From 706c07fa1d069290992bd31d53b0c89324992f9c Mon Sep 17 00:00:00 2001 From: Florian Dold Date: Thu, 28 Nov 2019 00:46:34 +0100 Subject: implement JS-only Taler, remove emscripten --- emscripten/README | 4 - emscripten/taler-emscripten-lib.js | 21 - emscripten/taler-emscripten-lib.wasm | Bin 428272 -> 0 bytes src/crypto/browserWorkerEntry.ts | 52 +- src/crypto/cryptoApi-test.ts | 117 -- src/crypto/cryptoImplementation.ts | 718 +++----- src/crypto/emscInterface-test.ts | 176 -- src/crypto/emscInterface.ts | 1657 ------------------ src/crypto/kdf.ts | 92 - src/crypto/nacl-fast.ts | 3036 --------------------------------- src/crypto/nodeEmscriptenLoader.ts | 101 -- src/crypto/nodeProcessWorker.ts | 2 - src/crypto/nodeWorkerEntry.ts | 17 +- src/crypto/primitives/kdf.ts | 92 + src/crypto/primitives/nacl-fast.ts | 3110 ++++++++++++++++++++++++++++++++++ src/crypto/primitives/sha256.ts | 429 +++++ src/crypto/sha256.ts | 429 ----- src/crypto/synchronousWorker.ts | 9 +- src/crypto/talerCrypto-test.ts | 44 +- src/crypto/talerCrypto.ts | 144 +- src/dbTypes.ts | 16 +- src/headless/helpers.ts | 7 +- src/headless/taler-wallet-cli.ts | 1 - src/helpers.ts | 11 + src/talerTypes.ts | 4 +- src/wallet-test.ts | 8 +- src/wallet.ts | 37 +- src/walletTypes.ts | 8 +- src/webex/renderHtml.tsx | 2 +- tsconfig.json | 10 +- 30 files changed, 4132 insertions(+), 6222 deletions(-) delete mode 100644 emscripten/README delete mode 100644 emscripten/taler-emscripten-lib.js delete mode 100644 emscripten/taler-emscripten-lib.wasm delete mode 100644 src/crypto/cryptoApi-test.ts delete mode 100644 src/crypto/emscInterface-test.ts delete mode 100644 src/crypto/emscInterface.ts delete mode 100644 src/crypto/kdf.ts delete mode 100644 src/crypto/nacl-fast.ts delete mode 100644 src/crypto/nodeEmscriptenLoader.ts create mode 100644 src/crypto/primitives/kdf.ts create mode 100644 src/crypto/primitives/nacl-fast.ts create mode 100644 src/crypto/primitives/sha256.ts delete mode 100644 src/crypto/sha256.ts diff --git a/emscripten/README b/emscripten/README deleted file mode 100644 index e13ea8ed1..000000000 --- a/emscripten/README +++ /dev/null @@ -1,4 +0,0 @@ -The taler-emscripten-lib.js is compiled from C using emscripten. - -See https://git.taler.net/libtalerutil-emscripten.git for automated build -instructions and the functions exported from this module. diff --git a/emscripten/taler-emscripten-lib.js b/emscripten/taler-emscripten-lib.js deleted file mode 100644 index dbc8832cb..000000000 --- a/emscripten/taler-emscripten-lib.js +++ /dev/null @@ -1,21 +0,0 @@ - -var TalerEmscriptenLib = (function() { - var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined; - return ( -function(TalerEmscriptenLib) { - TalerEmscriptenLib = TalerEmscriptenLib || {}; - -var Module=typeof TalerEmscriptenLib!=="undefined"?TalerEmscriptenLib:{};var moduleOverrides={};var key;for(key in Module){if(Module.hasOwnProperty(key)){moduleOverrides[key]=Module[key]}}var arguments_=[];var thisProgram="./this.program";var quit_=function(status,toThrow){throw toThrow};var ENVIRONMENT_IS_WEB=false;var ENVIRONMENT_IS_WORKER=false;var ENVIRONMENT_IS_NODE=false;var ENVIRONMENT_HAS_NODE=false;var ENVIRONMENT_IS_SHELL=false;ENVIRONMENT_IS_WEB=typeof window==="object";ENVIRONMENT_IS_WORKER=typeof importScripts==="function";ENVIRONMENT_HAS_NODE=typeof process==="object"&&typeof process.versions==="object"&&typeof process.versions.node==="string";ENVIRONMENT_IS_NODE=ENVIRONMENT_HAS_NODE&&!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_WORKER;ENVIRONMENT_IS_SHELL=!ENVIRONMENT_IS_WEB&&!ENVIRONMENT_IS_NODE&&!ENVIRONMENT_IS_WORKER;if(Module["ENVIRONMENT"]){throw new Error("Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -s ENVIRONMENT=web or -s ENVIRONMENT=node)")}var scriptDirectory="";function locateFile(path){if(Module["locateFile"]){return Module["locateFile"](path,scriptDirectory)}return scriptDirectory+path}var read_,readAsync,readBinary,setWindowTitle;if(ENVIRONMENT_IS_NODE){scriptDirectory=__dirname+"/";var nodeFS;var nodePath;read_=function shell_read(filename,binary){var ret;if(!nodeFS)nodeFS=require("fs");if(!nodePath)nodePath=require("path");filename=nodePath["normalize"](filename);ret=nodeFS["readFileSync"](filename);return binary?ret:ret.toString()};readBinary=function readBinary(filename){var ret=read_(filename,true);if(!ret.buffer){ret=new Uint8Array(ret)}assert(ret.buffer);return ret};if(process["argv"].length>1){thisProgram=process["argv"][1].replace(/\\/g,"/")}arguments_=process["argv"].slice(2);process["on"]("uncaughtException",function(ex){if(!(ex instanceof ExitStatus)){throw ex}});process["on"]("unhandledRejection",abort);quit_=function(status){process["exit"](status)};Module["inspect"]=function(){return"[Emscripten Module object]"}}else if(ENVIRONMENT_IS_SHELL){if(typeof read!="undefined"){read_=function shell_read(f){return read(f)}}readBinary=function readBinary(f){var data;if(typeof readbuffer==="function"){return new Uint8Array(readbuffer(f))}data=read(f,"binary");assert(typeof data==="object");return data};if(typeof scriptArgs!="undefined"){arguments_=scriptArgs}else if(typeof arguments!="undefined"){arguments_=arguments}if(typeof quit==="function"){quit_=function(status){quit(status)}}if(typeof print!=="undefined"){if(typeof console==="undefined")console={};console.log=print;console.warn=console.error=typeof printErr!=="undefined"?printErr:print}}else if(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER){if(ENVIRONMENT_IS_WORKER){scriptDirectory=self.location.href}else if(document.currentScript){scriptDirectory=document.currentScript.src}if(_scriptDir){scriptDirectory=_scriptDir}if(scriptDirectory.indexOf("blob:")!==0){scriptDirectory=scriptDirectory.substr(0,scriptDirectory.lastIndexOf("/")+1)}else{scriptDirectory=""}read_=function shell_read(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.send(null);return xhr.responseText};if(ENVIRONMENT_IS_WORKER){readBinary=function readBinary(url){var xhr=new XMLHttpRequest;xhr.open("GET",url,false);xhr.responseType="arraybuffer";xhr.send(null);return new Uint8Array(xhr.response)}}readAsync=function readAsync(url,onload,onerror){var xhr=new XMLHttpRequest;xhr.open("GET",url,true);xhr.responseType="arraybuffer";xhr.onload=function xhr_onload(){if(xhr.status==200||xhr.status==0&&xhr.response){onload(xhr.response);return}onerror()};xhr.onerror=onerror;xhr.send(null)};setWindowTitle=function(title){document.title=title}}else{throw new Error("environment detection error")}var out=Module["print"]||console.log.bind(console);var err=Module["printErr"]||console.warn.bind(console);for(key in moduleOverrides){if(moduleOverrides.hasOwnProperty(key)){Module[key]=moduleOverrides[key]}}moduleOverrides=null;if(Module["arguments"])arguments_=Module["arguments"];if(!Object.getOwnPropertyDescriptor(Module,"arguments"))Object.defineProperty(Module,"arguments",{get:function(){abort("Module.arguments has been replaced with plain arguments_")}});if(Module["thisProgram"])thisProgram=Module["thisProgram"];if(!Object.getOwnPropertyDescriptor(Module,"thisProgram"))Object.defineProperty(Module,"thisProgram",{get:function(){abort("Module.thisProgram has been replaced with plain thisProgram")}});if(Module["quit"])quit_=Module["quit"];if(!Object.getOwnPropertyDescriptor(Module,"quit"))Object.defineProperty(Module,"quit",{get:function(){abort("Module.quit has been replaced with plain quit_")}});assert(typeof Module["memoryInitializerPrefixURL"]==="undefined","Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["pthreadMainPrefixURL"]==="undefined","Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["cdInitializerPrefixURL"]==="undefined","Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["filePackagePrefixURL"]==="undefined","Module.filePackagePrefixURL option was removed, use Module.locateFile instead");assert(typeof Module["read"]==="undefined","Module.read option was removed (modify read_ in JS)");assert(typeof Module["readAsync"]==="undefined","Module.readAsync option was removed (modify readAsync in JS)");assert(typeof Module["readBinary"]==="undefined","Module.readBinary option was removed (modify readBinary in JS)");assert(typeof Module["setWindowTitle"]==="undefined","Module.setWindowTitle option was removed (modify setWindowTitle in JS)");if(!Object.getOwnPropertyDescriptor(Module,"read"))Object.defineProperty(Module,"read",{get:function(){abort("Module.read has been replaced with plain read_")}});if(!Object.getOwnPropertyDescriptor(Module,"readAsync"))Object.defineProperty(Module,"readAsync",{get:function(){abort("Module.readAsync has been replaced with plain readAsync")}});if(!Object.getOwnPropertyDescriptor(Module,"readBinary"))Object.defineProperty(Module,"readBinary",{get:function(){abort("Module.readBinary has been replaced with plain readBinary")}});stackSave=stackRestore=stackAlloc=function(){abort("cannot use the stack before compiled code is ready to run, and has provided stack access")};function dynamicAlloc(size){assert(DYNAMICTOP_PTR);var ret=HEAP32[DYNAMICTOP_PTR>>2];var end=ret+size+15&-16;if(end>_emscripten_get_heap_size()){abort("failure to dynamicAlloc - memory growth etc. is not supported there, call malloc/sbrk directly")}HEAP32[DYNAMICTOP_PTR>>2]=end;return ret}function getNativeTypeSize(type){switch(type){case"i1":case"i8":return 1;case"i16":return 2;case"i32":return 4;case"i64":return 8;case"float":return 4;case"double":return 8;default:{if(type[type.length-1]==="*"){return 4}else if(type[0]==="i"){var bits=parseInt(type.substr(1));assert(bits%8===0,"getNativeTypeSize invalid bits "+bits+", type "+type);return bits/8}else{return 0}}}}function warnOnce(text){if(!warnOnce.shown)warnOnce.shown={};if(!warnOnce.shown[text]){warnOnce.shown[text]=1;err(text)}}var asm2wasmImports={"f64-rem":function(x,y){return x%y},"debugger":function(){debugger}};var functionPointers=new Array(0);var tempRet0=0;var setTempRet0=function(value){tempRet0=value};var wasmBinary;if(Module["wasmBinary"])wasmBinary=Module["wasmBinary"];if(!Object.getOwnPropertyDescriptor(Module,"wasmBinary"))Object.defineProperty(Module,"wasmBinary",{get:function(){abort("Module.wasmBinary has been replaced with plain wasmBinary")}});if(typeof WebAssembly!=="object"){abort("No WebAssembly support found. Build with -s WASM=0 to target JavaScript instead.")}function setValue(ptr,value,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":HEAP8[ptr>>0]=value;break;case"i8":HEAP8[ptr>>0]=value;break;case"i16":HEAP16[ptr>>1]=value;break;case"i32":HEAP32[ptr>>2]=value;break;case"i64":tempI64=[value>>>0,(tempDouble=value,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[ptr>>2]=tempI64[0],HEAP32[ptr+4>>2]=tempI64[1];break;case"float":HEAPF32[ptr>>2]=value;break;case"double":HEAPF64[ptr>>3]=value;break;default:abort("invalid type for setValue: "+type)}}function getValue(ptr,type,noSafe){type=type||"i8";if(type.charAt(type.length-1)==="*")type="i32";switch(type){case"i1":return HEAP8[ptr>>0];case"i8":return HEAP8[ptr>>0];case"i16":return HEAP16[ptr>>1];case"i32":return HEAP32[ptr>>2];case"i64":return HEAP32[ptr>>2];case"float":return HEAPF32[ptr>>2];case"double":return HEAPF64[ptr>>3];default:abort("invalid type for getValue: "+type)}return null}var wasmMemory;var wasmTable;var ABORT=false;var EXITSTATUS=0;function assert(condition,text){if(!condition){abort("Assertion failed: "+text)}}function getCFunc(ident){var func=Module["_"+ident];assert(func,"Cannot call unknown function "+ident+", make sure it is exported");return func}function ccall(ident,returnType,argTypes,args,opts){var toC={"string":function(str){var ret=0;if(str!==null&&str!==undefined&&str!==0){var len=(str.length<<2)+1;ret=stackAlloc(len);stringToUTF8(str,ret,len)}return ret},"array":function(arr){var ret=stackAlloc(arr.length);writeArrayToMemory(arr,ret);return ret}};function convertReturnValue(ret){if(returnType==="string")return UTF8ToString(ret);if(returnType==="boolean")return Boolean(ret);return ret}var func=getCFunc(ident);var cArgs=[];var stack=0;assert(returnType!=="array",'Return type should not be "array".');if(args){for(var i=0;i>2]=0}stop=ret+size;while(ptr>0]=0}return ret}if(singleType==="i8"){if(slab.subarray||slab.slice){HEAPU8.set(slab,ret)}else{HEAPU8.set(new Uint8Array(slab),ret)}return ret}var i=0,type,typeSize,previousType;while(i=endIdx))++endPtr;if(endPtr-idx>16&&u8Array.subarray&&UTF8Decoder){return UTF8Decoder.decode(u8Array.subarray(idx,endPtr))}else{var str="";while(idx>10,56320|ch&1023)}}}return str}function UTF8ToString(ptr,maxBytesToRead){return ptr?UTF8ArrayToString(HEAPU8,ptr,maxBytesToRead):""}function stringToUTF8Array(str,outU8Array,outIdx,maxBytesToWrite){if(!(maxBytesToWrite>0))return 0;var startIdx=outIdx;var endIdx=outIdx+maxBytesToWrite-1;for(var i=0;i=55296&&u<=57343){var u1=str.charCodeAt(++i);u=65536+((u&1023)<<10)|u1&1023}if(u<=127){if(outIdx>=endIdx)break;outU8Array[outIdx++]=u}else if(u<=2047){if(outIdx+1>=endIdx)break;outU8Array[outIdx++]=192|u>>6;outU8Array[outIdx++]=128|u&63}else if(u<=65535){if(outIdx+2>=endIdx)break;outU8Array[outIdx++]=224|u>>12;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}else{if(outIdx+3>=endIdx)break;if(u>=2097152)warnOnce("Invalid Unicode code point 0x"+u.toString(16)+" encountered when serializing a JS string to an UTF-8 string on the asm.js/wasm heap! (Valid unicode code points should be in range 0-0x1FFFFF).");outU8Array[outIdx++]=240|u>>18;outU8Array[outIdx++]=128|u>>12&63;outU8Array[outIdx++]=128|u>>6&63;outU8Array[outIdx++]=128|u&63}}outU8Array[outIdx]=0;return outIdx-startIdx}function stringToUTF8(str,outPtr,maxBytesToWrite){assert(typeof maxBytesToWrite=="number","stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!");return stringToUTF8Array(str,HEAPU8,outPtr,maxBytesToWrite)}function lengthBytesUTF8(str){var len=0;for(var i=0;i=55296&&u<=57343)u=65536+((u&1023)<<10)|str.charCodeAt(++i)&1023;if(u<=127)++len;else if(u<=2047)len+=2;else if(u<=65535)len+=3;else len+=4}return len}var UTF16Decoder=typeof TextDecoder!=="undefined"?new TextDecoder("utf-16le"):undefined;function allocateUTF8(str){var size=lengthBytesUTF8(str)+1;var ret=_malloc(size);if(ret)stringToUTF8Array(str,HEAP8,ret,size);return ret}function writeArrayToMemory(array,buffer){assert(array.length>=0,"writeArrayToMemory array must have a length (should be an array or typed array)");HEAP8.set(array,buffer)}function writeAsciiToMemory(str,buffer,dontAddNull){for(var i=0;i>0]=str.charCodeAt(i)}if(!dontAddNull)HEAP8[buffer>>0]=0}var PAGE_SIZE=16384;var WASM_PAGE_SIZE=65536;var buffer,HEAP8,HEAPU8,HEAP16,HEAPU16,HEAP32,HEAPU32,HEAPF32,HEAPF64;function updateGlobalBufferViews(){Module["HEAP8"]=HEAP8=new Int8Array(buffer);Module["HEAP16"]=HEAP16=new Int16Array(buffer);Module["HEAP32"]=HEAP32=new Int32Array(buffer);Module["HEAPU8"]=HEAPU8=new Uint8Array(buffer);Module["HEAPU16"]=HEAPU16=new Uint16Array(buffer);Module["HEAPU32"]=HEAPU32=new Uint32Array(buffer);Module["HEAPF32"]=HEAPF32=new Float32Array(buffer);Module["HEAPF64"]=HEAPF64=new Float64Array(buffer)}var STACK_BASE=75824,STACK_MAX=5318704,DYNAMIC_BASE=5318704,DYNAMICTOP_PTR=75792;assert(STACK_BASE%16===0,"stack must start aligned");assert(DYNAMIC_BASE%16===0,"heap must start aligned");var TOTAL_STACK=5242880;if(Module["TOTAL_STACK"])assert(TOTAL_STACK===Module["TOTAL_STACK"],"the stack size can no longer be determined at runtime");var INITIAL_TOTAL_MEMORY=Module["TOTAL_MEMORY"]||16777216;if(!Object.getOwnPropertyDescriptor(Module,"TOTAL_MEMORY"))Object.defineProperty(Module,"TOTAL_MEMORY",{get:function(){abort("Module.TOTAL_MEMORY has been replaced with plain INITIAL_TOTAL_MEMORY")}});assert(INITIAL_TOTAL_MEMORY>=TOTAL_STACK,"TOTAL_MEMORY should be larger than TOTAL_STACK, was "+INITIAL_TOTAL_MEMORY+"! (TOTAL_STACK="+TOTAL_STACK+")");assert(typeof Int32Array!=="undefined"&&typeof Float64Array!=="undefined"&&Int32Array.prototype.subarray!==undefined&&Int32Array.prototype.set!==undefined,"JS engine does not provide full typed array support");if(Module["wasmMemory"]){wasmMemory=Module["wasmMemory"]}else{wasmMemory=new WebAssembly.Memory({"initial":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE,"maximum":INITIAL_TOTAL_MEMORY/WASM_PAGE_SIZE})}if(wasmMemory){buffer=wasmMemory.buffer}INITIAL_TOTAL_MEMORY=buffer.byteLength;assert(INITIAL_TOTAL_MEMORY%WASM_PAGE_SIZE===0);updateGlobalBufferViews();HEAP32[DYNAMICTOP_PTR>>2]=DYNAMIC_BASE;function writeStackCookie(){assert((STACK_MAX&3)==0);HEAPU32[(STACK_MAX>>2)-1]=34821223;HEAPU32[(STACK_MAX>>2)-2]=2310721022}function checkStackCookie(){var cookie1=HEAPU32[(STACK_MAX>>2)-1];var cookie2=HEAPU32[(STACK_MAX>>2)-2];if(cookie1!=34821223||cookie2!=2310721022){abort("Stack overflow! Stack cookie has been overwritten, expected hex dwords 0x89BACDFE and 0x02135467, but received 0x"+cookie2.toString(16)+" "+cookie1.toString(16))}if(HEAP32[0]!==1668509029)abort("Runtime error: The application has corrupted its heap memory area (address zero)!")}function abortStackOverflow(allocSize){abort("Stack overflow! Attempted to allocate "+allocSize+" bytes on the stack, but stack has only "+(STACK_MAX-stackSave()+allocSize)+" bytes available!")}HEAP32[0]=1668509029;HEAP16[1]=25459;if(HEAPU8[2]!==115||HEAPU8[3]!==99)throw"Runtime error: expected the system to be little-endian!";function abortFnPtrError(ptr,sig){abort("Invalid function pointer "+ptr+" called with signature '"+sig+"'. Perhaps this is an invalid value (e.g. caused by calling a virtual method on a NULL pointer)? Or calling a function with an incorrect type, which will fail? (it is worth building your source files with -Werror (warnings are errors), as warnings can indicate undefined behavior which can cause this). Build with ASSERTIONS=2 for more info.")}function callRuntimeCallbacks(callbacks){while(callbacks.length>0){var callback=callbacks.shift();if(typeof callback=="function"){callback();continue}var func=callback.func;if(typeof func==="number"){if(callback.arg===undefined){Module["dynCall_v"](func)}else{Module["dynCall_vi"](func,callback.arg)}}else{func(callback.arg===undefined?null:callback.arg)}}}var __ATPRERUN__=[];var __ATINIT__=[];var __ATMAIN__=[];var __ATEXIT__=[];var __ATPOSTRUN__=[];var runtimeInitialized=false;var runtimeExited=false;function preRun(){if(Module["preRun"]){if(typeof Module["preRun"]=="function")Module["preRun"]=[Module["preRun"]];while(Module["preRun"].length){addOnPreRun(Module["preRun"].shift())}}callRuntimeCallbacks(__ATPRERUN__)}function initRuntime(){checkStackCookie();assert(!runtimeInitialized);runtimeInitialized=true;if(!Module["noFSInit"]&&!FS.init.initialized)FS.init();TTY.init();callRuntimeCallbacks(__ATINIT__)}function preMain(){checkStackCookie();FS.ignorePermissions=false;callRuntimeCallbacks(__ATMAIN__)}function postRun(){checkStackCookie();if(Module["postRun"]){if(typeof Module["postRun"]=="function")Module["postRun"]=[Module["postRun"]];while(Module["postRun"].length){addOnPostRun(Module["postRun"].shift())}}callRuntimeCallbacks(__ATPOSTRUN__)}function addOnPreRun(cb){__ATPRERUN__.unshift(cb)}function addOnPostRun(cb){__ATPOSTRUN__.unshift(cb)}assert(Math.imul,"This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.fround,"This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.clz32,"This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");assert(Math.trunc,"This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill");var Math_abs=Math.abs;var Math_ceil=Math.ceil;var Math_floor=Math.floor;var Math_min=Math.min;var runDependencies=0;var runDependencyWatcher=null;var dependenciesFulfilled=null;var runDependencyTracking={};function getUniqueRunDependency(id){var orig=id;while(1){if(!runDependencyTracking[id])return id;id=orig+Math.random()}return id}function addRunDependency(id){runDependencies++;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(id){assert(!runDependencyTracking[id]);runDependencyTracking[id]=1;if(runDependencyWatcher===null&&typeof setInterval!=="undefined"){runDependencyWatcher=setInterval(function(){if(ABORT){clearInterval(runDependencyWatcher);runDependencyWatcher=null;return}var shown=false;for(var dep in runDependencyTracking){if(!shown){shown=true;err("still waiting on run dependencies:")}err("dependency: "+dep)}if(shown){err("(end of list)")}},1e4)}}else{err("warning: run dependency added without ID")}}function removeRunDependency(id){runDependencies--;if(Module["monitorRunDependencies"]){Module["monitorRunDependencies"](runDependencies)}if(id){assert(runDependencyTracking[id]);delete runDependencyTracking[id]}else{err("warning: run dependency removed without ID")}if(runDependencies==0){if(runDependencyWatcher!==null){clearInterval(runDependencyWatcher);runDependencyWatcher=null}if(dependenciesFulfilled){var callback=dependenciesFulfilled;dependenciesFulfilled=null;callback()}}}Module["preloadedImages"]={};Module["preloadedAudios"]={};var dataURIPrefix="data:application/octet-stream;base64,";function isDataURI(filename){return String.prototype.startsWith?filename.startsWith(dataURIPrefix):filename.indexOf(dataURIPrefix)===0}var wasmBinaryFile="taler-emscripten-lib.wasm";if(!isDataURI(wasmBinaryFile)){wasmBinaryFile=locateFile(wasmBinaryFile)}function getBinary(){try{if(wasmBinary){return new Uint8Array(wasmBinary)}if(readBinary){return readBinary(wasmBinaryFile)}else{throw"both async and sync fetching of the wasm failed"}}catch(err){abort(err)}}function getBinaryPromise(){if(!wasmBinary&&(ENVIRONMENT_IS_WEB||ENVIRONMENT_IS_WORKER)&&typeof fetch==="function"){return fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){if(!response["ok"]){throw"failed to load wasm binary file at '"+wasmBinaryFile+"'"}return response["arrayBuffer"]()}).catch(function(){return getBinary()})}return new Promise(function(resolve,reject){resolve(getBinary())})}function createWasm(env){var info={"env":env,"global":{"NaN":NaN,Infinity:Infinity},"global.Math":Math,"asm2wasm":asm2wasmImports};function receiveInstance(instance,module){var exports=instance.exports;Module["asm"]=exports;removeRunDependency("wasm-instantiate")}addRunDependency("wasm-instantiate");var trueModule=Module;function receiveInstantiatedSource(output){assert(Module===trueModule,"the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?");trueModule=null;receiveInstance(output["instance"])}function instantiateArrayBuffer(receiver){return getBinaryPromise().then(function(binary){return WebAssembly.instantiate(binary,info)}).then(receiver,function(reason){err("failed to asynchronously prepare wasm: "+reason);abort(reason)})}function instantiateAsync(){if(!wasmBinary&&typeof WebAssembly.instantiateStreaming==="function"&&!isDataURI(wasmBinaryFile)&&typeof fetch==="function"){fetch(wasmBinaryFile,{credentials:"same-origin"}).then(function(response){var result=WebAssembly.instantiateStreaming(response,info);return result.then(receiveInstantiatedSource,function(reason){err("wasm streaming compile failed: "+reason);err("falling back to ArrayBuffer instantiation");instantiateArrayBuffer(receiveInstantiatedSource)})})}else{return instantiateArrayBuffer(receiveInstantiatedSource)}}if(Module["instantiateWasm"]){try{var exports=Module["instantiateWasm"](info,receiveInstance);return exports}catch(e){err("Module.instantiateWasm callback failed with error: "+e);return false}}instantiateAsync();return{}}Module["asm"]=function(global,env,providedBuffer){env["memory"]=wasmMemory;env["table"]=wasmTable=new WebAssembly.Table({"initial":152,"maximum":152,"element":"anyfunc"});env["__memory_base"]=1024;env["__table_base"]=0;var exports=createWasm(env);assert(exports,"binaryen setup failed (no wasm support?)");return exports};var tempDouble;var tempI64;__ATINIT__.push({func:function(){globalCtors()}});var tempDoublePtr=75808;assert(tempDoublePtr%8==0);function demangle(func){warnOnce("warning: build with -s DEMANGLE_SUPPORT=1 to link in libcxxabi demangling");return func}function demangleAll(text){var regex=/__Z[\w\d_]+/g;return text.replace(regex,function(x){var y=demangle(x);return x===y?x:y+" ["+x+"]"})}function jsStackTrace(){var err=new Error;if(!err.stack){try{throw new Error(0)}catch(e){err=e}if(!err.stack){return"(no stack trace available)"}}return err.stack.toString()}function stackTrace(){var js=jsStackTrace();if(Module["extraStackTrace"])js+="\n"+Module["extraStackTrace"]();return demangleAll(js)}function ___assert_fail(condition,filename,line,func){abort("Assertion failed: "+UTF8ToString(condition)+", at: "+[filename?UTF8ToString(filename):"unknown filename",line,func?UTF8ToString(func):"unknown function"])}var ENV={};function ___buildEnvironment(environ){var MAX_ENV_VALUES=64;var TOTAL_ENV_SIZE=1024;var poolPtr;var envPtr;if(!___buildEnvironment.called){___buildEnvironment.called=true;ENV["USER"]=ENV["LOGNAME"]="web_user";ENV["PATH"]="/";ENV["PWD"]="/";ENV["HOME"]="/home/web_user";ENV["LANG"]="C.UTF-8";ENV["LANG"]=(typeof navigator==="object"&&navigator.languages&&navigator.languages[0]||"C").replace("-","_")+".UTF-8";ENV["_"]=thisProgram;poolPtr=getMemory(TOTAL_ENV_SIZE);envPtr=getMemory(MAX_ENV_VALUES*4);HEAP32[envPtr>>2]=poolPtr;HEAP32[environ>>2]=envPtr}else{envPtr=HEAP32[environ>>2];poolPtr=HEAP32[envPtr>>2]}var strings=[];var totalSize=0;for(var key in ENV){if(typeof ENV[key]==="string"){var line=key+"="+ENV[key];strings.push(line);totalSize+=line.length}}if(totalSize>TOTAL_ENV_SIZE){throw new Error("Environment size exceeded TOTAL_ENV_SIZE!")}var ptrSize=4;for(var i=0;i>2]=poolPtr;poolPtr+=line.length+1}HEAP32[envPtr+strings.length*ptrSize>>2]=0}function ___lock(){}var PATH={splitPath:function(filename){var splitPathRe=/^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/;return splitPathRe.exec(filename).slice(1)},normalizeArray:function(parts,allowAboveRoot){var up=0;for(var i=parts.length-1;i>=0;i--){var last=parts[i];if(last==="."){parts.splice(i,1)}else if(last===".."){parts.splice(i,1);up++}else if(up){parts.splice(i,1);up--}}if(allowAboveRoot){for(;up;up--){parts.unshift("..")}}return parts},normalize:function(path){var isAbsolute=path.charAt(0)==="/",trailingSlash=path.substr(-1)==="/";path=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),!isAbsolute).join("/");if(!path&&!isAbsolute){path="."}if(path&&trailingSlash){path+="/"}return(isAbsolute?"/":"")+path},dirname:function(path){var result=PATH.splitPath(path),root=result[0],dir=result[1];if(!root&&!dir){return"."}if(dir){dir=dir.substr(0,dir.length-1)}return root+dir},basename:function(path){if(path==="/")return"/";var lastSlash=path.lastIndexOf("/");if(lastSlash===-1)return path;return path.substr(lastSlash+1)},extname:function(path){return PATH.splitPath(path)[3]},join:function(){var paths=Array.prototype.slice.call(arguments,0);return PATH.normalize(paths.join("/"))},join2:function(l,r){return PATH.normalize(l+"/"+r)}};function ___setErrNo(value){if(Module["___errno_location"])HEAP32[Module["___errno_location"]()>>2]=value;else err("failed to set errno from JS");return value}var PATH_FS={resolve:function(){var resolvedPath="",resolvedAbsolute=false;for(var i=arguments.length-1;i>=-1&&!resolvedAbsolute;i--){var path=i>=0?arguments[i]:FS.cwd();if(typeof path!=="string"){throw new TypeError("Arguments to path.resolve must be strings")}else if(!path){return""}resolvedPath=path+"/"+resolvedPath;resolvedAbsolute=path.charAt(0)==="/"}resolvedPath=PATH.normalizeArray(resolvedPath.split("/").filter(function(p){return!!p}),!resolvedAbsolute).join("/");return(resolvedAbsolute?"/":"")+resolvedPath||"."},relative:function(from,to){from=PATH_FS.resolve(from).substr(1);to=PATH_FS.resolve(to).substr(1);function trim(arr){var start=0;for(;start=0;end--){if(arr[end]!=="")break}if(start>end)return[];return arr.slice(start,end-start+1)}var fromParts=trim(from.split("/"));var toParts=trim(to.split("/"));var length=Math.min(fromParts.length,toParts.length);var samePartsLength=length;for(var i=0;i0){result=buf.slice(0,bytesRead).toString("utf-8")}else{result=null}}else if(typeof window!="undefined"&&typeof window.prompt=="function"){result=window.prompt("Input: ");if(result!==null){result+="\n"}}else if(typeof readline=="function"){result=readline();if(result!==null){result+="\n"}}if(!result){return null}tty.input=intArrayFromString(result,true)}return tty.input.shift()},put_char:function(tty,val){if(val===null||val===10){out(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){out(UTF8ArrayToString(tty.output,0));tty.output=[]}}},default_tty1_ops:{put_char:function(tty,val){if(val===null||val===10){err(UTF8ArrayToString(tty.output,0));tty.output=[]}else{if(val!=0)tty.output.push(val)}},flush:function(tty){if(tty.output&&tty.output.length>0){err(UTF8ArrayToString(tty.output,0));tty.output=[]}}}};var MEMFS={ops_table:null,mount:function(mount){return MEMFS.createNode(null,"/",16384|511,0)},createNode:function(parent,name,mode,dev){if(FS.isBlkdev(mode)||FS.isFIFO(mode)){throw new FS.ErrnoError(1)}if(!MEMFS.ops_table){MEMFS.ops_table={dir:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,lookup:MEMFS.node_ops.lookup,mknod:MEMFS.node_ops.mknod,rename:MEMFS.node_ops.rename,unlink:MEMFS.node_ops.unlink,rmdir:MEMFS.node_ops.rmdir,readdir:MEMFS.node_ops.readdir,symlink:MEMFS.node_ops.symlink},stream:{llseek:MEMFS.stream_ops.llseek}},file:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:{llseek:MEMFS.stream_ops.llseek,read:MEMFS.stream_ops.read,write:MEMFS.stream_ops.write,allocate:MEMFS.stream_ops.allocate,mmap:MEMFS.stream_ops.mmap,msync:MEMFS.stream_ops.msync}},link:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr,readlink:MEMFS.node_ops.readlink},stream:{}},chrdev:{node:{getattr:MEMFS.node_ops.getattr,setattr:MEMFS.node_ops.setattr},stream:FS.chrdev_stream_ops}}}var node=FS.createNode(parent,name,mode,dev);if(FS.isDir(node.mode)){node.node_ops=MEMFS.ops_table.dir.node;node.stream_ops=MEMFS.ops_table.dir.stream;node.contents={}}else if(FS.isFile(node.mode)){node.node_ops=MEMFS.ops_table.file.node;node.stream_ops=MEMFS.ops_table.file.stream;node.usedBytes=0;node.contents=null}else if(FS.isLink(node.mode)){node.node_ops=MEMFS.ops_table.link.node;node.stream_ops=MEMFS.ops_table.link.stream}else if(FS.isChrdev(node.mode)){node.node_ops=MEMFS.ops_table.chrdev.node;node.stream_ops=MEMFS.ops_table.chrdev.stream}node.timestamp=Date.now();if(parent){parent.contents[name]=node}return node},getFileDataAsRegularArray:function(node){if(node.contents&&node.contents.subarray){var arr=[];for(var i=0;i=newCapacity)return;var CAPACITY_DOUBLING_MAX=1024*1024;newCapacity=Math.max(newCapacity,prevCapacity*(prevCapacity0)node.contents.set(oldContents.subarray(0,node.usedBytes),0);return},resizeFileStorage:function(node,newSize){if(node.usedBytes==newSize)return;if(newSize==0){node.contents=null;node.usedBytes=0;return}if(!node.contents||node.contents.subarray){var oldContents=node.contents;node.contents=new Uint8Array(new ArrayBuffer(newSize));if(oldContents){node.contents.set(oldContents.subarray(0,Math.min(newSize,node.usedBytes)))}node.usedBytes=newSize;return}if(!node.contents)node.contents=[];if(node.contents.length>newSize)node.contents.length=newSize;else while(node.contents.length=stream.node.usedBytes)return 0;var size=Math.min(stream.node.usedBytes-position,length);assert(size>=0);if(size>8&&contents.subarray){buffer.set(contents.subarray(position,position+size),offset)}else{for(var i=0;i0||position+lengthe2.timestamp){create.push(key);total++}});var remove=[];Object.keys(dst.entries).forEach(function(key){var e=dst.entries[key];var e2=src.entries[key];if(!e2){remove.push(key);total++}});if(!total){return callback(null)}var errored=false;var db=src.type==="remote"?src.db:dst.db;var transaction=db.transaction([IDBFS.DB_STORE_NAME],"readwrite");var store=transaction.objectStore(IDBFS.DB_STORE_NAME);function done(err){if(err&&!errored){errored=true;return callback(err)}}transaction.onerror=function(e){done(this.error);e.preventDefault()};transaction.oncomplete=function(e){if(!errored){callback(null)}};create.sort().forEach(function(path){if(dst.type==="local"){IDBFS.loadRemoteEntry(store,path,function(err,entry){if(err)return done(err);IDBFS.storeLocalEntry(path,entry,done)})}else{IDBFS.loadLocalEntry(path,function(err,entry){if(err)return done(err);IDBFS.storeRemoteEntry(store,path,entry,done)})}});remove.sort().reverse().forEach(function(path){if(dst.type==="local"){IDBFS.removeLocalEntry(path,done)}else{IDBFS.removeRemoteEntry(store,path,done)}})}};var NODEFS={isWindows:false,staticInit:function(){NODEFS.isWindows=!!process.platform.match(/^win/);var flags=process["binding"]("constants");if(flags["fs"]){flags=flags["fs"]}NODEFS.flagsForNodeMap={1024:flags["O_APPEND"],64:flags["O_CREAT"],128:flags["O_EXCL"],0:flags["O_RDONLY"],2:flags["O_RDWR"],4096:flags["O_SYNC"],512:flags["O_TRUNC"],1:flags["O_WRONLY"]}},bufferFrom:function(arrayBuffer){return Buffer.alloc?Buffer.from(arrayBuffer):new Buffer(arrayBuffer)},mount:function(mount){assert(ENVIRONMENT_HAS_NODE);return NODEFS.createNode(null,"/",NODEFS.getMode(mount.opts.root),0)},createNode:function(parent,name,mode,dev){if(!FS.isDir(mode)&&!FS.isFile(mode)&&!FS.isLink(mode)){throw new FS.ErrnoError(22)}var node=FS.createNode(parent,name,mode);node.node_ops=NODEFS.node_ops;node.stream_ops=NODEFS.stream_ops;return node},getMode:function(path){var stat;try{stat=fs.lstatSync(path);if(NODEFS.isWindows){stat.mode=stat.mode|(stat.mode&292)>>2}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return stat.mode},realPath:function(node){var parts=[];while(node.parent!==node){parts.push(node.name);node=node.parent}parts.push(node.mount.opts.root);parts.reverse();return PATH.join.apply(null,parts)},flagsForNode:function(flags){flags&=~2097152;flags&=~2048;flags&=~32768;flags&=~524288;var newFlags=0;for(var k in NODEFS.flagsForNodeMap){if(flags&k){newFlags|=NODEFS.flagsForNodeMap[k];flags^=k}}if(!flags){return newFlags}else{throw new FS.ErrnoError(22)}},node_ops:{getattr:function(node){var path=NODEFS.realPath(node);var stat;try{stat=fs.lstatSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}if(NODEFS.isWindows&&!stat.blksize){stat.blksize=4096}if(NODEFS.isWindows&&!stat.blocks){stat.blocks=(stat.size+stat.blksize-1)/stat.blksize|0}return{dev:stat.dev,ino:stat.ino,mode:stat.mode,nlink:stat.nlink,uid:stat.uid,gid:stat.gid,rdev:stat.rdev,size:stat.size,atime:stat.atime,mtime:stat.mtime,ctime:stat.ctime,blksize:stat.blksize,blocks:stat.blocks}},setattr:function(node,attr){var path=NODEFS.realPath(node);try{if(attr.mode!==undefined){fs.chmodSync(path,attr.mode);node.mode=attr.mode}if(attr.timestamp!==undefined){var date=new Date(attr.timestamp);fs.utimesSync(path,date,date)}if(attr.size!==undefined){fs.truncateSync(path,attr.size)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},lookup:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);var mode=NODEFS.getMode(path);return NODEFS.createNode(parent,name,mode)},mknod:function(parent,name,mode,dev){var node=NODEFS.createNode(parent,name,mode,dev);var path=NODEFS.realPath(node);try{if(FS.isDir(node.mode)){fs.mkdirSync(path,node.mode)}else{fs.writeFileSync(path,"",{mode:node.mode})}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}return node},rename:function(oldNode,newDir,newName){var oldPath=NODEFS.realPath(oldNode);var newPath=PATH.join2(NODEFS.realPath(newDir),newName);try{fs.renameSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},unlink:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.unlinkSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},rmdir:function(parent,name){var path=PATH.join2(NODEFS.realPath(parent),name);try{fs.rmdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readdir:function(node){var path=NODEFS.realPath(node);try{return fs.readdirSync(path)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},symlink:function(parent,newName,oldPath){var newPath=PATH.join2(NODEFS.realPath(parent),newName);try{fs.symlinkSync(oldPath,newPath)}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},readlink:function(node){var path=NODEFS.realPath(node);try{path=fs.readlinkSync(path);path=NODEJS_PATH.relative(NODEJS_PATH.resolve(node.mount.opts.root),path);return path}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}}},stream_ops:{open:function(stream){var path=NODEFS.realPath(stream.node);try{if(FS.isFile(stream.node.mode)){stream.nfd=fs.openSync(path,NODEFS.flagsForNode(stream.flags))}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},close:function(stream){try{if(FS.isFile(stream.node.mode)&&stream.nfd){fs.closeSync(stream.nfd)}}catch(e){if(!e.code)throw e;throw new FS.ErrnoError(-e.errno)}},read:function(stream,buffer,offset,length,position){if(length===0)return 0;try{return fs.readSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},write:function(stream,buffer,offset,length,position){try{return fs.writeSync(stream.nfd,NODEFS.bufferFrom(buffer.buffer),offset,length,position)}catch(e){throw new FS.ErrnoError(-e.errno)}},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){try{var stat=fs.fstatSync(stream.nfd);position+=stat.size}catch(e){throw new FS.ErrnoError(-e.errno)}}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var WORKERFS={DIR_MODE:16895,FILE_MODE:33279,reader:null,mount:function(mount){assert(ENVIRONMENT_IS_WORKER);if(!WORKERFS.reader)WORKERFS.reader=new FileReaderSync;var root=WORKERFS.createNode(null,"/",WORKERFS.DIR_MODE,0);var createdParents={};function ensureParent(path){var parts=path.split("/");var parent=root;for(var i=0;i=stream.node.size)return 0;var chunk=stream.node.contents.slice(position,position+length);var ab=WORKERFS.reader.readAsArrayBuffer(chunk);buffer.set(new Uint8Array(ab),offset);return chunk.size},write:function(stream,buffer,offset,length,position){throw new FS.ErrnoError(5)},llseek:function(stream,offset,whence){var position=offset;if(whence===1){position+=stream.position}else if(whence===2){if(FS.isFile(stream.node.mode)){position+=stream.node.size}}if(position<0){throw new FS.ErrnoError(22)}return position}}};var ERRNO_MESSAGES={0:"Success",1:"Not super-user",2:"No such file or directory",3:"No such process",4:"Interrupted system call",5:"I/O error",6:"No such device or address",7:"Arg list too long",8:"Exec format error",9:"Bad file number",10:"No children",11:"No more processes",12:"Not enough core",13:"Permission denied",14:"Bad address",15:"Block device required",16:"Mount device busy",17:"File exists",18:"Cross-device link",19:"No such device",20:"Not a directory",21:"Is a directory",22:"Invalid argument",23:"Too many open files in system",24:"Too many open files",25:"Not a typewriter",26:"Text file busy",27:"File too large",28:"No space left on device",29:"Illegal seek",30:"Read only file system",31:"Too many links",32:"Broken pipe",33:"Math arg out of domain of func",34:"Math result not representable",35:"File locking deadlock error",36:"File or path name too long",37:"No record locks available",38:"Function not implemented",39:"Directory not empty",40:"Too many symbolic links",42:"No message of desired type",43:"Identifier removed",44:"Channel number out of range",45:"Level 2 not synchronized",46:"Level 3 halted",47:"Level 3 reset",48:"Link number out of range",49:"Protocol driver not attached",50:"No CSI structure available",51:"Level 2 halted",52:"Invalid exchange",53:"Invalid request descriptor",54:"Exchange full",55:"No anode",56:"Invalid request code",57:"Invalid slot",59:"Bad font file fmt",60:"Device not a stream",61:"No data (for no delay io)",62:"Timer expired",63:"Out of streams resources",64:"Machine is not on the network",65:"Package not installed",66:"The object is remote",67:"The link has been severed",68:"Advertise error",69:"Srmount error",70:"Communication error on send",71:"Protocol error",72:"Multihop attempted",73:"Cross mount point (not really error)",74:"Trying to read unreadable message",75:"Value too large for defined data type",76:"Given log. name not unique",77:"f.d. invalid for this operation",78:"Remote address changed",79:"Can access a needed shared lib",80:"Accessing a corrupted shared lib",81:".lib section in a.out corrupted",82:"Attempting to link in too many libs",83:"Attempting to exec a shared library",84:"Illegal byte sequence",86:"Streams pipe error",87:"Too many users",88:"Socket operation on non-socket",89:"Destination address required",90:"Message too long",91:"Protocol wrong type for socket",92:"Protocol not available",93:"Unknown protocol",94:"Socket type not supported",95:"Not supported",96:"Protocol family not supported",97:"Address family not supported by protocol family",98:"Address already in use",99:"Address not available",100:"Network interface is not configured",101:"Network is unreachable",102:"Connection reset by network",103:"Connection aborted",104:"Connection reset by peer",105:"No buffer space available",106:"Socket is already connected",107:"Socket is not connected",108:"Can't send after socket shutdown",109:"Too many references",110:"Connection timed out",111:"Connection refused",112:"Host is down",113:"Host is unreachable",114:"Socket already connected",115:"Connection already in progress",116:"Stale file handle",122:"Quota exceeded",123:"No medium (in tape drive)",125:"Operation canceled",130:"Previous owner died",131:"State not recoverable"};var ERRNO_CODES={EPERM:1,ENOENT:2,ESRCH:3,EINTR:4,EIO:5,ENXIO:6,E2BIG:7,ENOEXEC:8,EBADF:9,ECHILD:10,EAGAIN:11,EWOULDBLOCK:11,ENOMEM:12,EACCES:13,EFAULT:14,ENOTBLK:15,EBUSY:16,EEXIST:17,EXDEV:18,ENODEV:19,ENOTDIR:20,EISDIR:21,EINVAL:22,ENFILE:23,EMFILE:24,ENOTTY:25,ETXTBSY:26,EFBIG:27,ENOSPC:28,ESPIPE:29,EROFS:30,EMLINK:31,EPIPE:32,EDOM:33,ERANGE:34,ENOMSG:42,EIDRM:43,ECHRNG:44,EL2NSYNC:45,EL3HLT:46,EL3RST:47,ELNRNG:48,EUNATCH:49,ENOCSI:50,EL2HLT:51,EDEADLK:35,ENOLCK:37,EBADE:52,EBADR:53,EXFULL:54,ENOANO:55,EBADRQC:56,EBADSLT:57,EDEADLOCK:35,EBFONT:59,ENOSTR:60,ENODATA:61,ETIME:62,ENOSR:63,ENONET:64,ENOPKG:65,EREMOTE:66,ENOLINK:67,EADV:68,ESRMNT:69,ECOMM:70,EPROTO:71,EMULTIHOP:72,EDOTDOT:73,EBADMSG:74,ENOTUNIQ:76,EBADFD:77,EREMCHG:78,ELIBACC:79,ELIBBAD:80,ELIBSCN:81,ELIBMAX:82,ELIBEXEC:83,ENOSYS:38,ENOTEMPTY:39,ENAMETOOLONG:36,ELOOP:40,EOPNOTSUPP:95,EPFNOSUPPORT:96,ECONNRESET:104,ENOBUFS:105,EAFNOSUPPORT:97,EPROTOTYPE:91,ENOTSOCK:88,ENOPROTOOPT:92,ESHUTDOWN:108,ECONNREFUSED:111,EADDRINUSE:98,ECONNABORTED:103,ENETUNREACH:101,ENETDOWN:100,ETIMEDOUT:110,EHOSTDOWN:112,EHOSTUNREACH:113,EINPROGRESS:115,EALREADY:114,EDESTADDRREQ:89,EMSGSIZE:90,EPROTONOSUPPORT:93,ESOCKTNOSUPPORT:94,EADDRNOTAVAIL:99,ENETRESET:102,EISCONN:106,ENOTCONN:107,ETOOMANYREFS:109,EUSERS:87,EDQUOT:122,ESTALE:116,ENOTSUP:95,ENOMEDIUM:123,EILSEQ:84,EOVERFLOW:75,ECANCELED:125,ENOTRECOVERABLE:131,EOWNERDEAD:130,ESTRPIPE:86};var FS={root:null,mounts:[],devices:{},streams:[],nextInode:1,nameTable:null,currentPath:"/",initialized:false,ignorePermissions:true,trackingDelegate:{},tracking:{openFlags:{READ:1,WRITE:2}},ErrnoError:null,genericErrors:{},filesystems:null,syncFSRequests:0,handleFSError:function(e){if(!(e instanceof FS.ErrnoError))throw e+" : "+stackTrace();return ___setErrNo(e.errno)},lookupPath:function(path,opts){path=PATH_FS.resolve(FS.cwd(),path);opts=opts||{};if(!path)return{path:"",node:null};var defaults={follow_mount:true,recurse_count:0};for(var key in defaults){if(opts[key]===undefined){opts[key]=defaults[key]}}if(opts.recurse_count>8){throw new FS.ErrnoError(40)}var parts=PATH.normalizeArray(path.split("/").filter(function(p){return!!p}),false);var current=FS.root;var current_path="/";for(var i=0;i40){throw new FS.ErrnoError(40)}}}}return{path:current_path,node:current}},getPath:function(node){var path;while(true){if(FS.isRoot(node)){var mount=node.mount.mountpoint;if(!path)return mount;return mount[mount.length-1]!=="/"?mount+"/"+path:mount+path}path=path?node.name+"/"+path:node.name;node=node.parent}},hashName:function(parentid,name){var hash=0;for(var i=0;i>>0)%FS.nameTable.length},hashAddNode:function(node){var hash=FS.hashName(node.parent.id,node.name);node.name_next=FS.nameTable[hash];FS.nameTable[hash]=node},hashRemoveNode:function(node){var hash=FS.hashName(node.parent.id,node.name);if(FS.nameTable[hash]===node){FS.nameTable[hash]=node.name_next}else{var current=FS.nameTable[hash];while(current){if(current.name_next===node){current.name_next=node.name_next;break}current=current.name_next}}},lookupNode:function(parent,name){var err=FS.mayLookup(parent);if(err){throw new FS.ErrnoError(err,parent)}var hash=FS.hashName(parent.id,name);for(var node=FS.nameTable[hash];node;node=node.name_next){var nodeName=node.name;if(node.parent.id===parent.id&&nodeName===name){return node}}return FS.lookup(parent,name)},createNode:function(parent,name,mode,rdev){if(!FS.FSNode){FS.FSNode=function(parent,name,mode,rdev){if(!parent){parent=this}this.parent=parent;this.mount=parent.mount;this.mounted=null;this.id=FS.nextInode++;this.name=name;this.mode=mode;this.node_ops={};this.stream_ops={};this.rdev=rdev};FS.FSNode.prototype={};var readMode=292|73;var writeMode=146;Object.defineProperties(FS.FSNode.prototype,{read:{get:function(){return(this.mode&readMode)===readMode},set:function(val){val?this.mode|=readMode:this.mode&=~readMode}},write:{get:function(){return(this.mode&writeMode)===writeMode},set:function(val){val?this.mode|=writeMode:this.mode&=~writeMode}},isFolder:{get:function(){return FS.isDir(this.mode)}},isDevice:{get:function(){return FS.isChrdev(this.mode)}}})}var node=new FS.FSNode(parent,name,mode,rdev);FS.hashAddNode(node);return node},destroyNode:function(node){FS.hashRemoveNode(node)},isRoot:function(node){return node===node.parent},isMountpoint:function(node){return!!node.mounted},isFile:function(mode){return(mode&61440)===32768},isDir:function(mode){return(mode&61440)===16384},isLink:function(mode){return(mode&61440)===40960},isChrdev:function(mode){return(mode&61440)===8192},isBlkdev:function(mode){return(mode&61440)===24576},isFIFO:function(mode){return(mode&61440)===4096},isSocket:function(mode){return(mode&49152)===49152},flagModes:{"r":0,"rs":1052672,"r+":2,"w":577,"wx":705,"xw":705,"w+":578,"wx+":706,"xw+":706,"a":1089,"ax":1217,"xa":1217,"a+":1090,"ax+":1218,"xa+":1218},modeStringToFlags:function(str){var flags=FS.flagModes[str];if(typeof flags==="undefined"){throw new Error("Unknown file open mode: "+str)}return flags},flagsToPermissionString:function(flag){var perms=["r","w","rw"][flag&3];if(flag&512){perms+="w"}return perms},nodePermissions:function(node,perms){if(FS.ignorePermissions){return 0}if(perms.indexOf("r")!==-1&&!(node.mode&292)){return 13}else if(perms.indexOf("w")!==-1&&!(node.mode&146)){return 13}else if(perms.indexOf("x")!==-1&&!(node.mode&73)){return 13}return 0},mayLookup:function(dir){var err=FS.nodePermissions(dir,"x");if(err)return err;if(!dir.node_ops.lookup)return 13;return 0},mayCreate:function(dir,name){try{var node=FS.lookupNode(dir,name);return 17}catch(e){}return FS.nodePermissions(dir,"wx")},mayDelete:function(dir,name,isdir){var node;try{node=FS.lookupNode(dir,name)}catch(e){return e.errno}var err=FS.nodePermissions(dir,"wx");if(err){return err}if(isdir){if(!FS.isDir(node.mode)){return 20}if(FS.isRoot(node)||FS.getPath(node)===FS.cwd()){return 16}}else{if(FS.isDir(node.mode)){return 21}}return 0},mayOpen:function(node,flags){if(!node){return 2}if(FS.isLink(node.mode)){return 40}else if(FS.isDir(node.mode)){if(FS.flagsToPermissionString(flags)!=="r"||flags&512){return 21}}return FS.nodePermissions(node,FS.flagsToPermissionString(flags))},MAX_OPEN_FDS:4096,nextfd:function(fd_start,fd_end){fd_start=fd_start||0;fd_end=fd_end||FS.MAX_OPEN_FDS;for(var fd=fd_start;fd<=fd_end;fd++){if(!FS.streams[fd]){return fd}}throw new FS.ErrnoError(24)},getStream:function(fd){return FS.streams[fd]},createStream:function(stream,fd_start,fd_end){if(!FS.FSStream){FS.FSStream=function(){};FS.FSStream.prototype={};Object.defineProperties(FS.FSStream.prototype,{object:{get:function(){return this.node},set:function(val){this.node=val}},isRead:{get:function(){return(this.flags&2097155)!==1}},isWrite:{get:function(){return(this.flags&2097155)!==0}},isAppend:{get:function(){return this.flags&1024}}})}var newStream=new FS.FSStream;for(var p in stream){newStream[p]=stream[p]}stream=newStream;var fd=FS.nextfd(fd_start,fd_end);stream.fd=fd;FS.streams[fd]=stream;return stream},closeStream:function(fd){FS.streams[fd]=null},chrdev_stream_ops:{open:function(stream){var device=FS.getDevice(stream.node.rdev);stream.stream_ops=device.stream_ops;if(stream.stream_ops.open){stream.stream_ops.open(stream)}},llseek:function(){throw new FS.ErrnoError(29)}},major:function(dev){return dev>>8},minor:function(dev){return dev&255},makedev:function(ma,mi){return ma<<8|mi},registerDevice:function(dev,ops){FS.devices[dev]={stream_ops:ops}},getDevice:function(dev){return FS.devices[dev]},getMounts:function(mount){var mounts=[];var check=[mount];while(check.length){var m=check.pop();mounts.push(m);check.push.apply(check,m.mounts)}return mounts},syncfs:function(populate,callback){if(typeof populate==="function"){callback=populate;populate=false}FS.syncFSRequests++;if(FS.syncFSRequests>1){console.log("warning: "+FS.syncFSRequests+" FS.syncfs operations in flight at once, probably just doing extra work")}var mounts=FS.getMounts(FS.root.mount);var completed=0;function doCallback(err){assert(FS.syncFSRequests>0);FS.syncFSRequests--;return callback(err)}function done(err){if(err){if(!done.errored){done.errored=true;return doCallback(err)}return}if(++completed>=mounts.length){doCallback(null)}}mounts.forEach(function(mount){if(!mount.type.syncfs){return done(null)}mount.type.syncfs(mount,populate,done)})},mount:function(type,opts,mountpoint){var root=mountpoint==="/";var pseudo=!mountpoint;var node;if(root&&FS.root){throw new FS.ErrnoError(16)}else if(!root&&!pseudo){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});mountpoint=lookup.path;node=lookup.node;if(FS.isMountpoint(node)){throw new FS.ErrnoError(16)}if(!FS.isDir(node.mode)){throw new FS.ErrnoError(20)}}var mount={type:type,opts:opts,mountpoint:mountpoint,mounts:[]};var mountRoot=type.mount(mount);mountRoot.mount=mount;mount.root=mountRoot;if(root){FS.root=mountRoot}else if(node){node.mounted=mount;if(node.mount){node.mount.mounts.push(mount)}}return mountRoot},unmount:function(mountpoint){var lookup=FS.lookupPath(mountpoint,{follow_mount:false});if(!FS.isMountpoint(lookup.node)){throw new FS.ErrnoError(22)}var node=lookup.node;var mount=node.mounted;var mounts=FS.getMounts(mount);Object.keys(FS.nameTable).forEach(function(hash){var current=FS.nameTable[hash];while(current){var next=current.name_next;if(mounts.indexOf(current.mount)!==-1){FS.destroyNode(current)}current=next}});node.mounted=null;var idx=node.mount.mounts.indexOf(mount);assert(idx!==-1);node.mount.mounts.splice(idx,1)},lookup:function(parent,name){return parent.node_ops.lookup(parent,name)},mknod:function(path,mode,dev){var lookup=FS.lookupPath(path,{parent:true});var parent=lookup.node;var name=PATH.basename(path);if(!name||name==="."||name===".."){throw new FS.ErrnoError(22)}var err=FS.mayCreate(parent,name);if(err){throw new FS.ErrnoError(err)}if(!parent.node_ops.mknod){throw new FS.ErrnoError(1)}return parent.node_ops.mknod(parent,name,mode,dev)},create:function(path,mode){mode=mode!==undefined?mode:438;mode&=4095;mode|=32768;return FS.mknod(path,mode,0)},mkdir:function(path,mode){mode=mode!==undefined?mode:511;mode&=511|512;mode|=16384;return FS.mknod(path,mode,0)},mkdirTree:function(path,mode){var dirs=path.split("/");var d="";for(var i=0;ithis.length-1||idx<0){return undefined}var chunkOffset=idx%this.chunkSize;var chunkNum=idx/this.chunkSize|0;return this.getter(chunkNum)[chunkOffset]};LazyUint8Array.prototype.setDataGetter=function LazyUint8Array_setDataGetter(getter){this.getter=getter};LazyUint8Array.prototype.cacheLength=function LazyUint8Array_cacheLength(){var xhr=new XMLHttpRequest;xhr.open("HEAD",url,false);xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);var datalength=Number(xhr.getResponseHeader("Content-length"));var header;var hasByteServing=(header=xhr.getResponseHeader("Accept-Ranges"))&&header==="bytes";var usesGzip=(header=xhr.getResponseHeader("Content-Encoding"))&&header==="gzip";var chunkSize=1024*1024;if(!hasByteServing)chunkSize=datalength;var doXHR=function(from,to){if(from>to)throw new Error("invalid range ("+from+", "+to+") or no bytes requested!");if(to>datalength-1)throw new Error("only "+datalength+" bytes available! programmer error!");var xhr=new XMLHttpRequest;xhr.open("GET",url,false);if(datalength!==chunkSize)xhr.setRequestHeader("Range","bytes="+from+"-"+to);if(typeof Uint8Array!="undefined")xhr.responseType="arraybuffer";if(xhr.overrideMimeType){xhr.overrideMimeType("text/plain; charset=x-user-defined")}xhr.send(null);if(!(xhr.status>=200&&xhr.status<300||xhr.status===304))throw new Error("Couldn't load "+url+". Status: "+xhr.status);if(xhr.response!==undefined){return new Uint8Array(xhr.response||[])}else{return intArrayFromString(xhr.responseText||"",true)}};var lazyArray=this;lazyArray.setDataGetter(function(chunkNum){var start=chunkNum*chunkSize;var end=(chunkNum+1)*chunkSize-1;end=Math.min(end,datalength-1);if(typeof lazyArray.chunks[chunkNum]==="undefined"){lazyArray.chunks[chunkNum]=doXHR(start,end)}if(typeof lazyArray.chunks[chunkNum]==="undefined")throw new Error("doXHR failed!");return lazyArray.chunks[chunkNum]});if(usesGzip||!datalength){chunkSize=datalength=1;datalength=this.getter(0).length;chunkSize=datalength;console.log("LazyFiles on gzip forces download of the whole file when length is accessed")}this._length=datalength;this._chunkSize=chunkSize;this.lengthKnown=true};if(typeof XMLHttpRequest!=="undefined"){if(!ENVIRONMENT_IS_WORKER)throw"Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc";var lazyArray=new LazyUint8Array;Object.defineProperties(lazyArray,{length:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._length}},chunkSize:{get:function(){if(!this.lengthKnown){this.cacheLength()}return this._chunkSize}}});var properties={isDevice:false,contents:lazyArray}}else{var properties={isDevice:false,url:url}}var node=FS.createFile(parent,name,properties,canRead,canWrite);if(properties.contents){node.contents=properties.contents}else if(properties.url){node.contents=null;node.url=properties.url}Object.defineProperties(node,{usedBytes:{get:function(){return this.contents.length}}});var stream_ops={};var keys=Object.keys(node.stream_ops);keys.forEach(function(key){var fn=node.stream_ops[key];stream_ops[key]=function forceLoadLazyFile(){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}return fn.apply(null,arguments)}});stream_ops.read=function stream_ops_read(stream,buffer,offset,length,position){if(!FS.forceLoadFile(node)){throw new FS.ErrnoError(5)}var contents=stream.node.contents;if(position>=contents.length)return 0;var size=Math.min(contents.length-position,length);assert(size>=0);if(contents.slice){for(var i=0;i>2]=stat.dev;HEAP32[buf+4>>2]=0;HEAP32[buf+8>>2]=stat.ino;HEAP32[buf+12>>2]=stat.mode;HEAP32[buf+16>>2]=stat.nlink;HEAP32[buf+20>>2]=stat.uid;HEAP32[buf+24>>2]=stat.gid;HEAP32[buf+28>>2]=stat.rdev;HEAP32[buf+32>>2]=0;tempI64=[stat.size>>>0,(tempDouble=stat.size,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+40>>2]=tempI64[0],HEAP32[buf+44>>2]=tempI64[1];HEAP32[buf+48>>2]=4096;HEAP32[buf+52>>2]=stat.blocks;HEAP32[buf+56>>2]=stat.atime.getTime()/1e3|0;HEAP32[buf+60>>2]=0;HEAP32[buf+64>>2]=stat.mtime.getTime()/1e3|0;HEAP32[buf+68>>2]=0;HEAP32[buf+72>>2]=stat.ctime.getTime()/1e3|0;HEAP32[buf+76>>2]=0;tempI64=[stat.ino>>>0,(tempDouble=stat.ino,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[buf+80>>2]=tempI64[0],HEAP32[buf+84>>2]=tempI64[1];return 0},doMsync:function(addr,stream,len,flags){var buffer=new Uint8Array(HEAPU8.subarray(addr,addr+len));FS.msync(stream,buffer,0,len,flags)},doMkdir:function(path,mode){path=PATH.normalize(path);if(path[path.length-1]==="/")path=path.substr(0,path.length-1);FS.mkdir(path,mode,0);return 0},doMknod:function(path,mode,dev){switch(mode&61440){case 32768:case 8192:case 24576:case 4096:case 49152:break;default:return-22}FS.mknod(path,mode,dev);return 0},doReadlink:function(path,buf,bufsize){if(bufsize<=0)return-22;var ret=FS.readlink(path);var len=Math.min(bufsize,lengthBytesUTF8(ret));var endChar=HEAP8[buf+len];stringToUTF8(ret,buf,bufsize+1);HEAP8[buf+len]=endChar;return len},doAccess:function(path,amode){if(amode&~7){return-22}var node;var lookup=FS.lookupPath(path,{follow:true});node=lookup.node;if(!node){return-2}var perms="";if(amode&4)perms+="r";if(amode&2)perms+="w";if(amode&1)perms+="x";if(perms&&FS.nodePermissions(node,perms)){return-13}return 0},doDup:function(path,flags,suggestFD){var suggest=FS.getStream(suggestFD);if(suggest)FS.close(suggest);return FS.open(path,flags,0,suggestFD,suggestFD).fd},doReadv:function(stream,iov,iovcnt,offset){var ret=0;for(var i=0;i>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.read(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr;if(curr>2];var len=HEAP32[iov+(i*8+4)>>2];var curr=FS.write(stream,HEAP8,ptr,len,offset);if(curr<0)return-1;ret+=curr}return ret},varargs:0,get:function(varargs){SYSCALLS.varargs+=4;var ret=HEAP32[SYSCALLS.varargs-4>>2];return ret},getStr:function(){var ret=UTF8ToString(SYSCALLS.get());return ret},getStreamFromFD:function(){var stream=FS.getStream(SYSCALLS.get());if(!stream)throw new FS.ErrnoError(9);return stream},get64:function(){var low=SYSCALLS.get(),high=SYSCALLS.get();if(low>=0)assert(high===0);else assert(high===-1);return low},getZero:function(){assert(SYSCALLS.get()===0)}};function ___syscall140(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),offset_high=SYSCALLS.get(),offset_low=SYSCALLS.get(),result=SYSCALLS.get(),whence=SYSCALLS.get();var HIGH_OFFSET=4294967296;var offset=offset_high*HIGH_OFFSET+(offset_low>>>0);var DOUBLE_LIMIT=9007199254740992;if(offset<=-DOUBLE_LIMIT||offset>=DOUBLE_LIMIT){return-75}FS.llseek(stream,offset,whence);tempI64=[stream.position>>>0,(tempDouble=stream.position,+Math_abs(tempDouble)>=1?tempDouble>0?(Math_min(+Math_floor(tempDouble/4294967296),4294967295)|0)>>>0:~~+Math_ceil((tempDouble-+(~~tempDouble>>>0))/4294967296)>>>0:0)],HEAP32[result>>2]=tempI64[0],HEAP32[result+4>>2]=tempI64[1];if(stream.getdents&&offset===0&&whence===0)stream.getdents=null;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall142(which,varargs){SYSCALLS.varargs=varargs;try{var nfds=SYSCALLS.get(),readfds=SYSCALLS.get(),writefds=SYSCALLS.get(),exceptfds=SYSCALLS.get(),timeout=SYSCALLS.get();assert(nfds<=64,"nfds must be less than or equal to 64");assert(!exceptfds,"exceptfds not supported");var total=0;var srcReadLow=readfds?HEAP32[readfds>>2]:0,srcReadHigh=readfds?HEAP32[readfds+4>>2]:0;var srcWriteLow=writefds?HEAP32[writefds>>2]:0,srcWriteHigh=writefds?HEAP32[writefds+4>>2]:0;var srcExceptLow=exceptfds?HEAP32[exceptfds>>2]:0,srcExceptHigh=exceptfds?HEAP32[exceptfds+4>>2]:0;var dstReadLow=0,dstReadHigh=0;var dstWriteLow=0,dstWriteHigh=0;var dstExceptLow=0,dstExceptHigh=0;var allLow=(readfds?HEAP32[readfds>>2]:0)|(writefds?HEAP32[writefds>>2]:0)|(exceptfds?HEAP32[exceptfds>>2]:0);var allHigh=(readfds?HEAP32[readfds+4>>2]:0)|(writefds?HEAP32[writefds+4>>2]:0)|(exceptfds?HEAP32[exceptfds+4>>2]:0);var check=function(fd,low,high,val){return fd<32?low&val:high&val};for(var fd=0;fd>2]=dstReadLow;HEAP32[readfds+4>>2]=dstReadHigh}if(writefds){HEAP32[writefds>>2]=dstWriteLow;HEAP32[writefds+4>>2]=dstWriteHigh}if(exceptfds){HEAP32[exceptfds>>2]=dstExceptLow;HEAP32[exceptfds+4>>2]=dstExceptHigh}return total}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall145(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doReadv(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall146(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),iov=SYSCALLS.get(),iovcnt=SYSCALLS.get();return SYSCALLS.doWritev(stream,iov,iovcnt)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __emscripten_syscall_mmap2(addr,len,prot,flags,fd,off){off<<=12;var ptr;var allocated=false;if((flags&16)!==0&&addr%PAGE_SIZE!==0){return-22}if((flags&32)!==0){ptr=_memalign(PAGE_SIZE,len);if(!ptr)return-12;_memset(ptr,0,len);allocated=true}else{var info=FS.getStream(fd);if(!info)return-9;var res=FS.mmap(info,HEAPU8,addr,len,off,prot,flags);ptr=res.ptr;allocated=res.allocated}SYSCALLS.mappings[ptr]={malloc:ptr,len:len,allocated:allocated,fd:fd,flags:flags};return ptr}function ___syscall192(which,varargs){SYSCALLS.varargs=varargs;try{var addr=SYSCALLS.get(),len=SYSCALLS.get(),prot=SYSCALLS.get(),flags=SYSCALLS.get(),fd=SYSCALLS.get(),off=SYSCALLS.get();return __emscripten_syscall_mmap2(addr,len,prot,flags,fd,off)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall194(which,varargs){SYSCALLS.varargs=varargs;try{var fd=SYSCALLS.get(),zero=SYSCALLS.getZero(),length=SYSCALLS.get64();FS.ftruncate(fd,length);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall195(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall197(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get();return SYSCALLS.doStat(FS.stat,stream.path,buf)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall202(which,varargs){SYSCALLS.varargs=varargs;try{return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall199(a0,a1){return ___syscall202(a0,a1)}var PROCINFO={ppid:1,pid:42,sid:42,pgid:42};function ___syscall20(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.pid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall201(a0,a1){return ___syscall202(a0,a1)}function ___syscall221(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),cmd=SYSCALLS.get();switch(cmd){case 0:{var arg=SYSCALLS.get();if(arg<0){return-22}var newStream;newStream=FS.open(stream.path,stream.flags,0,arg);return newStream.fd}case 1:case 2:return 0;case 3:return stream.flags;case 4:{var arg=SYSCALLS.get();stream.flags|=arg;return 0}case 12:{var arg=SYSCALLS.get();var offset=0;HEAP16[arg+offset>>1]=2;return 0}case 13:case 14:return 0;case 16:case 8:return-22;case 9:___setErrNo(22);return-1;default:{return-22}}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall3(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.read(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall33(which,varargs){SYSCALLS.varargs=varargs;try{var path=SYSCALLS.getStr(),amode=SYSCALLS.get();return SYSCALLS.doAccess(path,amode)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall4(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),buf=SYSCALLS.get(),count=SYSCALLS.get();return FS.write(stream,HEAP8,buf,count)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall5(which,varargs){SYSCALLS.varargs=varargs;try{var pathname=SYSCALLS.getStr(),flags=SYSCALLS.get(),mode=SYSCALLS.get();var stream=FS.open(pathname,flags,mode);return stream.fd}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall54(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD(),op=SYSCALLS.get();switch(op){case 21509:case 21505:{if(!stream.tty)return-25;return 0}case 21510:case 21511:case 21512:case 21506:case 21507:case 21508:{if(!stream.tty)return-25;return 0}case 21519:{if(!stream.tty)return-25;var argp=SYSCALLS.get();HEAP32[argp>>2]=0;return 0}case 21520:{if(!stream.tty)return-25;return-22}case 21531:{var argp=SYSCALLS.get();return FS.ioctl(stream,op,argp)}case 21523:{if(!stream.tty)return-25;return 0}case 21524:{if(!stream.tty)return-25;return 0}default:abort("bad ioctl syscall "+op)}}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall6(which,varargs){SYSCALLS.varargs=varargs;try{var stream=SYSCALLS.getStreamFromFD();FS.close(stream);return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall64(which,varargs){SYSCALLS.varargs=varargs;try{return PROCINFO.ppid}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___syscall77(which,varargs){SYSCALLS.varargs=varargs;try{var who=SYSCALLS.get(),usage=SYSCALLS.get();_memset(usage,0,136);HEAP32[usage>>2]=1;HEAP32[usage+4>>2]=2;HEAP32[usage+8>>2]=3;HEAP32[usage+12>>2]=4;return 0}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function __emscripten_syscall_munmap(addr,len){if(addr===-1||len===0){return-22}var info=SYSCALLS.mappings[addr];if(!info)return 0;if(len===info.len){var stream=FS.getStream(info.fd);SYSCALLS.doMsync(addr,stream,len,info.flags);FS.munmap(stream);SYSCALLS.mappings[addr]=null;if(info.allocated){_free(info.malloc)}}return 0}function ___syscall91(which,varargs){SYSCALLS.varargs=varargs;try{var addr=SYSCALLS.get(),len=SYSCALLS.get();return __emscripten_syscall_munmap(addr,len)}catch(e){if(typeof FS==="undefined"||!(e instanceof FS.ErrnoError))abort(e);return-e.errno}}function ___unlock(){}function _abort(){Module["abort"]()}function _atexit(func,arg){__ATEXIT__.unshift({func:func,arg:arg})}function _clock(){if(_clock.start===undefined)_clock.start=Date.now();return(Date.now()-_clock.start)*(1e6/1e3)|0}function _emscripten_get_heap_size(){return HEAP8.length}function _getenv(name){if(name===0)return 0;name=UTF8ToString(name);if(!ENV.hasOwnProperty(name))return 0;if(_getenv.ret)_free(_getenv.ret);_getenv.ret=allocateUTF8(ENV[name]);return _getenv.ret}function _gettimeofday(ptr){var now=Date.now();HEAP32[ptr>>2]=now/1e3|0;HEAP32[ptr+4>>2]=now%1e3*1e3|0;return 0}function _llvm_stackrestore(p){var self=_llvm_stacksave;var ret=self.LLVM_SAVEDSTACKS[p];self.LLVM_SAVEDSTACKS.splice(p,1);stackRestore(ret)}function _llvm_stacksave(){var self=_llvm_stacksave;if(!self.LLVM_SAVEDSTACKS){self.LLVM_SAVEDSTACKS=[]}self.LLVM_SAVEDSTACKS.push(stackSave());return self.LLVM_SAVEDSTACKS.length-1}var ___tm_current=75648;var ___tm_timezone=(stringToUTF8("GMT",75696,4),75696);function _tzset(){if(_tzset.called)return;_tzset.called=true;HEAP32[__get_timezone()>>2]=(new Date).getTimezoneOffset()*60;var winter=new Date(2e3,0,1);var summer=new Date(2e3,6,1);HEAP32[__get_daylight()>>2]=Number(winter.getTimezoneOffset()!=summer.getTimezoneOffset());function extractZone(date){var match=date.toTimeString().match(/\(([A-Za-z ]+)\)$/);return match?match[1]:"GMT"}var winterName=extractZone(winter);var summerName=extractZone(summer);var winterNamePtr=allocate(intArrayFromString(winterName),"i8",ALLOC_NORMAL);var summerNamePtr=allocate(intArrayFromString(summerName),"i8",ALLOC_NORMAL);if(summer.getTimezoneOffset()>2]=winterNamePtr;HEAP32[__get_tzname()+4>>2]=summerNamePtr}else{HEAP32[__get_tzname()>>2]=summerNamePtr;HEAP32[__get_tzname()+4>>2]=winterNamePtr}}function _localtime_r(time,tmPtr){_tzset();var date=new Date(HEAP32[time>>2]*1e3);HEAP32[tmPtr>>2]=date.getSeconds();HEAP32[tmPtr+4>>2]=date.getMinutes();HEAP32[tmPtr+8>>2]=date.getHours();HEAP32[tmPtr+12>>2]=date.getDate();HEAP32[tmPtr+16>>2]=date.getMonth();HEAP32[tmPtr+20>>2]=date.getFullYear()-1900;HEAP32[tmPtr+24>>2]=date.getDay();var start=new Date(date.getFullYear(),0,1);var yday=(date.getTime()-start.getTime())/(1e3*60*60*24)|0;HEAP32[tmPtr+28>>2]=yday;HEAP32[tmPtr+36>>2]=-(date.getTimezoneOffset()*60);var summerOffset=new Date(2e3,6,1).getTimezoneOffset();var winterOffset=start.getTimezoneOffset();var dst=(summerOffset!=winterOffset&&date.getTimezoneOffset()==Math.min(winterOffset,summerOffset))|0;HEAP32[tmPtr+32>>2]=dst;var zonePtr=HEAP32[__get_tzname()+(dst?4:0)>>2];HEAP32[tmPtr+40>>2]=zonePtr;return tmPtr}function _localtime(time){return _localtime_r(time,___tm_current)}function _emscripten_memcpy_big(dest,src,num){HEAPU8.set(HEAPU8.subarray(src,src+num),dest)}function abortOnCannotGrowMemory(requestedSize){abort("Cannot enlarge memory arrays to size "+requestedSize+" bytes (OOM). Either (1) compile with -s TOTAL_MEMORY=X with X higher than the current value "+HEAP8.length+", (2) compile with -s ALLOW_MEMORY_GROWTH=1 which allows increasing the size at runtime, or (3) if you want malloc to return NULL (0) instead of this abort, compile with -s ABORTING_MALLOC=0 ")}function _emscripten_resize_heap(requestedSize){abortOnCannotGrowMemory(requestedSize)}function __isLeapYear(year){return year%4===0&&(year%100!==0||year%400===0)}function __arraySum(array,index){var sum=0;for(var i=0;i<=index;sum+=array[i++]);return sum}var __MONTH_DAYS_LEAP=[31,29,31,30,31,30,31,31,30,31,30,31];var __MONTH_DAYS_REGULAR=[31,28,31,30,31,30,31,31,30,31,30,31];function __addDays(date,days){var newDate=new Date(date.getTime());while(days>0){var leap=__isLeapYear(newDate.getFullYear());var currentMonth=newDate.getMonth();var daysInCurrentMonth=(leap?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR)[currentMonth];if(days>daysInCurrentMonth-newDate.getDate()){days-=daysInCurrentMonth-newDate.getDate()+1;newDate.setDate(1);if(currentMonth<11){newDate.setMonth(currentMonth+1)}else{newDate.setMonth(0);newDate.setFullYear(newDate.getFullYear()+1)}}else{newDate.setDate(newDate.getDate()+days);return newDate}}return newDate}function _strftime(s,maxsize,format,tm){var tm_zone=HEAP32[tm+40>>2];var date={tm_sec:HEAP32[tm>>2],tm_min:HEAP32[tm+4>>2],tm_hour:HEAP32[tm+8>>2],tm_mday:HEAP32[tm+12>>2],tm_mon:HEAP32[tm+16>>2],tm_year:HEAP32[tm+20>>2],tm_wday:HEAP32[tm+24>>2],tm_yday:HEAP32[tm+28>>2],tm_isdst:HEAP32[tm+32>>2],tm_gmtoff:HEAP32[tm+36>>2],tm_zone:tm_zone?UTF8ToString(tm_zone):""};var pattern=UTF8ToString(format);var EXPANSION_RULES_1={"%c":"%a %b %d %H:%M:%S %Y","%D":"%m/%d/%y","%F":"%Y-%m-%d","%h":"%b","%r":"%I:%M:%S %p","%R":"%H:%M","%T":"%H:%M:%S","%x":"%m/%d/%y","%X":"%H:%M:%S","%Ec":"%c","%EC":"%C","%Ex":"%m/%d/%y","%EX":"%H:%M:%S","%Ey":"%y","%EY":"%Y","%Od":"%d","%Oe":"%e","%OH":"%H","%OI":"%I","%Om":"%m","%OM":"%M","%OS":"%S","%Ou":"%u","%OU":"%U","%OV":"%V","%Ow":"%w","%OW":"%W","%Oy":"%y"};for(var rule in EXPANSION_RULES_1){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_1[rule])}var WEEKDAYS=["Sunday","Monday","Tuesday","Wednesday","Thursday","Friday","Saturday"];var MONTHS=["January","February","March","April","May","June","July","August","September","October","November","December"];function leadingSomething(value,digits,character){var str=typeof value==="number"?value.toString():value||"";while(str.length0?1:0}var compare;if((compare=sgn(date1.getFullYear()-date2.getFullYear()))===0){if((compare=sgn(date1.getMonth()-date2.getMonth()))===0){compare=sgn(date1.getDate()-date2.getDate())}}return compare}function getFirstWeekStartDate(janFourth){switch(janFourth.getDay()){case 0:return new Date(janFourth.getFullYear()-1,11,29);case 1:return janFourth;case 2:return new Date(janFourth.getFullYear(),0,3);case 3:return new Date(janFourth.getFullYear(),0,2);case 4:return new Date(janFourth.getFullYear(),0,1);case 5:return new Date(janFourth.getFullYear()-1,11,31);case 6:return new Date(janFourth.getFullYear()-1,11,30)}}function getWeekBasedYear(date){var thisDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);var janFourthThisYear=new Date(thisDate.getFullYear(),0,4);var janFourthNextYear=new Date(thisDate.getFullYear()+1,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);if(compareByDay(firstWeekStartThisYear,thisDate)<=0){if(compareByDay(firstWeekStartNextYear,thisDate)<=0){return thisDate.getFullYear()+1}else{return thisDate.getFullYear()}}else{return thisDate.getFullYear()-1}}var EXPANSION_RULES_2={"%a":function(date){return WEEKDAYS[date.tm_wday].substring(0,3)},"%A":function(date){return WEEKDAYS[date.tm_wday]},"%b":function(date){return MONTHS[date.tm_mon].substring(0,3)},"%B":function(date){return MONTHS[date.tm_mon]},"%C":function(date){var year=date.tm_year+1900;return leadingNulls(year/100|0,2)},"%d":function(date){return leadingNulls(date.tm_mday,2)},"%e":function(date){return leadingSomething(date.tm_mday,2," ")},"%g":function(date){return getWeekBasedYear(date).toString().substring(2)},"%G":function(date){return getWeekBasedYear(date)},"%H":function(date){return leadingNulls(date.tm_hour,2)},"%I":function(date){var twelveHour=date.tm_hour;if(twelveHour==0)twelveHour=12;else if(twelveHour>12)twelveHour-=12;return leadingNulls(twelveHour,2)},"%j":function(date){return leadingNulls(date.tm_mday+__arraySum(__isLeapYear(date.tm_year+1900)?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,date.tm_mon-1),3)},"%m":function(date){return leadingNulls(date.tm_mon+1,2)},"%M":function(date){return leadingNulls(date.tm_min,2)},"%n":function(){return"\n"},"%p":function(date){if(date.tm_hour>=0&&date.tm_hour<12){return"AM"}else{return"PM"}},"%S":function(date){return leadingNulls(date.tm_sec,2)},"%t":function(){return"\t"},"%u":function(date){return date.tm_wday||7},"%U":function(date){var janFirst=new Date(date.tm_year+1900,0,1);var firstSunday=janFirst.getDay()===0?janFirst:__addDays(janFirst,7-janFirst.getDay());var endDate=new Date(date.tm_year+1900,date.tm_mon,date.tm_mday);if(compareByDay(firstSunday,endDate)<0){var februaryFirstUntilEndMonth=__arraySum(__isLeapYear(endDate.getFullYear())?__MONTH_DAYS_LEAP:__MONTH_DAYS_REGULAR,endDate.getMonth()-1)-31;var firstSundayUntilEndJanuary=31-firstSunday.getDate();var days=firstSundayUntilEndJanuary+februaryFirstUntilEndMonth+endDate.getDate();return leadingNulls(Math.ceil(days/7),2)}return compareByDay(firstSunday,janFirst)===0?"01":"00"},"%V":function(date){var janFourthThisYear=new Date(date.tm_year+1900,0,4);var janFourthNextYear=new Date(date.tm_year+1901,0,4);var firstWeekStartThisYear=getFirstWeekStartDate(janFourthThisYear);var firstWeekStartNextYear=getFirstWeekStartDate(janFourthNextYear);var endDate=__addDays(new Date(date.tm_year+1900,0,1),date.tm_yday);if(compareByDay(endDate,firstWeekStartThisYear)<0){return"53"}if(compareByDay(firstWeekStartNextYear,endDate)<=0){return"01"}var daysDifference;if(firstWeekStartThisYear.getFullYear()=0;off=Math.abs(off)/60;off=off/60*100+off%60;return(ahead?"+":"-")+String("0000"+off).slice(-4)},"%Z":function(date){return date.tm_zone},"%%":function(){return"%"}};for(var rule in EXPANSION_RULES_2){if(pattern.indexOf(rule)>=0){pattern=pattern.replace(new RegExp(rule,"g"),EXPANSION_RULES_2[rule](date))}}var bytes=intArrayFromString(pattern,false);if(bytes.length>maxsize){return 0}writeArrayToMemory(bytes,s);return bytes.length-1}function _sysconf(name){switch(name){case 30:return PAGE_SIZE;case 85:var maxHeapSize=2*1024*1024*1024-65536;maxHeapSize=HEAPU8.length;return maxHeapSize/PAGE_SIZE;case 132:case 133:case 12:case 137:case 138:case 15:case 235:case 16:case 17:case 18:case 19:case 20:case 149:case 13:case 10:case 236:case 153:case 9:case 21:case 22:case 159:case 154:case 14:case 77:case 78:case 139:case 80:case 81:case 82:case 68:case 67:case 164:case 11:case 29:case 47:case 48:case 95:case 52:case 51:case 46:return 200809;case 79:return 0;case 27:case 246:case 127:case 128:case 23:case 24:case 160:case 161:case 181:case 182:case 242:case 183:case 184:case 243:case 244:case 245:case 165:case 178:case 179:case 49:case 50:case 168:case 169:case 175:case 170:case 171:case 172:case 97:case 76:case 32:case 173:case 35:return-1;case 176:case 177:case 7:case 155:case 8:case 157:case 125:case 126:case 92:case 93:case 129:case 130:case 131:case 94:case 91:return 1;case 74:case 60:case 69:case 70:case 4:return 1024;case 31:case 42:case 72:return 32;case 87:case 26:case 33:return 2147483647;case 34:case 1:return 47839;case 38:case 36:return 99;case 43:case 37:return 2048;case 0:return 2097152;case 3:return 65536;case 28:return 32768;case 44:return 32767;case 75:return 16384;case 39:return 1e3;case 89:return 700;case 71:return 256;case 40:return 255;case 2:return 100;case 180:return 64;case 25:return 20;case 5:return 16;case 6:return 6;case 73:return 4;case 84:{if(typeof navigator==="object")return navigator["hardwareConcurrency"]||1;return 1}}___setErrNo(22);return-1}function _time(ptr){var ret=Date.now()/1e3|0;if(ptr){HEAP32[ptr>>2]=ret}return ret}FS.staticInit();if(ENVIRONMENT_HAS_NODE){var fs=require("fs");var NODEJS_PATH=require("path");NODEFS.staticInit()}function intArrayFromString(stringy,dontAddNull,length){var len=length>0?length:lengthBytesUTF8(stringy)+1;var u8array=new Array(len);var numBytesWritten=stringToUTF8Array(stringy,u8array,0,u8array.length);if(dontAddNull)u8array.length=numBytesWritten;return u8array}function nullFunc_ii(x){abortFnPtrError(x,"ii")}function nullFunc_iidiiii(x){abortFnPtrError(x,"iidiiii")}function nullFunc_iii(x){abortFnPtrError(x,"iii")}function nullFunc_iiii(x){abortFnPtrError(x,"iiii")}function nullFunc_iiiii(x){abortFnPtrError(x,"iiiii")}function nullFunc_jiji(x){abortFnPtrError(x,"jiji")}function nullFunc_v(x){abortFnPtrError(x,"v")}function nullFunc_vi(x){abortFnPtrError(x,"vi")}function nullFunc_vii(x){abortFnPtrError(x,"vii")}function nullFunc_viii(x){abortFnPtrError(x,"viii")}function nullFunc_viiii(x){abortFnPtrError(x,"viiii")}function nullFunc_viiiii(x){abortFnPtrError(x,"viiiii")}function nullFunc_viiiiii(x){abortFnPtrError(x,"viiiiii")}var asmGlobalArg={};var asmLibraryArg={"v":setTempRet0,"b":abortStackOverflow,"ca":nullFunc_ii,"W":nullFunc_iidiiii,"N":nullFunc_iii,"G":nullFunc_iiii,"A":nullFunc_iiiii,"u":nullFunc_jiji,"t":nullFunc_v,"s":nullFunc_vi,"r":nullFunc_vii,"ba":nullFunc_viii,"aa":nullFunc_viiii,"$":nullFunc_viiiii,"_":nullFunc_viiiiii,"k":___assert_fail,"Z":___buildEnvironment,"l":___lock,"q":___setErrNo,"Y":___syscall140,"X":___syscall142,"V":___syscall145,"p":___syscall146,"U":___syscall192,"T":___syscall194,"S":___syscall195,"R":___syscall197,"Q":___syscall199,"P":___syscall20,"O":___syscall201,"d":___syscall221,"M":___syscall3,"L":___syscall33,"K":___syscall4,"o":___syscall5,"n":___syscall54,"j":___syscall6,"J":___syscall64,"I":___syscall77,"H":___syscall91,"h":___unlock,"c":_abort,"F":_atexit,"m":_clock,"E":_emscripten_get_heap_size,"D":_emscripten_memcpy_big,"C":_emscripten_resize_heap,"B":_getenv,"g":_gettimeofday,"e":_llvm_stackrestore,"f":_llvm_stacksave,"z":_localtime,"y":_strftime,"x":_sysconf,"i":_time,"w":abortOnCannotGrowMemory,"a":DYNAMICTOP_PTR};var asm=Module["asm"](asmGlobalArg,asmLibraryArg,buffer);Module["asm"]=asm;var _GNUNET_CRYPTO_ecc_ecdh=Module["_GNUNET_CRYPTO_ecc_ecdh"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["da"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdh_eddsa=Module["_GNUNET_CRYPTO_ecdh_eddsa"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ea"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdhe_key_create=Module["_GNUNET_CRYPTO_ecdhe_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["fa"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdhe_key_get_public=Module["_GNUNET_CRYPTO_ecdhe_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ga"].apply(null,arguments)};var _GNUNET_CRYPTO_ecdsa_key_create=Module["_GNUNET_CRYPTO_ecdsa_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ha"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_key_create=Module["_GNUNET_CRYPTO_eddsa_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ia"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_key_get_public=Module["_GNUNET_CRYPTO_eddsa_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ja"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_sign=Module["_GNUNET_CRYPTO_eddsa_sign"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ka"].apply(null,arguments)};var _GNUNET_CRYPTO_eddsa_verify=Module["_GNUNET_CRYPTO_eddsa_verify"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["la"].apply(null,arguments)};var _GNUNET_CRYPTO_hash=Module["_GNUNET_CRYPTO_hash"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ma"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_abort=Module["_GNUNET_CRYPTO_hash_context_abort"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["na"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_finish=Module["_GNUNET_CRYPTO_hash_context_finish"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["oa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_read=Module["_GNUNET_CRYPTO_hash_context_read"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["pa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_context_start=Module["_GNUNET_CRYPTO_hash_context_start"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["qa"].apply(null,arguments)};var _GNUNET_CRYPTO_hash_create_random=Module["_GNUNET_CRYPTO_hash_create_random"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ra"].apply(null,arguments)};var _GNUNET_CRYPTO_hkdf=Module["_GNUNET_CRYPTO_hkdf"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["sa"].apply(null,arguments)};var _GNUNET_CRYPTO_kdf=Module["_GNUNET_CRYPTO_kdf"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ta"].apply(null,arguments)};var _GNUNET_CRYPTO_random_block=Module["_GNUNET_CRYPTO_random_block"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ua"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_blind=Module["_GNUNET_CRYPTO_rsa_blind"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["va"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_create=Module["_GNUNET_CRYPTO_rsa_private_key_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["wa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_decode=Module["_GNUNET_CRYPTO_rsa_private_key_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["xa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_encode=Module["_GNUNET_CRYPTO_rsa_private_key_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ya"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_free=Module["_GNUNET_CRYPTO_rsa_private_key_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["za"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_private_key_get_public=Module["_GNUNET_CRYPTO_rsa_private_key_get_public"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Aa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_decode=Module["_GNUNET_CRYPTO_rsa_public_key_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ba"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_encode=Module["_GNUNET_CRYPTO_rsa_public_key_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ca"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_public_key_free=Module["_GNUNET_CRYPTO_rsa_public_key_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Da"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_sign_blinded=Module["_GNUNET_CRYPTO_rsa_sign_blinded"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ea"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_decode=Module["_GNUNET_CRYPTO_rsa_signature_decode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Fa"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_encode=Module["_GNUNET_CRYPTO_rsa_signature_encode"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ga"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_signature_free=Module["_GNUNET_CRYPTO_rsa_signature_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ha"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_unblind=Module["_GNUNET_CRYPTO_rsa_unblind"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ia"].apply(null,arguments)};var _GNUNET_CRYPTO_rsa_verify=Module["_GNUNET_CRYPTO_rsa_verify"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ja"].apply(null,arguments)};var _GNUNET_CRYPTO_symmetric_decrypt=Module["_GNUNET_CRYPTO_symmetric_decrypt"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ka"].apply(null,arguments)};var _GNUNET_CRYPTO_symmetric_encrypt=Module["_GNUNET_CRYPTO_symmetric_encrypt"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["La"].apply(null,arguments)};var _GNUNET_STRINGS_data_to_string_alloc=Module["_GNUNET_STRINGS_data_to_string_alloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ma"].apply(null,arguments)};var _GNUNET_STRINGS_string_to_data=Module["_GNUNET_STRINGS_string_to_data"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Na"].apply(null,arguments)};var _TALER_WRALL_ecdhe_public_key_from_private=Module["_TALER_WRALL_ecdhe_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Oa"].apply(null,arguments)};var _TALER_WRALL_ecdsa_public_key_from_private=Module["_TALER_WRALL_ecdsa_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Pa"].apply(null,arguments)};var _TALER_WRALL_eddsa_public_key_from_private=Module["_TALER_WRALL_eddsa_public_key_from_private"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Qa"].apply(null,arguments)};var _TALER_WRALL_get_amount=Module["_TALER_WRALL_get_amount"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ra"].apply(null,arguments)};var _TALER_WRALL_purpose_create=Module["_TALER_WRALL_purpose_create"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Sa"].apply(null,arguments)};var _TALER_WR_get_currency=Module["_TALER_WR_get_currency"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ta"].apply(null,arguments)};var _TALER_WR_get_fraction=Module["_TALER_WR_get_fraction"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ua"].apply(null,arguments)};var _TALER_WR_get_value=Module["_TALER_WR_get_value"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Va"].apply(null,arguments)};var _TALER_amount_add=Module["_TALER_amount_add"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Wa"].apply(null,arguments)};var _TALER_amount_cmp=Module["_TALER_amount_cmp"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Xa"].apply(null,arguments)};var _TALER_amount_get_zero=Module["_TALER_amount_get_zero"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Ya"].apply(null,arguments)};var _TALER_amount_hton=Module["_TALER_amount_hton"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["Za"].apply(null,arguments)};var _TALER_amount_normalize=Module["_TALER_amount_normalize"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["_a"].apply(null,arguments)};var _TALER_amount_ntoh=Module["_TALER_amount_ntoh"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["$a"].apply(null,arguments)};var _TALER_amount_subtract=Module["_TALER_amount_subtract"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ab"].apply(null,arguments)};var _TALER_setup_fresh_coin=Module["_TALER_setup_fresh_coin"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["bb"].apply(null,arguments)};var ___errno_location=Module["___errno_location"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["cb"].apply(null,arguments)};var __get_daylight=Module["__get_daylight"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["db"].apply(null,arguments)};var __get_timezone=Module["__get_timezone"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["eb"].apply(null,arguments)};var __get_tzname=Module["__get_tzname"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["fb"].apply(null,arguments)};var _fflush=Module["_fflush"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["gb"].apply(null,arguments)};var _free=Module["_free"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["hb"].apply(null,arguments)};var _malloc=Module["_malloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ib"].apply(null,arguments)};var _memalign=Module["_memalign"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["jb"].apply(null,arguments)};var _memmove=Module["_memmove"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["kb"].apply(null,arguments)};var _memset=Module["_memset"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["lb"].apply(null,arguments)};var establishStackSpace=Module["establishStackSpace"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["ob"].apply(null,arguments)};var globalCtors=Module["globalCtors"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["pb"].apply(null,arguments)};var stackAlloc=Module["stackAlloc"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["qb"].apply(null,arguments)};var stackRestore=Module["stackRestore"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["rb"].apply(null,arguments)};var stackSave=Module["stackSave"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["sb"].apply(null,arguments)};var dynCall_v=Module["dynCall_v"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["mb"].apply(null,arguments)};var dynCall_vi=Module["dynCall_vi"]=function(){assert(runtimeInitialized,"you need to wait for the runtime to be ready (e.g. wait for main() to be called)");assert(!runtimeExited,"the runtime was exited (use NO_EXIT_RUNTIME to keep it alive after main() exits)");return Module["asm"]["nb"].apply(null,arguments)};Module["asm"]=asm;if(!Object.getOwnPropertyDescriptor(Module,"intArrayFromString"))Module["intArrayFromString"]=function(){abort("'intArrayFromString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"intArrayToString"))Module["intArrayToString"]=function(){abort("'intArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["ccall"]=ccall;Module["cwrap"]=cwrap;Module["setValue"]=setValue;Module["getValue"]=getValue;if(!Object.getOwnPropertyDescriptor(Module,"allocate"))Module["allocate"]=function(){abort("'allocate' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getMemory"))Module["getMemory"]=function(){abort("'getMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"AsciiToString"))Module["AsciiToString"]=function(){abort("'AsciiToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToAscii"))Module["stringToAscii"]=function(){abort("'stringToAscii' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF8ArrayToString"))Module["UTF8ArrayToString"]=function(){abort("'UTF8ArrayToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["UTF8ToString"]=UTF8ToString;if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF8Array"))Module["stringToUTF8Array"]=function(){abort("'stringToUTF8Array' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};Module["stringToUTF8"]=stringToUTF8;if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF8"))Module["lengthBytesUTF8"]=function(){abort("'lengthBytesUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF16ToString"))Module["UTF16ToString"]=function(){abort("'UTF16ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF16"))Module["stringToUTF16"]=function(){abort("'stringToUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF16"))Module["lengthBytesUTF16"]=function(){abort("'lengthBytesUTF16' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"UTF32ToString"))Module["UTF32ToString"]=function(){abort("'UTF32ToString' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stringToUTF32"))Module["stringToUTF32"]=function(){abort("'stringToUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"lengthBytesUTF32"))Module["lengthBytesUTF32"]=function(){abort("'lengthBytesUTF32' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"allocateUTF8"))Module["allocateUTF8"]=function(){abort("'allocateUTF8' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackTrace"))Module["stackTrace"]=function(){abort("'stackTrace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPreRun"))Module["addOnPreRun"]=function(){abort("'addOnPreRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnInit"))Module["addOnInit"]=function(){abort("'addOnInit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPreMain"))Module["addOnPreMain"]=function(){abort("'addOnPreMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnExit"))Module["addOnExit"]=function(){abort("'addOnExit' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addOnPostRun"))Module["addOnPostRun"]=function(){abort("'addOnPostRun' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeStringToMemory"))Module["writeStringToMemory"]=function(){abort("'writeStringToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeArrayToMemory"))Module["writeArrayToMemory"]=function(){abort("'writeArrayToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeAsciiToMemory"))Module["writeAsciiToMemory"]=function(){abort("'writeAsciiToMemory' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addRunDependency"))Module["addRunDependency"]=function(){abort("'addRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"removeRunDependency"))Module["removeRunDependency"]=function(){abort("'removeRunDependency' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"ENV"))Module["ENV"]=function(){abort("'ENV' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"FS"))Module["FS"]=function(){abort("'FS' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createFolder"))Module["FS_createFolder"]=function(){abort("'FS_createFolder' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createPath"))Module["FS_createPath"]=function(){abort("'FS_createPath' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createDataFile"))Module["FS_createDataFile"]=function(){abort("'FS_createDataFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createPreloadedFile"))Module["FS_createPreloadedFile"]=function(){abort("'FS_createPreloadedFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createLazyFile"))Module["FS_createLazyFile"]=function(){abort("'FS_createLazyFile' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createLink"))Module["FS_createLink"]=function(){abort("'FS_createLink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_createDevice"))Module["FS_createDevice"]=function(){abort("'FS_createDevice' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"FS_unlink"))Module["FS_unlink"]=function(){abort("'FS_unlink' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ). Alternatively, forcing filesystem support (-s FORCE_FILESYSTEM=1) can export this for you")};if(!Object.getOwnPropertyDescriptor(Module,"GL"))Module["GL"]=function(){abort("'GL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"dynamicAlloc"))Module["dynamicAlloc"]=function(){abort("'dynamicAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"warnOnce"))Module["warnOnce"]=function(){abort("'warnOnce' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"loadDynamicLibrary"))Module["loadDynamicLibrary"]=function(){abort("'loadDynamicLibrary' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"loadWebAssemblyModule"))Module["loadWebAssemblyModule"]=function(){abort("'loadWebAssemblyModule' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getLEB"))Module["getLEB"]=function(){abort("'getLEB' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getFunctionTables"))Module["getFunctionTables"]=function(){abort("'getFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"alignFunctionTables"))Module["alignFunctionTables"]=function(){abort("'alignFunctionTables' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"registerFunctions"))Module["registerFunctions"]=function(){abort("'registerFunctions' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"addFunction"))Module["addFunction"]=function(){abort("'addFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"removeFunction"))Module["removeFunction"]=function(){abort("'removeFunction' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getFuncWrapper"))Module["getFuncWrapper"]=function(){abort("'getFuncWrapper' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"prettyPrint"))Module["prettyPrint"]=function(){abort("'prettyPrint' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"makeBigInt"))Module["makeBigInt"]=function(){abort("'makeBigInt' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"dynCall"))Module["dynCall"]=function(){abort("'dynCall' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getCompilerSetting"))Module["getCompilerSetting"]=function(){abort("'getCompilerSetting' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackSave"))Module["stackSave"]=function(){abort("'stackSave' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackRestore"))Module["stackRestore"]=function(){abort("'stackRestore' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"stackAlloc"))Module["stackAlloc"]=function(){abort("'stackAlloc' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"establishStackSpace"))Module["establishStackSpace"]=function(){abort("'establishStackSpace' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"print"))Module["print"]=function(){abort("'print' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"printErr"))Module["printErr"]=function(){abort("'printErr' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"getTempRet0"))Module["getTempRet0"]=function(){abort("'getTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"setTempRet0"))Module["setTempRet0"]=function(){abort("'setTempRet0' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"callMain"))Module["callMain"]=function(){abort("'callMain' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"Pointer_stringify"))Module["Pointer_stringify"]=function(){abort("'Pointer_stringify' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"writeStackCookie"))Module["writeStackCookie"]=function(){abort("'writeStackCookie' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"checkStackCookie"))Module["checkStackCookie"]=function(){abort("'checkStackCookie' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"abortStackOverflow"))Module["abortStackOverflow"]=function(){abort("'abortStackOverflow' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")};if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_NORMAL"))Object.defineProperty(Module,"ALLOC_NORMAL",{get:function(){abort("'ALLOC_NORMAL' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_STACK"))Object.defineProperty(Module,"ALLOC_STACK",{get:function(){abort("'ALLOC_STACK' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_DYNAMIC"))Object.defineProperty(Module,"ALLOC_DYNAMIC",{get:function(){abort("'ALLOC_DYNAMIC' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});if(!Object.getOwnPropertyDescriptor(Module,"ALLOC_NONE"))Object.defineProperty(Module,"ALLOC_NONE",{get:function(){abort("'ALLOC_NONE' was not exported. add it to EXTRA_EXPORTED_RUNTIME_METHODS (see the FAQ)")}});Module["then"]=function(func){if(Module["calledRun"]){func(Module)}else{var old=Module["onRuntimeInitialized"];Module["onRuntimeInitialized"]=function(){if(old)old();func(Module)}}return Module};function ExitStatus(status){this.name="ExitStatus";this.message="Program terminated with exit("+status+")";this.status=status}dependenciesFulfilled=function runCaller(){if(!Module["calledRun"])run();if(!Module["calledRun"])dependenciesFulfilled=runCaller};function run(args){args=args||arguments_;if(runDependencies>0){return}writeStackCookie();preRun();if(runDependencies>0)return;if(Module["calledRun"])return;function doRun(){if(Module["calledRun"])return;Module["calledRun"]=true;if(ABORT)return;initRuntime();preMain();if(Module["onRuntimeInitialized"])Module["onRuntimeInitialized"]();assert(!Module["_main"],'compiled without a main, but one is present. if you added it from JS, use Module["onRuntimeInitialized"]');postRun()}if(Module["setStatus"]){Module["setStatus"]("Running...");setTimeout(function(){setTimeout(function(){Module["setStatus"]("")},1);doRun()},1)}else{doRun()}checkStackCookie()}Module["run"]=run;var abortDecorators=[];function abort(what){if(Module["onAbort"]){Module["onAbort"](what)}what+="";out(what);err(what);ABORT=true;EXITSTATUS=1;var extra="";var output="abort("+what+") at "+stackTrace()+extra;if(abortDecorators){abortDecorators.forEach(function(decorator){output=decorator(output,what)})}throw output}Module["abort"]=abort;if(Module["preInit"]){if(typeof Module["preInit"]=="function")Module["preInit"]=[Module["preInit"]];while(Module["preInit"].length>0){Module["preInit"].pop()()}}run(); - - - return TalerEmscriptenLib -} -); -})(); -if (typeof exports === 'object' && typeof module === 'object') - module.exports = TalerEmscriptenLib; - else if (typeof define === 'function' && define['amd']) - define([], function() { return TalerEmscriptenLib; }); - else if (typeof exports === 'object') - exports["TalerEmscriptenLib"] = TalerEmscriptenLib; - \ No newline at end of file diff --git a/emscripten/taler-emscripten-lib.wasm b/emscripten/taler-emscripten-lib.wasm deleted file mode 100644 index 743a2034a..000000000 Binary files a/emscripten/taler-emscripten-lib.wasm and /dev/null differ diff --git a/src/crypto/browserWorkerEntry.ts b/src/crypto/browserWorkerEntry.ts index d133e93cc..5ac762c13 100644 --- a/src/crypto/browserWorkerEntry.ts +++ b/src/crypto/browserWorkerEntry.ts @@ -23,61 +23,11 @@ */ import { CryptoImplementation } from "./cryptoImplementation"; -import { EmscEnvironment } from "./emscInterface"; const worker: Worker = (self as any) as Worker; -class BrowserEmscriptenLoader { - private cachedEmscEnvironment: EmscEnvironment | undefined = undefined; - private cachedEmscEnvironmentPromise: - | Promise - | undefined = undefined; - - async getEmscriptenEnvironment(): Promise { - - if (this.cachedEmscEnvironment) { - return this.cachedEmscEnvironment; - } - - if (this.cachedEmscEnvironmentPromise) { - return this.cachedEmscEnvironmentPromise; - } - - console.log("loading emscripten lib with 'importScripts'"); - // @ts-ignore - self.TalerEmscriptenLib = {}; - // @ts-ignore - importScripts('/emscripten/taler-emscripten-lib.js') - // @ts-ignore - if (!self.TalerEmscriptenLib) { - throw Error("can't import taler emscripten lib"); - } - const locateFile = (path: string, scriptDir: string) => { - console.log("locating file", "path", path, "scriptDir", scriptDir); - // This is quite hacky and assumes that our scriptDir is dist/ - return scriptDir + "../emscripten/" + path; - }; - console.log("instantiating TalerEmscriptenLib"); - // @ts-ignore - const lib = self.TalerEmscriptenLib({ locateFile }); - return new Promise((resolve, reject) => { - lib.then((mod: any) => { - this.cachedEmscEnvironmentPromise = undefined; - const emsc = new EmscEnvironment(mod); - this.cachedEmscEnvironment = new EmscEnvironment(mod); - console.log("emscripten module fully loaded"); - resolve(emsc); - }); - }); - } -} - -let loader = new BrowserEmscriptenLoader(); - async function handleRequest(operation: string, id: number, args: string[]) { - let emsc = await loader.getEmscriptenEnvironment(); - - const impl = new CryptoImplementation(emsc); + const impl = new CryptoImplementation(); if (!(operation in impl)) { console.error(`crypto operation '${operation}' not found`); diff --git a/src/crypto/cryptoApi-test.ts b/src/crypto/cryptoApi-test.ts deleted file mode 100644 index d9d42081c..000000000 --- a/src/crypto/cryptoApi-test.ts +++ /dev/null @@ -1,117 +0,0 @@ -/* - This file is part of TALER - (C) 2017 Inria and GNUnet e.V. - - TALER is free software; you can redistribute it and/or modify it under the - terms of the GNU General Public License as published by the Free Software - Foundation; either version 3, or (at your option) any later version. - - TALER is distributed in the hope that it will be useful, but WITHOUT ANY - WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR - A PARTICULAR PURPOSE. See the GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along with - TALER; see the file COPYING. If not, see - */ - -// tslint:disable:max-line-length - -import test from "ava"; - -import { - DenominationRecord, - DenominationStatus, - ReserveRecord, - ReserveRecordStatus, -} from "../dbTypes"; - -import { CryptoApi } from "./cryptoApi"; -import { NodeCryptoWorkerFactory } from "./nodeProcessWorker"; - -const masterPub1: string = - "CQQZ9DY3MZ1ARMN5K1VKDETS04Y2QCKMMCFHZSWJWWVN82BTTH00"; - -const denomValid1: DenominationRecord = { - denomPub: - "51R7ARKCD5HJTTV5F4G0M818E9SP280A40G2GVH04CR30GHS84R3JHHP6GSM2D9Q6514CGT568R32C9J6CWM4DSH64TM4DSM851K0CA48CVKAC1P6H144C2160T46DHK8CVM4HJ274S38C1M6S338D9N6GWM8DT684T3JCT36S13EC9G88R3EGHQ8S0KJGSQ60SKGD216N33AGJ2651K2E9S60TMCD1N75244HHQ6X33EDJ570R3GGJ2651MACA38D130DA560VK4HHJ68WK2CA26GW3ECSH6D13EC9S88VK2GT66WVK8D9G750K0D9R8RRK4DHQ71332GHK8D23GE26710M2H9K6WVK8HJ38MVKEGA66N23AC9H88VKACT58MV3CCSJ6H1K4DT38GRK0C9M8N33CE1R60V4AHA38H1KECSH6S33JH9N8GRKGH1K68S36GH354520818CMG26C1H60R30C935452081918G2J2G0", - denomPubHash: "dummy", - exchangeBaseUrl: "https://exchange.example.com/", - feeDeposit: { - currency: "PUDOS", - fraction: 10000, - value: 0, - }, - feeRefresh: { - currency: "PUDOS", - fraction: 10000, - value: 0, - }, - feeRefund: { - currency: "PUDOS", - fraction: 10000, - value: 0, - }, - feeWithdraw: { - currency: "PUDOS", - fraction: 10000, - value: 0, - }, - isOffered: true, - masterSig: - "CJFJCQ48Q45PSGJ5KY94N6M2TPARESM2E15BSPBD95YVVPEARAEQ6V6G4Z2XBMS0QM0F3Y9EYVP276FCS90EQ1578ZC8JHFBZ3NGP3G", - stampExpireDeposit: "/Date(1851580381)/", - stampExpireLegal: "/Date(1567756381)/", - stampExpireWithdraw: "/Date(2482300381)/", - stampStart: "/Date(1473148381)/", - status: DenominationStatus.Unverified, - value: { - currency: "PUDOS", - fraction: 100000, - value: 0, - }, -}; - -const denomInvalid1 = JSON.parse(JSON.stringify(denomValid1)); -denomInvalid1.value.value += 1; - -test("string hashing", async t => { - const crypto = new CryptoApi(new NodeCryptoWorkerFactory()); - const s = await crypto.hashString("hello taler"); - const sh = - "8RDMADB3YNF3QZBS3V467YZVJAMC2QAQX0TZGVZ6Q5PFRRAJFT70HHN0QF661QR9QWKYMMC7YEMPD679D2RADXCYK8Y669A2A5MKQFR"; - t.true(s === sh); - t.pass(); -}); - -test("precoin creation", async t => { - const crypto = new CryptoApi(new NodeCryptoWorkerFactory()); - const { priv, pub } = await crypto.createEddsaKeypair(); - const r: ReserveRecord = { - created: { t_ms: 0 }, - currentAmount: null, - exchangeBaseUrl: "https://example.com/exchange", - hasPayback: false, - precoinAmount: { currency: "PUDOS", value: 0, fraction: 0 }, - requestedAmount: { currency: "PUDOS", value: 0, fraction: 0 }, - reservePriv: priv, - reservePub: pub, - timestampConfirmed: undefined, - timestampReserveInfoPosted: undefined, - exchangeWire: "payto://foo", - reserveStatus: ReserveRecordStatus.UNCONFIRMED, - }; - - const precoin = await crypto.createPreCoin(denomValid1, r); - t.truthy(precoin); - t.pass(); -}); - -test("denom validation", async t => { - const crypto = new CryptoApi(new NodeCryptoWorkerFactory()); - let v: boolean; - v = await crypto.isValidDenom(denomValid1, masterPub1); - t.true(v); - v = await crypto.isValidDenom(denomInvalid1, masterPub1); - t.true(!v); - t.pass(); -}); diff --git a/src/crypto/cryptoImplementation.ts b/src/crypto/cryptoImplementation.ts index 38c63ceee..9ffdec701 100644 --- a/src/crypto/cryptoImplementation.ts +++ b/src/crypto/cryptoImplementation.ts @@ -14,10 +14,9 @@ TALER; see the file COPYING. If not, see */ - /** * Synchronous implementation of crypto-related functions for the wallet. - * + * * The functionality is parameterized over an Emscripten environment. */ @@ -38,19 +37,118 @@ import { } from "../dbTypes"; import { CoinPaySig, ContractTerms, PaybackRequest } from "../talerTypes"; -import { BenchmarkResult, CoinWithDenom, PayCoinInfo } from "../walletTypes"; -import { canonicalJson } from "../helpers"; -import { EmscEnvironment } from "./emscInterface"; -import * as native from "./emscInterface"; +import { + BenchmarkResult, + CoinWithDenom, + PayCoinInfo, + Timestamp, +} from "../walletTypes"; +import { canonicalJson, getTalerStampSec } from "../helpers"; import { AmountJson } from "../amounts"; import * as Amounts from "../amounts"; import * as timer from "../timer"; -import { getRandomBytes, encodeCrock } from "./talerCrypto"; +import { + getRandomBytes, + encodeCrock, + decodeCrock, + createEddsaKeyPair, + createBlindingKeySecret, + hash, + rsaBlind, + eddsaVerify, + eddsaSign, + rsaUnblind, + stringToBytes, + createHashContext, + createEcdheKeyPair, + keyExchangeEcdheEddsa, + setupRefreshPlanchet, +} from "./talerCrypto"; +import { randomBytes } from "./primitives/nacl-fast"; + +enum SignaturePurpose { + RESERVE_WITHDRAW = 1200, + WALLET_COIN_DEPOSIT = 1201, + MASTER_DENOMINATION_KEY_VALIDITY = 1025, + WALLET_COIN_MELT = 1202, + TEST = 4242, + MERCHANT_PAYMENT_OK = 1104, + MASTER_WIRE_FEES = 1028, + WALLET_COIN_PAYBACK = 1203, + WALLET_COIN_LINK = 1204, +} + +function amountToBuffer(amount: AmountJson): Uint8Array { + const buffer = new ArrayBuffer(8 + 4 + 12); + const dvbuf = new DataView(buffer); + const u8buf = new Uint8Array(buffer); + const te = new TextEncoder(); + const curr = te.encode(amount.currency); + dvbuf.setBigUint64(0, BigInt(amount.value)); + dvbuf.setUint32(8, amount.fraction); + u8buf.set(curr, 8 + 4); + + return u8buf; +} + +function timestampToBuffer(ts: Timestamp): Uint8Array { + const b = new ArrayBuffer(8); + const v = new DataView(b); + const s = BigInt(ts.t_ms) * BigInt(1000); + v.setBigUint64(0, s); + return new Uint8Array(b); +} + +function talerTimestampStringToBuffer(ts: string): Uint8Array { + const t_sec = getTalerStampSec(ts); + if (t_sec === null || t_sec === undefined) { + // Should have been validated before! + throw Error("invalid timestamp"); + } + const buffer = new ArrayBuffer(8); + const dvbuf = new DataView(buffer); + const s = BigInt(t_sec) * BigInt(1000 * 1000); + dvbuf.setBigUint64(0, s); + return new Uint8Array(buffer); +} + +class SignaturePurposeBuilder { + private chunks: Uint8Array[] = []; + + constructor(private purposeNum: number) {} + + put(bytes: Uint8Array): SignaturePurposeBuilder { + this.chunks.push(Uint8Array.from(bytes)); + return this; + } + + build(): Uint8Array { + let payloadLen = 0; + for (let c of this.chunks) { + payloadLen += c.byteLength; + } + const buf = new ArrayBuffer(4 + 4 + payloadLen); + const u8buf = new Uint8Array(buf); + let p = 8; + for (let c of this.chunks) { + u8buf.set(c, p); + p += c.byteLength; + } + const dvbuf = new DataView(buf); + dvbuf.setUint32(0, payloadLen + 4 + 4); + dvbuf.setUint32(4, this.purposeNum); + return u8buf; + } +} + +function buildSigPS(purposeNum: number): SignaturePurposeBuilder { + return new SignaturePurposeBuilder(purposeNum); +} export class CryptoImplementation { static enableTracing: boolean = false; - constructor(private emsc: EmscEnvironment) {} + constructor() {} /** * Create a pre-coin of the given denomination to be withdrawn from then given @@ -60,54 +158,39 @@ export class CryptoImplementation { denom: DenominationRecord, reserve: ReserveRecord, ): PreCoinRecord { - const reservePriv = new native.EddsaPrivateKey(this.emsc); - reservePriv.loadCrock(reserve.reservePriv); - const reservePub = new native.EddsaPublicKey(this.emsc); - reservePub.loadCrock(reserve.reservePub); - const denomPub = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub); - const coinPriv = native.EddsaPrivateKey.create(this.emsc); - const coinPub = coinPriv.getPublicKey(); - const blindingFactor = native.RsaBlindingKeySecret.create(this.emsc); - const pubHash: native.HashCode = coinPub.hash(); - const ev = native.rsaBlind(pubHash, blindingFactor, denomPub); - - if (!ev) { - throw Error("couldn't blind (malicious exchange key?)"); - } - - if (!denom.feeWithdraw) { - throw Error("Field fee_withdraw missing"); - } - - const amountWithFee = new native.Amount(this.emsc, denom.value); - amountWithFee.add(new native.Amount(this.emsc, denom.feeWithdraw)); - const withdrawFee = new native.Amount(this.emsc, denom.feeWithdraw); - - const denomPubHash = denomPub.encode().hash(); - - // Signature - const withdrawRequest = new native.WithdrawRequestPS(this.emsc, { - amount_with_fee: amountWithFee.toNbo(), - h_coin_envelope: ev.hash(), - h_denomination_pub: denomPubHash, - reserve_pub: reservePub, - withdraw_fee: withdrawFee.toNbo(), - }); - - const sig = native.eddsaSign(withdrawRequest.toPurpose(), reservePriv); + const reservePub = decodeCrock(reserve.reservePub); + const reservePriv = decodeCrock(reserve.reservePriv); + const denomPub = decodeCrock(denom.denomPub); + const coinKeyPair = createEddsaKeyPair(); + const blindingFactor = createBlindingKeySecret(); + const coinPubHash = hash(coinKeyPair.eddsaPub); + const ev = rsaBlind(coinPubHash, blindingFactor, denomPub); + const amountWithFee = Amounts.add(denom.value, denom.feeWithdraw).amount; + const denomPubHash = hash(denomPub); + const evHash = hash(ev); + + const withdrawRequest = buildSigPS(SignaturePurpose.RESERVE_WITHDRAW) + .put(reservePub) + .put(amountToBuffer(amountWithFee)) + .put(amountToBuffer(denom.feeWithdraw)) + .put(denomPubHash) + .put(evHash) + .build(); + + const sig = eddsaSign(withdrawRequest, reservePriv); const preCoin: PreCoinRecord = { - blindingKey: blindingFactor.toCrock(), - coinEv: ev.toCrock(), - coinPriv: coinPriv.toCrock(), - coinPub: coinPub.toCrock(), + blindingKey: encodeCrock(blindingFactor), + coinEv: encodeCrock(ev), + coinPriv: encodeCrock(coinKeyPair.eddsaPriv), + coinPub: encodeCrock(coinKeyPair.eddsaPub), coinValue: denom.value, - denomPub: denomPub.toCrock(), - denomPubHash: denomPubHash.toCrock(), + denomPub: encodeCrock(denomPub), + denomPubHash: encodeCrock(denomPubHash), exchangeBaseUrl: reserve.exchangeBaseUrl, isFromTip: false, - reservePub: reservePub.toCrock(), - withdrawSig: sig.toCrock(), + reservePub: encodeCrock(reservePub), + withdrawSig: encodeCrock(sig), }; return preCoin; } @@ -116,32 +199,20 @@ export class CryptoImplementation { * Create a planchet used for tipping, including the private keys. */ createTipPlanchet(denom: DenominationRecord): TipPlanchet { - const denomPub = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub); - const coinPriv = native.EddsaPrivateKey.create(this.emsc); - const coinPub = coinPriv.getPublicKey(); - const blindingFactor = native.RsaBlindingKeySecret.create(this.emsc); - const pubHash: native.HashCode = coinPub.hash(); - const ev = native.rsaBlind(pubHash, blindingFactor, denomPub); - - if (!ev) { - throw Error("couldn't blind (malicious exchange key?)"); - } - - if (!denom.feeWithdraw) { - throw Error("Field fee_withdraw missing"); - } + const denomPub = decodeCrock(denom.denomPub); + const coinKeyPair = createEddsaKeyPair(); + const blindingFactor = createBlindingKeySecret(); + const coinPubHash = hash(coinKeyPair.eddsaPub); + const ev = rsaBlind(coinPubHash, blindingFactor, denomPub); const tipPlanchet: TipPlanchet = { - blindingKey: blindingFactor.toCrock(), - coinEv: ev.toCrock(), - coinPriv: coinPriv.toCrock(), - coinPub: coinPub.toCrock(), + blindingKey: encodeCrock(blindingFactor), + coinEv: encodeCrock(ev), + coinPriv: encodeCrock(coinKeyPair.eddsaPriv), + coinPub: encodeCrock(coinKeyPair.eddsaPub), coinValue: denom.value, - denomPub: denomPub.encode().toCrock(), - denomPubHash: denomPub - .encode() - .hash() - .toCrock(), + denomPub: encodeCrock(denomPub), + denomPubHash: encodeCrock(hash(denomPub)), }; return tipPlanchet; } @@ -150,22 +221,18 @@ export class CryptoImplementation { * Create and sign a message to request payback for a coin. */ createPaybackRequest(coin: CoinRecord): PaybackRequest { - const p = new native.PaybackRequestPS(this.emsc, { - coin_blind: native.RsaBlindingKeySecret.fromCrock( - this.emsc, - coin.blindingKey, - ), - coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, coin.coinPub), - h_denom_pub: native.RsaPublicKey.fromCrock(this.emsc, coin.denomPub) - .encode() - .hash(), - }); - const coinPriv = native.EddsaPrivateKey.fromCrock(this.emsc, coin.coinPriv); - const coinSig = native.eddsaSign(p.toPurpose(), coinPriv); + const p = buildSigPS(SignaturePurpose.WALLET_COIN_PAYBACK) + .put(decodeCrock(coin.coinPub)) + .put(decodeCrock(coin.denomPubHash)) + .put(decodeCrock(coin.blindingKey)) + .build(); + + const coinPriv = decodeCrock(coin.coinPriv); + const coinSig = eddsaSign(p, coinPriv); const paybackRequest: PaybackRequest = { coin_blind_key_secret: coin.blindingKey, coin_pub: coin.coinPub, - coin_sig: coinSig.toCrock(), + coin_sig: encodeCrock(coinSig), denom_pub: coin.denomPub, denom_sig: coin.denomSig, }; @@ -180,114 +247,72 @@ export class CryptoImplementation { contractHash: string, merchantPub: string, ): boolean { - const p = new native.PaymentSignaturePS(this.emsc, { - contract_hash: native.HashCode.fromCrock(this.emsc, contractHash), - }); - const nativeSig = new native.EddsaSignature(this.emsc); - nativeSig.loadCrock(sig); - const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, merchantPub); - return native.eddsaVerify( - native.SignaturePurpose.MERCHANT_PAYMENT_OK, - p.toPurpose(), - nativeSig, - nativePub, - ); + const p = buildSigPS(SignaturePurpose.MERCHANT_PAYMENT_OK) + .put(decodeCrock(contractHash)) + .build(); + const sigBytes = decodeCrock(sig); + const pubBytes = decodeCrock(merchantPub); + return eddsaVerify(p, sigBytes, pubBytes); } /** * Check if a wire fee is correctly signed. */ isValidWireFee(type: string, wf: WireFee, masterPub: string): boolean { - const p = new native.MasterWireFeePS(this.emsc, { - closing_fee: new native.Amount(this.emsc, wf.closingFee).toNbo(), - end_date: native.AbsoluteTimeNbo.fromStampSeconds(this.emsc, (wf.endStamp.t_ms / 1000)), - h_wire_method: native.ByteArray.fromStringWithNull( - this.emsc, - type, - ).hash(), - start_date: native.AbsoluteTimeNbo.fromStampSeconds( - this.emsc, - Math.floor(wf.startStamp.t_ms / 1000), - ), - wire_fee: new native.Amount(this.emsc, wf.wireFee).toNbo(), - }); - - const nativeSig = new native.EddsaSignature(this.emsc); - nativeSig.loadCrock(wf.sig); - const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, masterPub); - - return native.eddsaVerify( - native.SignaturePurpose.MASTER_WIRE_FEES, - p.toPurpose(), - nativeSig, - nativePub, - ); + const p = buildSigPS(SignaturePurpose.MASTER_WIRE_FEES) + .put(hash(stringToBytes(type + "\0"))) + .put(timestampToBuffer(wf.startStamp)) + .put(timestampToBuffer(wf.endStamp)) + .put(amountToBuffer(wf.wireFee)) + .build(); + const sig = decodeCrock(wf.sig); + const pub = decodeCrock(masterPub); + return eddsaVerify(p, sig, pub); } /** * Check if the signature of a denomination is valid. */ isValidDenom(denom: DenominationRecord, masterPub: string): boolean { - const p = new native.DenominationKeyValidityPS(this.emsc, { - denom_hash: native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub) - .encode() - .hash(), - expire_legal: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - denom.stampExpireLegal, - ), - expire_spend: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - denom.stampExpireDeposit, - ), - expire_withdraw: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - denom.stampExpireWithdraw, - ), - fee_deposit: new native.Amount(this.emsc, denom.feeDeposit).toNbo(), - fee_refresh: new native.Amount(this.emsc, denom.feeRefresh).toNbo(), - fee_refund: new native.Amount(this.emsc, denom.feeRefund).toNbo(), - fee_withdraw: new native.Amount(this.emsc, denom.feeWithdraw).toNbo(), - master: native.EddsaPublicKey.fromCrock(this.emsc, masterPub), - start: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - denom.stampStart, - ), - value: new native.Amount(this.emsc, denom.value).toNbo(), - }); - - const nativeSig = new native.EddsaSignature(this.emsc); - nativeSig.loadCrock(denom.masterSig); - - const nativePub = native.EddsaPublicKey.fromCrock(this.emsc, masterPub); - - return native.eddsaVerify( - native.SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY, - p.toPurpose(), - nativeSig, - nativePub, - ); + const p = buildSigPS(SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY) + .put(decodeCrock(masterPub)) + .put(timestampToBuffer(denom.stampStart)) + .put(timestampToBuffer(denom.stampExpireWithdraw)) + .put(timestampToBuffer(denom.stampExpireDeposit)) + .put(timestampToBuffer(denom.stampExpireLegal)) + .put(amountToBuffer(denom.value)) + .put(amountToBuffer(denom.feeWithdraw)) + .put(amountToBuffer(denom.feeDeposit)) + .put(amountToBuffer(denom.feeRefresh)) + .put(amountToBuffer(denom.feeRefund)) + .put(decodeCrock(denom.denomPubHash)) + .build(); + const sig = decodeCrock(denom.masterSig); + const pub = decodeCrock(masterPub); + return eddsaVerify(p, sig, pub); } /** * Create a new EdDSA key pair. */ createEddsaKeypair(): { priv: string; pub: string } { - const priv = native.EddsaPrivateKey.create(this.emsc); - const pub = priv.getPublicKey(); - return { priv: priv.toCrock(), pub: pub.toCrock() }; + const pair = createEddsaKeyPair(); + return { + priv: encodeCrock(pair.eddsaPriv), + pub: encodeCrock(pair.eddsaPub), + }; } /** * Unblind a blindly signed value. */ rsaUnblind(sig: string, bk: string, pk: string): string { - const denomSig = native.rsaUnblind( - native.RsaSignature.fromCrock(this.emsc, sig), - native.RsaBlindingKeySecret.fromCrock(this.emsc, bk), - native.RsaPublicKey.fromCrock(this.emsc, pk), + const denomSig = rsaUnblind( + decodeCrock(sig), + decodeCrock(pk), + decodeCrock(bk), ); - return denomSig.encode().toCrock(); + return encodeCrock(denomSig); } /** @@ -315,79 +340,54 @@ export class CryptoImplementation { .amount; const total = Amounts.add(fees, totalAmount).amount; - const amountSpent = native.Amount.getZero( - this.emsc, - cds[0].coin.currentAmount.currency, - ); - const amountRemaining = new native.Amount(this.emsc, total); + let amountSpent = Amounts.getZero(cds[0].coin.currentAmount.currency); + let amountRemaining = total; + for (const cd of cds) { - let coinSpend: native.Amount; const originalCoin = { ...cd.coin }; if (amountRemaining.value === 0 && amountRemaining.fraction === 0) { break; } - if ( - amountRemaining.cmp( - new native.Amount(this.emsc, cd.coin.currentAmount), - ) < 0 - ) { - coinSpend = new native.Amount(this.emsc, amountRemaining.toJson()); + let coinSpend: AmountJson; + if (Amounts.cmp(amountRemaining, cd.coin.currentAmount) < 0) { + coinSpend = amountRemaining; } else { - coinSpend = new native.Amount(this.emsc, cd.coin.currentAmount); + coinSpend = cd.coin.currentAmount; } - amountSpent.add(coinSpend); - amountRemaining.sub(coinSpend); + amountSpent = Amounts.add(amountSpent, coinSpend).amount; - const feeDeposit: native.Amount = new native.Amount( - this.emsc, - cd.denom.feeDeposit, - ); + const feeDeposit = cd.denom.feeDeposit; // Give the merchant at least the deposit fee, otherwise it'll reject // the coin. - if (coinSpend.cmp(feeDeposit) < 0) { + + if (Amounts.cmp(coinSpend, feeDeposit) < 0) { coinSpend = feeDeposit; } - const newAmount = new native.Amount(this.emsc, cd.coin.currentAmount); - newAmount.sub(coinSpend); - cd.coin.currentAmount = newAmount.toJson(); + const newAmount = Amounts.sub(cd.coin.currentAmount, coinSpend).amount; + cd.coin.currentAmount = newAmount; cd.coin.status = CoinStatus.Dirty; - const d = new native.DepositRequestPS(this.emsc, { - amount_with_fee: coinSpend.toNbo(), - coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, cd.coin.coinPub), - deposit_fee: new native.Amount(this.emsc, cd.denom.feeDeposit).toNbo(), - h_contract: native.HashCode.fromCrock(this.emsc, contractTermsHash), - h_wire: native.HashCode.fromCrock(this.emsc, contractTerms.H_wire), - merchant: native.EddsaPublicKey.fromCrock( - this.emsc, - contractTerms.merchant_pub, - ), - refund_deadline: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - contractTerms.refund_deadline, - ), - timestamp: native.AbsoluteTimeNbo.fromTalerString( - this.emsc, - contractTerms.timestamp, - ), - }); - - const coinSig = native - .eddsaSign( - d.toPurpose(), - native.EddsaPrivateKey.fromCrock(this.emsc, cd.coin.coinPriv), - ) - .toCrock(); + const d = buildSigPS(SignaturePurpose.WALLET_COIN_DEPOSIT) + .put(decodeCrock(contractTermsHash)) + .put(decodeCrock(contractTerms.H_wire)) + .put(talerTimestampStringToBuffer(contractTerms.timestamp)) + .put(talerTimestampStringToBuffer(contractTerms.refund_deadline)) + .put(amountToBuffer(coinSpend)) + .put(amountToBuffer(cd.denom.feeDeposit)) + .put(decodeCrock(contractTerms.merchant_pub)) + .put(decodeCrock(cd.coin.coinPub)) + .build(); + const coinSig = eddsaSign(d, decodeCrock(cd.coin.coinPriv)); const s: CoinPaySig = { coin_pub: cd.coin.coinPub, - coin_sig: coinSig, - contribution: Amounts.toString(coinSpend.toJson()), + coin_sig: encodeCrock(coinSig), + contribution: Amounts.toString(coinSpend), denom_pub: cd.coin.denomPub, exchange_url: cd.denom.exchangeBaseUrl, ub_sig: cd.coin.denomSig, @@ -419,7 +419,7 @@ export class CryptoImplementation { // melt fee valueWithFee = Amounts.add(valueWithFee, meltFee).amount; - const sessionHc = new native.HashContext(this.emsc); + const sessionHc = createHashContext(); const transferPubs: string[] = []; const transferPrivs: string[] = []; @@ -427,79 +427,57 @@ export class CryptoImplementation { const preCoinsForGammas: RefreshPreCoinRecord[][] = []; for (let i = 0; i < kappa; i++) { - const t = native.EcdhePrivateKey.create(this.emsc); - const pub = t.getPublicKey(); - sessionHc.read(pub); - transferPrivs.push(t.toCrock()); - transferPubs.push(pub.toCrock()); + const transferKeyPair = createEcdheKeyPair(); + sessionHc.update(transferKeyPair.ecdhePub); + transferPrivs.push(encodeCrock(transferKeyPair.ecdhePriv)); + transferPubs.push(encodeCrock(transferKeyPair.ecdhePub)); } for (const denom of newCoinDenoms) { - const r = native.RsaPublicKey.fromCrock(this.emsc, denom.denomPub); - sessionHc.read(r.encode()); + const r = decodeCrock(denom.denomPub); + sessionHc.update(r); } - sessionHc.read( - native.EddsaPublicKey.fromCrock(this.emsc, meltCoin.coinPub), - ); - sessionHc.read(new native.Amount(this.emsc, valueWithFee).toNbo()); + sessionHc.update(decodeCrock(meltCoin.coinPub)); + sessionHc.update(amountToBuffer(valueWithFee)); for (let i = 0; i < kappa; i++) { const preCoins: RefreshPreCoinRecord[] = []; for (let j = 0; j < newCoinDenoms.length; j++) { - const transferPriv = native.EcdhePrivateKey.fromCrock( - this.emsc, - transferPrivs[i], - ); - const oldCoinPub = native.EddsaPublicKey.fromCrock( - this.emsc, - meltCoin.coinPub, - ); - const transferSecret = native.ecdhEddsa(transferPriv, oldCoinPub); - - const fresh = native.setupFreshCoin(transferSecret, j); - - const coinPriv = fresh.priv; - const coinPub = coinPriv.getPublicKey(); - const blindingFactor = fresh.blindingKey; - const pubHash: native.HashCode = coinPub.hash(); - const denomPub = native.RsaPublicKey.fromCrock( - this.emsc, - newCoinDenoms[j].denomPub, - ); - const ev = native.rsaBlind(pubHash, blindingFactor, denomPub); - if (!ev) { - throw Error("couldn't blind (malicious exchange key?)"); - } + const transferPriv = decodeCrock(transferPrivs[i]); + const oldCoinPub = decodeCrock(meltCoin.coinPub); + const transferSecret = keyExchangeEcdheEddsa(transferPriv, oldCoinPub); + + const fresh = setupRefreshPlanchet(transferSecret, j); + + const coinPriv = fresh.coinPriv; + const coinPub = fresh.coinPub; + const blindingFactor = fresh.bks; + const pubHash = hash(coinPub); + const denomPub = decodeCrock(newCoinDenoms[j].denomPub); + const ev = rsaBlind(pubHash, blindingFactor, denomPub); const preCoin: RefreshPreCoinRecord = { - blindingKey: blindingFactor.toCrock(), - coinEv: ev.toCrock(), - privateKey: coinPriv.toCrock(), - publicKey: coinPub.toCrock(), + blindingKey: encodeCrock(blindingFactor), + coinEv: encodeCrock(ev), + privateKey: encodeCrock(coinPriv), + publicKey: encodeCrock(coinPub), }; preCoins.push(preCoin); - sessionHc.read(ev); + sessionHc.update(ev); } preCoinsForGammas.push(preCoins); } - const sessionHash = new native.HashCode(this.emsc); - sessionHash.alloc(); - sessionHc.finish(sessionHash); + const sessionHash = sessionHc.finish(); - const confirmData = new native.RefreshMeltCoinAffirmationPS(this.emsc, { - amount_with_fee: new native.Amount(this.emsc, valueWithFee).toNbo(), - coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, meltCoin.coinPub), - melt_fee: new native.Amount(this.emsc, meltFee).toNbo(), - session_hash: sessionHash, - }); + const confirmData = buildSigPS(SignaturePurpose.WALLET_COIN_MELT) + .put(sessionHash) + .put(amountToBuffer(valueWithFee)) + .put(amountToBuffer(meltFee)) + .put(decodeCrock(meltCoin.coinPub)) + .build(); - const confirmSig: string = native - .eddsaSign( - confirmData.toPurpose(), - native.EddsaPrivateKey.fromCrock(this.emsc, meltCoin.coinPriv), - ) - .toCrock(); + const confirmSig = eddsaSign(confirmData, decodeCrock(meltCoin.coinPriv)); let valueOutput = Amounts.getZero(newCoinDenoms[0].value.currency); for (const denom of newCoinDenoms) { @@ -510,10 +488,10 @@ export class CryptoImplementation { const refreshSession: RefreshSessionRecord = { refreshSessionId, - confirmSig, + confirmSig: encodeCrock(confirmSig), exchangeBaseUrl, finished: false, - hash: sessionHash.toCrock(), + hash: encodeCrock(sessionHash), meltCoinPub: meltCoin.coinPub, newDenomHashes: newCoinDenoms.map(d => d.denomPubHash), newDenoms: newCoinDenoms.map(d => d.denomPub), @@ -532,18 +510,16 @@ export class CryptoImplementation { * Hash a string including the zero terminator. */ hashString(str: string): string { - const b = native.ByteArray.fromStringWithNull(this.emsc, str); - return b.hash().toCrock(); + const ts = new TextEncoder(); + const b = ts.encode(str + "\0"); + return encodeCrock(hash(b)); } /** * Hash a denomination public key. */ hashDenomPub(denomPub: string): string { - return native.RsaPublicKey.fromCrock(this.emsc, denomPub) - .encode() - .hash() - .toCrock(); + return encodeCrock(hash(decodeCrock(denomPub))); } signCoinLink( @@ -553,20 +529,16 @@ export class CryptoImplementation { transferPub: string, coinEv: string, ): string { - const coinEvHash = native.ByteArray.fromCrock(this.emsc, coinEv).hash(); - - const coinLink = new native.CoinLinkSignaturePS(this.emsc, { - coin_envelope_hash: coinEvHash, - h_denom_pub: native.HashCode.fromCrock(this.emsc, newDenomHash), - old_coin_pub: native.EddsaPublicKey.fromCrock(this.emsc, oldCoinPub), - transfer_pub: native.EcdhePublicKey.fromCrock(this.emsc, transferPub), - }); - - const coinPriv = native.EddsaPrivateKey.fromCrock(this.emsc, oldCoinPriv); - - const sig = native.eddsaSign(coinLink.toPurpose(), coinPriv); - - return sig.toCrock(); + const coinEvHash = hash(decodeCrock(coinEv)); + const coinLink = buildSigPS(SignaturePurpose.WALLET_COIN_LINK) + .put(decodeCrock(newDenomHash)) + .put(decodeCrock(oldCoinPub)) + .put(decodeCrock(transferPub)) + .put(coinEvHash) + .build(); + const coinPriv = decodeCrock(oldCoinPriv); + const sig = eddsaSign(coinLink, coinPriv); + return encodeCrock(sig); } benchmark(repetitions: number): BenchmarkResult { @@ -578,165 +550,40 @@ export class CryptoImplementation { } let time_hash_big = 0; - const ba = new native.ByteArray(this.emsc, 4096); for (let i = 0; i < repetitions; i++) { - ba.randomize(native.RandomQuality.WEAK); + const ba = randomBytes(4096); const start = timer.performanceNow(); - ba.hash(); + hash(ba); time_hash_big += timer.performanceNow() - start; } let time_eddsa_create = 0; for (let i = 0; i < repetitions; i++) { const start = timer.performanceNow(); - const priv: native.EddsaPrivateKey = native.EddsaPrivateKey.create( - this.emsc, - ); + const pair = createEddsaKeyPair(); time_eddsa_create += timer.performanceNow() - start; - priv.destroy(); } let time_eddsa_sign = 0; - const eddsaPriv: native.EddsaPrivateKey = native.EddsaPrivateKey.create( - this.emsc, - ); - const eddsaPub: native.EddsaPublicKey = eddsaPriv.getPublicKey(); - const h: native.HashCode = new native.HashCode(this.emsc); - h.alloc(); - h.random(native.RandomQuality.WEAK); + const p = randomBytes(4096); - const ps = new native.PaymentSignaturePS(this.emsc, { - contract_hash: h, - }); - - const p = ps.toPurpose(); + const pair = createEddsaKeyPair(); for (let i = 0; i < repetitions; i++) { const start = timer.performanceNow(); - native.eddsaSign(p, eddsaPriv); + eddsaSign(p, pair.eddsaPriv); time_eddsa_sign += timer.performanceNow() - start; } - const eddsaSig = native.eddsaSign(p, eddsaPriv); - - let time_ecdsa_create = 0; - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - const priv: native.EcdsaPrivateKey = native.EcdsaPrivateKey.create( - this.emsc, - ); - time_ecdsa_create += timer.performanceNow() - start; - priv.destroy(); - } + const sig = eddsaSign(p, pair.eddsaPriv); let time_eddsa_verify = 0; for (let i = 0; i < repetitions; i++) { const start = timer.performanceNow(); - native.eddsaVerify( - native.SignaturePurpose.MERCHANT_PAYMENT_OK, - p, - eddsaSig, - eddsaPub, - ); + eddsaVerify(p, sig, pair.eddsaPub); time_eddsa_verify += timer.performanceNow() - start; } - /* rsa 2048 */ - - let time_rsa_2048_blind = 0; - const rsaPriv2048: native.RsaPrivateKey = native.RsaPrivateKey.create( - this.emsc, - 2048, - ); - const rsaPub2048 = rsaPriv2048.getPublicKey(); - const blindingSecret2048 = native.RsaBlindingKeySecret.create(this.emsc); - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaBlind(h, blindingSecret2048, rsaPub2048); - time_rsa_2048_blind += timer.performanceNow() - start; - } - - const blindedMessage2048 = native.rsaBlind( - h, - blindingSecret2048, - rsaPub2048, - ); - if (!blindedMessage2048) { - throw Error("should not happen"); - } - const rsaBlindSig2048 = native.rsaSignBlinded( - rsaPriv2048, - blindedMessage2048, - ); - - let time_rsa_2048_unblind = 0; - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaUnblind(rsaBlindSig2048, blindingSecret2048, rsaPub2048); - time_rsa_2048_unblind += timer.performanceNow() - start; - } - - const unblindedSig2048 = native.rsaUnblind( - rsaBlindSig2048, - blindingSecret2048, - rsaPub2048, - ); - - let time_rsa_2048_verify = 0; - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaVerify(h, unblindedSig2048, rsaPub2048); - time_rsa_2048_verify += timer.performanceNow() - start; - } - - /* rsa 4096 */ - - let time_rsa_4096_blind = 0; - const rsaPriv4096: native.RsaPrivateKey = native.RsaPrivateKey.create( - this.emsc, - 4096, - ); - const rsaPub4096 = rsaPriv4096.getPublicKey(); - const blindingSecret4096 = native.RsaBlindingKeySecret.create(this.emsc); - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaBlind(h, blindingSecret4096, rsaPub4096); - time_rsa_4096_blind += timer.performanceNow() - start; - } - - const blindedMessage4096 = native.rsaBlind( - h, - blindingSecret4096, - rsaPub4096, - ); - if (!blindedMessage4096) { - throw Error("should not happen"); - } - const rsaBlindSig4096 = native.rsaSignBlinded( - rsaPriv4096, - blindedMessage4096, - ); - - let time_rsa_4096_unblind = 0; - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaUnblind(rsaBlindSig4096, blindingSecret4096, rsaPub4096); - time_rsa_4096_unblind += timer.performanceNow() - start; - } - - const unblindedSig4096 = native.rsaUnblind( - rsaBlindSig4096, - blindingSecret4096, - rsaPub4096, - ); - - let time_rsa_4096_verify = 0; - for (let i = 0; i < repetitions; i++) { - const start = timer.performanceNow(); - native.rsaVerify(h, unblindedSig4096, rsaPub4096); - time_rsa_4096_verify += timer.performanceNow() - start; - } - return { repetitions, time: { @@ -745,13 +592,6 @@ export class CryptoImplementation { eddsa_create: time_eddsa_create, eddsa_sign: time_eddsa_sign, eddsa_verify: time_eddsa_verify, - ecdsa_create: time_ecdsa_create, - rsa_2048_blind: time_rsa_2048_blind, - rsa_2048_unblind: time_rsa_2048_unblind, - rsa_2048_verify: time_rsa_2048_verify, - rsa_4096_blind: time_rsa_4096_blind, - rsa_4096_unblind: time_rsa_4096_unblind, - rsa_4096_verify: time_rsa_4096_verify, }, }; } diff --git a/src/crypto/emscInterface-test.ts b/src/crypto/emscInterface-test.ts deleted file mode 100644 index 30b9c2b51..000000000 --- a/src/crypto/emscInterface-test.ts +++ /dev/null @@ -1,176 +0,0 @@ -/* - This file is part of TALER - (C) 2017 Inria and GNUnet e.V. - - TALER is free software; you can redistribute it and/or modify it under the - terms of the GNU General Public License as published by the Free Software - Foundation; either version 3, or (at your option) any later version. - - TALER is distributed in the hope that it will be useful, but WITHOUT ANY - WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR - A PARTICULAR PURPOSE. See the GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along with - TALER; see the file COPYING. If not, see - */ - -// tslint:disable:max-line-length - -import test from "ava"; -import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader"; -import * as native from "./emscInterface"; - -import { encodeCrock, decodeCrock } from "./talerCrypto"; -import { timestampCheck } from "../helpers"; - - -test("string hashing", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const x = native.ByteArray.fromStringWithNull(emsc, "hello taler"); - const h = "8RDMADB3YNF3QZBS3V467YZVJAMC2QAQX0TZGVZ6Q5PFRRAJFT70HHN0QF661QR9QWKYMMC7YEMPD679D2RADXCYK8Y669A2A5MKQFR"; - const hc = x.hash().toCrock(); - console.log(`# hc ${hc}`); - t.true(h === hc, "must equal"); - - const te = new TextEncoder(); - - const x2 = te.encode("hello taler\0"); - - t.pass(); -}); - - -test("signing", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const x = native.ByteArray.fromStringWithNull(emsc, "hello taler"); - const priv = native.EddsaPrivateKey.create(emsc); - const pub = priv.getPublicKey(); - const purpose = new native.EccSignaturePurpose(emsc, native.SignaturePurpose.TEST, x); - - const purposeDataCrock = purpose.toCrock(); - const privCrock = priv.toCrock(); - const pubCrock = pub.toCrock(); - const sig = native.eddsaSign(purpose, priv); - console.time("a"); - for (let i = 0; i < 5000; i++) { - const sig = native.eddsaSign(purpose, priv); - } - console.timeEnd("a"); - t.true(native.eddsaVerify(native.SignaturePurpose.TEST, purpose, sig, pub)); - - const d2 = new Uint8Array(decodeCrock(purposeDataCrock)); - console.log("sig1:", sig.toCrock()); - - t.pass(); -}); - - -test("signing-fixed-data", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const x = native.ByteArray.fromStringWithNull(emsc, "hello taler"); - const purpose = new native.EccSignaturePurpose(emsc, native.SignaturePurpose.TEST, x); - const privStr = "G9R8KRRCAFKPD0KW7PW48CC2T03VQ8K2AN9J6J6K2YW27J5MHN90"; - const pubStr = "YHCZB442FQFJ0ET20MWA8YJ53M61EZGJ6QKV1KTJZMRNXDY45WT0"; - const sigStr = "7V6XY4QGC1406GPMT305MZQ1HDCR7R0S5BP02GTGDQFPSXB6YD2YDN5ZS7NJQCNP61Y39MRHXNXQ1Z15JY4CJY4CPDA6CKQ3313WG38"; - const priv = native.EddsaPrivateKey.fromCrock(emsc, privStr); - t.true(privStr === priv.toCrock()); - const pub = priv.getPublicKey(); - t.true(pubStr === pub.toCrock()); - const sig = native.EddsaSignature.fromCrock(emsc, sigStr); - t.true(sigStr === sig.toCrock()); - const sig2 = native.eddsaSign(purpose, priv); - t.true(sig.toCrock() === sig2.toCrock()); - t.true(native.eddsaVerify(native.SignaturePurpose.TEST, purpose, sig, pub)); - t.pass(); -}); - - -const denomPubStr1 = "51R7ARKCD5HJTTV5F4G0M818E9SP280A40G2GVH04CR30G9R64VK6HHS6MW42DSN8MVKJGHK6WR3CGT18MWMCDSM75138E1K8S0MADSQ68W34DHH6MW4CHA270W4CG9J6GW48DHG8MVK4E9S7523GEA56H0K4E1Q891KCCSG752KGC1M88VMCDSQ6D23CHHG8H33AGHG6MSK8GT26CRKAC1M64V3JCJ56CVKCC228MWMCHA26MS30H1J8MVKEDHJ70TMADHK892KJC1H60TKJDHM710KGGT584T38H9K851KCDHG60W30HJ28CT4CC1G8CR3JGJ28H236DJ28H330H9S890M2D9S8S14AGA369344GA36S248CHS70RKEDSS6MWKGDJ26D136GT465348CSS8S232CHM6GS34C9N8CS3GD9H60W36H1R8MSK2GSQ8MSM6C9R70SKCHHN6MW3ACJ28N0K2CA58RS3GCA26MV42G9P891KAG9Q8N0KGD9M850KEHJ16S130CA27124AE1G852KJCHR6S1KGDSJ8RTKED1S8RR3CCHP68W4CH9Q6GT34GT18GS36EA46N24AGSP6933GCHM60VMAE1S8GV3EHHN74W3GC1J651KEH9N8MSK0CSG6S2KEEA460R32C1M8D144GSR6RWKEC218S0KEGJ4611KEEA36CSKJC2564TM4CSJ6H230E1N74TM8C1P61342CSG60WKCGHH64VK2G9S8CRKAHHK88W30HJ388R3CH1Q6X2K2DHK8GSM4D1Q74WM4HA461146H9S6D33JDJ26D234C9Q6923ECSS60RM6CT46CSKCH1M6S13EH9J8S33GCSN4CMGM81051JJ08SG64R30C1H4CMGM81054520A8A00"; - - -test("rsa-encode", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const pubHashStr = "JM63YM5X7X547164QJ3MGJZ4WDD47GEQR5DW5SH35G4JFZXEJBHE5JBNZM5K8XN5C4BRW25BE6GSVAYBF790G2BZZ13VW91D41S4DS0"; - const denomPub = native.RsaPublicKey.fromCrock(emsc, denomPubStr1); - const pubHash = denomPub.encode().hash(); - t.true(pubHashStr === pubHash.toCrock()); - t.pass(); -}); - - -test("withdraw-request", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const reservePrivStr = "G9R8KRRCAFKPD0KW7PW48CC2T03VQ8K2AN9J6J6K2YW27J5MHN90"; - const reservePriv = native.EddsaPrivateKey.fromCrock(emsc, reservePrivStr); - const reservePub = reservePriv.getPublicKey(); - const amountWithFee = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 10000}); - amountWithFee.add(new native.Amount(emsc, {currency: "KUDOS", value: 0, fraction: 20000})); - const withdrawFee = new native.Amount(emsc, {currency: "KUDOS", value: 0, fraction: 20000}); - const denomPub = native.RsaPublicKey.fromCrock(emsc, denomPubStr1); - const ev = native.ByteArray.fromStringWithNull(emsc, "hello, world"); - - // Signature - const withdrawRequest = new native.WithdrawRequestPS(emsc, { - amount_with_fee: amountWithFee.toNbo(), - h_coin_envelope: ev.hash(), - h_denomination_pub: denomPub.encode().hash(), - reserve_pub: reservePub, - withdraw_fee: withdrawFee.toNbo(), - }); - - const sigStr = "AD3T8W44NV193J19RAN3NAJHPP6RVB0R3NWV7ZK5G8Q946YDK0B6F8YJBNRRBXSPVTKY31S7BVZPJFFTJJRMY61DH51X4JSXK677428"; - - const sig = native.eddsaSign(withdrawRequest.toPurpose(), reservePriv); - t.true(native.eddsaVerify(native.SignaturePurpose.RESERVE_WITHDRAW, withdrawRequest.toPurpose(), sig, reservePub)); - t.true(sig.toCrock() === sigStr); - t.pass(); -}); - - -test("currency-conversion", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const a1 = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 50000000}); - const a2 = new native.Amount(emsc, {currency: "KUDOS", value: 1, fraction: 50000000}); - a1.add(a2); - const x = a1.toJson(); - t.true(x.currency === "KUDOS"); - t.true(x.fraction === 0); - t.true(x.value === 3); - t.pass(); -}); - - -test("ecdsa", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const priv = native.EcdsaPrivateKey.create(emsc); - const pub1 = priv.getPublicKey(); - t.truthy(priv); - t.truthy(pub1); - t.pass(); -}); - - -test("ecdhe", async (t) => { - const loader = new NodeEmscriptenLoader(); - const emsc = await loader.getEmscriptenEnvironment(); - - const priv = native.EcdhePrivateKey.create(emsc); - const pub = priv.getPublicKey(); - t.truthy(priv); - t.truthy(pub); - t.pass(); -}); diff --git a/src/crypto/emscInterface.ts b/src/crypto/emscInterface.ts deleted file mode 100644 index da5442a61..000000000 --- a/src/crypto/emscInterface.ts +++ /dev/null @@ -1,1657 +0,0 @@ -/* - This file is part of TALER - (C) 2015 GNUnet e.V. - - TALER is free software; you can redistribute it and/or modify it under the - terms of the GNU General Public License as published by the Free Software - Foundation; either version 3, or (at your option) any later version. - - TALER is distributed in the hope that it will be useful, but WITHOUT ANY - WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR - A PARTICULAR PURPOSE. See the GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along with - TALER; see the file COPYING. If not, see - */ - - -/** - * Medium-level interface to emscripten-compiled modules used - * by the wallet. Handles memory management by allocating by allocating - * objects in arenas that then can be disposed of all at once. - * - * The high-level interface (using WebWorkers) is exposed in src/cryptoApi.ts. - */ - -/** - * Imports. - */ -import { AmountJson } from "../amounts"; - -/** - * Size of a native pointer. Must match the size - * use when compiling via emscripten. - */ -const PTR_SIZE = 4; - -const GNUNET_OK = 1; - - -/** - * Signature of the function that retrieves emscripten - * function implementations. - */ -export interface EmscFunGen { - (name: string, - ret: string, - args: string[]): ((...x: Array) => any); - (name: string, - ret: "number", - args: string[]): ((...x: Array) => number); - (name: string, - ret: "void", - args: string[]): ((...x: Array) => void); - (name: string, - ret: "string", - args: string[]): ((...x: Array) => string); -} - - -interface EmscLib { - cwrap: EmscFunGen; - - ccall(name: string, ret: "number"|"string", argTypes: any[], args: any[]): any; - - stringToUTF8(s: string, addr: number, maxLength: number): void; - - onRuntimeInitialized(f: () => void): void; - - readBinary?: (filename: string) => Promise; - - calledRun?: boolean; - - _free(ptr: number): void; - - _malloc(n: number): number; - - UTF8ToString(p: number, len?: number): string; - - getValue(ptr: number, type: string, noSafe?: boolean): number; - - setValue(ptr: number, value: number, type: string, noSafe?: boolean): void; - - writeStringToMemory(s: string, buffer: number, dontAddNull?: boolean): void; -} - -interface EmscFunctions { - amount_add(a1: number, a2: number, a3: number): number; - amount_cmp(a1: number, a2: number): number; - amount_get_zero(a1: string, a2: number): number; - amount_hton(a1: number, a2: number): void; - amount_normalize(a1: number): void; - amount_ntoh(a1: number, a2: number): void; - amount_subtract(a1: number, a2: number, a3: number): number; - ecdh_eddsa(a1: number, a2: number, a3: number): number; - eddsa_sign(a1: number, a2: number, a3: number): number; - eddsa_verify(a1: number, a2: number, a3: number, a4: number): number; - free(ptr: number): void; - get_currency(a: number): string; - get_fraction(a: number): number; - get_value(a: number): number; - hash(a1: number, a2: number, a3: number): void; - hash_context_abort(ctx: number): void; - hash_context_finish(a1: number, a2: number): void; - hash_context_read(a1: number, a2: number, a3: number): void; - hash_create_random(a1: number, a2: number): void; - memmove(a1: number, a2: number, a3: number): number; - random_block(a1: number, a2: number, a3: number): void; - rsa_blinding_key_free(a1: number): void; - rsa_public_key_free(a1: number): void; - rsa_private_key_free(a1: number): void; - rsa_signature_free(a1: number): void; - rsa_verify(msgHash: number, sig: number, pubKey: number): number; - setup_fresh_coin(a1: number, a2: number, a3: number): void; - string_to_data(a1: number, a2: number, a3: number, a4: number): number; -} - -interface EmscAllocFunctions { - data_to_string_alloc(a1: number, a2: number): number; - ecdhe_key_create(): number; - ecdhe_public_key_from_private(a1: number): number; - ecdsa_key_create(): number; - ecdsa_public_key_from_private(a1: number): number; - eddsa_key_create(): number; - eddsa_public_key_from_private(a1: number): number; - /** - * Note that value_1 and value_2 are the first 64-bit parameter, - * and not two separate parameters (by the emscripten calling convention). - */ - get_amount(value_1: number, value_2: number, fraction: number, currency: string): number; - hash_context_start(): number; - malloc(size: number): number; - purpose_create(a1: number, a2: number, a3: number): number; - rsa_blind(a1: number, a2: number, a3: number, a4: number, a5: number): number; - rsa_blinding_key_create(a1: number): number; - rsa_blinding_key_decode(a1: number, a2: number): number; - rsa_blinding_key_encode(a1: number, a2: number): number; - rsa_private_key_create(len: number): number; - rsa_private_key_decode(a1: number, a2: number): number; - rsa_private_key_encode(a1: number, a2: number): number; - rsa_private_key_get_public(privKeyPtr: number): number; - rsa_public_key_decode(a1: number, a2: number): number; - rsa_public_key_encode(a1: number, a2: number): number; - rsa_signature_decode(a1: number, a2: number): number; - rsa_signature_encode(a1: number, a2: number): number; - rsa_sign_blinded(keyPtr: number, msgPtr: number, msgLen: number): number; - rsa_unblind(a1: number, a2: number, a3: number): number; -} - -export class EmscEnvironment { - - /** - * Emscripten functions that don't do any memory allocations. - */ - public funcs: EmscFunctions; - - /** - * Emscripten functions that allocate memory. - */ - public allocFuncs: EmscAllocFunctions; - - public lib: EmscLib; - - constructor(lib: EmscLib) { - const getEmsc: EmscFunGen = (name: string, ret: any, argTypes: any[]) => { - return (...args: any[]) => { - return lib.ccall(name, ret, argTypes, args); - }; - }; - this.lib = lib; - this.allocFuncs = { - data_to_string_alloc: getEmsc("GNUNET_STRINGS_data_to_string_alloc", "number", ["number", "number"]), - ecdhe_key_create: getEmsc("GNUNET_CRYPTO_ecdhe_key_create", "number", []), - ecdhe_public_key_from_private: getEmsc( "TALER_WRALL_ecdhe_public_key_from_private", "number", ["number"]), - ecdsa_key_create: getEmsc("GNUNET_CRYPTO_ecdsa_key_create", "number", []), - ecdsa_public_key_from_private: getEmsc( "TALER_WRALL_ecdsa_public_key_from_private", "number", ["number"]), - eddsa_key_create: getEmsc("GNUNET_CRYPTO_eddsa_key_create", "number", []), - eddsa_public_key_from_private: getEmsc( "TALER_WRALL_eddsa_public_key_from_private", "number", ["number"]), - get_amount: getEmsc("TALER_WRALL_get_amount", "number", ["number", "number", "number", "string"]), - hash_context_start: getEmsc("GNUNET_CRYPTO_hash_context_start", "number", []), - malloc: (size: number) => lib._malloc(size), - purpose_create: getEmsc("TALER_WRALL_purpose_create", "number", ["number", "number", "number"]), - rsa_blind: getEmsc("GNUNET_CRYPTO_rsa_blind", "number", ["number", "number", "number", "number", "number"]), - rsa_blinding_key_create: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_create", "number", ["number"]), - rsa_blinding_key_decode: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_decode", "number", ["number", "number"]), - rsa_blinding_key_encode: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_encode", "number", ["number", "number"]), - rsa_private_key_create: getEmsc("GNUNET_CRYPTO_rsa_private_key_create", "number", ["number"]), - rsa_private_key_decode: getEmsc("GNUNET_CRYPTO_rsa_private_key_decode", "number", ["number", "number"]), - rsa_private_key_encode: getEmsc("GNUNET_CRYPTO_rsa_private_key_encode", "number", ["number", "number"]), - rsa_private_key_get_public: getEmsc("GNUNET_CRYPTO_rsa_private_key_get_public", "number", ["number"]), - rsa_public_key_decode: getEmsc("GNUNET_CRYPTO_rsa_public_key_decode", "number", ["number", "number"]), - rsa_public_key_encode: getEmsc("GNUNET_CRYPTO_rsa_public_key_encode", "number", ["number", "number"]), - rsa_signature_decode: getEmsc("GNUNET_CRYPTO_rsa_signature_decode", "number", ["number", "number"]), - rsa_signature_encode: getEmsc("GNUNET_CRYPTO_rsa_signature_encode", "number", ["number", "number"]), - rsa_sign_blinded: getEmsc("GNUNET_CRYPTO_rsa_sign_blinded", "number", ["number", "number", "number"]), - rsa_unblind: getEmsc("GNUNET_CRYPTO_rsa_unblind", "number", ["number", "number", "number"]), - }; - this.funcs = { - amount_add: getEmsc("TALER_amount_add", "number", ["number", "number", "number"]), - amount_cmp: getEmsc("TALER_amount_cmp", "number", ["number", "number"]), - amount_get_zero: getEmsc("TALER_amount_get_zero", "number", ["string", "number"]), - amount_hton: getEmsc("TALER_amount_hton", "void", ["number", "number"]), - amount_normalize: getEmsc("TALER_amount_normalize", "void", ["number"]), - amount_ntoh: getEmsc("TALER_amount_ntoh", "void", ["number", "number"]), - amount_subtract: getEmsc("TALER_amount_subtract", "number", ["number", "number", "number"]), - ecdh_eddsa: getEmsc("GNUNET_CRYPTO_ecdh_eddsa", "number", ["number", "number", "number"]), - eddsa_sign: getEmsc("GNUNET_CRYPTO_eddsa_sign", "number", ["number", "number", "number"]), - eddsa_verify: getEmsc("GNUNET_CRYPTO_eddsa_verify", "number", ["number", "number", "number", "number"]), - free: (ptr: number) => lib._free(ptr), - get_currency: getEmsc("TALER_WR_get_currency", "string", ["number"]), - get_fraction: getEmsc("TALER_WR_get_fraction", "number", ["number"]), - get_value: getEmsc("TALER_WR_get_value", "number", ["number"]), - hash: getEmsc("GNUNET_CRYPTO_hash", "void", ["number", "number", "number"]), - hash_context_abort: getEmsc("GNUNET_CRYPTO_hash_context_abort", "void", ["number"]), - hash_context_finish: getEmsc("GNUNET_CRYPTO_hash_context_finish", "void", ["number", "number"]), - hash_context_read: getEmsc("GNUNET_CRYPTO_hash_context_read", "void", ["number", "number", "number"]), - hash_create_random: getEmsc("GNUNET_CRYPTO_hash_create_random", "void", ["number", "number"]), - memmove: getEmsc("memmove", "number", ["number", "number", "number"]), - random_block: getEmsc("GNUNET_CRYPTO_random_block", "void", ["number", "number", "number"]), - rsa_blinding_key_free: getEmsc("GNUNET_CRYPTO_rsa_blinding_key_free", "void", ["number"]), - rsa_public_key_free: getEmsc("GNUNET_CRYPTO_rsa_public_key_free", "void", ["number"]), - rsa_private_key_free: getEmsc("GNUNET_CRYPTO_rsa_private_key_free", "void", ["number"]), - rsa_signature_free: getEmsc("GNUNET_CRYPTO_rsa_signature_free", "void", ["number"]), - rsa_verify: getEmsc("GNUNET_CRYPTO_rsa_verify", "number", ["number", "number", "number"]), - setup_fresh_coin: getEmsc("TALER_setup_fresh_coin", "void", ["number", "number", "number"]), - string_to_data: getEmsc("GNUNET_STRINGS_string_to_data", "number", ["number", "number", "number", "number"]), - }; - } -} - - -/** - * Constants for signatures purposes, define what the signatures vouches for. - */ -export enum SignaturePurpose { - RESERVE_WITHDRAW = 1200, - WALLET_COIN_DEPOSIT = 1201, - MASTER_DENOMINATION_KEY_VALIDITY = 1025, - WALLET_COIN_MELT = 1202, - TEST = 4242, - MERCHANT_PAYMENT_OK = 1104, - MASTER_WIRE_FEES = 1028, - WALLET_COIN_PAYBACK = 1203, - WALLET_COIN_LINK = 1204, -} - - -/** - * Desired quality levels for random numbers. - */ -export enum RandomQuality { - WEAK = 0, - STRONG = 1, - NONCE = 2, -} - - -/** - * Object that is allocated in some arena. - */ -interface ArenaObject { - destroy(): void; -} - - -/** - * Context for cummulative hashing. - */ -export class HashContext implements ArenaObject { - private hashContextPtr: number | undefined; - - constructor(private emsc: EmscEnvironment) { - this.hashContextPtr = emsc.allocFuncs.hash_context_start(); - } - - /** - * Add data to be hashed. - */ - read(obj: PackedArenaObject): void { - if (!this.hashContextPtr) { - throw Error("assertion failed"); - } - this.emsc.funcs.hash_context_read(this.hashContextPtr, obj.nativePtr, obj.size()); - } - - /** - * Finish the hash computation. - */ - finish(h: HashCode) { - if (!this.hashContextPtr) { - throw Error("assertion failed"); - } - h.alloc(); - this.emsc.funcs.hash_context_finish(this.hashContextPtr, h.nativePtr); - } - - /** - * Abort hashing without computing the result. - */ - destroy(): void { - if (this.hashContextPtr) { - this.emsc.funcs.hash_context_abort(this.hashContextPtr); - } - this.hashContextPtr = undefined; - } -} - - -/** - * Arena object that points to an allocated block of memory. - */ -abstract class MallocArenaObject implements ArenaObject { - protected _nativePtr: number | undefined = undefined; - - /** - * Is this a weak reference to the underlying memory? - */ - isWeak = false; - - destroy(): void { - if (this._nativePtr && !this.isWeak) { - this.emsc.funcs.free(this.nativePtr); - this._nativePtr = undefined; - } - } - - constructor(public emsc: EmscEnvironment, arena?: Arena) { - if (!arena) { - if (arenaStack.length === 0) { - throw Error("No arena available"); - } - arena = arenaStack[arenaStack.length - 1]; - } - arena.put(this); - } - - alloc(size: number) { - if (this._nativePtr !== undefined) { - throw Error("Double allocation"); - } - this.nativePtr = this.emsc.allocFuncs.malloc(size); - } - - set nativePtr(v: number) { - if (v === undefined) { - throw Error("Native pointer must be a number or null"); - } - this._nativePtr = v; - } - - get nativePtr() { - // We want to allow latent allocation - // of native wrappers, but we never want to - // pass 'undefined' to emscripten. - if (this._nativePtr === undefined) { - throw Error("Native pointer not initialized"); - } - return this._nativePtr; - } -} - - -/** - * An arena stores objects that will be deallocated - * at the same time. - */ -interface Arena { - put(obj: ArenaObject): void; - destroy(): void; -} - - -/** - * Arena that must be manually destroyed. - */ -class SimpleArena implements Arena { - protected heap: ArenaObject[]; - - constructor() { - this.heap = []; - } - - put(obj: ArenaObject) { - this.heap.push(obj); - } - - destroy() { - for (const obj of this.heap) { - obj.destroy(); - } - this.heap = []; - } -} - - -/** - * Arena that destroys all its objects once control has returned to the message - * loop. - */ -class SyncArena extends SimpleArena { - private isScheduled: boolean; - - constructor() { - super(); - } - - pub(obj: MallocArenaObject) { - super.put(obj); - if (!this.isScheduled) { - this.schedule(); - } - this.heap.push(obj); - } - - private schedule() { - this.isScheduled = true; - Promise.resolve().then(() => { - this.isScheduled = false; - this.destroy(); - }); - } -} - -export const arenaStack: Arena[] = []; -arenaStack.push(new SyncArena()); - - -/** - * Representation of monetary value in a given currency. - */ -export class Amount extends MallocArenaObject { - constructor(emsc: EmscEnvironment, args?: AmountJson, arena?: Arena) { - super(emsc, arena); - if (args) { - this.nativePtr = emsc.allocFuncs.get_amount(args.value, - 0, - args.fraction, - args.currency); - } else { - this.nativePtr = emsc.allocFuncs.get_amount(0, 0, 0, ""); - } - } - - static getZero(emsc: EmscEnvironment, currency: string, a?: Arena): Amount { - const am = new Amount(emsc, undefined, a); - const r = emsc.funcs.amount_get_zero(currency, am.nativePtr); - if (r !== GNUNET_OK) { - throw Error("invalid currency"); - } - return am; - } - - - toNbo(a?: Arena): AmountNbo { - const x = new AmountNbo(this.emsc, a); - x.alloc(); - this.emsc.funcs.amount_hton(x.nativePtr, this.nativePtr); - return x; - } - - fromNbo(nbo: AmountNbo): void { - this.emsc.funcs.amount_ntoh(this.nativePtr, nbo.nativePtr); - } - - get value() { - return this.emsc.funcs.get_value(this.nativePtr); - } - - get fraction() { - return this.emsc.funcs.get_fraction(this.nativePtr); - } - - get currency(): string { - return this.emsc.funcs.get_currency(this.nativePtr); - } - - toJson(): AmountJson { - return { - currency: this.emsc.funcs.get_currency(this.nativePtr), - fraction: this.emsc.funcs.get_fraction(this.nativePtr), - value: this.emsc.funcs.get_value(this.nativePtr), - }; - } - - /** - * Add an amount to this amount. - */ - add(a: Amount) { - const res = this.emsc.funcs.amount_add(this.nativePtr, a.nativePtr, this.nativePtr); - if (res < 1) { - // Overflow - return false; - } - return true; - } - - /** - * Perform saturating subtraction on amounts. - */ - sub(a: Amount) { - // this = this - a - const res = this.emsc.funcs.amount_subtract(this.nativePtr, this.nativePtr, a.nativePtr); - if (res === 0) { - // Underflow - return false; - } - if (res > 0) { - return true; - } - throw Error("Incompatible currencies"); - } - - cmp(a: Amount) { - // If we don't check this, the c code aborts. - if (this.currency !== a.currency) { - throw Error(`incomparable currencies (${this.currency} and ${a.currency})`); - } - return this.emsc.funcs.amount_cmp(this.nativePtr, a.nativePtr); - } - - normalize() { - this.emsc.funcs.amount_normalize(this.nativePtr); - } -} - - -/** - * Count the UTF-8 characters in a JavaScript string. - */ -function countUtf8Bytes(str: string): number { - let s = str.length; - // JavaScript strings are UTF-16 arrays - for (let i = str.length - 1; i >= 0; i--) { - const code = str.charCodeAt(i); - if (code > 0x7f && code <= 0x7ff) { - // We need an extra byte in utf-8 here - s++; - } else if (code > 0x7ff && code <= 0xffff) { - // We need two extra bytes in utf-8 here - s += 2; - } - // Skip over the other surrogate - if (code >= 0xDC00 && code <= 0xDFFF) { - i--; - } - } - return s; -} - - -/** - * Managed reference to a contiguous block of memory in the Emscripten heap. - * Can be converted from / to a serialized representation. - * Should contain only data, not pointers. - */ -abstract class PackedArenaObject extends MallocArenaObject { - abstract size(): number; - - constructor(emsc: EmscEnvironment, a?: Arena) { - super(emsc, a); - } - - randomize(qual: RandomQuality = RandomQuality.STRONG): void { - this.emsc.funcs.random_block(qual, this.nativePtr, this.size()); - } - - toCrock(): string { - const d = this.emsc.allocFuncs.data_to_string_alloc(this.nativePtr, this.size()); - const s = this.emsc.lib.UTF8ToString(d); - this.emsc.funcs.free(d); - return s; - } - - toJson(): any { - // Per default, the json encoding of - // packed arena objects is just the crockford encoding. - // Subclasses typically want to override this. - return this.toCrock(); - } - - loadCrock(s: string) { - this.alloc(); - // We need to get the javascript string - // to the emscripten heap first. - const buf = ByteArray.fromStringWithNull(this.emsc, s); - const res = this.emsc.funcs.string_to_data(buf.nativePtr, - s.length, - this.nativePtr, - this.size()); - buf.destroy(); - if (res < 1) { - throw {error: "wrong encoding"}; - } - } - - alloc() { - // FIXME: should the client be allowed to call alloc multiple times? - if (!this._nativePtr) { - this.nativePtr = this.emsc.allocFuncs.malloc(this.size()); - } - } - - hash(): HashCode { - const x = new HashCode(this.emsc); - x.alloc(); - this.emsc.funcs.hash(this.nativePtr, this.size(), x.nativePtr); - return x; - } - - hexdump() { - const bytes: string[] = []; - for (let i = 0; i < this.size(); i++) { - let b = this.emsc.lib.getValue(this.nativePtr + i, "i8"); - b = (b + 256) % 256; - bytes.push("0".concat(b.toString(16)).slice(-2)); - } - const lines: string[] = []; - for (let i = 0; i < bytes.length; i += 8) { - lines.push(bytes.slice(i, i + 8).join(",")); - } - return lines.join("\n"); - } -} - - -/** - * Amount, encoded for network transmission. - */ -export class AmountNbo extends PackedArenaObject { - size() { - return 24; - } - - toJson(): any { - const a = new SimpleArena(); - const am = new Amount(this.emsc, undefined, a); - am.fromNbo(this); - const json = am.toJson(); - a.destroy(); - return json; - } -} - - -/** - * Create a packed arena object from the base32 crockford encoding. - */ -function fromCrock(emsc: EmscEnvironment, s: string, ctor: Ctor): T { - const x: T = new ctor(emsc); - x.alloc(); - x.loadCrock(s); - return x; -} - - -/** - * Create a packed arena object from the base32 crockford encoding for objects - * that have a special decoding function. - */ -function fromCrockDecoded(emsc: EmscEnvironment, s: string, - ctor: Ctor, - decodeFn: (p: number, s: number) => number): T { - const obj = new ctor(emsc); - const buf = ByteArray.fromCrock(emsc, s); - obj.nativePtr = decodeFn(buf.nativePtr, buf.size()); - buf.destroy(); - return obj; -} - - -/** - * Encode an object using a special encoding function. - */ -function encode(obj: T, encodeFn: any, arena?: Arena): ByteArray { - const ptr = obj.emsc.allocFuncs.malloc(PTR_SIZE); - const len = encodeFn(obj.nativePtr, ptr); - const res = new ByteArray(obj.emsc, len, undefined, arena); - res.nativePtr = obj.emsc.lib.getValue(ptr, "*"); - obj.emsc.funcs.free(ptr); - return res; -} - - -/** - * Private EdDSA key. - */ -export class EddsaPrivateKey extends PackedArenaObject { - static create(emsc: EmscEnvironment, a?: Arena): EddsaPrivateKey { - const obj = new EddsaPrivateKey(emsc, a); - obj.nativePtr = emsc.allocFuncs.eddsa_key_create(); - return obj; - } - - size() { - return 32; - } - - getPublicKey(a?: Arena): EddsaPublicKey { - const obj = new EddsaPublicKey(this.emsc, a); - obj.nativePtr = this.emsc.allocFuncs.eddsa_public_key_from_private(this.nativePtr); - return obj; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EddsaPrivateKey { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to an EdDSA private key. - */ -export class EcdsaPrivateKey extends PackedArenaObject { - static create(emsc: EmscEnvironment, a?: Arena): EcdsaPrivateKey { - const obj = new EcdsaPrivateKey(emsc, a); - obj.nativePtr = emsc.allocFuncs.ecdsa_key_create(); - return obj; - } - - size() { - return 32; - } - - getPublicKey(a?: Arena): EcdsaPublicKey { - const obj = new EcdsaPublicKey(this.emsc, a); - obj.nativePtr = this.emsc.allocFuncs.ecdsa_public_key_from_private(this.nativePtr); - return obj; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EcdsaPrivateKey { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to an ECDHE private key. - */ -export class EcdhePrivateKey extends PackedArenaObject { - static create(emsc: EmscEnvironment, a?: Arena): EcdhePrivateKey { - const obj = new EcdhePrivateKey(emsc, a); - obj.nativePtr = emsc.allocFuncs.ecdhe_key_create(); - return obj; - } - - size() { - return 32; - } - - getPublicKey(a?: Arena): EcdhePublicKey { - const obj = new EcdhePublicKey(this.emsc, a); - obj.nativePtr = this.emsc.allocFuncs.ecdhe_public_key_from_private(this.nativePtr); - return obj; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EcdhePrivateKey { - return fromCrock(emsc, s, this); - } -} - - -/** - * Constructor for a given type. - */ -interface Ctor { - new(emsc: EmscEnvironment): T; -} - - -/** - * Low-level handle to an EdDSA public key. - */ -export class EddsaPublicKey extends PackedArenaObject { - size() { - return 32; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EddsaPublicKey { - return fromCrock(emsc, s, this); - } -} - -/** - * Low-level handle to an ECDSA public key. - */ -export class EcdsaPublicKey extends PackedArenaObject { - size() { - return 32; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EcdsaPublicKey { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to an ECDHE public key. - */ -export class EcdhePublicKey extends PackedArenaObject { - size() { - return 32; - } - - static fromCrock(emsc: EmscEnvironment, s: string): EcdhePublicKey { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to a blinding key secret. - */ -export class RsaBlindingKeySecret extends PackedArenaObject { - size() { - return 32; - } - - /** - * Create a random blinding key secret. - */ - static create(emsc: EmscEnvironment, a?: Arena): RsaBlindingKeySecret { - const o = new RsaBlindingKeySecret(emsc, a); - o.alloc(); - o.randomize(); - return o; - } - - static fromCrock(emsc: EmscEnvironment, s: string): RsaBlindingKeySecret { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to a hash code. - */ -export class HashCode extends PackedArenaObject { - size() { - return 64; - } - - static fromCrock(emsc: EmscEnvironment, s: string): HashCode { - return fromCrock(emsc, s, this); - } - - random(qual: RandomQuality = RandomQuality.STRONG) { - this.alloc(); - this.emsc.funcs.hash_create_random(qual, this.nativePtr); - } -} - - -/** - * Low-level handle to a byte array. - */ -export class ByteArray extends PackedArenaObject { - private allocatedSize: number; - - size() { - return this.allocatedSize; - } - - constructor(public emsc: EmscEnvironment, desiredSize: number, init?: number, a?: Arena) { - super(emsc, a); - if (init === undefined) { - this.nativePtr = this.emsc.allocFuncs.malloc(desiredSize); - } else { - this.nativePtr = init; - } - this.allocatedSize = desiredSize; - } - - static fromStringWithoutNull(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray { - // UTF-8 bytes, including 0-terminator - const terminatedByteLength = countUtf8Bytes(s) + 1; - const hstr = emsc.allocFuncs.malloc(terminatedByteLength); - emsc.lib.stringToUTF8(s, hstr, terminatedByteLength); - return new ByteArray(emsc, terminatedByteLength - 1, hstr, a); - } - - static fromStringWithNull(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray { - // UTF-8 bytes, including 0-terminator - const terminatedByteLength = countUtf8Bytes(s) + 1; - const hstr = emsc.allocFuncs.malloc(terminatedByteLength); - emsc.lib.stringToUTF8(s, hstr, terminatedByteLength); - return new ByteArray(emsc, terminatedByteLength, hstr, a); - } - - static fromCrock(emsc: EmscEnvironment, s: string, a?: Arena): ByteArray { - // this one is a bit more complicated than the other fromCrock functions, - // since we don't have a fixed size - const byteLength = countUtf8Bytes(s); - const hstr = emsc.allocFuncs.malloc(byteLength + 1); - emsc.lib.stringToUTF8(s, hstr, byteLength + 1); - const decodedLen = Math.floor((byteLength * 5) / 8); - const ba = new ByteArray(emsc, decodedLen, undefined, a); - const res = emsc.funcs.string_to_data(hstr, byteLength, ba.nativePtr, decodedLen); - emsc.funcs.free(hstr); - if (res !== GNUNET_OK) { - throw Error("decoding failed"); - } - return ba; - } -} - - -/** - * Data to sign, together with a header that includes a purpose id - * and size. - */ -export class EccSignaturePurpose extends PackedArenaObject { - size() { - return this.payloadSize + 8; - } - - private payloadSize: number; - - constructor(emsc: EmscEnvironment, - purpose: SignaturePurpose, - payload: PackedArenaObject, - a?: Arena) { - super(emsc, a); - this.nativePtr = emsc.allocFuncs.purpose_create(purpose, - payload.nativePtr, - payload.size()); - this.payloadSize = payload.size(); - } -} - - -abstract class SignatureStruct { - abstract fieldTypes(): any[]; - - abstract purpose(): SignaturePurpose; - - private members: any = {}; - - constructor(public emsc: EmscEnvironment, x: { [name: string]: any }) { - for (const k in x) { - this.set(k, x[k]); - } - } - - toPurpose(a?: Arena): EccSignaturePurpose { - let totalSize = 0; - for (const f of this.fieldTypes()) { - const name = f[0]; - const member = this.members[name]; - if (!member) { - throw Error(`Member ${name} not set`); - } - totalSize += member.size(); - } - - const buf = this.emsc.allocFuncs.malloc(totalSize); - let ptr = buf; - for (const f of this.fieldTypes()) { - const name = f[0]; - const member = this.members[name]; - const size = member.size(); - this.emsc.funcs.memmove(ptr, member.nativePtr, size); - ptr += size; - } - const ba = new ByteArray(this.emsc, totalSize, buf, a); - return new EccSignaturePurpose(this.emsc, this.purpose(), ba); - } - - - toJson() { - const res: any = {}; - for (const f of this.fieldTypes()) { - const name = f[0]; - const member = this.members[name]; - if (!member) { - throw Error(`Member ${name} not set`); - } - res[name] = member.toJson(); - } - res.purpose = this.purpose(); - return res; - } - - protected set(name: string, value: PackedArenaObject) { - const typemap: any = {}; - for (const f of this.fieldTypes()) { - typemap[f[0]] = f[1]; - } - if (!(name in typemap)) { - throw Error(`Key ${name} not found`); - } - if (!(value instanceof typemap[name])) { - throw Error(`Wrong type for ${name}`); - } - this.members[name] = value; - } -} - - -/** - * Arguments to constructor of [[WithdrawRequestPS]]. - */ -export interface WithdrawRequestPS_Args { - /** - * Reserve public key. - */ - reserve_pub: EddsaPublicKey; - /** - * Amount with fee. - */ - amount_with_fee: AmountNbo; - /** - * Withdraw fee. - */ - withdraw_fee: AmountNbo; - /** - * Hash of denomination public key. - */ - h_denomination_pub: HashCode; - /** - * Hash of coin envelope. - */ - h_coin_envelope: HashCode; -} - - -/** - * Low-level handle to a WithdrawRequest signature structure. - */ -export class WithdrawRequestPS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: WithdrawRequestPS_Args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.RESERVE_WITHDRAW; - } - - fieldTypes() { - return [ - ["reserve_pub", EddsaPublicKey], - ["amount_with_fee", AmountNbo], - ["withdraw_fee", AmountNbo], - ["h_denomination_pub", HashCode], - ["h_coin_envelope", HashCode], - ]; - } -} - - -/** - * Arguments for constructor or [[PaybackRequestPS]]. - */ -export interface PaybackRequestPS_args { - coin_pub: EddsaPublicKey; - h_denom_pub: HashCode; - coin_blind: RsaBlindingKeySecret; -} - - -/** - * Low-level handle to a PaybackRequest signature structure. - */ -export class PaybackRequestPS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: PaybackRequestPS_args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.WALLET_COIN_PAYBACK; - } - - fieldTypes() { - return [ - ["coin_pub", EddsaPublicKey], - ["h_denom_pub", HashCode], - ["coin_blind", RsaBlindingKeySecret], - ]; - } -} - - -/** - * Arguments for constructor of [[RefreshMeltCoinAffirmationPS]]. - */ -interface RefreshMeltCoinAffirmationPS_Args { - session_hash: HashCode; - amount_with_fee: AmountNbo; - melt_fee: AmountNbo; - coin_pub: EddsaPublicKey; -} - -/** - * Low-level handle to a RefreshMeltCoinAffirmationPS signature structure. - */ -export class RefreshMeltCoinAffirmationPS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: RefreshMeltCoinAffirmationPS_Args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.WALLET_COIN_MELT; - } - - fieldTypes() { - return [ - ["session_hash", HashCode], - ["amount_with_fee", AmountNbo], - ["melt_fee", AmountNbo], - ["coin_pub", EddsaPublicKey], - ]; - } -} - - -/** - * Arguments for constructor of [[MasterWireFeePS]]. - */ -interface MasterWireFeePS_Args { - /** - * Hash of wire method. - */ - h_wire_method: HashCode; - /** - * Start date. - */ - start_date: AbsoluteTimeNbo; - /** - * End date. - */ - end_date: AbsoluteTimeNbo; - /** - * Wire fee. - */ - wire_fee: AmountNbo; - /** - * Closing fee. - */ - closing_fee: AmountNbo; -} - - -/** - * Low-level handle to a structure being signed over. - */ -export class MasterWireFeePS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: MasterWireFeePS_Args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.MASTER_WIRE_FEES; - } - - fieldTypes() { - return [ - ["h_wire_method", HashCode], - ["start_date", AbsoluteTimeNbo], - ["end_date", AbsoluteTimeNbo], - ["wire_fee", AmountNbo], - ["closing_fee", AmountNbo], - ]; - } -} - - -/** - * Low-level handle to an absolute time in network byte order (NBO). - */ -export class AbsoluteTimeNbo extends PackedArenaObject { - static fromTalerString(emsc: EmscEnvironment, s: string): AbsoluteTimeNbo { - const x = new AbsoluteTimeNbo(emsc); - x.alloc(); - const r = /Date\(([0-9]+)\)/; - const m = r.exec(s); - if (!m || m.length !== 2) { - throw Error(); - } - const n = parseInt(m[1], 10) * 1000000; - // XXX: This only works up to 54 bit numbers. - set64(emsc, x.nativePtr, n); - return x; - } - - static fromStampSeconds(emsc: EmscEnvironment, stamp: number): AbsoluteTimeNbo { - const x = new AbsoluteTimeNbo(emsc); - x.alloc(); - // XXX: This only works up to 54 bit numbers. - set64(emsc, x.nativePtr, stamp * 1000000); - return x; - } - - - size() { - return 8; - } -} - - -// XXX: This only works up to 54 bit numbers. -function set64(emsc: EmscEnvironment, p: number, n: number) { - for (let i = 0; i < 8; ++i) { - emsc.lib.setValue(p + (7 - i), n & 0xFF, "i8"); - n = Math.floor(n / 256); - } -} - -// XXX: This only works up to 54 bit numbers. -function set32(emsc: EmscEnvironment, p: number, n: number) { - for (let i = 0; i < 4; ++i) { - emsc.lib.setValue(p + (3 - i), n & 0xFF, "i8"); - n = Math.floor(n / 256); - } -} - - -/** - * Low-level handle to an unsigned 64-bit value. - */ -export class UInt64 extends PackedArenaObject { - static fromNumber(emsc: EmscEnvironment, n: number): UInt64 { - const x = new UInt64(emsc); - x.alloc(); - set64(emsc, x.nativePtr, n); - return x; - } - - size() { - return 8; - } -} - - -/** - * Low-level handle to an unsigned 32-bit value. - */ -export class UInt32 extends PackedArenaObject { - static fromNumber(emsc: EmscEnvironment, n: number): UInt32 { - const x = new UInt32(emsc); - x.alloc(); - set32(emsc, x.nativePtr, n); - return x; - } - - size() { - return 4; - } -} - - -/** - * Argument to the constructor of [[DepositRequestPS]]. - */ -export interface DepositRequestPS_Args { - /** - * Contract hash. - */ - h_contract: HashCode; - /** - * Wire info hash. - */ - h_wire: HashCode; - /** - * Timestamp. - */ - timestamp: AbsoluteTimeNbo; - /** - * Refund deadline. - */ - refund_deadline: AbsoluteTimeNbo; - /** - * Amount with fee. - */ - amount_with_fee: AmountNbo; - /** - * Deposit fee. - */ - deposit_fee: AmountNbo; - /** - * Merchant public key. - */ - merchant: EddsaPublicKey; - /** - * Public key of the coin being deposited. - */ - coin_pub: EddsaPublicKey; -} - - -/** - * Low-level handle to a struct being signed over. - */ -export class DepositRequestPS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: DepositRequestPS_Args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.WALLET_COIN_DEPOSIT; - } - - fieldTypes() { - return [ - ["h_contract", HashCode], - ["h_wire", HashCode], - ["timestamp", AbsoluteTimeNbo], - ["refund_deadline", AbsoluteTimeNbo], - ["amount_with_fee", AmountNbo], - ["deposit_fee", AmountNbo], - ["merchant", EddsaPublicKey], - ["coin_pub", EddsaPublicKey], - ]; - } -} - - -interface CoinLinkSignaturePS_args { - h_denom_pub: HashCode; - old_coin_pub: EddsaPublicKey; - transfer_pub: EcdhePublicKey; - coin_envelope_hash: HashCode; -} - - -export class CoinLinkSignaturePS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: CoinLinkSignaturePS_args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.WALLET_COIN_LINK; - } - - fieldTypes() { - return [ - ["h_denom_pub", HashCode], - ["old_coin_pub", EddsaPublicKey], - ["transfer_pub", EcdhePublicKey], - ["coin_envelope_hash", HashCode], - ]; - } -} - - -/** - * Arguments for constuctor of [[DenominationKeyValidityPS]]. - */ -export interface DenominationKeyValidityPS_args { - master: EddsaPublicKey; - start: AbsoluteTimeNbo; - expire_withdraw: AbsoluteTimeNbo; - expire_spend: AbsoluteTimeNbo; - expire_legal: AbsoluteTimeNbo; - value: AmountNbo; - fee_withdraw: AmountNbo; - fee_deposit: AmountNbo; - fee_refresh: AmountNbo; - fee_refund: AmountNbo; - denom_hash: HashCode; -} - - -/** - * Low-level handle to a structure being signed over. - */ -export class DenominationKeyValidityPS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: DenominationKeyValidityPS_args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.MASTER_DENOMINATION_KEY_VALIDITY; - } - - fieldTypes() { - return [ - ["master", EddsaPublicKey], - ["start", AbsoluteTimeNbo], - ["expire_withdraw", AbsoluteTimeNbo], - ["expire_spend", AbsoluteTimeNbo], - ["expire_legal", AbsoluteTimeNbo], - ["value", AmountNbo], - ["fee_withdraw", AmountNbo], - ["fee_deposit", AmountNbo], - ["fee_refresh", AmountNbo], - ["fee_refund", AmountNbo], - ["denom_hash", HashCode], - ]; - } -} - -/** - * Arguments to constructor of [[PaymentSignaturePS]]. - */ -export interface PaymentSignaturePS_args { - /** - * Contract hash. - */ - contract_hash: HashCode; -} - - -/** - * Low-level handle to a structure being signed over. - */ -export class PaymentSignaturePS extends SignatureStruct { - constructor(emsc: EmscEnvironment, w: PaymentSignaturePS_args) { - super(emsc, w); - } - - purpose() { - return SignaturePurpose.MERCHANT_PAYMENT_OK; - } - - fieldTypes() { - return [ - ["contract_hash", HashCode], - ]; - } -} - - -/** - * Low-level handle to an RsaPrivateKey. - */ -export class RsaPrivateKey extends MallocArenaObject { - static fromCrock(emsc: EmscEnvironment, s: string): RsaPrivateKey { - return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_private_key_decode); - } - - static create(emsc: EmscEnvironment, bitLen: number, a?: Arena): RsaPrivateKey { - const obj = new RsaPrivateKey(emsc, a); - obj.nativePtr = emsc.allocFuncs.rsa_private_key_create(bitLen); - return obj; - } - - toCrock() { - return this.encode().toCrock(); - } - - - getPublicKey(a?: Arena): RsaPublicKey { - const obj = new RsaPublicKey(this.emsc, a); - obj.nativePtr = this.emsc.allocFuncs.rsa_private_key_get_public(this.nativePtr); - return obj; - } - - destroy() { - this.emsc.funcs.rsa_public_key_free(this.nativePtr); - this.nativePtr = 0; - } - - encode(arena?: Arena): ByteArray { - return encode(this, this.emsc.allocFuncs.rsa_private_key_encode); - } -} - - -/** - * Low-level handle to an RsaPublicKey. - */ -export class RsaPublicKey extends MallocArenaObject { - static fromCrock(emsc: EmscEnvironment, s: string): RsaPublicKey { - return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_public_key_decode); - } - - toCrock() { - return this.encode().toCrock(); - } - - destroy() { - this.emsc.funcs.rsa_public_key_free(this.nativePtr); - this.nativePtr = 0; - } - - encode(arena?: Arena): ByteArray { - return encode(this, this.emsc.allocFuncs.rsa_public_key_encode); - } -} - - -/** - * Low-level handle to an EddsaSignature. - */ -export class EddsaSignature extends PackedArenaObject { - size() { - return 64; - } - static fromCrock(emsc: EmscEnvironment, s: string): EddsaSignature { - return fromCrock(emsc, s, this); - } -} - - -/** - * Low-level handle to an RsaSignature. - */ -export class RsaSignature extends MallocArenaObject { - static fromCrock(emsc: EmscEnvironment, s: string, a?: Arena) { - return fromCrockDecoded(emsc, s, this, emsc.allocFuncs.rsa_signature_decode); - } - - encode(arena?: Arena): ByteArray { - return encode(this, this.emsc.allocFuncs.rsa_signature_encode); - } - - destroy() { - this.emsc.funcs.rsa_signature_free(this.nativePtr); - this.nativePtr = 0; - } -} - - -/** - * Blind a value so it can be blindly signed. - */ -export function rsaBlind(hashCode: HashCode, - blindingKey: RsaBlindingKeySecret, - pkey: RsaPublicKey, - arena?: Arena): ByteArray|null { - const emsc: EmscEnvironment = hashCode.emsc; - const buf_ptr_out = emsc.allocFuncs.malloc(PTR_SIZE); - const buf_size_out = emsc.allocFuncs.malloc(PTR_SIZE); - const res = emsc.allocFuncs.rsa_blind(hashCode.nativePtr, - blindingKey.nativePtr, - pkey.nativePtr, - buf_ptr_out, - buf_size_out); - const buf_ptr = emsc.lib.getValue(buf_ptr_out, "*"); - const buf_size = emsc.lib.getValue(buf_size_out, "*"); - emsc.funcs.free(buf_ptr_out); - emsc.funcs.free(buf_size_out); - if (res !== GNUNET_OK) { - // malicious key - return null; - } - return new ByteArray(emsc, buf_size, buf_ptr, arena); -} - - -/** - * Sign data using EdDSA. - */ -export function eddsaSign(purpose: EccSignaturePurpose, - priv: EddsaPrivateKey, - a?: Arena): EddsaSignature { - const sig = new EddsaSignature(purpose.emsc, a); - sig.alloc(); - const res = purpose.emsc.funcs.eddsa_sign(priv.nativePtr, purpose.nativePtr, sig.nativePtr); - if (res < 1) { - throw Error("EdDSA signing failed"); - } - return sig; -} - - -/** - * Verify EdDSA-signed data. - */ -export function eddsaVerify(purposeNum: number, - verify: EccSignaturePurpose, - sig: EddsaSignature, - pub: EddsaPublicKey, - a?: Arena): boolean { - const r = verify.emsc.funcs.eddsa_verify(purposeNum, - verify.nativePtr, - sig.nativePtr, - pub.nativePtr); - return r === GNUNET_OK; -} - - -export function rsaVerify(h: HashCode, - sig: RsaSignature, - pub: RsaPublicKey) { - const r = h.emsc.funcs.rsa_verify(h.nativePtr, - sig.nativePtr, - pub.nativePtr); - return r === GNUNET_OK; -} - - -/** - * Unblind a blindly signed value. - */ -export function rsaUnblind(sig: RsaSignature, - bk: RsaBlindingKeySecret, - pk: RsaPublicKey, - a?: Arena): RsaSignature { - const x = new RsaSignature(sig.emsc, a); - x.nativePtr = sig.emsc.allocFuncs.rsa_unblind(sig.nativePtr, - bk.nativePtr, - pk.nativePtr); - return x; -} - - -type TransferSecretP = HashCode; - -/** - * A fresh coin generated from a sed. - */ -export interface FreshCoin { - /** - * The coin's private key. - */ - priv: EddsaPrivateKey; - /** - * The blinding key to use for withdrawal. - */ - blindingKey: RsaBlindingKeySecret; -} - -/** - * Diffie-Hellman operation between an ECDHE private key - * and an EdDSA public key. - */ -export function ecdhEddsa(priv: EcdhePrivateKey, - pub: EddsaPublicKey): HashCode { - const h = new HashCode(priv.emsc); - h.alloc(); - const res = priv.emsc.funcs.ecdh_eddsa(priv.nativePtr, pub.nativePtr, h.nativePtr); - if (res !== GNUNET_OK) { - throw Error("ecdh_eddsa failed"); - } - return h; -} - -export function rsaSignBlinded(priv: RsaPrivateKey, - msg: ByteArray): RsaSignature { - const sig = new RsaSignature(priv.emsc); - sig.nativePtr = priv.emsc.allocFuncs.rsa_sign_blinded (priv.nativePtr, - msg.nativePtr, - msg.size()); - return sig; -} - - - -/** - * Derive a fresh coin from the given seed. Used during refreshing. - */ -export function setupFreshCoin(secretSeed: TransferSecretP, - coinIndex: number): FreshCoin { - const emsc: EmscEnvironment = secretSeed.emsc; - const priv = new EddsaPrivateKey(emsc); - priv.isWeak = true; - const blindingKey = new RsaBlindingKeySecret(emsc); - blindingKey.isWeak = true; - const buf = new ByteArray(emsc, priv.size() + blindingKey.size()); - - emsc.funcs.setup_fresh_coin(secretSeed.nativePtr, coinIndex, buf.nativePtr); - - priv.nativePtr = buf.nativePtr; - blindingKey.nativePtr = buf.nativePtr + priv.size(); - - return { priv, blindingKey }; -} diff --git a/src/crypto/kdf.ts b/src/crypto/kdf.ts deleted file mode 100644 index 082963074..000000000 --- a/src/crypto/kdf.ts +++ /dev/null @@ -1,92 +0,0 @@ -/* - This file is part of GNU Taler - (C) 2019 GNUnet e.V. - - GNU Taler is free software; you can redistribute it and/or modify it under the - terms of the GNU General Public License as published by the Free Software - Foundation; either version 3, or (at your option) any later version. - - GNU Taler is distributed in the hope that it will be useful, but WITHOUT ANY - WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR - A PARTICULAR PURPOSE. See the GNU General Public License for more details. - - You should have received a copy of the GNU General Public License along with - GNU Taler; see the file COPYING. If not, see - */ - -import nacl = require("./nacl-fast"); -import { sha256 } from "./sha256"; - -export function sha512(data: Uint8Array): Uint8Array { - return nacl.hash(data); -} - -export function hmac( - digest: (d: Uint8Array) => Uint8Array, - blockSize: number, - key: Uint8Array, - message: Uint8Array, -): Uint8Array { - if (key.byteLength > blockSize) { - key = digest(key); - } - if (key.byteLength < blockSize) { - const k = key; - key = new Uint8Array(blockSize); - key.set(k, 0); - } - const okp = new Uint8Array(blockSize); - const ikp = new Uint8Array(blockSize); - for (let i = 0; i < blockSize; i++) { - ikp[i] = key[i] ^ 0x36; - okp[i] = key[i] ^ 0x5c; - } - const b1 = new Uint8Array(blockSize + message.byteLength); - b1.set(ikp, 0); - b1.set(message, blockSize); - const h0 = digest(b1); - const b2 = new Uint8Array(blockSize + h0.length); - b2.set(okp, 0); - b2.set(h0, blockSize); - return digest(b2); -} - -export function hmacSha512(key: Uint8Array, message: Uint8Array) { - return hmac(sha512, 128, key, message); -} - -export function hmacSha256(key: Uint8Array, message: Uint8Array) { - return hmac(sha256, 64, key, message); -} - -export function kdf( - outputLength: number, - ikm: Uint8Array, - salt: Uint8Array, - info: Uint8Array, -): Uint8Array { - // extract - const prk = hmacSha512(salt, ikm); - - // expand - const N = Math.ceil(outputLength / 32); - const output = new Uint8Array(N * 32); - for (let i = 0; i < N; i++) { - let buf; - if (i == 0) { - buf = new Uint8Array(info.byteLength + 1); - buf.set(info, 0); - } else { - buf = new Uint8Array(info.byteLength + 1 + 32); - for (let j = 0; j < 32; j++) { - buf[j] = output[(i - 1) * 32 + j]; - } - buf.set(info, 32); - } - buf[buf.length - 1] = i + 1; - const chunk = hmacSha256(prk, buf); - output.set(chunk, i * 32); - } - - return output; -} diff --git a/src/crypto/nacl-fast.ts b/src/crypto/nacl-fast.ts deleted file mode 100644 index 418662e8d..000000000 --- a/src/crypto/nacl-fast.ts +++ /dev/null @@ -1,3036 +0,0 @@ -// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. -// TypeScript port in 2019 by Florian Dold. -// Public domain. -// -// Implementation derived from TweetNaCl version 20140427. -// See for details: http://tweetnacl.cr.yp.to/ - -const gf = function(init: number[] = []) { - const r = new Float64Array(16); - if (init) for (let i = 0; i < init.length; i++) r[i] = init[i]; - return r; -}; - -// Pluggable, initialized in high-level API below. -let randombytes = function(x: Uint8Array, n: number): void { - throw new Error("no PRNG"); -}; - -const _0 = new Uint8Array(16); -const _9 = new Uint8Array(32); -_9[0] = 9; - -// prettier-ignore -const gf0 = gf(); -const gf1 = gf([1]); -const _121665 = gf([0xdb41, 1]); -const D = gf([ - 0x78a3, - 0x1359, - 0x4dca, - 0x75eb, - 0xd8ab, - 0x4141, - 0x0a4d, - 0x0070, - 0xe898, - 0x7779, - 0x4079, - 0x8cc7, - 0xfe73, - 0x2b6f, - 0x6cee, - 0x5203, -]); -const D2 = gf([ - 0xf159, - 0x26b2, - 0x9b94, - 0xebd6, - 0xb156, - 0x8283, - 0x149a, - 0x00e0, - 0xd130, - 0xeef3, - 0x80f2, - 0x198e, - 0xfce7, - 0x56df, - 0xd9dc, - 0x2406, -]); -const X = gf([ - 0xd51a, - 0x8f25, - 0x2d60, - 0xc956, - 0xa7b2, - 0x9525, - 0xc760, - 0x692c, - 0xdc5c, - 0xfdd6, - 0xe231, - 0xc0a4, - 0x53fe, - 0xcd6e, - 0x36d3, - 0x2169, -]); -const Y = gf([ - 0x6658, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, - 0x6666, -]); -const I = gf([ - 0xa0b0, - 0x4a0e, - 0x1b27, - 0xc4ee, - 0xe478, - 0xad2f, - 0x1806, - 0x2f43, - 0xd7a7, - 0x3dfb, - 0x0099, - 0x2b4d, - 0xdf0b, - 0x4fc1, - 0x2480, - 0x2b83, -]); - -function ts64(x: Uint8Array, i: number, h: number, l: number) { - x[i] = (h >> 24) & 0xff; - x[i + 1] = (h >> 16) & 0xff; - x[i + 2] = (h >> 8) & 0xff; - x[i + 3] = h & 0xff; - x[i + 4] = (l >> 24) & 0xff; - x[i + 5] = (l >> 16) & 0xff; - x[i + 6] = (l >> 8) & 0xff; - x[i + 7] = l & 0xff; -} - -function vn(x: Uint8Array, xi: number, y: Uint8Array, yi: number, n: number) { - var i, - d = 0; - for (i = 0; i < n; i++) d |= x[xi + i] ^ y[yi + i]; - return (1 & ((d - 1) >>> 8)) - 1; -} - -function crypto_verify_16( - x: Uint8Array, - xi: number, - y: Uint8Array, - yi: number, -) { - return vn(x, xi, y, yi, 16); -} - -function crypto_verify_32( - x: Uint8Array, - xi: number, - y: Uint8Array, - yi: number, -) { - return vn(x, xi, y, yi, 32); -} - -// prettier-ignore -function core_salsa20(o: Uint8Array, p: Uint8Array, k: Uint8Array, c: Uint8Array) { - var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, - j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, - j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, - j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, - j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, - j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, - j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, - j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, - j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, - j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, - j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, - j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, - j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, - j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, - j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, - j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; - - var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, - x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, - x15 = j15, u; - - for (var i = 0; i < 20; i += 2) { - u = x0 + x12 | 0; - x4 ^= u<<7 | u>>>(32-7); - u = x4 + x0 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x4 | 0; - x12 ^= u<<13 | u>>>(32-13); - u = x12 + x8 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x1 | 0; - x9 ^= u<<7 | u>>>(32-7); - u = x9 + x5 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x9 | 0; - x1 ^= u<<13 | u>>>(32-13); - u = x1 + x13 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x6 | 0; - x14 ^= u<<7 | u>>>(32-7); - u = x14 + x10 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x14 | 0; - x6 ^= u<<13 | u>>>(32-13); - u = x6 + x2 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x11 | 0; - x3 ^= u<<7 | u>>>(32-7); - u = x3 + x15 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x3 | 0; - x11 ^= u<<13 | u>>>(32-13); - u = x11 + x7 | 0; - x15 ^= u<<18 | u>>>(32-18); - - u = x0 + x3 | 0; - x1 ^= u<<7 | u>>>(32-7); - u = x1 + x0 | 0; - x2 ^= u<<9 | u>>>(32-9); - u = x2 + x1 | 0; - x3 ^= u<<13 | u>>>(32-13); - u = x3 + x2 | 0; - x0 ^= u<<18 | u>>>(32-18); - - u = x5 + x4 | 0; - x6 ^= u<<7 | u>>>(32-7); - u = x6 + x5 | 0; - x7 ^= u<<9 | u>>>(32-9); - u = x7 + x6 | 0; - x4 ^= u<<13 | u>>>(32-13); - u = x4 + x7 | 0; - x5 ^= u<<18 | u>>>(32-18); - - u = x10 + x9 | 0; - x11 ^= u<<7 | u>>>(32-7); - u = x11 + x10 | 0; - x8 ^= u<<9 | u>>>(32-9); - u = x8 + x11 | 0; - x9 ^= u<<13 | u>>>(32-13); - u = x9 + x8 | 0; - x10 ^= u<<18 | u>>>(32-18); - - u = x15 + x14 | 0; - x12 ^= u<<7 | u>>>(32-7); - u = x12 + x15 | 0; - x13 ^= u<<9 | u>>>(32-9); - u = x13 + x12 | 0; - x14 ^= u<<13 | u>>>(32-13); - u = x14 + x13 | 0; - x15 ^= u<<18 | u>>>(32-18); - } - x0 = x0 + j0 | 0; - x1 = x1 + j1 | 0; - x2 = x2 + j2 | 0; - x3 = x3 + j3 | 0; - x4 = x4 + j4 | 0; - x5 = x5 + j5 | 0; - x6 = x6 + j6 | 0; - x7 = x7 + j7 | 0; - x8 = x8 + j8 | 0; - x9 = x9 + j9 | 0; - x10 = x10 + j10 | 0; - x11 = x11 + j11 | 0; - x12 = x12 + j12 | 0; - x13 = x13 + j13 | 0; - x14 = x14 + j14 | 0; - x15 = x15 + j15 | 0; - - o[ 0] = x0 >>> 0 & 0xff; - o[ 1] = x0 >>> 8 & 0xff; - o[ 2] = x0 >>> 16 & 0xff; - o[ 3] = x0 >>> 24 & 0xff; - - o[ 4] = x1 >>> 0 & 0xff; - o[ 5] = x1 >>> 8 & 0xff; - o[ 6] = x1 >>> 16 & 0xff; - o[ 7] = x1 >>> 24 & 0xff; - - o[ 8] = x2 >>> 0 & 0xff; - o[ 9] = x2 >>> 8 & 0xff; - o[10] = x2 >>> 16 & 0xff; - o[11] = x2 >>> 24 & 0xff; - - o[12] = x3 >>> 0 & 0xff; - o[13] = x3 >>> 8 & 0xff; - o[14] = x3 >>> 16 & 0xff; - o[15] = x3 >>> 24 & 0xff; - - o[16] = x4 >>> 0 & 0xff; - o[17] = x4 >>> 8 & 0xff; - o[18] = x4 >>> 16 & 0xff; - o[19] = x4 >>> 24 & 0xff; - - o[20] = x5 >>> 0 & 0xff; - o[21] = x5 >>> 8 & 0xff; - o[22] = x5 >>> 16 & 0xff; - o[23] = x5 >>> 24 & 0xff; - - o[24] = x6 >>> 0 & 0xff; - o[25] = x6 >>> 8 & 0xff; - o[26] = x6 >>> 16 & 0xff; - o[27] = x6 >>> 24 & 0xff; - - o[28] = x7 >>> 0 & 0xff; - o[29] = x7 >>> 8 & 0xff; - o[30] = x7 >>> 16 & 0xff; - o[31] = x7 >>> 24 & 0xff; - - o[32] = x8 >>> 0 & 0xff; - o[33] = x8 >>> 8 & 0xff; - o[34] = x8 >>> 16 & 0xff; - o[35] = x8 >>> 24 & 0xff; - - o[36] = x9 >>> 0 & 0xff; - o[37] = x9 >>> 8 & 0xff; - o[38] = x9 >>> 16 & 0xff; - o[39] = x9 >>> 24 & 0xff; - - o[40] = x10 >>> 0 & 0xff; - o[41] = x10 >>> 8 & 0xff; - o[42] = x10 >>> 16 & 0xff; - o[43] = x10 >>> 24 & 0xff; - - o[44] = x11 >>> 0 & 0xff; - o[45] = x11 >>> 8 & 0xff; - o[46] = x11 >>> 16 & 0xff; - o[47] = x11 >>> 24 & 0xff; - - o[48] = x12 >>> 0 & 0xff; - o[49] = x12 >>> 8 & 0xff; - o[50] = x12 >>> 16 & 0xff; - o[51] = x12 >>> 24 & 0xff; - - o[52] = x13 >>> 0 & 0xff; - o[53] = x13 >>> 8 & 0xff; - o[54] = x13 >>> 16 & 0xff; - o[55] = x13 >>> 24 & 0xff; - - o[56] = x14 >>> 0 & 0xff; - o[57] = x14 >>> 8 & 0xff; - o[58] = x14 >>> 16 & 0xff; - o[59] = x14 >>> 24 & 0xff; - - o[60] = x15 >>> 0 & 0xff; - o[61] = x15 >>> 8 & 0xff; - o[62] = x15 >>> 16 & 0xff; - o[63] = x15 >>> 24 & 0xff; -} - -function core_hsalsa20( - o: Uint8Array, - p: Uint8Array, - k: Uint8Array, - c: Uint8Array, -) { - var j0 = - (c[0] & 0xff) | - ((c[1] & 0xff) << 8) | - ((c[2] & 0xff) << 16) | - ((c[3] & 0xff) << 24), - j1 = - (k[0] & 0xff) | - ((k[1] & 0xff) << 8) | - ((k[2] & 0xff) << 16) | - ((k[3] & 0xff) << 24), - j2 = - (k[4] & 0xff) | - ((k[5] & 0xff) << 8) | - ((k[6] & 0xff) << 16) | - ((k[7] & 0xff) << 24), - j3 = - (k[8] & 0xff) | - ((k[9] & 0xff) << 8) | - ((k[10] & 0xff) << 16) | - ((k[11] & 0xff) << 24), - j4 = - (k[12] & 0xff) | - ((k[13] & 0xff) << 8) | - ((k[14] & 0xff) << 16) | - ((k[15] & 0xff) << 24), - j5 = - (c[4] & 0xff) | - ((c[5] & 0xff) << 8) | - ((c[6] & 0xff) << 16) | - ((c[7] & 0xff) << 24), - j6 = - (p[0] & 0xff) | - ((p[1] & 0xff) << 8) | - ((p[2] & 0xff) << 16) | - ((p[3] & 0xff) << 24), - j7 = - (p[4] & 0xff) | - ((p[5] & 0xff) << 8) | - ((p[6] & 0xff) << 16) | - ((p[7] & 0xff) << 24), - j8 = - (p[8] & 0xff) | - ((p[9] & 0xff) << 8) | - ((p[10] & 0xff) << 16) | - ((p[11] & 0xff) << 24), - j9 = - (p[12] & 0xff) | - ((p[13] & 0xff) << 8) | - ((p[14] & 0xff) << 16) | - ((p[15] & 0xff) << 24), - j10 = - (c[8] & 0xff) | - ((c[9] & 0xff) << 8) | - ((c[10] & 0xff) << 16) | - ((c[11] & 0xff) << 24), - j11 = - (k[16] & 0xff) | - ((k[17] & 0xff) << 8) | - ((k[18] & 0xff) << 16) | - ((k[19] & 0xff) << 24), - j12 = - (k[20] & 0xff) | - ((k[21] & 0xff) << 8) | - ((k[22] & 0xff) << 16) | - ((k[23] & 0xff) << 24), - j13 = - (k[24] & 0xff) | - ((k[25] & 0xff) << 8) | - ((k[26] & 0xff) << 16) | - ((k[27] & 0xff) << 24), - j14 = - (k[28] & 0xff) | - ((k[29] & 0xff) << 8) | - ((k[30] & 0xff) << 16) | - ((k[31] & 0xff) << 24), - j15 = - (c[12] & 0xff) | - ((c[13] & 0xff) << 8) | - ((c[14] & 0xff) << 16) | - ((c[15] & 0xff) << 24); - - var x0 = j0, - x1 = j1, - x2 = j2, - x3 = j3, - x4 = j4, - x5 = j5, - x6 = j6, - x7 = j7, - x8 = j8, - x9 = j9, - x10 = j10, - x11 = j11, - x12 = j12, - x13 = j13, - x14 = j14, - x15 = j15, - u; - - for (var i = 0; i < 20; i += 2) { - u = (x0 + x12) | 0; - x4 ^= (u << 7) | (u >>> (32 - 7)); - u = (x4 + x0) | 0; - x8 ^= (u << 9) | (u >>> (32 - 9)); - u = (x8 + x4) | 0; - x12 ^= (u << 13) | (u >>> (32 - 13)); - u = (x12 + x8) | 0; - x0 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x5 + x1) | 0; - x9 ^= (u << 7) | (u >>> (32 - 7)); - u = (x9 + x5) | 0; - x13 ^= (u << 9) | (u >>> (32 - 9)); - u = (x13 + x9) | 0; - x1 ^= (u << 13) | (u >>> (32 - 13)); - u = (x1 + x13) | 0; - x5 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x10 + x6) | 0; - x14 ^= (u << 7) | (u >>> (32 - 7)); - u = (x14 + x10) | 0; - x2 ^= (u << 9) | (u >>> (32 - 9)); - u = (x2 + x14) | 0; - x6 ^= (u << 13) | (u >>> (32 - 13)); - u = (x6 + x2) | 0; - x10 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x15 + x11) | 0; - x3 ^= (u << 7) | (u >>> (32 - 7)); - u = (x3 + x15) | 0; - x7 ^= (u << 9) | (u >>> (32 - 9)); - u = (x7 + x3) | 0; - x11 ^= (u << 13) | (u >>> (32 - 13)); - u = (x11 + x7) | 0; - x15 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x0 + x3) | 0; - x1 ^= (u << 7) | (u >>> (32 - 7)); - u = (x1 + x0) | 0; - x2 ^= (u << 9) | (u >>> (32 - 9)); - u = (x2 + x1) | 0; - x3 ^= (u << 13) | (u >>> (32 - 13)); - u = (x3 + x2) | 0; - x0 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x5 + x4) | 0; - x6 ^= (u << 7) | (u >>> (32 - 7)); - u = (x6 + x5) | 0; - x7 ^= (u << 9) | (u >>> (32 - 9)); - u = (x7 + x6) | 0; - x4 ^= (u << 13) | (u >>> (32 - 13)); - u = (x4 + x7) | 0; - x5 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x10 + x9) | 0; - x11 ^= (u << 7) | (u >>> (32 - 7)); - u = (x11 + x10) | 0; - x8 ^= (u << 9) | (u >>> (32 - 9)); - u = (x8 + x11) | 0; - x9 ^= (u << 13) | (u >>> (32 - 13)); - u = (x9 + x8) | 0; - x10 ^= (u << 18) | (u >>> (32 - 18)); - - u = (x15 + x14) | 0; - x12 ^= (u << 7) | (u >>> (32 - 7)); - u = (x12 + x15) | 0; - x13 ^= (u << 9) | (u >>> (32 - 9)); - u = (x13 + x12) | 0; - x14 ^= (u << 13) | (u >>> (32 - 13)); - u = (x14 + x13) | 0; - x15 ^= (u << 18) | (u >>> (32 - 18)); - } - - o[0] = (x0 >>> 0) & 0xff; - o[1] = (x0 >>> 8) & 0xff; - o[2] = (x0 >>> 16) & 0xff; - o[3] = (x0 >>> 24) & 0xff; - - o[4] = (x5 >>> 0) & 0xff; - o[5] = (x5 >>> 8) & 0xff; - o[6] = (x5 >>> 16) & 0xff; - o[7] = (x5 >>> 24) & 0xff; - - o[8] = (x10 >>> 0) & 0xff; - o[9] = (x10 >>> 8) & 0xff; - o[10] = (x10 >>> 16) & 0xff; - o[11] = (x10 >>> 24) & 0xff; - - o[12] = (x15 >>> 0) & 0xff; - o[13] = (x15 >>> 8) & 0xff; - o[14] = (x15 >>> 16) & 0xff; - o[15] = (x15 >>> 24) & 0xff; - - o[16] = (x6 >>> 0) & 0xff; - o[17] = (x6 >>> 8) & 0xff; - o[18] = (x6 >>> 16) & 0xff; - o[19] = (x6 >>> 24) & 0xff; - - o[20] = (x7 >>> 0) & 0xff; - o[21] = (x7 >>> 8) & 0xff; - o[22] = (x7 >>> 16) & 0xff; - o[23] = (x7 >>> 24) & 0xff; - - o[24] = (x8 >>> 0) & 0xff; - o[25] = (x8 >>> 8) & 0xff; - o[26] = (x8 >>> 16) & 0xff; - o[27] = (x8 >>> 24) & 0xff; - - o[28] = (x9 >>> 0) & 0xff; - o[29] = (x9 >>> 8) & 0xff; - o[30] = (x9 >>> 16) & 0xff; - o[31] = (x9 >>> 24) & 0xff; -} - -function crypto_core_salsa20( - out: Uint8Array, - inp: Uint8Array, - k: Uint8Array, - c: Uint8Array, -) { - core_salsa20(out, inp, k, c); -} - -function crypto_core_hsalsa20( - out: Uint8Array, - inp: Uint8Array, - k: Uint8Array, - c: Uint8Array, -) { - core_hsalsa20(out, inp, k, c); -} - -var sigma = new Uint8Array([ - 101, - 120, - 112, - 97, - 110, - 100, - 32, - 51, - 50, - 45, - 98, - 121, - 116, - 101, - 32, - 107, -]); -// "expand 32-byte k" - -function crypto_stream_salsa20_xor( - c: Uint8Array, - cpos: number, - m: Uint8Array, - mpos: number, - b: number, - n: Uint8Array, - k: Uint8Array, -) { - var z = new Uint8Array(16), - x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x, z, k, sigma); - for (i = 0; i < 64; i++) c[cpos + i] = m[mpos + i] ^ x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = (u + (z[i] & 0xff)) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - mpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x, z, k, sigma); - for (i = 0; i < b; i++) c[cpos + i] = m[mpos + i] ^ x[i]; - } - return 0; -} - -function crypto_stream_salsa20( - c: Uint8Array, - cpos: number, - b: number, - n: Uint8Array, - k: Uint8Array, -) { - var z = new Uint8Array(16), - x = new Uint8Array(64); - var u, i; - for (i = 0; i < 16; i++) z[i] = 0; - for (i = 0; i < 8; i++) z[i] = n[i]; - while (b >= 64) { - crypto_core_salsa20(x, z, k, sigma); - for (i = 0; i < 64; i++) c[cpos + i] = x[i]; - u = 1; - for (i = 8; i < 16; i++) { - u = (u + (z[i] & 0xff)) | 0; - z[i] = u & 0xff; - u >>>= 8; - } - b -= 64; - cpos += 64; - } - if (b > 0) { - crypto_core_salsa20(x, z, k, sigma); - for (i = 0; i < b; i++) c[cpos + i] = x[i]; - } - return 0; -} - -function crypto_stream( - c: Uint8Array, - cpos: number, - d: number, - n: Uint8Array, - k: Uint8Array, -) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s, n, k, sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i + 16]; - return crypto_stream_salsa20(c, cpos, d, sn, s); -} - -function crypto_stream_xor( - c: Uint8Array, - cpos: number, - m: Uint8Array, - mpos: number, - d: number, - n: Uint8Array, - k: Uint8Array, -) { - var s = new Uint8Array(32); - crypto_core_hsalsa20(s, n, k, sigma); - var sn = new Uint8Array(8); - for (var i = 0; i < 8; i++) sn[i] = n[i + 16]; - return crypto_stream_salsa20_xor(c, cpos, m, mpos, d, sn, s); -} - -/* - * Port of Andrew Moon's Poly1305-donna-16. Public domain. - * https://github.com/floodyberry/poly1305-donna - */ - -class poly1305 { - buffer = new Uint8Array(16); - r = new Uint16Array(10); - h = new Uint16Array(10); - pad = new Uint16Array(8); - leftover = 0; - fin = 0; - - constructor(key: Uint8Array) { - var t0, t1, t2, t3, t4, t5, t6, t7; - - t0 = (key[0] & 0xff) | ((key[1] & 0xff) << 8); - this.r[0] = t0 & 0x1fff; - t1 = (key[2] & 0xff) | ((key[3] & 0xff) << 8); - this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = (key[4] & 0xff) | ((key[5] & 0xff) << 8); - this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; - t3 = (key[6] & 0xff) | ((key[7] & 0xff) << 8); - this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = (key[8] & 0xff) | ((key[9] & 0xff) << 8); - this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; - this.r[5] = (t4 >>> 1) & 0x1ffe; - t5 = (key[10] & 0xff) | ((key[11] & 0xff) << 8); - this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = (key[12] & 0xff) | ((key[13] & 0xff) << 8); - this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; - t7 = (key[14] & 0xff) | ((key[15] & 0xff) << 8); - this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - this.r[9] = (t7 >>> 5) & 0x007f; - - this.pad[0] = (key[16] & 0xff) | ((key[17] & 0xff) << 8); - this.pad[1] = (key[18] & 0xff) | ((key[19] & 0xff) << 8); - this.pad[2] = (key[20] & 0xff) | ((key[21] & 0xff) << 8); - this.pad[3] = (key[22] & 0xff) | ((key[23] & 0xff) << 8); - this.pad[4] = (key[24] & 0xff) | ((key[25] & 0xff) << 8); - this.pad[5] = (key[26] & 0xff) | ((key[27] & 0xff) << 8); - this.pad[6] = (key[28] & 0xff) | ((key[29] & 0xff) << 8); - this.pad[7] = (key[30] & 0xff) | ((key[31] & 0xff) << 8); - } - - blocks(m: Uint8Array, mpos: number, bytes: number) { - var hibit = this.fin ? 0 : 1 << 11; - var t0, t1, t2, t3, t4, t5, t6, t7, c; - var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; - - var h0 = this.h[0], - h1 = this.h[1], - h2 = this.h[2], - h3 = this.h[3], - h4 = this.h[4], - h5 = this.h[5], - h6 = this.h[6], - h7 = this.h[7], - h8 = this.h[8], - h9 = this.h[9]; - - var r0 = this.r[0], - r1 = this.r[1], - r2 = this.r[2], - r3 = this.r[3], - r4 = this.r[4], - r5 = this.r[5], - r6 = this.r[6], - r7 = this.r[7], - r8 = this.r[8], - r9 = this.r[9]; - - while (bytes >= 16) { - t0 = (m[mpos + 0] & 0xff) | ((m[mpos + 1] & 0xff) << 8); - h0 += t0 & 0x1fff; - t1 = (m[mpos + 2] & 0xff) | ((m[mpos + 3] & 0xff) << 8); - h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; - t2 = (m[mpos + 4] & 0xff) | ((m[mpos + 5] & 0xff) << 8); - h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; - t3 = (m[mpos + 6] & 0xff) | ((m[mpos + 7] & 0xff) << 8); - h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; - t4 = (m[mpos + 8] & 0xff) | ((m[mpos + 9] & 0xff) << 8); - h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; - h5 += (t4 >>> 1) & 0x1fff; - t5 = (m[mpos + 10] & 0xff) | ((m[mpos + 11] & 0xff) << 8); - h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; - t6 = (m[mpos + 12] & 0xff) | ((m[mpos + 13] & 0xff) << 8); - h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; - t7 = (m[mpos + 14] & 0xff) | ((m[mpos + 15] & 0xff) << 8); - h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; - h9 += (t7 >>> 5) | hibit; - - c = 0; - - d0 = c; - d0 += h0 * r0; - d0 += h1 * (5 * r9); - d0 += h2 * (5 * r8); - d0 += h3 * (5 * r7); - d0 += h4 * (5 * r6); - c = d0 >>> 13; - d0 &= 0x1fff; - d0 += h5 * (5 * r5); - d0 += h6 * (5 * r4); - d0 += h7 * (5 * r3); - d0 += h8 * (5 * r2); - d0 += h9 * (5 * r1); - c += d0 >>> 13; - d0 &= 0x1fff; - - d1 = c; - d1 += h0 * r1; - d1 += h1 * r0; - d1 += h2 * (5 * r9); - d1 += h3 * (5 * r8); - d1 += h4 * (5 * r7); - c = d1 >>> 13; - d1 &= 0x1fff; - d1 += h5 * (5 * r6); - d1 += h6 * (5 * r5); - d1 += h7 * (5 * r4); - d1 += h8 * (5 * r3); - d1 += h9 * (5 * r2); - c += d1 >>> 13; - d1 &= 0x1fff; - - d2 = c; - d2 += h0 * r2; - d2 += h1 * r1; - d2 += h2 * r0; - d2 += h3 * (5 * r9); - d2 += h4 * (5 * r8); - c = d2 >>> 13; - d2 &= 0x1fff; - d2 += h5 * (5 * r7); - d2 += h6 * (5 * r6); - d2 += h7 * (5 * r5); - d2 += h8 * (5 * r4); - d2 += h9 * (5 * r3); - c += d2 >>> 13; - d2 &= 0x1fff; - - d3 = c; - d3 += h0 * r3; - d3 += h1 * r2; - d3 += h2 * r1; - d3 += h3 * r0; - d3 += h4 * (5 * r9); - c = d3 >>> 13; - d3 &= 0x1fff; - d3 += h5 * (5 * r8); - d3 += h6 * (5 * r7); - d3 += h7 * (5 * r6); - d3 += h8 * (5 * r5); - d3 += h9 * (5 * r4); - c += d3 >>> 13; - d3 &= 0x1fff; - - d4 = c; - d4 += h0 * r4; - d4 += h1 * r3; - d4 += h2 * r2; - d4 += h3 * r1; - d4 += h4 * r0; - c = d4 >>> 13; - d4 &= 0x1fff; - d4 += h5 * (5 * r9); - d4 += h6 * (5 * r8); - d4 += h7 * (5 * r7); - d4 += h8 * (5 * r6); - d4 += h9 * (5 * r5); - c += d4 >>> 13; - d4 &= 0x1fff; - - d5 = c; - d5 += h0 * r5; - d5 += h1 * r4; - d5 += h2 * r3; - d5 += h3 * r2; - d5 += h4 * r1; - c = d5 >>> 13; - d5 &= 0x1fff; - d5 += h5 * r0; - d5 += h6 * (5 * r9); - d5 += h7 * (5 * r8); - d5 += h8 * (5 * r7); - d5 += h9 * (5 * r6); - c += d5 >>> 13; - d5 &= 0x1fff; - - d6 = c; - d6 += h0 * r6; - d6 += h1 * r5; - d6 += h2 * r4; - d6 += h3 * r3; - d6 += h4 * r2; - c = d6 >>> 13; - d6 &= 0x1fff; - d6 += h5 * r1; - d6 += h6 * r0; - d6 += h7 * (5 * r9); - d6 += h8 * (5 * r8); - d6 += h9 * (5 * r7); - c += d6 >>> 13; - d6 &= 0x1fff; - - d7 = c; - d7 += h0 * r7; - d7 += h1 * r6; - d7 += h2 * r5; - d7 += h3 * r4; - d7 += h4 * r3; - c = d7 >>> 13; - d7 &= 0x1fff; - d7 += h5 * r2; - d7 += h6 * r1; - d7 += h7 * r0; - d7 += h8 * (5 * r9); - d7 += h9 * (5 * r8); - c += d7 >>> 13; - d7 &= 0x1fff; - - d8 = c; - d8 += h0 * r8; - d8 += h1 * r7; - d8 += h2 * r6; - d8 += h3 * r5; - d8 += h4 * r4; - c = d8 >>> 13; - d8 &= 0x1fff; - d8 += h5 * r3; - d8 += h6 * r2; - d8 += h7 * r1; - d8 += h8 * r0; - d8 += h9 * (5 * r9); - c += d8 >>> 13; - d8 &= 0x1fff; - - d9 = c; - d9 += h0 * r9; - d9 += h1 * r8; - d9 += h2 * r7; - d9 += h3 * r6; - d9 += h4 * r5; - c = d9 >>> 13; - d9 &= 0x1fff; - d9 += h5 * r4; - d9 += h6 * r3; - d9 += h7 * r2; - d9 += h8 * r1; - d9 += h9 * r0; - c += d9 >>> 13; - d9 &= 0x1fff; - - c = ((c << 2) + c) | 0; - c = (c + d0) | 0; - d0 = c & 0x1fff; - c = c >>> 13; - d1 += c; - - h0 = d0; - h1 = d1; - h2 = d2; - h3 = d3; - h4 = d4; - h5 = d5; - h6 = d6; - h7 = d7; - h8 = d8; - h9 = d9; - - mpos += 16; - bytes -= 16; - } - this.h[0] = h0; - this.h[1] = h1; - this.h[2] = h2; - this.h[3] = h3; - this.h[4] = h4; - this.h[5] = h5; - this.h[6] = h6; - this.h[7] = h7; - this.h[8] = h8; - this.h[9] = h9; - } - - finish(mac: Uint8Array, macpos: number) { - var g = new Uint16Array(10); - var c, mask, f, i; - - if (this.leftover) { - i = this.leftover; - this.buffer[i++] = 1; - for (; i < 16; i++) this.buffer[i] = 0; - this.fin = 1; - this.blocks(this.buffer, 0, 16); - } - - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - for (i = 2; i < 10; i++) { - this.h[i] += c; - c = this.h[i] >>> 13; - this.h[i] &= 0x1fff; - } - this.h[0] += c * 5; - c = this.h[0] >>> 13; - this.h[0] &= 0x1fff; - this.h[1] += c; - c = this.h[1] >>> 13; - this.h[1] &= 0x1fff; - this.h[2] += c; - - g[0] = this.h[0] + 5; - c = g[0] >>> 13; - g[0] &= 0x1fff; - for (i = 1; i < 10; i++) { - g[i] = this.h[i] + c; - c = g[i] >>> 13; - g[i] &= 0x1fff; - } - g[9] -= 1 << 13; - - mask = (c ^ 1) - 1; - for (i = 0; i < 10; i++) g[i] &= mask; - mask = ~mask; - for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; - - this.h[0] = (this.h[0] | (this.h[1] << 13)) & 0xffff; - this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10)) & 0xffff; - this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7)) & 0xffff; - this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4)) & 0xffff; - this.h[4] = - ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; - this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11)) & 0xffff; - this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8)) & 0xffff; - this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5)) & 0xffff; - - f = this.h[0] + this.pad[0]; - this.h[0] = f & 0xffff; - for (i = 1; i < 8; i++) { - f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; - this.h[i] = f & 0xffff; - } - - mac[macpos + 0] = (this.h[0] >>> 0) & 0xff; - mac[macpos + 1] = (this.h[0] >>> 8) & 0xff; - mac[macpos + 2] = (this.h[1] >>> 0) & 0xff; - mac[macpos + 3] = (this.h[1] >>> 8) & 0xff; - mac[macpos + 4] = (this.h[2] >>> 0) & 0xff; - mac[macpos + 5] = (this.h[2] >>> 8) & 0xff; - mac[macpos + 6] = (this.h[3] >>> 0) & 0xff; - mac[macpos + 7] = (this.h[3] >>> 8) & 0xff; - mac[macpos + 8] = (this.h[4] >>> 0) & 0xff; - mac[macpos + 9] = (this.h[4] >>> 8) & 0xff; - mac[macpos + 10] = (this.h[5] >>> 0) & 0xff; - mac[macpos + 11] = (this.h[5] >>> 8) & 0xff; - mac[macpos + 12] = (this.h[6] >>> 0) & 0xff; - mac[macpos + 13] = (this.h[6] >>> 8) & 0xff; - mac[macpos + 14] = (this.h[7] >>> 0) & 0xff; - mac[macpos + 15] = (this.h[7] >>> 8) & 0xff; - } - - update(m: Uint8Array, mpos: number, bytes: number) { - var i, want; - - if (this.leftover) { - want = 16 - this.leftover; - if (want > bytes) want = bytes; - for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos + i]; - bytes -= want; - mpos += want; - this.leftover += want; - if (this.leftover < 16) return; - this.blocks(this.buffer, 0, 16); - this.leftover = 0; - } - - if (bytes >= 16) { - want = bytes - (bytes % 16); - this.blocks(m, mpos, want); - mpos += want; - bytes -= want; - } - - if (bytes) { - for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos + i]; - this.leftover += bytes; - } - } -} - -function crypto_onetimeauth( - out: Uint8Array, - outpos: number, - m: Uint8Array, - mpos: number, - n: number, - k: Uint8Array, -) { - var s = new poly1305(k); - s.update(m, mpos, n); - s.finish(out, outpos); - return 0; -} - -function crypto_onetimeauth_verify( - h: Uint8Array, - hpos: number, - m: Uint8Array, - mpos: number, - n: number, - k: Uint8Array, -) { - var x = new Uint8Array(16); - crypto_onetimeauth(x, 0, m, mpos, n, k); - return crypto_verify_16(h, hpos, x, 0); -} - -function crypto_secretbox( - c: Uint8Array, - m: Uint8Array, - d: number, - n: Uint8Array, - k: Uint8Array, -) { - var i; - if (d < 32) return -1; - crypto_stream_xor(c, 0, m, 0, d, n, k); - crypto_onetimeauth(c, 16, c, 32, d - 32, c); - for (i = 0; i < 16; i++) c[i] = 0; - return 0; -} - -function crypto_secretbox_open( - m: Uint8Array, - c: Uint8Array, - d: number, - n: Uint8Array, - k: Uint8Array, -) { - var i; - var x = new Uint8Array(32); - if (d < 32) return -1; - crypto_stream(x, 0, 32, n, k); - if (crypto_onetimeauth_verify(c, 16, c, 32, d - 32, x) !== 0) return -1; - crypto_stream_xor(m, 0, c, 0, d, n, k); - for (i = 0; i < 32; i++) m[i] = 0; - return 0; -} - -function set25519(r: Float64Array, a: Float64Array) { - var i; - for (i = 0; i < 16; i++) r[i] = a[i] | 0; -} - -function car25519(o: Float64Array) { - var i, - v, - c = 1; - for (i = 0; i < 16; i++) { - v = o[i] + c + 65535; - c = Math.floor(v / 65536); - o[i] = v - c * 65536; - } - o[0] += c - 1 + 37 * (c - 1); -} - -function sel25519(p: Float64Array, q: Float64Array, b: number) { - var t, - c = ~(b - 1); - for (var i = 0; i < 16; i++) { - t = c & (p[i] ^ q[i]); - p[i] ^= t; - q[i] ^= t; - } -} - -function pack25519(o: Uint8Array, n: Float64Array) { - var i, j, b; - var m = gf(), - t = gf(); - for (i = 0; i < 16; i++) t[i] = n[i]; - car25519(t); - car25519(t); - car25519(t); - for (j = 0; j < 2; j++) { - m[0] = t[0] - 0xffed; - for (i = 1; i < 15; i++) { - m[i] = t[i] - 0xffff - ((m[i - 1] >> 16) & 1); - m[i - 1] &= 0xffff; - } - m[15] = t[15] - 0x7fff - ((m[14] >> 16) & 1); - b = (m[15] >> 16) & 1; - m[14] &= 0xffff; - sel25519(t, m, 1 - b); - } - for (i = 0; i < 16; i++) { - o[2 * i] = t[i] & 0xff; - o[2 * i + 1] = t[i] >> 8; - } -} - -function neq25519(a: Float64Array, b: Float64Array) { - var c = new Uint8Array(32), - d = new Uint8Array(32); - pack25519(c, a); - pack25519(d, b); - return crypto_verify_32(c, 0, d, 0); -} - -function par25519(a: Float64Array) { - var d = new Uint8Array(32); - pack25519(d, a); - return d[0] & 1; -} - -function unpack25519(o: Float64Array, n: Uint8Array) { - var i; - for (i = 0; i < 16; i++) o[i] = n[2 * i] + (n[2 * i + 1] << 8); - o[15] &= 0x7fff; -} - -function A(o: Float64Array, a: Float64Array, b: Float64Array) { - for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; -} - -function Z(o: Float64Array, a: Float64Array, b: Float64Array) { - for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; -} - -function M(o: Float64Array, a: Float64Array, b: Float64Array) { - var v, - c, - t0 = 0, - t1 = 0, - t2 = 0, - t3 = 0, - t4 = 0, - t5 = 0, - t6 = 0, - t7 = 0, - t8 = 0, - t9 = 0, - t10 = 0, - t11 = 0, - t12 = 0, - t13 = 0, - t14 = 0, - t15 = 0, - t16 = 0, - t17 = 0, - t18 = 0, - t19 = 0, - t20 = 0, - t21 = 0, - t22 = 0, - t23 = 0, - t24 = 0, - t25 = 0, - t26 = 0, - t27 = 0, - t28 = 0, - t29 = 0, - t30 = 0, - b0 = b[0], - b1 = b[1], - b2 = b[2], - b3 = b[3], - b4 = b[4], - b5 = b[5], - b6 = b[6], - b7 = b[7], - b8 = b[8], - b9 = b[9], - b10 = b[10], - b11 = b[11], - b12 = b[12], - b13 = b[13], - b14 = b[14], - b15 = b[15]; - - v = a[0]; - t0 += v * b0; - t1 += v * b1; - t2 += v * b2; - t3 += v * b3; - t4 += v * b4; - t5 += v * b5; - t6 += v * b6; - t7 += v * b7; - t8 += v * b8; - t9 += v * b9; - t10 += v * b10; - t11 += v * b11; - t12 += v * b12; - t13 += v * b13; - t14 += v * b14; - t15 += v * b15; - v = a[1]; - t1 += v * b0; - t2 += v * b1; - t3 += v * b2; - t4 += v * b3; - t5 += v * b4; - t6 += v * b5; - t7 += v * b6; - t8 += v * b7; - t9 += v * b8; - t10 += v * b9; - t11 += v * b10; - t12 += v * b11; - t13 += v * b12; - t14 += v * b13; - t15 += v * b14; - t16 += v * b15; - v = a[2]; - t2 += v * b0; - t3 += v * b1; - t4 += v * b2; - t5 += v * b3; - t6 += v * b4; - t7 += v * b5; - t8 += v * b6; - t9 += v * b7; - t10 += v * b8; - t11 += v * b9; - t12 += v * b10; - t13 += v * b11; - t14 += v * b12; - t15 += v * b13; - t16 += v * b14; - t17 += v * b15; - v = a[3]; - t3 += v * b0; - t4 += v * b1; - t5 += v * b2; - t6 += v * b3; - t7 += v * b4; - t8 += v * b5; - t9 += v * b6; - t10 += v * b7; - t11 += v * b8; - t12 += v * b9; - t13 += v * b10; - t14 += v * b11; - t15 += v * b12; - t16 += v * b13; - t17 += v * b14; - t18 += v * b15; - v = a[4]; - t4 += v * b0; - t5 += v * b1; - t6 += v * b2; - t7 += v * b3; - t8 += v * b4; - t9 += v * b5; - t10 += v * b6; - t11 += v * b7; - t12 += v * b8; - t13 += v * b9; - t14 += v * b10; - t15 += v * b11; - t16 += v * b12; - t17 += v * b13; - t18 += v * b14; - t19 += v * b15; - v = a[5]; - t5 += v * b0; - t6 += v * b1; - t7 += v * b2; - t8 += v * b3; - t9 += v * b4; - t10 += v * b5; - t11 += v * b6; - t12 += v * b7; - t13 += v * b8; - t14 += v * b9; - t15 += v * b10; - t16 += v * b11; - t17 += v * b12; - t18 += v * b13; - t19 += v * b14; - t20 += v * b15; - v = a[6]; - t6 += v * b0; - t7 += v * b1; - t8 += v * b2; - t9 += v * b3; - t10 += v * b4; - t11 += v * b5; - t12 += v * b6; - t13 += v * b7; - t14 += v * b8; - t15 += v * b9; - t16 += v * b10; - t17 += v * b11; - t18 += v * b12; - t19 += v * b13; - t20 += v * b14; - t21 += v * b15; - v = a[7]; - t7 += v * b0; - t8 += v * b1; - t9 += v * b2; - t10 += v * b3; - t11 += v * b4; - t12 += v * b5; - t13 += v * b6; - t14 += v * b7; - t15 += v * b8; - t16 += v * b9; - t17 += v * b10; - t18 += v * b11; - t19 += v * b12; - t20 += v * b13; - t21 += v * b14; - t22 += v * b15; - v = a[8]; - t8 += v * b0; - t9 += v * b1; - t10 += v * b2; - t11 += v * b3; - t12 += v * b4; - t13 += v * b5; - t14 += v * b6; - t15 += v * b7; - t16 += v * b8; - t17 += v * b9; - t18 += v * b10; - t19 += v * b11; - t20 += v * b12; - t21 += v * b13; - t22 += v * b14; - t23 += v * b15; - v = a[9]; - t9 += v * b0; - t10 += v * b1; - t11 += v * b2; - t12 += v * b3; - t13 += v * b4; - t14 += v * b5; - t15 += v * b6; - t16 += v * b7; - t17 += v * b8; - t18 += v * b9; - t19 += v * b10; - t20 += v * b11; - t21 += v * b12; - t22 += v * b13; - t23 += v * b14; - t24 += v * b15; - v = a[10]; - t10 += v * b0; - t11 += v * b1; - t12 += v * b2; - t13 += v * b3; - t14 += v * b4; - t15 += v * b5; - t16 += v * b6; - t17 += v * b7; - t18 += v * b8; - t19 += v * b9; - t20 += v * b10; - t21 += v * b11; - t22 += v * b12; - t23 += v * b13; - t24 += v * b14; - t25 += v * b15; - v = a[11]; - t11 += v * b0; - t12 += v * b1; - t13 += v * b2; - t14 += v * b3; - t15 += v * b4; - t16 += v * b5; - t17 += v * b6; - t18 += v * b7; - t19 += v * b8; - t20 += v * b9; - t21 += v * b10; - t22 += v * b11; - t23 += v * b12; - t24 += v * b13; - t25 += v * b14; - t26 += v * b15; - v = a[12]; - t12 += v * b0; - t13 += v * b1; - t14 += v * b2; - t15 += v * b3; - t16 += v * b4; - t17 += v * b5; - t18 += v * b6; - t19 += v * b7; - t20 += v * b8; - t21 += v * b9; - t22 += v * b10; - t23 += v * b11; - t24 += v * b12; - t25 += v * b13; - t26 += v * b14; - t27 += v * b15; - v = a[13]; - t13 += v * b0; - t14 += v * b1; - t15 += v * b2; - t16 += v * b3; - t17 += v * b4; - t18 += v * b5; - t19 += v * b6; - t20 += v * b7; - t21 += v * b8; - t22 += v * b9; - t23 += v * b10; - t24 += v * b11; - t25 += v * b12; - t26 += v * b13; - t27 += v * b14; - t28 += v * b15; - v = a[14]; - t14 += v * b0; - t15 += v * b1; - t16 += v * b2; - t17 += v * b3; - t18 += v * b4; - t19 += v * b5; - t20 += v * b6; - t21 += v * b7; - t22 += v * b8; - t23 += v * b9; - t24 += v * b10; - t25 += v * b11; - t26 += v * b12; - t27 += v * b13; - t28 += v * b14; - t29 += v * b15; - v = a[15]; - t15 += v * b0; - t16 += v * b1; - t17 += v * b2; - t18 += v * b3; - t19 += v * b4; - t20 += v * b5; - t21 += v * b6; - t22 += v * b7; - t23 += v * b8; - t24 += v * b9; - t25 += v * b10; - t26 += v * b11; - t27 += v * b12; - t28 += v * b13; - t29 += v * b14; - t30 += v * b15; - - t0 += 38 * t16; - t1 += 38 * t17; - t2 += 38 * t18; - t3 += 38 * t19; - t4 += 38 * t20; - t5 += 38 * t21; - t6 += 38 * t22; - t7 += 38 * t23; - t8 += 38 * t24; - t9 += 38 * t25; - t10 += 38 * t26; - t11 += 38 * t27; - t12 += 38 * t28; - t13 += 38 * t29; - t14 += 38 * t30; - // t15 left as is - - // first car - c = 1; - v = t0 + c + 65535; - c = Math.floor(v / 65536); - t0 = v - c * 65536; - v = t1 + c + 65535; - c = Math.floor(v / 65536); - t1 = v - c * 65536; - v = t2 + c + 65535; - c = Math.floor(v / 65536); - t2 = v - c * 65536; - v = t3 + c + 65535; - c = Math.floor(v / 65536); - t3 = v - c * 65536; - v = t4 + c + 65535; - c = Math.floor(v / 65536); - t4 = v - c * 65536; - v = t5 + c + 65535; - c = Math.floor(v / 65536); - t5 = v - c * 65536; - v = t6 + c + 65535; - c = Math.floor(v / 65536); - t6 = v - c * 65536; - v = t7 + c + 65535; - c = Math.floor(v / 65536); - t7 = v - c * 65536; - v = t8 + c + 65535; - c = Math.floor(v / 65536); - t8 = v - c * 65536; - v = t9 + c + 65535; - c = Math.floor(v / 65536); - t9 = v - c * 65536; - v = t10 + c + 65535; - c = Math.floor(v / 65536); - t10 = v - c * 65536; - v = t11 + c + 65535; - c = Math.floor(v / 65536); - t11 = v - c * 65536; - v = t12 + c + 65535; - c = Math.floor(v / 65536); - t12 = v - c * 65536; - v = t13 + c + 65535; - c = Math.floor(v / 65536); - t13 = v - c * 65536; - v = t14 + c + 65535; - c = Math.floor(v / 65536); - t14 = v - c * 65536; - v = t15 + c + 65535; - c = Math.floor(v / 65536); - t15 = v - c * 65536; - t0 += c - 1 + 37 * (c - 1); - - // second car - c = 1; - v = t0 + c + 65535; - c = Math.floor(v / 65536); - t0 = v - c * 65536; - v = t1 + c + 65535; - c = Math.floor(v / 65536); - t1 = v - c * 65536; - v = t2 + c + 65535; - c = Math.floor(v / 65536); - t2 = v - c * 65536; - v = t3 + c + 65535; - c = Math.floor(v / 65536); - t3 = v - c * 65536; - v = t4 + c + 65535; - c = Math.floor(v / 65536); - t4 = v - c * 65536; - v = t5 + c + 65535; - c = Math.floor(v / 65536); - t5 = v - c * 65536; - v = t6 + c + 65535; - c = Math.floor(v / 65536); - t6 = v - c * 65536; - v = t7 + c + 65535; - c = Math.floor(v / 65536); - t7 = v - c * 65536; - v = t8 + c + 65535; - c = Math.floor(v / 65536); - t8 = v - c * 65536; - v = t9 + c + 65535; - c = Math.floor(v / 65536); - t9 = v - c * 65536; - v = t10 + c + 65535; - c = Math.floor(v / 65536); - t10 = v - c * 65536; - v = t11 + c + 65535; - c = Math.floor(v / 65536); - t11 = v - c * 65536; - v = t12 + c + 65535; - c = Math.floor(v / 65536); - t12 = v - c * 65536; - v = t13 + c + 65535; - c = Math.floor(v / 65536); - t13 = v - c * 65536; - v = t14 + c + 65535; - c = Math.floor(v / 65536); - t14 = v - c * 65536; - v = t15 + c + 65535; - c = Math.floor(v / 65536); - t15 = v - c * 65536; - t0 += c - 1 + 37 * (c - 1); - - o[0] = t0; - o[1] = t1; - o[2] = t2; - o[3] = t3; - o[4] = t4; - o[5] = t5; - o[6] = t6; - o[7] = t7; - o[8] = t8; - o[9] = t9; - o[10] = t10; - o[11] = t11; - o[12] = t12; - o[13] = t13; - o[14] = t14; - o[15] = t15; -} - -function S(o: Float64Array, a: Float64Array) { - M(o, a, a); -} - -function inv25519(o: Float64Array, i: Float64Array) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 253; a >= 0; a--) { - S(c, c); - if (a !== 2 && a !== 4) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} - -function pow2523(o: Float64Array, i: Float64Array) { - var c = gf(); - var a; - for (a = 0; a < 16; a++) c[a] = i[a]; - for (a = 250; a >= 0; a--) { - S(c, c); - if (a !== 1) M(c, c, i); - } - for (a = 0; a < 16; a++) o[a] = c[a]; -} - -function crypto_scalarmult(q: Uint8Array, n: Uint8Array, p: Uint8Array) { - var z = new Uint8Array(32); - var x = new Float64Array(80), - r, - i; - var a = gf(), - b = gf(), - c = gf(), - d = gf(), - e = gf(), - f = gf(); - for (i = 0; i < 31; i++) z[i] = n[i]; - z[31] = (n[31] & 127) | 64; - z[0] &= 248; - unpack25519(x, p); - for (i = 0; i < 16; i++) { - b[i] = x[i]; - d[i] = a[i] = c[i] = 0; - } - a[0] = d[0] = 1; - for (i = 254; i >= 0; --i) { - r = (z[i >>> 3] >>> (i & 7)) & 1; - sel25519(a, b, r); - sel25519(c, d, r); - A(e, a, c); - Z(a, a, c); - A(c, b, d); - Z(b, b, d); - S(d, e); - S(f, a); - M(a, c, a); - M(c, b, e); - A(e, a, c); - Z(a, a, c); - S(b, a); - Z(c, d, f); - M(a, c, _121665); - A(a, a, d); - M(c, c, a); - M(a, d, f); - M(d, b, x); - S(b, e); - sel25519(a, b, r); - sel25519(c, d, r); - } - for (i = 0; i < 16; i++) { - x[i + 16] = a[i]; - x[i + 32] = c[i]; - x[i + 48] = b[i]; - x[i + 64] = d[i]; - } - var x32 = x.subarray(32); - var x16 = x.subarray(16); - inv25519(x32, x32); - M(x16, x16, x32); - pack25519(q, x16); - return 0; -} - -function crypto_scalarmult_base(q: Uint8Array, n: Uint8Array) { - return crypto_scalarmult(q, n, _9); -} - -function crypto_box_keypair(y: Uint8Array, x: Uint8Array) { - randombytes(x, 32); - return crypto_scalarmult_base(y, x); -} - -function crypto_box_beforenm(k: Uint8Array, y: Uint8Array, x: Uint8Array) { - var s = new Uint8Array(32); - crypto_scalarmult(s, x, y); - return crypto_core_hsalsa20(k, _0, s, sigma); -} - -var crypto_box_afternm = crypto_secretbox; -var crypto_box_open_afternm = crypto_secretbox_open; - -function crypto_box( - c: Uint8Array, - m: Uint8Array, - d: number, - n: Uint8Array, - y: Uint8Array, - x: Uint8Array, -) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_afternm(c, m, d, n, k); -} - -function crypto_box_open( - m: Uint8Array, - c: Uint8Array, - d: number, - n: Uint8Array, - y: Uint8Array, - x: Uint8Array, -) { - var k = new Uint8Array(32); - crypto_box_beforenm(k, y, x); - return crypto_box_open_afternm(m, c, d, n, k); -} - -// prettier-ignore -var K = [ - 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, - 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, - 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, - 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, - 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, - 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, - 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, - 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, - 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, - 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, - 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, - 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, - 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, - 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, - 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, - 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, - 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, - 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, - 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, - 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, - 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, - 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, - 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, - 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, - 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, - 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, - 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, - 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, - 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, - 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, - 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, - 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, - 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, - 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, - 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, - 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, - 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, - 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, - 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, - 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 -]; - -function crypto_hashblocks_hl( - hh: Int32Array, - hl: Int32Array, - m: Uint8Array, - n: number, -) { - var wh = new Int32Array(16), - wl = new Int32Array(16), - bh0, - bh1, - bh2, - bh3, - bh4, - bh5, - bh6, - bh7, - bl0, - bl1, - bl2, - bl3, - bl4, - bl5, - bl6, - bl7, - th, - tl, - i, - j, - h, - l, - a, - b, - c, - d; - - var ah0 = hh[0], - ah1 = hh[1], - ah2 = hh[2], - ah3 = hh[3], - ah4 = hh[4], - ah5 = hh[5], - ah6 = hh[6], - ah7 = hh[7], - al0 = hl[0], - al1 = hl[1], - al2 = hl[2], - al3 = hl[3], - al4 = hl[4], - al5 = hl[5], - al6 = hl[6], - al7 = hl[7]; - - var pos = 0; - while (n >= 128) { - for (i = 0; i < 16; i++) { - j = 8 * i + pos; - wh[i] = (m[j + 0] << 24) | (m[j + 1] << 16) | (m[j + 2] << 8) | m[j + 3]; - wl[i] = (m[j + 4] << 24) | (m[j + 5] << 16) | (m[j + 6] << 8) | m[j + 7]; - } - for (i = 0; i < 80; i++) { - bh0 = ah0; - bh1 = ah1; - bh2 = ah2; - bh3 = ah3; - bh4 = ah4; - bh5 = ah5; - bh6 = ah6; - bh7 = ah7; - - bl0 = al0; - bl1 = al1; - bl2 = al2; - bl3 = al3; - bl4 = al4; - bl5 = al5; - bl6 = al6; - bl7 = al7; - - // add - h = ah7; - l = al7; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - // Sigma1 - h = - ((ah4 >>> 14) | (al4 << (32 - 14))) ^ - ((ah4 >>> 18) | (al4 << (32 - 18))) ^ - ((al4 >>> (41 - 32)) | (ah4 << (32 - (41 - 32)))); - l = - ((al4 >>> 14) | (ah4 << (32 - 14))) ^ - ((al4 >>> 18) | (ah4 << (32 - 18))) ^ - ((ah4 >>> (41 - 32)) | (al4 << (32 - (41 - 32)))); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // Ch - h = (ah4 & ah5) ^ (~ah4 & ah6); - l = (al4 & al5) ^ (~al4 & al6); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // K - h = K[i * 2]; - l = K[i * 2 + 1]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // w - h = wh[i % 16]; - l = wl[i % 16]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - th = (c & 0xffff) | (d << 16); - tl = (a & 0xffff) | (b << 16); - - // add - h = th; - l = tl; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - // Sigma0 - h = - ((ah0 >>> 28) | (al0 << (32 - 28))) ^ - ((al0 >>> (34 - 32)) | (ah0 << (32 - (34 - 32)))) ^ - ((al0 >>> (39 - 32)) | (ah0 << (32 - (39 - 32)))); - l = - ((al0 >>> 28) | (ah0 << (32 - 28))) ^ - ((ah0 >>> (34 - 32)) | (al0 << (32 - (34 - 32)))) ^ - ((ah0 >>> (39 - 32)) | (al0 << (32 - (39 - 32)))); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // Maj - h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); - l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh7 = (c & 0xffff) | (d << 16); - bl7 = (a & 0xffff) | (b << 16); - - // add - h = bh3; - l = bl3; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = th; - l = tl; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - bh3 = (c & 0xffff) | (d << 16); - bl3 = (a & 0xffff) | (b << 16); - - ah1 = bh0; - ah2 = bh1; - ah3 = bh2; - ah4 = bh3; - ah5 = bh4; - ah6 = bh5; - ah7 = bh6; - ah0 = bh7; - - al1 = bl0; - al2 = bl1; - al3 = bl2; - al4 = bl3; - al5 = bl4; - al6 = bl5; - al7 = bl6; - al0 = bl7; - - if (i % 16 === 15) { - for (j = 0; j < 16; j++) { - // add - h = wh[j]; - l = wl[j]; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = wh[(j + 9) % 16]; - l = wl[(j + 9) % 16]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // sigma0 - th = wh[(j + 1) % 16]; - tl = wl[(j + 1) % 16]; - h = - ((th >>> 1) | (tl << (32 - 1))) ^ - ((th >>> 8) | (tl << (32 - 8))) ^ - (th >>> 7); - l = - ((tl >>> 1) | (th << (32 - 1))) ^ - ((tl >>> 8) | (th << (32 - 8))) ^ - ((tl >>> 7) | (th << (32 - 7))); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - // sigma1 - th = wh[(j + 14) % 16]; - tl = wl[(j + 14) % 16]; - h = - ((th >>> 19) | (tl << (32 - 19))) ^ - ((tl >>> (61 - 32)) | (th << (32 - (61 - 32)))) ^ - (th >>> 6); - l = - ((tl >>> 19) | (th << (32 - 19))) ^ - ((th >>> (61 - 32)) | (tl << (32 - (61 - 32)))) ^ - ((tl >>> 6) | (th << (32 - 6))); - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - wh[j] = (c & 0xffff) | (d << 16); - wl[j] = (a & 0xffff) | (b << 16); - } - } - } - - // add - h = ah0; - l = al0; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[0]; - l = hl[0]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[0] = ah0 = (c & 0xffff) | (d << 16); - hl[0] = al0 = (a & 0xffff) | (b << 16); - - h = ah1; - l = al1; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[1]; - l = hl[1]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[1] = ah1 = (c & 0xffff) | (d << 16); - hl[1] = al1 = (a & 0xffff) | (b << 16); - - h = ah2; - l = al2; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[2]; - l = hl[2]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[2] = ah2 = (c & 0xffff) | (d << 16); - hl[2] = al2 = (a & 0xffff) | (b << 16); - - h = ah3; - l = al3; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[3]; - l = hl[3]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[3] = ah3 = (c & 0xffff) | (d << 16); - hl[3] = al3 = (a & 0xffff) | (b << 16); - - h = ah4; - l = al4; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[4]; - l = hl[4]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[4] = ah4 = (c & 0xffff) | (d << 16); - hl[4] = al4 = (a & 0xffff) | (b << 16); - - h = ah5; - l = al5; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[5]; - l = hl[5]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[5] = ah5 = (c & 0xffff) | (d << 16); - hl[5] = al5 = (a & 0xffff) | (b << 16); - - h = ah6; - l = al6; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[6]; - l = hl[6]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[6] = ah6 = (c & 0xffff) | (d << 16); - hl[6] = al6 = (a & 0xffff) | (b << 16); - - h = ah7; - l = al7; - - a = l & 0xffff; - b = l >>> 16; - c = h & 0xffff; - d = h >>> 16; - - h = hh[7]; - l = hl[7]; - - a += l & 0xffff; - b += l >>> 16; - c += h & 0xffff; - d += h >>> 16; - - b += a >>> 16; - c += b >>> 16; - d += c >>> 16; - - hh[7] = ah7 = (c & 0xffff) | (d << 16); - hl[7] = al7 = (a & 0xffff) | (b << 16); - - pos += 128; - n -= 128; - } - - return n; -} - -function crypto_hash(out: Uint8Array, m: Uint8Array, n: number) { - const hh = new Int32Array(8); - const hl = new Int32Array(8); - const x = new Uint8Array(256); - let i; - let b = n; - - hh[0] = 0x6a09e667; - hh[1] = 0xbb67ae85; - hh[2] = 0x3c6ef372; - hh[3] = 0xa54ff53a; - hh[4] = 0x510e527f; - hh[5] = 0x9b05688c; - hh[6] = 0x1f83d9ab; - hh[7] = 0x5be0cd19; - - hl[0] = 0xf3bcc908; - hl[1] = 0x84caa73b; - hl[2] = 0xfe94f82b; - hl[3] = 0x5f1d36f1; - hl[4] = 0xade682d1; - hl[5] = 0x2b3e6c1f; - hl[6] = 0xfb41bd6b; - hl[7] = 0x137e2179; - - crypto_hashblocks_hl(hh, hl, m, n); - n %= 128; - - for (i = 0; i < n; i++) x[i] = m[b - n + i]; - x[n] = 128; - - n = 256 - 128 * (n < 112 ? 1 : 0); - x[n - 9] = 0; - ts64(x, n - 8, (b / 0x20000000) | 0, b << 3); - crypto_hashblocks_hl(hh, hl, x, n); - - for (i = 0; i < 8; i++) ts64(out, 8 * i, hh[i], hl[i]); - - return 0; -} - -function add(p: Float64Array[], q: Float64Array[]) { - var a = gf(), - b = gf(), - c = gf(), - d = gf(), - e = gf(), - f = gf(), - g = gf(), - h = gf(), - t = gf(); - - Z(a, p[1], p[0]); - Z(t, q[1], q[0]); - M(a, a, t); - A(b, p[0], p[1]); - A(t, q[0], q[1]); - M(b, b, t); - M(c, p[3], q[3]); - M(c, c, D2); - M(d, p[2], q[2]); - A(d, d, d); - Z(e, b, a); - Z(f, d, c); - A(g, d, c); - A(h, b, a); - - M(p[0], e, f); - M(p[1], h, g); - M(p[2], g, f); - M(p[3], e, h); -} - -function cswap(p: Float64Array[], q: Float64Array[], b: number) { - var i; - for (i = 0; i < 4; i++) { - sel25519(p[i], q[i], b); - } -} - -function pack(r: Uint8Array, p: Float64Array[]) { - var tx = gf(), - ty = gf(), - zi = gf(); - inv25519(zi, p[2]); - M(tx, p[0], zi); - M(ty, p[1], zi); - pack25519(r, ty); - r[31] ^= par25519(tx) << 7; -} - -function scalarmult(p: Float64Array[], q: Float64Array[], s: Uint8Array) { - var b, i; - set25519(p[0], gf0); - set25519(p[1], gf1); - set25519(p[2], gf1); - set25519(p[3], gf0); - for (i = 255; i >= 0; --i) { - b = (s[(i / 8) | 0] >> (i & 7)) & 1; - cswap(p, q, b); - add(q, p); - add(p, p); - cswap(p, q, b); - } -} - -function scalarbase(p: Float64Array[], s: Uint8Array) { - const q = [gf(), gf(), gf(), gf()]; - set25519(q[0], X); - set25519(q[1], Y); - set25519(q[2], gf1); - M(q[3], X, Y); - scalarmult(p, q, s); -} - -function crypto_sign_keypair( - pk: Uint8Array, - sk: Uint8Array, - seeded: boolean, -): number { - const d = new Uint8Array(64); - const p = [gf(), gf(), gf(), gf()]; - - if (!seeded) randombytes(sk, 32); - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - scalarbase(p, d); - pack(pk, p); - - for (let i = 0; i < 32; i++) sk[i + 32] = pk[i]; - return 0; -} - -var L = new Float64Array([ - 0xed, - 0xd3, - 0xf5, - 0x5c, - 0x1a, - 0x63, - 0x12, - 0x58, - 0xd6, - 0x9c, - 0xf7, - 0xa2, - 0xde, - 0xf9, - 0xde, - 0x14, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0, - 0x10, -]); - -function modL(r: Uint8Array, x: Float64Array) { - var carry, i, j, k; - for (i = 63; i >= 32; --i) { - carry = 0; - for (j = i - 32, k = i - 12; j < k; ++j) { - x[j] += carry - 16 * x[i] * L[j - (i - 32)]; - carry = (x[j] + 128) >> 8; - x[j] -= carry * 256; - } - x[j] += carry; - x[i] = 0; - } - carry = 0; - for (j = 0; j < 32; j++) { - x[j] += carry - (x[31] >> 4) * L[j]; - carry = x[j] >> 8; - x[j] &= 255; - } - for (j = 0; j < 32; j++) x[j] -= carry * L[j]; - for (i = 0; i < 32; i++) { - x[i + 1] += x[i] >> 8; - r[i] = x[i] & 255; - } -} - -function reduce(r: Uint8Array) { - const x = new Float64Array(64); - for (let i = 0; i < 64; i++) x[i] = r[i]; - for (let i = 0; i < 64; i++) r[i] = 0; - modL(r, x); -} - -// Note: difference from C - smlen returned, not passed as argument. -function crypto_sign(sm: Uint8Array, m: Uint8Array, n: number, sk: Uint8Array) { - var d = new Uint8Array(64), - h = new Uint8Array(64), - r = new Uint8Array(64); - var i, - j, - x = new Float64Array(64); - var p = [gf(), gf(), gf(), gf()]; - - crypto_hash(d, sk, 32); - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - var smlen = n + 64; - for (i = 0; i < n; i++) sm[64 + i] = m[i]; - for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; - - crypto_hash(r, sm.subarray(32), n + 32); - reduce(r); - scalarbase(p, r); - pack(sm, p); - - for (i = 32; i < 64; i++) sm[i] = sk[i]; - crypto_hash(h, sm, n + 64); - reduce(h); - - for (i = 0; i < 64; i++) x[i] = 0; - for (i = 0; i < 32; i++) x[i] = r[i]; - for (i = 0; i < 32; i++) { - for (j = 0; j < 32; j++) { - x[i + j] += h[i] * d[j]; - } - } - - modL(sm.subarray(32), x); - return smlen; -} - -function unpackneg(r: Float64Array[], p: Uint8Array) { - const t = gf(); - const chk = gf(); - const num = gf(); - const den = gf(); - const den2 = gf(); - const den4 = gf(); - const den6 = gf(); - - set25519(r[2], gf1); - unpack25519(r[1], p); - S(num, r[1]); - M(den, num, D); - Z(num, num, r[2]); - A(den, r[2], den); - - S(den2, den); - S(den4, den2); - M(den6, den4, den2); - M(t, den6, num); - M(t, t, den); - - pow2523(t, t); - M(t, t, num); - M(t, t, den); - M(t, t, den); - M(r[0], t, den); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) M(r[0], r[0], I); - - S(chk, r[0]); - M(chk, chk, den); - if (neq25519(chk, num)) return -1; - - if (par25519(r[0]) === p[31] >> 7) Z(r[0], gf0, r[0]); - - M(r[3], r[0], r[1]); - return 0; -} - -function crypto_sign_open( - m: Uint8Array, - sm: Uint8Array, - n: number, - pk: Uint8Array, -) { - var i, mlen; - var t = new Uint8Array(32), - h = new Uint8Array(64); - var p = [gf(), gf(), gf(), gf()], - q = [gf(), gf(), gf(), gf()]; - - mlen = -1; - if (n < 64) return -1; - - if (unpackneg(q, pk)) return -1; - - for (i = 0; i < n; i++) m[i] = sm[i]; - for (i = 0; i < 32; i++) m[i + 32] = pk[i]; - crypto_hash(h, m, n); - reduce(h); - scalarmult(p, q, h); - - scalarbase(q, sm.subarray(32)); - add(p, q); - pack(t, p); - - n -= 64; - if (crypto_verify_32(sm, 0, t, 0)) { - for (i = 0; i < n; i++) m[i] = 0; - return -1; - } - - for (i = 0; i < n; i++) m[i] = sm[i + 64]; - mlen = n; - return mlen; -} - -var crypto_secretbox_KEYBYTES = 32, - crypto_secretbox_NONCEBYTES = 24, - crypto_secretbox_ZEROBYTES = 32, - crypto_secretbox_BOXZEROBYTES = 16, - crypto_scalarmult_BYTES = 32, - crypto_scalarmult_SCALARBYTES = 32, - crypto_box_PUBLICKEYBYTES = 32, - crypto_box_SECRETKEYBYTES = 32, - crypto_box_BEFORENMBYTES = 32, - crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, - crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, - crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, - crypto_sign_BYTES = 64, - crypto_sign_PUBLICKEYBYTES = 32, - crypto_sign_SECRETKEYBYTES = 64, - crypto_sign_SEEDBYTES = 32, - crypto_hash_BYTES = 64; - -const lowlevel = { - crypto_core_hsalsa20: crypto_core_hsalsa20, - crypto_stream_xor: crypto_stream_xor, - crypto_stream: crypto_stream, - crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, - crypto_stream_salsa20: crypto_stream_salsa20, - crypto_onetimeauth: crypto_onetimeauth, - crypto_onetimeauth_verify: crypto_onetimeauth_verify, - crypto_verify_16: crypto_verify_16, - crypto_verify_32: crypto_verify_32, - crypto_secretbox: crypto_secretbox, - crypto_secretbox_open: crypto_secretbox_open, - crypto_scalarmult: crypto_scalarmult, - crypto_scalarmult_base: crypto_scalarmult_base, - crypto_box_beforenm: crypto_box_beforenm, - crypto_box_afternm: crypto_box_afternm, - crypto_box: crypto_box, - crypto_box_open: crypto_box_open, - crypto_box_keypair: crypto_box_keypair, - crypto_hash: crypto_hash, - crypto_sign: crypto_sign, - crypto_sign_keypair: crypto_sign_keypair, - crypto_sign_open: crypto_sign_open, - - crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, - crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, - crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, - crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, - crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, - crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, - crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, - crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, - crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, - crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, - crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, - crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, - crypto_sign_BYTES: crypto_sign_BYTES, - crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, - crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, - crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, - crypto_hash_BYTES: crypto_hash_BYTES, -}; - -/* High-level API */ - -function checkLengths(k: Uint8Array, n: Uint8Array) { - if (k.length !== crypto_secretbox_KEYBYTES) throw new Error("bad key size"); - if (n.length !== crypto_secretbox_NONCEBYTES) - throw new Error("bad nonce size"); -} - -function checkBoxLengths(pk: Uint8Array, sk: Uint8Array) { - if (pk.length !== crypto_box_PUBLICKEYBYTES) - throw new Error("bad public key size"); - if (sk.length !== crypto_box_SECRETKEYBYTES) - throw new Error("bad secret key size"); -} - -function checkArrayTypes(...args: Uint8Array[]) { - for (var i = 0; i < args.length; i++) { - if (!(args[i] instanceof Uint8Array)) - throw new TypeError("unexpected type, use Uint8Array"); - } -} - -function cleanup(arr: Uint8Array) { - for (var i = 0; i < arr.length; i++) arr[i] = 0; -} - -export function randomBytes(n: number) { - var b = new Uint8Array(n); - randombytes(b, n); - return b; -} - -export function secretbox(msg: Uint8Array, nonce: Uint8Array, key: Uint8Array) { - checkArrayTypes(msg, nonce, key); - checkLengths(key, nonce); - var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); - var c = new Uint8Array(m.length); - for (var i = 0; i < msg.length; i++) - m[i + crypto_secretbox_ZEROBYTES] = msg[i]; - crypto_secretbox(c, m, m.length, nonce, key); - return c.subarray(crypto_secretbox_BOXZEROBYTES); -} - -export function secretbox_open( - box: Uint8Array, - nonce: Uint8Array, - key: Uint8Array, -) { - checkArrayTypes(box, nonce, key); - checkLengths(key, nonce); - var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); - var m = new Uint8Array(c.length); - for (var i = 0; i < box.length; i++) - c[i + crypto_secretbox_BOXZEROBYTES] = box[i]; - if (c.length < 32) return null; - if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return null; - return m.subarray(crypto_secretbox_ZEROBYTES); -} - -export const secretbox_keyLength = crypto_secretbox_KEYBYTES; -export const secretbox_nonceLength = crypto_secretbox_NONCEBYTES; -export const secretbox_overheadLength = crypto_secretbox_BOXZEROBYTES; - -export function scalarMult(n: Uint8Array, p: Uint8Array) { - checkArrayTypes(n, p); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size"); - if (p.length !== crypto_scalarmult_BYTES) throw new Error("bad p size"); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult(q, n, p); - return q; -} - -export function scalarMult_base(n: Uint8Array) { - checkArrayTypes(n); - if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size"); - var q = new Uint8Array(crypto_scalarmult_BYTES); - crypto_scalarmult_base(q, n); - return q; -} - -export const scalarMult_scalarLength = crypto_scalarmult_SCALARBYTES; -export const scalarMult_groupElementLength = crypto_scalarmult_BYTES; - -export function box( - msg: Uint8Array, - nonce: Uint8Array, - publicKey: Uint8Array, - secretKey: Uint8Array, -) { - var k = box_before(publicKey, secretKey); - return secretbox(msg, nonce, k); -} - -export function box_before(publicKey: Uint8Array, secretKey: Uint8Array) { - checkArrayTypes(publicKey, secretKey); - checkBoxLengths(publicKey, secretKey); - var k = new Uint8Array(crypto_box_BEFORENMBYTES); - crypto_box_beforenm(k, publicKey, secretKey); - return k; -} - -export const box_after = secretbox; - -export function box_open( - msg: Uint8Array, - nonce: Uint8Array, - publicKey: Uint8Array, - secretKey: Uint8Array, -) { - var k = box_before(publicKey, secretKey); - return secretbox_open(msg, nonce, k); -} - -export const box_open_after = secretbox_open; - -export function box_keyPair() { - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); - crypto_box_keypair(pk, sk); - return { publicKey: pk, secretKey: sk }; -} - -export function box_keyPair_fromSecretKey(secretKey: Uint8Array) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_box_SECRETKEYBYTES) - throw new Error("bad secret key size"); - var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); - crypto_scalarmult_base(pk, secretKey); - return { publicKey: pk, secretKey: new Uint8Array(secretKey) }; -} - -export const box_publicKeyLength = crypto_box_PUBLICKEYBYTES; -export const box_secretKeyLength = crypto_box_SECRETKEYBYTES; -export const box_sharedKeyLength = crypto_box_BEFORENMBYTES; -export const box_nonceLength = crypto_box_NONCEBYTES; -export const box_overheadLength = secretbox_overheadLength; - -export function sign(msg: Uint8Array, secretKey: Uint8Array) { - checkArrayTypes(msg, secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error("bad secret key size"); - var signedMsg = new Uint8Array(crypto_sign_BYTES + msg.length); - crypto_sign(signedMsg, msg, msg.length, secretKey); - return signedMsg; -} - -export function sign_open(signedMsg: Uint8Array, publicKey: Uint8Array) { - checkArrayTypes(signedMsg, publicKey); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error("bad public key size"); - var tmp = new Uint8Array(signedMsg.length); - var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); - if (mlen < 0) return null; - var m = new Uint8Array(mlen); - for (var i = 0; i < m.length; i++) m[i] = tmp[i]; - return m; -} - -export function sign_detached(msg: Uint8Array, secretKey: Uint8Array) { - var signedMsg = sign(msg, secretKey); - var sig = new Uint8Array(crypto_sign_BYTES); - for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; - return sig; -} - -export function sign_detached_verify( - msg: Uint8Array, - sig: Uint8Array, - publicKey: Uint8Array, -) { - checkArrayTypes(msg, sig, publicKey); - if (sig.length !== crypto_sign_BYTES) throw new Error("bad signature size"); - if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) - throw new Error("bad public key size"); - var sm = new Uint8Array(crypto_sign_BYTES + msg.length); - var m = new Uint8Array(crypto_sign_BYTES + msg.length); - var i; - for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; - for (i = 0; i < msg.length; i++) sm[i + crypto_sign_BYTES] = msg[i]; - return crypto_sign_open(m, sm, sm.length, publicKey) >= 0; -} - -export function sign_keyPair() { - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - crypto_sign_keypair(pk, sk, false); - return { publicKey: pk, secretKey: sk }; -} - -export function x25519_edwards_keyPair_fromSecretKey( - secretKey: Uint8Array, -): Uint8Array { - const p = [gf(), gf(), gf(), gf()]; - const pk = new Uint8Array(32); - - const d = new Uint8Array(64); - if (secretKey.length != 32) { - throw new Error("bad secret key size"); - } - d.set(secretKey, 0); - //crypto_hash(d, secretKey, 32); - - d[0] &= 248; - d[31] &= 127; - d[31] |= 64; - - scalarbase(p, d); - pack(pk, p); - - return pk; -} - -export function sign_keyPair_fromSecretKey(secretKey: Uint8Array) { - checkArrayTypes(secretKey); - if (secretKey.length !== crypto_sign_SECRETKEYBYTES) - throw new Error("bad secret key size"); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32 + i]; - return { publicKey: pk, secretKey: new Uint8Array(secretKey) }; -} - -export function sign_keyPair_fromSeed(seed: Uint8Array) { - checkArrayTypes(seed); - if (seed.length !== crypto_sign_SEEDBYTES) throw new Error("bad seed size"); - var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); - var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); - for (var i = 0; i < 32; i++) sk[i] = seed[i]; - crypto_sign_keypair(pk, sk, true); - return { publicKey: pk, secretKey: sk }; -} - -export const sign_publicKeyLength = crypto_sign_PUBLICKEYBYTES; -export const sign_secretKeyLength = crypto_sign_SECRETKEYBYTES; -export const sign_seedLength = crypto_sign_SEEDBYTES; -export const sign_signatureLength = crypto_sign_BYTES; - -export function hash(msg: Uint8Array) { - checkArrayTypes(msg); - var h = new Uint8Array(crypto_hash_BYTES); - crypto_hash(h, msg, msg.length); - return h; -} - -export const hash_hashLength = crypto_hash_BYTES; - -export function verify(x: Uint8Array, y: Uint8Array) { - checkArrayTypes(x, y); - // Zero length arguments are considered not equal. - if (x.length === 0 || y.length === 0) return false; - if (x.length !== y.length) return false; - return vn(x, 0, y, 0, x.length) === 0 ? true : false; -} - -export function setPRNG(fn: (x: Uint8Array, n: number) => void) { - randombytes = fn; -} - -export function sign_ed25519_pk_to_curve25519( - ed25519_pk: Uint8Array, -): Uint8Array { - const ge_a = [gf(), gf(), gf(), gf()]; - const x = gf(); - const one_minus_y = gf(); - const x25519_pk = new Uint8Array(32); - - if (unpackneg(ge_a, ed25519_pk)) { - throw Error("invalid public key"); - } - - set25519(one_minus_y, gf1); - Z(one_minus_y, one_minus_y, ge_a[1]); - - set25519(x, gf1); - A(x, x, ge_a[1]); - - inv25519(one_minus_y, one_minus_y); - M(x, x, one_minus_y); - pack25519(x25519_pk, x); - - return x25519_pk; -} - -(function() { - // Initialize PRNG if environment provides CSPRNG. - // If not, methods calling randombytes will throw. - const crypto = - typeof self !== "undefined" ? self.crypto || (self as any).msCrypto : null; - if (crypto && crypto.getRandomValues) { - // Browsers. - var QUOTA = 65536; - setPRNG(function(x: Uint8Array, n: number) { - var i, - v = new Uint8Array(n); - for (i = 0; i < n; i += QUOTA) { - crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); - } - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } else if (typeof require !== "undefined") { - // Node.js. - const cr = require("crypto"); - if (cr && cr.randomBytes) { - setPRNG(function(x: Uint8Array, n: number) { - var i, - v = cr.randomBytes(n); - for (i = 0; i < n; i++) x[i] = v[i]; - cleanup(v); - }); - } - } -})(); diff --git a/src/crypto/nodeEmscriptenLoader.ts b/src/crypto/nodeEmscriptenLoader.ts deleted file mode 100644 index 65d54a702..000000000 --- a/src/crypto/nodeEmscriptenLoader.ts +++ /dev/null @@ -1,101 +0,0 @@ - -import { EmscEnvironment } from "./emscInterface"; -import { CryptoImplementation } from "./cryptoImplementation"; - -import fs = require("fs"); - -export class NodeEmscriptenLoader { - private cachedEmscEnvironment: EmscEnvironment | undefined = undefined; - private cachedEmscEnvironmentPromise: - | Promise - | undefined = undefined; - - private async getWasmBinary(): Promise { - // @ts-ignore - const akonoGetData = global.__akono_getData; - if (akonoGetData) { - // We're running embedded node on Android - console.log("reading wasm binary from akono"); - const data = akonoGetData("taler-emscripten-lib.wasm"); - // The data we get is base64-encoded binary data - let buf = new Buffer(data, 'base64'); - return new Uint8Array(buf); - - } else { - // We're in a normal node environment - const binaryPath = __dirname + "/../../../emscripten/taler-emscripten-lib.wasm"; - const wasmBinary = new Uint8Array(fs.readFileSync(binaryPath)); - return wasmBinary; - } - } - - async getEmscriptenEnvironment(): Promise { - if (this.cachedEmscEnvironment) { - return this.cachedEmscEnvironment; - } - - if (this.cachedEmscEnvironmentPromise) { - return this.cachedEmscEnvironmentPromise; - } - - let lib: any; - - const wasmBinary = await this.getWasmBinary(); - - return new Promise((resolve, reject) => { - // Arguments passed to the emscripten prelude - const libArgs = { - wasmBinary, - onRuntimeInitialized: () => { - if (!lib) { - console.error("fatal emscripten initialization error"); - return; - } - this.cachedEmscEnvironmentPromise = undefined; - this.cachedEmscEnvironment = new EmscEnvironment(lib); - resolve(this.cachedEmscEnvironment); - }, - }; - - // Make sure that TypeScript doesn't try - // to check the taler-emscripten-lib. - const indirectRequire = require; - - const g = global; - - // unavoidable hack, so that emscripten detects - // the environment as node even though importScripts - // is present. - - // @ts-ignore - const savedImportScripts = g.importScripts; - // @ts-ignore - delete g.importScripts; - // @ts-ignore - const savedCrypto = g.crypto; - // @ts-ignore - delete g.crypto; - - // Assume that the code is run from the dist/ directory. - const libFn = indirectRequire( - "../../../emscripten/taler-emscripten-lib.js", - ); - lib = libFn(libArgs); - - // @ts-ignore - g.importScripts = savedImportScripts; - // @ts-ignore - g.crypto = savedCrypto; - - if (!lib) { - throw Error("could not load taler-emscripten-lib.js"); - } - - if (!lib.ccall) { - throw Error( - "sanity check failed: taler-emscripten lib does not have 'ccall'", - ); - } - }); - } -} diff --git a/src/crypto/nodeProcessWorker.ts b/src/crypto/nodeProcessWorker.ts index c5d0f2e71..8ff149788 100644 --- a/src/crypto/nodeProcessWorker.ts +++ b/src/crypto/nodeProcessWorker.ts @@ -84,7 +84,6 @@ export class Worker { }); this.child.on("message", (msg: any) => { - console.log("nodeProcessWorker got child message", msg); this.dispatchMessage(msg); }); } @@ -114,7 +113,6 @@ export class Worker { * Forcibly terminate the worker thread. */ terminate () { - console.log("terminating node.js worker"); this.child.kill("SIGINT"); } } diff --git a/src/crypto/nodeWorkerEntry.ts b/src/crypto/nodeWorkerEntry.ts index 1ed16f870..1e088d987 100644 --- a/src/crypto/nodeWorkerEntry.ts +++ b/src/crypto/nodeWorkerEntry.ts @@ -14,20 +14,13 @@ TALER; see the file COPYING. If not, see */ - // tslint:disable:no-var-requires -import fs = require("fs"); -import vm = require("vm"); -import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader"; import { CryptoImplementation } from "./cryptoImplementation"; -const loader = new NodeEmscriptenLoader(); - async function handleRequest(operation: string, id: number, args: string[]) { - let emsc = await loader.getEmscriptenEnvironment(); - const impl = new CryptoImplementation(emsc); + const impl = new CryptoImplementation(); if (!(operation in impl)) { console.error(`crypto operation '${operation}' not found`); @@ -42,16 +35,12 @@ async function handleRequest(operation: string, id: number, args: string[]) { console.error("process.send not available"); } } catch (e) { - console.log("error during operation", e); + console.error("error during operation", e); return; } } process.on("message", (msgStr: any) => { - console.log("got message in node worker entry", msgStr); - - console.log("typeof msg", typeof msgStr); - const msg = JSON.parse(msgStr); const args = msg.data.args; @@ -76,5 +65,5 @@ process.on("message", (msgStr: any) => { }); process.on("uncaughtException", (err: any) => { - console.log("uncaught exception in node worker entry", err); + console.error("uncaught exception in node worker entry", err); }); diff --git a/src/crypto/primitives/kdf.ts b/src/crypto/primitives/kdf.ts new file mode 100644 index 000000000..082963074 --- /dev/null +++ b/src/crypto/primitives/kdf.ts @@ -0,0 +1,92 @@ +/* + This file is part of GNU Taler + (C) 2019 GNUnet e.V. + + GNU Taler is free software; you can redistribute it and/or modify it under the + terms of the GNU General Public License as published by the Free Software + Foundation; either version 3, or (at your option) any later version. + + GNU Taler is distributed in the hope that it will be useful, but WITHOUT ANY + WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS FOR + A PARTICULAR PURPOSE. See the GNU General Public License for more details. + + You should have received a copy of the GNU General Public License along with + GNU Taler; see the file COPYING. If not, see + */ + +import nacl = require("./nacl-fast"); +import { sha256 } from "./sha256"; + +export function sha512(data: Uint8Array): Uint8Array { + return nacl.hash(data); +} + +export function hmac( + digest: (d: Uint8Array) => Uint8Array, + blockSize: number, + key: Uint8Array, + message: Uint8Array, +): Uint8Array { + if (key.byteLength > blockSize) { + key = digest(key); + } + if (key.byteLength < blockSize) { + const k = key; + key = new Uint8Array(blockSize); + key.set(k, 0); + } + const okp = new Uint8Array(blockSize); + const ikp = new Uint8Array(blockSize); + for (let i = 0; i < blockSize; i++) { + ikp[i] = key[i] ^ 0x36; + okp[i] = key[i] ^ 0x5c; + } + const b1 = new Uint8Array(blockSize + message.byteLength); + b1.set(ikp, 0); + b1.set(message, blockSize); + const h0 = digest(b1); + const b2 = new Uint8Array(blockSize + h0.length); + b2.set(okp, 0); + b2.set(h0, blockSize); + return digest(b2); +} + +export function hmacSha512(key: Uint8Array, message: Uint8Array) { + return hmac(sha512, 128, key, message); +} + +export function hmacSha256(key: Uint8Array, message: Uint8Array) { + return hmac(sha256, 64, key, message); +} + +export function kdf( + outputLength: number, + ikm: Uint8Array, + salt: Uint8Array, + info: Uint8Array, +): Uint8Array { + // extract + const prk = hmacSha512(salt, ikm); + + // expand + const N = Math.ceil(outputLength / 32); + const output = new Uint8Array(N * 32); + for (let i = 0; i < N; i++) { + let buf; + if (i == 0) { + buf = new Uint8Array(info.byteLength + 1); + buf.set(info, 0); + } else { + buf = new Uint8Array(info.byteLength + 1 + 32); + for (let j = 0; j < 32; j++) { + buf[j] = output[(i - 1) * 32 + j]; + } + buf.set(info, 32); + } + buf[buf.length - 1] = i + 1; + const chunk = hmacSha256(prk, buf); + output.set(chunk, i * 32); + } + + return output; +} diff --git a/src/crypto/primitives/nacl-fast.ts b/src/crypto/primitives/nacl-fast.ts new file mode 100644 index 000000000..66ab78162 --- /dev/null +++ b/src/crypto/primitives/nacl-fast.ts @@ -0,0 +1,3110 @@ +// Ported in 2014 by Dmitry Chestnykh and Devi Mandiri. +// TypeScript port in 2019 by Florian Dold. +// Public domain. +// +// Implementation derived from TweetNaCl version 20140427. +// See for details: http://tweetnacl.cr.yp.to/ + +const gf = function(init: number[] = []) { + const r = new Float64Array(16); + if (init) for (let i = 0; i < init.length; i++) r[i] = init[i]; + return r; +}; + +// Pluggable, initialized in high-level API below. +let randombytes = function(x: Uint8Array, n: number): void { + throw new Error("no PRNG"); +}; + +const _0 = new Uint8Array(16); +const _9 = new Uint8Array(32); +_9[0] = 9; + +// prettier-ignore +const gf0 = gf(); +const gf1 = gf([1]); +const _121665 = gf([0xdb41, 1]); +const D = gf([ + 0x78a3, + 0x1359, + 0x4dca, + 0x75eb, + 0xd8ab, + 0x4141, + 0x0a4d, + 0x0070, + 0xe898, + 0x7779, + 0x4079, + 0x8cc7, + 0xfe73, + 0x2b6f, + 0x6cee, + 0x5203, +]); +const D2 = gf([ + 0xf159, + 0x26b2, + 0x9b94, + 0xebd6, + 0xb156, + 0x8283, + 0x149a, + 0x00e0, + 0xd130, + 0xeef3, + 0x80f2, + 0x198e, + 0xfce7, + 0x56df, + 0xd9dc, + 0x2406, +]); +const X = gf([ + 0xd51a, + 0x8f25, + 0x2d60, + 0xc956, + 0xa7b2, + 0x9525, + 0xc760, + 0x692c, + 0xdc5c, + 0xfdd6, + 0xe231, + 0xc0a4, + 0x53fe, + 0xcd6e, + 0x36d3, + 0x2169, +]); +const Y = gf([ + 0x6658, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, + 0x6666, +]); +const I = gf([ + 0xa0b0, + 0x4a0e, + 0x1b27, + 0xc4ee, + 0xe478, + 0xad2f, + 0x1806, + 0x2f43, + 0xd7a7, + 0x3dfb, + 0x0099, + 0x2b4d, + 0xdf0b, + 0x4fc1, + 0x2480, + 0x2b83, +]); + +function ts64(x: Uint8Array, i: number, h: number, l: number) { + x[i] = (h >> 24) & 0xff; + x[i + 1] = (h >> 16) & 0xff; + x[i + 2] = (h >> 8) & 0xff; + x[i + 3] = h & 0xff; + x[i + 4] = (l >> 24) & 0xff; + x[i + 5] = (l >> 16) & 0xff; + x[i + 6] = (l >> 8) & 0xff; + x[i + 7] = l & 0xff; +} + +function vn(x: Uint8Array, xi: number, y: Uint8Array, yi: number, n: number) { + var i, + d = 0; + for (i = 0; i < n; i++) d |= x[xi + i] ^ y[yi + i]; + return (1 & ((d - 1) >>> 8)) - 1; +} + +function crypto_verify_16( + x: Uint8Array, + xi: number, + y: Uint8Array, + yi: number, +) { + return vn(x, xi, y, yi, 16); +} + +function crypto_verify_32( + x: Uint8Array, + xi: number, + y: Uint8Array, + yi: number, +) { + return vn(x, xi, y, yi, 32); +} + +// prettier-ignore +function core_salsa20(o: Uint8Array, p: Uint8Array, k: Uint8Array, c: Uint8Array) { + var j0 = c[ 0] & 0xff | (c[ 1] & 0xff)<<8 | (c[ 2] & 0xff)<<16 | (c[ 3] & 0xff)<<24, + j1 = k[ 0] & 0xff | (k[ 1] & 0xff)<<8 | (k[ 2] & 0xff)<<16 | (k[ 3] & 0xff)<<24, + j2 = k[ 4] & 0xff | (k[ 5] & 0xff)<<8 | (k[ 6] & 0xff)<<16 | (k[ 7] & 0xff)<<24, + j3 = k[ 8] & 0xff | (k[ 9] & 0xff)<<8 | (k[10] & 0xff)<<16 | (k[11] & 0xff)<<24, + j4 = k[12] & 0xff | (k[13] & 0xff)<<8 | (k[14] & 0xff)<<16 | (k[15] & 0xff)<<24, + j5 = c[ 4] & 0xff | (c[ 5] & 0xff)<<8 | (c[ 6] & 0xff)<<16 | (c[ 7] & 0xff)<<24, + j6 = p[ 0] & 0xff | (p[ 1] & 0xff)<<8 | (p[ 2] & 0xff)<<16 | (p[ 3] & 0xff)<<24, + j7 = p[ 4] & 0xff | (p[ 5] & 0xff)<<8 | (p[ 6] & 0xff)<<16 | (p[ 7] & 0xff)<<24, + j8 = p[ 8] & 0xff | (p[ 9] & 0xff)<<8 | (p[10] & 0xff)<<16 | (p[11] & 0xff)<<24, + j9 = p[12] & 0xff | (p[13] & 0xff)<<8 | (p[14] & 0xff)<<16 | (p[15] & 0xff)<<24, + j10 = c[ 8] & 0xff | (c[ 9] & 0xff)<<8 | (c[10] & 0xff)<<16 | (c[11] & 0xff)<<24, + j11 = k[16] & 0xff | (k[17] & 0xff)<<8 | (k[18] & 0xff)<<16 | (k[19] & 0xff)<<24, + j12 = k[20] & 0xff | (k[21] & 0xff)<<8 | (k[22] & 0xff)<<16 | (k[23] & 0xff)<<24, + j13 = k[24] & 0xff | (k[25] & 0xff)<<8 | (k[26] & 0xff)<<16 | (k[27] & 0xff)<<24, + j14 = k[28] & 0xff | (k[29] & 0xff)<<8 | (k[30] & 0xff)<<16 | (k[31] & 0xff)<<24, + j15 = c[12] & 0xff | (c[13] & 0xff)<<8 | (c[14] & 0xff)<<16 | (c[15] & 0xff)<<24; + + var x0 = j0, x1 = j1, x2 = j2, x3 = j3, x4 = j4, x5 = j5, x6 = j6, x7 = j7, + x8 = j8, x9 = j9, x10 = j10, x11 = j11, x12 = j12, x13 = j13, x14 = j14, + x15 = j15, u; + + for (var i = 0; i < 20; i += 2) { + u = x0 + x12 | 0; + x4 ^= u<<7 | u>>>(32-7); + u = x4 + x0 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x4 | 0; + x12 ^= u<<13 | u>>>(32-13); + u = x12 + x8 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x1 | 0; + x9 ^= u<<7 | u>>>(32-7); + u = x9 + x5 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x9 | 0; + x1 ^= u<<13 | u>>>(32-13); + u = x1 + x13 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x6 | 0; + x14 ^= u<<7 | u>>>(32-7); + u = x14 + x10 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x14 | 0; + x6 ^= u<<13 | u>>>(32-13); + u = x6 + x2 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x11 | 0; + x3 ^= u<<7 | u>>>(32-7); + u = x3 + x15 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x3 | 0; + x11 ^= u<<13 | u>>>(32-13); + u = x11 + x7 | 0; + x15 ^= u<<18 | u>>>(32-18); + + u = x0 + x3 | 0; + x1 ^= u<<7 | u>>>(32-7); + u = x1 + x0 | 0; + x2 ^= u<<9 | u>>>(32-9); + u = x2 + x1 | 0; + x3 ^= u<<13 | u>>>(32-13); + u = x3 + x2 | 0; + x0 ^= u<<18 | u>>>(32-18); + + u = x5 + x4 | 0; + x6 ^= u<<7 | u>>>(32-7); + u = x6 + x5 | 0; + x7 ^= u<<9 | u>>>(32-9); + u = x7 + x6 | 0; + x4 ^= u<<13 | u>>>(32-13); + u = x4 + x7 | 0; + x5 ^= u<<18 | u>>>(32-18); + + u = x10 + x9 | 0; + x11 ^= u<<7 | u>>>(32-7); + u = x11 + x10 | 0; + x8 ^= u<<9 | u>>>(32-9); + u = x8 + x11 | 0; + x9 ^= u<<13 | u>>>(32-13); + u = x9 + x8 | 0; + x10 ^= u<<18 | u>>>(32-18); + + u = x15 + x14 | 0; + x12 ^= u<<7 | u>>>(32-7); + u = x12 + x15 | 0; + x13 ^= u<<9 | u>>>(32-9); + u = x13 + x12 | 0; + x14 ^= u<<13 | u>>>(32-13); + u = x14 + x13 | 0; + x15 ^= u<<18 | u>>>(32-18); + } + x0 = x0 + j0 | 0; + x1 = x1 + j1 | 0; + x2 = x2 + j2 | 0; + x3 = x3 + j3 | 0; + x4 = x4 + j4 | 0; + x5 = x5 + j5 | 0; + x6 = x6 + j6 | 0; + x7 = x7 + j7 | 0; + x8 = x8 + j8 | 0; + x9 = x9 + j9 | 0; + x10 = x10 + j10 | 0; + x11 = x11 + j11 | 0; + x12 = x12 + j12 | 0; + x13 = x13 + j13 | 0; + x14 = x14 + j14 | 0; + x15 = x15 + j15 | 0; + + o[ 0] = x0 >>> 0 & 0xff; + o[ 1] = x0 >>> 8 & 0xff; + o[ 2] = x0 >>> 16 & 0xff; + o[ 3] = x0 >>> 24 & 0xff; + + o[ 4] = x1 >>> 0 & 0xff; + o[ 5] = x1 >>> 8 & 0xff; + o[ 6] = x1 >>> 16 & 0xff; + o[ 7] = x1 >>> 24 & 0xff; + + o[ 8] = x2 >>> 0 & 0xff; + o[ 9] = x2 >>> 8 & 0xff; + o[10] = x2 >>> 16 & 0xff; + o[11] = x2 >>> 24 & 0xff; + + o[12] = x3 >>> 0 & 0xff; + o[13] = x3 >>> 8 & 0xff; + o[14] = x3 >>> 16 & 0xff; + o[15] = x3 >>> 24 & 0xff; + + o[16] = x4 >>> 0 & 0xff; + o[17] = x4 >>> 8 & 0xff; + o[18] = x4 >>> 16 & 0xff; + o[19] = x4 >>> 24 & 0xff; + + o[20] = x5 >>> 0 & 0xff; + o[21] = x5 >>> 8 & 0xff; + o[22] = x5 >>> 16 & 0xff; + o[23] = x5 >>> 24 & 0xff; + + o[24] = x6 >>> 0 & 0xff; + o[25] = x6 >>> 8 & 0xff; + o[26] = x6 >>> 16 & 0xff; + o[27] = x6 >>> 24 & 0xff; + + o[28] = x7 >>> 0 & 0xff; + o[29] = x7 >>> 8 & 0xff; + o[30] = x7 >>> 16 & 0xff; + o[31] = x7 >>> 24 & 0xff; + + o[32] = x8 >>> 0 & 0xff; + o[33] = x8 >>> 8 & 0xff; + o[34] = x8 >>> 16 & 0xff; + o[35] = x8 >>> 24 & 0xff; + + o[36] = x9 >>> 0 & 0xff; + o[37] = x9 >>> 8 & 0xff; + o[38] = x9 >>> 16 & 0xff; + o[39] = x9 >>> 24 & 0xff; + + o[40] = x10 >>> 0 & 0xff; + o[41] = x10 >>> 8 & 0xff; + o[42] = x10 >>> 16 & 0xff; + o[43] = x10 >>> 24 & 0xff; + + o[44] = x11 >>> 0 & 0xff; + o[45] = x11 >>> 8 & 0xff; + o[46] = x11 >>> 16 & 0xff; + o[47] = x11 >>> 24 & 0xff; + + o[48] = x12 >>> 0 & 0xff; + o[49] = x12 >>> 8 & 0xff; + o[50] = x12 >>> 16 & 0xff; + o[51] = x12 >>> 24 & 0xff; + + o[52] = x13 >>> 0 & 0xff; + o[53] = x13 >>> 8 & 0xff; + o[54] = x13 >>> 16 & 0xff; + o[55] = x13 >>> 24 & 0xff; + + o[56] = x14 >>> 0 & 0xff; + o[57] = x14 >>> 8 & 0xff; + o[58] = x14 >>> 16 & 0xff; + o[59] = x14 >>> 24 & 0xff; + + o[60] = x15 >>> 0 & 0xff; + o[61] = x15 >>> 8 & 0xff; + o[62] = x15 >>> 16 & 0xff; + o[63] = x15 >>> 24 & 0xff; +} + +function core_hsalsa20( + o: Uint8Array, + p: Uint8Array, + k: Uint8Array, + c: Uint8Array, +) { + var j0 = + (c[0] & 0xff) | + ((c[1] & 0xff) << 8) | + ((c[2] & 0xff) << 16) | + ((c[3] & 0xff) << 24), + j1 = + (k[0] & 0xff) | + ((k[1] & 0xff) << 8) | + ((k[2] & 0xff) << 16) | + ((k[3] & 0xff) << 24), + j2 = + (k[4] & 0xff) | + ((k[5] & 0xff) << 8) | + ((k[6] & 0xff) << 16) | + ((k[7] & 0xff) << 24), + j3 = + (k[8] & 0xff) | + ((k[9] & 0xff) << 8) | + ((k[10] & 0xff) << 16) | + ((k[11] & 0xff) << 24), + j4 = + (k[12] & 0xff) | + ((k[13] & 0xff) << 8) | + ((k[14] & 0xff) << 16) | + ((k[15] & 0xff) << 24), + j5 = + (c[4] & 0xff) | + ((c[5] & 0xff) << 8) | + ((c[6] & 0xff) << 16) | + ((c[7] & 0xff) << 24), + j6 = + (p[0] & 0xff) | + ((p[1] & 0xff) << 8) | + ((p[2] & 0xff) << 16) | + ((p[3] & 0xff) << 24), + j7 = + (p[4] & 0xff) | + ((p[5] & 0xff) << 8) | + ((p[6] & 0xff) << 16) | + ((p[7] & 0xff) << 24), + j8 = + (p[8] & 0xff) | + ((p[9] & 0xff) << 8) | + ((p[10] & 0xff) << 16) | + ((p[11] & 0xff) << 24), + j9 = + (p[12] & 0xff) | + ((p[13] & 0xff) << 8) | + ((p[14] & 0xff) << 16) | + ((p[15] & 0xff) << 24), + j10 = + (c[8] & 0xff) | + ((c[9] & 0xff) << 8) | + ((c[10] & 0xff) << 16) | + ((c[11] & 0xff) << 24), + j11 = + (k[16] & 0xff) | + ((k[17] & 0xff) << 8) | + ((k[18] & 0xff) << 16) | + ((k[19] & 0xff) << 24), + j12 = + (k[20] & 0xff) | + ((k[21] & 0xff) << 8) | + ((k[22] & 0xff) << 16) | + ((k[23] & 0xff) << 24), + j13 = + (k[24] & 0xff) | + ((k[25] & 0xff) << 8) | + ((k[26] & 0xff) << 16) | + ((k[27] & 0xff) << 24), + j14 = + (k[28] & 0xff) | + ((k[29] & 0xff) << 8) | + ((k[30] & 0xff) << 16) | + ((k[31] & 0xff) << 24), + j15 = + (c[12] & 0xff) | + ((c[13] & 0xff) << 8) | + ((c[14] & 0xff) << 16) | + ((c[15] & 0xff) << 24); + + var x0 = j0, + x1 = j1, + x2 = j2, + x3 = j3, + x4 = j4, + x5 = j5, + x6 = j6, + x7 = j7, + x8 = j8, + x9 = j9, + x10 = j10, + x11 = j11, + x12 = j12, + x13 = j13, + x14 = j14, + x15 = j15, + u; + + for (var i = 0; i < 20; i += 2) { + u = (x0 + x12) | 0; + x4 ^= (u << 7) | (u >>> (32 - 7)); + u = (x4 + x0) | 0; + x8 ^= (u << 9) | (u >>> (32 - 9)); + u = (x8 + x4) | 0; + x12 ^= (u << 13) | (u >>> (32 - 13)); + u = (x12 + x8) | 0; + x0 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x5 + x1) | 0; + x9 ^= (u << 7) | (u >>> (32 - 7)); + u = (x9 + x5) | 0; + x13 ^= (u << 9) | (u >>> (32 - 9)); + u = (x13 + x9) | 0; + x1 ^= (u << 13) | (u >>> (32 - 13)); + u = (x1 + x13) | 0; + x5 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x10 + x6) | 0; + x14 ^= (u << 7) | (u >>> (32 - 7)); + u = (x14 + x10) | 0; + x2 ^= (u << 9) | (u >>> (32 - 9)); + u = (x2 + x14) | 0; + x6 ^= (u << 13) | (u >>> (32 - 13)); + u = (x6 + x2) | 0; + x10 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x15 + x11) | 0; + x3 ^= (u << 7) | (u >>> (32 - 7)); + u = (x3 + x15) | 0; + x7 ^= (u << 9) | (u >>> (32 - 9)); + u = (x7 + x3) | 0; + x11 ^= (u << 13) | (u >>> (32 - 13)); + u = (x11 + x7) | 0; + x15 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x0 + x3) | 0; + x1 ^= (u << 7) | (u >>> (32 - 7)); + u = (x1 + x0) | 0; + x2 ^= (u << 9) | (u >>> (32 - 9)); + u = (x2 + x1) | 0; + x3 ^= (u << 13) | (u >>> (32 - 13)); + u = (x3 + x2) | 0; + x0 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x5 + x4) | 0; + x6 ^= (u << 7) | (u >>> (32 - 7)); + u = (x6 + x5) | 0; + x7 ^= (u << 9) | (u >>> (32 - 9)); + u = (x7 + x6) | 0; + x4 ^= (u << 13) | (u >>> (32 - 13)); + u = (x4 + x7) | 0; + x5 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x10 + x9) | 0; + x11 ^= (u << 7) | (u >>> (32 - 7)); + u = (x11 + x10) | 0; + x8 ^= (u << 9) | (u >>> (32 - 9)); + u = (x8 + x11) | 0; + x9 ^= (u << 13) | (u >>> (32 - 13)); + u = (x9 + x8) | 0; + x10 ^= (u << 18) | (u >>> (32 - 18)); + + u = (x15 + x14) | 0; + x12 ^= (u << 7) | (u >>> (32 - 7)); + u = (x12 + x15) | 0; + x13 ^= (u << 9) | (u >>> (32 - 9)); + u = (x13 + x12) | 0; + x14 ^= (u << 13) | (u >>> (32 - 13)); + u = (x14 + x13) | 0; + x15 ^= (u << 18) | (u >>> (32 - 18)); + } + + o[0] = (x0 >>> 0) & 0xff; + o[1] = (x0 >>> 8) & 0xff; + o[2] = (x0 >>> 16) & 0xff; + o[3] = (x0 >>> 24) & 0xff; + + o[4] = (x5 >>> 0) & 0xff; + o[5] = (x5 >>> 8) & 0xff; + o[6] = (x5 >>> 16) & 0xff; + o[7] = (x5 >>> 24) & 0xff; + + o[8] = (x10 >>> 0) & 0xff; + o[9] = (x10 >>> 8) & 0xff; + o[10] = (x10 >>> 16) & 0xff; + o[11] = (x10 >>> 24) & 0xff; + + o[12] = (x15 >>> 0) & 0xff; + o[13] = (x15 >>> 8) & 0xff; + o[14] = (x15 >>> 16) & 0xff; + o[15] = (x15 >>> 24) & 0xff; + + o[16] = (x6 >>> 0) & 0xff; + o[17] = (x6 >>> 8) & 0xff; + o[18] = (x6 >>> 16) & 0xff; + o[19] = (x6 >>> 24) & 0xff; + + o[20] = (x7 >>> 0) & 0xff; + o[21] = (x7 >>> 8) & 0xff; + o[22] = (x7 >>> 16) & 0xff; + o[23] = (x7 >>> 24) & 0xff; + + o[24] = (x8 >>> 0) & 0xff; + o[25] = (x8 >>> 8) & 0xff; + o[26] = (x8 >>> 16) & 0xff; + o[27] = (x8 >>> 24) & 0xff; + + o[28] = (x9 >>> 0) & 0xff; + o[29] = (x9 >>> 8) & 0xff; + o[30] = (x9 >>> 16) & 0xff; + o[31] = (x9 >>> 24) & 0xff; +} + +function crypto_core_salsa20( + out: Uint8Array, + inp: Uint8Array, + k: Uint8Array, + c: Uint8Array, +) { + core_salsa20(out, inp, k, c); +} + +function crypto_core_hsalsa20( + out: Uint8Array, + inp: Uint8Array, + k: Uint8Array, + c: Uint8Array, +) { + core_hsalsa20(out, inp, k, c); +} + +var sigma = new Uint8Array([ + 101, + 120, + 112, + 97, + 110, + 100, + 32, + 51, + 50, + 45, + 98, + 121, + 116, + 101, + 32, + 107, +]); +// "expand 32-byte k" + +function crypto_stream_salsa20_xor( + c: Uint8Array, + cpos: number, + m: Uint8Array, + mpos: number, + b: number, + n: Uint8Array, + k: Uint8Array, +) { + var z = new Uint8Array(16), + x = new Uint8Array(64); + var u, i; + for (i = 0; i < 16; i++) z[i] = 0; + for (i = 0; i < 8; i++) z[i] = n[i]; + while (b >= 64) { + crypto_core_salsa20(x, z, k, sigma); + for (i = 0; i < 64; i++) c[cpos + i] = m[mpos + i] ^ x[i]; + u = 1; + for (i = 8; i < 16; i++) { + u = (u + (z[i] & 0xff)) | 0; + z[i] = u & 0xff; + u >>>= 8; + } + b -= 64; + cpos += 64; + mpos += 64; + } + if (b > 0) { + crypto_core_salsa20(x, z, k, sigma); + for (i = 0; i < b; i++) c[cpos + i] = m[mpos + i] ^ x[i]; + } + return 0; +} + +function crypto_stream_salsa20( + c: Uint8Array, + cpos: number, + b: number, + n: Uint8Array, + k: Uint8Array, +) { + var z = new Uint8Array(16), + x = new Uint8Array(64); + var u, i; + for (i = 0; i < 16; i++) z[i] = 0; + for (i = 0; i < 8; i++) z[i] = n[i]; + while (b >= 64) { + crypto_core_salsa20(x, z, k, sigma); + for (i = 0; i < 64; i++) c[cpos + i] = x[i]; + u = 1; + for (i = 8; i < 16; i++) { + u = (u + (z[i] & 0xff)) | 0; + z[i] = u & 0xff; + u >>>= 8; + } + b -= 64; + cpos += 64; + } + if (b > 0) { + crypto_core_salsa20(x, z, k, sigma); + for (i = 0; i < b; i++) c[cpos + i] = x[i]; + } + return 0; +} + +function crypto_stream( + c: Uint8Array, + cpos: number, + d: number, + n: Uint8Array, + k: Uint8Array, +) { + var s = new Uint8Array(32); + crypto_core_hsalsa20(s, n, k, sigma); + var sn = new Uint8Array(8); + for (var i = 0; i < 8; i++) sn[i] = n[i + 16]; + return crypto_stream_salsa20(c, cpos, d, sn, s); +} + +function crypto_stream_xor( + c: Uint8Array, + cpos: number, + m: Uint8Array, + mpos: number, + d: number, + n: Uint8Array, + k: Uint8Array, +) { + var s = new Uint8Array(32); + crypto_core_hsalsa20(s, n, k, sigma); + var sn = new Uint8Array(8); + for (var i = 0; i < 8; i++) sn[i] = n[i + 16]; + return crypto_stream_salsa20_xor(c, cpos, m, mpos, d, sn, s); +} + +/* + * Port of Andrew Moon's Poly1305-donna-16. Public domain. + * https://github.com/floodyberry/poly1305-donna + */ + +class poly1305 { + buffer = new Uint8Array(16); + r = new Uint16Array(10); + h = new Uint16Array(10); + pad = new Uint16Array(8); + leftover = 0; + fin = 0; + + constructor(key: Uint8Array) { + var t0, t1, t2, t3, t4, t5, t6, t7; + + t0 = (key[0] & 0xff) | ((key[1] & 0xff) << 8); + this.r[0] = t0 & 0x1fff; + t1 = (key[2] & 0xff) | ((key[3] & 0xff) << 8); + this.r[1] = ((t0 >>> 13) | (t1 << 3)) & 0x1fff; + t2 = (key[4] & 0xff) | ((key[5] & 0xff) << 8); + this.r[2] = ((t1 >>> 10) | (t2 << 6)) & 0x1f03; + t3 = (key[6] & 0xff) | ((key[7] & 0xff) << 8); + this.r[3] = ((t2 >>> 7) | (t3 << 9)) & 0x1fff; + t4 = (key[8] & 0xff) | ((key[9] & 0xff) << 8); + this.r[4] = ((t3 >>> 4) | (t4 << 12)) & 0x00ff; + this.r[5] = (t4 >>> 1) & 0x1ffe; + t5 = (key[10] & 0xff) | ((key[11] & 0xff) << 8); + this.r[6] = ((t4 >>> 14) | (t5 << 2)) & 0x1fff; + t6 = (key[12] & 0xff) | ((key[13] & 0xff) << 8); + this.r[7] = ((t5 >>> 11) | (t6 << 5)) & 0x1f81; + t7 = (key[14] & 0xff) | ((key[15] & 0xff) << 8); + this.r[8] = ((t6 >>> 8) | (t7 << 8)) & 0x1fff; + this.r[9] = (t7 >>> 5) & 0x007f; + + this.pad[0] = (key[16] & 0xff) | ((key[17] & 0xff) << 8); + this.pad[1] = (key[18] & 0xff) | ((key[19] & 0xff) << 8); + this.pad[2] = (key[20] & 0xff) | ((key[21] & 0xff) << 8); + this.pad[3] = (key[22] & 0xff) | ((key[23] & 0xff) << 8); + this.pad[4] = (key[24] & 0xff) | ((key[25] & 0xff) << 8); + this.pad[5] = (key[26] & 0xff) | ((key[27] & 0xff) << 8); + this.pad[6] = (key[28] & 0xff) | ((key[29] & 0xff) << 8); + this.pad[7] = (key[30] & 0xff) | ((key[31] & 0xff) << 8); + } + + blocks(m: Uint8Array, mpos: number, bytes: number) { + var hibit = this.fin ? 0 : 1 << 11; + var t0, t1, t2, t3, t4, t5, t6, t7, c; + var d0, d1, d2, d3, d4, d5, d6, d7, d8, d9; + + var h0 = this.h[0], + h1 = this.h[1], + h2 = this.h[2], + h3 = this.h[3], + h4 = this.h[4], + h5 = this.h[5], + h6 = this.h[6], + h7 = this.h[7], + h8 = this.h[8], + h9 = this.h[9]; + + var r0 = this.r[0], + r1 = this.r[1], + r2 = this.r[2], + r3 = this.r[3], + r4 = this.r[4], + r5 = this.r[5], + r6 = this.r[6], + r7 = this.r[7], + r8 = this.r[8], + r9 = this.r[9]; + + while (bytes >= 16) { + t0 = (m[mpos + 0] & 0xff) | ((m[mpos + 1] & 0xff) << 8); + h0 += t0 & 0x1fff; + t1 = (m[mpos + 2] & 0xff) | ((m[mpos + 3] & 0xff) << 8); + h1 += ((t0 >>> 13) | (t1 << 3)) & 0x1fff; + t2 = (m[mpos + 4] & 0xff) | ((m[mpos + 5] & 0xff) << 8); + h2 += ((t1 >>> 10) | (t2 << 6)) & 0x1fff; + t3 = (m[mpos + 6] & 0xff) | ((m[mpos + 7] & 0xff) << 8); + h3 += ((t2 >>> 7) | (t3 << 9)) & 0x1fff; + t4 = (m[mpos + 8] & 0xff) | ((m[mpos + 9] & 0xff) << 8); + h4 += ((t3 >>> 4) | (t4 << 12)) & 0x1fff; + h5 += (t4 >>> 1) & 0x1fff; + t5 = (m[mpos + 10] & 0xff) | ((m[mpos + 11] & 0xff) << 8); + h6 += ((t4 >>> 14) | (t5 << 2)) & 0x1fff; + t6 = (m[mpos + 12] & 0xff) | ((m[mpos + 13] & 0xff) << 8); + h7 += ((t5 >>> 11) | (t6 << 5)) & 0x1fff; + t7 = (m[mpos + 14] & 0xff) | ((m[mpos + 15] & 0xff) << 8); + h8 += ((t6 >>> 8) | (t7 << 8)) & 0x1fff; + h9 += (t7 >>> 5) | hibit; + + c = 0; + + d0 = c; + d0 += h0 * r0; + d0 += h1 * (5 * r9); + d0 += h2 * (5 * r8); + d0 += h3 * (5 * r7); + d0 += h4 * (5 * r6); + c = d0 >>> 13; + d0 &= 0x1fff; + d0 += h5 * (5 * r5); + d0 += h6 * (5 * r4); + d0 += h7 * (5 * r3); + d0 += h8 * (5 * r2); + d0 += h9 * (5 * r1); + c += d0 >>> 13; + d0 &= 0x1fff; + + d1 = c; + d1 += h0 * r1; + d1 += h1 * r0; + d1 += h2 * (5 * r9); + d1 += h3 * (5 * r8); + d1 += h4 * (5 * r7); + c = d1 >>> 13; + d1 &= 0x1fff; + d1 += h5 * (5 * r6); + d1 += h6 * (5 * r5); + d1 += h7 * (5 * r4); + d1 += h8 * (5 * r3); + d1 += h9 * (5 * r2); + c += d1 >>> 13; + d1 &= 0x1fff; + + d2 = c; + d2 += h0 * r2; + d2 += h1 * r1; + d2 += h2 * r0; + d2 += h3 * (5 * r9); + d2 += h4 * (5 * r8); + c = d2 >>> 13; + d2 &= 0x1fff; + d2 += h5 * (5 * r7); + d2 += h6 * (5 * r6); + d2 += h7 * (5 * r5); + d2 += h8 * (5 * r4); + d2 += h9 * (5 * r3); + c += d2 >>> 13; + d2 &= 0x1fff; + + d3 = c; + d3 += h0 * r3; + d3 += h1 * r2; + d3 += h2 * r1; + d3 += h3 * r0; + d3 += h4 * (5 * r9); + c = d3 >>> 13; + d3 &= 0x1fff; + d3 += h5 * (5 * r8); + d3 += h6 * (5 * r7); + d3 += h7 * (5 * r6); + d3 += h8 * (5 * r5); + d3 += h9 * (5 * r4); + c += d3 >>> 13; + d3 &= 0x1fff; + + d4 = c; + d4 += h0 * r4; + d4 += h1 * r3; + d4 += h2 * r2; + d4 += h3 * r1; + d4 += h4 * r0; + c = d4 >>> 13; + d4 &= 0x1fff; + d4 += h5 * (5 * r9); + d4 += h6 * (5 * r8); + d4 += h7 * (5 * r7); + d4 += h8 * (5 * r6); + d4 += h9 * (5 * r5); + c += d4 >>> 13; + d4 &= 0x1fff; + + d5 = c; + d5 += h0 * r5; + d5 += h1 * r4; + d5 += h2 * r3; + d5 += h3 * r2; + d5 += h4 * r1; + c = d5 >>> 13; + d5 &= 0x1fff; + d5 += h5 * r0; + d5 += h6 * (5 * r9); + d5 += h7 * (5 * r8); + d5 += h8 * (5 * r7); + d5 += h9 * (5 * r6); + c += d5 >>> 13; + d5 &= 0x1fff; + + d6 = c; + d6 += h0 * r6; + d6 += h1 * r5; + d6 += h2 * r4; + d6 += h3 * r3; + d6 += h4 * r2; + c = d6 >>> 13; + d6 &= 0x1fff; + d6 += h5 * r1; + d6 += h6 * r0; + d6 += h7 * (5 * r9); + d6 += h8 * (5 * r8); + d6 += h9 * (5 * r7); + c += d6 >>> 13; + d6 &= 0x1fff; + + d7 = c; + d7 += h0 * r7; + d7 += h1 * r6; + d7 += h2 * r5; + d7 += h3 * r4; + d7 += h4 * r3; + c = d7 >>> 13; + d7 &= 0x1fff; + d7 += h5 * r2; + d7 += h6 * r1; + d7 += h7 * r0; + d7 += h8 * (5 * r9); + d7 += h9 * (5 * r8); + c += d7 >>> 13; + d7 &= 0x1fff; + + d8 = c; + d8 += h0 * r8; + d8 += h1 * r7; + d8 += h2 * r6; + d8 += h3 * r5; + d8 += h4 * r4; + c = d8 >>> 13; + d8 &= 0x1fff; + d8 += h5 * r3; + d8 += h6 * r2; + d8 += h7 * r1; + d8 += h8 * r0; + d8 += h9 * (5 * r9); + c += d8 >>> 13; + d8 &= 0x1fff; + + d9 = c; + d9 += h0 * r9; + d9 += h1 * r8; + d9 += h2 * r7; + d9 += h3 * r6; + d9 += h4 * r5; + c = d9 >>> 13; + d9 &= 0x1fff; + d9 += h5 * r4; + d9 += h6 * r3; + d9 += h7 * r2; + d9 += h8 * r1; + d9 += h9 * r0; + c += d9 >>> 13; + d9 &= 0x1fff; + + c = ((c << 2) + c) | 0; + c = (c + d0) | 0; + d0 = c & 0x1fff; + c = c >>> 13; + d1 += c; + + h0 = d0; + h1 = d1; + h2 = d2; + h3 = d3; + h4 = d4; + h5 = d5; + h6 = d6; + h7 = d7; + h8 = d8; + h9 = d9; + + mpos += 16; + bytes -= 16; + } + this.h[0] = h0; + this.h[1] = h1; + this.h[2] = h2; + this.h[3] = h3; + this.h[4] = h4; + this.h[5] = h5; + this.h[6] = h6; + this.h[7] = h7; + this.h[8] = h8; + this.h[9] = h9; + } + + finish(mac: Uint8Array, macpos: number) { + var g = new Uint16Array(10); + var c, mask, f, i; + + if (this.leftover) { + i = this.leftover; + this.buffer[i++] = 1; + for (; i < 16; i++) this.buffer[i] = 0; + this.fin = 1; + this.blocks(this.buffer, 0, 16); + } + + c = this.h[1] >>> 13; + this.h[1] &= 0x1fff; + for (i = 2; i < 10; i++) { + this.h[i] += c; + c = this.h[i] >>> 13; + this.h[i] &= 0x1fff; + } + this.h[0] += c * 5; + c = this.h[0] >>> 13; + this.h[0] &= 0x1fff; + this.h[1] += c; + c = this.h[1] >>> 13; + this.h[1] &= 0x1fff; + this.h[2] += c; + + g[0] = this.h[0] + 5; + c = g[0] >>> 13; + g[0] &= 0x1fff; + for (i = 1; i < 10; i++) { + g[i] = this.h[i] + c; + c = g[i] >>> 13; + g[i] &= 0x1fff; + } + g[9] -= 1 << 13; + + mask = (c ^ 1) - 1; + for (i = 0; i < 10; i++) g[i] &= mask; + mask = ~mask; + for (i = 0; i < 10; i++) this.h[i] = (this.h[i] & mask) | g[i]; + + this.h[0] = (this.h[0] | (this.h[1] << 13)) & 0xffff; + this.h[1] = ((this.h[1] >>> 3) | (this.h[2] << 10)) & 0xffff; + this.h[2] = ((this.h[2] >>> 6) | (this.h[3] << 7)) & 0xffff; + this.h[3] = ((this.h[3] >>> 9) | (this.h[4] << 4)) & 0xffff; + this.h[4] = + ((this.h[4] >>> 12) | (this.h[5] << 1) | (this.h[6] << 14)) & 0xffff; + this.h[5] = ((this.h[6] >>> 2) | (this.h[7] << 11)) & 0xffff; + this.h[6] = ((this.h[7] >>> 5) | (this.h[8] << 8)) & 0xffff; + this.h[7] = ((this.h[8] >>> 8) | (this.h[9] << 5)) & 0xffff; + + f = this.h[0] + this.pad[0]; + this.h[0] = f & 0xffff; + for (i = 1; i < 8; i++) { + f = (((this.h[i] + this.pad[i]) | 0) + (f >>> 16)) | 0; + this.h[i] = f & 0xffff; + } + + mac[macpos + 0] = (this.h[0] >>> 0) & 0xff; + mac[macpos + 1] = (this.h[0] >>> 8) & 0xff; + mac[macpos + 2] = (this.h[1] >>> 0) & 0xff; + mac[macpos + 3] = (this.h[1] >>> 8) & 0xff; + mac[macpos + 4] = (this.h[2] >>> 0) & 0xff; + mac[macpos + 5] = (this.h[2] >>> 8) & 0xff; + mac[macpos + 6] = (this.h[3] >>> 0) & 0xff; + mac[macpos + 7] = (this.h[3] >>> 8) & 0xff; + mac[macpos + 8] = (this.h[4] >>> 0) & 0xff; + mac[macpos + 9] = (this.h[4] >>> 8) & 0xff; + mac[macpos + 10] = (this.h[5] >>> 0) & 0xff; + mac[macpos + 11] = (this.h[5] >>> 8) & 0xff; + mac[macpos + 12] = (this.h[6] >>> 0) & 0xff; + mac[macpos + 13] = (this.h[6] >>> 8) & 0xff; + mac[macpos + 14] = (this.h[7] >>> 0) & 0xff; + mac[macpos + 15] = (this.h[7] >>> 8) & 0xff; + } + + update(m: Uint8Array, mpos: number, bytes: number) { + var i, want; + + if (this.leftover) { + want = 16 - this.leftover; + if (want > bytes) want = bytes; + for (i = 0; i < want; i++) this.buffer[this.leftover + i] = m[mpos + i]; + bytes -= want; + mpos += want; + this.leftover += want; + if (this.leftover < 16) return; + this.blocks(this.buffer, 0, 16); + this.leftover = 0; + } + + if (bytes >= 16) { + want = bytes - (bytes % 16); + this.blocks(m, mpos, want); + mpos += want; + bytes -= want; + } + + if (bytes) { + for (i = 0; i < bytes; i++) this.buffer[this.leftover + i] = m[mpos + i]; + this.leftover += bytes; + } + } +} + +function crypto_onetimeauth( + out: Uint8Array, + outpos: number, + m: Uint8Array, + mpos: number, + n: number, + k: Uint8Array, +) { + var s = new poly1305(k); + s.update(m, mpos, n); + s.finish(out, outpos); + return 0; +} + +function crypto_onetimeauth_verify( + h: Uint8Array, + hpos: number, + m: Uint8Array, + mpos: number, + n: number, + k: Uint8Array, +) { + var x = new Uint8Array(16); + crypto_onetimeauth(x, 0, m, mpos, n, k); + return crypto_verify_16(h, hpos, x, 0); +} + +function crypto_secretbox( + c: Uint8Array, + m: Uint8Array, + d: number, + n: Uint8Array, + k: Uint8Array, +) { + var i; + if (d < 32) return -1; + crypto_stream_xor(c, 0, m, 0, d, n, k); + crypto_onetimeauth(c, 16, c, 32, d - 32, c); + for (i = 0; i < 16; i++) c[i] = 0; + return 0; +} + +function crypto_secretbox_open( + m: Uint8Array, + c: Uint8Array, + d: number, + n: Uint8Array, + k: Uint8Array, +) { + var i; + var x = new Uint8Array(32); + if (d < 32) return -1; + crypto_stream(x, 0, 32, n, k); + if (crypto_onetimeauth_verify(c, 16, c, 32, d - 32, x) !== 0) return -1; + crypto_stream_xor(m, 0, c, 0, d, n, k); + for (i = 0; i < 32; i++) m[i] = 0; + return 0; +} + +function set25519(r: Float64Array, a: Float64Array) { + var i; + for (i = 0; i < 16; i++) r[i] = a[i] | 0; +} + +function car25519(o: Float64Array) { + var i, + v, + c = 1; + for (i = 0; i < 16; i++) { + v = o[i] + c + 65535; + c = Math.floor(v / 65536); + o[i] = v - c * 65536; + } + o[0] += c - 1 + 37 * (c - 1); +} + +function sel25519(p: Float64Array, q: Float64Array, b: number) { + var t, + c = ~(b - 1); + for (var i = 0; i < 16; i++) { + t = c & (p[i] ^ q[i]); + p[i] ^= t; + q[i] ^= t; + } +} + +function pack25519(o: Uint8Array, n: Float64Array) { + var i, j, b; + var m = gf(), + t = gf(); + for (i = 0; i < 16; i++) t[i] = n[i]; + car25519(t); + car25519(t); + car25519(t); + for (j = 0; j < 2; j++) { + m[0] = t[0] - 0xffed; + for (i = 1; i < 15; i++) { + m[i] = t[i] - 0xffff - ((m[i - 1] >> 16) & 1); + m[i - 1] &= 0xffff; + } + m[15] = t[15] - 0x7fff - ((m[14] >> 16) & 1); + b = (m[15] >> 16) & 1; + m[14] &= 0xffff; + sel25519(t, m, 1 - b); + } + for (i = 0; i < 16; i++) { + o[2 * i] = t[i] & 0xff; + o[2 * i + 1] = t[i] >> 8; + } +} + +function neq25519(a: Float64Array, b: Float64Array) { + var c = new Uint8Array(32), + d = new Uint8Array(32); + pack25519(c, a); + pack25519(d, b); + return crypto_verify_32(c, 0, d, 0); +} + +function par25519(a: Float64Array) { + var d = new Uint8Array(32); + pack25519(d, a); + return d[0] & 1; +} + +function unpack25519(o: Float64Array, n: Uint8Array) { + var i; + for (i = 0; i < 16; i++) o[i] = n[2 * i] + (n[2 * i + 1] << 8); + o[15] &= 0x7fff; +} + +function A(o: Float64Array, a: Float64Array, b: Float64Array) { + for (var i = 0; i < 16; i++) o[i] = a[i] + b[i]; +} + +function Z(o: Float64Array, a: Float64Array, b: Float64Array) { + for (var i = 0; i < 16; i++) o[i] = a[i] - b[i]; +} + +function M(o: Float64Array, a: Float64Array, b: Float64Array) { + var v, + c, + t0 = 0, + t1 = 0, + t2 = 0, + t3 = 0, + t4 = 0, + t5 = 0, + t6 = 0, + t7 = 0, + t8 = 0, + t9 = 0, + t10 = 0, + t11 = 0, + t12 = 0, + t13 = 0, + t14 = 0, + t15 = 0, + t16 = 0, + t17 = 0, + t18 = 0, + t19 = 0, + t20 = 0, + t21 = 0, + t22 = 0, + t23 = 0, + t24 = 0, + t25 = 0, + t26 = 0, + t27 = 0, + t28 = 0, + t29 = 0, + t30 = 0, + b0 = b[0], + b1 = b[1], + b2 = b[2], + b3 = b[3], + b4 = b[4], + b5 = b[5], + b6 = b[6], + b7 = b[7], + b8 = b[8], + b9 = b[9], + b10 = b[10], + b11 = b[11], + b12 = b[12], + b13 = b[13], + b14 = b[14], + b15 = b[15]; + + v = a[0]; + t0 += v * b0; + t1 += v * b1; + t2 += v * b2; + t3 += v * b3; + t4 += v * b4; + t5 += v * b5; + t6 += v * b6; + t7 += v * b7; + t8 += v * b8; + t9 += v * b9; + t10 += v * b10; + t11 += v * b11; + t12 += v * b12; + t13 += v * b13; + t14 += v * b14; + t15 += v * b15; + v = a[1]; + t1 += v * b0; + t2 += v * b1; + t3 += v * b2; + t4 += v * b3; + t5 += v * b4; + t6 += v * b5; + t7 += v * b6; + t8 += v * b7; + t9 += v * b8; + t10 += v * b9; + t11 += v * b10; + t12 += v * b11; + t13 += v * b12; + t14 += v * b13; + t15 += v * b14; + t16 += v * b15; + v = a[2]; + t2 += v * b0; + t3 += v * b1; + t4 += v * b2; + t5 += v * b3; + t6 += v * b4; + t7 += v * b5; + t8 += v * b6; + t9 += v * b7; + t10 += v * b8; + t11 += v * b9; + t12 += v * b10; + t13 += v * b11; + t14 += v * b12; + t15 += v * b13; + t16 += v * b14; + t17 += v * b15; + v = a[3]; + t3 += v * b0; + t4 += v * b1; + t5 += v * b2; + t6 += v * b3; + t7 += v * b4; + t8 += v * b5; + t9 += v * b6; + t10 += v * b7; + t11 += v * b8; + t12 += v * b9; + t13 += v * b10; + t14 += v * b11; + t15 += v * b12; + t16 += v * b13; + t17 += v * b14; + t18 += v * b15; + v = a[4]; + t4 += v * b0; + t5 += v * b1; + t6 += v * b2; + t7 += v * b3; + t8 += v * b4; + t9 += v * b5; + t10 += v * b6; + t11 += v * b7; + t12 += v * b8; + t13 += v * b9; + t14 += v * b10; + t15 += v * b11; + t16 += v * b12; + t17 += v * b13; + t18 += v * b14; + t19 += v * b15; + v = a[5]; + t5 += v * b0; + t6 += v * b1; + t7 += v * b2; + t8 += v * b3; + t9 += v * b4; + t10 += v * b5; + t11 += v * b6; + t12 += v * b7; + t13 += v * b8; + t14 += v * b9; + t15 += v * b10; + t16 += v * b11; + t17 += v * b12; + t18 += v * b13; + t19 += v * b14; + t20 += v * b15; + v = a[6]; + t6 += v * b0; + t7 += v * b1; + t8 += v * b2; + t9 += v * b3; + t10 += v * b4; + t11 += v * b5; + t12 += v * b6; + t13 += v * b7; + t14 += v * b8; + t15 += v * b9; + t16 += v * b10; + t17 += v * b11; + t18 += v * b12; + t19 += v * b13; + t20 += v * b14; + t21 += v * b15; + v = a[7]; + t7 += v * b0; + t8 += v * b1; + t9 += v * b2; + t10 += v * b3; + t11 += v * b4; + t12 += v * b5; + t13 += v * b6; + t14 += v * b7; + t15 += v * b8; + t16 += v * b9; + t17 += v * b10; + t18 += v * b11; + t19 += v * b12; + t20 += v * b13; + t21 += v * b14; + t22 += v * b15; + v = a[8]; + t8 += v * b0; + t9 += v * b1; + t10 += v * b2; + t11 += v * b3; + t12 += v * b4; + t13 += v * b5; + t14 += v * b6; + t15 += v * b7; + t16 += v * b8; + t17 += v * b9; + t18 += v * b10; + t19 += v * b11; + t20 += v * b12; + t21 += v * b13; + t22 += v * b14; + t23 += v * b15; + v = a[9]; + t9 += v * b0; + t10 += v * b1; + t11 += v * b2; + t12 += v * b3; + t13 += v * b4; + t14 += v * b5; + t15 += v * b6; + t16 += v * b7; + t17 += v * b8; + t18 += v * b9; + t19 += v * b10; + t20 += v * b11; + t21 += v * b12; + t22 += v * b13; + t23 += v * b14; + t24 += v * b15; + v = a[10]; + t10 += v * b0; + t11 += v * b1; + t12 += v * b2; + t13 += v * b3; + t14 += v * b4; + t15 += v * b5; + t16 += v * b6; + t17 += v * b7; + t18 += v * b8; + t19 += v * b9; + t20 += v * b10; + t21 += v * b11; + t22 += v * b12; + t23 += v * b13; + t24 += v * b14; + t25 += v * b15; + v = a[11]; + t11 += v * b0; + t12 += v * b1; + t13 += v * b2; + t14 += v * b3; + t15 += v * b4; + t16 += v * b5; + t17 += v * b6; + t18 += v * b7; + t19 += v * b8; + t20 += v * b9; + t21 += v * b10; + t22 += v * b11; + t23 += v * b12; + t24 += v * b13; + t25 += v * b14; + t26 += v * b15; + v = a[12]; + t12 += v * b0; + t13 += v * b1; + t14 += v * b2; + t15 += v * b3; + t16 += v * b4; + t17 += v * b5; + t18 += v * b6; + t19 += v * b7; + t20 += v * b8; + t21 += v * b9; + t22 += v * b10; + t23 += v * b11; + t24 += v * b12; + t25 += v * b13; + t26 += v * b14; + t27 += v * b15; + v = a[13]; + t13 += v * b0; + t14 += v * b1; + t15 += v * b2; + t16 += v * b3; + t17 += v * b4; + t18 += v * b5; + t19 += v * b6; + t20 += v * b7; + t21 += v * b8; + t22 += v * b9; + t23 += v * b10; + t24 += v * b11; + t25 += v * b12; + t26 += v * b13; + t27 += v * b14; + t28 += v * b15; + v = a[14]; + t14 += v * b0; + t15 += v * b1; + t16 += v * b2; + t17 += v * b3; + t18 += v * b4; + t19 += v * b5; + t20 += v * b6; + t21 += v * b7; + t22 += v * b8; + t23 += v * b9; + t24 += v * b10; + t25 += v * b11; + t26 += v * b12; + t27 += v * b13; + t28 += v * b14; + t29 += v * b15; + v = a[15]; + t15 += v * b0; + t16 += v * b1; + t17 += v * b2; + t18 += v * b3; + t19 += v * b4; + t20 += v * b5; + t21 += v * b6; + t22 += v * b7; + t23 += v * b8; + t24 += v * b9; + t25 += v * b10; + t26 += v * b11; + t27 += v * b12; + t28 += v * b13; + t29 += v * b14; + t30 += v * b15; + + t0 += 38 * t16; + t1 += 38 * t17; + t2 += 38 * t18; + t3 += 38 * t19; + t4 += 38 * t20; + t5 += 38 * t21; + t6 += 38 * t22; + t7 += 38 * t23; + t8 += 38 * t24; + t9 += 38 * t25; + t10 += 38 * t26; + t11 += 38 * t27; + t12 += 38 * t28; + t13 += 38 * t29; + t14 += 38 * t30; + // t15 left as is + + // first car + c = 1; + v = t0 + c + 65535; + c = Math.floor(v / 65536); + t0 = v - c * 65536; + v = t1 + c + 65535; + c = Math.floor(v / 65536); + t1 = v - c * 65536; + v = t2 + c + 65535; + c = Math.floor(v / 65536); + t2 = v - c * 65536; + v = t3 + c + 65535; + c = Math.floor(v / 65536); + t3 = v - c * 65536; + v = t4 + c + 65535; + c = Math.floor(v / 65536); + t4 = v - c * 65536; + v = t5 + c + 65535; + c = Math.floor(v / 65536); + t5 = v - c * 65536; + v = t6 + c + 65535; + c = Math.floor(v / 65536); + t6 = v - c * 65536; + v = t7 + c + 65535; + c = Math.floor(v / 65536); + t7 = v - c * 65536; + v = t8 + c + 65535; + c = Math.floor(v / 65536); + t8 = v - c * 65536; + v = t9 + c + 65535; + c = Math.floor(v / 65536); + t9 = v - c * 65536; + v = t10 + c + 65535; + c = Math.floor(v / 65536); + t10 = v - c * 65536; + v = t11 + c + 65535; + c = Math.floor(v / 65536); + t11 = v - c * 65536; + v = t12 + c + 65535; + c = Math.floor(v / 65536); + t12 = v - c * 65536; + v = t13 + c + 65535; + c = Math.floor(v / 65536); + t13 = v - c * 65536; + v = t14 + c + 65535; + c = Math.floor(v / 65536); + t14 = v - c * 65536; + v = t15 + c + 65535; + c = Math.floor(v / 65536); + t15 = v - c * 65536; + t0 += c - 1 + 37 * (c - 1); + + // second car + c = 1; + v = t0 + c + 65535; + c = Math.floor(v / 65536); + t0 = v - c * 65536; + v = t1 + c + 65535; + c = Math.floor(v / 65536); + t1 = v - c * 65536; + v = t2 + c + 65535; + c = Math.floor(v / 65536); + t2 = v - c * 65536; + v = t3 + c + 65535; + c = Math.floor(v / 65536); + t3 = v - c * 65536; + v = t4 + c + 65535; + c = Math.floor(v / 65536); + t4 = v - c * 65536; + v = t5 + c + 65535; + c = Math.floor(v / 65536); + t5 = v - c * 65536; + v = t6 + c + 65535; + c = Math.floor(v / 65536); + t6 = v - c * 65536; + v = t7 + c + 65535; + c = Math.floor(v / 65536); + t7 = v - c * 65536; + v = t8 + c + 65535; + c = Math.floor(v / 65536); + t8 = v - c * 65536; + v = t9 + c + 65535; + c = Math.floor(v / 65536); + t9 = v - c * 65536; + v = t10 + c + 65535; + c = Math.floor(v / 65536); + t10 = v - c * 65536; + v = t11 + c + 65535; + c = Math.floor(v / 65536); + t11 = v - c * 65536; + v = t12 + c + 65535; + c = Math.floor(v / 65536); + t12 = v - c * 65536; + v = t13 + c + 65535; + c = Math.floor(v / 65536); + t13 = v - c * 65536; + v = t14 + c + 65535; + c = Math.floor(v / 65536); + t14 = v - c * 65536; + v = t15 + c + 65535; + c = Math.floor(v / 65536); + t15 = v - c * 65536; + t0 += c - 1 + 37 * (c - 1); + + o[0] = t0; + o[1] = t1; + o[2] = t2; + o[3] = t3; + o[4] = t4; + o[5] = t5; + o[6] = t6; + o[7] = t7; + o[8] = t8; + o[9] = t9; + o[10] = t10; + o[11] = t11; + o[12] = t12; + o[13] = t13; + o[14] = t14; + o[15] = t15; +} + +function S(o: Float64Array, a: Float64Array) { + M(o, a, a); +} + +function inv25519(o: Float64Array, i: Float64Array) { + var c = gf(); + var a; + for (a = 0; a < 16; a++) c[a] = i[a]; + for (a = 253; a >= 0; a--) { + S(c, c); + if (a !== 2 && a !== 4) M(c, c, i); + } + for (a = 0; a < 16; a++) o[a] = c[a]; +} + +function pow2523(o: Float64Array, i: Float64Array) { + var c = gf(); + var a; + for (a = 0; a < 16; a++) c[a] = i[a]; + for (a = 250; a >= 0; a--) { + S(c, c); + if (a !== 1) M(c, c, i); + } + for (a = 0; a < 16; a++) o[a] = c[a]; +} + +function crypto_scalarmult(q: Uint8Array, n: Uint8Array, p: Uint8Array) { + var z = new Uint8Array(32); + var x = new Float64Array(80), + r, + i; + var a = gf(), + b = gf(), + c = gf(), + d = gf(), + e = gf(), + f = gf(); + for (i = 0; i < 31; i++) z[i] = n[i]; + z[31] = (n[31] & 127) | 64; + z[0] &= 248; + unpack25519(x, p); + for (i = 0; i < 16; i++) { + b[i] = x[i]; + d[i] = a[i] = c[i] = 0; + } + a[0] = d[0] = 1; + for (i = 254; i >= 0; --i) { + r = (z[i >>> 3] >>> (i & 7)) & 1; + sel25519(a, b, r); + sel25519(c, d, r); + A(e, a, c); + Z(a, a, c); + A(c, b, d); + Z(b, b, d); + S(d, e); + S(f, a); + M(a, c, a); + M(c, b, e); + A(e, a, c); + Z(a, a, c); + S(b, a); + Z(c, d, f); + M(a, c, _121665); + A(a, a, d); + M(c, c, a); + M(a, d, f); + M(d, b, x); + S(b, e); + sel25519(a, b, r); + sel25519(c, d, r); + } + for (i = 0; i < 16; i++) { + x[i + 16] = a[i]; + x[i + 32] = c[i]; + x[i + 48] = b[i]; + x[i + 64] = d[i]; + } + var x32 = x.subarray(32); + var x16 = x.subarray(16); + inv25519(x32, x32); + M(x16, x16, x32); + pack25519(q, x16); + return 0; +} + +function crypto_scalarmult_base(q: Uint8Array, n: Uint8Array) { + return crypto_scalarmult(q, n, _9); +} + +function crypto_box_keypair(y: Uint8Array, x: Uint8Array) { + randombytes(x, 32); + return crypto_scalarmult_base(y, x); +} + +function crypto_box_beforenm(k: Uint8Array, y: Uint8Array, x: Uint8Array) { + var s = new Uint8Array(32); + crypto_scalarmult(s, x, y); + return crypto_core_hsalsa20(k, _0, s, sigma); +} + +var crypto_box_afternm = crypto_secretbox; +var crypto_box_open_afternm = crypto_secretbox_open; + +function crypto_box( + c: Uint8Array, + m: Uint8Array, + d: number, + n: Uint8Array, + y: Uint8Array, + x: Uint8Array, +) { + var k = new Uint8Array(32); + crypto_box_beforenm(k, y, x); + return crypto_box_afternm(c, m, d, n, k); +} + +function crypto_box_open( + m: Uint8Array, + c: Uint8Array, + d: number, + n: Uint8Array, + y: Uint8Array, + x: Uint8Array, +) { + var k = new Uint8Array(32); + crypto_box_beforenm(k, y, x); + return crypto_box_open_afternm(m, c, d, n, k); +} + +// prettier-ignore +var K = [ + 0x428a2f98, 0xd728ae22, 0x71374491, 0x23ef65cd, + 0xb5c0fbcf, 0xec4d3b2f, 0xe9b5dba5, 0x8189dbbc, + 0x3956c25b, 0xf348b538, 0x59f111f1, 0xb605d019, + 0x923f82a4, 0xaf194f9b, 0xab1c5ed5, 0xda6d8118, + 0xd807aa98, 0xa3030242, 0x12835b01, 0x45706fbe, + 0x243185be, 0x4ee4b28c, 0x550c7dc3, 0xd5ffb4e2, + 0x72be5d74, 0xf27b896f, 0x80deb1fe, 0x3b1696b1, + 0x9bdc06a7, 0x25c71235, 0xc19bf174, 0xcf692694, + 0xe49b69c1, 0x9ef14ad2, 0xefbe4786, 0x384f25e3, + 0x0fc19dc6, 0x8b8cd5b5, 0x240ca1cc, 0x77ac9c65, + 0x2de92c6f, 0x592b0275, 0x4a7484aa, 0x6ea6e483, + 0x5cb0a9dc, 0xbd41fbd4, 0x76f988da, 0x831153b5, + 0x983e5152, 0xee66dfab, 0xa831c66d, 0x2db43210, + 0xb00327c8, 0x98fb213f, 0xbf597fc7, 0xbeef0ee4, + 0xc6e00bf3, 0x3da88fc2, 0xd5a79147, 0x930aa725, + 0x06ca6351, 0xe003826f, 0x14292967, 0x0a0e6e70, + 0x27b70a85, 0x46d22ffc, 0x2e1b2138, 0x5c26c926, + 0x4d2c6dfc, 0x5ac42aed, 0x53380d13, 0x9d95b3df, + 0x650a7354, 0x8baf63de, 0x766a0abb, 0x3c77b2a8, + 0x81c2c92e, 0x47edaee6, 0x92722c85, 0x1482353b, + 0xa2bfe8a1, 0x4cf10364, 0xa81a664b, 0xbc423001, + 0xc24b8b70, 0xd0f89791, 0xc76c51a3, 0x0654be30, + 0xd192e819, 0xd6ef5218, 0xd6990624, 0x5565a910, + 0xf40e3585, 0x5771202a, 0x106aa070, 0x32bbd1b8, + 0x19a4c116, 0xb8d2d0c8, 0x1e376c08, 0x5141ab53, + 0x2748774c, 0xdf8eeb99, 0x34b0bcb5, 0xe19b48a8, + 0x391c0cb3, 0xc5c95a63, 0x4ed8aa4a, 0xe3418acb, + 0x5b9cca4f, 0x7763e373, 0x682e6ff3, 0xd6b2b8a3, + 0x748f82ee, 0x5defb2fc, 0x78a5636f, 0x43172f60, + 0x84c87814, 0xa1f0ab72, 0x8cc70208, 0x1a6439ec, + 0x90befffa, 0x23631e28, 0xa4506ceb, 0xde82bde9, + 0xbef9a3f7, 0xb2c67915, 0xc67178f2, 0xe372532b, + 0xca273ece, 0xea26619c, 0xd186b8c7, 0x21c0c207, + 0xeada7dd6, 0xcde0eb1e, 0xf57d4f7f, 0xee6ed178, + 0x06f067aa, 0x72176fba, 0x0a637dc5, 0xa2c898a6, + 0x113f9804, 0xbef90dae, 0x1b710b35, 0x131c471b, + 0x28db77f5, 0x23047d84, 0x32caab7b, 0x40c72493, + 0x3c9ebe0a, 0x15c9bebc, 0x431d67c4, 0x9c100d4c, + 0x4cc5d4be, 0xcb3e42b6, 0x597f299c, 0xfc657e2a, + 0x5fcb6fab, 0x3ad6faec, 0x6c44198c, 0x4a475817 +]; + +function crypto_hashblocks_hl( + hh: Int32Array, + hl: Int32Array, + m: Uint8Array, + n: number, +) { + var wh = new Int32Array(16), + wl = new Int32Array(16), + bh0, + bh1, + bh2, + bh3, + bh4, + bh5, + bh6, + bh7, + bl0, + bl1, + bl2, + bl3, + bl4, + bl5, + bl6, + bl7, + th, + tl, + i, + j, + h, + l, + a, + b, + c, + d; + + var ah0 = hh[0], + ah1 = hh[1], + ah2 = hh[2], + ah3 = hh[3], + ah4 = hh[4], + ah5 = hh[5], + ah6 = hh[6], + ah7 = hh[7], + al0 = hl[0], + al1 = hl[1], + al2 = hl[2], + al3 = hl[3], + al4 = hl[4], + al5 = hl[5], + al6 = hl[6], + al7 = hl[7]; + + var pos = 0; + while (n >= 128) { + for (i = 0; i < 16; i++) { + j = 8 * i + pos; + wh[i] = (m[j + 0] << 24) | (m[j + 1] << 16) | (m[j + 2] << 8) | m[j + 3]; + wl[i] = (m[j + 4] << 24) | (m[j + 5] << 16) | (m[j + 6] << 8) | m[j + 7]; + } + for (i = 0; i < 80; i++) { + bh0 = ah0; + bh1 = ah1; + bh2 = ah2; + bh3 = ah3; + bh4 = ah4; + bh5 = ah5; + bh6 = ah6; + bh7 = ah7; + + bl0 = al0; + bl1 = al1; + bl2 = al2; + bl3 = al3; + bl4 = al4; + bl5 = al5; + bl6 = al6; + bl7 = al7; + + // add + h = ah7; + l = al7; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + // Sigma1 + h = + ((ah4 >>> 14) | (al4 << (32 - 14))) ^ + ((ah4 >>> 18) | (al4 << (32 - 18))) ^ + ((al4 >>> (41 - 32)) | (ah4 << (32 - (41 - 32)))); + l = + ((al4 >>> 14) | (ah4 << (32 - 14))) ^ + ((al4 >>> 18) | (ah4 << (32 - 18))) ^ + ((ah4 >>> (41 - 32)) | (al4 << (32 - (41 - 32)))); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // Ch + h = (ah4 & ah5) ^ (~ah4 & ah6); + l = (al4 & al5) ^ (~al4 & al6); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // K + h = K[i * 2]; + l = K[i * 2 + 1]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // w + h = wh[i % 16]; + l = wl[i % 16]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + th = (c & 0xffff) | (d << 16); + tl = (a & 0xffff) | (b << 16); + + // add + h = th; + l = tl; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + // Sigma0 + h = + ((ah0 >>> 28) | (al0 << (32 - 28))) ^ + ((al0 >>> (34 - 32)) | (ah0 << (32 - (34 - 32)))) ^ + ((al0 >>> (39 - 32)) | (ah0 << (32 - (39 - 32)))); + l = + ((al0 >>> 28) | (ah0 << (32 - 28))) ^ + ((ah0 >>> (34 - 32)) | (al0 << (32 - (34 - 32)))) ^ + ((ah0 >>> (39 - 32)) | (al0 << (32 - (39 - 32)))); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // Maj + h = (ah0 & ah1) ^ (ah0 & ah2) ^ (ah1 & ah2); + l = (al0 & al1) ^ (al0 & al2) ^ (al1 & al2); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + bh7 = (c & 0xffff) | (d << 16); + bl7 = (a & 0xffff) | (b << 16); + + // add + h = bh3; + l = bl3; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = th; + l = tl; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + bh3 = (c & 0xffff) | (d << 16); + bl3 = (a & 0xffff) | (b << 16); + + ah1 = bh0; + ah2 = bh1; + ah3 = bh2; + ah4 = bh3; + ah5 = bh4; + ah6 = bh5; + ah7 = bh6; + ah0 = bh7; + + al1 = bl0; + al2 = bl1; + al3 = bl2; + al4 = bl3; + al5 = bl4; + al6 = bl5; + al7 = bl6; + al0 = bl7; + + if (i % 16 === 15) { + for (j = 0; j < 16; j++) { + // add + h = wh[j]; + l = wl[j]; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = wh[(j + 9) % 16]; + l = wl[(j + 9) % 16]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // sigma0 + th = wh[(j + 1) % 16]; + tl = wl[(j + 1) % 16]; + h = + ((th >>> 1) | (tl << (32 - 1))) ^ + ((th >>> 8) | (tl << (32 - 8))) ^ + (th >>> 7); + l = + ((tl >>> 1) | (th << (32 - 1))) ^ + ((tl >>> 8) | (th << (32 - 8))) ^ + ((tl >>> 7) | (th << (32 - 7))); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + // sigma1 + th = wh[(j + 14) % 16]; + tl = wl[(j + 14) % 16]; + h = + ((th >>> 19) | (tl << (32 - 19))) ^ + ((tl >>> (61 - 32)) | (th << (32 - (61 - 32)))) ^ + (th >>> 6); + l = + ((tl >>> 19) | (th << (32 - 19))) ^ + ((th >>> (61 - 32)) | (tl << (32 - (61 - 32)))) ^ + ((tl >>> 6) | (th << (32 - 6))); + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + wh[j] = (c & 0xffff) | (d << 16); + wl[j] = (a & 0xffff) | (b << 16); + } + } + } + + // add + h = ah0; + l = al0; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[0]; + l = hl[0]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[0] = ah0 = (c & 0xffff) | (d << 16); + hl[0] = al0 = (a & 0xffff) | (b << 16); + + h = ah1; + l = al1; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[1]; + l = hl[1]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[1] = ah1 = (c & 0xffff) | (d << 16); + hl[1] = al1 = (a & 0xffff) | (b << 16); + + h = ah2; + l = al2; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[2]; + l = hl[2]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[2] = ah2 = (c & 0xffff) | (d << 16); + hl[2] = al2 = (a & 0xffff) | (b << 16); + + h = ah3; + l = al3; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[3]; + l = hl[3]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[3] = ah3 = (c & 0xffff) | (d << 16); + hl[3] = al3 = (a & 0xffff) | (b << 16); + + h = ah4; + l = al4; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[4]; + l = hl[4]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[4] = ah4 = (c & 0xffff) | (d << 16); + hl[4] = al4 = (a & 0xffff) | (b << 16); + + h = ah5; + l = al5; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[5]; + l = hl[5]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[5] = ah5 = (c & 0xffff) | (d << 16); + hl[5] = al5 = (a & 0xffff) | (b << 16); + + h = ah6; + l = al6; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[6]; + l = hl[6]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[6] = ah6 = (c & 0xffff) | (d << 16); + hl[6] = al6 = (a & 0xffff) | (b << 16); + + h = ah7; + l = al7; + + a = l & 0xffff; + b = l >>> 16; + c = h & 0xffff; + d = h >>> 16; + + h = hh[7]; + l = hl[7]; + + a += l & 0xffff; + b += l >>> 16; + c += h & 0xffff; + d += h >>> 16; + + b += a >>> 16; + c += b >>> 16; + d += c >>> 16; + + hh[7] = ah7 = (c & 0xffff) | (d << 16); + hl[7] = al7 = (a & 0xffff) | (b << 16); + + pos += 128; + n -= 128; + } + + return n; +} + +function crypto_hash(out: Uint8Array, m: Uint8Array, n: number) { + const hh = new Int32Array(8); + const hl = new Int32Array(8); + const x = new Uint8Array(256); + let b = n; + + hh[0] = 0x6a09e667; + hh[1] = 0xbb67ae85; + hh[2] = 0x3c6ef372; + hh[3] = 0xa54ff53a; + hh[4] = 0x510e527f; + hh[5] = 0x9b05688c; + hh[6] = 0x1f83d9ab; + hh[7] = 0x5be0cd19; + + hl[0] = 0xf3bcc908; + hl[1] = 0x84caa73b; + hl[2] = 0xfe94f82b; + hl[3] = 0x5f1d36f1; + hl[4] = 0xade682d1; + hl[5] = 0x2b3e6c1f; + hl[6] = 0xfb41bd6b; + hl[7] = 0x137e2179; + + crypto_hashblocks_hl(hh, hl, m, n); + n %= 128; + + for (let i = 0; i < n; i++) x[i] = m[b - n + i]; + x[n] = 128; + + n = 256 - 128 * (n < 112 ? 1 : 0); + x[n - 9] = 0; + ts64(x, n - 8, (b / 0x20000000) | 0, b << 3); + crypto_hashblocks_hl(hh, hl, x, n); + + for (let i = 0; i < 8; i++) + ts64(out, 8 * i, hh[i], hl[i]); + + return 0; +} + + +/** + * Incremental version of crypto_hash. + */ +export class HashState { + private hh = new Int32Array(8); + private hl = new Int32Array(8); + + private next = new Uint8Array(128); + private p = 0; + private total = 0; + + constructor() { + this.hh[0] = 0x6a09e667; + this.hh[1] = 0xbb67ae85; + this.hh[2] = 0x3c6ef372; + this.hh[3] = 0xa54ff53a; + this.hh[4] = 0x510e527f; + this.hh[5] = 0x9b05688c; + this.hh[6] = 0x1f83d9ab; + this.hh[7] = 0x5be0cd19; + + this.hl[0] = 0xf3bcc908; + this.hl[1] = 0x84caa73b; + this.hl[2] = 0xfe94f82b; + this.hl[3] = 0x5f1d36f1; + this.hl[4] = 0xade682d1; + this.hl[5] = 0x2b3e6c1f; + this.hl[6] = 0xfb41bd6b; + this.hl[7] = 0x137e2179; + } + + update(data: Uint8Array): HashState { + this.total += data.length; + let i = 0; + while (i < data.length) { + const r = 128 - this.p; + if (r > (data.length - i)) { + for (let j = 0; i + j < data.length; j++) { + this.next[this.p + j] = data[i + j]; + } + this.p += data.length - i; + break; + } else { + for (let j = 0; this.p + j < 128; j++) { + this.next[this.p + j] = data[i + j]; + } + crypto_hashblocks_hl(this.hh, this.hl, this.next, 128); + i += 128 - this.p; + this.p = 0; + } + } + return this; + } + + finish(): Uint8Array { + const out = new Uint8Array(64); + let n = this.p; + const x = new Uint8Array(256); + let b = this.total; + for (let i = 0; i < n; i++) x[i] = this.next[i]; + x[n] = 128; + + n = 256 - 128 * (n < 112 ? 1 : 0); + x[n - 9] = 0; + ts64(x, n - 8, (b / 0x20000000) | 0, b << 3); + crypto_hashblocks_hl(this.hh, this.hl, x, n); + + for (let i = 0; i < 8; i++) + ts64(out, 8 * i, this.hh[i], this.hl[i]); + return out; + } +} + +function add(p: Float64Array[], q: Float64Array[]) { + var a = gf(), + b = gf(), + c = gf(), + d = gf(), + e = gf(), + f = gf(), + g = gf(), + h = gf(), + t = gf(); + + Z(a, p[1], p[0]); + Z(t, q[1], q[0]); + M(a, a, t); + A(b, p[0], p[1]); + A(t, q[0], q[1]); + M(b, b, t); + M(c, p[3], q[3]); + M(c, c, D2); + M(d, p[2], q[2]); + A(d, d, d); + Z(e, b, a); + Z(f, d, c); + A(g, d, c); + A(h, b, a); + + M(p[0], e, f); + M(p[1], h, g); + M(p[2], g, f); + M(p[3], e, h); +} + +function cswap(p: Float64Array[], q: Float64Array[], b: number) { + var i; + for (i = 0; i < 4; i++) { + sel25519(p[i], q[i], b); + } +} + +function pack(r: Uint8Array, p: Float64Array[]) { + var tx = gf(), + ty = gf(), + zi = gf(); + inv25519(zi, p[2]); + M(tx, p[0], zi); + M(ty, p[1], zi); + pack25519(r, ty); + r[31] ^= par25519(tx) << 7; +} + +function scalarmult(p: Float64Array[], q: Float64Array[], s: Uint8Array) { + var b, i; + set25519(p[0], gf0); + set25519(p[1], gf1); + set25519(p[2], gf1); + set25519(p[3], gf0); + for (i = 255; i >= 0; --i) { + b = (s[(i / 8) | 0] >> (i & 7)) & 1; + cswap(p, q, b); + add(q, p); + add(p, p); + cswap(p, q, b); + } +} + +function scalarbase(p: Float64Array[], s: Uint8Array) { + const q = [gf(), gf(), gf(), gf()]; + set25519(q[0], X); + set25519(q[1], Y); + set25519(q[2], gf1); + M(q[3], X, Y); + scalarmult(p, q, s); +} + +function crypto_sign_keypair( + pk: Uint8Array, + sk: Uint8Array, + seeded: boolean, +): number { + const d = new Uint8Array(64); + const p = [gf(), gf(), gf(), gf()]; + + if (!seeded) randombytes(sk, 32); + crypto_hash(d, sk, 32); + d[0] &= 248; + d[31] &= 127; + d[31] |= 64; + + scalarbase(p, d); + pack(pk, p); + + for (let i = 0; i < 32; i++) sk[i + 32] = pk[i]; + return 0; +} + +var L = new Float64Array([ + 0xed, + 0xd3, + 0xf5, + 0x5c, + 0x1a, + 0x63, + 0x12, + 0x58, + 0xd6, + 0x9c, + 0xf7, + 0xa2, + 0xde, + 0xf9, + 0xde, + 0x14, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0, + 0x10, +]); + +function modL(r: Uint8Array, x: Float64Array) { + var carry, i, j, k; + for (i = 63; i >= 32; --i) { + carry = 0; + for (j = i - 32, k = i - 12; j < k; ++j) { + x[j] += carry - 16 * x[i] * L[j - (i - 32)]; + carry = (x[j] + 128) >> 8; + x[j] -= carry * 256; + } + x[j] += carry; + x[i] = 0; + } + carry = 0; + for (j = 0; j < 32; j++) { + x[j] += carry - (x[31] >> 4) * L[j]; + carry = x[j] >> 8; + x[j] &= 255; + } + for (j = 0; j < 32; j++) x[j] -= carry * L[j]; + for (i = 0; i < 32; i++) { + x[i + 1] += x[i] >> 8; + r[i] = x[i] & 255; + } +} + +function reduce(r: Uint8Array) { + const x = new Float64Array(64); + for (let i = 0; i < 64; i++) x[i] = r[i]; + for (let i = 0; i < 64; i++) r[i] = 0; + modL(r, x); +} + +// Note: difference from C - smlen returned, not passed as argument. +function crypto_sign(sm: Uint8Array, m: Uint8Array, n: number, sk: Uint8Array) { + var d = new Uint8Array(64), + h = new Uint8Array(64), + r = new Uint8Array(64); + var i, + j, + x = new Float64Array(64); + var p = [gf(), gf(), gf(), gf()]; + + crypto_hash(d, sk, 32); + d[0] &= 248; + d[31] &= 127; + d[31] |= 64; + + var smlen = n + 64; + for (i = 0; i < n; i++) sm[64 + i] = m[i]; + for (i = 0; i < 32; i++) sm[32 + i] = d[32 + i]; + + crypto_hash(r, sm.subarray(32), n + 32); + reduce(r); + scalarbase(p, r); + pack(sm, p); + + for (i = 32; i < 64; i++) sm[i] = sk[i]; + crypto_hash(h, sm, n + 64); + reduce(h); + + for (i = 0; i < 64; i++) x[i] = 0; + for (i = 0; i < 32; i++) x[i] = r[i]; + for (i = 0; i < 32; i++) { + for (j = 0; j < 32; j++) { + x[i + j] += h[i] * d[j]; + } + } + + modL(sm.subarray(32), x); + return smlen; +} + +function unpackneg(r: Float64Array[], p: Uint8Array) { + const t = gf(); + const chk = gf(); + const num = gf(); + const den = gf(); + const den2 = gf(); + const den4 = gf(); + const den6 = gf(); + + set25519(r[2], gf1); + unpack25519(r[1], p); + S(num, r[1]); + M(den, num, D); + Z(num, num, r[2]); + A(den, r[2], den); + + S(den2, den); + S(den4, den2); + M(den6, den4, den2); + M(t, den6, num); + M(t, t, den); + + pow2523(t, t); + M(t, t, num); + M(t, t, den); + M(t, t, den); + M(r[0], t, den); + + S(chk, r[0]); + M(chk, chk, den); + if (neq25519(chk, num)) M(r[0], r[0], I); + + S(chk, r[0]); + M(chk, chk, den); + if (neq25519(chk, num)) return -1; + + if (par25519(r[0]) === p[31] >> 7) Z(r[0], gf0, r[0]); + + M(r[3], r[0], r[1]); + return 0; +} + +function crypto_sign_open( + m: Uint8Array, + sm: Uint8Array, + n: number, + pk: Uint8Array, +) { + var i, mlen; + var t = new Uint8Array(32), + h = new Uint8Array(64); + var p = [gf(), gf(), gf(), gf()], + q = [gf(), gf(), gf(), gf()]; + + mlen = -1; + if (n < 64) return -1; + + if (unpackneg(q, pk)) return -1; + + for (i = 0; i < n; i++) m[i] = sm[i]; + for (i = 0; i < 32; i++) m[i + 32] = pk[i]; + crypto_hash(h, m, n); + reduce(h); + scalarmult(p, q, h); + + scalarbase(q, sm.subarray(32)); + add(p, q); + pack(t, p); + + n -= 64; + if (crypto_verify_32(sm, 0, t, 0)) { + for (i = 0; i < n; i++) m[i] = 0; + return -1; + } + + for (i = 0; i < n; i++) m[i] = sm[i + 64]; + mlen = n; + return mlen; +} + +var crypto_secretbox_KEYBYTES = 32, + crypto_secretbox_NONCEBYTES = 24, + crypto_secretbox_ZEROBYTES = 32, + crypto_secretbox_BOXZEROBYTES = 16, + crypto_scalarmult_BYTES = 32, + crypto_scalarmult_SCALARBYTES = 32, + crypto_box_PUBLICKEYBYTES = 32, + crypto_box_SECRETKEYBYTES = 32, + crypto_box_BEFORENMBYTES = 32, + crypto_box_NONCEBYTES = crypto_secretbox_NONCEBYTES, + crypto_box_ZEROBYTES = crypto_secretbox_ZEROBYTES, + crypto_box_BOXZEROBYTES = crypto_secretbox_BOXZEROBYTES, + crypto_sign_BYTES = 64, + crypto_sign_PUBLICKEYBYTES = 32, + crypto_sign_SECRETKEYBYTES = 64, + crypto_sign_SEEDBYTES = 32, + crypto_hash_BYTES = 64; + +const lowlevel = { + crypto_core_hsalsa20: crypto_core_hsalsa20, + crypto_stream_xor: crypto_stream_xor, + crypto_stream: crypto_stream, + crypto_stream_salsa20_xor: crypto_stream_salsa20_xor, + crypto_stream_salsa20: crypto_stream_salsa20, + crypto_onetimeauth: crypto_onetimeauth, + crypto_onetimeauth_verify: crypto_onetimeauth_verify, + crypto_verify_16: crypto_verify_16, + crypto_verify_32: crypto_verify_32, + crypto_secretbox: crypto_secretbox, + crypto_secretbox_open: crypto_secretbox_open, + crypto_scalarmult: crypto_scalarmult, + crypto_scalarmult_base: crypto_scalarmult_base, + crypto_box_beforenm: crypto_box_beforenm, + crypto_box_afternm: crypto_box_afternm, + crypto_box: crypto_box, + crypto_box_open: crypto_box_open, + crypto_box_keypair: crypto_box_keypair, + crypto_hash: crypto_hash, + crypto_sign: crypto_sign, + crypto_sign_keypair: crypto_sign_keypair, + crypto_sign_open: crypto_sign_open, + + crypto_secretbox_KEYBYTES: crypto_secretbox_KEYBYTES, + crypto_secretbox_NONCEBYTES: crypto_secretbox_NONCEBYTES, + crypto_secretbox_ZEROBYTES: crypto_secretbox_ZEROBYTES, + crypto_secretbox_BOXZEROBYTES: crypto_secretbox_BOXZEROBYTES, + crypto_scalarmult_BYTES: crypto_scalarmult_BYTES, + crypto_scalarmult_SCALARBYTES: crypto_scalarmult_SCALARBYTES, + crypto_box_PUBLICKEYBYTES: crypto_box_PUBLICKEYBYTES, + crypto_box_SECRETKEYBYTES: crypto_box_SECRETKEYBYTES, + crypto_box_BEFORENMBYTES: crypto_box_BEFORENMBYTES, + crypto_box_NONCEBYTES: crypto_box_NONCEBYTES, + crypto_box_ZEROBYTES: crypto_box_ZEROBYTES, + crypto_box_BOXZEROBYTES: crypto_box_BOXZEROBYTES, + crypto_sign_BYTES: crypto_sign_BYTES, + crypto_sign_PUBLICKEYBYTES: crypto_sign_PUBLICKEYBYTES, + crypto_sign_SECRETKEYBYTES: crypto_sign_SECRETKEYBYTES, + crypto_sign_SEEDBYTES: crypto_sign_SEEDBYTES, + crypto_hash_BYTES: crypto_hash_BYTES, +}; + +/* High-level API */ + +function checkLengths(k: Uint8Array, n: Uint8Array) { + if (k.length !== crypto_secretbox_KEYBYTES) throw new Error("bad key size"); + if (n.length !== crypto_secretbox_NONCEBYTES) + throw new Error("bad nonce size"); +} + +function checkBoxLengths(pk: Uint8Array, sk: Uint8Array) { + if (pk.length !== crypto_box_PUBLICKEYBYTES) + throw new Error("bad public key size"); + if (sk.length !== crypto_box_SECRETKEYBYTES) + throw new Error("bad secret key size"); +} + +function checkArrayTypes(...args: Uint8Array[]) { + for (var i = 0; i < args.length; i++) { + if (!(args[i] instanceof Uint8Array)) + throw new TypeError("unexpected type, use Uint8Array"); + } +} + +function cleanup(arr: Uint8Array) { + for (var i = 0; i < arr.length; i++) arr[i] = 0; +} + +export function randomBytes(n: number) { + var b = new Uint8Array(n); + randombytes(b, n); + return b; +} + +export function secretbox(msg: Uint8Array, nonce: Uint8Array, key: Uint8Array) { + checkArrayTypes(msg, nonce, key); + checkLengths(key, nonce); + var m = new Uint8Array(crypto_secretbox_ZEROBYTES + msg.length); + var c = new Uint8Array(m.length); + for (var i = 0; i < msg.length; i++) + m[i + crypto_secretbox_ZEROBYTES] = msg[i]; + crypto_secretbox(c, m, m.length, nonce, key); + return c.subarray(crypto_secretbox_BOXZEROBYTES); +} + +export function secretbox_open( + box: Uint8Array, + nonce: Uint8Array, + key: Uint8Array, +) { + checkArrayTypes(box, nonce, key); + checkLengths(key, nonce); + var c = new Uint8Array(crypto_secretbox_BOXZEROBYTES + box.length); + var m = new Uint8Array(c.length); + for (var i = 0; i < box.length; i++) + c[i + crypto_secretbox_BOXZEROBYTES] = box[i]; + if (c.length < 32) return null; + if (crypto_secretbox_open(m, c, c.length, nonce, key) !== 0) return null; + return m.subarray(crypto_secretbox_ZEROBYTES); +} + +export const secretbox_keyLength = crypto_secretbox_KEYBYTES; +export const secretbox_nonceLength = crypto_secretbox_NONCEBYTES; +export const secretbox_overheadLength = crypto_secretbox_BOXZEROBYTES; + +export function scalarMult(n: Uint8Array, p: Uint8Array) { + checkArrayTypes(n, p); + if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size"); + if (p.length !== crypto_scalarmult_BYTES) throw new Error("bad p size"); + var q = new Uint8Array(crypto_scalarmult_BYTES); + crypto_scalarmult(q, n, p); + return q; +} + +export function scalarMult_base(n: Uint8Array) { + checkArrayTypes(n); + if (n.length !== crypto_scalarmult_SCALARBYTES) throw new Error("bad n size"); + var q = new Uint8Array(crypto_scalarmult_BYTES); + crypto_scalarmult_base(q, n); + return q; +} + +export const scalarMult_scalarLength = crypto_scalarmult_SCALARBYTES; +export const scalarMult_groupElementLength = crypto_scalarmult_BYTES; + +export function box( + msg: Uint8Array, + nonce: Uint8Array, + publicKey: Uint8Array, + secretKey: Uint8Array, +) { + var k = box_before(publicKey, secretKey); + return secretbox(msg, nonce, k); +} + +export function box_before(publicKey: Uint8Array, secretKey: Uint8Array) { + checkArrayTypes(publicKey, secretKey); + checkBoxLengths(publicKey, secretKey); + var k = new Uint8Array(crypto_box_BEFORENMBYTES); + crypto_box_beforenm(k, publicKey, secretKey); + return k; +} + +export const box_after = secretbox; + +export function box_open( + msg: Uint8Array, + nonce: Uint8Array, + publicKey: Uint8Array, + secretKey: Uint8Array, +) { + var k = box_before(publicKey, secretKey); + return secretbox_open(msg, nonce, k); +} + +export const box_open_after = secretbox_open; + +export function box_keyPair() { + var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_box_SECRETKEYBYTES); + crypto_box_keypair(pk, sk); + return { publicKey: pk, secretKey: sk }; +} + +export function box_keyPair_fromSecretKey(secretKey: Uint8Array) { + checkArrayTypes(secretKey); + if (secretKey.length !== crypto_box_SECRETKEYBYTES) + throw new Error("bad secret key size"); + var pk = new Uint8Array(crypto_box_PUBLICKEYBYTES); + crypto_scalarmult_base(pk, secretKey); + return { publicKey: pk, secretKey: new Uint8Array(secretKey) }; +} + +export const box_publicKeyLength = crypto_box_PUBLICKEYBYTES; +export const box_secretKeyLength = crypto_box_SECRETKEYBYTES; +export const box_sharedKeyLength = crypto_box_BEFORENMBYTES; +export const box_nonceLength = crypto_box_NONCEBYTES; +export const box_overheadLength = secretbox_overheadLength; + +export function sign(msg: Uint8Array, secretKey: Uint8Array) { + checkArrayTypes(msg, secretKey); + if (secretKey.length !== crypto_sign_SECRETKEYBYTES) + throw new Error("bad secret key size"); + var signedMsg = new Uint8Array(crypto_sign_BYTES + msg.length); + crypto_sign(signedMsg, msg, msg.length, secretKey); + return signedMsg; +} + +export function sign_open(signedMsg: Uint8Array, publicKey: Uint8Array) { + checkArrayTypes(signedMsg, publicKey); + if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) + throw new Error("bad public key size"); + var tmp = new Uint8Array(signedMsg.length); + var mlen = crypto_sign_open(tmp, signedMsg, signedMsg.length, publicKey); + if (mlen < 0) return null; + var m = new Uint8Array(mlen); + for (var i = 0; i < m.length; i++) m[i] = tmp[i]; + return m; +} + +export function sign_detached(msg: Uint8Array, secretKey: Uint8Array) { + var signedMsg = sign(msg, secretKey); + var sig = new Uint8Array(crypto_sign_BYTES); + for (var i = 0; i < sig.length; i++) sig[i] = signedMsg[i]; + return sig; +} + +export function sign_detached_verify( + msg: Uint8Array, + sig: Uint8Array, + publicKey: Uint8Array, +) { + checkArrayTypes(msg, sig, publicKey); + if (sig.length !== crypto_sign_BYTES) throw new Error("bad signature size"); + if (publicKey.length !== crypto_sign_PUBLICKEYBYTES) + throw new Error("bad public key size"); + var sm = new Uint8Array(crypto_sign_BYTES + msg.length); + var m = new Uint8Array(crypto_sign_BYTES + msg.length); + var i; + for (i = 0; i < crypto_sign_BYTES; i++) sm[i] = sig[i]; + for (i = 0; i < msg.length; i++) sm[i + crypto_sign_BYTES] = msg[i]; + return crypto_sign_open(m, sm, sm.length, publicKey) >= 0; +} + +export function sign_keyPair() { + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); + crypto_sign_keypair(pk, sk, false); + return { publicKey: pk, secretKey: sk }; +} + +export function x25519_edwards_keyPair_fromSecretKey( + secretKey: Uint8Array, +): Uint8Array { + const p = [gf(), gf(), gf(), gf()]; + const pk = new Uint8Array(32); + + const d = new Uint8Array(64); + if (secretKey.length != 32) { + throw new Error("bad secret key size"); + } + d.set(secretKey, 0); + //crypto_hash(d, secretKey, 32); + + d[0] &= 248; + d[31] &= 127; + d[31] |= 64; + + scalarbase(p, d); + pack(pk, p); + + return pk; +} + +export function sign_keyPair_fromSecretKey(secretKey: Uint8Array) { + checkArrayTypes(secretKey); + if (secretKey.length !== crypto_sign_SECRETKEYBYTES) + throw new Error("bad secret key size"); + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + for (var i = 0; i < pk.length; i++) pk[i] = secretKey[32 + i]; + return { publicKey: pk, secretKey: new Uint8Array(secretKey) }; +} + +export function sign_keyPair_fromSeed(seed: Uint8Array) { + checkArrayTypes(seed); + if (seed.length !== crypto_sign_SEEDBYTES) throw new Error("bad seed size"); + var pk = new Uint8Array(crypto_sign_PUBLICKEYBYTES); + var sk = new Uint8Array(crypto_sign_SECRETKEYBYTES); + for (var i = 0; i < 32; i++) sk[i] = seed[i]; + crypto_sign_keypair(pk, sk, true); + return { publicKey: pk, secretKey: sk }; +} + +export const sign_publicKeyLength = crypto_sign_PUBLICKEYBYTES; +export const sign_secretKeyLength = crypto_sign_SECRETKEYBYTES; +export const sign_seedLength = crypto_sign_SEEDBYTES; +export const sign_signatureLength = crypto_sign_BYTES; + +export function hash(msg: Uint8Array) { + checkArrayTypes(msg); + var h = new Uint8Array(crypto_hash_BYTES); + crypto_hash(h, msg, msg.length); + return h; +} + +export const hash_hashLength = crypto_hash_BYTES; + +export function verify(x: Uint8Array, y: Uint8Array) { + checkArrayTypes(x, y); + // Zero length arguments are considered not equal. + if (x.length === 0 || y.length === 0) return false; + if (x.length !== y.length) return false; + return vn(x, 0, y, 0, x.length) === 0 ? true : false; +} + +export function setPRNG(fn: (x: Uint8Array, n: number) => void) { + randombytes = fn; +} + +export function sign_ed25519_pk_to_curve25519( + ed25519_pk: Uint8Array, +): Uint8Array { + const ge_a = [gf(), gf(), gf(), gf()]; + const x = gf(); + const one_minus_y = gf(); + const x25519_pk = new Uint8Array(32); + + if (unpackneg(ge_a, ed25519_pk)) { + throw Error("invalid public key"); + } + + set25519(one_minus_y, gf1); + Z(one_minus_y, one_minus_y, ge_a[1]); + + set25519(x, gf1); + A(x, x, ge_a[1]); + + inv25519(one_minus_y, one_minus_y); + M(x, x, one_minus_y); + pack25519(x25519_pk, x); + + return x25519_pk; +} + +(function() { + // Initialize PRNG if environment provides CSPRNG. + // If not, methods calling randombytes will throw. + const crypto = + typeof self !== "undefined" ? self.crypto || (self as any).msCrypto : null; + if (crypto && crypto.getRandomValues) { + // Browsers. + var QUOTA = 65536; + setPRNG(function(x: Uint8Array, n: number) { + var i, + v = new Uint8Array(n); + for (i = 0; i < n; i += QUOTA) { + crypto.getRandomValues(v.subarray(i, i + Math.min(n - i, QUOTA))); + } + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } else if (typeof require !== "undefined") { + // Node.js. + const cr = require("crypto"); + if (cr && cr.randomBytes) { + setPRNG(function(x: Uint8Array, n: number) { + var i, + v = cr.randomBytes(n); + for (i = 0; i < n; i++) x[i] = v[i]; + cleanup(v); + }); + } + } +})(); diff --git a/src/crypto/primitives/sha256.ts b/src/crypto/primitives/sha256.ts new file mode 100644 index 000000000..f4f6690c7 --- /dev/null +++ b/src/crypto/primitives/sha256.ts @@ -0,0 +1,429 @@ +// SHA-256 for JavaScript. +// +// Written in 2014-2016 by Dmitry Chestnykh. +// Public domain, no warranty. +// +// Functions (accept and return Uint8Arrays): +// +// sha256(message) -> hash +// sha256.hmac(key, message) -> mac +// +// Classes: +// +// new sha256.Hash() +export const digestLength: number = 32; +export const blockSize: number = 64; + +// SHA-256 constants +const K = new Uint32Array([ + 0x428a2f98, + 0x71374491, + 0xb5c0fbcf, + 0xe9b5dba5, + 0x3956c25b, + 0x59f111f1, + 0x923f82a4, + 0xab1c5ed5, + 0xd807aa98, + 0x12835b01, + 0x243185be, + 0x550c7dc3, + 0x72be5d74, + 0x80deb1fe, + 0x9bdc06a7, + 0xc19bf174, + 0xe49b69c1, + 0xefbe4786, + 0x0fc19dc6, + 0x240ca1cc, + 0x2de92c6f, + 0x4a7484aa, + 0x5cb0a9dc, + 0x76f988da, + 0x983e5152, + 0xa831c66d, + 0xb00327c8, + 0xbf597fc7, + 0xc6e00bf3, + 0xd5a79147, + 0x06ca6351, + 0x14292967, + 0x27b70a85, + 0x2e1b2138, + 0x4d2c6dfc, + 0x53380d13, + 0x650a7354, + 0x766a0abb, + 0x81c2c92e, + 0x92722c85, + 0xa2bfe8a1, + 0xa81a664b, + 0xc24b8b70, + 0xc76c51a3, + 0xd192e819, + 0xd6990624, + 0xf40e3585, + 0x106aa070, + 0x19a4c116, + 0x1e376c08, + 0x2748774c, + 0x34b0bcb5, + 0x391c0cb3, + 0x4ed8aa4a, + 0x5b9cca4f, + 0x682e6ff3, + 0x748f82ee, + 0x78a5636f, + 0x84c87814, + 0x8cc70208, + 0x90befffa, + 0xa4506ceb, + 0xbef9a3f7, + 0xc67178f2, +]); + +function hashBlocks( + w: Int32Array, + v: Int32Array, + p: Uint8Array, + pos: number, + len: number, +): number { + let a: number, + b: number, + c: number, + d: number, + e: number, + f: number, + g: number, + h: number, + u: number, + i: number, + j: number, + t1: number, + t2: number; + while (len >= 64) { + a = v[0]; + b = v[1]; + c = v[2]; + d = v[3]; + e = v[4]; + f = v[5]; + g = v[6]; + h = v[7]; + + for (i = 0; i < 16; i++) { + j = pos + i * 4; + w[i] = + ((p[j] & 0xff) << 24) | + ((p[j + 1] & 0xff) << 16) | + ((p[j + 2] & 0xff) << 8) | + (p[j + 3] & 0xff); + } + + for (i = 16; i < 64; i++) { + u = w[i - 2]; + t1 = + ((u >>> 17) | (u << (32 - 17))) ^ + ((u >>> 19) | (u << (32 - 19))) ^ + (u >>> 10); + + u = w[i - 15]; + t2 = + ((u >>> 7) | (u << (32 - 7))) ^ + ((u >>> 18) | (u << (32 - 18))) ^ + (u >>> 3); + + w[i] = ((t1 + w[i - 7]) | 0) + ((t2 + w[i - 16]) | 0); + } + + for (i = 0; i < 64; i++) { + t1 = + ((((((e >>> 6) | (e << (32 - 6))) ^ + ((e >>> 11) | (e << (32 - 11))) ^ + ((e >>> 25) | (e << (32 - 25)))) + + ((e & f) ^ (~e & g))) | + 0) + + ((h + ((K[i] + w[i]) | 0)) | 0)) | + 0; + + t2 = + ((((a >>> 2) | (a << (32 - 2))) ^ + ((a >>> 13) | (a << (32 - 13))) ^ + ((a >>> 22) | (a << (32 - 22)))) + + ((a & b) ^ (a & c) ^ (b & c))) | + 0; + + h = g; + g = f; + f = e; + e = (d + t1) | 0; + d = c; + c = b; + b = a; + a = (t1 + t2) | 0; + } + + v[0] += a; + v[1] += b; + v[2] += c; + v[3] += d; + v[4] += e; + v[5] += f; + v[6] += g; + v[7] += h; + + pos += 64; + len -= 64; + } + return pos; +} + +// Hash implements SHA256 hash algorithm. +export class HashSha256 { + digestLength: number = digestLength; + blockSize: number = blockSize; + + // Note: Int32Array is used instead of Uint32Array for performance reasons. + private state: Int32Array = new Int32Array(8); // hash state + private temp: Int32Array = new Int32Array(64); // temporary state + private buffer: Uint8Array = new Uint8Array(128); // buffer for data to hash + private bufferLength: number = 0; // number of bytes in buffer + private bytesHashed: number = 0; // number of total bytes hashed + + finished: boolean = false; // indicates whether the hash was finalized + + constructor() { + this.reset(); + } + + // Resets hash state making it possible + // to re-use this instance to hash other data. + reset(): this { + this.state[0] = 0x6a09e667; + this.state[1] = 0xbb67ae85; + this.state[2] = 0x3c6ef372; + this.state[3] = 0xa54ff53a; + this.state[4] = 0x510e527f; + this.state[5] = 0x9b05688c; + this.state[6] = 0x1f83d9ab; + this.state[7] = 0x5be0cd19; + this.bufferLength = 0; + this.bytesHashed = 0; + this.finished = false; + return this; + } + + // Cleans internal buffers and re-initializes hash state. + clean() { + for (let i = 0; i < this.buffer.length; i++) { + this.buffer[i] = 0; + } + for (let i = 0; i < this.temp.length; i++) { + this.temp[i] = 0; + } + this.reset(); + } + + // Updates hash state with the given data. + // + // Optionally, length of the data can be specified to hash + // fewer bytes than data.length. + // + // Throws error when trying to update already finalized hash: + // instance must be reset to use it again. + update(data: Uint8Array, dataLength: number = data.length): this { + if (this.finished) { + throw new Error("SHA256: can't update because hash was finished."); + } + let dataPos = 0; + this.bytesHashed += dataLength; + if (this.bufferLength > 0) { + while (this.bufferLength < 64 && dataLength > 0) { + this.buffer[this.bufferLength++] = data[dataPos++]; + dataLength--; + } + if (this.bufferLength === 64) { + hashBlocks(this.temp, this.state, this.buffer, 0, 64); + this.bufferLength = 0; + } + } + if (dataLength >= 64) { + dataPos = hashBlocks(this.temp, this.state, data, dataPos, dataLength); + dataLength %= 64; + } + while (dataLength > 0) { + this.buffer[this.bufferLength++] = data[dataPos++]; + dataLength--; + } + return this; + } + + // Finalizes hash state and puts hash into out. + // + // If hash was already finalized, puts the same value. + finish(out: Uint8Array): this { + if (!this.finished) { + const bytesHashed = this.bytesHashed; + const left = this.bufferLength; + const bitLenHi = (bytesHashed / 0x20000000) | 0; + const bitLenLo = bytesHashed << 3; + const padLength = bytesHashed % 64 < 56 ? 64 : 128; + + this.buffer[left] = 0x80; + for (let i = left + 1; i < padLength - 8; i++) { + this.buffer[i] = 0; + } + this.buffer[padLength - 8] = (bitLenHi >>> 24) & 0xff; + this.buffer[padLength - 7] = (bitLenHi >>> 16) & 0xff; + this.buffer[padLength - 6] = (bitLenHi >>> 8) & 0xff; + this.buffer[padLength - 5] = (bitLenHi >>> 0) & 0xff; + this.buffer[padLength - 4] = (bitLenLo >>> 24) & 0xff; + this.buffer[padLength - 3] = (bitLenLo >>> 16) & 0xff; + this.buffer[padLength - 2] = (bitLenLo >>> 8) & 0xff; + this.buffer[padLength - 1] = (bitLenLo >>> 0) & 0xff; + + hashBlocks(this.temp, this.state, this.buffer, 0, padLength); + + this.finished = true; + } + + for (let i = 0; i < 8; i++) { + out[i * 4 + 0] = (this.state[i] >>> 24) & 0xff; + out[i * 4 + 1] = (this.state[i] >>> 16) & 0xff; + out[i * 4 + 2] = (this.state[i] >>> 8) & 0xff; + out[i * 4 + 3] = (this.state[i] >>> 0) & 0xff; + } + + return this; + } + + // Returns the final hash digest. + digest(): Uint8Array { + const out = new Uint8Array(this.digestLength); + this.finish(out); + return out; + } + + // Internal function for use in HMAC for optimization. + _saveState(out: Uint32Array) { + for (let i = 0; i < this.state.length; i++) { + out[i] = this.state[i]; + } + } + + // Internal function for use in HMAC for optimization. + _restoreState(from: Uint32Array, bytesHashed: number) { + for (let i = 0; i < this.state.length; i++) { + this.state[i] = from[i]; + } + this.bytesHashed = bytesHashed; + this.finished = false; + this.bufferLength = 0; + } +} + +// HMAC implements HMAC-SHA256 message authentication algorithm. +export class HMAC { + private inner: HashSha256 = new HashSha256(); + private outer: HashSha256 = new HashSha256(); + + blockSize: number = this.inner.blockSize; + digestLength: number = this.inner.digestLength; + + // Copies of hash states after keying. + // Need for quick reset without hashing they key again. + private istate: Uint32Array; + private ostate: Uint32Array; + + constructor(key: Uint8Array) { + const pad = new Uint8Array(this.blockSize); + if (key.length > this.blockSize) { + new HashSha256() + .update(key) + .finish(pad) + .clean(); + } else { + for (let i = 0; i < key.length; i++) { + pad[i] = key[i]; + } + } + for (let i = 0; i < pad.length; i++) { + pad[i] ^= 0x36; + } + this.inner.update(pad); + + for (let i = 0; i < pad.length; i++) { + pad[i] ^= 0x36 ^ 0x5c; + } + this.outer.update(pad); + + this.istate = new Uint32Array(8); + this.ostate = new Uint32Array(8); + + this.inner._saveState(this.istate); + this.outer._saveState(this.ostate); + + for (let i = 0; i < pad.length; i++) { + pad[i] = 0; + } + } + + // Returns HMAC state to the state initialized with key + // to make it possible to run HMAC over the other data with the same + // key without creating a new instance. + reset(): this { + this.inner._restoreState(this.istate, this.inner.blockSize); + this.outer._restoreState(this.ostate, this.outer.blockSize); + return this; + } + + // Cleans HMAC state. + clean() { + for (let i = 0; i < this.istate.length; i++) { + this.ostate[i] = this.istate[i] = 0; + } + this.inner.clean(); + this.outer.clean(); + } + + // Updates state with provided data. + update(data: Uint8Array): this { + this.inner.update(data); + return this; + } + + // Finalizes HMAC and puts the result in out. + finish(out: Uint8Array): this { + if (this.outer.finished) { + this.outer.finish(out); + } else { + this.inner.finish(out); + this.outer.update(out, this.digestLength).finish(out); + } + return this; + } + + // Returns message authentication code. + digest(): Uint8Array { + const out = new Uint8Array(this.digestLength); + this.finish(out); + return out; + } +} + +// Returns SHA256 hash of data. +export function sha256(data: Uint8Array): Uint8Array { + const h = new HashSha256().update(data); + const digest = h.digest(); + h.clean(); + return digest; +} + +// Returns HMAC-SHA256 of data under the key. +export function hmacSha256(key: Uint8Array, data: Uint8Array) { + const h = new HMAC(key).update(data); + const digest = h.digest(); + h.clean(); + return digest; +} diff --git a/src/crypto/sha256.ts b/src/crypto/sha256.ts deleted file mode 100644 index f4f6690c7..000000000 --- a/src/crypto/sha256.ts +++ /dev/null @@ -1,429 +0,0 @@ -// SHA-256 for JavaScript. -// -// Written in 2014-2016 by Dmitry Chestnykh. -// Public domain, no warranty. -// -// Functions (accept and return Uint8Arrays): -// -// sha256(message) -> hash -// sha256.hmac(key, message) -> mac -// -// Classes: -// -// new sha256.Hash() -export const digestLength: number = 32; -export const blockSize: number = 64; - -// SHA-256 constants -const K = new Uint32Array([ - 0x428a2f98, - 0x71374491, - 0xb5c0fbcf, - 0xe9b5dba5, - 0x3956c25b, - 0x59f111f1, - 0x923f82a4, - 0xab1c5ed5, - 0xd807aa98, - 0x12835b01, - 0x243185be, - 0x550c7dc3, - 0x72be5d74, - 0x80deb1fe, - 0x9bdc06a7, - 0xc19bf174, - 0xe49b69c1, - 0xefbe4786, - 0x0fc19dc6, - 0x240ca1cc, - 0x2de92c6f, - 0x4a7484aa, - 0x5cb0a9dc, - 0x76f988da, - 0x983e5152, - 0xa831c66d, - 0xb00327c8, - 0xbf597fc7, - 0xc6e00bf3, - 0xd5a79147, - 0x06ca6351, - 0x14292967, - 0x27b70a85, - 0x2e1b2138, - 0x4d2c6dfc, - 0x53380d13, - 0x650a7354, - 0x766a0abb, - 0x81c2c92e, - 0x92722c85, - 0xa2bfe8a1, - 0xa81a664b, - 0xc24b8b70, - 0xc76c51a3, - 0xd192e819, - 0xd6990624, - 0xf40e3585, - 0x106aa070, - 0x19a4c116, - 0x1e376c08, - 0x2748774c, - 0x34b0bcb5, - 0x391c0cb3, - 0x4ed8aa4a, - 0x5b9cca4f, - 0x682e6ff3, - 0x748f82ee, - 0x78a5636f, - 0x84c87814, - 0x8cc70208, - 0x90befffa, - 0xa4506ceb, - 0xbef9a3f7, - 0xc67178f2, -]); - -function hashBlocks( - w: Int32Array, - v: Int32Array, - p: Uint8Array, - pos: number, - len: number, -): number { - let a: number, - b: number, - c: number, - d: number, - e: number, - f: number, - g: number, - h: number, - u: number, - i: number, - j: number, - t1: number, - t2: number; - while (len >= 64) { - a = v[0]; - b = v[1]; - c = v[2]; - d = v[3]; - e = v[4]; - f = v[5]; - g = v[6]; - h = v[7]; - - for (i = 0; i < 16; i++) { - j = pos + i * 4; - w[i] = - ((p[j] & 0xff) << 24) | - ((p[j + 1] & 0xff) << 16) | - ((p[j + 2] & 0xff) << 8) | - (p[j + 3] & 0xff); - } - - for (i = 16; i < 64; i++) { - u = w[i - 2]; - t1 = - ((u >>> 17) | (u << (32 - 17))) ^ - ((u >>> 19) | (u << (32 - 19))) ^ - (u >>> 10); - - u = w[i - 15]; - t2 = - ((u >>> 7) | (u << (32 - 7))) ^ - ((u >>> 18) | (u << (32 - 18))) ^ - (u >>> 3); - - w[i] = ((t1 + w[i - 7]) | 0) + ((t2 + w[i - 16]) | 0); - } - - for (i = 0; i < 64; i++) { - t1 = - ((((((e >>> 6) | (e << (32 - 6))) ^ - ((e >>> 11) | (e << (32 - 11))) ^ - ((e >>> 25) | (e << (32 - 25)))) + - ((e & f) ^ (~e & g))) | - 0) + - ((h + ((K[i] + w[i]) | 0)) | 0)) | - 0; - - t2 = - ((((a >>> 2) | (a << (32 - 2))) ^ - ((a >>> 13) | (a << (32 - 13))) ^ - ((a >>> 22) | (a << (32 - 22)))) + - ((a & b) ^ (a & c) ^ (b & c))) | - 0; - - h = g; - g = f; - f = e; - e = (d + t1) | 0; - d = c; - c = b; - b = a; - a = (t1 + t2) | 0; - } - - v[0] += a; - v[1] += b; - v[2] += c; - v[3] += d; - v[4] += e; - v[5] += f; - v[6] += g; - v[7] += h; - - pos += 64; - len -= 64; - } - return pos; -} - -// Hash implements SHA256 hash algorithm. -export class HashSha256 { - digestLength: number = digestLength; - blockSize: number = blockSize; - - // Note: Int32Array is used instead of Uint32Array for performance reasons. - private state: Int32Array = new Int32Array(8); // hash state - private temp: Int32Array = new Int32Array(64); // temporary state - private buffer: Uint8Array = new Uint8Array(128); // buffer for data to hash - private bufferLength: number = 0; // number of bytes in buffer - private bytesHashed: number = 0; // number of total bytes hashed - - finished: boolean = false; // indicates whether the hash was finalized - - constructor() { - this.reset(); - } - - // Resets hash state making it possible - // to re-use this instance to hash other data. - reset(): this { - this.state[0] = 0x6a09e667; - this.state[1] = 0xbb67ae85; - this.state[2] = 0x3c6ef372; - this.state[3] = 0xa54ff53a; - this.state[4] = 0x510e527f; - this.state[5] = 0x9b05688c; - this.state[6] = 0x1f83d9ab; - this.state[7] = 0x5be0cd19; - this.bufferLength = 0; - this.bytesHashed = 0; - this.finished = false; - return this; - } - - // Cleans internal buffers and re-initializes hash state. - clean() { - for (let i = 0; i < this.buffer.length; i++) { - this.buffer[i] = 0; - } - for (let i = 0; i < this.temp.length; i++) { - this.temp[i] = 0; - } - this.reset(); - } - - // Updates hash state with the given data. - // - // Optionally, length of the data can be specified to hash - // fewer bytes than data.length. - // - // Throws error when trying to update already finalized hash: - // instance must be reset to use it again. - update(data: Uint8Array, dataLength: number = data.length): this { - if (this.finished) { - throw new Error("SHA256: can't update because hash was finished."); - } - let dataPos = 0; - this.bytesHashed += dataLength; - if (this.bufferLength > 0) { - while (this.bufferLength < 64 && dataLength > 0) { - this.buffer[this.bufferLength++] = data[dataPos++]; - dataLength--; - } - if (this.bufferLength === 64) { - hashBlocks(this.temp, this.state, this.buffer, 0, 64); - this.bufferLength = 0; - } - } - if (dataLength >= 64) { - dataPos = hashBlocks(this.temp, this.state, data, dataPos, dataLength); - dataLength %= 64; - } - while (dataLength > 0) { - this.buffer[this.bufferLength++] = data[dataPos++]; - dataLength--; - } - return this; - } - - // Finalizes hash state and puts hash into out. - // - // If hash was already finalized, puts the same value. - finish(out: Uint8Array): this { - if (!this.finished) { - const bytesHashed = this.bytesHashed; - const left = this.bufferLength; - const bitLenHi = (bytesHashed / 0x20000000) | 0; - const bitLenLo = bytesHashed << 3; - const padLength = bytesHashed % 64 < 56 ? 64 : 128; - - this.buffer[left] = 0x80; - for (let i = left + 1; i < padLength - 8; i++) { - this.buffer[i] = 0; - } - this.buffer[padLength - 8] = (bitLenHi >>> 24) & 0xff; - this.buffer[padLength - 7] = (bitLenHi >>> 16) & 0xff; - this.buffer[padLength - 6] = (bitLenHi >>> 8) & 0xff; - this.buffer[padLength - 5] = (bitLenHi >>> 0) & 0xff; - this.buffer[padLength - 4] = (bitLenLo >>> 24) & 0xff; - this.buffer[padLength - 3] = (bitLenLo >>> 16) & 0xff; - this.buffer[padLength - 2] = (bitLenLo >>> 8) & 0xff; - this.buffer[padLength - 1] = (bitLenLo >>> 0) & 0xff; - - hashBlocks(this.temp, this.state, this.buffer, 0, padLength); - - this.finished = true; - } - - for (let i = 0; i < 8; i++) { - out[i * 4 + 0] = (this.state[i] >>> 24) & 0xff; - out[i * 4 + 1] = (this.state[i] >>> 16) & 0xff; - out[i * 4 + 2] = (this.state[i] >>> 8) & 0xff; - out[i * 4 + 3] = (this.state[i] >>> 0) & 0xff; - } - - return this; - } - - // Returns the final hash digest. - digest(): Uint8Array { - const out = new Uint8Array(this.digestLength); - this.finish(out); - return out; - } - - // Internal function for use in HMAC for optimization. - _saveState(out: Uint32Array) { - for (let i = 0; i < this.state.length; i++) { - out[i] = this.state[i]; - } - } - - // Internal function for use in HMAC for optimization. - _restoreState(from: Uint32Array, bytesHashed: number) { - for (let i = 0; i < this.state.length; i++) { - this.state[i] = from[i]; - } - this.bytesHashed = bytesHashed; - this.finished = false; - this.bufferLength = 0; - } -} - -// HMAC implements HMAC-SHA256 message authentication algorithm. -export class HMAC { - private inner: HashSha256 = new HashSha256(); - private outer: HashSha256 = new HashSha256(); - - blockSize: number = this.inner.blockSize; - digestLength: number = this.inner.digestLength; - - // Copies of hash states after keying. - // Need for quick reset without hashing they key again. - private istate: Uint32Array; - private ostate: Uint32Array; - - constructor(key: Uint8Array) { - const pad = new Uint8Array(this.blockSize); - if (key.length > this.blockSize) { - new HashSha256() - .update(key) - .finish(pad) - .clean(); - } else { - for (let i = 0; i < key.length; i++) { - pad[i] = key[i]; - } - } - for (let i = 0; i < pad.length; i++) { - pad[i] ^= 0x36; - } - this.inner.update(pad); - - for (let i = 0; i < pad.length; i++) { - pad[i] ^= 0x36 ^ 0x5c; - } - this.outer.update(pad); - - this.istate = new Uint32Array(8); - this.ostate = new Uint32Array(8); - - this.inner._saveState(this.istate); - this.outer._saveState(this.ostate); - - for (let i = 0; i < pad.length; i++) { - pad[i] = 0; - } - } - - // Returns HMAC state to the state initialized with key - // to make it possible to run HMAC over the other data with the same - // key without creating a new instance. - reset(): this { - this.inner._restoreState(this.istate, this.inner.blockSize); - this.outer._restoreState(this.ostate, this.outer.blockSize); - return this; - } - - // Cleans HMAC state. - clean() { - for (let i = 0; i < this.istate.length; i++) { - this.ostate[i] = this.istate[i] = 0; - } - this.inner.clean(); - this.outer.clean(); - } - - // Updates state with provided data. - update(data: Uint8Array): this { - this.inner.update(data); - return this; - } - - // Finalizes HMAC and puts the result in out. - finish(out: Uint8Array): this { - if (this.outer.finished) { - this.outer.finish(out); - } else { - this.inner.finish(out); - this.outer.update(out, this.digestLength).finish(out); - } - return this; - } - - // Returns message authentication code. - digest(): Uint8Array { - const out = new Uint8Array(this.digestLength); - this.finish(out); - return out; - } -} - -// Returns SHA256 hash of data. -export function sha256(data: Uint8Array): Uint8Array { - const h = new HashSha256().update(data); - const digest = h.digest(); - h.clean(); - return digest; -} - -// Returns HMAC-SHA256 of data under the key. -export function hmacSha256(key: Uint8Array, data: Uint8Array) { - const h = new HMAC(key).update(data); - const digest = h.digest(); - h.clean(); - return digest; -} diff --git a/src/crypto/synchronousWorker.ts b/src/crypto/synchronousWorker.ts index 41ebee4f3..12eecde9a 100644 --- a/src/crypto/synchronousWorker.ts +++ b/src/crypto/synchronousWorker.ts @@ -16,9 +16,6 @@ import { CryptoImplementation } from "./cryptoImplementation"; -import { NodeEmscriptenLoader } from "./nodeEmscriptenLoader"; - -import fs = require("fs"); import { CryptoWorkerFactory } from "./cryptoApi"; import { CryptoWorker } from "./cryptoWorker"; @@ -56,8 +53,6 @@ export class SynchronousCryptoWorker { */ onerror: undefined | ((m: any) => void); - private emscriptenLoader = new NodeEmscriptenLoader(); - constructor() { this.onerror = undefined; this.onmessage = undefined; @@ -84,9 +79,7 @@ export class SynchronousCryptoWorker { } private async handleRequest(operation: string, id: number, args: string[]) { - let emsc = await this.emscriptenLoader.getEmscriptenEnvironment(); - - const impl = new CryptoImplementation(emsc); + const impl = new CryptoImplementation(); if (!(operation in impl)) { console.error(`crypto operation '${operation}' not found`); diff --git a/src/crypto/talerCrypto-test.ts b/src/crypto/talerCrypto-test.ts index 3f9d6f398..59949dbd3 100644 --- a/src/crypto/talerCrypto-test.ts +++ b/src/crypto/talerCrypto-test.ts @@ -29,8 +29,8 @@ import { rsaUnblind, rsaVerify, } from "./talerCrypto"; -import { hmacSha512, sha512, kdf } from "./kdf"; -import nacl = require("./nacl-fast"); +import { sha512, kdf } from "./primitives/kdf"; +import nacl = require("./primitives/nacl-fast"); function hexToBytes(hex: string) { for (var bytes = [], c = 0; c < hex.length; c += 2) @@ -159,3 +159,43 @@ test("taler-exchange-tvg blind signing", t => { const v = rsaVerify(decodeCrock(messageHash), decodeCrock(sig), decodeCrock(rsaPublicKey)); t.true(v); }); + + +test("incremental hashing #1", (t) => { + const n = 1024; + const d = nacl.randomBytes(n); + + const h1 = nacl.hash(d); + const h2 = new nacl.HashState().update(d).finish(); + + const s = new nacl.HashState(); + for (let i = 0; i < n; i++) { + const b = new Uint8Array(1); + b[0] = d[i]; + s.update(b); + } + + const h3 = s.finish(); + + t.deepEqual(encodeCrock(h1), encodeCrock(h2)); + t.deepEqual(encodeCrock(h1), encodeCrock(h3)); +}); + +test("incremental hashing #2", (t) => { + const n = 10; + const d = nacl.randomBytes(n); + + const h1 = nacl.hash(d); + const h2 = new nacl.HashState().update(d).finish(); + const s = new nacl.HashState(); + for (let i = 0; i < n; i++) { + const b = new Uint8Array(1); + b[0] = d[i]; + s.update(b); + } + + const h3 = s.finish(); + + t.deepEqual(encodeCrock(h1), encodeCrock(h3)); + t.deepEqual(encodeCrock(h1), encodeCrock(h2)); +}); \ No newline at end of file diff --git a/src/crypto/talerCrypto.ts b/src/crypto/talerCrypto.ts index 0a36f0fe4..b754b0c57 100644 --- a/src/crypto/talerCrypto.ts +++ b/src/crypto/talerCrypto.ts @@ -18,9 +18,9 @@ * Native implementation of GNU Taler crypto. */ -import nacl = require("./nacl-fast"); +import nacl = require("./primitives/nacl-fast"); import bigint from "big-integer"; -import { kdf } from "./kdf"; +import { kdf } from "./primitives/kdf"; export function getRandomBytes(n: number): Uint8Array { return nacl.randomBytes(n); @@ -123,7 +123,7 @@ export function decodeCrock(encoded: string): Uint8Array { } export function eddsaGetPublic(eddsaPriv: Uint8Array): Uint8Array { - const pair = nacl.sign_keyPair_fromSeed(eddsaPriv); + const pair = nacl.sign_keyPair_fromSeed(eddsaPriv); return pair.publicKey; } @@ -131,7 +131,10 @@ export function ecdheGetPublic(ecdhePriv: Uint8Array): Uint8Array { return nacl.scalarMult_base(ecdhePriv); } -export function keyExchangeEddsaEcdhe(eddsaPriv: Uint8Array, ecdhePub: Uint8Array): Uint8Array { +export function keyExchangeEddsaEcdhe( + eddsaPriv: Uint8Array, + ecdhePub: Uint8Array, +): Uint8Array { const ph = nacl.hash(eddsaPriv); const a = new Uint8Array(32); for (let i = 0; i < 32; i++) { @@ -141,7 +144,10 @@ export function keyExchangeEddsaEcdhe(eddsaPriv: Uint8Array, ecdhePub: Uint8Arra return nacl.hash(x); } -export function keyExchangeEcdheEddsa(ecdhePriv: Uint8Array, eddsaPub: Uint8Array): Uint8Array { +export function keyExchangeEcdheEddsa( + ecdhePriv: Uint8Array, + eddsaPub: Uint8Array, +): Uint8Array { const curve25519Pub = nacl.sign_ed25519_pk_to_curve25519(eddsaPub); const x = nacl.scalarMult(ecdhePriv, curve25519Pub); return nacl.hash(x); @@ -172,8 +178,8 @@ function kdfMod( while (true) { const ctx = new Uint8Array(info.byteLength + 2); ctx.set(info, 0); - ctx[ctx.length - 2] = (counter >>> 8) & 0xFF; - ctx[ctx.length - 1] = counter & 0xFF; + ctx[ctx.length - 2] = (counter >>> 8) & 0xff; + ctx[ctx.length - 1] = counter & 0xff; const buf = kdf(buflen, ikm, salt, ctx); const arr = Array.from(buf); arr[0] = arr[0] & mask; @@ -185,7 +191,7 @@ function kdfMod( } } -function stringToBuf(s: string) { +export function stringToBytes(s: string) { const te = new TextEncoder(); return te.encode(s); } @@ -194,9 +200,12 @@ function loadBigInt(arr: Uint8Array) { return bigint.fromArray(Array.from(arr), 256, false); } -function rsaBlindingKeyDerive(rsaPub: RsaPub, bks: Uint8Array): bigint.BigInteger { - const salt = stringToBuf("Blinding KDF extrator HMAC key"); - const info = stringToBuf("Blinding KDF"); +function rsaBlindingKeyDerive( + rsaPub: RsaPub, + bks: Uint8Array, +): bigint.BigInteger { + const salt = stringToBytes("Blinding KDF extrator HMAC key"); + const info = stringToBytes("Blinding KDF"); return kdfMod(rsaPub.N, bks, salt, info); } @@ -206,7 +215,7 @@ function rsaBlindingKeyDerive(rsaPub: RsaPub, bks: Uint8Array): bigint.BigIntege * Assuming n is an RSA modulous and r is generated using a call to * GNUNET_CRYPTO_kdf_mod_mpi, if gcd(r,n) != 1 then n must be a * malicious RSA key designed to deanomize the user. - * + * * @param r KDF result * @param n RSA modulus of the public key */ @@ -218,7 +227,7 @@ function rsaGcdValidate(r: bigint.BigInteger, n: bigint.BigInteger) { } function rsaFullDomainHash(hm: Uint8Array, rsaPub: RsaPub): bigint.BigInteger { - const info = stringToBuf("RSA-FDA FTpsW!"); + const info = stringToBytes("RSA-FDA FTpsW!"); const salt = rsaPubEncode(rsaPub); const r = kdfMod(rsaPub.N, hm, salt, info); rsaGcdValidate(r, rsaPub.N); @@ -228,12 +237,15 @@ function rsaFullDomainHash(hm: Uint8Array, rsaPub: RsaPub): bigint.BigInteger { function rsaPubDecode(rsaPub: Uint8Array): RsaPub { const modulusLength = (rsaPub[0] << 8) | rsaPub[1]; const exponentLength = (rsaPub[2] << 8) | rsaPub[3]; - const modulus = rsaPub.slice(4, 4 + modulusLength) - const exponent = rsaPub.slice(4 + modulusLength, 4 + modulusLength + exponentLength); + const modulus = rsaPub.slice(4, 4 + modulusLength); + const exponent = rsaPub.slice( + 4 + modulusLength, + 4 + modulusLength + exponentLength, + ); const res = { N: loadBigInt(modulus), e: loadBigInt(exponent), - } + }; return res; } @@ -241,16 +253,20 @@ function rsaPubEncode(rsaPub: RsaPub): Uint8Array { const mb = rsaPub.N.toArray(256).value; const eb = rsaPub.e.toArray(256).value; const out = new Uint8Array(4 + mb.length + eb.length); - out[0] = (mb.length >>> 8) & 0xFF; - out[1] = mb.length & 0xFF; - out[2] = (eb.length >>> 8) & 0xFF; - out[3] = eb.length & 0xFF; + out[0] = (mb.length >>> 8) & 0xff; + out[1] = mb.length & 0xff; + out[2] = (eb.length >>> 8) & 0xff; + out[3] = eb.length & 0xff; out.set(mb, 4); out.set(eb, 4 + mb.length); return out; } -export function rsaBlind(hm: Uint8Array, bks: Uint8Array, rsaPubEnc: Uint8Array): Uint8Array { +export function rsaBlind( + hm: Uint8Array, + bks: Uint8Array, + rsaPubEnc: Uint8Array, +): Uint8Array { const rsaPub = rsaPubDecode(rsaPubEnc); const data = rsaFullDomainHash(hm, rsaPub); const r = rsaBlindingKeyDerive(rsaPub, bks); @@ -259,7 +275,11 @@ export function rsaBlind(hm: Uint8Array, bks: Uint8Array, rsaPubEnc: Uint8Array) return new Uint8Array(bm.toArray(256).value); } -export function rsaUnblind(sig: Uint8Array, rsaPubEnc: Uint8Array, bks: Uint8Array): Uint8Array { +export function rsaUnblind( + sig: Uint8Array, + rsaPubEnc: Uint8Array, + bks: Uint8Array, +): Uint8Array { const rsaPub = rsaPubDecode(rsaPubEnc); const blinded_s = loadBigInt(sig); const r = rsaBlindingKeyDerive(rsaPub, bks); @@ -268,10 +288,86 @@ export function rsaUnblind(sig: Uint8Array, rsaPubEnc: Uint8Array, bks: Uint8Arr return new Uint8Array(s.toArray(256).value); } -export function rsaVerify(hm: Uint8Array, rsaSig: Uint8Array, rsaPubEnc: Uint8Array): boolean { +export function rsaVerify( + hm: Uint8Array, + rsaSig: Uint8Array, + rsaPubEnc: Uint8Array, +): boolean { const rsaPub = rsaPubDecode(rsaPubEnc); const d = rsaFullDomainHash(hm, rsaPub); const sig = loadBigInt(rsaSig); const sig_e = sig.modPow(rsaPub.e, rsaPub.N); return sig_e.equals(d); -} \ No newline at end of file +} + +export interface EddsaKeyPair { + eddsaPub: Uint8Array; + eddsaPriv: Uint8Array; +} + +export interface EcdheKeyPair { + ecdhePub: Uint8Array; + ecdhePriv: Uint8Array; +} + +export function createEddsaKeyPair(): EddsaKeyPair { + const eddsaPriv = nacl.randomBytes(32); + const eddsaPub = eddsaGetPublic(eddsaPriv); + return { eddsaPriv, eddsaPub }; +} + +export function createEcdheKeyPair(): EcdheKeyPair { + const ecdhePriv = nacl.randomBytes(32); + const ecdhePub = ecdheGetPublic(ecdhePriv); + return { ecdhePriv, ecdhePub }; +} + +export function createBlindingKeySecret(): Uint8Array { + return nacl.randomBytes(32); +} + +export function hash(d: Uint8Array): Uint8Array { + return nacl.hash(d); +} + +export function eddsaSign(msg: Uint8Array, eddsaPriv: Uint8Array): Uint8Array { + const pair = nacl.sign_keyPair_fromSeed(eddsaPriv); + return nacl.sign_detached(msg, pair.secretKey); +} + +export function eddsaVerify( + msg: Uint8Array, + sig: Uint8Array, + eddsaPub: Uint8Array, +): boolean { + return nacl.sign_detached_verify(msg, sig, eddsaPub); +} + +export function createHashContext(): nacl.HashState { + return new nacl.HashState(); +} + +export interface FreshCoin { + coinPub: Uint8Array; + coinPriv: Uint8Array; + bks: Uint8Array; +} + +export function setupRefreshPlanchet( + secretSeed: Uint8Array, + coinNumber: number, +): FreshCoin { + const info = stringToBytes("taler-coin-derivation"); + const saltArrBuf = new ArrayBuffer(4); + const salt = new Uint8Array(saltArrBuf); + const saltDataView = new DataView(saltArrBuf); + saltDataView.setUint32(0, coinNumber); + const out = kdf(64, secretSeed, salt, info); + const coinPriv = out.slice(0, 32); + const bks = out.slice(32, 64); + return { + bks, + coinPriv, + coinPub: eddsaGetPublic(coinPriv), + }; +} diff --git a/src/dbTypes.ts b/src/dbTypes.ts index 22d98ffac..bb4f5dbdf 100644 --- a/src/dbTypes.ts +++ b/src/dbTypes.ts @@ -283,26 +283,26 @@ export class DenominationRecord { /** * Validity start date of the denomination. */ - @Checkable.String() - stampStart: string; + @Checkable.Value(() => Timestamp) + stampStart: Timestamp; /** * Date after which the currency can't be withdrawn anymore. */ - @Checkable.String() - stampExpireWithdraw: string; + @Checkable.Value(() => Timestamp) + stampExpireWithdraw: Timestamp; /** * Date after the denomination officially doesn't exist anymore. */ - @Checkable.String() - stampExpireLegal: string; + @Checkable.Value(() => Timestamp) + stampExpireLegal: Timestamp; /** * Data after which coins of this denomination can't be deposited anymore. */ - @Checkable.String() - stampExpireDeposit: string; + @Checkable.Value(() => Timestamp) + stampExpireDeposit: Timestamp; /** * Signature by the exchange's master key over the denomination diff --git a/src/headless/helpers.ts b/src/headless/helpers.ts index 5e06a2f25..a38ef1dbe 100644 --- a/src/headless/helpers.ts +++ b/src/headless/helpers.ts @@ -33,6 +33,7 @@ import * as amounts from "../amounts"; import { Bank } from "./bank"; import fs = require("fs"); +import { NodeCryptoWorkerFactory } from "../crypto/nodeProcessWorker"; const enableTracing = false; @@ -188,14 +189,16 @@ export async function getDefaultNodeWallet( myUnsupportedUpgrade, ); + const worker = new SynchronousCryptoWorkerFactory(); + //const worker = new NodeCryptoWorkerFactory(); + return new Wallet( myDb, myHttpLib, myBadge, myNotifier, - new SynchronousCryptoWorkerFactory(), + worker, ); - //const myWallet = new Wallet(myDb, myHttpLib, myBadge, myNotifier, new NodeCryptoWorkerFactory()); } export async function withdrawTestBalance( diff --git a/src/headless/taler-wallet-cli.ts b/src/headless/taler-wallet-cli.ts index bec098aca..90c04dd97 100644 --- a/src/headless/taler-wallet-cli.ts +++ b/src/headless/taler-wallet-cli.ts @@ -353,7 +353,6 @@ testCli default: "TESTKUDOS:4", }) .action(async args => { - console.log("parsed args", args); applyVerbose(args.wallet.verbose); let cmdObj = args.integrationtestCmd; diff --git a/src/helpers.ts b/src/helpers.ts index cfebf394f..1983cee9b 100644 --- a/src/helpers.ts +++ b/src/helpers.ts @@ -139,6 +139,17 @@ export function extractTalerStamp(stamp: string): Timestamp | undefined { }; } +/** + * Extract a timestamp from a Taler timestamp string. + */ +export function extractTalerStampOrThrow(stamp: string): Timestamp { + const r = extractTalerStamp(stamp); + if (!r) { + throw Error("invalid time stamp"); + } + return r; +} + /** * Check if a timestamp is in the right format. */ diff --git a/src/talerTypes.ts b/src/talerTypes.ts index ebb13f4a5..1e658d5be 100644 --- a/src/talerTypes.ts +++ b/src/talerTypes.ts @@ -388,10 +388,10 @@ export class ContractTerms { @Checkable.String(timestampCheck) refund_deadline: string; - /** + /** * Deadline for the wire transfer. */ - @Checkable.String(timestampCheck) + @Checkable.String() wire_transfer_deadline: string; /** diff --git a/src/wallet-test.ts b/src/wallet-test.ts index bd0925ed0..86ddb5e73 100644 --- a/src/wallet-test.ts +++ b/src/wallet-test.ts @@ -59,10 +59,10 @@ function fakeCwd(current: string, value: string, feeDeposit: string): types.Coin feeWithdraw: a("EUR:0.0"), isOffered: true, masterSig: "(mock)", - stampExpireDeposit: "(mock)", - stampExpireLegal: "(mock)", - stampExpireWithdraw: "(mock)", - stampStart: "(mock)", + stampExpireDeposit: { t_ms: 0 }, + stampExpireLegal: { t_ms: 0 }, + stampExpireWithdraw: { t_ms: 0 }, + stampStart: { t_ms: 0 }, status: dbTypes.DenominationStatus.VerifiedGood, value: a(value), }, diff --git a/src/wallet.ts b/src/wallet.ts index 58bb6b8c3..f1d7be5e5 100644 --- a/src/wallet.ts +++ b/src/wallet.ts @@ -30,6 +30,7 @@ import { getTalerStampSec, strcmp, extractTalerStamp, + extractTalerStampOrThrow, } from "./helpers"; import { HttpRequestLibrary } from "./http"; import * as LibtoolVersion from "./libtoolVersion"; @@ -163,20 +164,10 @@ const builtinCurrencies: CurrencyRecord[] = [ ]; function isWithdrawableDenom(d: DenominationRecord) { - const nowSec = new Date().getTime() / 1000; - const stampWithdrawSec = getTalerStampSec(d.stampExpireWithdraw); - if (stampWithdrawSec === null) { - return false; - } - const stampStartSec = getTalerStampSec(d.stampStart); - if (stampStartSec === null) { - return false; - } - // Withdraw if still possible to withdraw within a minute - if (stampWithdrawSec + 60 > nowSec && nowSec >= stampStartSec) { - return true; - } - return false; + const now = getTimestampNow(); + const started = now.t_ms >= d.stampStart.t_ms; + const stillOkay = d.stampExpireWithdraw.t_ms + (60 * 1000) > now.t_ms; + return started && stillOkay; } interface SelectPayCoinsResult { @@ -1374,6 +1365,7 @@ export class Wallet { denom.feeWithdraw, ); if (x.saturated) { + // FIXME!!!! console.error("database inconsistent"); throw TransactionAbort; } @@ -1891,10 +1883,10 @@ export class Wallet { const { isTrusted, isAudited } = await this.getExchangeTrust(exchangeInfo); - let earliestDepositExpiration = Infinity; - for (const denom of selectedDenoms) { - const expireDeposit = getTalerStampSec(denom.stampExpireDeposit)!; - if (expireDeposit < earliestDepositExpiration) { + let earliestDepositExpiration = selectedDenoms[0].stampExpireDeposit; + for (let i = 1; i < selectedDenoms.length; i++) { + const expireDeposit = selectedDenoms[i].stampExpireDeposit; + if (expireDeposit.t_ms < earliestDepositExpiration.t_ms) { earliestDepositExpiration = expireDeposit; } } @@ -2653,6 +2645,7 @@ export class Wallet { resp = await this.http.postJson(reqUrl.href(), req); } catch (e) { console.error("got error during /refresh/reveal request"); + console.error(e); return; } @@ -3137,10 +3130,10 @@ export class Wallet { feeWithdraw: Amounts.parseOrThrow(denomIn.fee_withdraw), isOffered: true, masterSig: denomIn.master_sig, - stampExpireDeposit: denomIn.stamp_expire_deposit, - stampExpireLegal: denomIn.stamp_expire_legal, - stampExpireWithdraw: denomIn.stamp_expire_withdraw, - stampStart: denomIn.stamp_start, + stampExpireDeposit: extractTalerStampOrThrow(denomIn.stamp_expire_deposit), + stampExpireLegal: extractTalerStampOrThrow(denomIn.stamp_expire_legal), + stampExpireWithdraw: extractTalerStampOrThrow(denomIn.stamp_expire_withdraw), + stampStart: extractTalerStampOrThrow(denomIn.stamp_start), status: DenominationStatus.Unverified, value: Amounts.parseOrThrow(denomIn.value), }; diff --git a/src/walletTypes.ts b/src/walletTypes.ts index a11da029f..b971e300d 100644 --- a/src/walletTypes.ts +++ b/src/walletTypes.ts @@ -113,7 +113,7 @@ export interface ReserveCreationInfo { /** * The earliest deposit expiration of the selected coins. */ - earliestDepositExpiration: number; + earliestDepositExpiration: Timestamp; /** * Number of currently offered denominations. @@ -591,11 +591,15 @@ export interface HistoryQuery { level: number; } -export interface Timestamp { +@Checkable.Class() +export class Timestamp { /** * Timestamp in milliseconds. */ + @Checkable.Number() t_ms: number; + + static checked: (obj: any) => Timestamp; } export interface Duration { diff --git a/src/webex/renderHtml.tsx b/src/webex/renderHtml.tsx index c2fdb1f14..42bcdbabc 100644 --- a/src/webex/renderHtml.tsx +++ b/src/webex/renderHtml.tsx @@ -240,7 +240,7 @@ function FeeDetailsView(props: { {i18n.str`Rounding loss:`} {overhead}

{i18n.str`Earliest expiration (for deposit): ${moment - .unix(rci.earliestDepositExpiration) + .unix(rci.earliestDepositExpiration.t_ms / 1000) .fromNow()}`}

Coin Fees

diff --git a/tsconfig.json b/tsconfig.json index 3a1a76521..8df947649 100644 --- a/tsconfig.json +++ b/tsconfig.json @@ -27,18 +27,14 @@ "src/android/index.ts", "src/checkable.ts", "src/crypto/browserWorkerEntry.ts", - "src/crypto/cryptoApi-test.ts", "src/crypto/cryptoApi.ts", "src/crypto/cryptoImplementation.ts", "src/crypto/cryptoWorker.ts", - "src/crypto/emscInterface-test.ts", - "src/crypto/emscInterface.ts", - "src/crypto/kdf.ts", - "src/crypto/nacl-fast.ts", - "src/crypto/nodeEmscriptenLoader.ts", "src/crypto/nodeProcessWorker.ts", "src/crypto/nodeWorkerEntry.ts", - "src/crypto/sha256.ts", + "src/crypto/primitives/kdf.ts", + "src/crypto/primitives/nacl-fast.ts", + "src/crypto/primitives/sha256.ts", "src/crypto/synchronousWorker.ts", "src/crypto/talerCrypto-test.ts", "src/crypto/talerCrypto.ts", -- cgit v1.2.3