n\t var index = this._findMapping(needle,\n\t this._originalMappings,\n\t \"originalLine\",\n\t \"originalColumn\",\n\t util.compareByOriginalPositions,\n\t binarySearch.LEAST_UPPER_BOUND);\n\t if (index >= 0) {\n\t var mapping = this._originalMappings[index];\n\t\n\t if (aArgs.column === undefined) {\n\t var originalLine = mapping.originalLine;\n\t\n\t // Iterate until either we run out of mappings, or we run into\n\t // a mapping for a different line than the one we found. Since\n\t // mappings are sorted, this is guaranteed to find all mappings for\n\t // the line we found.\n\t while (mapping && mapping.originalLine === originalLine) {\n\t mappings.push({\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t });\n\t\n\t mapping = this._originalMappings[++index];\n\t }\n\t } else {\n\t var originalColumn = mapping.originalColumn;\n\t\n\t // Iterate until either we run out of mappings, or we run into\n\t // a mapping for a different line than the one we were searching for.\n\t // Since mappings are sorted, this is guaranteed to find all mappings for\n\t // the line we are searching for.\n\t while (mapping &&\n\t mapping.originalLine === line &&\n\t mapping.originalColumn == originalColumn) {\n\t mappings.push({\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t });\n\t\n\t mapping = this._originalMappings[++index];\n\t }\n\t }\n\t }\n\t\n\t return mappings;\n\t };\n\t\n\texports.SourceMapConsumer = SourceMapConsumer;\n\t\n\t/**\n\t * A BasicSourceMapConsumer instance represents a parsed source map which we can\n\t * query for information about the original file positions by giving it a file\n\t * position in the generated source.\n\t *\n\t * The first parameter is the raw source map (either as a JSON string, or\n\t * already parsed to an object). According to the spec, source maps have the\n\t * following attributes:\n\t *\n\t * - version: Which version of the source map spec this map is following.\n\t * - sources: An array of URLs to the original source files.\n\t * - names: An array of identifiers which can be referrenced by individual mappings.\n\t * - sourceRoot: Optional. The URL root from which all sources are relative.\n\t * - sourcesContent: Optional. An array of contents of the original source files.\n\t * - mappings: A string of base64 VLQs which contain the actual mappings.\n\t * - file: Optional. The generated file this source map is associated with.\n\t *\n\t * Here is an example source map, taken from the source map spec[0]:\n\t *\n\t * {\n\t * version : 3,\n\t * file: \"out.js\",\n\t * sourceRoot : \"\",\n\t * sources: [\"foo.js\", \"bar.js\"],\n\t * names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t * mappings: \"AA,AB;;ABCDE;\"\n\t * }\n\t *\n\t * The second parameter, if given, is a string whose value is the URL\n\t * at which the source map was found. This URL is used to compute the\n\t * sources array.\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n\t */\n\tfunction BasicSourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t var version = util.getArg(sourceMap, 'version');\n\t var sources = util.getArg(sourceMap, 'sources');\n\t // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n\t // requires the array) to play nice here.\n\t var names = util.getArg(sourceMap, 'names', []);\n\t var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n\t var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n\t var mappings = util.getArg(sourceMap, 'mappings');\n\t var file = util.getArg(sourceMap, 'file', null);\n\t\n\t // Once again, Sass deviates from the spec and supplies the version as a\n\t // string rather than a number, so we use loose equality checking here.\n\t if (version != this._version) {\n\t throw new Error('Unsupported version: ' + version);\n\t }\n\t\n\t if (sourceRoot) {\n\t sourceRoot = util.normalize(sourceRoot);\n\t }\n\t\n\t sources = sources\n\t .map(String)\n\t // Some source maps produce relative source paths like \"./foo.js\" instead of\n\t // \"foo.js\". Normalize these first so that future comparisons will succeed.\n\t // See bugzil.la/1090768.\n\t .map(util.normalize)\n\t // Always ensure that absolute sources are internally stored relative to\n\t // the source root, if the source root is absolute. Not doing this would\n\t // be particularly problematic when the source root is a prefix of the\n\t // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n\t .map(function (source) {\n\t return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n\t ? util.relative(sourceRoot, source)\n\t : source;\n\t });\n\t\n\t // Pass `true` below to allow duplicate names and sources. While source maps\n\t // are intended to be compressed and deduplicated, the TypeScript compiler\n\t // sometimes generates source maps with duplicates in them. See Github issue\n\t // #72 and bugzil.la/889492.\n\t this._names = ArraySet.fromArray(names.map(String), true);\n\t this._sources = ArraySet.fromArray(sources, true);\n\t\n\t this._absoluteSources = this._sources.toArray().map(function (s) {\n\t return util.computeSourceURL(sourceRoot, s, aSourceMapURL);\n\t });\n\t\n\t this.sourceRoot = sourceRoot;\n\t this.sourcesContent = sourcesContent;\n\t this._mappings = mappings;\n\t this._sourceMapURL = aSourceMapURL;\n\t this.file = file;\n\t}\n\t\n\tBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\t\n\t/**\n\t * Utility function to find the index of a source. Returns -1 if not\n\t * found.\n\t */\n\tBasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) {\n\t var relativeSource = aSource;\n\t if (this.sourceRoot != null) {\n\t relativeSource = util.relative(this.sourceRoot, relativeSource);\n\t }\n\t\n\t if (this._sources.has(relativeSource)) {\n\t return this._sources.indexOf(relativeSource);\n\t }\n\t\n\t // Maybe aSource is an absolute URL as returned by |sources|. In\n\t // this case we can't simply undo the transform.\n\t var i;\n\t for (i = 0; i < this._absoluteSources.length; ++i) {\n\t if (this._absoluteSources[i] == aSource) {\n\t return i;\n\t }\n\t }\n\t\n\t return -1;\n\t};\n\t\n\t/**\n\t * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n\t *\n\t * @param SourceMapGenerator aSourceMap\n\t * The source map that will be consumed.\n\t * @param String aSourceMapURL\n\t * The URL at which the source map can be found (optional)\n\t * @returns BasicSourceMapConsumer\n\t */\n\tBasicSourceMapConsumer.fromSourceMap =\n\t function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) {\n\t var smc = Object.create(BasicSourceMapConsumer.prototype);\n\t\n\t var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n\t var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n\t smc.sourceRoot = aSourceMap._sourceRoot;\n\t smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n\t smc.sourceRoot);\n\t smc.file = aSourceMap._file;\n\t smc._sourceMapURL = aSourceMapURL;\n\t smc._absoluteSources = smc._sources.toArray().map(function (s) {\n\t return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL);\n\t });\n\t\n\t // Because we are modifying the entries (by converting string sources and\n\t // names to indices into the sources and names ArraySets), we have to make\n\t // a copy of the entry or else bad things happen. Shared mutable state\n\t // strikes again! See github issue #191.\n\t\n\t var generatedMappings = aSourceMap._mappings.toArray().slice();\n\t var destGeneratedMappings = smc.__generatedMappings = [];\n\t var destOriginalMappings = smc.__originalMappings = [];\n\t\n\t for (var i = 0, length = generatedMappings.length; i < length; i++) {\n\t var srcMapping = generatedMappings[i];\n\t var destMapping = new Mapping;\n\t destMapping.generatedLine = srcMapping.generatedLine;\n\t destMapping.generatedColumn = srcMapping.generatedColumn;\n\t\n\t if (srcMapping.source) {\n\t destMapping.source = sources.indexOf(srcMapping.source);\n\t destMapping.originalLine = srcMapping.originalLine;\n\t destMapping.originalColumn = srcMapping.originalColumn;\n\t\n\t if (srcMapping.name) {\n\t destMapping.name = names.indexOf(srcMapping.name);\n\t }\n\t\n\t destOriginalMappings.push(destMapping);\n\t }\n\t\n\t destGeneratedMappings.push(destMapping);\n\t }\n\t\n\t quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\t\n\t return smc;\n\t };\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tBasicSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n\t get: function () {\n\t return this._absoluteSources.slice();\n\t }\n\t});\n\t\n\t/**\n\t * Provide the JIT with a nice shape / hidden class.\n\t */\n\tfunction Mapping() {\n\t this.generatedLine = 0;\n\t this.generatedColumn = 0;\n\t this.source = null;\n\t this.originalLine = null;\n\t this.originalColumn = null;\n\t this.name = null;\n\t}\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tBasicSourceMapConsumer.prototype._parseMappings =\n\t function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t var generatedLine = 1;\n\t var previousGeneratedColumn = 0;\n\t var previousOriginalLine = 0;\n\t var previousOriginalColumn = 0;\n\t var previousSource = 0;\n\t var previousName = 0;\n\t var length = aStr.length;\n\t var index = 0;\n\t var cachedSegments = {};\n\t var temp = {};\n\t var originalMappings = [];\n\t var generatedMappings = [];\n\t var mapping, str, segment, end, value;\n\t\n\t while (index < length) {\n\t if (aStr.charAt(index) === ';') {\n\t generatedLine++;\n\t index++;\n\t previousGeneratedColumn = 0;\n\t }\n\t else if (aStr.charAt(index) === ',') {\n\t index++;\n\t }\n\t else {\n\t mapping = new Mapping();\n\t mapping.generatedLine = generatedLine;\n\t\n\t // Because each offset is encoded relative to the previous one,\n\t // many segments often have the same encoding. We can exploit this\n\t // fact by caching the parsed variable length fields of each segment,\n\t // allowing us to avoid a second parse if we encounter the same\n\t // segment again.\n\t for (end = index; end < length; end++) {\n\t if (this._charIsMappingSeparator(aStr, end)) {\n\t break;\n\t }\n\t }\n\t str = aStr.slice(index, end);\n\t\n\t segment = cachedSegments[str];\n\t if (segment) {\n\t index += str.length;\n\t } else {\n\t segment = [];\n\t while (index < end) {\n\t base64VLQ.decode(aStr, index, temp);\n\t value = temp.value;\n\t index = temp.rest;\n\t segment.push(value);\n\t }\n\t\n\t if (segment.length === 2) {\n\t throw new Error('Found a source, but no line and column');\n\t }\n\t\n\t if (segment.length === 3) {\n\t throw new Error('Found a source and line, but no column');\n\t }\n\t\n\t cachedSegments[str] = segment;\n\t }\n\t\n\t // Generated column.\n\t mapping.generatedColumn = previousGeneratedColumn + segment[0];\n\t previousGeneratedColumn = mapping.generatedColumn;\n\t\n\t if (segment.length > 1) {\n\t // Original source.\n\t mapping.source = previousSource + segment[1];\n\t previousSource += segment[1];\n\t\n\t // Original line.\n\t mapping.originalLine = previousOriginalLine + segment[2];\n\t previousOriginalLine = mapping.originalLine;\n\t // Lines are stored 0-based\n\t mapping.originalLine += 1;\n\t\n\t // Original column.\n\t mapping.originalColumn = previousOriginalColumn + segment[3];\n\t previousOriginalColumn = mapping.originalColumn;\n\t\n\t if (segment.length > 4) {\n\t // Original name.\n\t mapping.name = previousName + segment[4];\n\t previousName += segment[4];\n\t }\n\t }\n\t\n\t generatedMappings.push(mapping);\n\t if (typeof mapping.originalLine === 'number') {\n\t originalMappings.push(mapping);\n\t }\n\t }\n\t }\n\t\n\t quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t this.__generatedMappings = generatedMappings;\n\t\n\t quickSort(originalMappings, util.compareByOriginalPositions);\n\t this.__originalMappings = originalMappings;\n\t };\n\t\n\t/**\n\t * Find the mapping that best matches the hypothetical \"needle\" mapping that\n\t * we are searching for in the given \"haystack\" of mappings.\n\t */\n\tBasicSourceMapConsumer.prototype._findMapping =\n\t function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n\t aColumnName, aComparator, aBias) {\n\t // To return the position we are searching for, we must first find the\n\t // mapping for the given position and then return the opposite position it\n\t // points to. Because the mappings are sorted, we can use binary search to\n\t // find the best mapping.\n\t\n\t if (aNeedle[aLineName] <= 0) {\n\t throw new TypeError('Line must be greater than or equal to 1, got '\n\t + aNeedle[aLineName]);\n\t }\n\t if (aNeedle[aColumnName] < 0) {\n\t throw new TypeError('Column must be greater than or equal to 0, got '\n\t + aNeedle[aColumnName]);\n\t }\n\t\n\t return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n\t };\n\t\n\t/**\n\t * Compute the last column for each generated mapping. The last column is\n\t * inclusive.\n\t */\n\tBasicSourceMapConsumer.prototype.computeColumnSpans =\n\t function SourceMapConsumer_computeColumnSpans() {\n\t for (var index = 0; index < this._generatedMappings.length; ++index) {\n\t var mapping = this._generatedMappings[index];\n\t\n\t // Mappings do not contain a field for the last generated columnt. We\n\t // can come up with an optimistic estimate, however, by assuming that\n\t // mappings are contiguous (i.e. given two consecutive mappings, the\n\t // first mapping ends where the second one starts).\n\t if (index + 1 < this._generatedMappings.length) {\n\t var nextMapping = this._generatedMappings[index + 1];\n\t\n\t if (mapping.generatedLine === nextMapping.generatedLine) {\n\t mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n\t continue;\n\t }\n\t }\n\t\n\t // The last mapping for each line spans the entire line.\n\t mapping.lastGeneratedColumn = Infinity;\n\t }\n\t };\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t * - line: The line number in the generated source. The line number\n\t * is 1-based.\n\t * - column: The column number in the generated source. The column\n\t * number is 0-based.\n\t * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - source: The original source file, or null.\n\t * - line: The line number in the original source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the original source, or null. The\n\t * column number is 0-based.\n\t * - name: The original identifier, or null.\n\t */\n\tBasicSourceMapConsumer.prototype.originalPositionFor =\n\t function SourceMapConsumer_originalPositionFor(aArgs) {\n\t var needle = {\n\t generatedLine: util.getArg(aArgs, 'line'),\n\t generatedColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t var index = this._findMapping(\n\t needle,\n\t this._generatedMappings,\n\t \"generatedLine\",\n\t \"generatedColumn\",\n\t util.compareByGeneratedPositionsDeflated,\n\t util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t );\n\t\n\t if (index >= 0) {\n\t var mapping = this._generatedMappings[index];\n\t\n\t if (mapping.generatedLine === needle.generatedLine) {\n\t var source = util.getArg(mapping, 'source', null);\n\t if (source !== null) {\n\t source = this._sources.at(source);\n\t source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL);\n\t }\n\t var name = util.getArg(mapping, 'name', null);\n\t if (name !== null) {\n\t name = this._names.at(name);\n\t }\n\t return {\n\t source: source,\n\t line: util.getArg(mapping, 'originalLine', null),\n\t column: util.getArg(mapping, 'originalColumn', null),\n\t name: name\n\t };\n\t }\n\t }\n\t\n\t return {\n\t source: null,\n\t line: null,\n\t column: null,\n\t name: null\n\t };\n\t };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t function BasicSourceMapConsumer_hasContentsOfAllSources() {\n\t if (!this.sourcesContent) {\n\t return false;\n\t }\n\t return this.sourcesContent.length >= this._sources.size() &&\n\t !this.sourcesContent.some(function (sc) { return sc == null; });\n\t };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tBasicSourceMapConsumer.prototype.sourceContentFor =\n\t function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t if (!this.sourcesContent) {\n\t return null;\n\t }\n\t\n\t var index = this._findSourceIndex(aSource);\n\t if (index >= 0) {\n\t return this.sourcesContent[index];\n\t }\n\t\n\t var relativeSource = aSource;\n\t if (this.sourceRoot != null) {\n\t relativeSource = util.relative(this.sourceRoot, relativeSource);\n\t }\n\t\n\t var url;\n\t if (this.sourceRoot != null\n\t && (url = util.urlParse(this.sourceRoot))) {\n\t // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n\t // many users. We can help them out when they expect file:// URIs to\n\t // behave like it would if they were running a local HTTP server. See\n\t // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n\t var fileUriAbsPath = relativeSource.replace(/^file:\\/\\//, \"\");\n\t if (url.scheme == \"file\"\n\t && this._sources.has(fileUriAbsPath)) {\n\t return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n\t }\n\t\n\t if ((!url.path || url.path == \"/\")\n\t && this._sources.has(\"/\" + relativeSource)) {\n\t return this.sourcesContent[this._sources.indexOf(\"/\" + relativeSource)];\n\t }\n\t }\n\t\n\t // This function is used recursively from\n\t // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n\t // don't want to throw if we can't find the source - we just want to\n\t // return null, so we provide a flag to exit gracefully.\n\t if (nullOnMissing) {\n\t return null;\n\t }\n\t else {\n\t throw new Error('\"' + relativeSource + '\" is not in the SourceMap.');\n\t }\n\t };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number\n\t * is 1-based.\n\t * - column: The column number in the original source. The column\n\t * number is 0-based.\n\t * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n\t * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tBasicSourceMapConsumer.prototype.generatedPositionFor =\n\t function SourceMapConsumer_generatedPositionFor(aArgs) {\n\t var source = util.getArg(aArgs, 'source');\n\t source = this._findSourceIndex(source);\n\t if (source < 0) {\n\t return {\n\t line: null,\n\t column: null,\n\t lastColumn: null\n\t };\n\t }\n\t\n\t var needle = {\n\t source: source,\n\t originalLine: util.getArg(aArgs, 'line'),\n\t originalColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t var index = this._findMapping(\n\t needle,\n\t this._originalMappings,\n\t \"originalLine\",\n\t \"originalColumn\",\n\t util.compareByOriginalPositions,\n\t util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n\t );\n\t\n\t if (index >= 0) {\n\t var mapping = this._originalMappings[index];\n\t\n\t if (mapping.source === needle.source) {\n\t return {\n\t line: util.getArg(mapping, 'generatedLine', null),\n\t column: util.getArg(mapping, 'generatedColumn', null),\n\t lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n\t };\n\t }\n\t }\n\t\n\t return {\n\t line: null,\n\t column: null,\n\t lastColumn: null\n\t };\n\t };\n\t\n\texports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\t\n\t/**\n\t * An IndexedSourceMapConsumer instance represents a parsed source map which\n\t * we can query for information. It differs from BasicSourceMapConsumer in\n\t * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n\t * input.\n\t *\n\t * The first parameter is a raw source map (either as a JSON string, or already\n\t * parsed to an object). According to the spec for indexed source maps, they\n\t * have the following attributes:\n\t *\n\t * - version: Which version of the source map spec this map is following.\n\t * - file: Optional. The generated file this source map is associated with.\n\t * - sections: A list of section definitions.\n\t *\n\t * Each value under the \"sections\" field has two fields:\n\t * - offset: The offset into the original specified at which this section\n\t * begins to apply, defined as an object with a \"line\" and \"column\"\n\t * field.\n\t * - map: A source map definition. This source map could also be indexed,\n\t * but doesn't have to be.\n\t *\n\t * Instead of the \"map\" field, it's also possible to have a \"url\" field\n\t * specifying a URL to retrieve a source map from, but that's currently\n\t * unsupported.\n\t *\n\t * Here's an example source map, taken from the source map spec[0], but\n\t * modified to omit a section which uses the \"url\" field.\n\t *\n\t * {\n\t * version : 3,\n\t * file: \"app.js\",\n\t * sections: [{\n\t * offset: {line:100, column:10},\n\t * map: {\n\t * version : 3,\n\t * file: \"section.js\",\n\t * sources: [\"foo.js\", \"bar.js\"],\n\t * names: [\"src\", \"maps\", \"are\", \"fun\"],\n\t * mappings: \"AAAA,E;;ABCDE;\"\n\t * }\n\t * }],\n\t * }\n\t *\n\t * The second parameter, if given, is a string whose value is the URL\n\t * at which the source map was found. This URL is used to compute the\n\t * sources array.\n\t *\n\t * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n\t */\n\tfunction IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) {\n\t var sourceMap = aSourceMap;\n\t if (typeof aSourceMap === 'string') {\n\t sourceMap = util.parseSourceMapInput(aSourceMap);\n\t }\n\t\n\t var version = util.getArg(sourceMap, 'version');\n\t var sections = util.getArg(sourceMap, 'sections');\n\t\n\t if (version != this._version) {\n\t throw new Error('Unsupported version: ' + version);\n\t }\n\t\n\t this._sources = new ArraySet();\n\t this._names = new ArraySet();\n\t\n\t var lastOffset = {\n\t line: -1,\n\t column: 0\n\t };\n\t this._sections = sections.map(function (s) {\n\t if (s.url) {\n\t // The url field will require support for asynchronicity.\n\t // See https://github.com/mozilla/source-map/issues/16\n\t throw new Error('Support for url field in sections not implemented.');\n\t }\n\t var offset = util.getArg(s, 'offset');\n\t var offsetLine = util.getArg(offset, 'line');\n\t var offsetColumn = util.getArg(offset, 'column');\n\t\n\t if (offsetLine < lastOffset.line ||\n\t (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n\t throw new Error('Section offsets must be ordered and non-overlapping.');\n\t }\n\t lastOffset = offset;\n\t\n\t return {\n\t generatedOffset: {\n\t // The offset fields are 0-based, but we use 1-based indices when\n\t // encoding/decoding from VLQ.\n\t generatedLine: offsetLine + 1,\n\t generatedColumn: offsetColumn + 1\n\t },\n\t consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL)\n\t }\n\t });\n\t}\n\t\n\tIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\n\tIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\t\n\t/**\n\t * The version of the source mapping spec that we are consuming.\n\t */\n\tIndexedSourceMapConsumer.prototype._version = 3;\n\t\n\t/**\n\t * The list of original sources.\n\t */\n\tObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n\t get: function () {\n\t var sources = [];\n\t for (var i = 0; i < this._sections.length; i++) {\n\t for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n\t sources.push(this._sections[i].consumer.sources[j]);\n\t }\n\t }\n\t return sources;\n\t }\n\t});\n\t\n\t/**\n\t * Returns the original source, line, and column information for the generated\n\t * source's line and column positions provided. The only argument is an object\n\t * with the following properties:\n\t *\n\t * - line: The line number in the generated source. The line number\n\t * is 1-based.\n\t * - column: The column number in the generated source. The column\n\t * number is 0-based.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - source: The original source file, or null.\n\t * - line: The line number in the original source, or null. The\n\t * line number is 1-based.\n\t * - column: The column number in the original source, or null. The\n\t * column number is 0-based.\n\t * - name: The original identifier, or null.\n\t */\n\tIndexedSourceMapConsumer.prototype.originalPositionFor =\n\t function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n\t var needle = {\n\t generatedLine: util.getArg(aArgs, 'line'),\n\t generatedColumn: util.getArg(aArgs, 'column')\n\t };\n\t\n\t // Find the section containing the generated position we're trying to map\n\t // to an original position.\n\t var sectionIndex = binarySearch.search(needle, this._sections,\n\t function(needle, section) {\n\t var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n\t if (cmp) {\n\t return cmp;\n\t }\n\t\n\t return (needle.generatedColumn -\n\t section.generatedOffset.generatedColumn);\n\t });\n\t var section = this._sections[sectionIndex];\n\t\n\t if (!section) {\n\t return {\n\t source: null,\n\t line: null,\n\t column: null,\n\t name: null\n\t };\n\t }\n\t\n\t return section.consumer.originalPositionFor({\n\t line: needle.generatedLine -\n\t (section.generatedOffset.generatedLine - 1),\n\t column: needle.generatedColumn -\n\t (section.generatedOffset.generatedLine === needle.generatedLine\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0),\n\t bias: aArgs.bias\n\t });\n\t };\n\t\n\t/**\n\t * Return true if we have the source content for every source in the source\n\t * map, false otherwise.\n\t */\n\tIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n\t function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n\t return this._sections.every(function (s) {\n\t return s.consumer.hasContentsOfAllSources();\n\t });\n\t };\n\t\n\t/**\n\t * Returns the original source content. The only argument is the url of the\n\t * original source file. Returns null if no original source content is\n\t * available.\n\t */\n\tIndexedSourceMapConsumer.prototype.sourceContentFor =\n\t function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t\n\t var content = section.consumer.sourceContentFor(aSource, true);\n\t if (content) {\n\t return content;\n\t }\n\t }\n\t if (nullOnMissing) {\n\t return null;\n\t }\n\t else {\n\t throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n\t }\n\t };\n\t\n\t/**\n\t * Returns the generated line and column information for the original source,\n\t * line, and column positions provided. The only argument is an object with\n\t * the following properties:\n\t *\n\t * - source: The filename of the original source.\n\t * - line: The line number in the original source. The line number\n\t * is 1-based.\n\t * - column: The column number in the original source. The column\n\t * number is 0-based.\n\t *\n\t * and an object is returned with the following properties:\n\t *\n\t * - line: The line number in the generated source, or null. The\n\t * line number is 1-based. \n\t * - column: The column number in the generated source, or null.\n\t * The column number is 0-based.\n\t */\n\tIndexedSourceMapConsumer.prototype.generatedPositionFor =\n\t function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t\n\t // Only consider this section if the requested source is in the list of\n\t // sources of the consumer.\n\t if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) {\n\t continue;\n\t }\n\t var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n\t if (generatedPosition) {\n\t var ret = {\n\t line: generatedPosition.line +\n\t (section.generatedOffset.generatedLine - 1),\n\t column: generatedPosition.column +\n\t (section.generatedOffset.generatedLine === generatedPosition.line\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0)\n\t };\n\t return ret;\n\t }\n\t }\n\t\n\t return {\n\t line: null,\n\t column: null\n\t };\n\t };\n\t\n\t/**\n\t * Parse the mappings in a string in to a data structure which we can easily\n\t * query (the ordered arrays in the `this.__generatedMappings` and\n\t * `this.__originalMappings` properties).\n\t */\n\tIndexedSourceMapConsumer.prototype._parseMappings =\n\t function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n\t this.__generatedMappings = [];\n\t this.__originalMappings = [];\n\t for (var i = 0; i < this._sections.length; i++) {\n\t var section = this._sections[i];\n\t var sectionMappings = section.consumer._generatedMappings;\n\t for (var j = 0; j < sectionMappings.length; j++) {\n\t var mapping = sectionMappings[j];\n\t\n\t var source = section.consumer._sources.at(mapping.source);\n\t source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL);\n\t this._sources.add(source);\n\t source = this._sources.indexOf(source);\n\t\n\t var name = null;\n\t if (mapping.name) {\n\t name = section.consumer._names.at(mapping.name);\n\t this._names.add(name);\n\t name = this._names.indexOf(name);\n\t }\n\t\n\t // The mappings coming from the consumer for the section have\n\t // generated positions relative to the start of the section, so we\n\t // need to offset them to be relative to the start of the concatenated\n\t // generated file.\n\t var adjustedMapping = {\n\t source: source,\n\t generatedLine: mapping.generatedLine +\n\t (section.generatedOffset.generatedLine - 1),\n\t generatedColumn: mapping.generatedColumn +\n\t (section.generatedOffset.generatedLine === mapping.generatedLine\n\t ? section.generatedOffset.generatedColumn - 1\n\t : 0),\n\t originalLine: mapping.originalLine,\n\t originalColumn: mapping.originalColumn,\n\t name: name\n\t };\n\t\n\t this.__generatedMappings.push(adjustedMapping);\n\t if (typeof adjustedMapping.originalLine === 'number') {\n\t this.__originalMappings.push(adjustedMapping);\n\t }\n\t }\n\t }\n\t\n\t quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n\t quickSort(this.__originalMappings, util.compareByOriginalPositions);\n\t };\n\t\n\texports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n/***/ }),\n/* 8 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\texports.GREATEST_LOWER_BOUND = 1;\n\texports.LEAST_UPPER_BOUND = 2;\n\t\n\t/**\n\t * Recursive implementation of binary search.\n\t *\n\t * @param aLow Indices here and lower do not contain the needle.\n\t * @param aHigh Indices here and higher do not contain the needle.\n\t * @param aNeedle The element being searched for.\n\t * @param aHaystack The non-empty array being searched.\n\t * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t */\n\tfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n\t // This function terminates when one of the following is true:\n\t //\n\t // 1. We find the exact element we are looking for.\n\t //\n\t // 2. We did not find the exact element, but we can return the index of\n\t // the next-closest element.\n\t //\n\t // 3. We did not find the exact element, and there is no next-closest\n\t // element than the one we are searching for, so we return -1.\n\t var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n\t var cmp = aCompare(aNeedle, aHaystack[mid], true);\n\t if (cmp === 0) {\n\t // Found the element we are looking for.\n\t return mid;\n\t }\n\t else if (cmp > 0) {\n\t // Our needle is greater than aHaystack[mid].\n\t if (aHigh - mid > 1) {\n\t // The element is in the upper half.\n\t return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n\t }\n\t\n\t // The exact needle element was not found in this haystack. Determine if\n\t // we are in termination case (3) or (2) and return the appropriate thing.\n\t if (aBias == exports.LEAST_UPPER_BOUND) {\n\t return aHigh < aHaystack.length ? aHigh : -1;\n\t } else {\n\t return mid;\n\t }\n\t }\n\t else {\n\t // Our needle is less than aHaystack[mid].\n\t if (mid - aLow > 1) {\n\t // The element is in the lower half.\n\t return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n\t }\n\t\n\t // we are in termination case (3) or (2) and return the appropriate thing.\n\t if (aBias == exports.LEAST_UPPER_BOUND) {\n\t return mid;\n\t } else {\n\t return aLow < 0 ? -1 : aLow;\n\t }\n\t }\n\t}\n\t\n\t/**\n\t * This is an implementation of binary search which will always try and return\n\t * the index of the closest element if there is no exact hit. This is because\n\t * mappings between original and generated line/col pairs are single points,\n\t * and there is an implicit region between each of them, so a miss just means\n\t * that you aren't on the very start of a region.\n\t *\n\t * @param aNeedle The element you are looking for.\n\t * @param aHaystack The array that is being searched.\n\t * @param aCompare A function which takes the needle and an element in the\n\t * array and returns -1, 0, or 1 depending on whether the needle is less\n\t * than, equal to, or greater than the element, respectively.\n\t * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n\t * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n\t * closest element that is smaller than or greater than the one we are\n\t * searching for, respectively, if the exact element cannot be found.\n\t * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n\t */\n\texports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n\t if (aHaystack.length === 0) {\n\t return -1;\n\t }\n\t\n\t var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n\t aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n\t if (index < 0) {\n\t return -1;\n\t }\n\t\n\t // We have found either the exact element, or the next-closest element than\n\t // the one we are searching for. However, there may be more than one such\n\t // element. Make sure we always return the smallest of these.\n\t while (index - 1 >= 0) {\n\t if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n\t break;\n\t }\n\t --index;\n\t }\n\t\n\t return index;\n\t};\n\n\n/***/ }),\n/* 9 */\n/***/ (function(module, exports) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\t// It turns out that some (most?) JavaScript engines don't self-host\n\t// `Array.prototype.sort`. This makes sense because C++ will likely remain\n\t// faster than JS when doing raw CPU-intensive sorting. However, when using a\n\t// custom comparator function, calling back and forth between the VM's C++ and\n\t// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n\t// worse generated code for the comparator function than would be optimal. In\n\t// fact, when sorting with a comparator, these costs outweigh the benefits of\n\t// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n\t// a ~3500ms mean speed-up in `bench/bench.html`.\n\t\n\t/**\n\t * Swap the elements indexed by `x` and `y` in the array `ary`.\n\t *\n\t * @param {Array} ary\n\t * The array.\n\t * @param {Number} x\n\t * The index of the first item.\n\t * @param {Number} y\n\t * The index of the second item.\n\t */\n\tfunction swap(ary, x, y) {\n\t var temp = ary[x];\n\t ary[x] = ary[y];\n\t ary[y] = temp;\n\t}\n\t\n\t/**\n\t * Returns a random integer within the range `low .. high` inclusive.\n\t *\n\t * @param {Number} low\n\t * The lower bound on the range.\n\t * @param {Number} high\n\t * The upper bound on the range.\n\t */\n\tfunction randomIntInRange(low, high) {\n\t return Math.round(low + (Math.random() * (high - low)));\n\t}\n\t\n\t/**\n\t * The Quick Sort algorithm.\n\t *\n\t * @param {Array} ary\n\t * An array to sort.\n\t * @param {function} comparator\n\t * Function to use to compare two items.\n\t * @param {Number} p\n\t * Start index of the array\n\t * @param {Number} r\n\t * End index of the array\n\t */\n\tfunction doQuickSort(ary, comparator, p, r) {\n\t // If our lower bound is less than our upper bound, we (1) partition the\n\t // array into two pieces and (2) recurse on each half. If it is not, this is\n\t // the empty array and our base case.\n\t\n\t if (p < r) {\n\t // (1) Partitioning.\n\t //\n\t // The partitioning chooses a pivot between `p` and `r` and moves all\n\t // elements that are less than or equal to the pivot to the before it, and\n\t // all the elements that are greater than it after it. The effect is that\n\t // once partition is done, the pivot is in the exact place it will be when\n\t // the array is put in sorted order, and it will not need to be moved\n\t // again. This runs in O(n) time.\n\t\n\t // Always choose a random pivot so that an input array which is reverse\n\t // sorted does not cause O(n^2) running time.\n\t var pivotIndex = randomIntInRange(p, r);\n\t var i = p - 1;\n\t\n\t swap(ary, pivotIndex, r);\n\t var pivot = ary[r];\n\t\n\t // Immediately after `j` is incremented in this loop, the following hold\n\t // true:\n\t //\n\t // * Every element in `ary[p .. i]` is less than or equal to the pivot.\n\t //\n\t // * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n\t for (var j = p; j < r; j++) {\n\t if (comparator(ary[j], pivot) <= 0) {\n\t i += 1;\n\t swap(ary, i, j);\n\t }\n\t }\n\t\n\t swap(ary, i + 1, j);\n\t var q = i + 1;\n\t\n\t // (2) Recurse on each half.\n\t\n\t doQuickSort(ary, comparator, p, q - 1);\n\t doQuickSort(ary, comparator, q + 1, r);\n\t }\n\t}\n\t\n\t/**\n\t * Sort the given array in-place with the given comparator function.\n\t *\n\t * @param {Array} ary\n\t * An array to sort.\n\t * @param {function} comparator\n\t * Function to use to compare two items.\n\t */\n\texports.quickSort = function (ary, comparator) {\n\t doQuickSort(ary, comparator, 0, ary.length - 1);\n\t};\n\n\n/***/ }),\n/* 10 */\n/***/ (function(module, exports, __webpack_require__) {\n\n\t/* -*- Mode: js; js-indent-level: 2; -*- */\n\t/*\n\t * Copyright 2011 Mozilla Foundation and contributors\n\t * Licensed under the New BSD license. See LICENSE or:\n\t * http://opensource.org/licenses/BSD-3-Clause\n\t */\n\t\n\tvar SourceMapGenerator = __webpack_require__(1).SourceMapGenerator;\n\tvar util = __webpack_require__(4);\n\t\n\t// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n\t// operating systems these days (capturing the result).\n\tvar REGEX_NEWLINE = /(\\r?\\n)/;\n\t\n\t// Newline character code for charCodeAt() comparisons\n\tvar NEWLINE_CODE = 10;\n\t\n\t// Private symbol for identifying `SourceNode`s when multiple versions of\n\t// the source-map library are loaded. This MUST NOT CHANGE across\n\t// versions!\n\tvar isSourceNode = \"$$$isSourceNode$$$\";\n\t\n\t/**\n\t * SourceNodes provide a way to abstract over interpolating/concatenating\n\t * snippets of generated JavaScript source code while maintaining the line and\n\t * column information associated with the original source code.\n\t *\n\t * @param aLine The original line number.\n\t * @param aColumn The original column number.\n\t * @param aSource The original source's filename.\n\t * @param aChunks Optional. An array of strings which are snippets of\n\t * generated JS, or other SourceNodes.\n\t * @param aName The original identifier.\n\t */\n\tfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n\t this.children = [];\n\t this.sourceContents = {};\n\t this.line = aLine == null ? null : aLine;\n\t this.column = aColumn == null ? null : aColumn;\n\t this.source = aSource == null ? null : aSource;\n\t this.name = aName == null ? null : aName;\n\t this[isSourceNode] = true;\n\t if (aChunks != null) this.add(aChunks);\n\t}\n\t\n\t/**\n\t * Creates a SourceNode from generated code and a SourceMapConsumer.\n\t *\n\t * @param aGeneratedCode The generated code\n\t * @param aSourceMapConsumer The SourceMap for the generated code\n\t * @param aRelativePath Optional. The path that relative sources in the\n\t * SourceMapConsumer should be relative to.\n\t */\n\tSourceNode.fromStringWithSourceMap =\n\t function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n\t // The SourceNode we want to fill with the generated code\n\t // and the SourceMap\n\t var node = new SourceNode();\n\t\n\t // All even indices of this array are one line of the generated code,\n\t // while all odd indices are the newlines between two adjacent lines\n\t // (since `REGEX_NEWLINE` captures its match).\n\t // Processed fragments are accessed by calling `shiftNextLine`.\n\t var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n\t var remainingLinesIndex = 0;\n\t var shiftNextLine = function() {\n\t var lineContents = getNextLine();\n\t // The last line of a file might not have a newline.\n\t var newLine = getNextLine() || \"\";\n\t return lineContents + newLine;\n\t\n\t function getNextLine() {\n\t return remainingLinesIndex < remainingLines.length ?\n\t remainingLines[remainingLinesIndex++] : undefined;\n\t }\n\t };\n\t\n\t // We need to remember the position of \"remainingLines\"\n\t var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\t\n\t // The generate SourceNodes we need a code range.\n\t // To extract it current and last mapping is used.\n\t // Here we store the last mapping.\n\t var lastMapping = null;\n\t\n\t aSourceMapConsumer.eachMapping(function (mapping) {\n\t if (lastMapping !== null) {\n\t // We add the code from \"lastMapping\" to \"mapping\":\n\t // First check if there is a new line in between.\n\t if (lastGeneratedLine < mapping.generatedLine) {\n\t // Associate first line with \"lastMapping\"\n\t addMappingWithCode(lastMapping, shiftNextLine());\n\t lastGeneratedLine++;\n\t lastGeneratedColumn = 0;\n\t // The remaining code is added without mapping\n\t } else {\n\t // There is no new line in between.\n\t // Associate the code between \"lastGeneratedColumn\" and\n\t // \"mapping.generatedColumn\" with \"lastMapping\"\n\t var nextLine = remainingLines[remainingLinesIndex] || '';\n\t var code = nextLine.substr(0, mapping.generatedColumn -\n\t lastGeneratedColumn);\n\t remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n\t lastGeneratedColumn);\n\t lastGeneratedColumn = mapping.generatedColumn;\n\t addMappingWithCode(lastMapping, code);\n\t // No more remaining code, continue\n\t lastMapping = mapping;\n\t return;\n\t }\n\t }\n\t // We add the generated code until the first mapping\n\t // to the SourceNode without any mapping.\n\t // Each line is added as separate string.\n\t while (lastGeneratedLine < mapping.generatedLine) {\n\t node.add(shiftNextLine());\n\t lastGeneratedLine++;\n\t }\n\t if (lastGeneratedColumn < mapping.generatedColumn) {\n\t var nextLine = remainingLines[remainingLinesIndex] || '';\n\t node.add(nextLine.substr(0, mapping.generatedColumn));\n\t remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n\t lastGeneratedColumn = mapping.generatedColumn;\n\t }\n\t lastMapping = mapping;\n\t }, this);\n\t // We have processed all mappings.\n\t if (remainingLinesIndex < remainingLines.length) {\n\t if (lastMapping) {\n\t // Associate the remaining code in the current line with \"lastMapping\"\n\t addMappingWithCode(lastMapping, shiftNextLine());\n\t }\n\t // and add the remaining lines without any mapping\n\t node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n\t }\n\t\n\t // Copy sourcesContent into SourceNode\n\t aSourceMapConsumer.sources.forEach(function (sourceFile) {\n\t var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n\t if (content != null) {\n\t if (aRelativePath != null) {\n\t sourceFile = util.join(aRelativePath, sourceFile);\n\t }\n\t node.setSourceContent(sourceFile, content);\n\t }\n\t });\n\t\n\t return node;\n\t\n\t function addMappingWithCode(mapping, code) {\n\t if (mapping === null || mapping.source === undefined) {\n\t node.add(code);\n\t } else {\n\t var source = aRelativePath\n\t ? util.join(aRelativePath, mapping.source)\n\t : mapping.source;\n\t node.add(new SourceNode(mapping.originalLine,\n\t mapping.originalColumn,\n\t source,\n\t code,\n\t mapping.name));\n\t }\n\t }\n\t };\n\t\n\t/**\n\t * Add a chunk of generated JS to this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t * SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.add = function SourceNode_add(aChunk) {\n\t if (Array.isArray(aChunk)) {\n\t aChunk.forEach(function (chunk) {\n\t this.add(chunk);\n\t }, this);\n\t }\n\t else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t if (aChunk) {\n\t this.children.push(aChunk);\n\t }\n\t }\n\t else {\n\t throw new TypeError(\n\t \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t );\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Add a chunk of generated JS to the beginning of this source node.\n\t *\n\t * @param aChunk A string snippet of generated JS code, another instance of\n\t * SourceNode, or an array where each member is one of those things.\n\t */\n\tSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n\t if (Array.isArray(aChunk)) {\n\t for (var i = aChunk.length-1; i >= 0; i--) {\n\t this.prepend(aChunk[i]);\n\t }\n\t }\n\t else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n\t this.children.unshift(aChunk);\n\t }\n\t else {\n\t throw new TypeError(\n\t \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n\t );\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Walk over the tree of JS snippets in this node and its children. The\n\t * walking function is called once for each snippet of JS and is passed that\n\t * snippet and the its original associated source's line/column location.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n\t var chunk;\n\t for (var i = 0, len = this.children.length; i < len; i++) {\n\t chunk = this.children[i];\n\t if (chunk[isSourceNode]) {\n\t chunk.walk(aFn);\n\t }\n\t else {\n\t if (chunk !== '') {\n\t aFn(chunk, { source: this.source,\n\t line: this.line,\n\t column: this.column,\n\t name: this.name });\n\t }\n\t }\n\t }\n\t};\n\t\n\t/**\n\t * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n\t * each of `this.children`.\n\t *\n\t * @param aSep The separator.\n\t */\n\tSourceNode.prototype.join = function SourceNode_join(aSep) {\n\t var newChildren;\n\t var i;\n\t var len = this.children.length;\n\t if (len > 0) {\n\t newChildren = [];\n\t for (i = 0; i < len-1; i++) {\n\t newChildren.push(this.children[i]);\n\t newChildren.push(aSep);\n\t }\n\t newChildren.push(this.children[i]);\n\t this.children = newChildren;\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Call String.prototype.replace on the very right-most source snippet. Useful\n\t * for trimming whitespace from the end of a source node, etc.\n\t *\n\t * @param aPattern The pattern to replace.\n\t * @param aReplacement The thing to replace the pattern with.\n\t */\n\tSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n\t var lastChild = this.children[this.children.length - 1];\n\t if (lastChild[isSourceNode]) {\n\t lastChild.replaceRight(aPattern, aReplacement);\n\t }\n\t else if (typeof lastChild === 'string') {\n\t this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n\t }\n\t else {\n\t this.children.push(''.replace(aPattern, aReplacement));\n\t }\n\t return this;\n\t};\n\t\n\t/**\n\t * Set the source content for a source file. This will be added to the SourceMapGenerator\n\t * in the sourcesContent field.\n\t *\n\t * @param aSourceFile The filename of the source file\n\t * @param aSourceContent The content of the source file\n\t */\n\tSourceNode.prototype.setSourceContent =\n\t function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n\t this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n\t };\n\t\n\t/**\n\t * Walk over the tree of SourceNodes. The walking function is called for each\n\t * source file content and is passed the filename and source content.\n\t *\n\t * @param aFn The traversal function.\n\t */\n\tSourceNode.prototype.walkSourceContents =\n\t function SourceNode_walkSourceContents(aFn) {\n\t for (var i = 0, len = this.children.length; i < len; i++) {\n\t if (this.children[i][isSourceNode]) {\n\t this.children[i].walkSourceContents(aFn);\n\t }\n\t }\n\t\n\t var sources = Object.keys(this.sourceContents);\n\t for (var i = 0, len = sources.length; i < len; i++) {\n\t aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n\t }\n\t };\n\t\n\t/**\n\t * Return the string representation of this source node. Walks over the tree\n\t * and concatenates all the various snippets together to one string.\n\t */\n\tSourceNode.prototype.toString = function SourceNode_toString() {\n\t var str = \"\";\n\t this.walk(function (chunk) {\n\t str += chunk;\n\t });\n\t return str;\n\t};\n\t\n\t/**\n\t * Returns the string representation of this source node along with a source\n\t * map.\n\t */\n\tSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n\t var generated = {\n\t code: \"\",\n\t line: 1,\n\t column: 0\n\t };\n\t var map = new SourceMapGenerator(aArgs);\n\t var sourceMappingActive = false;\n\t var lastOriginalSource = null;\n\t var lastOriginalLine = null;\n\t var lastOriginalColumn = null;\n\t var lastOriginalName = null;\n\t this.walk(function (chunk, original) {\n\t generated.code += chunk;\n\t if (original.source !== null\n\t && original.line !== null\n\t && original.column !== null) {\n\t if(lastOriginalSource !== original.source\n\t || lastOriginalLine !== original.line\n\t || lastOriginalColumn !== original.column\n\t || lastOriginalName !== original.name) {\n\t map.addMapping({\n\t source: original.source,\n\t original: {\n\t line: original.line,\n\t column: original.column\n\t },\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t },\n\t name: original.name\n\t });\n\t }\n\t lastOriginalSource = original.source;\n\t lastOriginalLine = original.line;\n\t lastOriginalColumn = original.column;\n\t lastOriginalName = original.name;\n\t sourceMappingActive = true;\n\t } else if (sourceMappingActive) {\n\t map.addMapping({\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t }\n\t });\n\t lastOriginalSource = null;\n\t sourceMappingActive = false;\n\t }\n\t for (var idx = 0, length = chunk.length; idx < length; idx++) {\n\t if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n\t generated.line++;\n\t generated.column = 0;\n\t // Mappings end at eol\n\t if (idx + 1 === length) {\n\t lastOriginalSource = null;\n\t sourceMappingActive = false;\n\t } else if (sourceMappingActive) {\n\t map.addMapping({\n\t source: original.source,\n\t original: {\n\t line: original.line,\n\t column: original.column\n\t },\n\t generated: {\n\t line: generated.line,\n\t column: generated.column\n\t },\n\t name: original.name\n\t });\n\t }\n\t } else {\n\t generated.column++;\n\t }\n\t }\n\t });\n\t this.walkSourceContents(function (sourceFile, sourceContent) {\n\t map.setSourceContent(sourceFile, sourceContent);\n\t });\n\t\n\t return { code: generated.code, map: map };\n\t};\n\t\n\texports.SourceNode = SourceNode;\n\n\n/***/ })\n/******/ ])\n});\n;\n\n\n// WEBPACK FOOTER //\n// source-map.min.js"," \t// The module cache\n \tvar installedModules = {};\n\n \t// The require function\n \tfunction __webpack_require__(moduleId) {\n\n \t\t// Check if module is in cache\n \t\tif(installedModules[moduleId])\n \t\t\treturn installedModules[moduleId].exports;\n\n \t\t// Create a new module (and put it into the cache)\n \t\tvar module = installedModules[moduleId] = {\n \t\t\texports: {},\n \t\t\tid: moduleId,\n \t\t\tloaded: false\n \t\t};\n\n \t\t// Execute the module function\n \t\tmodules[moduleId].call(module.exports, module, module.exports, __webpack_require__);\n\n \t\t// Flag the module as loaded\n \t\tmodule.loaded = true;\n\n \t\t// Return the exports of the module\n \t\treturn module.exports;\n \t}\n\n\n \t// expose the modules object (__webpack_modules__)\n \t__webpack_require__.m = modules;\n\n \t// expose the module cache\n \t__webpack_require__.c = installedModules;\n\n \t// __webpack_public_path__\n \t__webpack_require__.p = \"\";\n\n \t// Load entry module and return exports\n \treturn __webpack_require__(0);\n\n\n\n// WEBPACK FOOTER //\n// webpack/bootstrap 0fd5815da764db5fb9fe","/*\n * Copyright 2009-2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE.txt or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\nexports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator;\nexports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer;\nexports.SourceNode = require('./lib/source-node').SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./source-map.js\n// module id = 0\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar base64VLQ = require('./base64-vlq');\nvar util = require('./util');\nvar ArraySet = require('./array-set').ArraySet;\nvar MappingList = require('./mapping-list').MappingList;\n\n/**\n * An instance of the SourceMapGenerator represents a source map which is\n * being built incrementally. You may pass an object with the following\n * properties:\n *\n * - file: The filename of the generated source.\n * - sourceRoot: A root for all relative URLs in this source map.\n */\nfunction SourceMapGenerator(aArgs) {\n if (!aArgs) {\n aArgs = {};\n }\n this._file = util.getArg(aArgs, 'file', null);\n this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null);\n this._skipValidation = util.getArg(aArgs, 'skipValidation', false);\n this._sources = new ArraySet();\n this._names = new ArraySet();\n this._mappings = new MappingList();\n this._sourcesContents = null;\n}\n\nSourceMapGenerator.prototype._version = 3;\n\n/**\n * Creates a new SourceMapGenerator based on a SourceMapConsumer\n *\n * @param aSourceMapConsumer The SourceMap.\n */\nSourceMapGenerator.fromSourceMap =\n function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) {\n var sourceRoot = aSourceMapConsumer.sourceRoot;\n var generator = new SourceMapGenerator({\n file: aSourceMapConsumer.file,\n sourceRoot: sourceRoot\n });\n aSourceMapConsumer.eachMapping(function (mapping) {\n var newMapping = {\n generated: {\n line: mapping.generatedLine,\n column: mapping.generatedColumn\n }\n };\n\n if (mapping.source != null) {\n newMapping.source = mapping.source;\n if (sourceRoot != null) {\n newMapping.source = util.relative(sourceRoot, newMapping.source);\n }\n\n newMapping.original = {\n line: mapping.originalLine,\n column: mapping.originalColumn\n };\n\n if (mapping.name != null) {\n newMapping.name = mapping.name;\n }\n }\n\n generator.addMapping(newMapping);\n });\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var sourceRelative = sourceFile;\n if (sourceRoot !== null) {\n sourceRelative = util.relative(sourceRoot, sourceFile);\n }\n\n if (!generator._sources.has(sourceRelative)) {\n generator._sources.add(sourceRelative);\n }\n\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n generator.setSourceContent(sourceFile, content);\n }\n });\n return generator;\n };\n\n/**\n * Add a single mapping from original source line and column to the generated\n * source's line and column for this source map being created. The mapping\n * object should have the following properties:\n *\n * - generated: An object with the generated line and column positions.\n * - original: An object with the original line and column positions.\n * - source: The original source file (relative to the sourceRoot).\n * - name: An optional original token name for this mapping.\n */\nSourceMapGenerator.prototype.addMapping =\n function SourceMapGenerator_addMapping(aArgs) {\n var generated = util.getArg(aArgs, 'generated');\n var original = util.getArg(aArgs, 'original', null);\n var source = util.getArg(aArgs, 'source', null);\n var name = util.getArg(aArgs, 'name', null);\n\n if (!this._skipValidation) {\n this._validateMapping(generated, original, source, name);\n }\n\n if (source != null) {\n source = String(source);\n if (!this._sources.has(source)) {\n this._sources.add(source);\n }\n }\n\n if (name != null) {\n name = String(name);\n if (!this._names.has(name)) {\n this._names.add(name);\n }\n }\n\n this._mappings.add({\n generatedLine: generated.line,\n generatedColumn: generated.column,\n originalLine: original != null && original.line,\n originalColumn: original != null && original.column,\n source: source,\n name: name\n });\n };\n\n/**\n * Set the source content for a source file.\n */\nSourceMapGenerator.prototype.setSourceContent =\n function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) {\n var source = aSourceFile;\n if (this._sourceRoot != null) {\n source = util.relative(this._sourceRoot, source);\n }\n\n if (aSourceContent != null) {\n // Add the source content to the _sourcesContents map.\n // Create a new _sourcesContents map if the property is null.\n if (!this._sourcesContents) {\n this._sourcesContents = Object.create(null);\n }\n this._sourcesContents[util.toSetString(source)] = aSourceContent;\n } else if (this._sourcesContents) {\n // Remove the source file from the _sourcesContents map.\n // If the _sourcesContents map is empty, set the property to null.\n delete this._sourcesContents[util.toSetString(source)];\n if (Object.keys(this._sourcesContents).length === 0) {\n this._sourcesContents = null;\n }\n }\n };\n\n/**\n * Applies the mappings of a sub-source-map for a specific source file to the\n * source map being generated. Each mapping to the supplied source file is\n * rewritten using the supplied source map. Note: The resolution for the\n * resulting mappings is the minimium of this map and the supplied map.\n *\n * @param aSourceMapConsumer The source map to be applied.\n * @param aSourceFile Optional. The filename of the source file.\n * If omitted, SourceMapConsumer's file property will be used.\n * @param aSourceMapPath Optional. The dirname of the path to the source map\n * to be applied. If relative, it is relative to the SourceMapConsumer.\n * This parameter is needed when the two source maps aren't in the same\n * directory, and the source map to be applied contains relative source\n * paths. If so, those relative source paths need to be rewritten\n * relative to the SourceMapGenerator.\n */\nSourceMapGenerator.prototype.applySourceMap =\n function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) {\n var sourceFile = aSourceFile;\n // If aSourceFile is omitted, we will use the file property of the SourceMap\n if (aSourceFile == null) {\n if (aSourceMapConsumer.file == null) {\n throw new Error(\n 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' +\n 'or the source map\\'s \"file\" property. Both were omitted.'\n );\n }\n sourceFile = aSourceMapConsumer.file;\n }\n var sourceRoot = this._sourceRoot;\n // Make \"sourceFile\" relative if an absolute Url is passed.\n if (sourceRoot != null) {\n sourceFile = util.relative(sourceRoot, sourceFile);\n }\n // Applying the SourceMap can add and remove items from the sources and\n // the names array.\n var newSources = new ArraySet();\n var newNames = new ArraySet();\n\n // Find mappings for the \"sourceFile\"\n this._mappings.unsortedForEach(function (mapping) {\n if (mapping.source === sourceFile && mapping.originalLine != null) {\n // Check if it can be mapped by the source map, then update the mapping.\n var original = aSourceMapConsumer.originalPositionFor({\n line: mapping.originalLine,\n column: mapping.originalColumn\n });\n if (original.source != null) {\n // Copy mapping\n mapping.source = original.source;\n if (aSourceMapPath != null) {\n mapping.source = util.join(aSourceMapPath, mapping.source)\n }\n if (sourceRoot != null) {\n mapping.source = util.relative(sourceRoot, mapping.source);\n }\n mapping.originalLine = original.line;\n mapping.originalColumn = original.column;\n if (original.name != null) {\n mapping.name = original.name;\n }\n }\n }\n\n var source = mapping.source;\n if (source != null && !newSources.has(source)) {\n newSources.add(source);\n }\n\n var name = mapping.name;\n if (name != null && !newNames.has(name)) {\n newNames.add(name);\n }\n\n }, this);\n this._sources = newSources;\n this._names = newNames;\n\n // Copy sourcesContents of applied map.\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n if (aSourceMapPath != null) {\n sourceFile = util.join(aSourceMapPath, sourceFile);\n }\n if (sourceRoot != null) {\n sourceFile = util.relative(sourceRoot, sourceFile);\n }\n this.setSourceContent(sourceFile, content);\n }\n }, this);\n };\n\n/**\n * A mapping can have one of the three levels of data:\n *\n * 1. Just the generated position.\n * 2. The Generated position, original position, and original source.\n * 3. Generated and original position, original source, as well as a name\n * token.\n *\n * To maintain consistency, we validate that any new mapping being added falls\n * in to one of these categories.\n */\nSourceMapGenerator.prototype._validateMapping =\n function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource,\n aName) {\n // When aOriginal is truthy but has empty values for .line and .column,\n // it is most likely a programmer error. In this case we throw a very\n // specific error message to try to guide them the right way.\n // For example: https://github.com/Polymer/polymer-bundler/pull/519\n if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') {\n throw new Error(\n 'original.line and original.column are not numbers -- you probably meant to omit ' +\n 'the original mapping entirely and only map the generated position. If so, pass ' +\n 'null for the original mapping instead of an object with empty or null values.'\n );\n }\n\n if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n && aGenerated.line > 0 && aGenerated.column >= 0\n && !aOriginal && !aSource && !aName) {\n // Case 1.\n return;\n }\n else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated\n && aOriginal && 'line' in aOriginal && 'column' in aOriginal\n && aGenerated.line > 0 && aGenerated.column >= 0\n && aOriginal.line > 0 && aOriginal.column >= 0\n && aSource) {\n // Cases 2 and 3.\n return;\n }\n else {\n throw new Error('Invalid mapping: ' + JSON.stringify({\n generated: aGenerated,\n source: aSource,\n original: aOriginal,\n name: aName\n }));\n }\n };\n\n/**\n * Serialize the accumulated mappings in to the stream of base 64 VLQs\n * specified by the source map format.\n */\nSourceMapGenerator.prototype._serializeMappings =\n function SourceMapGenerator_serializeMappings() {\n var previousGeneratedColumn = 0;\n var previousGeneratedLine = 1;\n var previousOriginalColumn = 0;\n var previousOriginalLine = 0;\n var previousName = 0;\n var previousSource = 0;\n var result = '';\n var next;\n var mapping;\n var nameIdx;\n var sourceIdx;\n\n var mappings = this._mappings.toArray();\n for (var i = 0, len = mappings.length; i < len; i++) {\n mapping = mappings[i];\n next = ''\n\n if (mapping.generatedLine !== previousGeneratedLine) {\n previousGeneratedColumn = 0;\n while (mapping.generatedLine !== previousGeneratedLine) {\n next += ';';\n previousGeneratedLine++;\n }\n }\n else {\n if (i > 0) {\n if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) {\n continue;\n }\n next += ',';\n }\n }\n\n next += base64VLQ.encode(mapping.generatedColumn\n - previousGeneratedColumn);\n previousGeneratedColumn = mapping.generatedColumn;\n\n if (mapping.source != null) {\n sourceIdx = this._sources.indexOf(mapping.source);\n next += base64VLQ.encode(sourceIdx - previousSource);\n previousSource = sourceIdx;\n\n // lines are stored 0-based in SourceMap spec version 3\n next += base64VLQ.encode(mapping.originalLine - 1\n - previousOriginalLine);\n previousOriginalLine = mapping.originalLine - 1;\n\n next += base64VLQ.encode(mapping.originalColumn\n - previousOriginalColumn);\n previousOriginalColumn = mapping.originalColumn;\n\n if (mapping.name != null) {\n nameIdx = this._names.indexOf(mapping.name);\n next += base64VLQ.encode(nameIdx - previousName);\n previousName = nameIdx;\n }\n }\n\n result += next;\n }\n\n return result;\n };\n\nSourceMapGenerator.prototype._generateSourcesContent =\n function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) {\n return aSources.map(function (source) {\n if (!this._sourcesContents) {\n return null;\n }\n if (aSourceRoot != null) {\n source = util.relative(aSourceRoot, source);\n }\n var key = util.toSetString(source);\n return Object.prototype.hasOwnProperty.call(this._sourcesContents, key)\n ? this._sourcesContents[key]\n : null;\n }, this);\n };\n\n/**\n * Externalize the source map.\n */\nSourceMapGenerator.prototype.toJSON =\n function SourceMapGenerator_toJSON() {\n var map = {\n version: this._version,\n sources: this._sources.toArray(),\n names: this._names.toArray(),\n mappings: this._serializeMappings()\n };\n if (this._file != null) {\n map.file = this._file;\n }\n if (this._sourceRoot != null) {\n map.sourceRoot = this._sourceRoot;\n }\n if (this._sourcesContents) {\n map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot);\n }\n\n return map;\n };\n\n/**\n * Render the source map being generated to a string.\n */\nSourceMapGenerator.prototype.toString =\n function SourceMapGenerator_toString() {\n return JSON.stringify(this.toJSON());\n };\n\nexports.SourceMapGenerator = SourceMapGenerator;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-generator.js\n// module id = 1\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n *\n * Based on the Base 64 VLQ implementation in Closure Compiler:\n * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java\n *\n * Copyright 2011 The Closure Compiler Authors. All rights reserved.\n * Redistribution and use in source and binary forms, with or without\n * modification, are permitted provided that the following conditions are\n * met:\n *\n * * Redistributions of source code must retain the above copyright\n * notice, this list of conditions and the following disclaimer.\n * * Redistributions in binary form must reproduce the above\n * copyright notice, this list of conditions and the following\n * disclaimer in the documentation and/or other materials provided\n * with the distribution.\n * * Neither the name of Google Inc. nor the names of its\n * contributors may be used to endorse or promote products derived\n * from this software without specific prior written permission.\n *\n * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS\n * \"AS IS\" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT\n * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR\n * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT\n * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL,\n * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT\n * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE,\n * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY\n * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT\n * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE\n * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.\n */\n\nvar base64 = require('./base64');\n\n// A single base 64 digit can contain 6 bits of data. For the base 64 variable\n// length quantities we use in the source map spec, the first bit is the sign,\n// the next four bits are the actual value, and the 6th bit is the\n// continuation bit. The continuation bit tells us whether there are more\n// digits in this value following this digit.\n//\n// Continuation\n// | Sign\n// | |\n// V V\n// 101011\n\nvar VLQ_BASE_SHIFT = 5;\n\n// binary: 100000\nvar VLQ_BASE = 1 << VLQ_BASE_SHIFT;\n\n// binary: 011111\nvar VLQ_BASE_MASK = VLQ_BASE - 1;\n\n// binary: 100000\nvar VLQ_CONTINUATION_BIT = VLQ_BASE;\n\n/**\n * Converts from a two-complement value to a value where the sign bit is\n * placed in the least significant bit. For example, as decimals:\n * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary)\n * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary)\n */\nfunction toVLQSigned(aValue) {\n return aValue < 0\n ? ((-aValue) << 1) + 1\n : (aValue << 1) + 0;\n}\n\n/**\n * Converts to a two-complement value from a value where the sign bit is\n * placed in the least significant bit. For example, as decimals:\n * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1\n * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2\n */\nfunction fromVLQSigned(aValue) {\n var isNegative = (aValue & 1) === 1;\n var shifted = aValue >> 1;\n return isNegative\n ? -shifted\n : shifted;\n}\n\n/**\n * Returns the base 64 VLQ encoded value.\n */\nexports.encode = function base64VLQ_encode(aValue) {\n var encoded = \"\";\n var digit;\n\n var vlq = toVLQSigned(aValue);\n\n do {\n digit = vlq & VLQ_BASE_MASK;\n vlq >>>= VLQ_BASE_SHIFT;\n if (vlq > 0) {\n // There are still more digits in this value, so we must make sure the\n // continuation bit is marked.\n digit |= VLQ_CONTINUATION_BIT;\n }\n encoded += base64.encode(digit);\n } while (vlq > 0);\n\n return encoded;\n};\n\n/**\n * Decodes the next base 64 VLQ value from the given string and returns the\n * value and the rest of the string via the out parameter.\n */\nexports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) {\n var strLen = aStr.length;\n var result = 0;\n var shift = 0;\n var continuation, digit;\n\n do {\n if (aIndex >= strLen) {\n throw new Error(\"Expected more digits in base 64 VLQ value.\");\n }\n\n digit = base64.decode(aStr.charCodeAt(aIndex++));\n if (digit === -1) {\n throw new Error(\"Invalid base64 digit: \" + aStr.charAt(aIndex - 1));\n }\n\n continuation = !!(digit & VLQ_CONTINUATION_BIT);\n digit &= VLQ_BASE_MASK;\n result = result + (digit << shift);\n shift += VLQ_BASE_SHIFT;\n } while (continuation);\n\n aOutParam.value = fromVLQSigned(result);\n aOutParam.rest = aIndex;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64-vlq.js\n// module id = 2\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split('');\n\n/**\n * Encode an integer in the range of 0 to 63 to a single base 64 digit.\n */\nexports.encode = function (number) {\n if (0 <= number && number < intToCharMap.length) {\n return intToCharMap[number];\n }\n throw new TypeError(\"Must be between 0 and 63: \" + number);\n};\n\n/**\n * Decode a single base 64 character code digit to an integer. Returns -1 on\n * failure.\n */\nexports.decode = function (charCode) {\n var bigA = 65; // 'A'\n var bigZ = 90; // 'Z'\n\n var littleA = 97; // 'a'\n var littleZ = 122; // 'z'\n\n var zero = 48; // '0'\n var nine = 57; // '9'\n\n var plus = 43; // '+'\n var slash = 47; // '/'\n\n var littleOffset = 26;\n var numberOffset = 52;\n\n // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ\n if (bigA <= charCode && charCode <= bigZ) {\n return (charCode - bigA);\n }\n\n // 26 - 51: abcdefghijklmnopqrstuvwxyz\n if (littleA <= charCode && charCode <= littleZ) {\n return (charCode - littleA + littleOffset);\n }\n\n // 52 - 61: 0123456789\n if (zero <= charCode && charCode <= nine) {\n return (charCode - zero + numberOffset);\n }\n\n // 62: +\n if (charCode == plus) {\n return 62;\n }\n\n // 63: /\n if (charCode == slash) {\n return 63;\n }\n\n // Invalid base64 digit.\n return -1;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/base64.js\n// module id = 3\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n/**\n * This is a helper function for getting values from parameter/options\n * objects.\n *\n * @param args The object we are extracting values from\n * @param name The name of the property we are getting.\n * @param defaultValue An optional value to return if the property is missing\n * from the object. If this is not specified and the property is missing, an\n * error will be thrown.\n */\nfunction getArg(aArgs, aName, aDefaultValue) {\n if (aName in aArgs) {\n return aArgs[aName];\n } else if (arguments.length === 3) {\n return aDefaultValue;\n } else {\n throw new Error('\"' + aName + '\" is a required argument.');\n }\n}\nexports.getArg = getArg;\n\nvar urlRegexp = /^(?:([\\w+\\-.]+):)?\\/\\/(?:(\\w+:\\w+)@)?([\\w.-]*)(?::(\\d+))?(.*)$/;\nvar dataUrlRegexp = /^data:.+\\,.+$/;\n\nfunction urlParse(aUrl) {\n var match = aUrl.match(urlRegexp);\n if (!match) {\n return null;\n }\n return {\n scheme: match[1],\n auth: match[2],\n host: match[3],\n port: match[4],\n path: match[5]\n };\n}\nexports.urlParse = urlParse;\n\nfunction urlGenerate(aParsedUrl) {\n var url = '';\n if (aParsedUrl.scheme) {\n url += aParsedUrl.scheme + ':';\n }\n url += '//';\n if (aParsedUrl.auth) {\n url += aParsedUrl.auth + '@';\n }\n if (aParsedUrl.host) {\n url += aParsedUrl.host;\n }\n if (aParsedUrl.port) {\n url += \":\" + aParsedUrl.port\n }\n if (aParsedUrl.path) {\n url += aParsedUrl.path;\n }\n return url;\n}\nexports.urlGenerate = urlGenerate;\n\n/**\n * Normalizes a path, or the path portion of a URL:\n *\n * - Replaces consecutive slashes with one slash.\n * - Removes unnecessary '.' parts.\n * - Removes unnecessary '<dir>/..' parts.\n *\n * Based on code in the Node.js 'path' core module.\n *\n * @param aPath The path or url to normalize.\n */\nfunction normalize(aPath) {\n var path = aPath;\n var url = urlParse(aPath);\n if (url) {\n if (!url.path) {\n return aPath;\n }\n path = url.path;\n }\n var isAbsolute = exports.isAbsolute(path);\n\n var parts = path.split(/\\/+/);\n for (var part, up = 0, i = parts.length - 1; i >= 0; i--) {\n part = parts[i];\n if (part === '.') {\n parts.splice(i, 1);\n } else if (part === '..') {\n up++;\n } else if (up > 0) {\n if (part === '') {\n // The first part is blank if the path is absolute. Trying to go\n // above the root is a no-op. Therefore we can remove all '..' parts\n // directly after the root.\n parts.splice(i + 1, up);\n up = 0;\n } else {\n parts.splice(i, 2);\n up--;\n }\n }\n }\n path = parts.join('/');\n\n if (path === '') {\n path = isAbsolute ? '/' : '.';\n }\n\n if (url) {\n url.path = path;\n return urlGenerate(url);\n }\n return path;\n}\nexports.normalize = normalize;\n\n/**\n * Joins two paths/URLs.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be joined with the root.\n *\n * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a\n * scheme-relative URL: Then the scheme of aRoot, if any, is prepended\n * first.\n * - Otherwise aPath is a path. If aRoot is a URL, then its path portion\n * is updated with the result and aRoot is returned. Otherwise the result\n * is returned.\n * - If aPath is absolute, the result is aPath.\n * - Otherwise the two paths are joined with a slash.\n * - Joining for example 'http://' and 'www.example.com' is also supported.\n */\nfunction join(aRoot, aPath) {\n if (aRoot === \"\") {\n aRoot = \".\";\n }\n if (aPath === \"\") {\n aPath = \".\";\n }\n var aPathUrl = urlParse(aPath);\n var aRootUrl = urlParse(aRoot);\n if (aRootUrl) {\n aRoot = aRootUrl.path || '/';\n }\n\n // `join(foo, '//www.example.org')`\n if (aPathUrl && !aPathUrl.scheme) {\n if (aRootUrl) {\n aPathUrl.scheme = aRootUrl.scheme;\n }\n return urlGenerate(aPathUrl);\n }\n\n if (aPathUrl || aPath.match(dataUrlRegexp)) {\n return aPath;\n }\n\n // `join('http://', 'www.example.com')`\n if (aRootUrl && !aRootUrl.host && !aRootUrl.path) {\n aRootUrl.host = aPath;\n return urlGenerate(aRootUrl);\n }\n\n var joined = aPath.charAt(0) === '/'\n ? aPath\n : normalize(aRoot.replace(/\\/+$/, '') + '/' + aPath);\n\n if (aRootUrl) {\n aRootUrl.path = joined;\n return urlGenerate(aRootUrl);\n }\n return joined;\n}\nexports.join = join;\n\nexports.isAbsolute = function (aPath) {\n return aPath.charAt(0) === '/' || urlRegexp.test(aPath);\n};\n\n/**\n * Make a path relative to a URL or another path.\n *\n * @param aRoot The root path or URL.\n * @param aPath The path or URL to be made relative to aRoot.\n */\nfunction relative(aRoot, aPath) {\n if (aRoot === \"\") {\n aRoot = \".\";\n }\n\n aRoot = aRoot.replace(/\\/$/, '');\n\n // It is possible for the path to be above the root. In this case, simply\n // checking whether the root is a prefix of the path won't work. Instead, we\n // need to remove components from the root one by one, until either we find\n // a prefix that fits, or we run out of components to remove.\n var level = 0;\n while (aPath.indexOf(aRoot + '/') !== 0) {\n var index = aRoot.lastIndexOf(\"/\");\n if (index < 0) {\n return aPath;\n }\n\n // If the only part of the root that is left is the scheme (i.e. http://,\n // file:///, etc.), one or more slashes (/), or simply nothing at all, we\n // have exhausted all components, so the path is not relative to the root.\n aRoot = aRoot.slice(0, index);\n if (aRoot.match(/^([^\\/]+:\\/)?\\/*$/)) {\n return aPath;\n }\n\n ++level;\n }\n\n // Make sure we add a \"../\" for each component we removed from the root.\n return Array(level + 1).join(\"../\") + aPath.substr(aRoot.length + 1);\n}\nexports.relative = relative;\n\nvar supportsNullProto = (function () {\n var obj = Object.create(null);\n return !('__proto__' in obj);\n}());\n\nfunction identity (s) {\n return s;\n}\n\n/**\n * Because behavior goes wacky when you set `__proto__` on objects, we\n * have to prefix all the strings in our set with an arbitrary character.\n *\n * See https://github.com/mozilla/source-map/pull/31 and\n * https://github.com/mozilla/source-map/issues/30\n *\n * @param String aStr\n */\nfunction toSetString(aStr) {\n if (isProtoString(aStr)) {\n return '$' + aStr;\n }\n\n return aStr;\n}\nexports.toSetString = supportsNullProto ? identity : toSetString;\n\nfunction fromSetString(aStr) {\n if (isProtoString(aStr)) {\n return aStr.slice(1);\n }\n\n return aStr;\n}\nexports.fromSetString = supportsNullProto ? identity : fromSetString;\n\nfunction isProtoString(s) {\n if (!s) {\n return false;\n }\n\n var length = s.length;\n\n if (length < 9 /* \"__proto__\".length */) {\n return false;\n }\n\n if (s.charCodeAt(length - 1) !== 95 /* '_' */ ||\n s.charCodeAt(length - 2) !== 95 /* '_' */ ||\n s.charCodeAt(length - 3) !== 111 /* 'o' */ ||\n s.charCodeAt(length - 4) !== 116 /* 't' */ ||\n s.charCodeAt(length - 5) !== 111 /* 'o' */ ||\n s.charCodeAt(length - 6) !== 114 /* 'r' */ ||\n s.charCodeAt(length - 7) !== 112 /* 'p' */ ||\n s.charCodeAt(length - 8) !== 95 /* '_' */ ||\n s.charCodeAt(length - 9) !== 95 /* '_' */) {\n return false;\n }\n\n for (var i = length - 10; i >= 0; i--) {\n if (s.charCodeAt(i) !== 36 /* '$' */) {\n return false;\n }\n }\n\n return true;\n}\n\n/**\n * Comparator between two mappings where the original positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same original source/line/column, but different generated\n * line and column the same. Useful when searching for a mapping with a\n * stubbed out mapping.\n */\nfunction compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) {\n var cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0 || onlyCompareOriginal) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByOriginalPositions = compareByOriginalPositions;\n\n/**\n * Comparator between two mappings with deflated source and name indices where\n * the generated positions are compared.\n *\n * Optionally pass in `true` as `onlyCompareGenerated` to consider two\n * mappings with the same generated line and column, but different\n * source/name/original line and column the same. Useful when searching for a\n * mapping with a stubbed out mapping.\n */\nfunction compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) {\n var cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0 || onlyCompareGenerated) {\n return cmp;\n }\n\n cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated;\n\nfunction strcmp(aStr1, aStr2) {\n if (aStr1 === aStr2) {\n return 0;\n }\n\n if (aStr1 === null) {\n return 1; // aStr2 !== null\n }\n\n if (aStr2 === null) {\n return -1; // aStr1 !== null\n }\n\n if (aStr1 > aStr2) {\n return 1;\n }\n\n return -1;\n}\n\n/**\n * Comparator between two mappings with inflated source and name strings where\n * the generated positions are compared.\n */\nfunction compareByGeneratedPositionsInflated(mappingA, mappingB) {\n var cmp = mappingA.generatedLine - mappingB.generatedLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.generatedColumn - mappingB.generatedColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = strcmp(mappingA.source, mappingB.source);\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalLine - mappingB.originalLine;\n if (cmp !== 0) {\n return cmp;\n }\n\n cmp = mappingA.originalColumn - mappingB.originalColumn;\n if (cmp !== 0) {\n return cmp;\n }\n\n return strcmp(mappingA.name, mappingB.name);\n}\nexports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated;\n\n/**\n * Strip any JSON XSSI avoidance prefix from the string (as documented\n * in the source maps specification), and then parse the string as\n * JSON.\n */\nfunction parseSourceMapInput(str) {\n return JSON.parse(str.replace(/^\\)]}'[^\\n]*\\n/, ''));\n}\nexports.parseSourceMapInput = parseSourceMapInput;\n\n/**\n * Compute the URL of a source given the the source root, the source's\n * URL, and the source map's URL.\n */\nfunction computeSourceURL(sourceRoot, sourceURL, sourceMapURL) {\n sourceURL = sourceURL || '';\n\n if (sourceRoot) {\n // This follows what Chrome does.\n if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') {\n sourceRoot += '/';\n }\n // The spec says:\n // Line 4: An optional source root, useful for relocating source\n // files on a server or removing repeated values in the\n // “sources” entry. This value is prepended to the individual\n // entries in the “source” field.\n sourceURL = sourceRoot + sourceURL;\n }\n\n // Historically, SourceMapConsumer did not take the sourceMapURL as\n // a parameter. This mode is still somewhat supported, which is why\n // this code block is conditional. However, it's preferable to pass\n // the source map URL to SourceMapConsumer, so that this function\n // can implement the source URL resolution algorithm as outlined in\n // the spec. This block is basically the equivalent of:\n // new URL(sourceURL, sourceMapURL).toString()\n // ... except it avoids using URL, which wasn't available in the\n // older releases of node still supported by this library.\n //\n // The spec says:\n // If the sources are not absolute URLs after prepending of the\n // “sourceRoot”, the sources are resolved relative to the\n // SourceMap (like resolving script src in a html document).\n if (sourceMapURL) {\n var parsed = urlParse(sourceMapURL);\n if (!parsed) {\n throw new Error(\"sourceMapURL could not be parsed\");\n }\n if (parsed.path) {\n // Strip the last path component, but keep the \"/\".\n var index = parsed.path.lastIndexOf('/');\n if (index >= 0) {\n parsed.path = parsed.path.substring(0, index + 1);\n }\n }\n sourceURL = join(urlGenerate(parsed), sourceURL);\n }\n\n return normalize(sourceURL);\n}\nexports.computeSourceURL = computeSourceURL;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/util.js\n// module id = 4\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar has = Object.prototype.hasOwnProperty;\nvar hasNativeMap = typeof Map !== \"undefined\";\n\n/**\n * A data structure which is a combination of an array and a set. Adding a new\n * member is O(1), testing for membership is O(1), and finding the index of an\n * element is O(1). Removing elements from the set is not supported. Only\n * strings are supported for membership.\n */\nfunction ArraySet() {\n this._array = [];\n this._set = hasNativeMap ? new Map() : Object.create(null);\n}\n\n/**\n * Static method for creating ArraySet instances from an existing array.\n */\nArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) {\n var set = new ArraySet();\n for (var i = 0, len = aArray.length; i < len; i++) {\n set.add(aArray[i], aAllowDuplicates);\n }\n return set;\n};\n\n/**\n * Return how many unique items are in this ArraySet. If duplicates have been\n * added, than those do not count towards the size.\n *\n * @returns Number\n */\nArraySet.prototype.size = function ArraySet_size() {\n return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length;\n};\n\n/**\n * Add the given string to this set.\n *\n * @param String aStr\n */\nArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) {\n var sStr = hasNativeMap ? aStr : util.toSetString(aStr);\n var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr);\n var idx = this._array.length;\n if (!isDuplicate || aAllowDuplicates) {\n this._array.push(aStr);\n }\n if (!isDuplicate) {\n if (hasNativeMap) {\n this._set.set(aStr, idx);\n } else {\n this._set[sStr] = idx;\n }\n }\n};\n\n/**\n * Is the given string a member of this set?\n *\n * @param String aStr\n */\nArraySet.prototype.has = function ArraySet_has(aStr) {\n if (hasNativeMap) {\n return this._set.has(aStr);\n } else {\n var sStr = util.toSetString(aStr);\n return has.call(this._set, sStr);\n }\n};\n\n/**\n * What is the index of the given string in the array?\n *\n * @param String aStr\n */\nArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) {\n if (hasNativeMap) {\n var idx = this._set.get(aStr);\n if (idx >= 0) {\n return idx;\n }\n } else {\n var sStr = util.toSetString(aStr);\n if (has.call(this._set, sStr)) {\n return this._set[sStr];\n }\n }\n\n throw new Error('\"' + aStr + '\" is not in the set.');\n};\n\n/**\n * What is the element at the given index?\n *\n * @param Number aIdx\n */\nArraySet.prototype.at = function ArraySet_at(aIdx) {\n if (aIdx >= 0 && aIdx < this._array.length) {\n return this._array[aIdx];\n }\n throw new Error('No element indexed by ' + aIdx);\n};\n\n/**\n * Returns the array representation of this set (which has the proper indices\n * indicated by indexOf). Note that this is a copy of the internal array used\n * for storing the members so that no one can mess with internal state.\n */\nArraySet.prototype.toArray = function ArraySet_toArray() {\n return this._array.slice();\n};\n\nexports.ArraySet = ArraySet;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/array-set.js\n// module id = 5\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2014 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\n\n/**\n * Determine whether mappingB is after mappingA with respect to generated\n * position.\n */\nfunction generatedPositionAfter(mappingA, mappingB) {\n // Optimized for most common case\n var lineA = mappingA.generatedLine;\n var lineB = mappingB.generatedLine;\n var columnA = mappingA.generatedColumn;\n var columnB = mappingB.generatedColumn;\n return lineB > lineA || lineB == lineA && columnB >= columnA ||\n util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0;\n}\n\n/**\n * A data structure to provide a sorted view of accumulated mappings in a\n * performance conscious manner. It trades a neglibable overhead in general\n * case for a large speedup in case of mappings being added in order.\n */\nfunction MappingList() {\n this._array = [];\n this._sorted = true;\n // Serves as infimum\n this._last = {generatedLine: -1, generatedColumn: 0};\n}\n\n/**\n * Iterate through internal items. This method takes the same arguments that\n * `Array.prototype.forEach` takes.\n *\n * NOTE: The order of the mappings is NOT guaranteed.\n */\nMappingList.prototype.unsortedForEach =\n function MappingList_forEach(aCallback, aThisArg) {\n this._array.forEach(aCallback, aThisArg);\n };\n\n/**\n * Add the given source mapping.\n *\n * @param Object aMapping\n */\nMappingList.prototype.add = function MappingList_add(aMapping) {\n if (generatedPositionAfter(this._last, aMapping)) {\n this._last = aMapping;\n this._array.push(aMapping);\n } else {\n this._sorted = false;\n this._array.push(aMapping);\n }\n};\n\n/**\n * Returns the flat, sorted array of mappings. The mappings are sorted by\n * generated position.\n *\n * WARNING: This method returns internal data without copying, for\n * performance. The return value must NOT be mutated, and should be treated as\n * an immutable borrow. If you want to take ownership, you must make your own\n * copy.\n */\nMappingList.prototype.toArray = function MappingList_toArray() {\n if (!this._sorted) {\n this._array.sort(util.compareByGeneratedPositionsInflated);\n this._sorted = true;\n }\n return this._array;\n};\n\nexports.MappingList = MappingList;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/mapping-list.js\n// module id = 6\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar util = require('./util');\nvar binarySearch = require('./binary-search');\nvar ArraySet = require('./array-set').ArraySet;\nvar base64VLQ = require('./base64-vlq');\nvar quickSort = require('./quick-sort').quickSort;\n\nfunction SourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n return sourceMap.sections != null\n ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL)\n : new BasicSourceMapConsumer(sourceMap, aSourceMapURL);\n}\n\nSourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) {\n return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL);\n}\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nSourceMapConsumer.prototype._version = 3;\n\n// `__generatedMappings` and `__originalMappings` are arrays that hold the\n// parsed mapping coordinates from the source map's \"mappings\" attribute. They\n// are lazily instantiated, accessed via the `_generatedMappings` and\n// `_originalMappings` getters respectively, and we only parse the mappings\n// and create these arrays once queried for a source location. We jump through\n// these hoops because there can be many thousands of mappings, and parsing\n// them is expensive, so we only want to do it if we must.\n//\n// Each object in the arrays is of the form:\n//\n// {\n// generatedLine: The line number in the generated code,\n// generatedColumn: The column number in the generated code,\n// source: The path to the original source file that generated this\n// chunk of code,\n// originalLine: The line number in the original source that\n// corresponds to this chunk of generated code,\n// originalColumn: The column number in the original source that\n// corresponds to this chunk of generated code,\n// name: The name of the original symbol which generated this chunk of\n// code.\n// }\n//\n// All properties except for `generatedLine` and `generatedColumn` can be\n// `null`.\n//\n// `_generatedMappings` is ordered by the generated positions.\n//\n// `_originalMappings` is ordered by the original positions.\n\nSourceMapConsumer.prototype.__generatedMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', {\n configurable: true,\n enumerable: true,\n get: function () {\n if (!this.__generatedMappings) {\n this._parseMappings(this._mappings, this.sourceRoot);\n }\n\n return this.__generatedMappings;\n }\n});\n\nSourceMapConsumer.prototype.__originalMappings = null;\nObject.defineProperty(SourceMapConsumer.prototype, '_originalMappings', {\n configurable: true,\n enumerable: true,\n get: function () {\n if (!this.__originalMappings) {\n this._parseMappings(this._mappings, this.sourceRoot);\n }\n\n return this.__originalMappings;\n }\n});\n\nSourceMapConsumer.prototype._charIsMappingSeparator =\n function SourceMapConsumer_charIsMappingSeparator(aStr, index) {\n var c = aStr.charAt(index);\n return c === \";\" || c === \",\";\n };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nSourceMapConsumer.prototype._parseMappings =\n function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n throw new Error(\"Subclasses must implement _parseMappings\");\n };\n\nSourceMapConsumer.GENERATED_ORDER = 1;\nSourceMapConsumer.ORIGINAL_ORDER = 2;\n\nSourceMapConsumer.GREATEST_LOWER_BOUND = 1;\nSourceMapConsumer.LEAST_UPPER_BOUND = 2;\n\n/**\n * Iterate over each mapping between an original source/line/column and a\n * generated line/column in this source map.\n *\n * @param Function aCallback\n * The function that is called with each mapping.\n * @param Object aContext\n * Optional. If specified, this object will be the value of `this` every\n * time that `aCallback` is called.\n * @param aOrder\n * Either `SourceMapConsumer.GENERATED_ORDER` or\n * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to\n * iterate over the mappings sorted by the generated file's line/column\n * order or the original's source/line/column order, respectively. Defaults to\n * `SourceMapConsumer.GENERATED_ORDER`.\n */\nSourceMapConsumer.prototype.eachMapping =\n function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) {\n var context = aContext || null;\n var order = aOrder || SourceMapConsumer.GENERATED_ORDER;\n\n var mappings;\n switch (order) {\n case SourceMapConsumer.GENERATED_ORDER:\n mappings = this._generatedMappings;\n break;\n case SourceMapConsumer.ORIGINAL_ORDER:\n mappings = this._originalMappings;\n break;\n default:\n throw new Error(\"Unknown order of iteration.\");\n }\n\n var sourceRoot = this.sourceRoot;\n mappings.map(function (mapping) {\n var source = mapping.source === null ? null : this._sources.at(mapping.source);\n source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL);\n return {\n source: source,\n generatedLine: mapping.generatedLine,\n generatedColumn: mapping.generatedColumn,\n originalLine: mapping.originalLine,\n originalColumn: mapping.originalColumn,\n name: mapping.name === null ? null : this._names.at(mapping.name)\n };\n }, this).forEach(aCallback, context);\n };\n\n/**\n * Returns all generated line and column information for the original source,\n * line, and column provided. If no column is provided, returns all mappings\n * corresponding to a either the line we are searching for or the next\n * closest line that has any mappings. Otherwise, returns all mappings\n * corresponding to the given line and either the column we are searching for\n * or the next closest column that has any offsets.\n *\n * The only argument is an object with the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number is 1-based.\n * - column: Optional. the column number in the original source.\n * The column number is 0-based.\n *\n * and an array of objects is returned, each with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based.\n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nSourceMapConsumer.prototype.allGeneratedPositionsFor =\n function SourceMapConsumer_allGeneratedPositionsFor(aArgs) {\n var line = util.getArg(aArgs, 'line');\n\n // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping\n // returns the index of the closest mapping less than the needle. By\n // setting needle.originalColumn to 0, we thus find the last mapping for\n // the given line, provided such a mapping exists.\n var needle = {\n source: util.getArg(aArgs, 'source'),\n originalLine: line,\n originalColumn: util.getArg(aArgs, 'column', 0)\n };\n\n needle.source = this._findSourceIndex(needle.source);\n if (needle.source < 0) {\n return [];\n }\n\n var mappings = [];\n\n var index = this._findMapping(needle,\n this._originalMappings,\n \"originalLine\",\n \"originalColumn\",\n util.compareByOriginalPositions,\n binarySearch.LEAST_UPPER_BOUND);\n if (index >= 0) {\n var mapping = this._originalMappings[index];\n\n if (aArgs.column === undefined) {\n var originalLine = mapping.originalLine;\n\n // Iterate until either we run out of mappings, or we run into\n // a mapping for a different line than the one we found. Since\n // mappings are sorted, this is guaranteed to find all mappings for\n // the line we found.\n while (mapping && mapping.originalLine === originalLine) {\n mappings.push({\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n });\n\n mapping = this._originalMappings[++index];\n }\n } else {\n var originalColumn = mapping.originalColumn;\n\n // Iterate until either we run out of mappings, or we run into\n // a mapping for a different line than the one we were searching for.\n // Since mappings are sorted, this is guaranteed to find all mappings for\n // the line we are searching for.\n while (mapping &&\n mapping.originalLine === line &&\n mapping.originalColumn == originalColumn) {\n mappings.push({\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n });\n\n mapping = this._originalMappings[++index];\n }\n }\n }\n\n return mappings;\n };\n\nexports.SourceMapConsumer = SourceMapConsumer;\n\n/**\n * A BasicSourceMapConsumer instance represents a parsed source map which we can\n * query for information about the original file positions by giving it a file\n * position in the generated source.\n *\n * The first parameter is the raw source map (either as a JSON string, or\n * already parsed to an object). According to the spec, source maps have the\n * following attributes:\n *\n * - version: Which version of the source map spec this map is following.\n * - sources: An array of URLs to the original source files.\n * - names: An array of identifiers which can be referrenced by individual mappings.\n * - sourceRoot: Optional. The URL root from which all sources are relative.\n * - sourcesContent: Optional. An array of contents of the original source files.\n * - mappings: A string of base64 VLQs which contain the actual mappings.\n * - file: Optional. The generated file this source map is associated with.\n *\n * Here is an example source map, taken from the source map spec[0]:\n *\n * {\n * version : 3,\n * file: \"out.js\",\n * sourceRoot : \"\",\n * sources: [\"foo.js\", \"bar.js\"],\n * names: [\"src\", \"maps\", \"are\", \"fun\"],\n * mappings: \"AA,AB;;ABCDE;\"\n * }\n *\n * The second parameter, if given, is a string whose value is the URL\n * at which the source map was found. This URL is used to compute the\n * sources array.\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1#\n */\nfunction BasicSourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n var version = util.getArg(sourceMap, 'version');\n var sources = util.getArg(sourceMap, 'sources');\n // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which\n // requires the array) to play nice here.\n var names = util.getArg(sourceMap, 'names', []);\n var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null);\n var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null);\n var mappings = util.getArg(sourceMap, 'mappings');\n var file = util.getArg(sourceMap, 'file', null);\n\n // Once again, Sass deviates from the spec and supplies the version as a\n // string rather than a number, so we use loose equality checking here.\n if (version != this._version) {\n throw new Error('Unsupported version: ' + version);\n }\n\n if (sourceRoot) {\n sourceRoot = util.normalize(sourceRoot);\n }\n\n sources = sources\n .map(String)\n // Some source maps produce relative source paths like \"./foo.js\" instead of\n // \"foo.js\". Normalize these first so that future comparisons will succeed.\n // See bugzil.la/1090768.\n .map(util.normalize)\n // Always ensure that absolute sources are internally stored relative to\n // the source root, if the source root is absolute. Not doing this would\n // be particularly problematic when the source root is a prefix of the\n // source (valid, but why??). See github issue #199 and bugzil.la/1188982.\n .map(function (source) {\n return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source)\n ? util.relative(sourceRoot, source)\n : source;\n });\n\n // Pass `true` below to allow duplicate names and sources. While source maps\n // are intended to be compressed and deduplicated, the TypeScript compiler\n // sometimes generates source maps with duplicates in them. See Github issue\n // #72 and bugzil.la/889492.\n this._names = ArraySet.fromArray(names.map(String), true);\n this._sources = ArraySet.fromArray(sources, true);\n\n this._absoluteSources = this._sources.toArray().map(function (s) {\n return util.computeSourceURL(sourceRoot, s, aSourceMapURL);\n });\n\n this.sourceRoot = sourceRoot;\n this.sourcesContent = sourcesContent;\n this._mappings = mappings;\n this._sourceMapURL = aSourceMapURL;\n this.file = file;\n}\n\nBasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nBasicSourceMapConsumer.prototype.consumer = SourceMapConsumer;\n\n/**\n * Utility function to find the index of a source. Returns -1 if not\n * found.\n */\nBasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) {\n var relativeSource = aSource;\n if (this.sourceRoot != null) {\n relativeSource = util.relative(this.sourceRoot, relativeSource);\n }\n\n if (this._sources.has(relativeSource)) {\n return this._sources.indexOf(relativeSource);\n }\n\n // Maybe aSource is an absolute URL as returned by |sources|. In\n // this case we can't simply undo the transform.\n var i;\n for (i = 0; i < this._absoluteSources.length; ++i) {\n if (this._absoluteSources[i] == aSource) {\n return i;\n }\n }\n\n return -1;\n};\n\n/**\n * Create a BasicSourceMapConsumer from a SourceMapGenerator.\n *\n * @param SourceMapGenerator aSourceMap\n * The source map that will be consumed.\n * @param String aSourceMapURL\n * The URL at which the source map can be found (optional)\n * @returns BasicSourceMapConsumer\n */\nBasicSourceMapConsumer.fromSourceMap =\n function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) {\n var smc = Object.create(BasicSourceMapConsumer.prototype);\n\n var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true);\n var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true);\n smc.sourceRoot = aSourceMap._sourceRoot;\n smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(),\n smc.sourceRoot);\n smc.file = aSourceMap._file;\n smc._sourceMapURL = aSourceMapURL;\n smc._absoluteSources = smc._sources.toArray().map(function (s) {\n return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL);\n });\n\n // Because we are modifying the entries (by converting string sources and\n // names to indices into the sources and names ArraySets), we have to make\n // a copy of the entry or else bad things happen. Shared mutable state\n // strikes again! See github issue #191.\n\n var generatedMappings = aSourceMap._mappings.toArray().slice();\n var destGeneratedMappings = smc.__generatedMappings = [];\n var destOriginalMappings = smc.__originalMappings = [];\n\n for (var i = 0, length = generatedMappings.length; i < length; i++) {\n var srcMapping = generatedMappings[i];\n var destMapping = new Mapping;\n destMapping.generatedLine = srcMapping.generatedLine;\n destMapping.generatedColumn = srcMapping.generatedColumn;\n\n if (srcMapping.source) {\n destMapping.source = sources.indexOf(srcMapping.source);\n destMapping.originalLine = srcMapping.originalLine;\n destMapping.originalColumn = srcMapping.originalColumn;\n\n if (srcMapping.name) {\n destMapping.name = names.indexOf(srcMapping.name);\n }\n\n destOriginalMappings.push(destMapping);\n }\n\n destGeneratedMappings.push(destMapping);\n }\n\n quickSort(smc.__originalMappings, util.compareByOriginalPositions);\n\n return smc;\n };\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nBasicSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(BasicSourceMapConsumer.prototype, 'sources', {\n get: function () {\n return this._absoluteSources.slice();\n }\n});\n\n/**\n * Provide the JIT with a nice shape / hidden class.\n */\nfunction Mapping() {\n this.generatedLine = 0;\n this.generatedColumn = 0;\n this.source = null;\n this.originalLine = null;\n this.originalColumn = null;\n this.name = null;\n}\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nBasicSourceMapConsumer.prototype._parseMappings =\n function SourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n var generatedLine = 1;\n var previousGeneratedColumn = 0;\n var previousOriginalLine = 0;\n var previousOriginalColumn = 0;\n var previousSource = 0;\n var previousName = 0;\n var length = aStr.length;\n var index = 0;\n var cachedSegments = {};\n var temp = {};\n var originalMappings = [];\n var generatedMappings = [];\n var mapping, str, segment, end, value;\n\n while (index < length) {\n if (aStr.charAt(index) === ';') {\n generatedLine++;\n index++;\n previousGeneratedColumn = 0;\n }\n else if (aStr.charAt(index) === ',') {\n index++;\n }\n else {\n mapping = new Mapping();\n mapping.generatedLine = generatedLine;\n\n // Because each offset is encoded relative to the previous one,\n // many segments often have the same encoding. We can exploit this\n // fact by caching the parsed variable length fields of each segment,\n // allowing us to avoid a second parse if we encounter the same\n // segment again.\n for (end = index; end < length; end++) {\n if (this._charIsMappingSeparator(aStr, end)) {\n break;\n }\n }\n str = aStr.slice(index, end);\n\n segment = cachedSegments[str];\n if (segment) {\n index += str.length;\n } else {\n segment = [];\n while (index < end) {\n base64VLQ.decode(aStr, index, temp);\n value = temp.value;\n index = temp.rest;\n segment.push(value);\n }\n\n if (segment.length === 2) {\n throw new Error('Found a source, but no line and column');\n }\n\n if (segment.length === 3) {\n throw new Error('Found a source and line, but no column');\n }\n\n cachedSegments[str] = segment;\n }\n\n // Generated column.\n mapping.generatedColumn = previousGeneratedColumn + segment[0];\n previousGeneratedColumn = mapping.generatedColumn;\n\n if (segment.length > 1) {\n // Original source.\n mapping.source = previousSource + segment[1];\n previousSource += segment[1];\n\n // Original line.\n mapping.originalLine = previousOriginalLine + segment[2];\n previousOriginalLine = mapping.originalLine;\n // Lines are stored 0-based\n mapping.originalLine += 1;\n\n // Original column.\n mapping.originalColumn = previousOriginalColumn + segment[3];\n previousOriginalColumn = mapping.originalColumn;\n\n if (segment.length > 4) {\n // Original name.\n mapping.name = previousName + segment[4];\n previousName += segment[4];\n }\n }\n\n generatedMappings.push(mapping);\n if (typeof mapping.originalLine === 'number') {\n originalMappings.push(mapping);\n }\n }\n }\n\n quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated);\n this.__generatedMappings = generatedMappings;\n\n quickSort(originalMappings, util.compareByOriginalPositions);\n this.__originalMappings = originalMappings;\n };\n\n/**\n * Find the mapping that best matches the hypothetical \"needle\" mapping that\n * we are searching for in the given \"haystack\" of mappings.\n */\nBasicSourceMapConsumer.prototype._findMapping =\n function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName,\n aColumnName, aComparator, aBias) {\n // To return the position we are searching for, we must first find the\n // mapping for the given position and then return the opposite position it\n // points to. Because the mappings are sorted, we can use binary search to\n // find the best mapping.\n\n if (aNeedle[aLineName] <= 0) {\n throw new TypeError('Line must be greater than or equal to 1, got '\n + aNeedle[aLineName]);\n }\n if (aNeedle[aColumnName] < 0) {\n throw new TypeError('Column must be greater than or equal to 0, got '\n + aNeedle[aColumnName]);\n }\n\n return binarySearch.search(aNeedle, aMappings, aComparator, aBias);\n };\n\n/**\n * Compute the last column for each generated mapping. The last column is\n * inclusive.\n */\nBasicSourceMapConsumer.prototype.computeColumnSpans =\n function SourceMapConsumer_computeColumnSpans() {\n for (var index = 0; index < this._generatedMappings.length; ++index) {\n var mapping = this._generatedMappings[index];\n\n // Mappings do not contain a field for the last generated columnt. We\n // can come up with an optimistic estimate, however, by assuming that\n // mappings are contiguous (i.e. given two consecutive mappings, the\n // first mapping ends where the second one starts).\n if (index + 1 < this._generatedMappings.length) {\n var nextMapping = this._generatedMappings[index + 1];\n\n if (mapping.generatedLine === nextMapping.generatedLine) {\n mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1;\n continue;\n }\n }\n\n // The last mapping for each line spans the entire line.\n mapping.lastGeneratedColumn = Infinity;\n }\n };\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n * - line: The line number in the generated source. The line number\n * is 1-based.\n * - column: The column number in the generated source. The column\n * number is 0-based.\n * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n * - source: The original source file, or null.\n * - line: The line number in the original source, or null. The\n * line number is 1-based.\n * - column: The column number in the original source, or null. The\n * column number is 0-based.\n * - name: The original identifier, or null.\n */\nBasicSourceMapConsumer.prototype.originalPositionFor =\n function SourceMapConsumer_originalPositionFor(aArgs) {\n var needle = {\n generatedLine: util.getArg(aArgs, 'line'),\n generatedColumn: util.getArg(aArgs, 'column')\n };\n\n var index = this._findMapping(\n needle,\n this._generatedMappings,\n \"generatedLine\",\n \"generatedColumn\",\n util.compareByGeneratedPositionsDeflated,\n util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n );\n\n if (index >= 0) {\n var mapping = this._generatedMappings[index];\n\n if (mapping.generatedLine === needle.generatedLine) {\n var source = util.getArg(mapping, 'source', null);\n if (source !== null) {\n source = this._sources.at(source);\n source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL);\n }\n var name = util.getArg(mapping, 'name', null);\n if (name !== null) {\n name = this._names.at(name);\n }\n return {\n source: source,\n line: util.getArg(mapping, 'originalLine', null),\n column: util.getArg(mapping, 'originalColumn', null),\n name: name\n };\n }\n }\n\n return {\n source: null,\n line: null,\n column: null,\n name: null\n };\n };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nBasicSourceMapConsumer.prototype.hasContentsOfAllSources =\n function BasicSourceMapConsumer_hasContentsOfAllSources() {\n if (!this.sourcesContent) {\n return false;\n }\n return this.sourcesContent.length >= this._sources.size() &&\n !this.sourcesContent.some(function (sc) { return sc == null; });\n };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nBasicSourceMapConsumer.prototype.sourceContentFor =\n function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n if (!this.sourcesContent) {\n return null;\n }\n\n var index = this._findSourceIndex(aSource);\n if (index >= 0) {\n return this.sourcesContent[index];\n }\n\n var relativeSource = aSource;\n if (this.sourceRoot != null) {\n relativeSource = util.relative(this.sourceRoot, relativeSource);\n }\n\n var url;\n if (this.sourceRoot != null\n && (url = util.urlParse(this.sourceRoot))) {\n // XXX: file:// URIs and absolute paths lead to unexpected behavior for\n // many users. We can help them out when they expect file:// URIs to\n // behave like it would if they were running a local HTTP server. See\n // https://bugzilla.mozilla.org/show_bug.cgi?id=885597.\n var fileUriAbsPath = relativeSource.replace(/^file:\\/\\//, \"\");\n if (url.scheme == \"file\"\n && this._sources.has(fileUriAbsPath)) {\n return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)]\n }\n\n if ((!url.path || url.path == \"/\")\n && this._sources.has(\"/\" + relativeSource)) {\n return this.sourcesContent[this._sources.indexOf(\"/\" + relativeSource)];\n }\n }\n\n // This function is used recursively from\n // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we\n // don't want to throw if we can't find the source - we just want to\n // return null, so we provide a flag to exit gracefully.\n if (nullOnMissing) {\n return null;\n }\n else {\n throw new Error('\"' + relativeSource + '\" is not in the SourceMap.');\n }\n };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number\n * is 1-based.\n * - column: The column number in the original source. The column\n * number is 0-based.\n * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or\n * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'.\n *\n * and an object is returned with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based.\n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nBasicSourceMapConsumer.prototype.generatedPositionFor =\n function SourceMapConsumer_generatedPositionFor(aArgs) {\n var source = util.getArg(aArgs, 'source');\n source = this._findSourceIndex(source);\n if (source < 0) {\n return {\n line: null,\n column: null,\n lastColumn: null\n };\n }\n\n var needle = {\n source: source,\n originalLine: util.getArg(aArgs, 'line'),\n originalColumn: util.getArg(aArgs, 'column')\n };\n\n var index = this._findMapping(\n needle,\n this._originalMappings,\n \"originalLine\",\n \"originalColumn\",\n util.compareByOriginalPositions,\n util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND)\n );\n\n if (index >= 0) {\n var mapping = this._originalMappings[index];\n\n if (mapping.source === needle.source) {\n return {\n line: util.getArg(mapping, 'generatedLine', null),\n column: util.getArg(mapping, 'generatedColumn', null),\n lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null)\n };\n }\n }\n\n return {\n line: null,\n column: null,\n lastColumn: null\n };\n };\n\nexports.BasicSourceMapConsumer = BasicSourceMapConsumer;\n\n/**\n * An IndexedSourceMapConsumer instance represents a parsed source map which\n * we can query for information. It differs from BasicSourceMapConsumer in\n * that it takes \"indexed\" source maps (i.e. ones with a \"sections\" field) as\n * input.\n *\n * The first parameter is a raw source map (either as a JSON string, or already\n * parsed to an object). According to the spec for indexed source maps, they\n * have the following attributes:\n *\n * - version: Which version of the source map spec this map is following.\n * - file: Optional. The generated file this source map is associated with.\n * - sections: A list of section definitions.\n *\n * Each value under the \"sections\" field has two fields:\n * - offset: The offset into the original specified at which this section\n * begins to apply, defined as an object with a \"line\" and \"column\"\n * field.\n * - map: A source map definition. This source map could also be indexed,\n * but doesn't have to be.\n *\n * Instead of the \"map\" field, it's also possible to have a \"url\" field\n * specifying a URL to retrieve a source map from, but that's currently\n * unsupported.\n *\n * Here's an example source map, taken from the source map spec[0], but\n * modified to omit a section which uses the \"url\" field.\n *\n * {\n * version : 3,\n * file: \"app.js\",\n * sections: [{\n * offset: {line:100, column:10},\n * map: {\n * version : 3,\n * file: \"section.js\",\n * sources: [\"foo.js\", \"bar.js\"],\n * names: [\"src\", \"maps\", \"are\", \"fun\"],\n * mappings: \"AAAA,E;;ABCDE;\"\n * }\n * }],\n * }\n *\n * The second parameter, if given, is a string whose value is the URL\n * at which the source map was found. This URL is used to compute the\n * sources array.\n *\n * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt\n */\nfunction IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) {\n var sourceMap = aSourceMap;\n if (typeof aSourceMap === 'string') {\n sourceMap = util.parseSourceMapInput(aSourceMap);\n }\n\n var version = util.getArg(sourceMap, 'version');\n var sections = util.getArg(sourceMap, 'sections');\n\n if (version != this._version) {\n throw new Error('Unsupported version: ' + version);\n }\n\n this._sources = new ArraySet();\n this._names = new ArraySet();\n\n var lastOffset = {\n line: -1,\n column: 0\n };\n this._sections = sections.map(function (s) {\n if (s.url) {\n // The url field will require support for asynchronicity.\n // See https://github.com/mozilla/source-map/issues/16\n throw new Error('Support for url field in sections not implemented.');\n }\n var offset = util.getArg(s, 'offset');\n var offsetLine = util.getArg(offset, 'line');\n var offsetColumn = util.getArg(offset, 'column');\n\n if (offsetLine < lastOffset.line ||\n (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) {\n throw new Error('Section offsets must be ordered and non-overlapping.');\n }\n lastOffset = offset;\n\n return {\n generatedOffset: {\n // The offset fields are 0-based, but we use 1-based indices when\n // encoding/decoding from VLQ.\n generatedLine: offsetLine + 1,\n generatedColumn: offsetColumn + 1\n },\n consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL)\n }\n });\n}\n\nIndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype);\nIndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer;\n\n/**\n * The version of the source mapping spec that we are consuming.\n */\nIndexedSourceMapConsumer.prototype._version = 3;\n\n/**\n * The list of original sources.\n */\nObject.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', {\n get: function () {\n var sources = [];\n for (var i = 0; i < this._sections.length; i++) {\n for (var j = 0; j < this._sections[i].consumer.sources.length; j++) {\n sources.push(this._sections[i].consumer.sources[j]);\n }\n }\n return sources;\n }\n});\n\n/**\n * Returns the original source, line, and column information for the generated\n * source's line and column positions provided. The only argument is an object\n * with the following properties:\n *\n * - line: The line number in the generated source. The line number\n * is 1-based.\n * - column: The column number in the generated source. The column\n * number is 0-based.\n *\n * and an object is returned with the following properties:\n *\n * - source: The original source file, or null.\n * - line: The line number in the original source, or null. The\n * line number is 1-based.\n * - column: The column number in the original source, or null. The\n * column number is 0-based.\n * - name: The original identifier, or null.\n */\nIndexedSourceMapConsumer.prototype.originalPositionFor =\n function IndexedSourceMapConsumer_originalPositionFor(aArgs) {\n var needle = {\n generatedLine: util.getArg(aArgs, 'line'),\n generatedColumn: util.getArg(aArgs, 'column')\n };\n\n // Find the section containing the generated position we're trying to map\n // to an original position.\n var sectionIndex = binarySearch.search(needle, this._sections,\n function(needle, section) {\n var cmp = needle.generatedLine - section.generatedOffset.generatedLine;\n if (cmp) {\n return cmp;\n }\n\n return (needle.generatedColumn -\n section.generatedOffset.generatedColumn);\n });\n var section = this._sections[sectionIndex];\n\n if (!section) {\n return {\n source: null,\n line: null,\n column: null,\n name: null\n };\n }\n\n return section.consumer.originalPositionFor({\n line: needle.generatedLine -\n (section.generatedOffset.generatedLine - 1),\n column: needle.generatedColumn -\n (section.generatedOffset.generatedLine === needle.generatedLine\n ? section.generatedOffset.generatedColumn - 1\n : 0),\n bias: aArgs.bias\n });\n };\n\n/**\n * Return true if we have the source content for every source in the source\n * map, false otherwise.\n */\nIndexedSourceMapConsumer.prototype.hasContentsOfAllSources =\n function IndexedSourceMapConsumer_hasContentsOfAllSources() {\n return this._sections.every(function (s) {\n return s.consumer.hasContentsOfAllSources();\n });\n };\n\n/**\n * Returns the original source content. The only argument is the url of the\n * original source file. Returns null if no original source content is\n * available.\n */\nIndexedSourceMapConsumer.prototype.sourceContentFor =\n function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) {\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n\n var content = section.consumer.sourceContentFor(aSource, true);\n if (content) {\n return content;\n }\n }\n if (nullOnMissing) {\n return null;\n }\n else {\n throw new Error('\"' + aSource + '\" is not in the SourceMap.');\n }\n };\n\n/**\n * Returns the generated line and column information for the original source,\n * line, and column positions provided. The only argument is an object with\n * the following properties:\n *\n * - source: The filename of the original source.\n * - line: The line number in the original source. The line number\n * is 1-based.\n * - column: The column number in the original source. The column\n * number is 0-based.\n *\n * and an object is returned with the following properties:\n *\n * - line: The line number in the generated source, or null. The\n * line number is 1-based. \n * - column: The column number in the generated source, or null.\n * The column number is 0-based.\n */\nIndexedSourceMapConsumer.prototype.generatedPositionFor =\n function IndexedSourceMapConsumer_generatedPositionFor(aArgs) {\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n\n // Only consider this section if the requested source is in the list of\n // sources of the consumer.\n if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) {\n continue;\n }\n var generatedPosition = section.consumer.generatedPositionFor(aArgs);\n if (generatedPosition) {\n var ret = {\n line: generatedPosition.line +\n (section.generatedOffset.generatedLine - 1),\n column: generatedPosition.column +\n (section.generatedOffset.generatedLine === generatedPosition.line\n ? section.generatedOffset.generatedColumn - 1\n : 0)\n };\n return ret;\n }\n }\n\n return {\n line: null,\n column: null\n };\n };\n\n/**\n * Parse the mappings in a string in to a data structure which we can easily\n * query (the ordered arrays in the `this.__generatedMappings` and\n * `this.__originalMappings` properties).\n */\nIndexedSourceMapConsumer.prototype._parseMappings =\n function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) {\n this.__generatedMappings = [];\n this.__originalMappings = [];\n for (var i = 0; i < this._sections.length; i++) {\n var section = this._sections[i];\n var sectionMappings = section.consumer._generatedMappings;\n for (var j = 0; j < sectionMappings.length; j++) {\n var mapping = sectionMappings[j];\n\n var source = section.consumer._sources.at(mapping.source);\n source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL);\n this._sources.add(source);\n source = this._sources.indexOf(source);\n\n var name = null;\n if (mapping.name) {\n name = section.consumer._names.at(mapping.name);\n this._names.add(name);\n name = this._names.indexOf(name);\n }\n\n // The mappings coming from the consumer for the section have\n // generated positions relative to the start of the section, so we\n // need to offset them to be relative to the start of the concatenated\n // generated file.\n var adjustedMapping = {\n source: source,\n generatedLine: mapping.generatedLine +\n (section.generatedOffset.generatedLine - 1),\n generatedColumn: mapping.generatedColumn +\n (section.generatedOffset.generatedLine === mapping.generatedLine\n ? section.generatedOffset.generatedColumn - 1\n : 0),\n originalLine: mapping.originalLine,\n originalColumn: mapping.originalColumn,\n name: name\n };\n\n this.__generatedMappings.push(adjustedMapping);\n if (typeof adjustedMapping.originalLine === 'number') {\n this.__originalMappings.push(adjustedMapping);\n }\n }\n }\n\n quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated);\n quickSort(this.__originalMappings, util.compareByOriginalPositions);\n };\n\nexports.IndexedSourceMapConsumer = IndexedSourceMapConsumer;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-map-consumer.js\n// module id = 7\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nexports.GREATEST_LOWER_BOUND = 1;\nexports.LEAST_UPPER_BOUND = 2;\n\n/**\n * Recursive implementation of binary search.\n *\n * @param aLow Indices here and lower do not contain the needle.\n * @param aHigh Indices here and higher do not contain the needle.\n * @param aNeedle The element being searched for.\n * @param aHaystack The non-empty array being searched.\n * @param aCompare Function which takes two elements and returns -1, 0, or 1.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n */\nfunction recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) {\n // This function terminates when one of the following is true:\n //\n // 1. We find the exact element we are looking for.\n //\n // 2. We did not find the exact element, but we can return the index of\n // the next-closest element.\n //\n // 3. We did not find the exact element, and there is no next-closest\n // element than the one we are searching for, so we return -1.\n var mid = Math.floor((aHigh - aLow) / 2) + aLow;\n var cmp = aCompare(aNeedle, aHaystack[mid], true);\n if (cmp === 0) {\n // Found the element we are looking for.\n return mid;\n }\n else if (cmp > 0) {\n // Our needle is greater than aHaystack[mid].\n if (aHigh - mid > 1) {\n // The element is in the upper half.\n return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias);\n }\n\n // The exact needle element was not found in this haystack. Determine if\n // we are in termination case (3) or (2) and return the appropriate thing.\n if (aBias == exports.LEAST_UPPER_BOUND) {\n return aHigh < aHaystack.length ? aHigh : -1;\n } else {\n return mid;\n }\n }\n else {\n // Our needle is less than aHaystack[mid].\n if (mid - aLow > 1) {\n // The element is in the lower half.\n return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias);\n }\n\n // we are in termination case (3) or (2) and return the appropriate thing.\n if (aBias == exports.LEAST_UPPER_BOUND) {\n return mid;\n } else {\n return aLow < 0 ? -1 : aLow;\n }\n }\n}\n\n/**\n * This is an implementation of binary search which will always try and return\n * the index of the closest element if there is no exact hit. This is because\n * mappings between original and generated line/col pairs are single points,\n * and there is an implicit region between each of them, so a miss just means\n * that you aren't on the very start of a region.\n *\n * @param aNeedle The element you are looking for.\n * @param aHaystack The array that is being searched.\n * @param aCompare A function which takes the needle and an element in the\n * array and returns -1, 0, or 1 depending on whether the needle is less\n * than, equal to, or greater than the element, respectively.\n * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or\n * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the\n * closest element that is smaller than or greater than the one we are\n * searching for, respectively, if the exact element cannot be found.\n * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'.\n */\nexports.search = function search(aNeedle, aHaystack, aCompare, aBias) {\n if (aHaystack.length === 0) {\n return -1;\n }\n\n var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack,\n aCompare, aBias || exports.GREATEST_LOWER_BOUND);\n if (index < 0) {\n return -1;\n }\n\n // We have found either the exact element, or the next-closest element than\n // the one we are searching for. However, there may be more than one such\n // element. Make sure we always return the smallest of these.\n while (index - 1 >= 0) {\n if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) {\n break;\n }\n --index;\n }\n\n return index;\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/binary-search.js\n// module id = 8\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\n// It turns out that some (most?) JavaScript engines don't self-host\n// `Array.prototype.sort`. This makes sense because C++ will likely remain\n// faster than JS when doing raw CPU-intensive sorting. However, when using a\n// custom comparator function, calling back and forth between the VM's C++ and\n// JIT'd JS is rather slow *and* loses JIT type information, resulting in\n// worse generated code for the comparator function than would be optimal. In\n// fact, when sorting with a comparator, these costs outweigh the benefits of\n// sorting in C++. By using our own JS-implemented Quick Sort (below), we get\n// a ~3500ms mean speed-up in `bench/bench.html`.\n\n/**\n * Swap the elements indexed by `x` and `y` in the array `ary`.\n *\n * @param {Array} ary\n * The array.\n * @param {Number} x\n * The index of the first item.\n * @param {Number} y\n * The index of the second item.\n */\nfunction swap(ary, x, y) {\n var temp = ary[x];\n ary[x] = ary[y];\n ary[y] = temp;\n}\n\n/**\n * Returns a random integer within the range `low .. high` inclusive.\n *\n * @param {Number} low\n * The lower bound on the range.\n * @param {Number} high\n * The upper bound on the range.\n */\nfunction randomIntInRange(low, high) {\n return Math.round(low + (Math.random() * (high - low)));\n}\n\n/**\n * The Quick Sort algorithm.\n *\n * @param {Array} ary\n * An array to sort.\n * @param {function} comparator\n * Function to use to compare two items.\n * @param {Number} p\n * Start index of the array\n * @param {Number} r\n * End index of the array\n */\nfunction doQuickSort(ary, comparator, p, r) {\n // If our lower bound is less than our upper bound, we (1) partition the\n // array into two pieces and (2) recurse on each half. If it is not, this is\n // the empty array and our base case.\n\n if (p < r) {\n // (1) Partitioning.\n //\n // The partitioning chooses a pivot between `p` and `r` and moves all\n // elements that are less than or equal to the pivot to the before it, and\n // all the elements that are greater than it after it. The effect is that\n // once partition is done, the pivot is in the exact place it will be when\n // the array is put in sorted order, and it will not need to be moved\n // again. This runs in O(n) time.\n\n // Always choose a random pivot so that an input array which is reverse\n // sorted does not cause O(n^2) running time.\n var pivotIndex = randomIntInRange(p, r);\n var i = p - 1;\n\n swap(ary, pivotIndex, r);\n var pivot = ary[r];\n\n // Immediately after `j` is incremented in this loop, the following hold\n // true:\n //\n // * Every element in `ary[p .. i]` is less than or equal to the pivot.\n //\n // * Every element in `ary[i+1 .. j-1]` is greater than the pivot.\n for (var j = p; j < r; j++) {\n if (comparator(ary[j], pivot) <= 0) {\n i += 1;\n swap(ary, i, j);\n }\n }\n\n swap(ary, i + 1, j);\n var q = i + 1;\n\n // (2) Recurse on each half.\n\n doQuickSort(ary, comparator, p, q - 1);\n doQuickSort(ary, comparator, q + 1, r);\n }\n}\n\n/**\n * Sort the given array in-place with the given comparator function.\n *\n * @param {Array} ary\n * An array to sort.\n * @param {function} comparator\n * Function to use to compare two items.\n */\nexports.quickSort = function (ary, comparator) {\n doQuickSort(ary, comparator, 0, ary.length - 1);\n};\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/quick-sort.js\n// module id = 9\n// module chunks = 0","/* -*- Mode: js; js-indent-level: 2; -*- */\n/*\n * Copyright 2011 Mozilla Foundation and contributors\n * Licensed under the New BSD license. See LICENSE or:\n * http://opensource.org/licenses/BSD-3-Clause\n */\n\nvar SourceMapGenerator = require('./source-map-generator').SourceMapGenerator;\nvar util = require('./util');\n\n// Matches a Windows-style `\\r\\n` newline or a `\\n` newline used by all other\n// operating systems these days (capturing the result).\nvar REGEX_NEWLINE = /(\\r?\\n)/;\n\n// Newline character code for charCodeAt() comparisons\nvar NEWLINE_CODE = 10;\n\n// Private symbol for identifying `SourceNode`s when multiple versions of\n// the source-map library are loaded. This MUST NOT CHANGE across\n// versions!\nvar isSourceNode = \"$$$isSourceNode$$$\";\n\n/**\n * SourceNodes provide a way to abstract over interpolating/concatenating\n * snippets of generated JavaScript source code while maintaining the line and\n * column information associated with the original source code.\n *\n * @param aLine The original line number.\n * @param aColumn The original column number.\n * @param aSource The original source's filename.\n * @param aChunks Optional. An array of strings which are snippets of\n * generated JS, or other SourceNodes.\n * @param aName The original identifier.\n */\nfunction SourceNode(aLine, aColumn, aSource, aChunks, aName) {\n this.children = [];\n this.sourceContents = {};\n this.line = aLine == null ? null : aLine;\n this.column = aColumn == null ? null : aColumn;\n this.source = aSource == null ? null : aSource;\n this.name = aName == null ? null : aName;\n this[isSourceNode] = true;\n if (aChunks != null) this.add(aChunks);\n}\n\n/**\n * Creates a SourceNode from generated code and a SourceMapConsumer.\n *\n * @param aGeneratedCode The generated code\n * @param aSourceMapConsumer The SourceMap for the generated code\n * @param aRelativePath Optional. The path that relative sources in the\n * SourceMapConsumer should be relative to.\n */\nSourceNode.fromStringWithSourceMap =\n function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) {\n // The SourceNode we want to fill with the generated code\n // and the SourceMap\n var node = new SourceNode();\n\n // All even indices of this array are one line of the generated code,\n // while all odd indices are the newlines between two adjacent lines\n // (since `REGEX_NEWLINE` captures its match).\n // Processed fragments are accessed by calling `shiftNextLine`.\n var remainingLines = aGeneratedCode.split(REGEX_NEWLINE);\n var remainingLinesIndex = 0;\n var shiftNextLine = function() {\n var lineContents = getNextLine();\n // The last line of a file might not have a newline.\n var newLine = getNextLine() || \"\";\n return lineContents + newLine;\n\n function getNextLine() {\n return remainingLinesIndex < remainingLines.length ?\n remainingLines[remainingLinesIndex++] : undefined;\n }\n };\n\n // We need to remember the position of \"remainingLines\"\n var lastGeneratedLine = 1, lastGeneratedColumn = 0;\n\n // The generate SourceNodes we need a code range.\n // To extract it current and last mapping is used.\n // Here we store the last mapping.\n var lastMapping = null;\n\n aSourceMapConsumer.eachMapping(function (mapping) {\n if (lastMapping !== null) {\n // We add the code from \"lastMapping\" to \"mapping\":\n // First check if there is a new line in between.\n if (lastGeneratedLine < mapping.generatedLine) {\n // Associate first line with \"lastMapping\"\n addMappingWithCode(lastMapping, shiftNextLine());\n lastGeneratedLine++;\n lastGeneratedColumn = 0;\n // The remaining code is added without mapping\n } else {\n // There is no new line in between.\n // Associate the code between \"lastGeneratedColumn\" and\n // \"mapping.generatedColumn\" with \"lastMapping\"\n var nextLine = remainingLines[remainingLinesIndex] || '';\n var code = nextLine.substr(0, mapping.generatedColumn -\n lastGeneratedColumn);\n remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn -\n lastGeneratedColumn);\n lastGeneratedColumn = mapping.generatedColumn;\n addMappingWithCode(lastMapping, code);\n // No more remaining code, continue\n lastMapping = mapping;\n return;\n }\n }\n // We add the generated code until the first mapping\n // to the SourceNode without any mapping.\n // Each line is added as separate string.\n while (lastGeneratedLine < mapping.generatedLine) {\n node.add(shiftNextLine());\n lastGeneratedLine++;\n }\n if (lastGeneratedColumn < mapping.generatedColumn) {\n var nextLine = remainingLines[remainingLinesIndex] || '';\n node.add(nextLine.substr(0, mapping.generatedColumn));\n remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn);\n lastGeneratedColumn = mapping.generatedColumn;\n }\n lastMapping = mapping;\n }, this);\n // We have processed all mappings.\n if (remainingLinesIndex < remainingLines.length) {\n if (lastMapping) {\n // Associate the remaining code in the current line with \"lastMapping\"\n addMappingWithCode(lastMapping, shiftNextLine());\n }\n // and add the remaining lines without any mapping\n node.add(remainingLines.splice(remainingLinesIndex).join(\"\"));\n }\n\n // Copy sourcesContent into SourceNode\n aSourceMapConsumer.sources.forEach(function (sourceFile) {\n var content = aSourceMapConsumer.sourceContentFor(sourceFile);\n if (content != null) {\n if (aRelativePath != null) {\n sourceFile = util.join(aRelativePath, sourceFile);\n }\n node.setSourceContent(sourceFile, content);\n }\n });\n\n return node;\n\n function addMappingWithCode(mapping, code) {\n if (mapping === null || mapping.source === undefined) {\n node.add(code);\n } else {\n var source = aRelativePath\n ? util.join(aRelativePath, mapping.source)\n : mapping.source;\n node.add(new SourceNode(mapping.originalLine,\n mapping.originalColumn,\n source,\n code,\n mapping.name));\n }\n }\n };\n\n/**\n * Add a chunk of generated JS to this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n * SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.add = function SourceNode_add(aChunk) {\n if (Array.isArray(aChunk)) {\n aChunk.forEach(function (chunk) {\n this.add(chunk);\n }, this);\n }\n else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n if (aChunk) {\n this.children.push(aChunk);\n }\n }\n else {\n throw new TypeError(\n \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n );\n }\n return this;\n};\n\n/**\n * Add a chunk of generated JS to the beginning of this source node.\n *\n * @param aChunk A string snippet of generated JS code, another instance of\n * SourceNode, or an array where each member is one of those things.\n */\nSourceNode.prototype.prepend = function SourceNode_prepend(aChunk) {\n if (Array.isArray(aChunk)) {\n for (var i = aChunk.length-1; i >= 0; i--) {\n this.prepend(aChunk[i]);\n }\n }\n else if (aChunk[isSourceNode] || typeof aChunk === \"string\") {\n this.children.unshift(aChunk);\n }\n else {\n throw new TypeError(\n \"Expected a SourceNode, string, or an array of SourceNodes and strings. Got \" + aChunk\n );\n }\n return this;\n};\n\n/**\n * Walk over the tree of JS snippets in this node and its children. The\n * walking function is called once for each snippet of JS and is passed that\n * snippet and the its original associated source's line/column location.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walk = function SourceNode_walk(aFn) {\n var chunk;\n for (var i = 0, len = this.children.length; i < len; i++) {\n chunk = this.children[i];\n if (chunk[isSourceNode]) {\n chunk.walk(aFn);\n }\n else {\n if (chunk !== '') {\n aFn(chunk, { source: this.source,\n line: this.line,\n column: this.column,\n name: this.name });\n }\n }\n }\n};\n\n/**\n * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between\n * each of `this.children`.\n *\n * @param aSep The separator.\n */\nSourceNode.prototype.join = function SourceNode_join(aSep) {\n var newChildren;\n var i;\n var len = this.children.length;\n if (len > 0) {\n newChildren = [];\n for (i = 0; i < len-1; i++) {\n newChildren.push(this.children[i]);\n newChildren.push(aSep);\n }\n newChildren.push(this.children[i]);\n this.children = newChildren;\n }\n return this;\n};\n\n/**\n * Call String.prototype.replace on the very right-most source snippet. Useful\n * for trimming whitespace from the end of a source node, etc.\n *\n * @param aPattern The pattern to replace.\n * @param aReplacement The thing to replace the pattern with.\n */\nSourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) {\n var lastChild = this.children[this.children.length - 1];\n if (lastChild[isSourceNode]) {\n lastChild.replaceRight(aPattern, aReplacement);\n }\n else if (typeof lastChild === 'string') {\n this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement);\n }\n else {\n this.children.push(''.replace(aPattern, aReplacement));\n }\n return this;\n};\n\n/**\n * Set the source content for a source file. This will be added to the SourceMapGenerator\n * in the sourcesContent field.\n *\n * @param aSourceFile The filename of the source file\n * @param aSourceContent The content of the source file\n */\nSourceNode.prototype.setSourceContent =\n function SourceNode_setSourceContent(aSourceFile, aSourceContent) {\n this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent;\n };\n\n/**\n * Walk over the tree of SourceNodes. The walking function is called for each\n * source file content and is passed the filename and source content.\n *\n * @param aFn The traversal function.\n */\nSourceNode.prototype.walkSourceContents =\n function SourceNode_walkSourceContents(aFn) {\n for (var i = 0, len = this.children.length; i < len; i++) {\n if (this.children[i][isSourceNode]) {\n this.children[i].walkSourceContents(aFn);\n }\n }\n\n var sources = Object.keys(this.sourceContents);\n for (var i = 0, len = sources.length; i < len; i++) {\n aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]);\n }\n };\n\n/**\n * Return the string representation of this source node. Walks over the tree\n * and concatenates all the various snippets together to one string.\n */\nSourceNode.prototype.toString = function SourceNode_toString() {\n var str = \"\";\n this.walk(function (chunk) {\n str += chunk;\n });\n return str;\n};\n\n/**\n * Returns the string representation of this source node along with a source\n * map.\n */\nSourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) {\n var generated = {\n code: \"\",\n line: 1,\n column: 0\n };\n var map = new SourceMapGenerator(aArgs);\n var sourceMappingActive = false;\n var lastOriginalSource = null;\n var lastOriginalLine = null;\n var lastOriginalColumn = null;\n var lastOriginalName = null;\n this.walk(function (chunk, original) {\n generated.code += chunk;\n if (original.source !== null\n && original.line !== null\n && original.column !== null) {\n if(lastOriginalSource !== original.source\n || lastOriginalLine !== original.line\n || lastOriginalColumn !== original.column\n || lastOriginalName !== original.name) {\n map.addMapping({\n source: original.source,\n original: {\n line: original.line,\n column: original.column\n },\n generated: {\n line: generated.line,\n column: generated.column\n },\n name: original.name\n });\n }\n lastOriginalSource = original.source;\n lastOriginalLine = original.line;\n lastOriginalColumn = original.column;\n lastOriginalName = original.name;\n sourceMappingActive = true;\n } else if (sourceMappingActive) {\n map.addMapping({\n generated: {\n line: generated.line,\n column: generated.column\n }\n });\n lastOriginalSource = null;\n sourceMappingActive = false;\n }\n for (var idx = 0, length = chunk.length; idx < length; idx++) {\n if (chunk.charCodeAt(idx) === NEWLINE_CODE) {\n generated.line++;\n generated.column = 0;\n // Mappings end at eol\n if (idx + 1 === length) {\n lastOriginalSource = null;\n sourceMappingActive = false;\n } else if (sourceMappingActive) {\n map.addMapping({\n source: original.source,\n original: {\n line: original.line,\n column: original.column\n },\n generated: {\n line: generated.line,\n column: generated.column\n },\n name: original.name\n });\n }\n } else {\n generated.column++;\n }\n }\n });\n this.walkSourceContents(function (sourceFile, sourceContent) {\n map.setSourceContent(sourceFile, sourceContent);\n });\n\n return { code: generated.code, map: map };\n};\n\nexports.SourceNode = SourceNode;\n\n\n\n//////////////////\n// WEBPACK FOOTER\n// ./lib/source-node.js\n// module id = 10\n// module chunks = 0"],"sourceRoot":""}
\ No newline at end of file diff --git a/node_modules/ava/node_modules/source-map/lib/array-set.js b/node_modules/ava/node_modules/source-map/lib/array-set.js new file mode 100644 index 000000000..fbd5c81ca --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/array-set.js @@ -0,0 +1,121 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); +var has = Object.prototype.hasOwnProperty; +var hasNativeMap = typeof Map !== "undefined"; + +/** + * A data structure which is a combination of an array and a set. Adding a new + * member is O(1), testing for membership is O(1), and finding the index of an + * element is O(1). Removing elements from the set is not supported. Only + * strings are supported for membership. + */ +function ArraySet() { + this._array = []; + this._set = hasNativeMap ? new Map() : Object.create(null); +} + +/** + * Static method for creating ArraySet instances from an existing array. + */ +ArraySet.fromArray = function ArraySet_fromArray(aArray, aAllowDuplicates) { + var set = new ArraySet(); + for (var i = 0, len = aArray.length; i < len; i++) { + set.add(aArray[i], aAllowDuplicates); + } + return set; +}; + +/** + * Return how many unique items are in this ArraySet. If duplicates have been + * added, than those do not count towards the size. + * + * @returns Number + */ +ArraySet.prototype.size = function ArraySet_size() { + return hasNativeMap ? this._set.size : Object.getOwnPropertyNames(this._set).length; +}; + +/** + * Add the given string to this set. + * + * @param String aStr + */ +ArraySet.prototype.add = function ArraySet_add(aStr, aAllowDuplicates) { + var sStr = hasNativeMap ? aStr : util.toSetString(aStr); + var isDuplicate = hasNativeMap ? this.has(aStr) : has.call(this._set, sStr); + var idx = this._array.length; + if (!isDuplicate || aAllowDuplicates) { + this._array.push(aStr); + } + if (!isDuplicate) { + if (hasNativeMap) { + this._set.set(aStr, idx); + } else { + this._set[sStr] = idx; + } + } +}; + +/** + * Is the given string a member of this set? + * + * @param String aStr + */ +ArraySet.prototype.has = function ArraySet_has(aStr) { + if (hasNativeMap) { + return this._set.has(aStr); + } else { + var sStr = util.toSetString(aStr); + return has.call(this._set, sStr); + } +}; + +/** + * What is the index of the given string in the array? + * + * @param String aStr + */ +ArraySet.prototype.indexOf = function ArraySet_indexOf(aStr) { + if (hasNativeMap) { + var idx = this._set.get(aStr); + if (idx >= 0) { + return idx; + } + } else { + var sStr = util.toSetString(aStr); + if (has.call(this._set, sStr)) { + return this._set[sStr]; + } + } + + throw new Error('"' + aStr + '" is not in the set.'); +}; + +/** + * What is the element at the given index? + * + * @param Number aIdx + */ +ArraySet.prototype.at = function ArraySet_at(aIdx) { + if (aIdx >= 0 && aIdx < this._array.length) { + return this._array[aIdx]; + } + throw new Error('No element indexed by ' + aIdx); +}; + +/** + * Returns the array representation of this set (which has the proper indices + * indicated by indexOf). Note that this is a copy of the internal array used + * for storing the members so that no one can mess with internal state. + */ +ArraySet.prototype.toArray = function ArraySet_toArray() { + return this._array.slice(); +}; + +exports.ArraySet = ArraySet; diff --git a/node_modules/ava/node_modules/source-map/lib/base64-vlq.js b/node_modules/ava/node_modules/source-map/lib/base64-vlq.js new file mode 100644 index 000000000..612b40401 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/base64-vlq.js @@ -0,0 +1,140 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + * + * Based on the Base 64 VLQ implementation in Closure Compiler: + * https://code.google.com/p/closure-compiler/source/browse/trunk/src/com/google/debugging/sourcemap/Base64VLQ.java + * + * Copyright 2011 The Closure Compiler Authors. All rights reserved. + * Redistribution and use in source and binary forms, with or without + * modification, are permitted provided that the following conditions are + * met: + * + * * Redistributions of source code must retain the above copyright + * notice, this list of conditions and the following disclaimer. + * * Redistributions in binary form must reproduce the above + * copyright notice, this list of conditions and the following + * disclaimer in the documentation and/or other materials provided + * with the distribution. + * * Neither the name of Google Inc. nor the names of its + * contributors may be used to endorse or promote products derived + * from this software without specific prior written permission. + * + * THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS AND CONTRIBUTORS + * "AS IS" AND ANY EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT + * LIMITED TO, THE IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR + * A PARTICULAR PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT + * OWNER OR CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, + * SPECIAL, EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT + * LIMITED TO, PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, + * DATA, OR PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY + * THEORY OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT + * (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE + * OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE. + */ + +var base64 = require('./base64'); + +// A single base 64 digit can contain 6 bits of data. For the base 64 variable +// length quantities we use in the source map spec, the first bit is the sign, +// the next four bits are the actual value, and the 6th bit is the +// continuation bit. The continuation bit tells us whether there are more +// digits in this value following this digit. +// +// Continuation +// | Sign +// | | +// V V +// 101011 + +var VLQ_BASE_SHIFT = 5; + +// binary: 100000 +var VLQ_BASE = 1 << VLQ_BASE_SHIFT; + +// binary: 011111 +var VLQ_BASE_MASK = VLQ_BASE - 1; + +// binary: 100000 +var VLQ_CONTINUATION_BIT = VLQ_BASE; + +/** + * Converts from a two-complement value to a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 1 becomes 2 (10 binary), -1 becomes 3 (11 binary) + * 2 becomes 4 (100 binary), -2 becomes 5 (101 binary) + */ +function toVLQSigned(aValue) { + return aValue < 0 + ? ((-aValue) << 1) + 1 + : (aValue << 1) + 0; +} + +/** + * Converts to a two-complement value from a value where the sign bit is + * placed in the least significant bit. For example, as decimals: + * 2 (10 binary) becomes 1, 3 (11 binary) becomes -1 + * 4 (100 binary) becomes 2, 5 (101 binary) becomes -2 + */ +function fromVLQSigned(aValue) { + var isNegative = (aValue & 1) === 1; + var shifted = aValue >> 1; + return isNegative + ? -shifted + : shifted; +} + +/** + * Returns the base 64 VLQ encoded value. + */ +exports.encode = function base64VLQ_encode(aValue) { + var encoded = ""; + var digit; + + var vlq = toVLQSigned(aValue); + + do { + digit = vlq & VLQ_BASE_MASK; + vlq >>>= VLQ_BASE_SHIFT; + if (vlq > 0) { + // There are still more digits in this value, so we must make sure the + // continuation bit is marked. + digit |= VLQ_CONTINUATION_BIT; + } + encoded += base64.encode(digit); + } while (vlq > 0); + + return encoded; +}; + +/** + * Decodes the next base 64 VLQ value from the given string and returns the + * value and the rest of the string via the out parameter. + */ +exports.decode = function base64VLQ_decode(aStr, aIndex, aOutParam) { + var strLen = aStr.length; + var result = 0; + var shift = 0; + var continuation, digit; + + do { + if (aIndex >= strLen) { + throw new Error("Expected more digits in base 64 VLQ value."); + } + + digit = base64.decode(aStr.charCodeAt(aIndex++)); + if (digit === -1) { + throw new Error("Invalid base64 digit: " + aStr.charAt(aIndex - 1)); + } + + continuation = !!(digit & VLQ_CONTINUATION_BIT); + digit &= VLQ_BASE_MASK; + result = result + (digit << shift); + shift += VLQ_BASE_SHIFT; + } while (continuation); + + aOutParam.value = fromVLQSigned(result); + aOutParam.rest = aIndex; +}; diff --git a/node_modules/ava/node_modules/source-map/lib/base64.js b/node_modules/ava/node_modules/source-map/lib/base64.js new file mode 100644 index 000000000..8aa86b302 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/base64.js @@ -0,0 +1,67 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var intToCharMap = 'ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/'.split(''); + +/** + * Encode an integer in the range of 0 to 63 to a single base 64 digit. + */ +exports.encode = function (number) { + if (0 <= number && number < intToCharMap.length) { + return intToCharMap[number]; + } + throw new TypeError("Must be between 0 and 63: " + number); +}; + +/** + * Decode a single base 64 character code digit to an integer. Returns -1 on + * failure. + */ +exports.decode = function (charCode) { + var bigA = 65; // 'A' + var bigZ = 90; // 'Z' + + var littleA = 97; // 'a' + var littleZ = 122; // 'z' + + var zero = 48; // '0' + var nine = 57; // '9' + + var plus = 43; // '+' + var slash = 47; // '/' + + var littleOffset = 26; + var numberOffset = 52; + + // 0 - 25: ABCDEFGHIJKLMNOPQRSTUVWXYZ + if (bigA <= charCode && charCode <= bigZ) { + return (charCode - bigA); + } + + // 26 - 51: abcdefghijklmnopqrstuvwxyz + if (littleA <= charCode && charCode <= littleZ) { + return (charCode - littleA + littleOffset); + } + + // 52 - 61: 0123456789 + if (zero <= charCode && charCode <= nine) { + return (charCode - zero + numberOffset); + } + + // 62: + + if (charCode == plus) { + return 62; + } + + // 63: / + if (charCode == slash) { + return 63; + } + + // Invalid base64 digit. + return -1; +}; diff --git a/node_modules/ava/node_modules/source-map/lib/binary-search.js b/node_modules/ava/node_modules/source-map/lib/binary-search.js new file mode 100644 index 000000000..010ac941e --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/binary-search.js @@ -0,0 +1,111 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +exports.GREATEST_LOWER_BOUND = 1; +exports.LEAST_UPPER_BOUND = 2; + +/** + * Recursive implementation of binary search. + * + * @param aLow Indices here and lower do not contain the needle. + * @param aHigh Indices here and higher do not contain the needle. + * @param aNeedle The element being searched for. + * @param aHaystack The non-empty array being searched. + * @param aCompare Function which takes two elements and returns -1, 0, or 1. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + */ +function recursiveSearch(aLow, aHigh, aNeedle, aHaystack, aCompare, aBias) { + // This function terminates when one of the following is true: + // + // 1. We find the exact element we are looking for. + // + // 2. We did not find the exact element, but we can return the index of + // the next-closest element. + // + // 3. We did not find the exact element, and there is no next-closest + // element than the one we are searching for, so we return -1. + var mid = Math.floor((aHigh - aLow) / 2) + aLow; + var cmp = aCompare(aNeedle, aHaystack[mid], true); + if (cmp === 0) { + // Found the element we are looking for. + return mid; + } + else if (cmp > 0) { + // Our needle is greater than aHaystack[mid]. + if (aHigh - mid > 1) { + // The element is in the upper half. + return recursiveSearch(mid, aHigh, aNeedle, aHaystack, aCompare, aBias); + } + + // The exact needle element was not found in this haystack. Determine if + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return aHigh < aHaystack.length ? aHigh : -1; + } else { + return mid; + } + } + else { + // Our needle is less than aHaystack[mid]. + if (mid - aLow > 1) { + // The element is in the lower half. + return recursiveSearch(aLow, mid, aNeedle, aHaystack, aCompare, aBias); + } + + // we are in termination case (3) or (2) and return the appropriate thing. + if (aBias == exports.LEAST_UPPER_BOUND) { + return mid; + } else { + return aLow < 0 ? -1 : aLow; + } + } +} + +/** + * This is an implementation of binary search which will always try and return + * the index of the closest element if there is no exact hit. This is because + * mappings between original and generated line/col pairs are single points, + * and there is an implicit region between each of them, so a miss just means + * that you aren't on the very start of a region. + * + * @param aNeedle The element you are looking for. + * @param aHaystack The array that is being searched. + * @param aCompare A function which takes the needle and an element in the + * array and returns -1, 0, or 1 depending on whether the needle is less + * than, equal to, or greater than the element, respectively. + * @param aBias Either 'binarySearch.GREATEST_LOWER_BOUND' or + * 'binarySearch.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'binarySearch.GREATEST_LOWER_BOUND'. + */ +exports.search = function search(aNeedle, aHaystack, aCompare, aBias) { + if (aHaystack.length === 0) { + return -1; + } + + var index = recursiveSearch(-1, aHaystack.length, aNeedle, aHaystack, + aCompare, aBias || exports.GREATEST_LOWER_BOUND); + if (index < 0) { + return -1; + } + + // We have found either the exact element, or the next-closest element than + // the one we are searching for. However, there may be more than one such + // element. Make sure we always return the smallest of these. + while (index - 1 >= 0) { + if (aCompare(aHaystack[index], aHaystack[index - 1], true) !== 0) { + break; + } + --index; + } + + return index; +}; diff --git a/node_modules/ava/node_modules/source-map/lib/mapping-list.js b/node_modules/ava/node_modules/source-map/lib/mapping-list.js new file mode 100644 index 000000000..06d1274a0 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/mapping-list.js @@ -0,0 +1,79 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2014 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); + +/** + * Determine whether mappingB is after mappingA with respect to generated + * position. + */ +function generatedPositionAfter(mappingA, mappingB) { + // Optimized for most common case + var lineA = mappingA.generatedLine; + var lineB = mappingB.generatedLine; + var columnA = mappingA.generatedColumn; + var columnB = mappingB.generatedColumn; + return lineB > lineA || lineB == lineA && columnB >= columnA || + util.compareByGeneratedPositionsInflated(mappingA, mappingB) <= 0; +} + +/** + * A data structure to provide a sorted view of accumulated mappings in a + * performance conscious manner. It trades a neglibable overhead in general + * case for a large speedup in case of mappings being added in order. + */ +function MappingList() { + this._array = []; + this._sorted = true; + // Serves as infimum + this._last = {generatedLine: -1, generatedColumn: 0}; +} + +/** + * Iterate through internal items. This method takes the same arguments that + * `Array.prototype.forEach` takes. + * + * NOTE: The order of the mappings is NOT guaranteed. + */ +MappingList.prototype.unsortedForEach = + function MappingList_forEach(aCallback, aThisArg) { + this._array.forEach(aCallback, aThisArg); + }; + +/** + * Add the given source mapping. + * + * @param Object aMapping + */ +MappingList.prototype.add = function MappingList_add(aMapping) { + if (generatedPositionAfter(this._last, aMapping)) { + this._last = aMapping; + this._array.push(aMapping); + } else { + this._sorted = false; + this._array.push(aMapping); + } +}; + +/** + * Returns the flat, sorted array of mappings. The mappings are sorted by + * generated position. + * + * WARNING: This method returns internal data without copying, for + * performance. The return value must NOT be mutated, and should be treated as + * an immutable borrow. If you want to take ownership, you must make your own + * copy. + */ +MappingList.prototype.toArray = function MappingList_toArray() { + if (!this._sorted) { + this._array.sort(util.compareByGeneratedPositionsInflated); + this._sorted = true; + } + return this._array; +}; + +exports.MappingList = MappingList; diff --git a/node_modules/ava/node_modules/source-map/lib/quick-sort.js b/node_modules/ava/node_modules/source-map/lib/quick-sort.js new file mode 100644 index 000000000..6a7caadbb --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/quick-sort.js @@ -0,0 +1,114 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +// It turns out that some (most?) JavaScript engines don't self-host +// `Array.prototype.sort`. This makes sense because C++ will likely remain +// faster than JS when doing raw CPU-intensive sorting. However, when using a +// custom comparator function, calling back and forth between the VM's C++ and +// JIT'd JS is rather slow *and* loses JIT type information, resulting in +// worse generated code for the comparator function than would be optimal. In +// fact, when sorting with a comparator, these costs outweigh the benefits of +// sorting in C++. By using our own JS-implemented Quick Sort (below), we get +// a ~3500ms mean speed-up in `bench/bench.html`. + +/** + * Swap the elements indexed by `x` and `y` in the array `ary`. + * + * @param {Array} ary + * The array. + * @param {Number} x + * The index of the first item. + * @param {Number} y + * The index of the second item. + */ +function swap(ary, x, y) { + var temp = ary[x]; + ary[x] = ary[y]; + ary[y] = temp; +} + +/** + * Returns a random integer within the range `low .. high` inclusive. + * + * @param {Number} low + * The lower bound on the range. + * @param {Number} high + * The upper bound on the range. + */ +function randomIntInRange(low, high) { + return Math.round(low + (Math.random() * (high - low))); +} + +/** + * The Quick Sort algorithm. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + * @param {Number} p + * Start index of the array + * @param {Number} r + * End index of the array + */ +function doQuickSort(ary, comparator, p, r) { + // If our lower bound is less than our upper bound, we (1) partition the + // array into two pieces and (2) recurse on each half. If it is not, this is + // the empty array and our base case. + + if (p < r) { + // (1) Partitioning. + // + // The partitioning chooses a pivot between `p` and `r` and moves all + // elements that are less than or equal to the pivot to the before it, and + // all the elements that are greater than it after it. The effect is that + // once partition is done, the pivot is in the exact place it will be when + // the array is put in sorted order, and it will not need to be moved + // again. This runs in O(n) time. + + // Always choose a random pivot so that an input array which is reverse + // sorted does not cause O(n^2) running time. + var pivotIndex = randomIntInRange(p, r); + var i = p - 1; + + swap(ary, pivotIndex, r); + var pivot = ary[r]; + + // Immediately after `j` is incremented in this loop, the following hold + // true: + // + // * Every element in `ary[p .. i]` is less than or equal to the pivot. + // + // * Every element in `ary[i+1 .. j-1]` is greater than the pivot. + for (var j = p; j < r; j++) { + if (comparator(ary[j], pivot) <= 0) { + i += 1; + swap(ary, i, j); + } + } + + swap(ary, i + 1, j); + var q = i + 1; + + // (2) Recurse on each half. + + doQuickSort(ary, comparator, p, q - 1); + doQuickSort(ary, comparator, q + 1, r); + } +} + +/** + * Sort the given array in-place with the given comparator function. + * + * @param {Array} ary + * An array to sort. + * @param {function} comparator + * Function to use to compare two items. + */ +exports.quickSort = function (ary, comparator) { + doQuickSort(ary, comparator, 0, ary.length - 1); +}; diff --git a/node_modules/ava/node_modules/source-map/lib/source-map-consumer.js b/node_modules/ava/node_modules/source-map/lib/source-map-consumer.js new file mode 100644 index 000000000..7b99d1da7 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/source-map-consumer.js @@ -0,0 +1,1145 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var util = require('./util'); +var binarySearch = require('./binary-search'); +var ArraySet = require('./array-set').ArraySet; +var base64VLQ = require('./base64-vlq'); +var quickSort = require('./quick-sort').quickSort; + +function SourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + return sourceMap.sections != null + ? new IndexedSourceMapConsumer(sourceMap, aSourceMapURL) + : new BasicSourceMapConsumer(sourceMap, aSourceMapURL); +} + +SourceMapConsumer.fromSourceMap = function(aSourceMap, aSourceMapURL) { + return BasicSourceMapConsumer.fromSourceMap(aSourceMap, aSourceMapURL); +} + +/** + * The version of the source mapping spec that we are consuming. + */ +SourceMapConsumer.prototype._version = 3; + +// `__generatedMappings` and `__originalMappings` are arrays that hold the +// parsed mapping coordinates from the source map's "mappings" attribute. They +// are lazily instantiated, accessed via the `_generatedMappings` and +// `_originalMappings` getters respectively, and we only parse the mappings +// and create these arrays once queried for a source location. We jump through +// these hoops because there can be many thousands of mappings, and parsing +// them is expensive, so we only want to do it if we must. +// +// Each object in the arrays is of the form: +// +// { +// generatedLine: The line number in the generated code, +// generatedColumn: The column number in the generated code, +// source: The path to the original source file that generated this +// chunk of code, +// originalLine: The line number in the original source that +// corresponds to this chunk of generated code, +// originalColumn: The column number in the original source that +// corresponds to this chunk of generated code, +// name: The name of the original symbol which generated this chunk of +// code. +// } +// +// All properties except for `generatedLine` and `generatedColumn` can be +// `null`. +// +// `_generatedMappings` is ordered by the generated positions. +// +// `_originalMappings` is ordered by the original positions. + +SourceMapConsumer.prototype.__generatedMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_generatedMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__generatedMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__generatedMappings; + } +}); + +SourceMapConsumer.prototype.__originalMappings = null; +Object.defineProperty(SourceMapConsumer.prototype, '_originalMappings', { + configurable: true, + enumerable: true, + get: function () { + if (!this.__originalMappings) { + this._parseMappings(this._mappings, this.sourceRoot); + } + + return this.__originalMappings; + } +}); + +SourceMapConsumer.prototype._charIsMappingSeparator = + function SourceMapConsumer_charIsMappingSeparator(aStr, index) { + var c = aStr.charAt(index); + return c === ";" || c === ","; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +SourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + throw new Error("Subclasses must implement _parseMappings"); + }; + +SourceMapConsumer.GENERATED_ORDER = 1; +SourceMapConsumer.ORIGINAL_ORDER = 2; + +SourceMapConsumer.GREATEST_LOWER_BOUND = 1; +SourceMapConsumer.LEAST_UPPER_BOUND = 2; + +/** + * Iterate over each mapping between an original source/line/column and a + * generated line/column in this source map. + * + * @param Function aCallback + * The function that is called with each mapping. + * @param Object aContext + * Optional. If specified, this object will be the value of `this` every + * time that `aCallback` is called. + * @param aOrder + * Either `SourceMapConsumer.GENERATED_ORDER` or + * `SourceMapConsumer.ORIGINAL_ORDER`. Specifies whether you want to + * iterate over the mappings sorted by the generated file's line/column + * order or the original's source/line/column order, respectively. Defaults to + * `SourceMapConsumer.GENERATED_ORDER`. + */ +SourceMapConsumer.prototype.eachMapping = + function SourceMapConsumer_eachMapping(aCallback, aContext, aOrder) { + var context = aContext || null; + var order = aOrder || SourceMapConsumer.GENERATED_ORDER; + + var mappings; + switch (order) { + case SourceMapConsumer.GENERATED_ORDER: + mappings = this._generatedMappings; + break; + case SourceMapConsumer.ORIGINAL_ORDER: + mappings = this._originalMappings; + break; + default: + throw new Error("Unknown order of iteration."); + } + + var sourceRoot = this.sourceRoot; + mappings.map(function (mapping) { + var source = mapping.source === null ? null : this._sources.at(mapping.source); + source = util.computeSourceURL(sourceRoot, source, this._sourceMapURL); + return { + source: source, + generatedLine: mapping.generatedLine, + generatedColumn: mapping.generatedColumn, + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: mapping.name === null ? null : this._names.at(mapping.name) + }; + }, this).forEach(aCallback, context); + }; + +/** + * Returns all generated line and column information for the original source, + * line, and column provided. If no column is provided, returns all mappings + * corresponding to a either the line we are searching for or the next + * closest line that has any mappings. Otherwise, returns all mappings + * corresponding to the given line and either the column we are searching for + * or the next closest column that has any offsets. + * + * The only argument is an object with the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number is 1-based. + * - column: Optional. the column number in the original source. + * The column number is 0-based. + * + * and an array of objects is returned, each with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +SourceMapConsumer.prototype.allGeneratedPositionsFor = + function SourceMapConsumer_allGeneratedPositionsFor(aArgs) { + var line = util.getArg(aArgs, 'line'); + + // When there is no exact match, BasicSourceMapConsumer.prototype._findMapping + // returns the index of the closest mapping less than the needle. By + // setting needle.originalColumn to 0, we thus find the last mapping for + // the given line, provided such a mapping exists. + var needle = { + source: util.getArg(aArgs, 'source'), + originalLine: line, + originalColumn: util.getArg(aArgs, 'column', 0) + }; + + needle.source = this._findSourceIndex(needle.source); + if (needle.source < 0) { + return []; + } + + var mappings = []; + + var index = this._findMapping(needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + binarySearch.LEAST_UPPER_BOUND); + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (aArgs.column === undefined) { + var originalLine = mapping.originalLine; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we found. Since + // mappings are sorted, this is guaranteed to find all mappings for + // the line we found. + while (mapping && mapping.originalLine === originalLine) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } else { + var originalColumn = mapping.originalColumn; + + // Iterate until either we run out of mappings, or we run into + // a mapping for a different line than the one we were searching for. + // Since mappings are sorted, this is guaranteed to find all mappings for + // the line we are searching for. + while (mapping && + mapping.originalLine === line && + mapping.originalColumn == originalColumn) { + mappings.push({ + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }); + + mapping = this._originalMappings[++index]; + } + } + } + + return mappings; + }; + +exports.SourceMapConsumer = SourceMapConsumer; + +/** + * A BasicSourceMapConsumer instance represents a parsed source map which we can + * query for information about the original file positions by giving it a file + * position in the generated source. + * + * The first parameter is the raw source map (either as a JSON string, or + * already parsed to an object). According to the spec, source maps have the + * following attributes: + * + * - version: Which version of the source map spec this map is following. + * - sources: An array of URLs to the original source files. + * - names: An array of identifiers which can be referrenced by individual mappings. + * - sourceRoot: Optional. The URL root from which all sources are relative. + * - sourcesContent: Optional. An array of contents of the original source files. + * - mappings: A string of base64 VLQs which contain the actual mappings. + * - file: Optional. The generated file this source map is associated with. + * + * Here is an example source map, taken from the source map spec[0]: + * + * { + * version : 3, + * file: "out.js", + * sourceRoot : "", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AA,AB;;ABCDE;" + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit?pli=1# + */ +function BasicSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sources = util.getArg(sourceMap, 'sources'); + // Sass 3.3 leaves out the 'names' array, so we deviate from the spec (which + // requires the array) to play nice here. + var names = util.getArg(sourceMap, 'names', []); + var sourceRoot = util.getArg(sourceMap, 'sourceRoot', null); + var sourcesContent = util.getArg(sourceMap, 'sourcesContent', null); + var mappings = util.getArg(sourceMap, 'mappings'); + var file = util.getArg(sourceMap, 'file', null); + + // Once again, Sass deviates from the spec and supplies the version as a + // string rather than a number, so we use loose equality checking here. + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + if (sourceRoot) { + sourceRoot = util.normalize(sourceRoot); + } + + sources = sources + .map(String) + // Some source maps produce relative source paths like "./foo.js" instead of + // "foo.js". Normalize these first so that future comparisons will succeed. + // See bugzil.la/1090768. + .map(util.normalize) + // Always ensure that absolute sources are internally stored relative to + // the source root, if the source root is absolute. Not doing this would + // be particularly problematic when the source root is a prefix of the + // source (valid, but why??). See github issue #199 and bugzil.la/1188982. + .map(function (source) { + return sourceRoot && util.isAbsolute(sourceRoot) && util.isAbsolute(source) + ? util.relative(sourceRoot, source) + : source; + }); + + // Pass `true` below to allow duplicate names and sources. While source maps + // are intended to be compressed and deduplicated, the TypeScript compiler + // sometimes generates source maps with duplicates in them. See Github issue + // #72 and bugzil.la/889492. + this._names = ArraySet.fromArray(names.map(String), true); + this._sources = ArraySet.fromArray(sources, true); + + this._absoluteSources = this._sources.toArray().map(function (s) { + return util.computeSourceURL(sourceRoot, s, aSourceMapURL); + }); + + this.sourceRoot = sourceRoot; + this.sourcesContent = sourcesContent; + this._mappings = mappings; + this._sourceMapURL = aSourceMapURL; + this.file = file; +} + +BasicSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +BasicSourceMapConsumer.prototype.consumer = SourceMapConsumer; + +/** + * Utility function to find the index of a source. Returns -1 if not + * found. + */ +BasicSourceMapConsumer.prototype._findSourceIndex = function(aSource) { + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + if (this._sources.has(relativeSource)) { + return this._sources.indexOf(relativeSource); + } + + // Maybe aSource is an absolute URL as returned by |sources|. In + // this case we can't simply undo the transform. + var i; + for (i = 0; i < this._absoluteSources.length; ++i) { + if (this._absoluteSources[i] == aSource) { + return i; + } + } + + return -1; +}; + +/** + * Create a BasicSourceMapConsumer from a SourceMapGenerator. + * + * @param SourceMapGenerator aSourceMap + * The source map that will be consumed. + * @param String aSourceMapURL + * The URL at which the source map can be found (optional) + * @returns BasicSourceMapConsumer + */ +BasicSourceMapConsumer.fromSourceMap = + function SourceMapConsumer_fromSourceMap(aSourceMap, aSourceMapURL) { + var smc = Object.create(BasicSourceMapConsumer.prototype); + + var names = smc._names = ArraySet.fromArray(aSourceMap._names.toArray(), true); + var sources = smc._sources = ArraySet.fromArray(aSourceMap._sources.toArray(), true); + smc.sourceRoot = aSourceMap._sourceRoot; + smc.sourcesContent = aSourceMap._generateSourcesContent(smc._sources.toArray(), + smc.sourceRoot); + smc.file = aSourceMap._file; + smc._sourceMapURL = aSourceMapURL; + smc._absoluteSources = smc._sources.toArray().map(function (s) { + return util.computeSourceURL(smc.sourceRoot, s, aSourceMapURL); + }); + + // Because we are modifying the entries (by converting string sources and + // names to indices into the sources and names ArraySets), we have to make + // a copy of the entry or else bad things happen. Shared mutable state + // strikes again! See github issue #191. + + var generatedMappings = aSourceMap._mappings.toArray().slice(); + var destGeneratedMappings = smc.__generatedMappings = []; + var destOriginalMappings = smc.__originalMappings = []; + + for (var i = 0, length = generatedMappings.length; i < length; i++) { + var srcMapping = generatedMappings[i]; + var destMapping = new Mapping; + destMapping.generatedLine = srcMapping.generatedLine; + destMapping.generatedColumn = srcMapping.generatedColumn; + + if (srcMapping.source) { + destMapping.source = sources.indexOf(srcMapping.source); + destMapping.originalLine = srcMapping.originalLine; + destMapping.originalColumn = srcMapping.originalColumn; + + if (srcMapping.name) { + destMapping.name = names.indexOf(srcMapping.name); + } + + destOriginalMappings.push(destMapping); + } + + destGeneratedMappings.push(destMapping); + } + + quickSort(smc.__originalMappings, util.compareByOriginalPositions); + + return smc; + }; + +/** + * The version of the source mapping spec that we are consuming. + */ +BasicSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(BasicSourceMapConsumer.prototype, 'sources', { + get: function () { + return this._absoluteSources.slice(); + } +}); + +/** + * Provide the JIT with a nice shape / hidden class. + */ +function Mapping() { + this.generatedLine = 0; + this.generatedColumn = 0; + this.source = null; + this.originalLine = null; + this.originalColumn = null; + this.name = null; +} + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +BasicSourceMapConsumer.prototype._parseMappings = + function SourceMapConsumer_parseMappings(aStr, aSourceRoot) { + var generatedLine = 1; + var previousGeneratedColumn = 0; + var previousOriginalLine = 0; + var previousOriginalColumn = 0; + var previousSource = 0; + var previousName = 0; + var length = aStr.length; + var index = 0; + var cachedSegments = {}; + var temp = {}; + var originalMappings = []; + var generatedMappings = []; + var mapping, str, segment, end, value; + + while (index < length) { + if (aStr.charAt(index) === ';') { + generatedLine++; + index++; + previousGeneratedColumn = 0; + } + else if (aStr.charAt(index) === ',') { + index++; + } + else { + mapping = new Mapping(); + mapping.generatedLine = generatedLine; + + // Because each offset is encoded relative to the previous one, + // many segments often have the same encoding. We can exploit this + // fact by caching the parsed variable length fields of each segment, + // allowing us to avoid a second parse if we encounter the same + // segment again. + for (end = index; end < length; end++) { + if (this._charIsMappingSeparator(aStr, end)) { + break; + } + } + str = aStr.slice(index, end); + + segment = cachedSegments[str]; + if (segment) { + index += str.length; + } else { + segment = []; + while (index < end) { + base64VLQ.decode(aStr, index, temp); + value = temp.value; + index = temp.rest; + segment.push(value); + } + + if (segment.length === 2) { + throw new Error('Found a source, but no line and column'); + } + + if (segment.length === 3) { + throw new Error('Found a source and line, but no column'); + } + + cachedSegments[str] = segment; + } + + // Generated column. + mapping.generatedColumn = previousGeneratedColumn + segment[0]; + previousGeneratedColumn = mapping.generatedColumn; + + if (segment.length > 1) { + // Original source. + mapping.source = previousSource + segment[1]; + previousSource += segment[1]; + + // Original line. + mapping.originalLine = previousOriginalLine + segment[2]; + previousOriginalLine = mapping.originalLine; + // Lines are stored 0-based + mapping.originalLine += 1; + + // Original column. + mapping.originalColumn = previousOriginalColumn + segment[3]; + previousOriginalColumn = mapping.originalColumn; + + if (segment.length > 4) { + // Original name. + mapping.name = previousName + segment[4]; + previousName += segment[4]; + } + } + + generatedMappings.push(mapping); + if (typeof mapping.originalLine === 'number') { + originalMappings.push(mapping); + } + } + } + + quickSort(generatedMappings, util.compareByGeneratedPositionsDeflated); + this.__generatedMappings = generatedMappings; + + quickSort(originalMappings, util.compareByOriginalPositions); + this.__originalMappings = originalMappings; + }; + +/** + * Find the mapping that best matches the hypothetical "needle" mapping that + * we are searching for in the given "haystack" of mappings. + */ +BasicSourceMapConsumer.prototype._findMapping = + function SourceMapConsumer_findMapping(aNeedle, aMappings, aLineName, + aColumnName, aComparator, aBias) { + // To return the position we are searching for, we must first find the + // mapping for the given position and then return the opposite position it + // points to. Because the mappings are sorted, we can use binary search to + // find the best mapping. + + if (aNeedle[aLineName] <= 0) { + throw new TypeError('Line must be greater than or equal to 1, got ' + + aNeedle[aLineName]); + } + if (aNeedle[aColumnName] < 0) { + throw new TypeError('Column must be greater than or equal to 0, got ' + + aNeedle[aColumnName]); + } + + return binarySearch.search(aNeedle, aMappings, aComparator, aBias); + }; + +/** + * Compute the last column for each generated mapping. The last column is + * inclusive. + */ +BasicSourceMapConsumer.prototype.computeColumnSpans = + function SourceMapConsumer_computeColumnSpans() { + for (var index = 0; index < this._generatedMappings.length; ++index) { + var mapping = this._generatedMappings[index]; + + // Mappings do not contain a field for the last generated columnt. We + // can come up with an optimistic estimate, however, by assuming that + // mappings are contiguous (i.e. given two consecutive mappings, the + // first mapping ends where the second one starts). + if (index + 1 < this._generatedMappings.length) { + var nextMapping = this._generatedMappings[index + 1]; + + if (mapping.generatedLine === nextMapping.generatedLine) { + mapping.lastGeneratedColumn = nextMapping.generatedColumn - 1; + continue; + } + } + + // The last mapping for each line spans the entire line. + mapping.lastGeneratedColumn = Infinity; + } + }; + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +BasicSourceMapConsumer.prototype.originalPositionFor = + function SourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._generatedMappings, + "generatedLine", + "generatedColumn", + util.compareByGeneratedPositionsDeflated, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._generatedMappings[index]; + + if (mapping.generatedLine === needle.generatedLine) { + var source = util.getArg(mapping, 'source', null); + if (source !== null) { + source = this._sources.at(source); + source = util.computeSourceURL(this.sourceRoot, source, this._sourceMapURL); + } + var name = util.getArg(mapping, 'name', null); + if (name !== null) { + name = this._names.at(name); + } + return { + source: source, + line: util.getArg(mapping, 'originalLine', null), + column: util.getArg(mapping, 'originalColumn', null), + name: name + }; + } + } + + return { + source: null, + line: null, + column: null, + name: null + }; + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +BasicSourceMapConsumer.prototype.hasContentsOfAllSources = + function BasicSourceMapConsumer_hasContentsOfAllSources() { + if (!this.sourcesContent) { + return false; + } + return this.sourcesContent.length >= this._sources.size() && + !this.sourcesContent.some(function (sc) { return sc == null; }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +BasicSourceMapConsumer.prototype.sourceContentFor = + function SourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + if (!this.sourcesContent) { + return null; + } + + var index = this._findSourceIndex(aSource); + if (index >= 0) { + return this.sourcesContent[index]; + } + + var relativeSource = aSource; + if (this.sourceRoot != null) { + relativeSource = util.relative(this.sourceRoot, relativeSource); + } + + var url; + if (this.sourceRoot != null + && (url = util.urlParse(this.sourceRoot))) { + // XXX: file:// URIs and absolute paths lead to unexpected behavior for + // many users. We can help them out when they expect file:// URIs to + // behave like it would if they were running a local HTTP server. See + // https://bugzilla.mozilla.org/show_bug.cgi?id=885597. + var fileUriAbsPath = relativeSource.replace(/^file:\/\//, ""); + if (url.scheme == "file" + && this._sources.has(fileUriAbsPath)) { + return this.sourcesContent[this._sources.indexOf(fileUriAbsPath)] + } + + if ((!url.path || url.path == "/") + && this._sources.has("/" + relativeSource)) { + return this.sourcesContent[this._sources.indexOf("/" + relativeSource)]; + } + } + + // This function is used recursively from + // IndexedSourceMapConsumer.prototype.sourceContentFor. In that case, we + // don't want to throw if we can't find the source - we just want to + // return null, so we provide a flag to exit gracefully. + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + relativeSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * - bias: Either 'SourceMapConsumer.GREATEST_LOWER_BOUND' or + * 'SourceMapConsumer.LEAST_UPPER_BOUND'. Specifies whether to return the + * closest element that is smaller than or greater than the one we are + * searching for, respectively, if the exact element cannot be found. + * Defaults to 'SourceMapConsumer.GREATEST_LOWER_BOUND'. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +BasicSourceMapConsumer.prototype.generatedPositionFor = + function SourceMapConsumer_generatedPositionFor(aArgs) { + var source = util.getArg(aArgs, 'source'); + source = this._findSourceIndex(source); + if (source < 0) { + return { + line: null, + column: null, + lastColumn: null + }; + } + + var needle = { + source: source, + originalLine: util.getArg(aArgs, 'line'), + originalColumn: util.getArg(aArgs, 'column') + }; + + var index = this._findMapping( + needle, + this._originalMappings, + "originalLine", + "originalColumn", + util.compareByOriginalPositions, + util.getArg(aArgs, 'bias', SourceMapConsumer.GREATEST_LOWER_BOUND) + ); + + if (index >= 0) { + var mapping = this._originalMappings[index]; + + if (mapping.source === needle.source) { + return { + line: util.getArg(mapping, 'generatedLine', null), + column: util.getArg(mapping, 'generatedColumn', null), + lastColumn: util.getArg(mapping, 'lastGeneratedColumn', null) + }; + } + } + + return { + line: null, + column: null, + lastColumn: null + }; + }; + +exports.BasicSourceMapConsumer = BasicSourceMapConsumer; + +/** + * An IndexedSourceMapConsumer instance represents a parsed source map which + * we can query for information. It differs from BasicSourceMapConsumer in + * that it takes "indexed" source maps (i.e. ones with a "sections" field) as + * input. + * + * The first parameter is a raw source map (either as a JSON string, or already + * parsed to an object). According to the spec for indexed source maps, they + * have the following attributes: + * + * - version: Which version of the source map spec this map is following. + * - file: Optional. The generated file this source map is associated with. + * - sections: A list of section definitions. + * + * Each value under the "sections" field has two fields: + * - offset: The offset into the original specified at which this section + * begins to apply, defined as an object with a "line" and "column" + * field. + * - map: A source map definition. This source map could also be indexed, + * but doesn't have to be. + * + * Instead of the "map" field, it's also possible to have a "url" field + * specifying a URL to retrieve a source map from, but that's currently + * unsupported. + * + * Here's an example source map, taken from the source map spec[0], but + * modified to omit a section which uses the "url" field. + * + * { + * version : 3, + * file: "app.js", + * sections: [{ + * offset: {line:100, column:10}, + * map: { + * version : 3, + * file: "section.js", + * sources: ["foo.js", "bar.js"], + * names: ["src", "maps", "are", "fun"], + * mappings: "AAAA,E;;ABCDE;" + * } + * }], + * } + * + * The second parameter, if given, is a string whose value is the URL + * at which the source map was found. This URL is used to compute the + * sources array. + * + * [0]: https://docs.google.com/document/d/1U1RGAehQwRypUTovF1KRlpiOFze0b-_2gc6fAH0KY0k/edit#heading=h.535es3xeprgt + */ +function IndexedSourceMapConsumer(aSourceMap, aSourceMapURL) { + var sourceMap = aSourceMap; + if (typeof aSourceMap === 'string') { + sourceMap = util.parseSourceMapInput(aSourceMap); + } + + var version = util.getArg(sourceMap, 'version'); + var sections = util.getArg(sourceMap, 'sections'); + + if (version != this._version) { + throw new Error('Unsupported version: ' + version); + } + + this._sources = new ArraySet(); + this._names = new ArraySet(); + + var lastOffset = { + line: -1, + column: 0 + }; + this._sections = sections.map(function (s) { + if (s.url) { + // The url field will require support for asynchronicity. + // See https://github.com/mozilla/source-map/issues/16 + throw new Error('Support for url field in sections not implemented.'); + } + var offset = util.getArg(s, 'offset'); + var offsetLine = util.getArg(offset, 'line'); + var offsetColumn = util.getArg(offset, 'column'); + + if (offsetLine < lastOffset.line || + (offsetLine === lastOffset.line && offsetColumn < lastOffset.column)) { + throw new Error('Section offsets must be ordered and non-overlapping.'); + } + lastOffset = offset; + + return { + generatedOffset: { + // The offset fields are 0-based, but we use 1-based indices when + // encoding/decoding from VLQ. + generatedLine: offsetLine + 1, + generatedColumn: offsetColumn + 1 + }, + consumer: new SourceMapConsumer(util.getArg(s, 'map'), aSourceMapURL) + } + }); +} + +IndexedSourceMapConsumer.prototype = Object.create(SourceMapConsumer.prototype); +IndexedSourceMapConsumer.prototype.constructor = SourceMapConsumer; + +/** + * The version of the source mapping spec that we are consuming. + */ +IndexedSourceMapConsumer.prototype._version = 3; + +/** + * The list of original sources. + */ +Object.defineProperty(IndexedSourceMapConsumer.prototype, 'sources', { + get: function () { + var sources = []; + for (var i = 0; i < this._sections.length; i++) { + for (var j = 0; j < this._sections[i].consumer.sources.length; j++) { + sources.push(this._sections[i].consumer.sources[j]); + } + } + return sources; + } +}); + +/** + * Returns the original source, line, and column information for the generated + * source's line and column positions provided. The only argument is an object + * with the following properties: + * + * - line: The line number in the generated source. The line number + * is 1-based. + * - column: The column number in the generated source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - source: The original source file, or null. + * - line: The line number in the original source, or null. The + * line number is 1-based. + * - column: The column number in the original source, or null. The + * column number is 0-based. + * - name: The original identifier, or null. + */ +IndexedSourceMapConsumer.prototype.originalPositionFor = + function IndexedSourceMapConsumer_originalPositionFor(aArgs) { + var needle = { + generatedLine: util.getArg(aArgs, 'line'), + generatedColumn: util.getArg(aArgs, 'column') + }; + + // Find the section containing the generated position we're trying to map + // to an original position. + var sectionIndex = binarySearch.search(needle, this._sections, + function(needle, section) { + var cmp = needle.generatedLine - section.generatedOffset.generatedLine; + if (cmp) { + return cmp; + } + + return (needle.generatedColumn - + section.generatedOffset.generatedColumn); + }); + var section = this._sections[sectionIndex]; + + if (!section) { + return { + source: null, + line: null, + column: null, + name: null + }; + } + + return section.consumer.originalPositionFor({ + line: needle.generatedLine - + (section.generatedOffset.generatedLine - 1), + column: needle.generatedColumn - + (section.generatedOffset.generatedLine === needle.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + bias: aArgs.bias + }); + }; + +/** + * Return true if we have the source content for every source in the source + * map, false otherwise. + */ +IndexedSourceMapConsumer.prototype.hasContentsOfAllSources = + function IndexedSourceMapConsumer_hasContentsOfAllSources() { + return this._sections.every(function (s) { + return s.consumer.hasContentsOfAllSources(); + }); + }; + +/** + * Returns the original source content. The only argument is the url of the + * original source file. Returns null if no original source content is + * available. + */ +IndexedSourceMapConsumer.prototype.sourceContentFor = + function IndexedSourceMapConsumer_sourceContentFor(aSource, nullOnMissing) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + var content = section.consumer.sourceContentFor(aSource, true); + if (content) { + return content; + } + } + if (nullOnMissing) { + return null; + } + else { + throw new Error('"' + aSource + '" is not in the SourceMap.'); + } + }; + +/** + * Returns the generated line and column information for the original source, + * line, and column positions provided. The only argument is an object with + * the following properties: + * + * - source: The filename of the original source. + * - line: The line number in the original source. The line number + * is 1-based. + * - column: The column number in the original source. The column + * number is 0-based. + * + * and an object is returned with the following properties: + * + * - line: The line number in the generated source, or null. The + * line number is 1-based. + * - column: The column number in the generated source, or null. + * The column number is 0-based. + */ +IndexedSourceMapConsumer.prototype.generatedPositionFor = + function IndexedSourceMapConsumer_generatedPositionFor(aArgs) { + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + + // Only consider this section if the requested source is in the list of + // sources of the consumer. + if (section.consumer._findSourceIndex(util.getArg(aArgs, 'source')) === -1) { + continue; + } + var generatedPosition = section.consumer.generatedPositionFor(aArgs); + if (generatedPosition) { + var ret = { + line: generatedPosition.line + + (section.generatedOffset.generatedLine - 1), + column: generatedPosition.column + + (section.generatedOffset.generatedLine === generatedPosition.line + ? section.generatedOffset.generatedColumn - 1 + : 0) + }; + return ret; + } + } + + return { + line: null, + column: null + }; + }; + +/** + * Parse the mappings in a string in to a data structure which we can easily + * query (the ordered arrays in the `this.__generatedMappings` and + * `this.__originalMappings` properties). + */ +IndexedSourceMapConsumer.prototype._parseMappings = + function IndexedSourceMapConsumer_parseMappings(aStr, aSourceRoot) { + this.__generatedMappings = []; + this.__originalMappings = []; + for (var i = 0; i < this._sections.length; i++) { + var section = this._sections[i]; + var sectionMappings = section.consumer._generatedMappings; + for (var j = 0; j < sectionMappings.length; j++) { + var mapping = sectionMappings[j]; + + var source = section.consumer._sources.at(mapping.source); + source = util.computeSourceURL(section.consumer.sourceRoot, source, this._sourceMapURL); + this._sources.add(source); + source = this._sources.indexOf(source); + + var name = null; + if (mapping.name) { + name = section.consumer._names.at(mapping.name); + this._names.add(name); + name = this._names.indexOf(name); + } + + // The mappings coming from the consumer for the section have + // generated positions relative to the start of the section, so we + // need to offset them to be relative to the start of the concatenated + // generated file. + var adjustedMapping = { + source: source, + generatedLine: mapping.generatedLine + + (section.generatedOffset.generatedLine - 1), + generatedColumn: mapping.generatedColumn + + (section.generatedOffset.generatedLine === mapping.generatedLine + ? section.generatedOffset.generatedColumn - 1 + : 0), + originalLine: mapping.originalLine, + originalColumn: mapping.originalColumn, + name: name + }; + + this.__generatedMappings.push(adjustedMapping); + if (typeof adjustedMapping.originalLine === 'number') { + this.__originalMappings.push(adjustedMapping); + } + } + } + + quickSort(this.__generatedMappings, util.compareByGeneratedPositionsDeflated); + quickSort(this.__originalMappings, util.compareByOriginalPositions); + }; + +exports.IndexedSourceMapConsumer = IndexedSourceMapConsumer; diff --git a/node_modules/ava/node_modules/source-map/lib/source-map-generator.js b/node_modules/ava/node_modules/source-map/lib/source-map-generator.js new file mode 100644 index 000000000..508bcfbbc --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/source-map-generator.js @@ -0,0 +1,425 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var base64VLQ = require('./base64-vlq'); +var util = require('./util'); +var ArraySet = require('./array-set').ArraySet; +var MappingList = require('./mapping-list').MappingList; + +/** + * An instance of the SourceMapGenerator represents a source map which is + * being built incrementally. You may pass an object with the following + * properties: + * + * - file: The filename of the generated source. + * - sourceRoot: A root for all relative URLs in this source map. + */ +function SourceMapGenerator(aArgs) { + if (!aArgs) { + aArgs = {}; + } + this._file = util.getArg(aArgs, 'file', null); + this._sourceRoot = util.getArg(aArgs, 'sourceRoot', null); + this._skipValidation = util.getArg(aArgs, 'skipValidation', false); + this._sources = new ArraySet(); + this._names = new ArraySet(); + this._mappings = new MappingList(); + this._sourcesContents = null; +} + +SourceMapGenerator.prototype._version = 3; + +/** + * Creates a new SourceMapGenerator based on a SourceMapConsumer + * + * @param aSourceMapConsumer The SourceMap. + */ +SourceMapGenerator.fromSourceMap = + function SourceMapGenerator_fromSourceMap(aSourceMapConsumer) { + var sourceRoot = aSourceMapConsumer.sourceRoot; + var generator = new SourceMapGenerator({ + file: aSourceMapConsumer.file, + sourceRoot: sourceRoot + }); + aSourceMapConsumer.eachMapping(function (mapping) { + var newMapping = { + generated: { + line: mapping.generatedLine, + column: mapping.generatedColumn + } + }; + + if (mapping.source != null) { + newMapping.source = mapping.source; + if (sourceRoot != null) { + newMapping.source = util.relative(sourceRoot, newMapping.source); + } + + newMapping.original = { + line: mapping.originalLine, + column: mapping.originalColumn + }; + + if (mapping.name != null) { + newMapping.name = mapping.name; + } + } + + generator.addMapping(newMapping); + }); + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var sourceRelative = sourceFile; + if (sourceRoot !== null) { + sourceRelative = util.relative(sourceRoot, sourceFile); + } + + if (!generator._sources.has(sourceRelative)) { + generator._sources.add(sourceRelative); + } + + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + generator.setSourceContent(sourceFile, content); + } + }); + return generator; + }; + +/** + * Add a single mapping from original source line and column to the generated + * source's line and column for this source map being created. The mapping + * object should have the following properties: + * + * - generated: An object with the generated line and column positions. + * - original: An object with the original line and column positions. + * - source: The original source file (relative to the sourceRoot). + * - name: An optional original token name for this mapping. + */ +SourceMapGenerator.prototype.addMapping = + function SourceMapGenerator_addMapping(aArgs) { + var generated = util.getArg(aArgs, 'generated'); + var original = util.getArg(aArgs, 'original', null); + var source = util.getArg(aArgs, 'source', null); + var name = util.getArg(aArgs, 'name', null); + + if (!this._skipValidation) { + this._validateMapping(generated, original, source, name); + } + + if (source != null) { + source = String(source); + if (!this._sources.has(source)) { + this._sources.add(source); + } + } + + if (name != null) { + name = String(name); + if (!this._names.has(name)) { + this._names.add(name); + } + } + + this._mappings.add({ + generatedLine: generated.line, + generatedColumn: generated.column, + originalLine: original != null && original.line, + originalColumn: original != null && original.column, + source: source, + name: name + }); + }; + +/** + * Set the source content for a source file. + */ +SourceMapGenerator.prototype.setSourceContent = + function SourceMapGenerator_setSourceContent(aSourceFile, aSourceContent) { + var source = aSourceFile; + if (this._sourceRoot != null) { + source = util.relative(this._sourceRoot, source); + } + + if (aSourceContent != null) { + // Add the source content to the _sourcesContents map. + // Create a new _sourcesContents map if the property is null. + if (!this._sourcesContents) { + this._sourcesContents = Object.create(null); + } + this._sourcesContents[util.toSetString(source)] = aSourceContent; + } else if (this._sourcesContents) { + // Remove the source file from the _sourcesContents map. + // If the _sourcesContents map is empty, set the property to null. + delete this._sourcesContents[util.toSetString(source)]; + if (Object.keys(this._sourcesContents).length === 0) { + this._sourcesContents = null; + } + } + }; + +/** + * Applies the mappings of a sub-source-map for a specific source file to the + * source map being generated. Each mapping to the supplied source file is + * rewritten using the supplied source map. Note: The resolution for the + * resulting mappings is the minimium of this map and the supplied map. + * + * @param aSourceMapConsumer The source map to be applied. + * @param aSourceFile Optional. The filename of the source file. + * If omitted, SourceMapConsumer's file property will be used. + * @param aSourceMapPath Optional. The dirname of the path to the source map + * to be applied. If relative, it is relative to the SourceMapConsumer. + * This parameter is needed when the two source maps aren't in the same + * directory, and the source map to be applied contains relative source + * paths. If so, those relative source paths need to be rewritten + * relative to the SourceMapGenerator. + */ +SourceMapGenerator.prototype.applySourceMap = + function SourceMapGenerator_applySourceMap(aSourceMapConsumer, aSourceFile, aSourceMapPath) { + var sourceFile = aSourceFile; + // If aSourceFile is omitted, we will use the file property of the SourceMap + if (aSourceFile == null) { + if (aSourceMapConsumer.file == null) { + throw new Error( + 'SourceMapGenerator.prototype.applySourceMap requires either an explicit source file, ' + + 'or the source map\'s "file" property. Both were omitted.' + ); + } + sourceFile = aSourceMapConsumer.file; + } + var sourceRoot = this._sourceRoot; + // Make "sourceFile" relative if an absolute Url is passed. + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + // Applying the SourceMap can add and remove items from the sources and + // the names array. + var newSources = new ArraySet(); + var newNames = new ArraySet(); + + // Find mappings for the "sourceFile" + this._mappings.unsortedForEach(function (mapping) { + if (mapping.source === sourceFile && mapping.originalLine != null) { + // Check if it can be mapped by the source map, then update the mapping. + var original = aSourceMapConsumer.originalPositionFor({ + line: mapping.originalLine, + column: mapping.originalColumn + }); + if (original.source != null) { + // Copy mapping + mapping.source = original.source; + if (aSourceMapPath != null) { + mapping.source = util.join(aSourceMapPath, mapping.source) + } + if (sourceRoot != null) { + mapping.source = util.relative(sourceRoot, mapping.source); + } + mapping.originalLine = original.line; + mapping.originalColumn = original.column; + if (original.name != null) { + mapping.name = original.name; + } + } + } + + var source = mapping.source; + if (source != null && !newSources.has(source)) { + newSources.add(source); + } + + var name = mapping.name; + if (name != null && !newNames.has(name)) { + newNames.add(name); + } + + }, this); + this._sources = newSources; + this._names = newNames; + + // Copy sourcesContents of applied map. + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aSourceMapPath != null) { + sourceFile = util.join(aSourceMapPath, sourceFile); + } + if (sourceRoot != null) { + sourceFile = util.relative(sourceRoot, sourceFile); + } + this.setSourceContent(sourceFile, content); + } + }, this); + }; + +/** + * A mapping can have one of the three levels of data: + * + * 1. Just the generated position. + * 2. The Generated position, original position, and original source. + * 3. Generated and original position, original source, as well as a name + * token. + * + * To maintain consistency, we validate that any new mapping being added falls + * in to one of these categories. + */ +SourceMapGenerator.prototype._validateMapping = + function SourceMapGenerator_validateMapping(aGenerated, aOriginal, aSource, + aName) { + // When aOriginal is truthy but has empty values for .line and .column, + // it is most likely a programmer error. In this case we throw a very + // specific error message to try to guide them the right way. + // For example: https://github.com/Polymer/polymer-bundler/pull/519 + if (aOriginal && typeof aOriginal.line !== 'number' && typeof aOriginal.column !== 'number') { + throw new Error( + 'original.line and original.column are not numbers -- you probably meant to omit ' + + 'the original mapping entirely and only map the generated position. If so, pass ' + + 'null for the original mapping instead of an object with empty or null values.' + ); + } + + if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aGenerated.line > 0 && aGenerated.column >= 0 + && !aOriginal && !aSource && !aName) { + // Case 1. + return; + } + else if (aGenerated && 'line' in aGenerated && 'column' in aGenerated + && aOriginal && 'line' in aOriginal && 'column' in aOriginal + && aGenerated.line > 0 && aGenerated.column >= 0 + && aOriginal.line > 0 && aOriginal.column >= 0 + && aSource) { + // Cases 2 and 3. + return; + } + else { + throw new Error('Invalid mapping: ' + JSON.stringify({ + generated: aGenerated, + source: aSource, + original: aOriginal, + name: aName + })); + } + }; + +/** + * Serialize the accumulated mappings in to the stream of base 64 VLQs + * specified by the source map format. + */ +SourceMapGenerator.prototype._serializeMappings = + function SourceMapGenerator_serializeMappings() { + var previousGeneratedColumn = 0; + var previousGeneratedLine = 1; + var previousOriginalColumn = 0; + var previousOriginalLine = 0; + var previousName = 0; + var previousSource = 0; + var result = ''; + var next; + var mapping; + var nameIdx; + var sourceIdx; + + var mappings = this._mappings.toArray(); + for (var i = 0, len = mappings.length; i < len; i++) { + mapping = mappings[i]; + next = '' + + if (mapping.generatedLine !== previousGeneratedLine) { + previousGeneratedColumn = 0; + while (mapping.generatedLine !== previousGeneratedLine) { + next += ';'; + previousGeneratedLine++; + } + } + else { + if (i > 0) { + if (!util.compareByGeneratedPositionsInflated(mapping, mappings[i - 1])) { + continue; + } + next += ','; + } + } + + next += base64VLQ.encode(mapping.generatedColumn + - previousGeneratedColumn); + previousGeneratedColumn = mapping.generatedColumn; + + if (mapping.source != null) { + sourceIdx = this._sources.indexOf(mapping.source); + next += base64VLQ.encode(sourceIdx - previousSource); + previousSource = sourceIdx; + + // lines are stored 0-based in SourceMap spec version 3 + next += base64VLQ.encode(mapping.originalLine - 1 + - previousOriginalLine); + previousOriginalLine = mapping.originalLine - 1; + + next += base64VLQ.encode(mapping.originalColumn + - previousOriginalColumn); + previousOriginalColumn = mapping.originalColumn; + + if (mapping.name != null) { + nameIdx = this._names.indexOf(mapping.name); + next += base64VLQ.encode(nameIdx - previousName); + previousName = nameIdx; + } + } + + result += next; + } + + return result; + }; + +SourceMapGenerator.prototype._generateSourcesContent = + function SourceMapGenerator_generateSourcesContent(aSources, aSourceRoot) { + return aSources.map(function (source) { + if (!this._sourcesContents) { + return null; + } + if (aSourceRoot != null) { + source = util.relative(aSourceRoot, source); + } + var key = util.toSetString(source); + return Object.prototype.hasOwnProperty.call(this._sourcesContents, key) + ? this._sourcesContents[key] + : null; + }, this); + }; + +/** + * Externalize the source map. + */ +SourceMapGenerator.prototype.toJSON = + function SourceMapGenerator_toJSON() { + var map = { + version: this._version, + sources: this._sources.toArray(), + names: this._names.toArray(), + mappings: this._serializeMappings() + }; + if (this._file != null) { + map.file = this._file; + } + if (this._sourceRoot != null) { + map.sourceRoot = this._sourceRoot; + } + if (this._sourcesContents) { + map.sourcesContent = this._generateSourcesContent(map.sources, map.sourceRoot); + } + + return map; + }; + +/** + * Render the source map being generated to a string. + */ +SourceMapGenerator.prototype.toString = + function SourceMapGenerator_toString() { + return JSON.stringify(this.toJSON()); + }; + +exports.SourceMapGenerator = SourceMapGenerator; diff --git a/node_modules/ava/node_modules/source-map/lib/source-node.js b/node_modules/ava/node_modules/source-map/lib/source-node.js new file mode 100644 index 000000000..8bcdbe385 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/source-node.js @@ -0,0 +1,413 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +var SourceMapGenerator = require('./source-map-generator').SourceMapGenerator; +var util = require('./util'); + +// Matches a Windows-style `\r\n` newline or a `\n` newline used by all other +// operating systems these days (capturing the result). +var REGEX_NEWLINE = /(\r?\n)/; + +// Newline character code for charCodeAt() comparisons +var NEWLINE_CODE = 10; + +// Private symbol for identifying `SourceNode`s when multiple versions of +// the source-map library are loaded. This MUST NOT CHANGE across +// versions! +var isSourceNode = "$$$isSourceNode$$$"; + +/** + * SourceNodes provide a way to abstract over interpolating/concatenating + * snippets of generated JavaScript source code while maintaining the line and + * column information associated with the original source code. + * + * @param aLine The original line number. + * @param aColumn The original column number. + * @param aSource The original source's filename. + * @param aChunks Optional. An array of strings which are snippets of + * generated JS, or other SourceNodes. + * @param aName The original identifier. + */ +function SourceNode(aLine, aColumn, aSource, aChunks, aName) { + this.children = []; + this.sourceContents = {}; + this.line = aLine == null ? null : aLine; + this.column = aColumn == null ? null : aColumn; + this.source = aSource == null ? null : aSource; + this.name = aName == null ? null : aName; + this[isSourceNode] = true; + if (aChunks != null) this.add(aChunks); +} + +/** + * Creates a SourceNode from generated code and a SourceMapConsumer. + * + * @param aGeneratedCode The generated code + * @param aSourceMapConsumer The SourceMap for the generated code + * @param aRelativePath Optional. The path that relative sources in the + * SourceMapConsumer should be relative to. + */ +SourceNode.fromStringWithSourceMap = + function SourceNode_fromStringWithSourceMap(aGeneratedCode, aSourceMapConsumer, aRelativePath) { + // The SourceNode we want to fill with the generated code + // and the SourceMap + var node = new SourceNode(); + + // All even indices of this array are one line of the generated code, + // while all odd indices are the newlines between two adjacent lines + // (since `REGEX_NEWLINE` captures its match). + // Processed fragments are accessed by calling `shiftNextLine`. + var remainingLines = aGeneratedCode.split(REGEX_NEWLINE); + var remainingLinesIndex = 0; + var shiftNextLine = function() { + var lineContents = getNextLine(); + // The last line of a file might not have a newline. + var newLine = getNextLine() || ""; + return lineContents + newLine; + + function getNextLine() { + return remainingLinesIndex < remainingLines.length ? + remainingLines[remainingLinesIndex++] : undefined; + } + }; + + // We need to remember the position of "remainingLines" + var lastGeneratedLine = 1, lastGeneratedColumn = 0; + + // The generate SourceNodes we need a code range. + // To extract it current and last mapping is used. + // Here we store the last mapping. + var lastMapping = null; + + aSourceMapConsumer.eachMapping(function (mapping) { + if (lastMapping !== null) { + // We add the code from "lastMapping" to "mapping": + // First check if there is a new line in between. + if (lastGeneratedLine < mapping.generatedLine) { + // Associate first line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + lastGeneratedLine++; + lastGeneratedColumn = 0; + // The remaining code is added without mapping + } else { + // There is no new line in between. + // Associate the code between "lastGeneratedColumn" and + // "mapping.generatedColumn" with "lastMapping" + var nextLine = remainingLines[remainingLinesIndex] || ''; + var code = nextLine.substr(0, mapping.generatedColumn - + lastGeneratedColumn); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn - + lastGeneratedColumn); + lastGeneratedColumn = mapping.generatedColumn; + addMappingWithCode(lastMapping, code); + // No more remaining code, continue + lastMapping = mapping; + return; + } + } + // We add the generated code until the first mapping + // to the SourceNode without any mapping. + // Each line is added as separate string. + while (lastGeneratedLine < mapping.generatedLine) { + node.add(shiftNextLine()); + lastGeneratedLine++; + } + if (lastGeneratedColumn < mapping.generatedColumn) { + var nextLine = remainingLines[remainingLinesIndex] || ''; + node.add(nextLine.substr(0, mapping.generatedColumn)); + remainingLines[remainingLinesIndex] = nextLine.substr(mapping.generatedColumn); + lastGeneratedColumn = mapping.generatedColumn; + } + lastMapping = mapping; + }, this); + // We have processed all mappings. + if (remainingLinesIndex < remainingLines.length) { + if (lastMapping) { + // Associate the remaining code in the current line with "lastMapping" + addMappingWithCode(lastMapping, shiftNextLine()); + } + // and add the remaining lines without any mapping + node.add(remainingLines.splice(remainingLinesIndex).join("")); + } + + // Copy sourcesContent into SourceNode + aSourceMapConsumer.sources.forEach(function (sourceFile) { + var content = aSourceMapConsumer.sourceContentFor(sourceFile); + if (content != null) { + if (aRelativePath != null) { + sourceFile = util.join(aRelativePath, sourceFile); + } + node.setSourceContent(sourceFile, content); + } + }); + + return node; + + function addMappingWithCode(mapping, code) { + if (mapping === null || mapping.source === undefined) { + node.add(code); + } else { + var source = aRelativePath + ? util.join(aRelativePath, mapping.source) + : mapping.source; + node.add(new SourceNode(mapping.originalLine, + mapping.originalColumn, + source, + code, + mapping.name)); + } + } + }; + +/** + * Add a chunk of generated JS to this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.add = function SourceNode_add(aChunk) { + if (Array.isArray(aChunk)) { + aChunk.forEach(function (chunk) { + this.add(chunk); + }, this); + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + if (aChunk) { + this.children.push(aChunk); + } + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Add a chunk of generated JS to the beginning of this source node. + * + * @param aChunk A string snippet of generated JS code, another instance of + * SourceNode, or an array where each member is one of those things. + */ +SourceNode.prototype.prepend = function SourceNode_prepend(aChunk) { + if (Array.isArray(aChunk)) { + for (var i = aChunk.length-1; i >= 0; i--) { + this.prepend(aChunk[i]); + } + } + else if (aChunk[isSourceNode] || typeof aChunk === "string") { + this.children.unshift(aChunk); + } + else { + throw new TypeError( + "Expected a SourceNode, string, or an array of SourceNodes and strings. Got " + aChunk + ); + } + return this; +}; + +/** + * Walk over the tree of JS snippets in this node and its children. The + * walking function is called once for each snippet of JS and is passed that + * snippet and the its original associated source's line/column location. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walk = function SourceNode_walk(aFn) { + var chunk; + for (var i = 0, len = this.children.length; i < len; i++) { + chunk = this.children[i]; + if (chunk[isSourceNode]) { + chunk.walk(aFn); + } + else { + if (chunk !== '') { + aFn(chunk, { source: this.source, + line: this.line, + column: this.column, + name: this.name }); + } + } + } +}; + +/** + * Like `String.prototype.join` except for SourceNodes. Inserts `aStr` between + * each of `this.children`. + * + * @param aSep The separator. + */ +SourceNode.prototype.join = function SourceNode_join(aSep) { + var newChildren; + var i; + var len = this.children.length; + if (len > 0) { + newChildren = []; + for (i = 0; i < len-1; i++) { + newChildren.push(this.children[i]); + newChildren.push(aSep); + } + newChildren.push(this.children[i]); + this.children = newChildren; + } + return this; +}; + +/** + * Call String.prototype.replace on the very right-most source snippet. Useful + * for trimming whitespace from the end of a source node, etc. + * + * @param aPattern The pattern to replace. + * @param aReplacement The thing to replace the pattern with. + */ +SourceNode.prototype.replaceRight = function SourceNode_replaceRight(aPattern, aReplacement) { + var lastChild = this.children[this.children.length - 1]; + if (lastChild[isSourceNode]) { + lastChild.replaceRight(aPattern, aReplacement); + } + else if (typeof lastChild === 'string') { + this.children[this.children.length - 1] = lastChild.replace(aPattern, aReplacement); + } + else { + this.children.push(''.replace(aPattern, aReplacement)); + } + return this; +}; + +/** + * Set the source content for a source file. This will be added to the SourceMapGenerator + * in the sourcesContent field. + * + * @param aSourceFile The filename of the source file + * @param aSourceContent The content of the source file + */ +SourceNode.prototype.setSourceContent = + function SourceNode_setSourceContent(aSourceFile, aSourceContent) { + this.sourceContents[util.toSetString(aSourceFile)] = aSourceContent; + }; + +/** + * Walk over the tree of SourceNodes. The walking function is called for each + * source file content and is passed the filename and source content. + * + * @param aFn The traversal function. + */ +SourceNode.prototype.walkSourceContents = + function SourceNode_walkSourceContents(aFn) { + for (var i = 0, len = this.children.length; i < len; i++) { + if (this.children[i][isSourceNode]) { + this.children[i].walkSourceContents(aFn); + } + } + + var sources = Object.keys(this.sourceContents); + for (var i = 0, len = sources.length; i < len; i++) { + aFn(util.fromSetString(sources[i]), this.sourceContents[sources[i]]); + } + }; + +/** + * Return the string representation of this source node. Walks over the tree + * and concatenates all the various snippets together to one string. + */ +SourceNode.prototype.toString = function SourceNode_toString() { + var str = ""; + this.walk(function (chunk) { + str += chunk; + }); + return str; +}; + +/** + * Returns the string representation of this source node along with a source + * map. + */ +SourceNode.prototype.toStringWithSourceMap = function SourceNode_toStringWithSourceMap(aArgs) { + var generated = { + code: "", + line: 1, + column: 0 + }; + var map = new SourceMapGenerator(aArgs); + var sourceMappingActive = false; + var lastOriginalSource = null; + var lastOriginalLine = null; + var lastOriginalColumn = null; + var lastOriginalName = null; + this.walk(function (chunk, original) { + generated.code += chunk; + if (original.source !== null + && original.line !== null + && original.column !== null) { + if(lastOriginalSource !== original.source + || lastOriginalLine !== original.line + || lastOriginalColumn !== original.column + || lastOriginalName !== original.name) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + lastOriginalSource = original.source; + lastOriginalLine = original.line; + lastOriginalColumn = original.column; + lastOriginalName = original.name; + sourceMappingActive = true; + } else if (sourceMappingActive) { + map.addMapping({ + generated: { + line: generated.line, + column: generated.column + } + }); + lastOriginalSource = null; + sourceMappingActive = false; + } + for (var idx = 0, length = chunk.length; idx < length; idx++) { + if (chunk.charCodeAt(idx) === NEWLINE_CODE) { + generated.line++; + generated.column = 0; + // Mappings end at eol + if (idx + 1 === length) { + lastOriginalSource = null; + sourceMappingActive = false; + } else if (sourceMappingActive) { + map.addMapping({ + source: original.source, + original: { + line: original.line, + column: original.column + }, + generated: { + line: generated.line, + column: generated.column + }, + name: original.name + }); + } + } else { + generated.column++; + } + } + }); + this.walkSourceContents(function (sourceFile, sourceContent) { + map.setSourceContent(sourceFile, sourceContent); + }); + + return { code: generated.code, map: map }; +}; + +exports.SourceNode = SourceNode; diff --git a/node_modules/ava/node_modules/source-map/lib/util.js b/node_modules/ava/node_modules/source-map/lib/util.js new file mode 100644 index 000000000..3ca92e56f --- /dev/null +++ b/node_modules/ava/node_modules/source-map/lib/util.js @@ -0,0 +1,488 @@ +/* -*- Mode: js; js-indent-level: 2; -*- */ +/* + * Copyright 2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE or: + * http://opensource.org/licenses/BSD-3-Clause + */ + +/** + * This is a helper function for getting values from parameter/options + * objects. + * + * @param args The object we are extracting values from + * @param name The name of the property we are getting. + * @param defaultValue An optional value to return if the property is missing + * from the object. If this is not specified and the property is missing, an + * error will be thrown. + */ +function getArg(aArgs, aName, aDefaultValue) { + if (aName in aArgs) { + return aArgs[aName]; + } else if (arguments.length === 3) { + return aDefaultValue; + } else { + throw new Error('"' + aName + '" is a required argument.'); + } +} +exports.getArg = getArg; + +var urlRegexp = /^(?:([\w+\-.]+):)?\/\/(?:(\w+:\w+)@)?([\w.-]*)(?::(\d+))?(.*)$/; +var dataUrlRegexp = /^data:.+\,.+$/; + +function urlParse(aUrl) { + var match = aUrl.match(urlRegexp); + if (!match) { + return null; + } + return { + scheme: match[1], + auth: match[2], + host: match[3], + port: match[4], + path: match[5] + }; +} +exports.urlParse = urlParse; + +function urlGenerate(aParsedUrl) { + var url = ''; + if (aParsedUrl.scheme) { + url += aParsedUrl.scheme + ':'; + } + url += '//'; + if (aParsedUrl.auth) { + url += aParsedUrl.auth + '@'; + } + if (aParsedUrl.host) { + url += aParsedUrl.host; + } + if (aParsedUrl.port) { + url += ":" + aParsedUrl.port + } + if (aParsedUrl.path) { + url += aParsedUrl.path; + } + return url; +} +exports.urlGenerate = urlGenerate; + +/** + * Normalizes a path, or the path portion of a URL: + * + * - Replaces consecutive slashes with one slash. + * - Removes unnecessary '.' parts. + * - Removes unnecessary '<dir>/..' parts. + * + * Based on code in the Node.js 'path' core module. + * + * @param aPath The path or url to normalize. + */ +function normalize(aPath) { + var path = aPath; + var url = urlParse(aPath); + if (url) { + if (!url.path) { + return aPath; + } + path = url.path; + } + var isAbsolute = exports.isAbsolute(path); + + var parts = path.split(/\/+/); + for (var part, up = 0, i = parts.length - 1; i >= 0; i--) { + part = parts[i]; + if (part === '.') { + parts.splice(i, 1); + } else if (part === '..') { + up++; + } else if (up > 0) { + if (part === '') { + // The first part is blank if the path is absolute. Trying to go + // above the root is a no-op. Therefore we can remove all '..' parts + // directly after the root. + parts.splice(i + 1, up); + up = 0; + } else { + parts.splice(i, 2); + up--; + } + } + } + path = parts.join('/'); + + if (path === '') { + path = isAbsolute ? '/' : '.'; + } + + if (url) { + url.path = path; + return urlGenerate(url); + } + return path; +} +exports.normalize = normalize; + +/** + * Joins two paths/URLs. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be joined with the root. + * + * - If aPath is a URL or a data URI, aPath is returned, unless aPath is a + * scheme-relative URL: Then the scheme of aRoot, if any, is prepended + * first. + * - Otherwise aPath is a path. If aRoot is a URL, then its path portion + * is updated with the result and aRoot is returned. Otherwise the result + * is returned. + * - If aPath is absolute, the result is aPath. + * - Otherwise the two paths are joined with a slash. + * - Joining for example 'http://' and 'www.example.com' is also supported. + */ +function join(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + if (aPath === "") { + aPath = "."; + } + var aPathUrl = urlParse(aPath); + var aRootUrl = urlParse(aRoot); + if (aRootUrl) { + aRoot = aRootUrl.path || '/'; + } + + // `join(foo, '//www.example.org')` + if (aPathUrl && !aPathUrl.scheme) { + if (aRootUrl) { + aPathUrl.scheme = aRootUrl.scheme; + } + return urlGenerate(aPathUrl); + } + + if (aPathUrl || aPath.match(dataUrlRegexp)) { + return aPath; + } + + // `join('http://', 'www.example.com')` + if (aRootUrl && !aRootUrl.host && !aRootUrl.path) { + aRootUrl.host = aPath; + return urlGenerate(aRootUrl); + } + + var joined = aPath.charAt(0) === '/' + ? aPath + : normalize(aRoot.replace(/\/+$/, '') + '/' + aPath); + + if (aRootUrl) { + aRootUrl.path = joined; + return urlGenerate(aRootUrl); + } + return joined; +} +exports.join = join; + +exports.isAbsolute = function (aPath) { + return aPath.charAt(0) === '/' || urlRegexp.test(aPath); +}; + +/** + * Make a path relative to a URL or another path. + * + * @param aRoot The root path or URL. + * @param aPath The path or URL to be made relative to aRoot. + */ +function relative(aRoot, aPath) { + if (aRoot === "") { + aRoot = "."; + } + + aRoot = aRoot.replace(/\/$/, ''); + + // It is possible for the path to be above the root. In this case, simply + // checking whether the root is a prefix of the path won't work. Instead, we + // need to remove components from the root one by one, until either we find + // a prefix that fits, or we run out of components to remove. + var level = 0; + while (aPath.indexOf(aRoot + '/') !== 0) { + var index = aRoot.lastIndexOf("/"); + if (index < 0) { + return aPath; + } + + // If the only part of the root that is left is the scheme (i.e. http://, + // file:///, etc.), one or more slashes (/), or simply nothing at all, we + // have exhausted all components, so the path is not relative to the root. + aRoot = aRoot.slice(0, index); + if (aRoot.match(/^([^\/]+:\/)?\/*$/)) { + return aPath; + } + + ++level; + } + + // Make sure we add a "../" for each component we removed from the root. + return Array(level + 1).join("../") + aPath.substr(aRoot.length + 1); +} +exports.relative = relative; + +var supportsNullProto = (function () { + var obj = Object.create(null); + return !('__proto__' in obj); +}()); + +function identity (s) { + return s; +} + +/** + * Because behavior goes wacky when you set `__proto__` on objects, we + * have to prefix all the strings in our set with an arbitrary character. + * + * See https://github.com/mozilla/source-map/pull/31 and + * https://github.com/mozilla/source-map/issues/30 + * + * @param String aStr + */ +function toSetString(aStr) { + if (isProtoString(aStr)) { + return '$' + aStr; + } + + return aStr; +} +exports.toSetString = supportsNullProto ? identity : toSetString; + +function fromSetString(aStr) { + if (isProtoString(aStr)) { + return aStr.slice(1); + } + + return aStr; +} +exports.fromSetString = supportsNullProto ? identity : fromSetString; + +function isProtoString(s) { + if (!s) { + return false; + } + + var length = s.length; + + if (length < 9 /* "__proto__".length */) { + return false; + } + + if (s.charCodeAt(length - 1) !== 95 /* '_' */ || + s.charCodeAt(length - 2) !== 95 /* '_' */ || + s.charCodeAt(length - 3) !== 111 /* 'o' */ || + s.charCodeAt(length - 4) !== 116 /* 't' */ || + s.charCodeAt(length - 5) !== 111 /* 'o' */ || + s.charCodeAt(length - 6) !== 114 /* 'r' */ || + s.charCodeAt(length - 7) !== 112 /* 'p' */ || + s.charCodeAt(length - 8) !== 95 /* '_' */ || + s.charCodeAt(length - 9) !== 95 /* '_' */) { + return false; + } + + for (var i = length - 10; i >= 0; i--) { + if (s.charCodeAt(i) !== 36 /* '$' */) { + return false; + } + } + + return true; +} + +/** + * Comparator between two mappings where the original positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same original source/line/column, but different generated + * line and column the same. Useful when searching for a mapping with a + * stubbed out mapping. + */ +function compareByOriginalPositions(mappingA, mappingB, onlyCompareOriginal) { + var cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0 || onlyCompareOriginal) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByOriginalPositions = compareByOriginalPositions; + +/** + * Comparator between two mappings with deflated source and name indices where + * the generated positions are compared. + * + * Optionally pass in `true` as `onlyCompareGenerated` to consider two + * mappings with the same generated line and column, but different + * source/name/original line and column the same. Useful when searching for a + * mapping with a stubbed out mapping. + */ +function compareByGeneratedPositionsDeflated(mappingA, mappingB, onlyCompareGenerated) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0 || onlyCompareGenerated) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsDeflated = compareByGeneratedPositionsDeflated; + +function strcmp(aStr1, aStr2) { + if (aStr1 === aStr2) { + return 0; + } + + if (aStr1 === null) { + return 1; // aStr2 !== null + } + + if (aStr2 === null) { + return -1; // aStr1 !== null + } + + if (aStr1 > aStr2) { + return 1; + } + + return -1; +} + +/** + * Comparator between two mappings with inflated source and name strings where + * the generated positions are compared. + */ +function compareByGeneratedPositionsInflated(mappingA, mappingB) { + var cmp = mappingA.generatedLine - mappingB.generatedLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.generatedColumn - mappingB.generatedColumn; + if (cmp !== 0) { + return cmp; + } + + cmp = strcmp(mappingA.source, mappingB.source); + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalLine - mappingB.originalLine; + if (cmp !== 0) { + return cmp; + } + + cmp = mappingA.originalColumn - mappingB.originalColumn; + if (cmp !== 0) { + return cmp; + } + + return strcmp(mappingA.name, mappingB.name); +} +exports.compareByGeneratedPositionsInflated = compareByGeneratedPositionsInflated; + +/** + * Strip any JSON XSSI avoidance prefix from the string (as documented + * in the source maps specification), and then parse the string as + * JSON. + */ +function parseSourceMapInput(str) { + return JSON.parse(str.replace(/^\)]}'[^\n]*\n/, '')); +} +exports.parseSourceMapInput = parseSourceMapInput; + +/** + * Compute the URL of a source given the the source root, the source's + * URL, and the source map's URL. + */ +function computeSourceURL(sourceRoot, sourceURL, sourceMapURL) { + sourceURL = sourceURL || ''; + + if (sourceRoot) { + // This follows what Chrome does. + if (sourceRoot[sourceRoot.length - 1] !== '/' && sourceURL[0] !== '/') { + sourceRoot += '/'; + } + // The spec says: + // Line 4: An optional source root, useful for relocating source + // files on a server or removing repeated values in the + // “sources” entry. This value is prepended to the individual + // entries in the “source” field. + sourceURL = sourceRoot + sourceURL; + } + + // Historically, SourceMapConsumer did not take the sourceMapURL as + // a parameter. This mode is still somewhat supported, which is why + // this code block is conditional. However, it's preferable to pass + // the source map URL to SourceMapConsumer, so that this function + // can implement the source URL resolution algorithm as outlined in + // the spec. This block is basically the equivalent of: + // new URL(sourceURL, sourceMapURL).toString() + // ... except it avoids using URL, which wasn't available in the + // older releases of node still supported by this library. + // + // The spec says: + // If the sources are not absolute URLs after prepending of the + // “sourceRoot”, the sources are resolved relative to the + // SourceMap (like resolving script src in a html document). + if (sourceMapURL) { + var parsed = urlParse(sourceMapURL); + if (!parsed) { + throw new Error("sourceMapURL could not be parsed"); + } + if (parsed.path) { + // Strip the last path component, but keep the "/". + var index = parsed.path.lastIndexOf('/'); + if (index >= 0) { + parsed.path = parsed.path.substring(0, index + 1); + } + } + sourceURL = join(urlGenerate(parsed), sourceURL); + } + + return normalize(sourceURL); +} +exports.computeSourceURL = computeSourceURL; diff --git a/node_modules/ava/node_modules/source-map/package.json b/node_modules/ava/node_modules/source-map/package.json new file mode 100644 index 000000000..24663417e --- /dev/null +++ b/node_modules/ava/node_modules/source-map/package.json @@ -0,0 +1,73 @@ +{ + "name": "source-map", + "description": "Generates and consumes source maps", + "version": "0.6.1", + "homepage": "https://github.com/mozilla/source-map", + "author": "Nick Fitzgerald <nfitzgerald@mozilla.com>", + "contributors": [ + "Tobias Koppers <tobias.koppers@googlemail.com>", + "Duncan Beevers <duncan@dweebd.com>", + "Stephen Crane <scrane@mozilla.com>", + "Ryan Seddon <seddon.ryan@gmail.com>", + "Miles Elam <miles.elam@deem.com>", + "Mihai Bazon <mihai.bazon@gmail.com>", + "Michael Ficarra <github.public.email@michael.ficarra.me>", + "Todd Wolfson <todd@twolfson.com>", + "Alexander Solovyov <alexander@solovyov.net>", + "Felix Gnass <fgnass@gmail.com>", + "Conrad Irwin <conrad.irwin@gmail.com>", + "usrbincc <usrbincc@yahoo.com>", + "David Glasser <glasser@davidglasser.net>", + "Chase Douglas <chase@newrelic.com>", + "Evan Wallace <evan.exe@gmail.com>", + "Heather Arthur <fayearthur@gmail.com>", + "Hugh Kennedy <hughskennedy@gmail.com>", + "David Glasser <glasser@davidglasser.net>", + "Simon Lydell <simon.lydell@gmail.com>", + "Jmeas Smith <jellyes2@gmail.com>", + "Michael Z Goddard <mzgoddard@gmail.com>", + "azu <azu@users.noreply.github.com>", + "John Gozde <john@gozde.ca>", + "Adam Kirkton <akirkton@truefitinnovation.com>", + "Chris Montgomery <christopher.montgomery@dowjones.com>", + "J. Ryan Stinnett <jryans@gmail.com>", + "Jack Herrington <jherrington@walmartlabs.com>", + "Chris Truter <jeffpalentine@gmail.com>", + "Daniel Espeset <daniel@danielespeset.com>", + "Jamie Wong <jamie.lf.wong@gmail.com>", + "Eddy Bruël <ejpbruel@mozilla.com>", + "Hawken Rives <hawkrives@gmail.com>", + "Gilad Peleg <giladp007@gmail.com>", + "djchie <djchie.dev@gmail.com>", + "Gary Ye <garysye@gmail.com>", + "Nicolas Lalevée <nicolas.lalevee@hibnet.org>" + ], + "repository": { + "type": "git", + "url": "http://github.com/mozilla/source-map.git" + }, + "main": "./source-map.js", + "files": [ + "source-map.js", + "source-map.d.ts", + "lib/", + "dist/source-map.debug.js", + "dist/source-map.js", + "dist/source-map.min.js", + "dist/source-map.min.js.map" + ], + "engines": { + "node": ">=0.10.0" + }, + "license": "BSD-3-Clause", + "scripts": { + "test": "npm run build && node test/run-tests.js", + "build": "webpack --color", + "toc": "doctoc --title '## Table of Contents' README.md && doctoc --title '## Table of Contents' CONTRIBUTING.md" + }, + "devDependencies": { + "doctoc": "^0.15.0", + "webpack": "^1.12.0" + }, + "typings": "source-map" +} diff --git a/node_modules/ava/node_modules/source-map/source-map.d.ts b/node_modules/ava/node_modules/source-map/source-map.d.ts new file mode 100644 index 000000000..8f972b0cf --- /dev/null +++ b/node_modules/ava/node_modules/source-map/source-map.d.ts @@ -0,0 +1,98 @@ +export interface StartOfSourceMap { + file?: string; + sourceRoot?: string; +} + +export interface RawSourceMap extends StartOfSourceMap { + version: string; + sources: string[]; + names: string[]; + sourcesContent?: string[]; + mappings: string; +} + +export interface Position { + line: number; + column: number; +} + +export interface LineRange extends Position { + lastColumn: number; +} + +export interface FindPosition extends Position { + // SourceMapConsumer.GREATEST_LOWER_BOUND or SourceMapConsumer.LEAST_UPPER_BOUND + bias?: number; +} + +export interface SourceFindPosition extends FindPosition { + source: string; +} + +export interface MappedPosition extends Position { + source: string; + name?: string; +} + +export interface MappingItem { + source: string; + generatedLine: number; + generatedColumn: number; + originalLine: number; + originalColumn: number; + name: string; +} + +export class SourceMapConsumer { + static GENERATED_ORDER: number; + static ORIGINAL_ORDER: number; + + static GREATEST_LOWER_BOUND: number; + static LEAST_UPPER_BOUND: number; + + constructor(rawSourceMap: RawSourceMap); + computeColumnSpans(): void; + originalPositionFor(generatedPosition: FindPosition): MappedPosition; + generatedPositionFor(originalPosition: SourceFindPosition): LineRange; + allGeneratedPositionsFor(originalPosition: MappedPosition): Position[]; + hasContentsOfAllSources(): boolean; + sourceContentFor(source: string, returnNullOnMissing?: boolean): string; + eachMapping(callback: (mapping: MappingItem) => void, context?: any, order?: number): void; +} + +export interface Mapping { + generated: Position; + original: Position; + source: string; + name?: string; +} + +export class SourceMapGenerator { + constructor(startOfSourceMap?: StartOfSourceMap); + static fromSourceMap(sourceMapConsumer: SourceMapConsumer): SourceMapGenerator; + addMapping(mapping: Mapping): void; + setSourceContent(sourceFile: string, sourceContent: string): void; + applySourceMap(sourceMapConsumer: SourceMapConsumer, sourceFile?: string, sourceMapPath?: string): void; + toString(): string; +} + +export interface CodeWithSourceMap { + code: string; + map: SourceMapGenerator; +} + +export class SourceNode { + constructor(); + constructor(line: number, column: number, source: string); + constructor(line: number, column: number, source: string, chunk?: string, name?: string); + static fromStringWithSourceMap(code: string, sourceMapConsumer: SourceMapConsumer, relativePath?: string): SourceNode; + add(chunk: string): void; + prepend(chunk: string): void; + setSourceContent(sourceFile: string, sourceContent: string): void; + walk(fn: (chunk: string, mapping: MappedPosition) => void): void; + walkSourceContents(fn: (file: string, content: string) => void): void; + join(sep: string): SourceNode; + replaceRight(pattern: string, replacement: string): SourceNode; + toString(): string; + toStringWithSourceMap(startOfSourceMap?: StartOfSourceMap): CodeWithSourceMap; +} diff --git a/node_modules/ava/node_modules/source-map/source-map.js b/node_modules/ava/node_modules/source-map/source-map.js new file mode 100644 index 000000000..bc88fe820 --- /dev/null +++ b/node_modules/ava/node_modules/source-map/source-map.js @@ -0,0 +1,8 @@ +/* + * Copyright 2009-2011 Mozilla Foundation and contributors + * Licensed under the New BSD license. See LICENSE.txt or: + * http://opensource.org/licenses/BSD-3-Clause + */ +exports.SourceMapGenerator = require('./lib/source-map-generator').SourceMapGenerator; +exports.SourceMapConsumer = require('./lib/source-map-consumer').SourceMapConsumer; +exports.SourceNode = require('./lib/source-node').SourceNode; diff --git a/node_modules/ava/node_modules/supports-color/browser.js b/node_modules/ava/node_modules/supports-color/browser.js new file mode 100644 index 000000000..62afa3a74 --- /dev/null +++ b/node_modules/ava/node_modules/supports-color/browser.js @@ -0,0 +1,5 @@ +'use strict'; +module.exports = { + stdout: false, + stderr: false +}; diff --git a/node_modules/ava/node_modules/supports-color/index.js b/node_modules/ava/node_modules/supports-color/index.js new file mode 100644 index 000000000..bbf9ef1e8 --- /dev/null +++ b/node_modules/ava/node_modules/supports-color/index.js @@ -0,0 +1,126 @@ +'use strict'; +const os = require('os'); +const hasFlag = require('has-flag'); + +const env = process.env; + +function translateLevel(level) { + if (level === 0) { + return false; + } + + return { + level, + hasBasic: true, + has256: level >= 2, + has16m: level >= 3 + }; +} + +function supportsColor(stream) { + if (hasFlag('no-color') || + hasFlag('no-colors') || + hasFlag('color=false')) { + return 0; + } + + if (hasFlag('color=16m') || + hasFlag('color=full') || + hasFlag('color=truecolor')) { + return 3; + } + + if (hasFlag('color=256')) { + return 2; + } + + if (hasFlag('color') || + hasFlag('colors') || + hasFlag('color=true') || + hasFlag('color=always')) { + return 1; + } + + if (stream && !stream.isTTY) { + return 0; + } + + if (process.platform === 'win32') { + // Node.js 7.5.0 is the first version of Node.js to include a patch to + // libuv that enables 256 color output on Windows. Anything earlier and it + // won't work. However, here we target Node.js 8 at minimum as it is an LTS + // release, and Node.js 7 is not. Windows 10 build 10586 is the first Windows + // release that supports 256 colors. Windows 10 build 14931 is the first release + // that supports 16m/TrueColor. + const osRelease = os.release().split('.'); + if ( + Number(process.versions.node.split('.')[0]) >= 8 && + Number(osRelease[0]) >= 10 && + Number(osRelease[2]) >= 10586 + ) { + return Number(osRelease[2]) >= 14931 ? 3 : 2; + } + + return 1; + } + + if ('CI' in env) { + if (['TRAVIS', 'CIRCLECI', 'APPVEYOR', 'GITLAB_CI'].some(sign => sign in env) || env.CI_NAME === 'codeship') { + return 1; + } + + return 0; + } + + if ('TEAMCITY_VERSION' in env) { + return /^(9\.(0*[1-9]\d*)\.|\d{2,}\.)/.test(env.TEAMCITY_VERSION) ? 1 : 0; + } + + if ('TERM_PROGRAM' in env) { + const version = parseInt((env.TERM_PROGRAM_VERSION || '').split('.')[0], 10); + + switch (env.TERM_PROGRAM) { + case 'iTerm.app': + return version >= 3 ? 3 : 2; + case 'Hyper': + return 3; + case 'Apple_Terminal': + return 2; + // No default + } + } + + if (/-256(color)?$/i.test(env.TERM)) { + return 2; + } + + if (/^screen|^xterm|^vt100|^rxvt|color|ansi|cygwin|linux/i.test(env.TERM)) { + return 1; + } + + if ('COLORTERM' in env) { + return 1; + } + + if (env.TERM === 'dumb') { + return 0; + } + + return 0; +} + +function getSupportLevel(stream) { + let level = supportsColor(stream); + + if ('FORCE_COLOR' in env) { + level = (env.FORCE_COLOR.length > 0 && parseInt(env.FORCE_COLOR, 10) === 0) ? 0 : (level || 1); + } + + return translateLevel(level); +} + +module.exports = { + supportsColor: getSupportLevel, + stdout: getSupportLevel(process.stdout), + stderr: getSupportLevel(process.stderr) +}; diff --git a/node_modules/ava/node_modules/supports-color/license b/node_modules/ava/node_modules/supports-color/license new file mode 100644 index 000000000..e7af2f771 --- /dev/null +++ b/node_modules/ava/node_modules/supports-color/license @@ -0,0 +1,9 @@ +MIT License + +Copyright (c) Sindre Sorhus <sindresorhus@gmail.com> (sindresorhus.com) + +Permission is hereby granted, free of charge, to any person obtaining a copy of this software and associated documentation files (the "Software"), to deal in the Software without restriction, including without limitation the rights to use, copy, modify, merge, publish, distribute, sublicense, and/or sell copies of the Software, and to permit persons to whom the Software is furnished to do so, subject to the following conditions: + +The above copyright notice and this permission notice shall be included in all copies or substantial portions of the Software. + +THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. diff --git a/node_modules/ava/node_modules/supports-color/package.json b/node_modules/ava/node_modules/supports-color/package.json new file mode 100644 index 000000000..8c5263435 --- /dev/null +++ b/node_modules/ava/node_modules/supports-color/package.json @@ -0,0 +1,53 @@ +{ + "name": "supports-color", + "version": "5.1.0", + "description": "Detect whether a terminal supports color", + "license": "MIT", + "repository": "chalk/supports-color", + "author": { + "name": "Sindre Sorhus", + "email": "sindresorhus@gmail.com", + "url": "sindresorhus.com" + }, + "engines": { + "node": ">=4" + }, + "scripts": { + "test": "xo && ava" + }, + "files": [ + "index.js", + "browser.js" + ], + "keywords": [ + "color", + "colour", + "colors", + "terminal", + "console", + "cli", + "ansi", + "styles", + "tty", + "rgb", + "256", + "shell", + "xterm", + "command-line", + "support", + "supports", + "capability", + "detect", + "truecolor", + "16m" + ], + "dependencies": { + "has-flag": "^2.0.0" + }, + "devDependencies": { + "ava": "*", + "import-fresh": "^2.0.0", + "xo": "*" + }, + "browser": "browser.js" +} diff --git a/node_modules/ava/node_modules/supports-color/readme.md b/node_modules/ava/node_modules/supports-color/readme.md new file mode 100644 index 000000000..f6e401957 --- /dev/null +++ b/node_modules/ava/node_modules/supports-color/readme.md @@ -0,0 +1,66 @@ +# supports-color [](https://travis-ci.org/chalk/supports-color) + +> Detect whether a terminal supports color + + +## Install + +``` +$ npm install supports-color +``` + + +## Usage + +```js +const supportsColor = require('supports-color'); + +if (supportsColor.stdout) { + console.log('Terminal stdout supports color'); +} + +if (supportsColor.stdout.has256) { + console.log('Terminal stdout supports 256 colors'); +} + +if (supportsColor.stderr.has16m) { + console.log('Terminal stderr supports 16 million colors (truecolor)'); +} +``` + + +## API + +Returns an `Object` with a `stdout` and `stderr` property for testing either streams. Each property is an `Object`, or `false` if color is not supported. + +The `stdout`/`stderr` objects specifies a level of support for color through a `.level` property and a corresponding flag: + +- `.level = 1` and `.hasBasic = true`: Basic color support (16 colors) +- `.level = 2` and `.has256 = true`: 256 color support +- `.level = 3` and `.has16m = true`: Truecolor support (16 million colors) + + +## Info + +It obeys the `--color` and `--no-color` CLI flags. + +Can be overridden by the user with the flags `--color` and `--no-color`. For situations where using `--color` is not possible, add the environment variable `FORCE_COLOR=1` to forcefully enable color or `FORCE_COLOR=0` to forcefully disable. The use of `FORCE_COLOR` overrides all other color support checks. + +Explicit 256/Truecolor mode can be enabled using the `--color=256` and `--color=16m` flags, respectively. + + +## Related + +- [supports-color-cli](https://github.com/chalk/supports-color-cli) - CLI for this module +- [chalk](https://github.com/chalk/chalk) - Terminal string styling done right + + +## Maintainers + +- [Sindre Sorhus](https://github.com/sindresorhus) +- [Josh Junon](https://github.com/qix-) + + +## License + +MIT |
